Created
May 30, 2020 17:40
-
-
Save carstenhag/39a2451a3520ae1727ae188c5fcffe88 to your computer and use it in GitHub Desktop.
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
package: name='com.example.resourcesresolutionbug.red' versionCode='1' versionName='1.0' platformBuildVersionName='' platformBuildVersionCode='' compileSdkVersion='29' compileSdkVersionCodename='10' | |
sdkVersion:'21' | |
targetSdkVersion:'29' | |
application-label:'Resources Resolution Bug' | |
application-label-af:'Resources Resolution Bug' | |
application-label-am:'Resources Resolution Bug' | |
application-label-ar:'Resources Resolution Bug' | |
application-label-as:'Resources Resolution Bug' | |
application-label-az:'Resources Resolution Bug' | |
application-label-be:'Resources Resolution Bug' | |
application-label-bg:'Resources Resolution Bug' | |
application-label-bn:'Resources Resolution Bug' | |
application-label-bs:'Resources Resolution Bug' | |
application-label-ca:'Resources Resolution Bug' | |
application-label-cs:'Resources Resolution Bug' | |
application-label-da:'Resources Resolution Bug' | |
application-label-de:'Resources Resolution Bug' | |
application-label-el:'Resources Resolution Bug' | |
application-label-en-AU:'Resources Resolution Bug' | |
application-label-en-CA:'Resources Resolution Bug' | |
application-label-en-GB:'Resources Resolution Bug' | |
application-label-en-IN:'Resources Resolution Bug' | |
application-label-en-XC:'Resources Resolution Bug' | |
application-label-es:'Resources Resolution Bug' | |
application-label-es-US:'Resources Resolution Bug' | |
application-label-et:'Resources Resolution Bug' | |
application-label-eu:'Resources Resolution Bug' | |
application-label-fa:'Resources Resolution Bug' | |
application-label-fi:'Resources Resolution Bug' | |
application-label-fr:'Resources Resolution Bug' | |
application-label-fr-CA:'Resources Resolution Bug' | |
application-label-gl:'Resources Resolution Bug' | |
application-label-gu:'Resources Resolution Bug' | |
application-label-hi:'Resources Resolution Bug' | |
application-label-hr:'Resources Resolution Bug' | |
application-label-hu:'Resources Resolution Bug' | |
application-label-hy:'Resources Resolution Bug' | |
application-label-in:'Resources Resolution Bug' | |
application-label-is:'Resources Resolution Bug' | |
application-label-it:'Resources Resolution Bug' | |
application-label-iw:'Resources Resolution Bug' | |
application-label-ja:'Resources Resolution Bug' | |
application-label-ka:'Resources Resolution Bug' | |
application-label-kk:'Resources Resolution Bug' | |
application-label-km:'Resources Resolution Bug' | |
application-label-kn:'Resources Resolution Bug' | |
application-label-ko:'Resources Resolution Bug' | |
application-label-ky:'Resources Resolution Bug' | |
application-label-lo:'Resources Resolution Bug' | |
application-label-lt:'Resources Resolution Bug' | |
application-label-lv:'Resources Resolution Bug' | |
application-label-mk:'Resources Resolution Bug' | |
application-label-ml:'Resources Resolution Bug' | |
application-label-mn:'Resources Resolution Bug' | |
application-label-mr:'Resources Resolution Bug' | |
application-label-ms:'Resources Resolution Bug' | |
application-label-my:'Resources Resolution Bug' | |
application-label-nb:'Resources Resolution Bug' | |
application-label-ne:'Resources Resolution Bug' | |
application-label-nl:'Resources Resolution Bug' | |
application-label-or:'Resources Resolution Bug' | |
application-label-pa:'Resources Resolution Bug' | |
application-label-pl:'Resources Resolution Bug' | |
application-label-pt:'Resources Resolution Bug' | |
application-label-pt-BR:'Resources Resolution Bug' | |
application-label-pt-PT:'Resources Resolution Bug' | |
application-label-ro:'Resources Resolution Bug' | |
application-label-ru:'Resources Resolution Bug' | |
application-label-si:'Resources Resolution Bug' | |
application-label-sk:'Resources Resolution Bug' | |
application-label-sl:'Resources Resolution Bug' | |
application-label-sq:'Resources Resolution Bug' | |
application-label-sr:'Resources Resolution Bug' | |
application-label-sr-Latn:'Resources Resolution Bug' | |
application-label-sv:'Resources Resolution Bug' | |
application-label-sw:'Resources Resolution Bug' | |
application-label-ta:'Resources Resolution Bug' | |
application-label-te:'Resources Resolution Bug' | |
application-label-th:'Resources Resolution Bug' | |
application-label-tl:'Resources Resolution Bug' | |
application-label-tr:'Resources Resolution Bug' | |
application-label-uk:'Resources Resolution Bug' | |
application-label-ur:'Resources Resolution Bug' | |
application-label-uz:'Resources Resolution Bug' | |
application-label-vi:'Resources Resolution Bug' | |
application-label-zh-CN:'Resources Resolution Bug' | |
application-label-zh-HK:'Resources Resolution Bug' | |
application-label-zh-TW:'Resources Resolution Bug' | |
application-label-zu:'Resources Resolution Bug' | |
application-icon-160:'res/mipmap-anydpi-v26/ic_launcher.xml' | |
application-icon-240:'res/mipmap-anydpi-v26/ic_launcher.xml' | |
application-icon-320:'res/mipmap-anydpi-v26/ic_launcher.xml' | |
application-icon-480:'res/mipmap-anydpi-v26/ic_launcher.xml' | |
application-icon-640:'res/mipmap-anydpi-v26/ic_launcher.xml' | |
application-icon-65534:'res/mipmap-anydpi-v26/ic_launcher.xml' | |
application: label='Resources Resolution Bug' icon='res/mipmap-anydpi-v26/ic_launcher.xml' | |
testOnly='-1' | |
application-debuggable | |
launchable-activity: name='com.example.resourcesresolutionbug.MainActivity' label='' icon='' | |
feature-group: label='' | |
uses-feature: name='android.hardware.faketouch' | |
uses-implied-feature: name='android.hardware.faketouch' reason='default feature for all apps' | |
main | |
supports-screens: 'small' 'normal' 'large' 'xlarge' | |
supports-any-density: 'true' | |
locales: '--_--' 'af' 'am' 'ar' 'as' 'az' 'be' 'bg' 'bn' 'bs' 'ca' 'cs' 'da' 'de' 'el' 'en-AU' 'en-CA' 'en-GB' 'en-IN' 'en-XC' 'es' 'es-US' 'et' 'eu' 'fa' 'fi' 'fr' 'fr-CA' 'gl' 'gu' 'hi' 'hr' 'hu' 'hy' 'in' 'is' 'it' 'iw' 'ja' 'ka' 'kk' 'km' 'kn' 'ko' 'ky' 'lo' 'lt' 'lv' 'mk' 'ml' 'mn' 'mr' 'ms' 'my' 'nb' 'ne' 'nl' 'or' 'pa' 'pl' 'pt' 'pt-BR' 'pt-PT' 'ro' 'ru' 'si' 'sk' 'sl' 'sq' 'sr' 'sr-Latn' 'sv' 'sw' 'ta' 'te' 'th' 'tl' 'tr' 'uk' 'ur' 'uz' 'vi' 'zh-CN' 'zh-HK' 'zh-TW' 'zu' | |
densities: '160' '240' '320' '480' '640' '65534' |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
h720dp | |
sw600dp | |
watch | |
night | |
large | |
xlarge | |
ldltr | |
v22 | |
v23 | |
v24 | |
v25 | |
v26 | |
v28 | |
port | |
land | |
mdpi | |
hdpi | |
xhdpi | |
xxhdpi | |
ldrtl-xxhdpi | |
xxxhdpi | |
anydpi-v24 | |
anydpi-v26 | |
ca | |
da | |
fa | |
ja | |
ka | |
pa | |
ta | |
nb | |
be | |
de | |
ne | |
te | |
af | |
bg | |
th | |
fi | |
hi | |
si | |
vi | |
kk | |
mk | |
sk | |
uk | |
el | |
gl | |
ml | |
nl | |
pl | |
sl | |
tl | |
am | |
km | |
bn | |
in | |
kn | |
mn | |
ko | |
lo | |
ro | |
sq | |
ar | |
fr | |
hr | |
mr | |
or | |
sr | |
b+sr+Latn | |
tr | |
ur | |
as | |
bs | |
cs | |
es | |
is | |
ms | |
et | |
it | |
lt | |
pt | |
eu | |
gu | |
hu | |
ru | |
zu | |
lv | |
sv | |
iw | |
sw | |
hy | |
ky | |
my | |
az | |
uz | |
en-rCA | |
fr-rCA | |
en-rGB | |
en-rXC | |
zh-rHK | |
zh-rCN | |
en-rIN | |
pt-rBR | |
es-rUS | |
pt-rPT | |
en-rAU | |
zh-rTW |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
Binary APK | |
Package name=com.example.resourcesresolutionbug.red id=7f | |
type anim id=01 entryCount=24 | |
resource 0x7f010000 anim/abc_fade_in | |
() (file) res/anim/abc_fade_in.xml type=XML | |
resource 0x7f010001 anim/abc_fade_out | |
() (file) res/anim/abc_fade_out.xml type=XML | |
resource 0x7f010002 anim/abc_grow_fade_in_from_bottom | |
() (file) res/anim/abc_grow_fade_in_from_bottom.xml type=XML | |
resource 0x7f010003 anim/abc_popup_enter | |
() (file) res/anim/abc_popup_enter.xml type=XML | |
resource 0x7f010004 anim/abc_popup_exit | |
() (file) res/anim/abc_popup_exit.xml type=XML | |
resource 0x7f010005 anim/abc_shrink_fade_out_from_bottom | |
() (file) res/anim/abc_shrink_fade_out_from_bottom.xml type=XML | |
resource 0x7f010006 anim/abc_slide_in_bottom | |
() (file) res/anim/abc_slide_in_bottom.xml type=XML | |
resource 0x7f010007 anim/abc_slide_in_top | |
() (file) res/anim/abc_slide_in_top.xml type=XML | |
resource 0x7f010008 anim/abc_slide_out_bottom | |
() (file) res/anim/abc_slide_out_bottom.xml type=XML | |
resource 0x7f010009 anim/abc_slide_out_top | |
() (file) res/anim/abc_slide_out_top.xml type=XML | |
resource 0x7f01000a anim/abc_tooltip_enter | |
() (file) res/anim/abc_tooltip_enter.xml type=XML | |
resource 0x7f01000b anim/abc_tooltip_exit | |
() (file) res/anim/abc_tooltip_exit.xml type=XML | |
resource 0x7f01000c anim/btn_checkbox_to_checked_box_inner_merged_animation | |
() (file) res/anim/btn_checkbox_to_checked_box_inner_merged_animation.xml type=XML | |
resource 0x7f01000d anim/btn_checkbox_to_checked_box_outer_merged_animation | |
() (file) res/anim/btn_checkbox_to_checked_box_outer_merged_animation.xml type=XML | |
resource 0x7f01000e anim/btn_checkbox_to_checked_icon_null_animation | |
() (file) res/anim/btn_checkbox_to_checked_icon_null_animation.xml type=XML | |
resource 0x7f01000f anim/btn_checkbox_to_unchecked_box_inner_merged_animation | |
() (file) res/anim/btn_checkbox_to_unchecked_box_inner_merged_animation.xml type=XML | |
resource 0x7f010010 anim/btn_checkbox_to_unchecked_check_path_merged_animation | |
() (file) res/anim/btn_checkbox_to_unchecked_check_path_merged_animation.xml type=XML | |
resource 0x7f010011 anim/btn_checkbox_to_unchecked_icon_null_animation | |
() (file) res/anim/btn_checkbox_to_unchecked_icon_null_animation.xml type=XML | |
resource 0x7f010012 anim/btn_radio_to_off_mtrl_dot_group_animation | |
() (file) res/anim/btn_radio_to_off_mtrl_dot_group_animation.xml type=XML | |
resource 0x7f010013 anim/btn_radio_to_off_mtrl_ring_outer_animation | |
() (file) res/anim/btn_radio_to_off_mtrl_ring_outer_animation.xml type=XML | |
resource 0x7f010014 anim/btn_radio_to_off_mtrl_ring_outer_path_animation | |
() (file) res/anim/btn_radio_to_off_mtrl_ring_outer_path_animation.xml type=XML | |
resource 0x7f010015 anim/btn_radio_to_on_mtrl_dot_group_animation | |
() (file) res/anim/btn_radio_to_on_mtrl_dot_group_animation.xml type=XML | |
resource 0x7f010016 anim/btn_radio_to_on_mtrl_ring_outer_animation | |
() (file) res/anim/btn_radio_to_on_mtrl_ring_outer_animation.xml type=XML | |
resource 0x7f010017 anim/btn_radio_to_on_mtrl_ring_outer_path_animation | |
() (file) res/anim/btn_radio_to_on_mtrl_ring_outer_path_animation.xml type=XML | |
type attr id=02 entryCount=335 | |
resource 0x7f020000 attr/actionBarDivider | |
() (attr) type=reference | |
resource 0x7f020001 attr/actionBarItemBackground | |
() (attr) type=reference | |
resource 0x7f020002 attr/actionBarPopupTheme | |
() (attr) type=reference | |
resource 0x7f020003 attr/actionBarSize | |
() (attr) type=dimension|enum size=1 | |
wrap_content(0x7f0700b7)=0x00000000 | |
resource 0x7f020004 attr/actionBarSplitStyle | |
() (attr) type=reference | |
resource 0x7f020005 attr/actionBarStyle | |
() (attr) type=reference | |
resource 0x7f020006 attr/actionBarTabBarStyle | |
() (attr) type=reference | |
resource 0x7f020007 attr/actionBarTabStyle | |
() (attr) type=reference | |
resource 0x7f020008 attr/actionBarTabTextStyle | |
() (attr) type=reference | |
resource 0x7f020009 attr/actionBarTheme | |
() (attr) type=reference | |
resource 0x7f02000a attr/actionBarWidgetTheme | |
() (attr) type=reference | |
resource 0x7f02000b attr/actionButtonStyle | |
() (attr) type=reference | |
resource 0x7f02000c attr/actionDropDownStyle | |
() (attr) type=reference | |
resource 0x7f02000d attr/actionLayout | |
() (attr) type=reference | |
resource 0x7f02000e attr/actionMenuTextAppearance | |
() (attr) type=reference | |
resource 0x7f02000f attr/actionMenuTextColor | |
() (attr) type=reference|color | |
resource 0x7f020010 attr/actionModeBackground | |
() (attr) type=reference | |
resource 0x7f020011 attr/actionModeCloseButtonStyle | |
() (attr) type=reference | |
resource 0x7f020012 attr/actionModeCloseDrawable | |
() (attr) type=reference | |
resource 0x7f020013 attr/actionModeCopyDrawable | |
() (attr) type=reference | |
resource 0x7f020014 attr/actionModeCutDrawable | |
() (attr) type=reference | |
resource 0x7f020015 attr/actionModeFindDrawable | |
() (attr) type=reference | |
resource 0x7f020016 attr/actionModePasteDrawable | |
() (attr) type=reference | |
resource 0x7f020017 attr/actionModePopupWindowStyle | |
() (attr) type=reference | |
resource 0x7f020018 attr/actionModeSelectAllDrawable | |
() (attr) type=reference | |
resource 0x7f020019 attr/actionModeShareDrawable | |
() (attr) type=reference | |
resource 0x7f02001a attr/actionModeSplitBackground | |
() (attr) type=reference | |
resource 0x7f02001b attr/actionModeStyle | |
() (attr) type=reference | |
resource 0x7f02001c attr/actionModeWebSearchDrawable | |
() (attr) type=reference | |
resource 0x7f02001d attr/actionOverflowButtonStyle | |
() (attr) type=reference | |
resource 0x7f02001e attr/actionOverflowMenuStyle | |
() (attr) type=reference | |
resource 0x7f02001f attr/actionProviderClass | |
() (attr) type=string | |
resource 0x7f020020 attr/actionViewClass | |
() (attr) type=string | |
resource 0x7f020021 attr/activityChooserViewStyle | |
() (attr) type=reference | |
resource 0x7f020022 attr/alertDialogButtonGroupStyle | |
() (attr) type=reference | |
resource 0x7f020023 attr/alertDialogCenterButtons | |
() (attr) type=boolean | |
resource 0x7f020024 attr/alertDialogStyle | |
() (attr) type=reference | |
resource 0x7f020025 attr/alertDialogTheme | |
() (attr) type=reference | |
resource 0x7f020026 attr/allowStacking | |
() (attr) type=boolean | |
resource 0x7f020027 attr/alpha | |
() (attr) type=float | |
resource 0x7f020028 attr/alphabeticModifiers | |
() (attr) type=flags size=6 | |
ALT(0x7f070000)=0x00000002 | |
CTRL(0x7f070001)=0x00001000 | |
FUNCTION(0x7f070002)=0x00000008 | |
META(0x7f070003)=0x00010000 | |
SHIFT(0x7f070004)=0x00000001 | |
SYM(0x7f070005)=0x00000004 | |
resource 0x7f020029 attr/arrowHeadLength | |
() (attr) type=dimension | |
resource 0x7f02002a attr/arrowShaftLength | |
() (attr) type=dimension | |
resource 0x7f02002b attr/autoCompleteTextViewStyle | |
() (attr) type=reference | |
resource 0x7f02002c attr/autoSizeMaxTextSize | |
() (attr) type=dimension | |
resource 0x7f02002d attr/autoSizeMinTextSize | |
() (attr) type=dimension | |
resource 0x7f02002e attr/autoSizePresetSizes | |
() (attr) type=reference | |
resource 0x7f02002f attr/autoSizeStepGranularity | |
() (attr) type=dimension | |
resource 0x7f020030 attr/autoSizeTextType | |
() (attr) type=enum size=2 | |
none(0x7f07006e)=0x00000000 | |
uniform(0x7f0700b2)=0x00000001 | |
resource 0x7f020031 attr/background | |
() (attr) type=reference | |
resource 0x7f020032 attr/backgroundSplit | |
() (attr) type=reference|color | |
resource 0x7f020033 attr/backgroundStacked | |
() (attr) type=reference|color | |
resource 0x7f020034 attr/backgroundTint | |
() (attr) type=color | |
resource 0x7f020035 attr/backgroundTintMode | |
() (attr) type=enum size=6 | |
add(0x7f07003a)=0x00000010 | |
multiply(0x7f07006c)=0x0000000e | |
screen(0x7f07007f)=0x0000000f | |
src_atop(0x7f070096)=0x00000009 | |
src_in(0x7f070097)=0x00000005 | |
src_over(0x7f070098)=0x00000003 | |
resource 0x7f020036 attr/barLength | |
() (attr) type=dimension | |
resource 0x7f020037 attr/barrierAllowsGoneWidgets | |
() (attr) type=boolean | |
resource 0x7f020038 attr/barrierDirection | |
() (attr) type=enum size=6 | |
bottom(0x7f070041)=0x00000003 | |
end(0x7f070054)=0x00000006 | |
left(0x7f070065)=0x00000000 | |
right(0x7f07007c)=0x00000001 | |
start(0x7f07009a)=0x00000005 | |
top(0x7f0700af)=0x00000002 | |
resource 0x7f020039 attr/borderlessButtonStyle | |
() (attr) type=reference | |
resource 0x7f02003a attr/buttonBarButtonStyle | |
() (attr) type=reference | |
resource 0x7f02003b attr/buttonBarNegativeButtonStyle | |
() (attr) type=reference | |
resource 0x7f02003c attr/buttonBarNeutralButtonStyle | |
() (attr) type=reference | |
resource 0x7f02003d attr/buttonBarPositiveButtonStyle | |
() (attr) type=reference | |
resource 0x7f02003e attr/buttonBarStyle | |
() (attr) type=reference | |
resource 0x7f02003f attr/buttonCompat | |
() (attr) type=reference | |
resource 0x7f020040 attr/buttonGravity | |
() (attr) type=flags size=3 | |
bottom(0x7f070041)=0x00000050 | |
center_vertical(0x7f070043)=0x00000010 | |
top(0x7f0700af)=0x00000030 | |
resource 0x7f020041 attr/buttonIconDimen | |
() (attr) type=dimension | |
resource 0x7f020042 attr/buttonPanelSideLayout | |
() (attr) type=reference | |
resource 0x7f020043 attr/buttonStyle | |
() (attr) type=reference | |
resource 0x7f020044 attr/buttonStyleSmall | |
() (attr) type=reference | |
resource 0x7f020045 attr/buttonTint | |
() (attr) type=color | |
resource 0x7f020046 attr/buttonTintMode | |
() (attr) type=enum size=6 | |
add(0x7f07003a)=0x00000010 | |
multiply(0x7f07006c)=0x0000000e | |
screen(0x7f07007f)=0x0000000f | |
src_atop(0x7f070096)=0x00000009 | |
src_in(0x7f070097)=0x00000005 | |
src_over(0x7f070098)=0x00000003 | |
resource 0x7f020047 attr/chainUseRtl | |
() (attr) type=boolean | |
resource 0x7f020048 attr/checkboxStyle | |
() (attr) type=reference | |
resource 0x7f020049 attr/checkedTextViewStyle | |
() (attr) type=reference | |
resource 0x7f02004a attr/closeIcon | |
() (attr) type=reference | |
resource 0x7f02004b attr/closeItemLayout | |
() (attr) type=reference | |
resource 0x7f02004c attr/collapseContentDescription | |
() (attr) type=string | |
resource 0x7f02004d attr/collapseIcon | |
() (attr) type=reference | |
resource 0x7f02004e attr/color | |
() (attr) type=color | |
resource 0x7f02004f attr/colorAccent | |
() (attr) type=color | |
resource 0x7f020050 attr/colorBackgroundFloating | |
() (attr) type=color | |
resource 0x7f020051 attr/colorButtonNormal | |
() (attr) type=color | |
resource 0x7f020052 attr/colorControlActivated | |
() (attr) type=color | |
resource 0x7f020053 attr/colorControlHighlight | |
() (attr) type=color | |
resource 0x7f020054 attr/colorControlNormal | |
() (attr) type=color | |
resource 0x7f020055 attr/colorError | |
() (attr) type=reference|color | |
resource 0x7f020056 attr/colorPrimary | |
() (attr) type=color | |
resource 0x7f020057 attr/colorPrimaryDark | |
() (attr) type=color | |
resource 0x7f020058 attr/colorSwitchThumbNormal | |
() (attr) type=color | |
resource 0x7f020059 attr/commitIcon | |
() (attr) type=reference | |
resource 0x7f02005a attr/constraintSet | |
() (attr) type=reference | |
resource 0x7f02005b attr/constraint_referenced_ids | |
() (attr) type=string | |
resource 0x7f02005c attr/content | |
() (attr) type=reference | |
resource 0x7f02005d attr/contentDescription | |
() (attr) type=string | |
resource 0x7f02005e attr/contentInsetEnd | |
() (attr) type=dimension | |
resource 0x7f02005f attr/contentInsetEndWithActions | |
() (attr) type=dimension | |
resource 0x7f020060 attr/contentInsetLeft | |
() (attr) type=dimension | |
resource 0x7f020061 attr/contentInsetRight | |
() (attr) type=dimension | |
resource 0x7f020062 attr/contentInsetStart | |
() (attr) type=dimension | |
resource 0x7f020063 attr/contentInsetStartWithNavigation | |
() (attr) type=dimension | |
resource 0x7f020064 attr/controlBackground | |
() (attr) type=reference | |
resource 0x7f020065 attr/customNavigationLayout | |
() (attr) type=reference | |
resource 0x7f020066 attr/defaultQueryHint | |
() (attr) type=string | |
resource 0x7f020067 attr/dialogCornerRadius | |
() (attr) type=dimension | |
resource 0x7f020068 attr/dialogPreferredPadding | |
() (attr) type=dimension | |
resource 0x7f020069 attr/dialogTheme | |
() (attr) type=reference | |
resource 0x7f02006a attr/displayOptions | |
() (attr) type=flags size=7 | |
disableHome(0x7f070052)=0x00000020 | |
homeAsUp(0x7f07005c)=0x00000004 | |
none(0x7f07006e)=0x00000000 | |
showCustom(0x7f07008f)=0x00000010 | |
showHome(0x7f070090)=0x00000002 | |
showTitle(0x7f070091)=0x00000008 | |
useLogo(0x7f0700b4)=0x00000001 | |
resource 0x7f02006b attr/divider | |
() (attr) type=reference | |
resource 0x7f02006c attr/dividerHorizontal | |
() (attr) type=reference | |
resource 0x7f02006d attr/dividerPadding | |
() (attr) type=dimension | |
resource 0x7f02006e attr/dividerVertical | |
() (attr) type=reference | |
resource 0x7f02006f attr/drawableBottomCompat | |
() (attr) type=reference | |
resource 0x7f020070 attr/drawableEndCompat | |
() (attr) type=reference | |
resource 0x7f020071 attr/drawableLeftCompat | |
() (attr) type=reference | |
resource 0x7f020072 attr/drawableRightCompat | |
() (attr) type=reference | |
resource 0x7f020073 attr/drawableSize | |
() (attr) type=dimension | |
resource 0x7f020074 attr/drawableStartCompat | |
() (attr) type=reference | |
resource 0x7f020075 attr/drawableTint | |
() (attr) type=color | |
resource 0x7f020076 attr/drawableTintMode | |
() (attr) type=enum size=6 | |
add(0x7f07003a)=0x00000010 | |
multiply(0x7f07006c)=0x0000000e | |
screen(0x7f07007f)=0x0000000f | |
src_atop(0x7f070096)=0x00000009 | |
src_in(0x7f070097)=0x00000005 | |
src_over(0x7f070098)=0x00000003 | |
resource 0x7f020077 attr/drawableTopCompat | |
() (attr) type=reference | |
resource 0x7f020078 attr/drawerArrowStyle | |
() (attr) type=reference | |
resource 0x7f020079 attr/dropDownListViewStyle | |
() (attr) type=reference | |
resource 0x7f02007a attr/dropdownListPreferredItemHeight | |
() (attr) type=dimension | |
resource 0x7f02007b attr/editTextBackground | |
() (attr) type=reference | |
resource 0x7f02007c attr/editTextColor | |
() (attr) type=reference|color | |
resource 0x7f02007d attr/editTextStyle | |
() (attr) type=reference | |
resource 0x7f02007e attr/elevation | |
() (attr) type=dimension | |
resource 0x7f02007f attr/emptyVisibility | |
() (attr) type=enum size=2 | |
gone(0x7f070058)=0x00000000 | |
invisible(0x7f070063)=0x00000001 | |
resource 0x7f020080 attr/expandActivityOverflowButtonDrawable | |
() (attr) type=reference | |
resource 0x7f020081 attr/firstBaselineToTopHeight | |
() (attr) type=dimension | |
resource 0x7f020082 attr/font | |
() (attr) type=reference | |
resource 0x7f020083 attr/fontFamily | |
() (attr) type=string | |
resource 0x7f020084 attr/fontProviderAuthority | |
() (attr) type=string | |
resource 0x7f020085 attr/fontProviderCerts | |
() (attr) type=reference | |
resource 0x7f020086 attr/fontProviderFetchStrategy | |
() (attr) type=enum size=2 | |
async(0x7f07003d)=0x00000001 | |
blocking(0x7f070040)=0x00000000 | |
resource 0x7f020087 attr/fontProviderFetchTimeout | |
() (attr) type=integer|enum size=1 | |
forever(0x7f070057)=0xffffffff | |
resource 0x7f020088 attr/fontProviderPackage | |
() (attr) type=string | |
resource 0x7f020089 attr/fontProviderQuery | |
() (attr) type=string | |
resource 0x7f02008a attr/fontStyle | |
() (attr) type=enum size=2 | |
italic(0x7f070064)=0x00000001 | |
normal(0x7f07006f)=0x00000000 | |
resource 0x7f02008b attr/fontVariationSettings | |
() (attr) type=string | |
resource 0x7f02008c attr/fontWeight | |
() (attr) type=integer | |
resource 0x7f02008d attr/gapBetweenBars | |
() (attr) type=dimension | |
resource 0x7f02008e attr/goIcon | |
() (attr) type=reference | |
resource 0x7f02008f attr/height | |
() (attr) type=dimension | |
resource 0x7f020090 attr/hideOnContentScroll | |
() (attr) type=boolean | |
resource 0x7f020091 attr/homeAsUpIndicator | |
() (attr) type=reference | |
resource 0x7f020092 attr/homeLayout | |
() (attr) type=reference | |
resource 0x7f020093 attr/icon | |
() (attr) type=reference | |
resource 0x7f020094 attr/iconTint | |
() (attr) type=color | |
resource 0x7f020095 attr/iconTintMode | |
() (attr) type=enum size=6 | |
add(0x7f07003a)=0x00000010 | |
multiply(0x7f07006c)=0x0000000e | |
screen(0x7f07007f)=0x0000000f | |
src_atop(0x7f070096)=0x00000009 | |
src_in(0x7f070097)=0x00000005 | |
src_over(0x7f070098)=0x00000003 | |
resource 0x7f020096 attr/iconifiedByDefault | |
() (attr) type=boolean | |
resource 0x7f020097 attr/imageButtonStyle | |
() (attr) type=reference | |
resource 0x7f020098 attr/indeterminateProgressStyle | |
() (attr) type=reference | |
resource 0x7f020099 attr/initialActivityCount | |
() (attr) type=string | |
resource 0x7f02009a attr/isLightTheme | |
() (attr) type=boolean | |
resource 0x7f02009b attr/itemPadding | |
() (attr) type=dimension | |
resource 0x7f02009c attr/lastBaselineToBottomHeight | |
() (attr) type=dimension | |
resource 0x7f02009d attr/layout | |
() (attr) type=reference | |
resource 0x7f02009e attr/layout_constrainedHeight | |
() (attr) type=boolean | |
resource 0x7f02009f attr/layout_constrainedWidth | |
() (attr) type=boolean | |
resource 0x7f0200a0 attr/layout_constraintBaseline_creator | |
() (attr) type=integer | |
resource 0x7f0200a1 attr/layout_constraintBaseline_toBaselineOf | |
() (attr) type=reference|enum size=1 | |
parent(0x7f070076)=0x00000000 | |
resource 0x7f0200a2 attr/layout_constraintBottom_creator | |
() (attr) type=integer | |
resource 0x7f0200a3 attr/layout_constraintBottom_toBottomOf | |
() (attr) type=reference|enum size=1 | |
parent(0x7f070076)=0x00000000 | |
resource 0x7f0200a4 attr/layout_constraintBottom_toTopOf | |
() (attr) type=reference|enum size=1 | |
parent(0x7f070076)=0x00000000 | |
resource 0x7f0200a5 attr/layout_constraintCircle | |
() (attr) type=reference | |
resource 0x7f0200a6 attr/layout_constraintCircleAngle | |
() (attr) type=integer | |
resource 0x7f0200a7 attr/layout_constraintCircleRadius | |
() (attr) type=dimension | |
resource 0x7f0200a8 attr/layout_constraintDimensionRatio | |
() (attr) type=string | |
resource 0x7f0200a9 attr/layout_constraintEnd_toEndOf | |
() (attr) type=reference|enum size=1 | |
parent(0x7f070076)=0x00000000 | |
resource 0x7f0200aa attr/layout_constraintEnd_toStartOf | |
() (attr) type=reference|enum size=1 | |
parent(0x7f070076)=0x00000000 | |
resource 0x7f0200ab attr/layout_constraintGuide_begin | |
() (attr) type=dimension | |
resource 0x7f0200ac attr/layout_constraintGuide_end | |
() (attr) type=dimension | |
resource 0x7f0200ad attr/layout_constraintGuide_percent | |
() (attr) type=float | |
resource 0x7f0200ae attr/layout_constraintHeight_default | |
() (attr) type=enum size=3 | |
percent(0x7f070078)=0x00000002 | |
spread(0x7f070094)=0x00000000 | |
wrap(0x7f0700b6)=0x00000001 | |
resource 0x7f0200af attr/layout_constraintHeight_max | |
() (attr) type=dimension|enum size=1 | |
wrap(0x7f0700b6)=0xfffffffe | |
resource 0x7f0200b0 attr/layout_constraintHeight_min | |
() (attr) type=dimension|enum size=1 | |
wrap(0x7f0700b6)=0xfffffffe | |
resource 0x7f0200b1 attr/layout_constraintHeight_percent | |
() (attr) type=float | |
resource 0x7f0200b2 attr/layout_constraintHorizontal_bias | |
() (attr) type=float | |
resource 0x7f0200b3 attr/layout_constraintHorizontal_chainStyle | |
() (attr) type=enum size=3 | |
packed(0x7f070075)=0x00000002 | |
spread(0x7f070094)=0x00000000 | |
spread_inside(0x7f070095)=0x00000001 | |
resource 0x7f0200b4 attr/layout_constraintHorizontal_weight | |
() (attr) type=float | |
resource 0x7f0200b5 attr/layout_constraintLeft_creator | |
() (attr) type=integer | |
resource 0x7f0200b6 attr/layout_constraintLeft_toLeftOf | |
() (attr) type=reference|enum size=1 | |
parent(0x7f070076)=0x00000000 | |
resource 0x7f0200b7 attr/layout_constraintLeft_toRightOf | |
() (attr) type=reference|enum size=1 | |
parent(0x7f070076)=0x00000000 | |
resource 0x7f0200b8 attr/layout_constraintRight_creator | |
() (attr) type=integer | |
resource 0x7f0200b9 attr/layout_constraintRight_toLeftOf | |
() (attr) type=reference|enum size=1 | |
parent(0x7f070076)=0x00000000 | |
resource 0x7f0200ba attr/layout_constraintRight_toRightOf | |
() (attr) type=reference|enum size=1 | |
parent(0x7f070076)=0x00000000 | |
resource 0x7f0200bb attr/layout_constraintStart_toEndOf | |
() (attr) type=reference|enum size=1 | |
parent(0x7f070076)=0x00000000 | |
resource 0x7f0200bc attr/layout_constraintStart_toStartOf | |
() (attr) type=reference|enum size=1 | |
parent(0x7f070076)=0x00000000 | |
resource 0x7f0200bd attr/layout_constraintTop_creator | |
() (attr) type=integer | |
resource 0x7f0200be attr/layout_constraintTop_toBottomOf | |
() (attr) type=reference|enum size=1 | |
parent(0x7f070076)=0x00000000 | |
resource 0x7f0200bf attr/layout_constraintTop_toTopOf | |
() (attr) type=reference|enum size=1 | |
parent(0x7f070076)=0x00000000 | |
resource 0x7f0200c0 attr/layout_constraintVertical_bias | |
() (attr) type=float | |
resource 0x7f0200c1 attr/layout_constraintVertical_chainStyle | |
() (attr) type=enum size=3 | |
packed(0x7f070075)=0x00000002 | |
spread(0x7f070094)=0x00000000 | |
spread_inside(0x7f070095)=0x00000001 | |
resource 0x7f0200c2 attr/layout_constraintVertical_weight | |
() (attr) type=float | |
resource 0x7f0200c3 attr/layout_constraintWidth_default | |
() (attr) type=enum size=3 | |
percent(0x7f070078)=0x00000002 | |
spread(0x7f070094)=0x00000000 | |
wrap(0x7f0700b6)=0x00000001 | |
resource 0x7f0200c4 attr/layout_constraintWidth_max | |
() (attr) type=dimension|enum size=1 | |
wrap(0x7f0700b6)=0xfffffffe | |
resource 0x7f0200c5 attr/layout_constraintWidth_min | |
() (attr) type=dimension|enum size=1 | |
wrap(0x7f0700b6)=0xfffffffe | |
resource 0x7f0200c6 attr/layout_constraintWidth_percent | |
() (attr) type=float | |
resource 0x7f0200c7 attr/layout_editor_absoluteX | |
() (attr) type=dimension | |
resource 0x7f0200c8 attr/layout_editor_absoluteY | |
() (attr) type=dimension | |
resource 0x7f0200c9 attr/layout_goneMarginBottom | |
() (attr) type=dimension | |
resource 0x7f0200ca attr/layout_goneMarginEnd | |
() (attr) type=dimension | |
resource 0x7f0200cb attr/layout_goneMarginLeft | |
() (attr) type=dimension | |
resource 0x7f0200cc attr/layout_goneMarginRight | |
() (attr) type=dimension | |
resource 0x7f0200cd attr/layout_goneMarginStart | |
() (attr) type=dimension | |
resource 0x7f0200ce attr/layout_goneMarginTop | |
() (attr) type=dimension | |
resource 0x7f0200cf attr/layout_optimizationLevel | |
() (attr) type=flags size=7 | |
barrier(0x7f07003e)=0x00000002 | |
chains(0x7f070044)=0x00000004 | |
dimensions(0x7f070050)=0x00000008 | |
direct(0x7f070051)=0x00000001 | |
groups(0x7f07005a)=0x00000020 | |
none(0x7f07006e)=0x00000000 | |
standard(0x7f070099)=0x00000007 | |
resource 0x7f0200d0 attr/lineHeight | |
() (attr) type=dimension | |
resource 0x7f0200d1 attr/listChoiceBackgroundIndicator | |
() (attr) type=reference | |
resource 0x7f0200d2 attr/listChoiceIndicatorMultipleAnimated | |
() (attr) type=reference | |
resource 0x7f0200d3 attr/listChoiceIndicatorSingleAnimated | |
() (attr) type=reference | |
resource 0x7f0200d4 attr/listDividerAlertDialog | |
() (attr) type=reference | |
resource 0x7f0200d5 attr/listItemLayout | |
() (attr) type=reference | |
resource 0x7f0200d6 attr/listLayout | |
() (attr) type=reference | |
resource 0x7f0200d7 attr/listMenuViewStyle | |
() (attr) type=reference | |
resource 0x7f0200d8 attr/listPopupWindowStyle | |
() (attr) type=reference | |
resource 0x7f0200d9 attr/listPreferredItemHeight | |
() (attr) type=dimension | |
resource 0x7f0200da attr/listPreferredItemHeightLarge | |
() (attr) type=dimension | |
resource 0x7f0200db attr/listPreferredItemHeightSmall | |
() (attr) type=dimension | |
resource 0x7f0200dc attr/listPreferredItemPaddingEnd | |
() (attr) type=dimension | |
resource 0x7f0200dd attr/listPreferredItemPaddingLeft | |
() (attr) type=dimension | |
resource 0x7f0200de attr/listPreferredItemPaddingRight | |
() (attr) type=dimension | |
resource 0x7f0200df attr/listPreferredItemPaddingStart | |
() (attr) type=dimension | |
resource 0x7f0200e0 attr/logo | |
() (attr) type=reference | |
resource 0x7f0200e1 attr/logoDescription | |
() (attr) type=string | |
resource 0x7f0200e2 attr/maxButtonHeight | |
() (attr) type=dimension | |
resource 0x7f0200e3 attr/measureWithLargestChild | |
() (attr) type=boolean | |
resource 0x7f0200e4 attr/menu | |
() (attr) type=reference | |
resource 0x7f0200e5 attr/multiChoiceItemLayout | |
() (attr) type=reference | |
resource 0x7f0200e6 attr/navigationContentDescription | |
() (attr) type=string | |
resource 0x7f0200e7 attr/navigationIcon | |
() (attr) type=reference | |
resource 0x7f0200e8 attr/navigationMode | |
() (attr) type=enum size=3 | |
listMode(0x7f070068)=0x00000001 | |
normal(0x7f07006f)=0x00000000 | |
tabMode(0x7f07009d)=0x00000002 | |
resource 0x7f0200e9 attr/numericModifiers | |
() (attr) type=flags size=6 | |
ALT(0x7f070000)=0x00000002 | |
CTRL(0x7f070001)=0x00001000 | |
FUNCTION(0x7f070002)=0x00000008 | |
META(0x7f070003)=0x00010000 | |
SHIFT(0x7f070004)=0x00000001 | |
SYM(0x7f070005)=0x00000004 | |
resource 0x7f0200ea attr/overlapAnchor | |
() (attr) type=boolean | |
resource 0x7f0200eb attr/paddingBottomNoButtons | |
() (attr) type=dimension | |
resource 0x7f0200ec attr/paddingEnd | |
() (attr) type=dimension | |
resource 0x7f0200ed attr/paddingStart | |
() (attr) type=dimension | |
resource 0x7f0200ee attr/paddingTopNoTitle | |
() (attr) type=dimension | |
resource 0x7f0200ef attr/panelBackground | |
() (attr) type=reference | |
resource 0x7f0200f0 attr/panelMenuListTheme | |
() (attr) type=reference | |
resource 0x7f0200f1 attr/panelMenuListWidth | |
() (attr) type=dimension | |
resource 0x7f0200f2 attr/popupMenuStyle | |
() (attr) type=reference | |
resource 0x7f0200f3 attr/popupTheme | |
() (attr) type=reference | |
resource 0x7f0200f4 attr/popupWindowStyle | |
() (attr) type=reference | |
resource 0x7f0200f5 attr/preserveIconSpacing | |
() (attr) type=boolean | |
resource 0x7f0200f6 attr/progressBarPadding | |
() (attr) type=dimension | |
resource 0x7f0200f7 attr/progressBarStyle | |
() (attr) type=reference | |
resource 0x7f0200f8 attr/queryBackground | |
() (attr) type=reference | |
resource 0x7f0200f9 attr/queryHint | |
() (attr) type=string | |
resource 0x7f0200fa attr/radioButtonStyle | |
() (attr) type=reference | |
resource 0x7f0200fb attr/ratingBarStyle | |
() (attr) type=reference | |
resource 0x7f0200fc attr/ratingBarStyleIndicator | |
() (attr) type=reference | |
resource 0x7f0200fd attr/ratingBarStyleSmall | |
() (attr) type=reference | |
resource 0x7f0200fe attr/searchHintIcon | |
() (attr) type=reference | |
resource 0x7f0200ff attr/searchIcon | |
() (attr) type=reference | |
resource 0x7f020100 attr/searchViewStyle | |
() (attr) type=reference | |
resource 0x7f020101 attr/seekBarStyle | |
() (attr) type=reference | |
resource 0x7f020102 attr/selectableItemBackground | |
() (attr) type=reference | |
resource 0x7f020103 attr/selectableItemBackgroundBorderless | |
() (attr) type=reference | |
resource 0x7f020104 attr/showAsAction | |
() (attr) type=flags size=5 | |
always(0x7f07003c)=0x00000002 | |
collapseActionView(0x7f070048)=0x00000008 | |
ifRoom(0x7f07005f)=0x00000001 | |
never(0x7f07006d)=0x00000000 | |
withText(0x7f0700b5)=0x00000004 | |
resource 0x7f020105 attr/showDividers | |
() (attr) type=flags size=4 | |
beginning(0x7f07003f)=0x00000001 | |
end(0x7f070054)=0x00000004 | |
middle(0x7f07006b)=0x00000002 | |
none(0x7f07006e)=0x00000000 | |
resource 0x7f020106 attr/showText | |
() (attr) type=boolean | |
resource 0x7f020107 attr/showTitle | |
() (attr) type=boolean | |
resource 0x7f020108 attr/singleChoiceItemLayout | |
() (attr) type=reference | |
resource 0x7f020109 attr/spinBars | |
() (attr) type=boolean | |
resource 0x7f02010a attr/spinnerDropDownItemStyle | |
() (attr) type=reference | |
resource 0x7f02010b attr/spinnerStyle | |
() (attr) type=reference | |
resource 0x7f02010c attr/splitTrack | |
() (attr) type=boolean | |
resource 0x7f02010d attr/srcCompat | |
() (attr) type=reference | |
resource 0x7f02010e attr/state_above_anchor | |
() (attr) type=boolean | |
resource 0x7f02010f attr/subMenuArrow | |
() (attr) type=reference | |
resource 0x7f020110 attr/submitBackground | |
() (attr) type=reference | |
resource 0x7f020111 attr/subtitle | |
() (attr) type=string | |
resource 0x7f020112 attr/subtitleTextAppearance | |
() (attr) type=reference | |
resource 0x7f020113 attr/subtitleTextColor | |
() (attr) type=color | |
resource 0x7f020114 attr/subtitleTextStyle | |
() (attr) type=reference | |
resource 0x7f020115 attr/suggestionRowLayout | |
() (attr) type=reference | |
resource 0x7f020116 attr/switchMinWidth | |
() (attr) type=dimension | |
resource 0x7f020117 attr/switchPadding | |
() (attr) type=dimension | |
resource 0x7f020118 attr/switchStyle | |
() (attr) type=reference | |
resource 0x7f020119 attr/switchTextAppearance | |
() (attr) type=reference | |
resource 0x7f02011a attr/textAllCaps | |
() (attr) type=reference|boolean | |
resource 0x7f02011b attr/textAppearanceLargePopupMenu | |
() (attr) type=reference | |
resource 0x7f02011c attr/textAppearanceListItem | |
() (attr) type=reference | |
resource 0x7f02011d attr/textAppearanceListItemSecondary | |
() (attr) type=reference | |
resource 0x7f02011e attr/textAppearanceListItemSmall | |
() (attr) type=reference | |
resource 0x7f02011f attr/textAppearancePopupMenuHeader | |
() (attr) type=reference | |
resource 0x7f020120 attr/textAppearanceSearchResultSubtitle | |
() (attr) type=reference | |
resource 0x7f020121 attr/textAppearanceSearchResultTitle | |
() (attr) type=reference | |
resource 0x7f020122 attr/textAppearanceSmallPopupMenu | |
() (attr) type=reference | |
resource 0x7f020123 attr/textColorAlertDialogListItem | |
() (attr) type=reference|color | |
resource 0x7f020124 attr/textColorSearchUrl | |
() (attr) type=reference|color | |
resource 0x7f020125 attr/textLocale | |
() (attr) type=string | |
resource 0x7f020126 attr/theme | |
() (attr) type=reference | |
resource 0x7f020127 attr/thickness | |
() (attr) type=dimension | |
resource 0x7f020128 attr/thumbTextPadding | |
() (attr) type=dimension | |
resource 0x7f020129 attr/thumbTint | |
() (attr) type=color | |
resource 0x7f02012a attr/thumbTintMode | |
() (attr) type=enum size=6 | |
add(0x7f07003a)=0x00000010 | |
multiply(0x7f07006c)=0x0000000e | |
screen(0x7f07007f)=0x0000000f | |
src_atop(0x7f070096)=0x00000009 | |
src_in(0x7f070097)=0x00000005 | |
src_over(0x7f070098)=0x00000003 | |
resource 0x7f02012b attr/tickMark | |
() (attr) type=reference | |
resource 0x7f02012c attr/tickMarkTint | |
() (attr) type=color | |
resource 0x7f02012d attr/tickMarkTintMode | |
() (attr) type=enum size=6 | |
add(0x7f07003a)=0x00000010 | |
multiply(0x7f07006c)=0x0000000e | |
screen(0x7f07007f)=0x0000000f | |
src_atop(0x7f070096)=0x00000009 | |
src_in(0x7f070097)=0x00000005 | |
src_over(0x7f070098)=0x00000003 | |
resource 0x7f02012e attr/tint | |
() (attr) type=color | |
resource 0x7f02012f attr/tintMode | |
() (attr) type=enum size=6 | |
add(0x7f07003a)=0x00000010 | |
multiply(0x7f07006c)=0x0000000e | |
screen(0x7f07007f)=0x0000000f | |
src_atop(0x7f070096)=0x00000009 | |
src_in(0x7f070097)=0x00000005 | |
src_over(0x7f070098)=0x00000003 | |
resource 0x7f020130 attr/title | |
() (attr) type=string | |
resource 0x7f020131 attr/titleMargin | |
() (attr) type=dimension | |
resource 0x7f020132 attr/titleMarginBottom | |
() (attr) type=dimension | |
resource 0x7f020133 attr/titleMarginEnd | |
() (attr) type=dimension | |
resource 0x7f020134 attr/titleMarginStart | |
() (attr) type=dimension | |
resource 0x7f020135 attr/titleMarginTop | |
() (attr) type=dimension | |
resource 0x7f020136 attr/titleMargins | |
() (attr) type=dimension | |
resource 0x7f020137 attr/titleTextAppearance | |
() (attr) type=reference | |
resource 0x7f020138 attr/titleTextColor | |
() (attr) type=color | |
resource 0x7f020139 attr/titleTextStyle | |
() (attr) type=reference | |
resource 0x7f02013a attr/toolbarNavigationButtonStyle | |
() (attr) type=reference | |
resource 0x7f02013b attr/toolbarStyle | |
() (attr) type=reference | |
resource 0x7f02013c attr/tooltipForegroundColor | |
() (attr) type=reference|color | |
resource 0x7f02013d attr/tooltipFrameBackground | |
() (attr) type=reference | |
resource 0x7f02013e attr/tooltipText | |
() (attr) type=string | |
resource 0x7f02013f attr/track | |
() (attr) type=reference | |
resource 0x7f020140 attr/trackTint | |
() (attr) type=color | |
resource 0x7f020141 attr/trackTintMode | |
() (attr) type=enum size=6 | |
add(0x7f07003a)=0x00000010 | |
multiply(0x7f07006c)=0x0000000e | |
screen(0x7f07007f)=0x0000000f | |
src_atop(0x7f070096)=0x00000009 | |
src_in(0x7f070097)=0x00000005 | |
src_over(0x7f070098)=0x00000003 | |
resource 0x7f020142 attr/ttcIndex | |
() (attr) type=integer | |
resource 0x7f020143 attr/viewInflaterClass | |
() (attr) type=string | |
resource 0x7f020144 attr/voiceIcon | |
() (attr) type=reference | |
resource 0x7f020145 attr/windowActionBar | |
() (attr) type=boolean | |
resource 0x7f020146 attr/windowActionBarOverlay | |
() (attr) type=boolean | |
resource 0x7f020147 attr/windowActionModeOverlay | |
() (attr) type=boolean | |
resource 0x7f020148 attr/windowFixedHeightMajor | |
() (attr) type=dimension|fraction | |
resource 0x7f020149 attr/windowFixedHeightMinor | |
() (attr) type=dimension|fraction | |
resource 0x7f02014a attr/windowFixedWidthMajor | |
() (attr) type=dimension|fraction | |
resource 0x7f02014b attr/windowFixedWidthMinor | |
() (attr) type=dimension|fraction | |
resource 0x7f02014c attr/windowMinWidthMajor | |
() (attr) type=dimension|fraction | |
resource 0x7f02014d attr/windowMinWidthMinor | |
() (attr) type=dimension|fraction | |
resource 0x7f02014e attr/windowNoTitle | |
() (attr) type=boolean | |
type bool id=03 entryCount=3 | |
resource 0x7f030000 bool/abc_action_bar_embed_tabs | |
() true | |
(port) false | |
resource 0x7f030001 bool/abc_allow_stacked_button_bar | |
() false | |
resource 0x7f030002 bool/abc_config_actionMenuItemAllCaps | |
() true | |
type color id=04 entryCount=89 | |
resource 0x7f040000 color/abc_background_cache_hint_selector_material_dark | |
() (file) res/color/abc_background_cache_hint_selector_material_dark.xml type=XML | |
resource 0x7f040001 color/abc_background_cache_hint_selector_material_light | |
() (file) res/color/abc_background_cache_hint_selector_material_light.xml type=XML | |
resource 0x7f040002 color/abc_btn_colored_borderless_text_material | |
() (file) res/color-v21/abc_btn_colored_borderless_text_material.xml type=XML | |
(v23) (file) res/color-v23/abc_btn_colored_borderless_text_material.xml type=XML | |
resource 0x7f040003 color/abc_btn_colored_text_material | |
() (file) res/color/abc_btn_colored_text_material.xml type=XML | |
(v23) (file) res/color-v23/abc_btn_colored_text_material.xml type=XML | |
resource 0x7f040004 color/abc_color_highlight_material | |
(v23) (file) res/color-v23/abc_color_highlight_material.xml type=XML | |
resource 0x7f040005 color/abc_hint_foreground_material_dark | |
() (file) res/color/abc_hint_foreground_material_dark.xml type=XML | |
resource 0x7f040006 color/abc_hint_foreground_material_light | |
() (file) res/color/abc_hint_foreground_material_light.xml type=XML | |
resource 0x7f040007 color/abc_input_method_navigation_guard | |
() @0x0106000c | |
resource 0x7f040008 color/abc_primary_text_disable_only_material_dark | |
() (file) res/color/abc_primary_text_disable_only_material_dark.xml type=XML | |
resource 0x7f040009 color/abc_primary_text_disable_only_material_light | |
() (file) res/color/abc_primary_text_disable_only_material_light.xml type=XML | |
resource 0x7f04000a color/abc_primary_text_material_dark | |
() (file) res/color/abc_primary_text_material_dark.xml type=XML | |
resource 0x7f04000b color/abc_primary_text_material_light | |
() (file) res/color/abc_primary_text_material_light.xml type=XML | |
resource 0x7f04000c color/abc_search_url_text | |
() (file) res/color/abc_search_url_text.xml type=XML | |
resource 0x7f04000d color/abc_search_url_text_normal | |
() #ff7fa87f | |
resource 0x7f04000e color/abc_search_url_text_pressed | |
() @0x0106000c | |
resource 0x7f04000f color/abc_search_url_text_selected | |
() @0x0106000c | |
resource 0x7f040010 color/abc_secondary_text_material_dark | |
() (file) res/color/abc_secondary_text_material_dark.xml type=XML | |
resource 0x7f040011 color/abc_secondary_text_material_light | |
() (file) res/color/abc_secondary_text_material_light.xml type=XML | |
resource 0x7f040012 color/abc_tint_btn_checkable | |
() (file) res/color/abc_tint_btn_checkable.xml type=XML | |
(v23) (file) res/color-v23/abc_tint_btn_checkable.xml type=XML | |
resource 0x7f040013 color/abc_tint_default | |
() (file) res/color/abc_tint_default.xml type=XML | |
(v23) (file) res/color-v23/abc_tint_default.xml type=XML | |
resource 0x7f040014 color/abc_tint_edittext | |
() (file) res/color/abc_tint_edittext.xml type=XML | |
(v23) (file) res/color-v23/abc_tint_edittext.xml type=XML | |
resource 0x7f040015 color/abc_tint_seek_thumb | |
() (file) res/color/abc_tint_seek_thumb.xml type=XML | |
(v23) (file) res/color-v23/abc_tint_seek_thumb.xml type=XML | |
resource 0x7f040016 color/abc_tint_spinner | |
() (file) res/color/abc_tint_spinner.xml type=XML | |
(v23) (file) res/color-v23/abc_tint_spinner.xml type=XML | |
resource 0x7f040017 color/abc_tint_switch_track | |
() (file) res/color/abc_tint_switch_track.xml type=XML | |
(v23) (file) res/color-v23/abc_tint_switch_track.xml type=XML | |
resource 0x7f040018 color/accent_material_dark | |
() @color/material_deep_teal_200 | |
resource 0x7f040019 color/accent_material_light | |
() @color/material_deep_teal_500 | |
resource 0x7f04001a color/androidx_core_ripple_material_light | |
() #1f000000 | |
resource 0x7f04001b color/androidx_core_secondary_text_default_material_light | |
() #8a000000 | |
resource 0x7f04001c color/background_floating_material_dark | |
() @color/material_grey_800 | |
resource 0x7f04001d color/background_floating_material_light | |
() @0x0106000b | |
resource 0x7f04001e color/background_material_dark | |
() @color/material_grey_850 | |
resource 0x7f04001f color/background_material_light | |
() @color/material_grey_50 | |
resource 0x7f040020 color/bright_foreground_disabled_material_dark | |
() #80ffffff | |
resource 0x7f040021 color/bright_foreground_disabled_material_light | |
() #80000000 | |
resource 0x7f040022 color/bright_foreground_inverse_material_dark | |
() @color/bright_foreground_material_light | |
resource 0x7f040023 color/bright_foreground_inverse_material_light | |
() @color/bright_foreground_material_dark | |
resource 0x7f040024 color/bright_foreground_material_dark | |
() @0x0106000b | |
resource 0x7f040025 color/bright_foreground_material_light | |
() @0x0106000c | |
resource 0x7f040026 color/button_material_dark | |
() #ff5a595b | |
resource 0x7f040027 color/button_material_light | |
() #ffd6d7d7 | |
resource 0x7f040028 color/colorAccent | |
() #ff03dac5 | |
resource 0x7f040029 color/colorPrimary | |
() #ff6200ee | |
resource 0x7f04002a color/colorPrimaryDark | |
() #ff3700b3 | |
resource 0x7f04002b color/dim_foreground_disabled_material_dark | |
() #80bebebe | |
resource 0x7f04002c color/dim_foreground_disabled_material_light | |
() #80323232 | |
resource 0x7f04002d color/dim_foreground_material_dark | |
() #ffbebebe | |
resource 0x7f04002e color/dim_foreground_material_light | |
() #ff323232 | |
resource 0x7f04002f color/error_color_material_dark | |
() #ffff7043 | |
resource 0x7f040030 color/error_color_material_light | |
() #ffff5722 | |
resource 0x7f040031 color/foreground_material_dark | |
() @0x0106000b | |
resource 0x7f040032 color/foreground_material_light | |
() @0x0106000c | |
resource 0x7f040033 color/highlighted_text_material_dark | |
() #6680cbc4 | |
resource 0x7f040034 color/highlighted_text_material_light | |
() #66009688 | |
resource 0x7f040035 color/material_blue_grey_800 | |
() #ff37474f | |
resource 0x7f040036 color/material_blue_grey_900 | |
() #ff263238 | |
resource 0x7f040037 color/material_blue_grey_950 | |
() #ff21272b | |
resource 0x7f040038 color/material_deep_teal_200 | |
() #ff80cbc4 | |
resource 0x7f040039 color/material_deep_teal_500 | |
() #ff008577 | |
resource 0x7f04003a color/material_grey_100 | |
() #fff5f5f5 | |
resource 0x7f04003b color/material_grey_300 | |
() #ffe0e0e0 | |
resource 0x7f04003c color/material_grey_50 | |
() #fffafafa | |
resource 0x7f04003d color/material_grey_600 | |
() #ff757575 | |
resource 0x7f04003e color/material_grey_800 | |
() #ff424242 | |
resource 0x7f04003f color/material_grey_850 | |
() #ff303030 | |
resource 0x7f040040 color/material_grey_900 | |
() #ff212121 | |
resource 0x7f040041 color/notification_action_color_filter | |
() @color/androidx_core_secondary_text_default_material_light | |
resource 0x7f040042 color/notification_icon_bg_color | |
() #ff9e9e9e | |
resource 0x7f040043 color/primary_dark_material_dark | |
() @0x0106000c | |
resource 0x7f040044 color/primary_dark_material_light | |
() @color/material_grey_600 | |
resource 0x7f040045 color/primary_material_dark | |
() @color/material_grey_900 | |
resource 0x7f040046 color/primary_material_light | |
() @color/material_grey_100 | |
resource 0x7f040047 color/primary_text_default_material_dark | |
() #ffffffff | |
resource 0x7f040048 color/primary_text_default_material_light | |
() #de000000 | |
resource 0x7f040049 color/primary_text_disabled_material_dark | |
() #4dffffff | |
resource 0x7f04004a color/primary_text_disabled_material_light | |
() #39000000 | |
resource 0x7f04004b color/ripple_material_dark | |
() #33ffffff | |
resource 0x7f04004c color/ripple_material_light | |
() #1f000000 | |
resource 0x7f04004d color/secondary_text_default_material_dark | |
() #b3ffffff | |
resource 0x7f04004e color/secondary_text_default_material_light | |
() #8a000000 | |
resource 0x7f04004f color/secondary_text_disabled_material_dark | |
() #36ffffff | |
resource 0x7f040050 color/secondary_text_disabled_material_light | |
() #24000000 | |
resource 0x7f040051 color/switch_thumb_disabled_material_dark | |
() #ff616161 | |
resource 0x7f040052 color/switch_thumb_disabled_material_light | |
() #ffbdbdbd | |
resource 0x7f040053 color/switch_thumb_material_dark | |
() (file) res/color/switch_thumb_material_dark.xml type=XML | |
resource 0x7f040054 color/switch_thumb_material_light | |
() (file) res/color/switch_thumb_material_light.xml type=XML | |
resource 0x7f040055 color/switch_thumb_normal_material_dark | |
() #ffbdbdbd | |
resource 0x7f040056 color/switch_thumb_normal_material_light | |
() #fff1f1f1 | |
resource 0x7f040057 color/tooltip_background_dark | |
() #e6616161 | |
resource 0x7f040058 color/tooltip_background_light | |
() #e6ffffff | |
type dimen id=05 entryCount=117 | |
resource 0x7f050000 dimen/abc_action_bar_content_inset_material | |
() 16.000000dp | |
(sw600dp) 24.000000dp | |
resource 0x7f050001 dimen/abc_action_bar_content_inset_with_nav | |
() 72.000000dp | |
(sw600dp) 80.000000dp | |
resource 0x7f050002 dimen/abc_action_bar_default_height_material | |
() 56.000000dp | |
(sw600dp) 64.000000dp | |
(land) 48.000000dp | |
resource 0x7f050003 dimen/abc_action_bar_default_padding_end_material | |
() 0.000000dp | |
(sw600dp) 8.000000dp | |
resource 0x7f050004 dimen/abc_action_bar_default_padding_start_material | |
() 0.000000dp | |
(sw600dp) 8.000000dp | |
resource 0x7f050005 dimen/abc_action_bar_elevation_material | |
() 4.000000dp | |
resource 0x7f050006 dimen/abc_action_bar_icon_vertical_padding_material | |
() 16.000000dp | |
resource 0x7f050007 dimen/abc_action_bar_overflow_padding_end_material | |
() 10.000000dp | |
resource 0x7f050008 dimen/abc_action_bar_overflow_padding_start_material | |
() 6.000000dp | |
resource 0x7f050009 dimen/abc_action_bar_stacked_max_height | |
() 48.000000dp | |
resource 0x7f05000a dimen/abc_action_bar_stacked_tab_max_width | |
() 180.000000dp | |
resource 0x7f05000b dimen/abc_action_bar_subtitle_bottom_margin_material | |
() 5.000000dp | |
resource 0x7f05000c dimen/abc_action_bar_subtitle_top_margin_material | |
() 16777213.000000dp | |
resource 0x7f05000d dimen/abc_action_button_min_height_material | |
() 48.000000dp | |
resource 0x7f05000e dimen/abc_action_button_min_width_material | |
() 48.000000dp | |
resource 0x7f05000f dimen/abc_action_button_min_width_overflow_material | |
() 36.000000dp | |
resource 0x7f050010 dimen/abc_alert_dialog_button_bar_height | |
() 48.000000dp | |
(h720dp) 54.000000dp | |
resource 0x7f050011 dimen/abc_alert_dialog_button_dimen | |
() 48.000000dp | |
resource 0x7f050012 dimen/abc_button_inset_horizontal_material | |
() @dimen/abc_control_inset_material | |
resource 0x7f050013 dimen/abc_button_inset_vertical_material | |
() 6.000000dp | |
resource 0x7f050014 dimen/abc_button_padding_horizontal_material | |
() 8.000000dp | |
resource 0x7f050015 dimen/abc_button_padding_vertical_material | |
() @dimen/abc_control_padding_material | |
resource 0x7f050016 dimen/abc_cascading_menus_min_smallest_width | |
() 720.000000dp | |
resource 0x7f050017 dimen/abc_config_prefDialogWidth | |
() 320.000000dp | |
(sw600dp) 580.000000dp | |
(large) 440.000000dp | |
resource 0x7f050018 dimen/abc_control_corner_material | |
() 2.000000dp | |
resource 0x7f050019 dimen/abc_control_inset_material | |
() 4.000000dp | |
resource 0x7f05001a dimen/abc_control_padding_material | |
() 4.000000dp | |
resource 0x7f05001b dimen/abc_dialog_corner_radius_material | |
() 2.000000dp | |
resource 0x7f05001c dimen/abc_dialog_fixed_height_major | |
() 0.800000% | |
(large) 0.600000% | |
(xlarge) 0.600000% | |
resource 0x7f05001d dimen/abc_dialog_fixed_height_minor | |
() 1.000000% | |
(large) 0.900000% | |
(xlarge) 0.900000% | |
resource 0x7f05001e dimen/abc_dialog_fixed_width_major | |
() 320.000000dp | |
(large) 0.600000% | |
(xlarge) 0.500000% | |
resource 0x7f05001f dimen/abc_dialog_fixed_width_minor | |
() 320.000000dp | |
(large) 0.900000% | |
(xlarge) 0.700000% | |
resource 0x7f050020 dimen/abc_dialog_list_padding_bottom_no_buttons | |
() 8.000000dp | |
resource 0x7f050021 dimen/abc_dialog_list_padding_top_no_title | |
() 8.000000dp | |
resource 0x7f050022 dimen/abc_dialog_min_width_major | |
() 0.650000% | |
(large) 0.550000% | |
(xlarge) 0.450000% | |
resource 0x7f050023 dimen/abc_dialog_min_width_minor | |
() 0.950000% | |
(large) 0.800000% | |
(xlarge) 0.720000% | |
resource 0x7f050024 dimen/abc_dialog_padding_material | |
() 24.000000dp | |
resource 0x7f050025 dimen/abc_dialog_padding_top_material | |
() 18.000000dp | |
resource 0x7f050026 dimen/abc_dialog_title_divider_material | |
() 8.000000dp | |
resource 0x7f050027 dimen/abc_disabled_alpha_material_dark | |
() 0.3 | |
resource 0x7f050028 dimen/abc_disabled_alpha_material_light | |
() 0.26 | |
resource 0x7f050029 dimen/abc_dropdownitem_icon_width | |
() 32.000000dp | |
resource 0x7f05002a dimen/abc_dropdownitem_text_padding_left | |
() 8.000000dp | |
resource 0x7f05002b dimen/abc_dropdownitem_text_padding_right | |
() 8.000000dp | |
resource 0x7f05002c dimen/abc_edit_text_inset_bottom_material | |
() 7.000000dp | |
resource 0x7f05002d dimen/abc_edit_text_inset_horizontal_material | |
() 4.000000dp | |
resource 0x7f05002e dimen/abc_edit_text_inset_top_material | |
() 10.000000dp | |
resource 0x7f05002f dimen/abc_floating_window_z | |
() 16.000000dp | |
resource 0x7f050030 dimen/abc_list_item_height_large_material | |
() 80.000000dp | |
resource 0x7f050031 dimen/abc_list_item_height_material | |
() 64.000000dp | |
resource 0x7f050032 dimen/abc_list_item_height_small_material | |
() 48.000000dp | |
resource 0x7f050033 dimen/abc_list_item_padding_horizontal_material | |
() @dimen/abc_action_bar_content_inset_material | |
resource 0x7f050034 dimen/abc_panel_menu_list_width | |
() 296.000000dp | |
resource 0x7f050035 dimen/abc_progress_bar_height_material | |
() 4.000000dp | |
resource 0x7f050036 dimen/abc_search_view_preferred_height | |
() 48.000000dp | |
resource 0x7f050037 dimen/abc_search_view_preferred_width | |
() 320.000000dp | |
resource 0x7f050038 dimen/abc_seekbar_track_background_height_material | |
() 2.000000dp | |
resource 0x7f050039 dimen/abc_seekbar_track_progress_height_material | |
() 2.000000dp | |
resource 0x7f05003a dimen/abc_select_dialog_padding_start_material | |
() 20.000000dp | |
resource 0x7f05003b dimen/abc_switch_padding | |
() 0.000000px | |
resource 0x7f05003c dimen/abc_text_size_body_1_material | |
() 14.000000sp | |
resource 0x7f05003d dimen/abc_text_size_body_2_material | |
() 14.000000sp | |
resource 0x7f05003e dimen/abc_text_size_button_material | |
() 14.000000sp | |
resource 0x7f05003f dimen/abc_text_size_caption_material | |
() 12.000000sp | |
resource 0x7f050040 dimen/abc_text_size_display_1_material | |
() 34.000000sp | |
resource 0x7f050041 dimen/abc_text_size_display_2_material | |
() 45.000000sp | |
resource 0x7f050042 dimen/abc_text_size_display_3_material | |
() 56.000000sp | |
resource 0x7f050043 dimen/abc_text_size_display_4_material | |
() 112.000000sp | |
resource 0x7f050044 dimen/abc_text_size_headline_material | |
() 24.000000sp | |
resource 0x7f050045 dimen/abc_text_size_large_material | |
() 22.000000sp | |
resource 0x7f050046 dimen/abc_text_size_medium_material | |
() 18.000000sp | |
resource 0x7f050047 dimen/abc_text_size_menu_header_material | |
() 14.000000sp | |
resource 0x7f050048 dimen/abc_text_size_menu_material | |
() 16.000000sp | |
resource 0x7f050049 dimen/abc_text_size_small_material | |
() 14.000000sp | |
resource 0x7f05004a dimen/abc_text_size_subhead_material | |
() 16.000000sp | |
resource 0x7f05004b dimen/abc_text_size_subtitle_material_toolbar | |
() 16.000000dp | |
(sw600dp) 16.000000dp | |
(land) 12.000000dp | |
resource 0x7f05004c dimen/abc_text_size_title_material | |
() 20.000000sp | |
resource 0x7f05004d dimen/abc_text_size_title_material_toolbar | |
() 20.000000dp | |
(sw600dp) 20.000000dp | |
(land) 14.000000dp | |
resource 0x7f05004e dimen/compat_button_inset_horizontal_material | |
() 4.000000dp | |
resource 0x7f05004f dimen/compat_button_inset_vertical_material | |
() 6.000000dp | |
resource 0x7f050050 dimen/compat_button_padding_horizontal_material | |
() 8.000000dp | |
resource 0x7f050051 dimen/compat_button_padding_vertical_material | |
() 4.000000dp | |
resource 0x7f050052 dimen/compat_control_corner_material | |
() 2.000000dp | |
resource 0x7f050053 dimen/compat_notification_large_icon_max_height | |
() 320.000000dp | |
resource 0x7f050054 dimen/compat_notification_large_icon_max_width | |
() 320.000000dp | |
resource 0x7f050055 dimen/disabled_alpha_material_dark | |
() 0.3 | |
resource 0x7f050056 dimen/disabled_alpha_material_light | |
() 0.26 | |
resource 0x7f050057 dimen/highlight_alpha_material_colored | |
() 0.26 | |
resource 0x7f050058 dimen/highlight_alpha_material_dark | |
() 0.2 | |
resource 0x7f050059 dimen/highlight_alpha_material_light | |
() 0.12 | |
resource 0x7f05005a dimen/hint_alpha_material_dark | |
() 0.5 | |
resource 0x7f05005b dimen/hint_alpha_material_light | |
() 0.38 | |
resource 0x7f05005c dimen/hint_pressed_alpha_material_dark | |
() 0.7 | |
resource 0x7f05005d dimen/hint_pressed_alpha_material_light | |
() 0.54 | |
resource 0x7f05005e dimen/notification_action_icon_size | |
() 32.000000dp | |
resource 0x7f05005f dimen/notification_action_text_size | |
() 13.000000sp | |
resource 0x7f050060 dimen/notification_big_circle_margin | |
() 12.000000dp | |
resource 0x7f050061 dimen/notification_content_margin_start | |
() 0.000000dp | |
resource 0x7f050062 dimen/notification_large_icon_height | |
() 64.000000dp | |
resource 0x7f050063 dimen/notification_large_icon_width | |
() 64.000000dp | |
resource 0x7f050064 dimen/notification_main_column_padding_top | |
() 0.000000dp | |
resource 0x7f050065 dimen/notification_media_narrow_margin | |
() 12.000000dp | |
resource 0x7f050066 dimen/notification_right_icon_size | |
() 16.000000dp | |
resource 0x7f050067 dimen/notification_right_side_padding_top | |
() 4.000000dp | |
resource 0x7f050068 dimen/notification_small_icon_background_padding | |
() 3.000000dp | |
resource 0x7f050069 dimen/notification_small_icon_size_as_large | |
() 24.000000dp | |
resource 0x7f05006a dimen/notification_subtext_size | |
() 13.000000sp | |
resource 0x7f05006b dimen/notification_top_pad | |
() 10.000000dp | |
resource 0x7f05006c dimen/notification_top_pad_large_text | |
() 5.000000dp | |
resource 0x7f05006d dimen/tooltip_corner_radius | |
() 2.000000dp | |
resource 0x7f05006e dimen/tooltip_horizontal_padding | |
() 16.000000dp | |
resource 0x7f05006f dimen/tooltip_margin | |
() 8.000000dp | |
resource 0x7f050070 dimen/tooltip_precise_anchor_extra_offset | |
() 8.000000dp | |
resource 0x7f050071 dimen/tooltip_precise_anchor_threshold | |
() 96.000000dp | |
resource 0x7f050072 dimen/tooltip_vertical_padding | |
() 6.500000dp | |
resource 0x7f050073 dimen/tooltip_y_offset_non_touch | |
() 0.000000dp | |
resource 0x7f050074 dimen/tooltip_y_offset_touch | |
() 16.000000dp | |
type drawable id=06 entryCount=113 | |
resource 0x7f060000 drawable/$ic_launcher_foreground__0 | |
(v24) (file) res/drawable-v24/$ic_launcher_foreground__0.xml type=XML | |
resource 0x7f060001 drawable/abc_ab_share_pack_mtrl_alpha | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_ab_share_pack_mtrl_alpha.9.png type=PNG | |
resource 0x7f060002 drawable/abc_action_bar_item_background_material | |
() (file) res/drawable-v21/abc_action_bar_item_background_material.xml type=XML | |
resource 0x7f060003 drawable/abc_btn_borderless_material | |
() (file) res/drawable/abc_btn_borderless_material.xml type=XML | |
resource 0x7f060004 drawable/abc_btn_check_material | |
() (file) res/drawable/abc_btn_check_material.xml type=XML | |
resource 0x7f060005 drawable/abc_btn_check_material_anim | |
() (file) res/drawable/abc_btn_check_material_anim.xml type=XML | |
resource 0x7f060006 drawable/abc_btn_check_to_on_mtrl_000 | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_btn_check_to_on_mtrl_000.png type=PNG | |
resource 0x7f060007 drawable/abc_btn_check_to_on_mtrl_015 | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_btn_check_to_on_mtrl_015.png type=PNG | |
resource 0x7f060008 drawable/abc_btn_colored_material | |
() (file) res/drawable-v21/abc_btn_colored_material.xml type=XML | |
resource 0x7f060009 drawable/abc_btn_default_mtrl_shape | |
() (file) res/drawable/abc_btn_default_mtrl_shape.xml type=XML | |
resource 0x7f06000a drawable/abc_btn_radio_material | |
() (file) res/drawable/abc_btn_radio_material.xml type=XML | |
resource 0x7f06000b drawable/abc_btn_radio_material_anim | |
() (file) res/drawable/abc_btn_radio_material_anim.xml type=XML | |
resource 0x7f06000c drawable/abc_btn_radio_to_on_mtrl_000 | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_btn_radio_to_on_mtrl_000.png type=PNG | |
resource 0x7f06000d drawable/abc_btn_radio_to_on_mtrl_015 | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_btn_radio_to_on_mtrl_015.png type=PNG | |
resource 0x7f06000e drawable/abc_btn_switch_to_on_mtrl_00001 | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_btn_switch_to_on_mtrl_00001.9.png type=PNG | |
resource 0x7f06000f drawable/abc_btn_switch_to_on_mtrl_00012 | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_btn_switch_to_on_mtrl_00012.9.png type=PNG | |
resource 0x7f060010 drawable/abc_cab_background_internal_bg | |
() (file) res/drawable/abc_cab_background_internal_bg.xml type=XML | |
resource 0x7f060011 drawable/abc_cab_background_top_material | |
() (file) res/drawable/abc_cab_background_top_material.xml type=XML | |
resource 0x7f060012 drawable/abc_cab_background_top_mtrl_alpha | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_cab_background_top_mtrl_alpha.9.png type=PNG | |
resource 0x7f060013 drawable/abc_control_background_material | |
(v23) (file) res/drawable-v23/abc_control_background_material.xml type=XML | |
resource 0x7f060014 drawable/abc_dialog_material_background | |
() (file) res/drawable-v21/abc_dialog_material_background.xml type=XML | |
(watch) (file) res/drawable-watch-v20/abc_dialog_material_background.xml type=XML | |
resource 0x7f060015 drawable/abc_edit_text_material | |
() (file) res/drawable-v21/abc_edit_text_material.xml type=XML | |
resource 0x7f060016 drawable/abc_ic_ab_back_material | |
() (file) res/drawable/abc_ic_ab_back_material.xml type=XML | |
resource 0x7f060017 drawable/abc_ic_arrow_drop_right_black_24dp | |
() (file) res/drawable/abc_ic_arrow_drop_right_black_24dp.xml type=XML | |
resource 0x7f060018 drawable/abc_ic_clear_material | |
() (file) res/drawable/abc_ic_clear_material.xml type=XML | |
resource 0x7f060019 drawable/abc_ic_commit_search_api_mtrl_alpha | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_ic_commit_search_api_mtrl_alpha.png type=PNG | |
resource 0x7f06001a drawable/abc_ic_go_search_api_material | |
() (file) res/drawable/abc_ic_go_search_api_material.xml type=XML | |
resource 0x7f06001b drawable/abc_ic_menu_copy_mtrl_am_alpha | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_ic_menu_copy_mtrl_am_alpha.png type=PNG | |
(ldrtl-xxhdpi) (file) res/drawable-ldrtl-xxhdpi-v17/abc_ic_menu_copy_mtrl_am_alpha.png type=PNG | |
resource 0x7f06001c drawable/abc_ic_menu_cut_mtrl_alpha | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_ic_menu_cut_mtrl_alpha.png type=PNG | |
(ldrtl-xxhdpi) (file) res/drawable-ldrtl-xxhdpi-v17/abc_ic_menu_cut_mtrl_alpha.png type=PNG | |
resource 0x7f06001d drawable/abc_ic_menu_overflow_material | |
() (file) res/drawable/abc_ic_menu_overflow_material.xml type=XML | |
resource 0x7f06001e drawable/abc_ic_menu_paste_mtrl_am_alpha | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_ic_menu_paste_mtrl_am_alpha.png type=PNG | |
resource 0x7f06001f drawable/abc_ic_menu_selectall_mtrl_alpha | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_ic_menu_selectall_mtrl_alpha.png type=PNG | |
resource 0x7f060020 drawable/abc_ic_menu_share_mtrl_alpha | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_ic_menu_share_mtrl_alpha.png type=PNG | |
resource 0x7f060021 drawable/abc_ic_search_api_material | |
() (file) res/drawable/abc_ic_search_api_material.xml type=XML | |
resource 0x7f060022 drawable/abc_ic_star_black_16dp | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_ic_star_black_16dp.png type=PNG | |
resource 0x7f060023 drawable/abc_ic_star_black_36dp | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_ic_star_black_36dp.png type=PNG | |
resource 0x7f060024 drawable/abc_ic_star_black_48dp | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_ic_star_black_48dp.png type=PNG | |
resource 0x7f060025 drawable/abc_ic_star_half_black_16dp | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_ic_star_half_black_16dp.png type=PNG | |
resource 0x7f060026 drawable/abc_ic_star_half_black_36dp | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_ic_star_half_black_36dp.png type=PNG | |
resource 0x7f060027 drawable/abc_ic_star_half_black_48dp | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_ic_star_half_black_48dp.png type=PNG | |
resource 0x7f060028 drawable/abc_ic_voice_search_api_material | |
() (file) res/drawable/abc_ic_voice_search_api_material.xml type=XML | |
resource 0x7f060029 drawable/abc_item_background_holo_dark | |
() (file) res/drawable/abc_item_background_holo_dark.xml type=XML | |
resource 0x7f06002a drawable/abc_item_background_holo_light | |
() (file) res/drawable/abc_item_background_holo_light.xml type=XML | |
resource 0x7f06002b drawable/abc_list_divider_material | |
() (file) res/drawable-v21/abc_list_divider_material.xml type=XML | |
resource 0x7f06002c drawable/abc_list_divider_mtrl_alpha | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_list_divider_mtrl_alpha.9.png type=PNG | |
resource 0x7f06002d drawable/abc_list_focused_holo | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_list_focused_holo.9.png type=PNG | |
resource 0x7f06002e drawable/abc_list_longpressed_holo | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_list_longpressed_holo.9.png type=PNG | |
resource 0x7f06002f drawable/abc_list_pressed_holo_dark | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_list_pressed_holo_dark.9.png type=PNG | |
resource 0x7f060030 drawable/abc_list_pressed_holo_light | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_list_pressed_holo_light.9.png type=PNG | |
resource 0x7f060031 drawable/abc_list_selector_background_transition_holo_dark | |
() (file) res/drawable/abc_list_selector_background_transition_holo_dark.xml type=XML | |
resource 0x7f060032 drawable/abc_list_selector_background_transition_holo_light | |
() (file) res/drawable/abc_list_selector_background_transition_holo_light.xml type=XML | |
resource 0x7f060033 drawable/abc_list_selector_disabled_holo_dark | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_list_selector_disabled_holo_dark.9.png type=PNG | |
resource 0x7f060034 drawable/abc_list_selector_disabled_holo_light | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_list_selector_disabled_holo_light.9.png type=PNG | |
resource 0x7f060035 drawable/abc_list_selector_holo_dark | |
() (file) res/drawable/abc_list_selector_holo_dark.xml type=XML | |
resource 0x7f060036 drawable/abc_list_selector_holo_light | |
() (file) res/drawable/abc_list_selector_holo_light.xml type=XML | |
resource 0x7f060037 drawable/abc_menu_hardkey_panel_mtrl_mult | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_menu_hardkey_panel_mtrl_mult.9.png type=PNG | |
resource 0x7f060038 drawable/abc_popup_background_mtrl_mult | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_popup_background_mtrl_mult.9.png type=PNG | |
resource 0x7f060039 drawable/abc_ratingbar_indicator_material | |
() (file) res/drawable/abc_ratingbar_indicator_material.xml type=XML | |
resource 0x7f06003a drawable/abc_ratingbar_material | |
() (file) res/drawable/abc_ratingbar_material.xml type=XML | |
resource 0x7f06003b drawable/abc_ratingbar_small_material | |
() (file) res/drawable/abc_ratingbar_small_material.xml type=XML | |
resource 0x7f06003c drawable/abc_scrubber_control_off_mtrl_alpha | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_scrubber_control_off_mtrl_alpha.png type=PNG | |
resource 0x7f06003d drawable/abc_scrubber_control_to_pressed_mtrl_000 | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_scrubber_control_to_pressed_mtrl_000.png type=PNG | |
resource 0x7f06003e drawable/abc_scrubber_control_to_pressed_mtrl_005 | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_scrubber_control_to_pressed_mtrl_005.png type=PNG | |
resource 0x7f06003f drawable/abc_scrubber_primary_mtrl_alpha | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_scrubber_primary_mtrl_alpha.9.png type=PNG | |
resource 0x7f060040 drawable/abc_scrubber_track_mtrl_alpha | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_scrubber_track_mtrl_alpha.9.png type=PNG | |
resource 0x7f060041 drawable/abc_seekbar_thumb_material | |
() (file) res/drawable/abc_seekbar_thumb_material.xml type=XML | |
resource 0x7f060042 drawable/abc_seekbar_tick_mark_material | |
() (file) res/drawable/abc_seekbar_tick_mark_material.xml type=XML | |
resource 0x7f060043 drawable/abc_seekbar_track_material | |
() (file) res/drawable/abc_seekbar_track_material.xml type=XML | |
resource 0x7f060044 drawable/abc_spinner_mtrl_am_alpha | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_spinner_mtrl_am_alpha.9.png type=PNG | |
(ldrtl-xxhdpi) (file) res/drawable-ldrtl-xxhdpi-v17/abc_spinner_mtrl_am_alpha.9.png type=PNG | |
resource 0x7f060045 drawable/abc_spinner_textfield_background_material | |
() (file) res/drawable/abc_spinner_textfield_background_material.xml type=XML | |
resource 0x7f060046 drawable/abc_switch_thumb_material | |
() (file) res/drawable/abc_switch_thumb_material.xml type=XML | |
resource 0x7f060047 drawable/abc_switch_track_mtrl_alpha | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_switch_track_mtrl_alpha.9.png type=PNG | |
resource 0x7f060048 drawable/abc_tab_indicator_material | |
() (file) res/drawable/abc_tab_indicator_material.xml type=XML | |
resource 0x7f060049 drawable/abc_tab_indicator_mtrl_alpha | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_tab_indicator_mtrl_alpha.9.png type=PNG | |
resource 0x7f06004a drawable/abc_text_cursor_material | |
() (file) res/drawable/abc_text_cursor_material.xml type=XML | |
resource 0x7f06004b drawable/abc_text_select_handle_left_mtrl_dark | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_text_select_handle_left_mtrl_dark.png type=PNG | |
resource 0x7f06004c drawable/abc_text_select_handle_left_mtrl_light | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_text_select_handle_left_mtrl_light.png type=PNG | |
resource 0x7f06004d drawable/abc_text_select_handle_middle_mtrl_dark | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_text_select_handle_middle_mtrl_dark.png type=PNG | |
resource 0x7f06004e drawable/abc_text_select_handle_middle_mtrl_light | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_text_select_handle_middle_mtrl_light.png type=PNG | |
resource 0x7f06004f drawable/abc_text_select_handle_right_mtrl_dark | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_text_select_handle_right_mtrl_dark.png type=PNG | |
resource 0x7f060050 drawable/abc_text_select_handle_right_mtrl_light | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_text_select_handle_right_mtrl_light.png type=PNG | |
resource 0x7f060051 drawable/abc_textfield_activated_mtrl_alpha | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_textfield_activated_mtrl_alpha.9.png type=PNG | |
resource 0x7f060052 drawable/abc_textfield_default_mtrl_alpha | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_textfield_default_mtrl_alpha.9.png type=PNG | |
resource 0x7f060053 drawable/abc_textfield_search_activated_mtrl_alpha | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_textfield_search_activated_mtrl_alpha.9.png type=PNG | |
resource 0x7f060054 drawable/abc_textfield_search_default_mtrl_alpha | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/abc_textfield_search_default_mtrl_alpha.9.png type=PNG | |
resource 0x7f060055 drawable/abc_textfield_search_material | |
() (file) res/drawable/abc_textfield_search_material.xml type=XML | |
resource 0x7f060056 drawable/abc_vector_test | |
() (file) res/drawable/abc_vector_test.xml type=XML | |
resource 0x7f060057 drawable/background | |
() (file) res/drawable/background.xml type=XML | |
resource 0x7f060058 drawable/btn_checkbox_checked_mtrl | |
() (file) res/drawable/btn_checkbox_checked_mtrl.xml type=XML | |
resource 0x7f060059 drawable/btn_checkbox_checked_to_unchecked_mtrl_animation | |
() (file) res/drawable/btn_checkbox_checked_to_unchecked_mtrl_animation.xml type=XML | |
resource 0x7f06005a drawable/btn_checkbox_unchecked_mtrl | |
() (file) res/drawable/btn_checkbox_unchecked_mtrl.xml type=XML | |
resource 0x7f06005b drawable/btn_checkbox_unchecked_to_checked_mtrl_animation | |
() (file) res/drawable/btn_checkbox_unchecked_to_checked_mtrl_animation.xml type=XML | |
resource 0x7f06005c drawable/btn_radio_off_mtrl | |
() (file) res/drawable/btn_radio_off_mtrl.xml type=XML | |
resource 0x7f06005d drawable/btn_radio_off_to_on_mtrl_animation | |
() (file) res/drawable/btn_radio_off_to_on_mtrl_animation.xml type=XML | |
resource 0x7f06005e drawable/btn_radio_on_mtrl | |
() (file) res/drawable/btn_radio_on_mtrl.xml type=XML | |
resource 0x7f06005f drawable/btn_radio_on_to_off_mtrl_animation | |
() (file) res/drawable/btn_radio_on_to_off_mtrl_animation.xml type=XML | |
resource 0x7f060060 drawable/ic_launcher_background | |
() (file) res/drawable/ic_launcher_background.xml type=XML | |
resource 0x7f060061 drawable/ic_launcher_foreground | |
(v24) (file) res/drawable-v24/ic_launcher_foreground.xml type=XML | |
resource 0x7f060062 drawable/ic_map_filter | |
() (file) res/drawable/ic_map_filter.xml type=XML | |
(xxhdpi) (file) res/drawable-xxhdpi-v4/ic_map_filter.png type=PNG | |
(anydpi-v24) (file) res/drawable-anydpi-v24/ic_map_filter.xml type=XML | |
resource 0x7f060063 drawable/notification_action_background | |
() (file) res/drawable-v21/notification_action_background.xml type=XML | |
resource 0x7f060064 drawable/notification_bg | |
() (file) res/drawable/notification_bg.xml type=XML | |
resource 0x7f060065 drawable/notification_bg_low | |
() (file) res/drawable/notification_bg_low.xml type=XML | |
resource 0x7f060066 drawable/notification_bg_low_normal | |
(xhdpi) (file) res/drawable-xhdpi-v4/notification_bg_low_normal.9.png type=PNG | |
resource 0x7f060067 drawable/notification_bg_low_pressed | |
(xhdpi) (file) res/drawable-xhdpi-v4/notification_bg_low_pressed.9.png type=PNG | |
resource 0x7f060068 drawable/notification_bg_normal | |
(xhdpi) (file) res/drawable-xhdpi-v4/notification_bg_normal.9.png type=PNG | |
resource 0x7f060069 drawable/notification_bg_normal_pressed | |
(xhdpi) (file) res/drawable-xhdpi-v4/notification_bg_normal_pressed.9.png type=PNG | |
resource 0x7f06006a drawable/notification_icon_background | |
() (file) res/drawable/notification_icon_background.xml type=XML | |
resource 0x7f06006b drawable/notification_template_icon_bg | |
() #3333b5e5 | |
resource 0x7f06006c drawable/notification_template_icon_low_bg | |
() #0cffffff | |
resource 0x7f06006d drawable/notification_tile_bg | |
() (file) res/drawable/notification_tile_bg.xml type=XML | |
resource 0x7f06006e drawable/notify_panel_notification_icon_bg | |
(xhdpi) (file) res/drawable-xhdpi-v4/notify_panel_notification_icon_bg.png type=PNG | |
resource 0x7f06006f drawable/tooltip_frame_dark | |
() (file) res/drawable/tooltip_frame_dark.xml type=XML | |
resource 0x7f060070 drawable/tooltip_frame_light | |
() (file) res/drawable/tooltip_frame_light.xml type=XML | |
type id id=07 entryCount=184 | |
resource 0x7f070000 id/ALT | |
() (id) | |
resource 0x7f070001 id/CTRL | |
() (id) | |
resource 0x7f070002 id/FUNCTION | |
() (id) | |
resource 0x7f070003 id/META | |
() (id) | |
resource 0x7f070004 id/SHIFT | |
() (id) | |
resource 0x7f070005 id/SYM | |
() (id) | |
resource 0x7f070006 id/accessibility_action_clickable_span | |
() (id) | |
resource 0x7f070007 id/accessibility_custom_action_0 | |
() (id) | |
resource 0x7f070008 id/accessibility_custom_action_1 | |
() (id) | |
resource 0x7f070009 id/accessibility_custom_action_10 | |
() (id) | |
resource 0x7f07000a id/accessibility_custom_action_11 | |
() (id) | |
resource 0x7f07000b id/accessibility_custom_action_12 | |
() (id) | |
resource 0x7f07000c id/accessibility_custom_action_13 | |
() (id) | |
resource 0x7f07000d id/accessibility_custom_action_14 | |
() (id) | |
resource 0x7f07000e id/accessibility_custom_action_15 | |
() (id) | |
resource 0x7f07000f id/accessibility_custom_action_16 | |
() (id) | |
resource 0x7f070010 id/accessibility_custom_action_17 | |
() (id) | |
resource 0x7f070011 id/accessibility_custom_action_18 | |
() (id) | |
resource 0x7f070012 id/accessibility_custom_action_19 | |
() (id) | |
resource 0x7f070013 id/accessibility_custom_action_2 | |
() (id) | |
resource 0x7f070014 id/accessibility_custom_action_20 | |
() (id) | |
resource 0x7f070015 id/accessibility_custom_action_21 | |
() (id) | |
resource 0x7f070016 id/accessibility_custom_action_22 | |
() (id) | |
resource 0x7f070017 id/accessibility_custom_action_23 | |
() (id) | |
resource 0x7f070018 id/accessibility_custom_action_24 | |
() (id) | |
resource 0x7f070019 id/accessibility_custom_action_25 | |
() (id) | |
resource 0x7f07001a id/accessibility_custom_action_26 | |
() (id) | |
resource 0x7f07001b id/accessibility_custom_action_27 | |
() (id) | |
resource 0x7f07001c id/accessibility_custom_action_28 | |
() (id) | |
resource 0x7f07001d id/accessibility_custom_action_29 | |
() (id) | |
resource 0x7f07001e id/accessibility_custom_action_3 | |
() (id) | |
resource 0x7f07001f id/accessibility_custom_action_30 | |
() (id) | |
resource 0x7f070020 id/accessibility_custom_action_31 | |
() (id) | |
resource 0x7f070021 id/accessibility_custom_action_4 | |
() (id) | |
resource 0x7f070022 id/accessibility_custom_action_5 | |
() (id) | |
resource 0x7f070023 id/accessibility_custom_action_6 | |
() (id) | |
resource 0x7f070024 id/accessibility_custom_action_7 | |
() (id) | |
resource 0x7f070025 id/accessibility_custom_action_8 | |
() (id) | |
resource 0x7f070026 id/accessibility_custom_action_9 | |
() (id) | |
resource 0x7f070027 id/action_bar | |
() (id) | |
resource 0x7f070028 id/action_bar_activity_content | |
() (id) | |
resource 0x7f070029 id/action_bar_container | |
() (id) | |
resource 0x7f07002a id/action_bar_root | |
() (id) | |
resource 0x7f07002b id/action_bar_spinner | |
() (id) | |
resource 0x7f07002c id/action_bar_subtitle | |
() (id) | |
resource 0x7f07002d id/action_bar_title | |
() (id) | |
resource 0x7f07002e id/action_container | |
() (id) | |
resource 0x7f07002f id/action_context_bar | |
() (id) | |
resource 0x7f070030 id/action_divider | |
() (id) | |
resource 0x7f070031 id/action_image | |
() (id) | |
resource 0x7f070032 id/action_menu_divider | |
() (id) | |
resource 0x7f070033 id/action_menu_presenter | |
() (id) | |
resource 0x7f070034 id/action_mode_bar | |
() (id) | |
resource 0x7f070035 id/action_mode_bar_stub | |
() (id) | |
resource 0x7f070036 id/action_mode_close_button | |
() (id) | |
resource 0x7f070037 id/action_text | |
() (id) | |
resource 0x7f070038 id/actions | |
() (id) | |
resource 0x7f070039 id/activity_chooser_view_content | |
() (id) | |
resource 0x7f07003a id/add | |
() (id) | |
resource 0x7f07003b id/alertTitle | |
() (id) | |
resource 0x7f07003c id/always | |
() (id) | |
resource 0x7f07003d id/async | |
() (id) | |
resource 0x7f07003e id/barrier | |
() (id) | |
resource 0x7f07003f id/beginning | |
() (id) | |
resource 0x7f070040 id/blocking | |
() (id) | |
resource 0x7f070041 id/bottom | |
() (id) | |
resource 0x7f070042 id/buttonPanel | |
() (id) | |
resource 0x7f070043 id/center_vertical | |
() (id) | |
resource 0x7f070044 id/chains | |
() (id) | |
resource 0x7f070045 id/checkbox | |
() (id) | |
resource 0x7f070046 id/checked | |
() (id) | |
resource 0x7f070047 id/chronometer | |
() (id) | |
resource 0x7f070048 id/collapseActionView | |
() (id) | |
resource 0x7f070049 id/content | |
() (id) | |
resource 0x7f07004a id/contentPanel | |
() (id) | |
resource 0x7f07004b id/custom | |
() (id) | |
resource 0x7f07004c id/customPanel | |
() (id) | |
resource 0x7f07004d id/decor_content_parent | |
() (id) | |
resource 0x7f07004e id/default_activity_button | |
() (id) | |
resource 0x7f07004f id/dialog_button | |
() (id) | |
resource 0x7f070050 id/dimensions | |
() (id) | |
resource 0x7f070051 id/direct | |
() (id) | |
resource 0x7f070052 id/disableHome | |
() (id) | |
resource 0x7f070053 id/edit_query | |
() (id) | |
resource 0x7f070054 id/end | |
() (id) | |
resource 0x7f070055 id/expand_activities_button | |
() (id) | |
resource 0x7f070056 id/expanded_menu | |
() (id) | |
resource 0x7f070057 id/forever | |
() (id) | |
resource 0x7f070058 id/gone | |
() (id) | |
resource 0x7f070059 id/group_divider | |
() (id) | |
resource 0x7f07005a id/groups | |
() (id) | |
resource 0x7f07005b id/home | |
() (id) | |
resource 0x7f07005c id/homeAsUp | |
() (id) | |
resource 0x7f07005d id/icon | |
() (id) | |
resource 0x7f07005e id/icon_group | |
() (id) | |
resource 0x7f07005f id/ifRoom | |
() (id) | |
resource 0x7f070060 id/image | |
() (id) | |
resource 0x7f070061 id/imageView | |
() (id) | |
resource 0x7f070062 id/info | |
() (id) | |
resource 0x7f070063 id/invisible | |
() (id) | |
resource 0x7f070064 id/italic | |
() (id) | |
resource 0x7f070065 id/left | |
() (id) | |
resource 0x7f070066 id/line1 | |
() (id) | |
resource 0x7f070067 id/line3 | |
() (id) | |
resource 0x7f070068 id/listMode | |
() (id) | |
resource 0x7f070069 id/list_item | |
() (id) | |
resource 0x7f07006a id/message | |
() (id) | |
resource 0x7f07006b id/middle | |
() (id) | |
resource 0x7f07006c id/multiply | |
() (id) | |
resource 0x7f07006d id/never | |
() (id) | |
resource 0x7f07006e id/none | |
() (id) | |
resource 0x7f07006f id/normal | |
() (id) | |
resource 0x7f070070 id/notification_background | |
() (id) | |
resource 0x7f070071 id/notification_main_column | |
() (id) | |
resource 0x7f070072 id/notification_main_column_container | |
() (id) | |
resource 0x7f070073 id/off | |
() (id) | |
resource 0x7f070074 id/on | |
() (id) | |
resource 0x7f070075 id/packed | |
() (id) | |
resource 0x7f070076 id/parent | |
() (id) | |
resource 0x7f070077 id/parentPanel | |
() (id) | |
resource 0x7f070078 id/percent | |
() (id) | |
resource 0x7f070079 id/progress_circular | |
() (id) | |
resource 0x7f07007a id/progress_horizontal | |
() (id) | |
resource 0x7f07007b id/radio | |
() (id) | |
resource 0x7f07007c id/right | |
() (id) | |
resource 0x7f07007d id/right_icon | |
() (id) | |
resource 0x7f07007e id/right_side | |
() (id) | |
resource 0x7f07007f id/screen | |
() (id) | |
resource 0x7f070080 id/scrollIndicatorDown | |
() (id) | |
resource 0x7f070081 id/scrollIndicatorUp | |
() (id) | |
resource 0x7f070082 id/scrollView | |
() (id) | |
resource 0x7f070083 id/search_badge | |
() (id) | |
resource 0x7f070084 id/search_bar | |
() (id) | |
resource 0x7f070085 id/search_button | |
() (id) | |
resource 0x7f070086 id/search_close_btn | |
() (id) | |
resource 0x7f070087 id/search_edit_frame | |
() (id) | |
resource 0x7f070088 id/search_go_btn | |
() (id) | |
resource 0x7f070089 id/search_mag_icon | |
() (id) | |
resource 0x7f07008a id/search_plate | |
() (id) | |
resource 0x7f07008b id/search_src_text | |
() (id) | |
resource 0x7f07008c id/search_voice_btn | |
() (id) | |
resource 0x7f07008d id/select_dialog_listview | |
() (id) | |
resource 0x7f07008e id/shortcut | |
() (id) | |
resource 0x7f07008f id/showCustom | |
() (id) | |
resource 0x7f070090 id/showHome | |
() (id) | |
resource 0x7f070091 id/showTitle | |
() (id) | |
resource 0x7f070092 id/spacer | |
() (id) | |
resource 0x7f070093 id/split_action_bar | |
() (id) | |
resource 0x7f070094 id/spread | |
() (id) | |
resource 0x7f070095 id/spread_inside | |
() (id) | |
resource 0x7f070096 id/src_atop | |
() (id) | |
resource 0x7f070097 id/src_in | |
() (id) | |
resource 0x7f070098 id/src_over | |
() (id) | |
resource 0x7f070099 id/standard | |
() (id) | |
resource 0x7f07009a id/start | |
() (id) | |
resource 0x7f07009b id/submenuarrow | |
() (id) | |
resource 0x7f07009c id/submit_area | |
() (id) | |
resource 0x7f07009d id/tabMode | |
() (id) | |
resource 0x7f07009e id/tag_accessibility_actions | |
() (id) | |
resource 0x7f07009f id/tag_accessibility_clickable_spans | |
() (id) | |
resource 0x7f0700a0 id/tag_accessibility_heading | |
() (id) | |
resource 0x7f0700a1 id/tag_accessibility_pane_title | |
() (id) | |
resource 0x7f0700a2 id/tag_screen_reader_focusable | |
() (id) | |
resource 0x7f0700a3 id/tag_transition_group | |
() (id) | |
resource 0x7f0700a4 id/tag_unhandled_key_event_manager | |
() (id) | |
resource 0x7f0700a5 id/tag_unhandled_key_listeners | |
() (id) | |
resource 0x7f0700a6 id/text | |
() (id) | |
resource 0x7f0700a7 id/text2 | |
() (id) | |
resource 0x7f0700a8 id/textSpacerNoButtons | |
() (id) | |
resource 0x7f0700a9 id/textSpacerNoTitle | |
() (id) | |
resource 0x7f0700aa id/textView | |
() (id) | |
resource 0x7f0700ab id/time | |
() (id) | |
resource 0x7f0700ac id/title | |
() (id) | |
resource 0x7f0700ad id/titleDividerNoCustom | |
() (id) | |
resource 0x7f0700ae id/title_template | |
() (id) | |
resource 0x7f0700af id/top | |
() (id) | |
resource 0x7f0700b0 id/topPanel | |
() (id) | |
resource 0x7f0700b1 id/unchecked | |
() (id) | |
resource 0x7f0700b2 id/uniform | |
() (id) | |
resource 0x7f0700b3 id/up | |
() (id) | |
resource 0x7f0700b4 id/useLogo | |
() (id) | |
resource 0x7f0700b5 id/withText | |
() (id) | |
resource 0x7f0700b6 id/wrap | |
() (id) | |
resource 0x7f0700b7 id/wrap_content | |
() (id) | |
type integer id=08 entryCount=5 | |
resource 0x7f080000 integer/abc_config_activityDefaultDur | |
() 220 | |
resource 0x7f080001 integer/abc_config_activityShortDur | |
() 150 | |
resource 0x7f080002 integer/cancel_button_image_alpha | |
() 127 | |
resource 0x7f080003 integer/config_tooltipAnimTime | |
() 150 | |
resource 0x7f080004 integer/status_bar_notification_info_maxnum | |
() 999 | |
type interpolator id=09 entryCount=7 | |
resource 0x7f090000 interpolator/btn_checkbox_checked_mtrl_animation_interpolator_0 | |
() (file) res/interpolator/btn_checkbox_checked_mtrl_animation_interpolator_0.xml type=XML | |
resource 0x7f090001 interpolator/btn_checkbox_checked_mtrl_animation_interpolator_1 | |
() (file) res/interpolator/btn_checkbox_checked_mtrl_animation_interpolator_1.xml type=XML | |
resource 0x7f090002 interpolator/btn_checkbox_unchecked_mtrl_animation_interpolator_0 | |
() (file) res/interpolator/btn_checkbox_unchecked_mtrl_animation_interpolator_0.xml type=XML | |
resource 0x7f090003 interpolator/btn_checkbox_unchecked_mtrl_animation_interpolator_1 | |
() (file) res/interpolator/btn_checkbox_unchecked_mtrl_animation_interpolator_1.xml type=XML | |
resource 0x7f090004 interpolator/btn_radio_to_off_mtrl_animation_interpolator_0 | |
() (file) res/interpolator/btn_radio_to_off_mtrl_animation_interpolator_0.xml type=XML | |
resource 0x7f090005 interpolator/btn_radio_to_on_mtrl_animation_interpolator_0 | |
() (file) res/interpolator/btn_radio_to_on_mtrl_animation_interpolator_0.xml type=XML | |
resource 0x7f090006 interpolator/fast_out_slow_in | |
() (file) res/interpolator/fast_out_slow_in.xml type=XML | |
type layout id=0a entryCount=40 | |
resource 0x7f0a0000 layout/abc_action_bar_title_item | |
() (file) res/layout/abc_action_bar_title_item.xml type=XML | |
resource 0x7f0a0001 layout/abc_action_bar_up_container | |
() (file) res/layout/abc_action_bar_up_container.xml type=XML | |
resource 0x7f0a0002 layout/abc_action_menu_item_layout | |
() (file) res/layout/abc_action_menu_item_layout.xml type=XML | |
resource 0x7f0a0003 layout/abc_action_menu_layout | |
() (file) res/layout/abc_action_menu_layout.xml type=XML | |
resource 0x7f0a0004 layout/abc_action_mode_bar | |
() (file) res/layout/abc_action_mode_bar.xml type=XML | |
resource 0x7f0a0005 layout/abc_action_mode_close_item_material | |
() (file) res/layout/abc_action_mode_close_item_material.xml type=XML | |
resource 0x7f0a0006 layout/abc_activity_chooser_view | |
() (file) res/layout/abc_activity_chooser_view.xml type=XML | |
resource 0x7f0a0007 layout/abc_activity_chooser_view_list_item | |
() (file) res/layout/abc_activity_chooser_view_list_item.xml type=XML | |
resource 0x7f0a0008 layout/abc_alert_dialog_button_bar_material | |
() (file) res/layout/abc_alert_dialog_button_bar_material.xml type=XML | |
(watch) (file) res/layout-watch-v20/abc_alert_dialog_button_bar_material.xml type=XML | |
(v22) (file) res/layout-v22/abc_alert_dialog_button_bar_material.xml type=XML | |
resource 0x7f0a0009 layout/abc_alert_dialog_material | |
() (file) res/layout/abc_alert_dialog_material.xml type=XML | |
resource 0x7f0a000a layout/abc_alert_dialog_title_material | |
() (file) res/layout/abc_alert_dialog_title_material.xml type=XML | |
(watch) (file) res/layout-watch-v20/abc_alert_dialog_title_material.xml type=XML | |
resource 0x7f0a000b layout/abc_cascading_menu_item_layout | |
() (file) res/layout/abc_cascading_menu_item_layout.xml type=XML | |
resource 0x7f0a000c layout/abc_dialog_title_material | |
() (file) res/layout/abc_dialog_title_material.xml type=XML | |
resource 0x7f0a000d layout/abc_expanded_menu_layout | |
() (file) res/layout/abc_expanded_menu_layout.xml type=XML | |
resource 0x7f0a000e layout/abc_list_menu_item_checkbox | |
() (file) res/layout/abc_list_menu_item_checkbox.xml type=XML | |
resource 0x7f0a000f layout/abc_list_menu_item_icon | |
() (file) res/layout/abc_list_menu_item_icon.xml type=XML | |
resource 0x7f0a0010 layout/abc_list_menu_item_layout | |
() (file) res/layout/abc_list_menu_item_layout.xml type=XML | |
resource 0x7f0a0011 layout/abc_list_menu_item_radio | |
() (file) res/layout/abc_list_menu_item_radio.xml type=XML | |
resource 0x7f0a0012 layout/abc_popup_menu_header_item_layout | |
() (file) res/layout/abc_popup_menu_header_item_layout.xml type=XML | |
resource 0x7f0a0013 layout/abc_popup_menu_item_layout | |
() (file) res/layout/abc_popup_menu_item_layout.xml type=XML | |
resource 0x7f0a0014 layout/abc_screen_content_include | |
() (file) res/layout/abc_screen_content_include.xml type=XML | |
resource 0x7f0a0015 layout/abc_screen_simple | |
() (file) res/layout/abc_screen_simple.xml type=XML | |
resource 0x7f0a0016 layout/abc_screen_simple_overlay_action_mode | |
() (file) res/layout/abc_screen_simple_overlay_action_mode.xml type=XML | |
resource 0x7f0a0017 layout/abc_screen_toolbar | |
() (file) res/layout/abc_screen_toolbar.xml type=XML | |
(v26) (file) res/layout-v26/abc_screen_toolbar.xml type=XML | |
resource 0x7f0a0018 layout/abc_search_dropdown_item_icons_2line | |
() (file) res/layout/abc_search_dropdown_item_icons_2line.xml type=XML | |
resource 0x7f0a0019 layout/abc_search_view | |
() (file) res/layout/abc_search_view.xml type=XML | |
resource 0x7f0a001a layout/abc_select_dialog_material | |
() (file) res/layout/abc_select_dialog_material.xml type=XML | |
resource 0x7f0a001b layout/abc_tooltip | |
() (file) res/layout/abc_tooltip.xml type=XML | |
resource 0x7f0a001c layout/activity_main | |
() (file) res/layout/activity_main.xml type=XML | |
resource 0x7f0a001d layout/custom_dialog | |
() (file) res/layout/custom_dialog.xml type=XML | |
resource 0x7f0a001e layout/notification_action | |
() (file) res/layout-v21/notification_action.xml type=XML | |
resource 0x7f0a001f layout/notification_action_tombstone | |
() (file) res/layout-v21/notification_action_tombstone.xml type=XML | |
resource 0x7f0a0020 layout/notification_template_custom_big | |
() (file) res/layout-v21/notification_template_custom_big.xml type=XML | |
resource 0x7f0a0021 layout/notification_template_icon_group | |
() (file) res/layout-v21/notification_template_icon_group.xml type=XML | |
resource 0x7f0a0022 layout/notification_template_part_chronometer | |
() (file) res/layout/notification_template_part_chronometer.xml type=XML | |
resource 0x7f0a0023 layout/notification_template_part_time | |
() (file) res/layout/notification_template_part_time.xml type=XML | |
resource 0x7f0a0024 layout/select_dialog_item_material | |
() (file) res/layout/select_dialog_item_material.xml type=XML | |
resource 0x7f0a0025 layout/select_dialog_multichoice_material | |
() (file) res/layout/select_dialog_multichoice_material.xml type=XML | |
resource 0x7f0a0026 layout/select_dialog_singlechoice_material | |
() (file) res/layout/select_dialog_singlechoice_material.xml type=XML | |
resource 0x7f0a0027 layout/support_simple_spinner_dropdown_item | |
() (file) res/layout/support_simple_spinner_dropdown_item.xml type=XML | |
type mipmap id=0b entryCount=2 | |
resource 0x7f0b0000 mipmap/ic_launcher | |
(mdpi) (file) res/mipmap-mdpi-v4/ic_launcher.png type=PNG | |
(hdpi) (file) res/mipmap-hdpi-v4/ic_launcher.png type=PNG | |
(xhdpi) (file) res/mipmap-xhdpi-v4/ic_launcher.png type=PNG | |
(xxhdpi) (file) res/mipmap-xxhdpi-v4/ic_launcher.png type=PNG | |
(xxxhdpi) (file) res/mipmap-xxxhdpi-v4/ic_launcher.png type=PNG | |
(anydpi-v26) (file) res/mipmap-anydpi-v26/ic_launcher.xml type=XML | |
resource 0x7f0b0001 mipmap/ic_launcher_round | |
(mdpi) (file) res/mipmap-mdpi-v4/ic_launcher_round.png type=PNG | |
(hdpi) (file) res/mipmap-hdpi-v4/ic_launcher_round.png type=PNG | |
(xhdpi) (file) res/mipmap-xhdpi-v4/ic_launcher_round.png type=PNG | |
(xxhdpi) (file) res/mipmap-xxhdpi-v4/ic_launcher_round.png type=PNG | |
(xxxhdpi) (file) res/mipmap-xxxhdpi-v4/ic_launcher_round.png type=PNG | |
(anydpi-v26) (file) res/mipmap-anydpi-v26/ic_launcher_round.xml type=XML | |
type string id=0c entryCount=30 | |
resource 0x7f0c0000 string/abc_action_bar_home_description | |
() "Navigate home" | |
(ca) "Navega a la pàgina d'inici" | |
(da) "Find hjem" | |
(fa) "┘¥█î┘àϺ█îÏ┤ Ï¿┘ç ÏÁ┘üÏ¡┘ç ϺÏÁ┘ä█î" | |
(ja) "ÒâøÒâ╝ÒâáÒü½µê╗Òéï" | |
(ka) "ßâøßâùßâÉßâòßâÉßâáßâûßâö ßâÆßâÉßâôßâÉßâíßâòßâÜßâÉ" | |
(pa) "Ó¿╣Ó®ïÓ¿« 'Ó¿ñÓ®ç Ó¿£Ó¿¥Ó¿ô" | |
(ta) "Ó««Ó»üÓ«òÓ«¬Ó»ìÓ«¬Ó«┐Ó«▒Ó»ìÓ«òÓ»üÓ«ÜÓ»ì Ó«ÜÓ»åÓ«▓Ó»ìÓ«▓Ó»üÓ««Ó»ì" | |
(nb) "Naviger hjem" | |
(be) "ðƒðÁÐÇð░ð╣ÐüÐåÐû ð¢ð░ ð│ð░ð╗ð¥Ð×ð¢ÐâÐÄ ÐüÐéð░ÐÇð¥ð¢ð║Ðâ" | |
(de) "Zur Startseite" | |
(ne) "ÓñùÓÑâÓñ╣ Óñ¬ÓÑâÓñÀÓÑìÓñáÓñ«Óñ¥ Óñ£Óñ¥Óñ¿ÓÑüÓñ╣ÓÑïÓñ©ÓÑì" | |
(te) "Ó░╣Ó▒ïÓ░«Ó▒ìÔÇîÓ░òÓ▒ü Ó░¿Ó░¥Ó░ÁÓ░┐Ó░ùÓ▒çÓ░ƒÓ▒ì Ó░ÜÓ▒çÓ░©Ó▒ìÓ░ñÓ▒üÓ░éÓ░ªÓ░┐" | |
(af) "Gaan na tuisskerm" | |
(bg) "ðØð░ð▓ð©ð│ð©ÐÇð░ð¢ðÁ ð║Ðèð╝ ð¢ð░Ðçð░ð╗ð¢ð©ÐÅ ðÁð║ÐÇð░ð¢" | |
(th) "Ó©ÖÓ©│Ó©ùÓ©▓Ó©çÓ╣äÓ©øÓ©½Ó©ÖÓ╣ëÓ©▓Ó╣üÓ©úÓ©ü" | |
(fi) "Siirry etusivulle" | |
(hi) "Óñ╣ÓÑïÓñ« Óñ¬ÓÑçÓñ£ Óñ¬Óñ░ Óñ£Óñ¥ÓñÅÓñé" | |
(si) "Ó©ÓÀöÓ¢ÓÀè ÓÂ┤ÓÀÆÓºÓÀöÓÀÇÓº ÓÀâÓÂéÓÂáÓÀÅÓ¢ÓÂ▒ÓÂ║ ÓÂÜÓÂ╗ÓÂ▒ÓÀèÓÂ▒" | |
(vi) "Chß╗ë ─æã░ß╗Øng vß╗ü nh├á" | |
(kk) "ðØðÁð│ÐûðÀð│Ðû ð▒ðÁÐéð║ðÁ Ë®ÐéÐâ" | |
(mk) "ðöð▓ð©ðÂð© ÐüðÁ ð║ð¥ð¢ ð┤ð¥ð╝ð░" | |
(sk) "Prejsť na plochu" | |
(uk) "ðƒðÁÐÇðÁð╣Ðéð© ð¢ð░ ð│ð¥ð╗ð¥ð▓ð¢Ðâ" | |
(el) "╬á╬╗╬┐╬«╬│╬À¤â╬À ¤â¤ä╬À╬¢ ╬▒¤ü¤ç╬╣╬║╬« ¤â╬Á╬╗╬»╬┤╬▒" | |
(gl) "Vai ao inicio" | |
(ml) "Ó┤╣ÓÁïÓ┤«Ó┤┐Ó┤▓ÓÁçÓ┤òÓÁìÓ┤òÓÁì Ó┤¬ÓÁïÓ┤ÁÓÁüÓ┤ò" | |
(nl) "Navigeren naar startpositie" | |
(pl) "Przejdź na stronę główną" | |
(sl) "Krmarjenje na za─ìetek" | |
(tl) "Mag-navigate sa home" | |
(am) "ßêÿßèÉßê╗ ßï│ßêÁßêÁ" | |
(km) "ÔÇïß×æßƒàß×æßƒåß×û߃Éß×Üß×èß×¥ß×ÿ" | |
(bn) "Óª╣ÓºïÓª«Óºç Óª¿ÓºçÓª¡Óª┐ÓªùÓºçÓªƒ ÓªòÓª░ÓºüÓª¿" | |
(in) "Tunjukkan jalan ke rumah" | |
(kn) "Ó▓╣Ó│ïÓ▓«Ó│ìÔÇîÓ▓ùÓ│å Ó▓¿Ó│ìÓ▓»Ó▓¥Ó▓ÁÓ▓┐Ó▓ùÓ│çÓ▓ƒÓ│ì Ó▓«Ó▓¥Ó▓íÓ▓┐" | |
(mn) "ðØÊ»Ê»ÐÇ ÐàÐâÐâð┤ð░Ðü ÐâÐÇÐâÐâ Ðêð©ð╗ðÂð©Ðà" | |
(ko) "ÝÖêý£╝Ùí£ ýØ┤ÙÅÖ" | |
(lo) "Ó║üÓ║▒Ó║ÜÓ╗äÓ║øÓ╗£Ó╗ëÓ║▓Ó║½Ó║╝Ó║▒Ó║ü" | |
(ro) "Naviga╚øi la ecranul de pornire" | |
(sq) "Orientohu për në shtëpi" | |
(ar) "Ϻ┘äϬ┘êϼ┘ç ÏÑ┘ä┘ë Ϻ┘ä┘à┘åÏ▓┘ä" | |
(fr) "Revenir à l'accueil" | |
(hr) "Idi na po─ìetnu" | |
(mr) "ÓñÿÓñ░Óñ¥ÓñòÓñíÓÑç Óñ¿ÓÑçÓñÁÓÑìÓñ╣Óñ┐ÓñùÓÑçÓñƒ ÓñòÓñ░Óñ¥" | |
(or) "Ó¼╣Ó¡ïÓ¼«Ó¡ì Ó¼¬Ó¡çÓ¼£Ó¡ìÔÇîÓ¼òÓ¡ü Ó¼¿Ó¡çÓ¼¡Ó¼┐Ó¼ùÓ¡çÓ¼ƒÓ¡ì Ó¼òÓ¼░Ó¼¿Ó¡ìÓ¼ñÓ¡ü" | |
(sr) "ðÿð┤ð©ÐéðÁ ð¢ð░ ð┐ð¥ÐçðÁÐéð¢Ðâ" | |
(b+sr+Latn) "Idite na po─ìetnu" | |
(tr) "Eve gidi┼ƒ yolunu g├Âster" | |
(ur) "┌»┌¥Ï▒ ┌®█î ÏÀÏ▒┘ü ┘å█î┘ê█î┌»█î┘╣ ┌®Ï▒█î┌║" | |
(as) "ÓªùÓºâÓª╣ Óª¬ÓºâÓªÀÓºìÓªáÓª¥Óª▓Óºê Óª»Óª¥ÓªôÓªò" | |
(bs) "Vratite se na po─ìetnu stranicu" | |
(cs) "Přejít na plochu" | |
(es) "Ir a inicio" | |
(is) "Fara heim" | |
(ms) "Navigasi laman utama" | |
(et) "Liigu avalehele" | |
(it) "Portami a casa" | |
(lt) "Eiti ─» pagrindin─» puslap─»" | |
(pt) "Navegar para a página inicial" | |
(eu) "Joan orri nagusira" | |
(gu) "Ó¬ÿÓ¬░Ó¬¿Ó½ï Ó¬░Ó¬©Ó½ìÓ¬ñÓ½ï Ó¬¼Ó¬ñÓ¬¥Ó¬ÁÓ½ï" | |
(hu) "Ugrás a főoldalra" | |
(ru) "ðƒðÁÐÇðÁð╣Ðéð© ð¢ð░ ð│ð╗ð░ð▓ð¢Ðïð╣ Ðìð║ÐÇð░ð¢" | |
(zu) "Zulazulela ekhaya" | |
(lv) "P─ürvietoties uz s─ükuma ekr─ünu" | |
(sv) "Navigera hem" | |
(iw) "ÎáÎÖÎòÎòÎÿ ΣÎôÎú ÎöÎæÎÖά" | |
(sw) "Nenda mwanzo" | |
(hy) "È▒ıÂÍüıÂıÑı¼ ıúı¼ı¡ıíı¥ı©ÍÇ ıºı╗" | |
(ky) "ðæð░Ðêð║Ðï ð▒ðÁÐéð║ðÁ Ðçð░ð▒ÐïÐéÐéð¥ð¥" | |
(my) "ßÇÖßÇ░ßÇ£ßÇößÇ▒ßÇøßǼßÇÇßÇ¡ßÇ» ßÇòßÇ╝ßÇößÇ║ßÇ×ßÇ¢ßǼßÇ©ßÇøßÇößÇ║" | |
(az) "ãÅsas s╔Öhif╔Öy╔Ö ke├ºin" | |
(uz) "Boshiga oÔÇÿtish" | |
(en-rCA) "Navigate home" | |
(fr-rCA) "Revenir à l'accueil" | |
(en-rGB) "Navigate home" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄNavigate homeÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "þÇÅÞª¢õ©╗Úáü" | |
(zh-rCN) "Þ¢¼Õê░ÚªûÚíÁ" | |
(en-rIN) "Navigate home" | |
(pt-rBR) "Navegar para a página inicial" | |
(es-rUS) "Navegar a la página principal" | |
(pt-rPT) "Navegar para casa" | |
(en-rAU) "Navigate home" | |
(zh-rTW) "þÇÅÞª¢ÚªûÚáü" | |
resource 0x7f0c0001 string/abc_action_bar_up_description | |
() "Navigate up" | |
(ca) "Navega cap amunt" | |
(da) "Gå op" | |
(fa) "Ï▒┘üϬ┘å Ï¿┘ç ϿϺ┘äϺ" | |
(ja) "ÕëìÒü½µê╗Òéï" | |
(ka) "ßâûßâößâøßâØßâù ßâÆßâÉßâôßâÉßâíßâòßâÜßâÉ" | |
(pa) "Ó¿ëÓ®▒Ó¿¬Ó¿░ Ó¿£Ó¿¥Ó¿ô" | |
(ta) "Ó««Ó»çÓ«▓Ó»ç Ó«ÜÓ»åÓ«▓Ó»ìÓ«▓Ó»üÓ««Ó»ì" | |
(nb) "Gå opp" | |
(be) "ðƒðÁÐÇð░ð╣ÐüÐåÐû Ð×ð▓ðÁÐÇÐà" | |
(de) "Nach oben" | |
(ne) "Óñ«Óñ¥ÓñÑÓñ┐ Óñ¿ÓÑçÓñ¡Óñ┐ÓñùÓÑçÓñƒ ÓñùÓñ░ÓÑìÓñ¿ÓÑüÓñ╣ÓÑïÓñ©ÓÑì" | |
(te) "Ó░¬Ó▒êÓ░òÓ░┐ Ó░¿Ó░¥Ó░ÁÓ░┐Ó░ùÓ▒çÓ░ƒÓ▒ì Ó░ÜÓ▒çÓ░©Ó▒ìÓ░ñÓ▒üÓ░éÓ░ªÓ░┐" | |
(af) "Gaan op" | |
(bg) "ðØð░ð▓ð©ð│ð©ÐÇð░ð¢ðÁ ð¢ð░ð│ð¥ÐÇðÁ" | |
(th) "Ó©üÓ©ÑÓ©▒Ó©Ü" | |
(fi) "Siirry yl├Âs" | |
(hi) "ÓñÁÓñ¥Óñ¬Óñ© Óñ£Óñ¥ÓñÅÓñé" | |
(si) "ÓÂëÓÀäÓÀàÓº ÓÀâÓÂéÓÂáÓÀÅÓ¢ÓÂ▒ÓÂ║ ÓÂÜÓÂ╗ÓÂ▒ÓÀèÓÂ▒" | |
(vi) "Di chuyển lên" | |
(kk) "ðûð¥Êôð░ÐÇÐï Êøð░ÐÇð░ð╣ Ë®ÐéÐâ" | |
(mk) "ðöð▓ð©ðÂð© ÐüðÁ ð¢ð░ð│ð¥ÐÇðÁ" | |
(sk) "Prejsť nahor" | |
(uk) "ðƒðÁÐÇðÁð╣Ðéð© ð▓ð│ð¥ÐÇÐâ" | |
(el) "╬á╬╗╬┐╬«╬│╬À¤â╬À ¤Ç¤ü╬┐¤é ¤ä╬▒ ╬Á¤Ç╬¼╬¢¤ë" | |
(gl) "Vai cara arriba" | |
(ml) "Ó┤«ÓÁüÓ┤òÓ┤│Ó┤┐Ó┤▓ÓÁçÓ┤òÓÁìÓ┤òÓÁì Ó┤¬ÓÁïÓ┤ÁÓÁüÓ┤ò" | |
(nl) "Omhoog navigeren" | |
(pl) "Przejd┼║ wy┼╝ej" | |
(sl) "Pomik navzgor" | |
(tl) "Mag-navigate pataas" | |
(am) "ßïêßï░ ßêïßï¡ ßï½ßêÁßê▒" | |
(km) "ß×Ü߃åß×Çß×Àß×øß×íß×¥ß×äß×øß×¥" | |
(bn) "ÓªëÓª¬Óª░Óºç Óª¿ÓºçÓª¡Óª┐ÓªùÓºçÓªƒ ÓªòÓª░ÓºüÓª¿" | |
(in) "Kembali ke atas" | |
(kn) "Ó▓«Ó│çÓ▓▓Ó▓òÓ│ìÓ▓òÓ│å Ó▓¿Ó│ìÓ▓»Ó▓¥Ó▓ÁÓ▓┐Ó▓ùÓ│çÓ▓ƒÓ│ì Ó▓«Ó▓¥Ó▓íÓ▓┐" | |
(mn) "ðöÐìÐìÐê Ðêð©ð╗ðÂð©Ðà" | |
(ko) "ý£äÙí£ ýØ┤ÙÅÖ" | |
(lo) "Ó╗ÇÓ║ÑÓ║ÀÓ╗êÓ║¡Ó║ÖÓ║éÓ║ÂÓ╗ëÓ║ÖÓ╗ÇÓ║ùÓ║┤Ó║ç" | |
(ro) "Naviga╚øi ├«n sus" | |
(sq) "Ngjitu lart" | |
(ar) "Ϻ┘äϬ┘å┘é┘ä ÏÑ┘ä┘ë ÏúÏ╣┘ä┘ë" | |
(fr) "Revenir en haut de la page" | |
(hr) "Natrag" | |
(mr) "ÓñÁÓñ░ Óñ¿ÓÑçÓñÁÓÑìÔÇìÓñ╣Óñ┐ÓñùÓÑçÓñƒ ÓñòÓñ░Óñ¥" | |
(or) "Ó¼ëÓ¼¬Ó¼░Ó¼òÓ¡ü Ó¼¿Ó¡çÓ¼¡Ó¼┐Ó¼ùÓ¡çÓ¼ƒÓ¡ì Ó¼òÓ¼░Ó¼¿Ó¡ìÓ¼ñÓ¡ü" | |
(sr) "ðÿð┤ð©ÐéðÁ ð¢ð░ð│ð¥ÐÇðÁ" | |
(b+sr+Latn) "Idite nagore" | |
(tr) "Yukar─▒ git" | |
(ur) "Ϻ┘ê┘¥Ï▒ ┘å█î┘ê█î┌»█î┘╣ ┌®Ï▒█î┌║" | |
(as) "ÓªôÓª¬Óº░Óª▓Óºê Óª»Óª¥ÓªôÓªò" | |
(bs) "Idi gore" | |
(cs) "Přejít nahoru" | |
(es) "Desplazarse hacia arriba" | |
(is) "Fara upp" | |
(ms) "Navigasi ke atas" | |
(et) "Liigu ├╝les" | |
(it) "Torna indietro" | |
(lt) "Naršyti aukštyn" | |
(pt) "Navegar para cima" | |
(eu) "Joan gora" | |
(gu) "Ó¬ëÓ¬¬Ó¬░ Ó¬¿Ó½àÓ¬ÁÓ¬┐Ó¬ùÓ½çÓ¬ƒ Ó¬òÓ¬░Ó½ï" | |
(hu) "Fel" | |
(ru) "ðƒðÁÐÇðÁð╣Ðéð© ð▓ð▓ðÁÐÇÐà" | |
(zu) "Zulazulela phezulu" | |
(lv) "Pārvietoties uz augšu" | |
(sv) "Navigera uppåt" | |
(iw) "ÎáÎÖÎòÎòÎÿ ΣÎ×ÎóΣÎö" | |
(sw) "Sogeza juu" | |
(hy) "È▒ıÂÍüıÂıÑı¼ ı¥ıÑÍÇÍç" | |
(ky) "ð£ÐâÐÇÐâð¢ð║Ðâ Ðìð║ÐÇð░ð¢ð│ð░ Ë®Ðéʻʻ" | |
(my) "ßÇíßÇòßÇ▒ßǽßÇ║ßÇ×ßÇ¡ßÇ»ßÇÀ ßÇøßÇ¢ßÇ¥ßÇ▒ßÇÀßÇøßÇößÇ║" | |
(az) "Yuxarı keçin" | |
(uz) "Yopish" | |
(en-rCA) "Navigate up" | |
(fr-rCA) "Revenir en arrière" | |
(en-rGB) "Navigate up" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄNavigate upÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "ÕÉæõ©èþÇÅÞª¢" | |
(zh-rCN) "Þ¢¼Õê░õ©èõ©ÇÕ▒éþ║º" | |
(en-rIN) "Navigate up" | |
(pt-rBR) "Navegar para cima" | |
(es-rUS) "Navegar hacia arriba" | |
(pt-rPT) "Navegar para cima" | |
(en-rAU) "Navigate up" | |
(zh-rTW) "ÕÉæõ©èþÇÅÞª¢" | |
resource 0x7f0c0002 string/abc_action_menu_overflow_description | |
() "More options" | |
(ca) "M├®s opcions" | |
(da) "Flere valgmuligheder" | |
(fa) "┌»Ï▓█î┘å┘çÔÇî┘çϺ█î Ï¿█îÏ┤ϬÏ▒" | |
(ja) "ÒüØÒü«õ╗ûÒü«Òé¬ÒâùÒéÀÒâºÒâ│" | |
(ka) "სხვა ვარიანტები" | |
(pa) "Ó¿╣Ó®ïÓ¿░ Ó¿ÁÓ¿┐Ó¿òÓ¿▓Ó¿¬" | |
(ta) "Ó««Ó»çÓ«▓Ó»üÓ««Ó»ì Ó«ÁÓ«┐Ó«░Ó»üÓ«¬Ó»ìÓ«¬Ó«ÖÓ»ìÓ«òÓ«│Ó»ì" | |
(nb) "Flere alternativer" | |
(be) "ðöð░ð┤ð░Ðéð║ð¥ð▓ÐïÐÅ ð┐ð░ÐÇð░ð╝ðÁÐéÐÇÐï" | |
(de) "Weitere Optionen" | |
(ne) "ÓñÑÓñ¬ ÓñÁÓñ┐ÓñòÓñ▓ÓÑìÓñ¬Óñ╣Óñ░ÓÑé" | |
(te) "Ó░«Ó░░Ó░┐Ó░¿Ó▒ìÓ░¿Ó░┐ Ó░ÄÓ░éÓ░¬Ó░┐Ó░òÓ░▓Ó▒ü" | |
(af) "Nog opsies" | |
(bg) "ð×ÐëðÁ ð¥ð┐Ðåð©ð©" | |
(th) "Ó©òÓ©▒Ó©ºÓ╣ÇÓ©ÑÓ©ÀÓ©¡Ó©üÓ©¡Ó©ÀÓ╣êÓ©Ö" | |
(fi) "Lisäasetukset" | |
(hi) "Óñ£Óñ╝ÓÑìÓñ»Óñ¥ÓñªÓñ¥ ÓñÁÓñ┐ÓñòÓñ▓ÓÑìÓñ¬" | |
(si) "Ó¡ÓÀÇÓ¡ÓÀè ÓÀÇÓÀÆÓÂÜÓ¢ÓÀèÓÂ┤" | |
(vi) "Tùy chọn khác" | |
(kk) "ðæð░ÐüÊøð░ ð¥ð┐Ðåð©ÐÅð╗ð░ÐÇ" | |
(mk) "ðƒð¥ð▓ðÁУðÁ ð¥ð┐Ðåð©ð©" | |
(sk) "Ďalšie moŝnosti" | |
(uk) "ðæÐûð╗ÐîÐêðÁ ð¥ð┐ÐåÐûð╣" | |
(el) "╬á╬Á¤ü╬╣¤â¤â¤î¤ä╬Á¤ü╬Á¤é ╬Á¤Ç╬╣╬╗╬┐╬│╬¡¤é" | |
(gl) "Máis opcións" | |
(ml) "Ó┤òÓÁéÓ┤ƒÓÁüÓ┤ñÓÁ¢ Ó┤ôÓ┤¬ÓÁìÓ┤ÀÓ┤¿ÓÁüÓ┤òÓÁ¥" | |
(nl) "Meer opties" | |
(pl) "Wi─Öcej opcji" | |
(sl) "Več moŝnosti" | |
(tl) "Higit pang opsyon" | |
(am) "ßë░ßî¿ßêøßê¬ ßèáßêøßê½ßî«ßë¢" | |
(km) "ß×çß×ÿ߃Æß×Üß×¥ß׃ß×à߃Æß×Üß×¥ß×ôß×æßƒÇß×Å" | |
(bn) "ÓªåÓª░Óªô Óª¼Óª┐ÓªòÓª▓ÓºìÓª¬" | |
(in) "Opsi lain" | |
(kn) "Ó▓çÓ▓¿Ó│ìÓ▓¿Ó▓ÀÓ│ìÓ▓ƒÓ│ü Ó▓åÓ▓»Ó│ìÓ▓òÓ│åÓ▓ùÓ▓│Ó│ü" | |
(mn) "ðæÐâÐüð░ð┤ Ðüð¥ð¢ð│ð¥ð╗Ðé" | |
(ko) "ýÂöÛ░Ç ýÿÁýàÿ" | |
(lo) "Ó║òÓ║╗Ó║ºÓ╗ÇÓ║ÑÓ║ÀÓ║¡Ó║üÓ╗ÇÓ║×Ó║ÁÓ╗êÓ║íÓ╗ÇÓ║òÓ║ÁÓ║í" | |
(ro) "Mai multe op╚øiuni" | |
(sq) "Opsione të tjera" | |
(ar) "Ï«┘èϺÏ▒ϺϬ Ïú┘âϽÏ▒" | |
(fr) "Autres options" | |
(hr) "Više opcija" | |
(mr) "ÓñåÓñúÓñûÓÑÇ Óñ¬Óñ░ÓÑìÓñ»Óñ¥Óñ»" | |
(or) "Ó¼àÓ¼ºÓ¼┐Ó¼ò Ó¼¼Ó¼┐Ó¼òÓ¼│Ó¡ìÓ¼¬" | |
(sr) "ðêð¥Ðê ð¥ð┐Ðåð©Ðÿð░" | |
(b+sr+Latn) "Još opcija" | |
(tr) "Diğer seçenekler" | |
(ur) "┘àÏ▓█îÏ» ϺϫϬ█îϺÏ▒ϺϬ" | |
(as) "ÓªàÓªºÓª┐Óªò Óª¼Óª┐ÓªòÓª▓ÓºìÓª¬" | |
(bs) "Više opcija" | |
(cs) "Více moŝností" | |
(es) "Más opciones" | |
(is) "Fleiri valkostir" | |
(ms) "Lagi pilihan" | |
(et) "Rohkem valikuid" | |
(it) "Altre opzioni" | |
(lt) "Daugiau parink─ìi┼│" | |
(pt) "Mais op├º├Áes" | |
(eu) "Aukera gehiago" | |
(gu) "Ó¬ÁÓ¬ºÓ½ü Ó¬ÁÓ¬┐Ó¬òÓ¬▓Ó½ìÓ¬¬Ó½ï" | |
(hu) "Tov├íbbi lehet┼æs├®gek" | |
(ru) "ðòÐëÐæ" | |
(zu) "Ezinye izinketho" | |
(lv) "Citas opcijas" | |
(sv) "Fler alternativ" | |
(iw) "ÎóÎòÎô ÎÉÎñήοÎòÎÖÎòά" | |
(sw) "Chaguo zaidi" | |
(hy) "È▒ıÁı¼ ı¿ıÂı┐ÍÇıíıÂÍäıÂıÑÍÇ" | |
(ky) "ðöð░ð│Ðï ð┐ð░ÐÇð░ð╝ðÁÐéÐÇð╗ðÁÐÇ" | |
(my) "ßÇößÇ▒ßǼßÇÇßÇ║ßÇæßÇòßÇ║ ßÇøßÇ¢ßÇ▒ßÇ©ßÇàßÇøßǼßÇÖßÇ╗ßǼßÇ©" | |
(az) "Digər seçimlər" | |
(uz) "Yana" | |
(en-rCA) "More options" | |
(fr-rCA) "Autres options" | |
(en-rGB) "More options" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄMore optionsÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "µø┤ÕñÜÚü©Úáà" | |
(zh-rCN) "µø┤ÕñÜÚÇëÚí╣" | |
(en-rIN) "More options" | |
(pt-rBR) "Mais op├º├Áes" | |
(es-rUS) "Más opciones" | |
(pt-rPT) "Mais op├º├Áes" | |
(en-rAU) "More options" | |
(zh-rTW) "µø┤ÕñÜÚü©Úáà" | |
resource 0x7f0c0003 string/abc_action_mode_done | |
() "Done" | |
(ca) "Fet" | |
(da) "Udf├©r" | |
(fa) "Ϭ┘àϺ┘à" | |
(ja) "Õ«îõ║å" | |
(ka) "ßâøßâûßâÉßâôßâÉßâÉ" | |
(pa) "Ó¿╣Ó®ï Ó¿ùÓ¿┐Ó¿å" | |
(ta) "Ó««Ó»üÓ«ƒÓ«┐Ó«¿Ó»ìÓ«ñÓ«ñÓ»ü" | |
(nb) "Ferdig" | |
(be) "ðôð░Ðéð¥ð▓ð░" | |
(de) "Fertig" | |
(ne) "Óñ©Óñ«ÓÑìÓñ¬Óñ¿ÓÑìÓñ¿ Óñ¡Óñ»ÓÑï" | |
(te) "Ó░¬Ó▒éÓ░░Ó▒ìÓ░ñÓ░»Ó░┐Ó░éÓ░ªÓ░┐" | |
(af) "Klaar" | |
(bg) "ðôð¥Ðéð¥ð▓ð¥" | |
(th) "Ó╣ÇÓ©¬Ó©úÓ╣çÓ©ê" | |
(fi) "Valmis" | |
(hi) "Óñ╣ÓÑï ÓñùÓñ»Óñ¥" | |
(si) "ÓÂÜÓÀàÓÀÅ" | |
(vi) "Xong" | |
(kk) "ðöð░ð╣Ðïð¢" | |
(mk) "ðôð¥Ðéð¥ð▓ð¥" | |
(sk) "Hotovo" | |
(uk) "ðôð¥Ðéð¥ð▓ð¥" | |
(el) "╬ñ╬¡╬╗╬┐¤é" | |
(gl) "Feito" | |
(ml) "Ó┤¬ÓÁéÓÁ╝Ó┤ñÓÁìÓ┤ñÓ┤┐Ó┤»Ó┤¥Ó┤»Ó┤┐" | |
(nl) "Gereed" | |
(pl) "Gotowe" | |
(sl) "Kon─ìano" | |
(tl) "Tapos na" | |
(am) "ተከናውኗል" | |
(km) "ß×Üß×¢ß×àß×Üß×Âß×øßƒï" | |
(bn) "Óª╣Óª»Óª╝Óºç ÓªùÓºçÓªøÓºç" | |
(in) "Selesai" | |
(kn) "Ó▓«Ó│üÓ▓ùÓ▓┐Ó▓ªÓ▓┐Ó▓ªÓ│å" | |
(mn) "ðæð¥ð╗Ðüð¥ð¢" | |
(ko) "ýÖäÙúî" | |
(lo) "Ó╗üÓ║ÑÓ╗ëÓ║ºÓ╗å" | |
(ro) "Gata" | |
(sq) "U krye" | |
(ar) "Ϭ┘à" | |
(fr) "OK" | |
(hr) "Gotovo" | |
(mr) "Óñ¬ÓÑéÓñ░ÓÑìÓñú ÓñØÓñ¥Óñ▓ÓÑç" | |
(or) "Ó¼╣Ó¡ïÓ¼çÓ¼ùÓ¼▓Ó¼¥" | |
(sr) "ðôð¥Ðéð¥ð▓ð¥" | |
(b+sr+Latn) "Gotovo" | |
(tr) "Bitti" | |
(ur) "█ü┘ê ┌»█îϺ" | |
(as) "Óª©Óª«ÓºìÓª¬Óª¿ÓºìÓª¿ Óª╣ÔÇÖÓª▓" | |
(bs) "Gotovo" | |
(cs) "Hotovo" | |
(es) "Listo" | |
(is) "Loki├░" | |
(ms) "Selesai" | |
(et) "Valmis" | |
(it) "Fine" | |
(lt) "Atlikta" | |
(pt) "Concluído" | |
(eu) "Eginda" | |
(gu) "Ó¬ÑÓ¬ê Ó¬ùÓ¬»Ó½üÓ¬é" | |
(hu) "K├®sz" | |
(ru) "ðôð¥Ðéð¥ð▓ð¥" | |
(zu) "Kwenziwe" | |
(lv) "Gatavs" | |
(sv) "Klar" | |
(iw) "ÎíÎÖÎòÎØ" | |
(sw) "Nimemaliza" | |
(hy) "ıèıíı┐ÍÇıíı¢ı┐ ıº" | |
(ky) "ðæÊ»ÐéÐéÊ»" | |
(my) "ßÇòßÇ╝ßÇ«ßÇ©ßÇòßÇ╝ßÇ«" | |
(az) "Haz─▒rd─▒r" | |
(uz) "OK" | |
(en-rCA) "Done" | |
(fr-rCA) "Termin├®" | |
(en-rGB) "Done" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄDoneÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "Õ«îµêÉ" | |
(zh-rCN) "Õ«îµêÉ" | |
(en-rIN) "Done" | |
(pt-rBR) "Concluído" | |
(es-rUS) "Listo" | |
(pt-rPT) "Concluído" | |
(en-rAU) "Done" | |
(zh-rTW) "Õ«îµêÉ" | |
resource 0x7f0c0004 string/abc_activity_chooser_view_see_all | |
() "See all" | |
(ca) "Mostra-ho tot" | |
(da) "Se alle" | |
(fa) "Ï»█îÏ»┘å ┘ç┘à┘ç" | |
(ja) "ÒüÖÒü╣ÒüªÞí¿þñ║" | |
(ka) "ყველას ნახვა" | |
(pa) "Ó¿©Ó¿¡ Ó¿ªÓ®çÓ¿ûÓ®ï" | |
(ta) "Ó«àÓ«®Ó»êÓ«ñÓ»ìÓ«ñÓ»êÓ«»Ó»üÓ««Ó»ì Ó«òÓ«¥Ó«ƒÓ»ìÓ«ƒÓ»ü" | |
(nb) "Se alle" | |
(be) "ðƒð░ð║ð░ðÀð░ÐåÐî ÐâÐüðÁ" | |
(de) "Alle anzeigen" | |
(ne) "Óñ©Óñ¼ÓÑê Óñ╣ÓÑçÓñ░ÓÑìÓñ¿ÓÑüÓñ╣ÓÑïÓñ©ÓÑì" | |
(te) "Ó░àÓ░¿Ó▒ìÓ░¿Ó▒Ç Ó░ÜÓ▒éÓ░íÓ░éÓ░íÓ░┐" | |
(af) "Sien alles" | |
(bg) "ðƒÐÇðÁð│ð╗ðÁð┤ ð¢ð░ ð▓Ðüð©Ðçð║ð©" | |
(th) "Ó©öÓ©╣Ó©ùÓ©▒Ó╣ëÓ©çÓ©½Ó©íÓ©ö" | |
(fi) "Näytä kaikki" | |
(hi) "Óñ©Óñ¡ÓÑÇ ÓñªÓÑçÓñûÓÑçÓñé" | |
(si) "ÓÀâÓÀÆÓÂ║Ó¢ÓÀèÓ¢ ÓÂÂÓ¢ÓÂ▒ÓÀèÓÂ▒" | |
(vi) "Xem tất cả" | |
(kk) "ðæð░ÐÇð╗ÐïÊôÐïð¢ ð║Ë®ÐÇÐâ" | |
(mk) "ðƒÐÇð©ð║ð░ðÂð© ð│ð© Ðüð©ÐéðÁ" | |
(sk) "Zobraziť všetky" | |
(uk) "ðƒð¥ð║ð░ðÀð░Ðéð© ð▓ÐüÐû" | |
(el) "╬ò╬╝¤å╬¼╬¢╬╣¤â╬À ¤î╬╗¤ë╬¢" | |
(gl) "Ver todo" | |
(ml) "Ó┤ÄÓ┤▓ÓÁìÓ┤▓Ó┤¥Ó┤é Ó┤òÓ┤¥Ó┤úÓÁüÓ┤ò" | |
(nl) "Alles weergeven" | |
(pl) "Poka┼╝ wszystko" | |
(sl) "Pokaŝi vse" | |
(tl) "Tingnan lahat" | |
(am) "ßêüßêëßèòßêØ ßï¡ßêÿßêìßè¿ßë▒" | |
(km) "ß×ÿß×¥ß×øß׿ß×Â߃åß×äß×óß׃߃ï" | |
(bn) "Óª©Óª¼ÓªùÓºüÓª▓Óª┐ ÓªªÓºçÓªûÓºüÓª¿" | |
(in) "Lihat semua" | |
(kn) "Ó▓ÄÓ▓▓Ó│ìÓ▓▓Ó▓ÁÓ▓¿Ó│ìÓ▓¿Ó│é Ó▓¿Ó│ïÓ▓íÓ▓┐" | |
(mn) "ðæÊ»ð│ð┤ð©ð╣ð│ Ðàð░ÐÇð░Ðà" | |
(ko) "ýáäý▓┤ Ù│┤Û©░" | |
(lo) "Ó╗ÇÓ║ÜÓ║┤Ó╗êÓ║çÓ║ùÓ║▒Ó║çÓ╗ØÓ║╗Ó║ö" | |
(ro) "Afi╚Öa╚øi tot" | |
(sq) "Shfaq çdo gjë" | |
(ar) "Ï╣Ï▒Ï Ϻ┘ä┘â┘ä" | |
(fr) "Tout afficher" | |
(hr) "Prikaŝi sve" | |
(mr) "Óñ©Óñ░ÓÑìÓñÁ Óñ¬Óñ¥Óñ╣Óñ¥" | |
(or) "Ó¼©Ó¼¼Ó¡ü Ó¼ªÓ¡çÓ¼ûÓ¼¿Ó¡ìÓ¼ñÓ¡ü" | |
(sr) "ðƒÐÇð©ð║ð░ðÂð© Ðüð▓ðÁ" | |
(b+sr+Latn) "Prikaŝi sve" | |
(tr) "T├╝m├╝n├╝ g├Âster" | |
(ur) "Ï│Ï¿┌¥█î Ï»█î┌®┌¥█î┌║" | |
(as) "Óª©ÓªòÓª▓Óºï ÓªÜÓª¥ÓªôÓªò" | |
(bs) "Prikaŝi sve" | |
(cs) "Zobrazit vše" | |
(es) "Ver todo" | |
(is) "Sjá allt" | |
(ms) "Lihat semua" | |
(et) "Kuva k├Áik" | |
(it) "Mostra tutto" | |
(lt) "śr. viską" | |
(pt) "Ver tudo" | |
(eu) "Ikusi guztiak" | |
(gu) "Ó¬¼Ó¬ºÓ½Ç Ó¬£Ó½üÓ¬ô" | |
(hu) "Az ├Âsszes megtekint├®se" | |
(ru) "ðƒð¥ð║ð░ðÀð░ÐéÐî ð▓ÐüðÁ" | |
(zu) "Buka konke" | |
(lv) "Skat─½t visu" | |
(sv) "Visa alla" | |
(iw) "ÎöÎªÎÆÎ¬ ÎöÎøÎòΣ" | |
(sw) "Angalia zote" | |
(hy) "ıÅıÑı¢ıÂıÑı¼ ıóı©ı¼ı©ÍÇı¿" | |
(ky) "ðæð░ð░ÐÇÐïð¢ ð║Ë®ÐÇʻʻ" | |
(my) "ßÇíßǼßÇ©ßÇ£ßÇ»ßÇÂßÇ© ßÇÇßÇ╝ßÇèßÇÀßÇ║ßÇøßÇößÇ║" | |
(az) "Ham─▒s─▒na bax─▒n" | |
(uz) "Hammasi" | |
(en-rCA) "See all" | |
(fr-rCA) "Tout afficher" | |
(en-rGB) "See all" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄSee allÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "µƒÑþ£ïÕà¿Úâ¿" | |
(zh-rCN) "µƒÑþ£ïÕà¿Úâ¿" | |
(en-rIN) "See all" | |
(pt-rBR) "Ver tudo" | |
(es-rUS) "Ver todas" | |
(pt-rPT) "Ver tudo" | |
(en-rAU) "See all" | |
(zh-rTW) "µƒÑþ£ïÕà¿Úâ¿" | |
resource 0x7f0c0005 string/abc_activitychooserview_choose_application | |
() "Choose an app" | |
(ca) "Selecciona una aplicaci├│" | |
(da) "Vælg en app" | |
(fa) "Ϻ┘åϬϫϺϿ Ï¿Ï▒┘åϺ┘à┘ç" | |
(ja) "ÒéóÒâùÒâ¬Òü«Úü©µè×" | |
(ka) "ßâÉßâÿßâáßâ®ßâÿßâößâù ßâÉßâ×ßâÿ" | |
(pa) "Ó¿çÓ®▒Ó¿ò Ó¿ÉÓ¿¬ Ó¿ÜÓ®üÓ¿úÓ®ï" | |
(ta) "Ó«åÓ«¬Ó»ìÓ«©Ó»êÓ«ñÓ»ì Ó«ñÓ»çÓ«░Ó»ìÓ«ÁÓ»üÓ«ÜÓ»åÓ«»Ó»ìÓ«ò" | |
(nb) "Velg en app" | |
(be) "ðÆÐïð▒ðÁÐÇÐïÐåðÁ ð┐ÐÇð░ð│ÐÇð░ð╝Ðâ" | |
(de) "App auswählen" | |
(ne) "ÓñÅÓñëÓñƒÓñ¥ ÓñàÓñ¿ÓÑüÓñ¬ÓÑìÓñ░Óñ»ÓÑïÓñù ÓñøÓñ¥Óñ¿ÓÑìÓñ¿ÓÑüÓñ╣ÓÑïÓñ©ÓÑì" | |
(te) "Ó░»Ó░¥Ó░¬Ó▒ìÔÇîÓ░¿Ó▒ü Ó░ÄÓ░éÓ░ÜÓ▒üÓ░òÓ▒ïÓ░éÓ░íÓ░┐" | |
(af) "Kies 'n program" | |
(bg) "ðÿðÀð▒ðÁÐÇðÁÐéðÁ ð┐ÐÇð©ð╗ð¥ðÂðÁð¢ð©ðÁ" | |
(th) "Ó╣ÇÓ©ÑÓ©ÀÓ©¡Ó©üÓ╣üÓ©¡Ó©ø" | |
(fi) "Valitse sovellus" | |
(hi) "ÓñòÓÑïÓñê ÓñÉÓñ¬ÓÑìÓñ▓Óñ┐ÓñòÓÑçÓñÂÓñ¿ ÓñÜÓÑüÓñ¿ÓÑçÓñé" | |
(si) "ÓÂ║ÓÀÖÓ»ÓÀöÓ©ÓÂÜÓÀè Ó¡ÓÀØÓÂ╗ÓÂ▒ÓÀèÓÂ▒" | |
(vi) "Chß╗ìn mß╗Öt ß╗®ng dß╗Ñng" | |
(kk) "ÊÜð¥ð╗ð┤ð░ð¢ð▒ð░ð¢Ðï Ðéð░Êúð┤ð░Ðâ" | |
(mk) "ðÿðÀð▒ðÁÐÇð© ð░ð┐ð╗ð©ð║ð░Ðåð©Ðÿð░" | |
(sk) "Vybrať aplikáciu" | |
(uk) "ðÆð©ð▒ÐÇð░Ðéð© ð┐ÐÇð¥ð│ÐÇð░ð╝Ðâ" | |
(el) "╬ò¤Ç╬╣╬╗╬¡╬¥¤ä╬Á ╬╝╬╣╬▒ ╬Á¤å╬▒¤ü╬╝╬┐╬│╬«" | |
(gl) "Selecciona unha aplicaci├│n" | |
(ml) "Ó┤åÓ┤¬ÓÁìÓ┤¬ÓÁì Ó┤ñÓ┤┐Ó┤░Ó┤×ÓÁìÓ┤×ÓÁåÓ┤ƒÓÁüÓ┤òÓÁìÓ┤òÓÁüÓ┤ò" | |
(nl) "Een app selecteren" | |
(pl) "Wybierz aplikacj─Ö" | |
(sl) "Izbira aplikacije" | |
(tl) "Pumili ng app" | |
(am) "ßèáßèòßïÁ ßêÿßë░ßîìßëáßê¬ßï½ ßï¡ßêØßê¿ßîí" | |
(km) "ß×ç߃Æß×Üß×¥ß׃ß×Üß×¥ß׃ÔÇïß×Çß×ÿ߃Æß×ÿß×£ß×ÀßׯßשÔÇïÔÇï" | |
(bn) "ÓªÅÓªòÓªƒÓª┐ ÓªàÓºìÓª»Óª¥Óª¬ Óª¼ÓºçÓªøÓºç Óª¿Óª┐Óª¿" | |
(in) "Pilih aplikasi" | |
(kn) "Ó▓åÓ│ìÓ▓»Ó▓¬Ó│ìÔÇîÓ▓ÁÓ│èÓ▓éÓ▓ªÓ▓¿Ó│ìÓ▓¿Ó│ü Ó▓åÓ▓»Ó│ìÓ▓òÓ│åÓ▓«Ó▓¥Ó▓íÓ▓┐" | |
(mn) "ðÉð┐ð┐Ðïð│ Ðüð¥ð¢ð│ð¥Ðà" | |
(ko) "ýò▒ ýäáÝâØ" | |
(lo) "Ó╗ÇÓ║ÑÓ║ÀÓ║¡Ó║üÓ╗üÓ║¡Ó║▒Ó║Ü" | |
(ro) "Alege╚øi o aplica╚øie" | |
(sq) "Zgjidh një aplikacion" | |
(ar) "ϺϫϬ┘èϺÏ▒ ϬÏÀÏ¿┘è┘é" | |
(fr) "S├®lectionner une application" | |
(hr) "Odabir aplikacije" | |
(mr) "ÓñàÔÇìÓÑàÓñ¬ Óñ¿Óñ┐ÓñÁÓñíÓñ¥" | |
(or) "Ó¼ùÓ¡ïÓ¼ƒÓ¼┐ӼŠӼåÓ¼¬Ó¡ìÔÇì Ó¼¼Ó¼¥Ó¼øÓ¼¿Ó¡ìÓ¼ñÓ¡ü" | |
(sr) "ðÿðÀð░ð▒ðÁÐÇð©ÐéðÁ ð░ð┐ð╗ð©ð║ð░Ðåð©ÐÿÐâ" | |
(b+sr+Latn) "Izaberite aplikaciju" | |
(tr) "Bir uygulama seçin" | |
(ur) "Ϻ█î┌® Ϻ█î┘¥ ┘à┘åϬϫϿ ┌®Ï▒█î┌║" | |
(as) "ÓªòÓºïÓª¿Óºï ÓªÅÓª¬Óºì Óª¼Óª¥ÓªøÓª¿Óª┐ ÓªòÓº░Óªò" | |
(bs) "Odaberite aplikaciju" | |
(cs) "Vybrat aplikaci" | |
(es) "Seleccionar una aplicaci├│n" | |
(is) "Veldu forrit" | |
(ms) "Pilih apl" | |
(et) "Valige rakendus" | |
(it) "Scelta di un'app" | |
(lt) "Pasirinkite program─à" | |
(pt) "Selecionar um app" | |
(eu) "Aukeratu aplikazio bat" | |
(gu) "Ó¬ìÓ¬¬Ó½ìÓ¬▓Ó¬┐Ó¬òÓ½çÓ¬ÂÓ¬¿ Ó¬¬Ó¬©Ó¬éÓ¬ª Ó¬òÓ¬░Ó½ï" | |
(hu) "Válasszon alkalmazást" | |
(ru) "ðÆÐïð▒ðÁÐÇð©ÐéðÁ ð┐ÐÇð©ð╗ð¥ðÂðÁð¢ð©ðÁ" | |
(zu) "Khetha insiza" | |
(lv) "Izv─ôlieties lietotni" | |
(sv) "Välj en app" | |
(iw) "ÎæÎùÎÖοά ÎÉÎñΣÎÖκΪÎÖÎö" | |
(sw) "Chagua programu" | |
(hy) "È©ıÂı┐ÍÇıÑı¼ ı░ıíı¥ıÑı¼ı¥ıíı«" | |
(ky) "ðÜð¥ð╗ð┤ð¥ð¢ð╝ð¥ Ðéð░ð¢ð┤ð¥ð¥" | |
(my) "ßÇíßÇÇßÇ║ßÇòßÇ║ßÇÉßÇàßÇ║ßÇüßÇ»ßÇÇßÇ¡ßÇ» ßÇøßÇ¢ßÇ▒ßÇ©ßÇøßÇößÇ║" | |
(az) "Tətbiq seçin" | |
(uz) "Ilovani tanlang" | |
(en-rCA) "Choose an app" | |
(fr-rCA) "S├®lectionner une application" | |
(en-rGB) "Choose an app" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄChoose an appÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "Úü©µôçµçëþö¿þ¿ïÕ╝Å" | |
(zh-rCN) "ÚÇëµï®Õ║öþö¿" | |
(en-rIN) "Choose an app" | |
(pt-rBR) "Selecionar um app" | |
(es-rUS) "Elegir una app" | |
(pt-rPT) "Escolher uma aplicação" | |
(en-rAU) "Choose an app" | |
(zh-rTW) "Úü©µôçµçëþö¿þ¿ïÕ╝Å" | |
resource 0x7f0c0006 string/abc_capital_off | |
() "OFF" | |
(ca) "DESACTIVA" | |
(da) "FRA" | |
(fa) "ϫϺ┘à┘êÏ┤" | |
(ja) "OFF" | |
(ka) "ßâÆßâÉßâøßâØßâáßâùßâòßâÉ" | |
(pa) "Ó¿¼Ó®░Ó¿ª" | |
(ta) "Ó«åÓ«âÓ«¬Ó»ì" | |
(nb) "AV" | |
(be) "ðÆð½ðÜðø." | |
(de) "AUS" | |
(ne) "Óñ¿Óñ┐ÓñÀÓÑìÓñòÓÑìÓñ░Óñ┐Óñ»" | |
(te) "Ó░åÓ░½Ó▒ì" | |
(af) "AF" | |
(bg) "ðÿðùðÜðø." | |
(th) "Ó©øÓ©┤Ó©ö" | |
(fi) "POIS PÄÄLTÄ" | |
(hi) "Óñ¼ÓñéÓñª" | |
(si) "ÓÂÜÓÀèÔÇìÓÂ╗ÓÀÆÓÂ║ÓÀÅÓÀÇÓÀÆÓÂ╗ÓÀäÓÀÆÓ¡ÓÂ║ÓÀÆ" | |
(vi) "TẮT" | |
(kk) "Ë¿ð¿ðåðáðú" | |
(mk) "ðÿðíðÜðøðúðºðòðØð×" | |
(sk) "VYP." | |
(uk) "ðùðØðÿðûðÜðÉ" | |
(el) "╬æ╬á╬ò╬Ø╬ò╬í╬ô╬ƒ╬á╬ƒ╬Ö╬ù╬ú╬ù" | |
(gl) "DESACTIVAR" | |
(ml) "Ó┤ôÓ┤½ÓÁì" | |
(nl) "UIT" | |
(pl) "WYŁ." | |
(sl) "IZKLOP" | |
(tl) "I-OFF" | |
(am) "አጥፋ" | |
(km) "ß×öß×Àß׿" | |
(bn) "Óª¼Óª¿ÓºìÓªº ÓªåÓªøÓºç" | |
(in) "NONAKTIF" | |
(kn) "Ó▓åÓ▓½Ó│ì" | |
(mn) "ðÿðöð¡ðÆðÑðôÊ«ðÖ" | |
(ko) "ýé¼ýÜ® ýñæýºÇ" | |
(lo) "Ó║øÓ║┤Ó║ö" | |
(ro) "DEZACTIVAT" | |
(sq) "JOAKTIV" | |
(ar) "ÏÑ┘è┘éϺ┘ü" | |
(fr) "NON" | |
(hr) "ISKLJU─îENO" | |
(mr) "Óñ¼ÓñéÓñª" | |
(or) "Ó¼àÓ¼½Ó¡ì" | |
(sr) "ðÿðíðÜðëðúðºðòðØð×" | |
(b+sr+Latn) "ISKLJU─îENO" | |
(tr) "KAPAT" | |
(ur) "Ïó┘ü" | |
(as) "ÓªàÓª½" | |
(bs) "ISKLJU─îENO" | |
(cs) "VYP" | |
(es) "DESACTIVADO" | |
(is) "SLÖKKT" | |
(ms) "MATI" | |
(et) "VÄLJAS" | |
(it) "OFF" | |
(lt) "IŠJUNGTI" | |
(pt) "DESATIVADO" | |
(eu) "DESAKTIBATU" | |
(gu) "Ó¬¼Ó¬éÓ¬º" | |
(hu) "KI" | |
(ru) "ðÆð½ðÜðø" | |
(zu) "VALA" | |
(lv) "IZSL─ÆGT" | |
(sv) "AV" | |
(iw) "ÎøÎæÎòÎÖ" | |
(sw) "IMEZIMWA" | |
(hy) "È▒ıåıïÈ▒ıÅÈÁÈ╝" | |
(ky) "Ë¿ðºÊ«ðÜ" | |
(my) "ßÇòßÇ¡ßÇÉßÇ║ßÇøßÇößÇ║" | |
(az) "DEAKT─░V" | |
(uz) "YOQILMAGAN" | |
(en-rCA) "OFF" | |
(fr-rCA) "DÉSACTIVER" | |
(en-rGB) "OFF" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄOFFÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "Úù£Úûë" | |
(zh-rCN) "Õà│Úù¡" | |
(en-rIN) "OFF" | |
(pt-rBR) "DESATIVADO" | |
(es-rUS) "DESACTIVAR" | |
(pt-rPT) "DESATIVADO" | |
(en-rAU) "OFF" | |
(zh-rTW) "Úù£Úûë" | |
resource 0x7f0c0007 string/abc_capital_on | |
() "ON" | |
(ca) "ACTIVA" | |
(da) "TIL" | |
(fa) "Ï▒┘êÏ┤┘å" | |
(ja) "ON" | |
(ka) "ßâ®ßâÉßâáßâùßâòßâÉ" | |
(pa) "Ó¿ÜÓ¿¥Ó¿▓Ó®é" | |
(ta) "Ó«åÓ«®Ó»ì" | |
(nb) "PÅ" | |
(be) "ðúðÜðø." | |
(de) "AN" | |
(ne) "Óñ©ÓñòÓÑìÓñ░Óñ┐Óñ»" | |
(te) "Ó░åÓ░¿Ó▒ì" | |
(af) "AAN" | |
(bg) "ðÆðÜðø." | |
(th) "Ó╣ÇÓ©øÓ©┤Ó©ö" | |
(fi) "PÄÄLLÄ" | |
(hi) "ÓñÜÓñ¥Óñ▓ÓÑé" | |
(si) "ÓÂÜÓÀèÔÇìÓÂ╗ÓÀÆÓÂ║ÓÀÅÓ¡ÓÀèÓ©ÓÂÜÓÂ║ÓÀÆ" | |
(vi) "BẬT" | |
(kk) "ÊÜð×ðíðú" | |
(mk) "ðÆðÜðøðúðºðòðØð×" | |
(sk) "ZAP." | |
(uk) "ðúðÆðåð£ðÜ." | |
(el) "╬ò╬Ø╬ò╬í╬ô╬ƒ╬á╬ƒ╬Ö╬ù╬ú╬ù" | |
(gl) "ACTIVAR" | |
(ml) "Ó┤ôÓÁ║" | |
(nl) "AAN" | |
(pl) "WŁ." | |
(sl) "VKLOP" | |
(tl) "I-ON" | |
(am) "አብራ" | |
(km) "ß×öß×¥ß×Ç" | |
(bn) "ÓªÜÓª¥Óª▓Óºü ÓªòÓª░ÓºüÓª¿" | |
(in) "AKTIF" | |
(kn) "Ó▓åÓ▓¿Ó│ì" | |
(mn) "ðÿðöð¡ðÆðÑðóð¡ðÖ" | |
(ko) "ýé¼ýÜ®" | |
(lo) "Ó╗ÇÓ║øÓ║ÁÓ║ö" | |
(ro) "ACTIVAT" | |
(sq) "AKTIV" | |
(ar) "Ϭ┘üÏ╣┘è┘ä" | |
(fr) "OUI" | |
(hr) "UKLJU─îENO" | |
(mr) "Óñ©ÓÑüÓñ░ÓÑé" | |
(or) "Ó¼àÓ¼¿Ó¡ì" | |
(sr) "ðúðÜðëðúðºðòðØð×" | |
(b+sr+Latn) "UKLJU─îENO" | |
(tr) "AÇ" | |
(ur) "Ïó┘å" | |
(as) "ÓªàÓª¿" | |
(bs) "UKLJU─îENO" | |
(cs) "ZAP" | |
(es) "ACTIVADO" | |
(is) "KVEIKT" | |
(ms) "HIDUP" | |
(et) "SEES" | |
(it) "ON" | |
(lt) "─«JUNGTI" | |
(pt) "ATIVADO" | |
(eu) "AKTIBATU" | |
(gu) "Ó¬ÜÓ¬¥Ó¬▓Ó½ü" | |
(hu) "BE" | |
(ru) "ðÆðÜðø" | |
(zu) "VULA" | |
(lv) "IESL─ÆGT" | |
(sv) "PÅ" | |
(iw) "Î×ÎòÎñÎóΣ" | |
(sw) "IMEWASHWA" | |
(hy) "ıäÈ╗È▒ıæıåÈÁÈ╝" | |
(ky) "ðÜÊ«ðÖÊ«ðÜ" | |
(my) "ßÇûßÇ¢ßÇäßÇÀßÇ║ßÇøßÇößÇ║" | |
(az) "AKT─░V" | |
(uz) "YONIQ" | |
(en-rCA) "ON" | |
(fr-rCA) "ACTIVER" | |
(en-rGB) "ON" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄONÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "ÚûïÕòƒ" | |
(zh-rCN) "Õ╝ÇÕÉ»" | |
(en-rIN) "ON" | |
(pt-rBR) "ATIVADO" | |
(es-rUS) "ACTIVAR" | |
(pt-rPT) "ATIVADO" | |
(en-rAU) "ON" | |
(zh-rTW) "ÚûïÕòƒ" | |
resource 0x7f0c0008 string/abc_menu_alt_shortcut_label | |
() "Alt+" | |
(ca) "Alt+" | |
(da) "Alt+" | |
(fa) "ÔÇÄAlt+ÔÇÄ" | |
(ja) "Alt+" | |
(ka) "Alt+" | |
(pa) "Alt+" | |
(ta) "Alt Ó««Ó«▒Ó»ìÓ«▒Ó»üÓ««Ó»ì" | |
(nb) "Alt+" | |
(be) "Alt +" | |
(de) "Alt +" | |
(ne) "Alt+" | |
(te) "Alt+" | |
(af) "Alt+" | |
(bg) "Alt+" | |
(th) "Alt+" | |
(fi) "Alt+" | |
(hi) "Alt+" | |
(si) "Alt+" | |
(vi) "Alt+" | |
(kk) "Alt+" | |
(mk) "Alt+" | |
(sk) "Alt+" | |
(uk) "Alt+" | |
(el) "Alt+" | |
(gl) "Alt +" | |
(ml) "Alt+" | |
(nl) "Alt +" | |
(pl) "Alt+" | |
(sl) "Alt +" | |
(tl) "Alt+" | |
(am) "Alt+" | |
(km) "Alt+" | |
(bn) "Alt+" | |
(in) "Alt+" | |
(kn) "Alt+" | |
(mn) "Alt+" | |
(ko) "Alt+" | |
(lo) "Alt+" | |
(ro) "Alt+" | |
(sq) "Alt+" | |
(ar) "Alt+" | |
(fr) "Alt+" | |
(hr) "Alt+" | |
(mr) "Alt+" | |
(or) "Alt+" | |
(sr) "Alt+" | |
(b+sr+Latn) "Alt+" | |
(tr) "Alt+" | |
(ur) "Alt+ÔÇÄ" | |
(as) "Alt+" | |
(bs) "Alt+" | |
(cs) "Alt+" | |
(es) "Alt +" | |
(is) "Alt+" | |
(ms) "Alt+" | |
(et) "Alt +" | |
(it) "ALT +" | |
(lt) "ÔÇ×AltÔÇ£ +" | |
(pt) "Alt+" | |
(eu) "Alt +" | |
(gu) "Alt+" | |
(hu) "Alt+" | |
(ru) "Alt +" | |
(zu) "Alt+" | |
(lv) "Alternēšanas taustiņš +" | |
(sv) "Alt + " | |
(iw) "Alt+" | |
(sw) "Alt+" | |
(hy) "Alt+" | |
(ky) "Alt+" | |
(my) "Alt+" | |
(az) "Alt+" | |
(uz) "Alt+" | |
(en-rCA) "Alt+" | |
(fr-rCA) "Alt+" | |
(en-rGB) "Alt+" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄAlt+ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "Alt +" | |
(zh-rCN) "Alt+" | |
(en-rIN) "Alt+" | |
(pt-rBR) "Alt+" | |
(es-rUS) "Alt+" | |
(pt-rPT) "Alt +" | |
(en-rAU) "Alt+" | |
(zh-rTW) "Alt +" | |
resource 0x7f0c0009 string/abc_menu_ctrl_shortcut_label | |
() "Ctrl+" | |
(ca) "Ctrl+" | |
(da) "Ctrl+" | |
(fa) "ÔÇÄCtrl+ÔÇÄ" | |
(ja) "Ctrl+" | |
(ka) "Ctrl+" | |
(pa) "Ctrl+" | |
(ta) "Ctrl Ó««Ó«▒Ó»ìÓ«▒Ó»üÓ««Ó»ì" | |
(nb) "Ctrl+" | |
(be) "Ctrl +" | |
(de) "Strg +" | |
(ne) "Ctrl+" | |
(te) "Ctrl+" | |
(af) "Ctrl+" | |
(bg) "Ctrl+" | |
(th) "Ctrl+" | |
(fi) "Ctrl+" | |
(hi) "Ctrl+" | |
(si) "Ctrl+" | |
(vi) "Ctrl+" | |
(kk) "Ctrl+" | |
(mk) "Ctrl+" | |
(sk) "Ctrl+" | |
(uk) "Ctrl+" | |
(el) "Ctrl+" | |
(gl) "Ctrl +" | |
(ml) "Ctrl+" | |
(nl) "Ctrl +" | |
(pl) "Ctrl+" | |
(sl) "Ctrl +" | |
(tl) "Ctrl+" | |
(am) "Ctrl+" | |
(km) "Ctrl+" | |
(bn) "Ctrl+" | |
(in) "Ctrl+" | |
(kn) "Ctrl+" | |
(mn) "Ctrl+" | |
(ko) "Ctrl+" | |
(lo) "Ctrl+" | |
(ro) "Ctrl+" | |
(sq) "Ctrl+" | |
(ar) "Ctrl+" | |
(fr) "Ctrl+" | |
(hr) "Ctrl+" | |
(mr) "Ctrl+" | |
(or) "Ctrl+" | |
(sr) "Ctrl+" | |
(b+sr+Latn) "Ctrl+" | |
(tr) "Ctrl+" | |
(ur) "Ctrl+ÔÇÄ" | |
(as) "Ctrl+" | |
(bs) "Ctrl+" | |
(cs) "Ctrl+" | |
(es) "Ctrl +" | |
(is) "Ctrl+" | |
(ms) "Ctrl+" | |
(et) "Ctrl +" | |
(it) "CTRL +" | |
(lt) "ÔÇ×CtrlÔÇ£ +" | |
(pt) "Ctrl+" | |
(eu) "Ktrl +" | |
(gu) "Ctrl+" | |
(hu) "Ctrl+" | |
(ru) "Ctrl +" | |
(zu) "Ctrl+" | |
(lv) "Vadīšanas taustiņš +" | |
(sv) "Ctrl + " | |
(iw) "Ctrl+ÔÇÄ" | |
(sw) "Ctrl+" | |
(hy) "Ctrl+" | |
(ky) "Ctrl+" | |
(my) "Ctrl+" | |
(az) "Ctrl+" | |
(uz) "Ctrl+" | |
(en-rCA) "Ctrl+" | |
(fr-rCA) "Ctrl+" | |
(en-rGB) "Ctrl+" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄCtrl+ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "Ctrl +" | |
(zh-rCN) "Ctrl+" | |
(en-rIN) "Ctrl+" | |
(pt-rBR) "Ctrl+" | |
(es-rUS) "Ctrl+" | |
(pt-rPT) "Ctrl +" | |
(en-rAU) "Ctrl+" | |
(zh-rTW) "Ctrl +" | |
resource 0x7f0c000a string/abc_menu_delete_shortcut_label | |
() "delete" | |
(ca) "Supr" | |
(da) "slet" | |
(fa) "Ï¡Ï░┘ü" | |
(ja) "Delete" | |
(ka) "delete" | |
(pa) "Ó¿«Ó¿┐Ó¿ƒÓ¿¥Ó¿ô" | |
(ta) "delete" | |
(nb) "slett" | |
(be) "Delete" | |
(de) "L├Âschen" | |
(ne) "delete" | |
(te) "delete" | |
(af) "delete" | |
(bg) "delete" | |
(th) "Ó©ÑÓ©Ü" | |
(fi) "delete" | |
(hi) "delete" | |
(si) "Ó©ÓÂÜÓÂ▒ÓÀèÓÂ▒" | |
(vi) "delete" | |
(kk) "delete" | |
(mk) "ð©ðÀð▒ÐÇð©Ðêð©" | |
(sk) "odstrániť" | |
(uk) "delete" | |
(el) "delete" | |
(gl) "eliminar" | |
(ml) "Ó┤çÓ┤▓ÓÁìÓ┤▓Ó┤¥Ó┤ñÓ┤¥Ó┤òÓÁìÓ┤òÓÁüÓ┤ò" | |
(nl) "Delete" | |
(pl) "Delete" | |
(sl) "delete" | |
(tl) "delete" | |
(am) "ßê░ßê¡ßïØ" | |
(km) "ß×øß×╗ß×ö" | |
(bn) "Óª«ÓºüÓªøÓºüÓª¿" | |
(in) "delete" | |
(kn) "delete" | |
(mn) "ÐâÐüÐéð│ð░Ðà" | |
(ko) "Delete" | |
(lo) "Ó║ÑÓ║ÂÓ║Ü" | |
(ro) "delete" | |
(sq) "delete" | |
(ar) "Ï¡Ï░┘ü" | |
(fr) "supprimer" | |
(hr) "delete" | |
(mr) "Óñ╣ÓñƒÓñÁÓñ¥" | |
(or) "Ó¼íÓ¼┐Ó¼▓Ó¼┐Ó¼ƒÓ¡ìÔÇì" | |
(sr) "delete" | |
(b+sr+Latn) "delete" | |
(tr) "sil" | |
(ur) "delete" | |
(as) "delete" | |
(bs) "delete" | |
(cs) "delete" | |
(es) "Suprimir" | |
(is) "ey├░a" | |
(ms) "delete" | |
(et) "kustuta" | |
(it) "CANC" | |
(lt) "ÔÇ×deleteÔÇ£" | |
(pt) "delete" | |
(eu) "ezabatu" | |
(gu) "delete" | |
(hu) "Delete" | |
(ru) "Delete" | |
(zu) "delete" | |
(lv) "dzēšanas taustiņš" | |
(sv) "delete" | |
(iw) "Î×ÎùÎÖκÎö" | |
(sw) "delete" | |
(hy) "Delete" | |
(ky) "delete" | |
(my) "delete" | |
(az) "silin" | |
(uz) "Delete" | |
(en-rCA) "delete" | |
(fr-rCA) "supprimer" | |
(en-rGB) "delete" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄdeleteÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "Õê¬ÚÖñ" | |
(zh-rCN) "Delete Úö«" | |
(en-rIN) "delete" | |
(pt-rBR) "delete" | |
(es-rUS) "borrar" | |
(pt-rPT) "eliminar" | |
(en-rAU) "delete" | |
(zh-rTW) "Delete ÚìÁ" | |
resource 0x7f0c000b string/abc_menu_enter_shortcut_label | |
() "enter" | |
(ca) "Retorn" | |
(da) "enter" | |
(fa) "enter" | |
(ja) "Enter" | |
(ka) "enter" | |
(pa) "enter" | |
(ta) "enter" | |
(nb) "enter" | |
(be) "Enter" | |
(de) "Eingabetaste" | |
(ne) "enter" | |
(te) "enter" | |
(af) "enter" | |
(bg) "enter" | |
(th) "Enter" | |
(fi) "enter" | |
(hi) "enter" | |
(si) "enter" | |
(vi) "enter" | |
(kk) "enter" | |
(mk) "Enter" | |
(sk) "enter" | |
(uk) "enter" | |
(el) "enter" | |
(gl) "intro" | |
(ml) "enter" | |
(nl) "Enter" | |
(pl) "Enter" | |
(sl) "enter" | |
(tl) "enter" | |
(am) "enter" | |
(km) "enter" | |
(bn) "enter" | |
(in) "enter" | |
(kn) "enter" | |
(mn) "ð¥ÐÇÐâÐâð╗ð░Ðà" | |
(ko) "Enter" | |
(lo) "enter" | |
(ro) "enter" | |
(sq) "enter" | |
(ar) "enter" | |
(fr) "entr├®e" | |
(hr) "enter" | |
(mr) "ÓñÅÓñéÓñƒÓñ░ ÓñòÓñ░Óñ¥" | |
(or) "Ó¼ÅÓ¼úÓ¡ìÓ¼ƒÓ¼░Ó¡ì" | |
(sr) "enter" | |
(b+sr+Latn) "enter" | |
(tr) "enter" | |
(ur) "enter" | |
(as) "enter" | |
(bs) "enter" | |
(cs) "enter" | |
(es) "Intro" | |
(is) "enter" | |
(ms) "enter" | |
(et) "sisestusklahv" | |
(it) "INVIO" | |
(lt) "ÔÇ×enterÔÇ£" | |
(pt) "enter" | |
(eu) "sartu" | |
(gu) "Enter" | |
(hu) "Enter" | |
(ru) "ðÆð▓ð¥ð┤" | |
(zu) "enter" | |
(lv) "ievadīšanas taustiņš" | |
(sv) "retur" | |
(iw) "Enter" | |
(sw) "enter" | |
(hy) "Enter" | |
(ky) "enter" | |
(my) "enter" | |
(az) "daxil olun" | |
(uz) "Enter" | |
(en-rCA) "enter" | |
(fr-rCA) "entr├®e" | |
(en-rGB) "enter" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄenterÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "Enter ÚìÁ" | |
(zh-rCN) "Enter Úö«" | |
(en-rIN) "enter" | |
(pt-rBR) "enter" | |
(es-rUS) "intro" | |
(pt-rPT) "enter" | |
(en-rAU) "enter" | |
(zh-rTW) "Enter ÚìÁ" | |
resource 0x7f0c000c string/abc_menu_function_shortcut_label | |
() "Function+" | |
(ca) "Funci├│+" | |
(da) "Fn+" | |
(fa) "ÔÇÄFunction+ÔÇÄ" | |
(ja) "Function+" | |
(ka) "Function+" | |
(pa) "Function+" | |
(ta) "Function Ó««Ó«▒Ó»ìÓ«▒Ó»üÓ««Ó»ì" | |
(nb) "Funksjon+" | |
(be) "Fn +" | |
(de) "Funktionstaste +" | |
(ne) "Function+" | |
(te) "Function+" | |
(af) "Funksie+" | |
(bg) "Function+" | |
(th) "Function+" | |
(fi) "Fn+" | |
(hi) "Function+" | |
(si) "Function+" | |
(vi) "Function+" | |
(kk) "Function+" | |
(mk) "Function+" | |
(sk) "Function+" | |
(uk) "Function+" | |
(el) "Function+" | |
(gl) "Funci├│n +" | |
(ml) "Ó┤½Ó┤éÓ┤ùÓÁìÓ┤ÀÓ┤¿ÓÁìÔÇì+" | |
(nl) "Functie +" | |
(pl) "Funkcyjny+" | |
(sl) "Fn +" | |
(tl) "Function+" | |
(am) "Function+" | |
(km) "Function+" | |
(bn) "Function+" | |
(in) "Function+" | |
(kn) "Function+" | |
(mn) "ðñÐâð¢ð║Ðå+" | |
(ko) "Function+" | |
(lo) "Function+" | |
(ro) "Function+" | |
(sq) "Funksioni+" | |
(ar) "Function+" | |
(fr) "Fonction+" | |
(hr) "Function+" | |
(mr) "Function+" | |
(or) "Function+" | |
(sr) "Function+" | |
(b+sr+Latn) "Function+" | |
(tr) "Function+" | |
(ur) "Function+ÔÇÄ" | |
(as) "Function+" | |
(bs) "Function+" | |
(cs) "Fn+" | |
(es) "Función +" | |
(is) "A├░ger├░arlykill+" | |
(ms) "Fungsi+" | |
(et) "Funktsiooniklahv +" | |
(it) "FUNZIONE +" | |
(lt) "ÔÇ×FunctionÔÇ£ +" | |
(pt) "Function+" | |
(eu) "Funtzioa +" | |
(gu) "Function+" | |
(hu) "Function+" | |
(ru) "Fn +" | |
(zu) "Function+" | |
(lv) "Funkcijas taustiņš +" | |
(sv) "Funktion + " | |
(iw) "Function+" | |
(sw) "Function+" | |
(hy) "Function+" | |
(ky) "Function+" | |
(my) "Function+" | |
(az) "Funksiya+" | |
(uz) "Fn+" | |
(en-rCA) "Function+" | |
(fr-rCA) "Fonction+" | |
(en-rGB) "Function+" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄFunction+ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "Fn +" | |
(zh-rCN) "Fn+" | |
(en-rIN) "Function+" | |
(pt-rBR) "Function+" | |
(es-rUS) "Funci├│n+" | |
(pt-rPT) "Função +" | |
(en-rAU) "Function+" | |
(zh-rTW) "Fn +" | |
resource 0x7f0c000d string/abc_menu_meta_shortcut_label | |
() "Meta+" | |
(ca) "Meta+" | |
(da) "Meta+" | |
(fa) "ÔÇÄMeta+ÔÇÄ" | |
(ja) "Meta+" | |
(ka) "Meta+" | |
(pa) "Meta+" | |
(ta) "Meta Ó««Ó«▒Ó»ìÓ«▒Ó»üÓ««Ó»ì" | |
(nb) "Meta+" | |
(be) "Meta +" | |
(de) "Meta-Taste +" | |
(ne) "Meta+" | |
(te) "Meta+" | |
(af) "Meta+" | |
(bg) "Meta+" | |
(th) "Meta+" | |
(fi) "Meta+" | |
(hi) "Meta+" | |
(si) "Meta+" | |
(vi) "Meta+" | |
(kk) "Meta+" | |
(mk) "Meta+" | |
(sk) "Meta+" | |
(uk) "Meta+" | |
(el) "Meta+" | |
(gl) "Meta +" | |
(ml) "Ó┤«ÓÁåÓ┤▒ÓÁìÓ┤▒+" | |
(nl) "Meta +" | |
(pl) "Meta+" | |
(sl) "Meta +" | |
(tl) "Meta+" | |
(am) "Meta+" | |
(km) "Meta+" | |
(bn) "Meta+" | |
(in) "Meta+" | |
(kn) "Meta+" | |
(mn) "ð£ðÁÐéð░+" | |
(ko) "Meta+" | |
(lo) "Meta+" | |
(ro) "Meta+" | |
(sq) "Meta+" | |
(ar) "Meta+" | |
(fr) "M├®ta+" | |
(hr) "Meta+" | |
(mr) "Meta+" | |
(or) "Meta+" | |
(sr) "Meta+" | |
(b+sr+Latn) "Meta+" | |
(tr) "Meta+" | |
(ur) "Meta+ÔÇÄ" | |
(as) "Meta+" | |
(bs) "Meta+" | |
(cs) "Meta+" | |
(es) "Meta +" | |
(is) "Meta+" | |
(ms) "Meta+" | |
(et) "Meta +" | |
(it) "META +" | |
(lt) "ÔÇ×MetaÔÇ£ +" | |
(pt) "Meta+" | |
(eu) "Meta +" | |
(gu) "Meta+" | |
(hu) "Meta+" | |
(ru) "Meta +" | |
(zu) "Meta+" | |
(lv) "Meta taustiņš +" | |
(sv) "Meta + " | |
(iw) "Meta+" | |
(sw) "Meta+" | |
(hy) "Meta+" | |
(ky) "Meta+" | |
(my) "Meta+" | |
(az) "Meta+" | |
(uz) "Meta+" | |
(en-rCA) "Meta+" | |
(fr-rCA) "M├®ta+" | |
(en-rGB) "Meta+" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄMeta+ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "Meta +" | |
(zh-rCN) "Meta+" | |
(en-rIN) "Meta+" | |
(pt-rBR) "Meta+" | |
(es-rUS) "Meta+" | |
(pt-rPT) "Meta +" | |
(en-rAU) "Meta+" | |
(zh-rTW) "Meta +" | |
resource 0x7f0c000e string/abc_menu_shift_shortcut_label | |
() "Shift+" | |
(ca) "Maj+" | |
(da) "Shift+" | |
(fa) "ÔÇÄShift+ÔÇÄ" | |
(ja) "Shift+" | |
(ka) "Shift+" | |
(pa) "Shift+" | |
(ta) "Shift Ó««Ó«▒Ó»ìÓ«▒Ó»üÓ««Ó»ì" | |
(nb) "Shift+" | |
(be) "Shift +" | |
(de) "Umschalttaste +" | |
(ne) "Shift+" | |
(te) "Shift+" | |
(af) "Shift+" | |
(bg) "Shift+" | |
(th) "Shift+" | |
(fi) "Vaihto+" | |
(hi) "Shift+" | |
(si) "Shift+" | |
(vi) "Shift+" | |
(kk) "Shift+" | |
(mk) "Shift+" | |
(sk) "Shift+" | |
(uk) "Shift+" | |
(el) "Shift+" | |
(gl) "Mai├║s +" | |
(ml) "Shift+" | |
(nl) "Shift +" | |
(pl) "Shift+" | |
(sl) "Shift +" | |
(tl) "Shift+" | |
(am) "Shift+" | |
(km) "Shift+" | |
(bn) "Shift+" | |
(in) "Shift+" | |
(kn) "Shift+" | |
(mn) "ð¿ð©ÐäÐé+" | |
(ko) "Shift+" | |
(lo) "Shift+" | |
(ro) "Shift+" | |
(sq) "Shift+" | |
(ar) "Shift+" | |
(fr) "Maj+" | |
(hr) "Shift+" | |
(mr) "Shift+" | |
(or) "Shift+" | |
(sr) "Shift+" | |
(b+sr+Latn) "Shift+" | |
(tr) "Üst Karakter+" | |
(ur) "Shift+ÔÇÄ" | |
(as) "Shift+" | |
(bs) "Shift+" | |
(cs) "Shift+" | |
(es) "Mayús +" | |
(is) "Shift+" | |
(ms) "Shift+" | |
(et) "T├Ástuklahv +" | |
(it) "MAIUSC +" | |
(lt) "ÔÇ×ShiftÔÇ£ +" | |
(pt) "Shift+" | |
(eu) "Maius +" | |
(gu) "Shift+" | |
(hu) "Shift+" | |
(ru) "Shift +" | |
(zu) "Shift+" | |
(lv) "Pārslēgšanas taustiņš +" | |
(sv) "Skift + " | |
(iw) "Shift+" | |
(sw) "Shift+" | |
(hy) "Shift+" | |
(ky) "Shift+" | |
(my) "Shift+" | |
(az) "Shift+" | |
(uz) "Shift+" | |
(en-rCA) "Shift+" | |
(fr-rCA) "Maj+" | |
(en-rGB) "Shift+" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄShift+ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "Shift +" | |
(zh-rCN) "Shift+" | |
(en-rIN) "Shift+" | |
(pt-rBR) "Shift+" | |
(es-rUS) "May├║scula+" | |
(pt-rPT) "Shift +" | |
(en-rAU) "Shift+" | |
(zh-rTW) "Shift +" | |
resource 0x7f0c000f string/abc_menu_space_shortcut_label | |
() "space" | |
(ca) "Espai" | |
(da) "mellemrum" | |
(fa) "┘üϺÏÁ┘ä┘ç" | |
(ja) "Space" | |
(ka) "ßâ¿ßâØßâáßâÿßâíßâÿ" | |
(pa) "space" | |
(ta) "space" | |
(nb) "mellomrom" | |
(be) "ðƒÐÇð░ð▒ðÁð╗" | |
(de) "Leertaste" | |
(ne) "space" | |
(te) "Ó░©Ó▒ìÓ░¬Ó▒çÓ░©Ó▒ì" | |
(af) "spasiebalk" | |
(bg) "ð║ð╗ð░ð▓ð©Ðêð░ ðÀð░ ð©ð¢ÐéðÁÐÇð▓ð░ð╗" | |
(th) "Space" | |
(fi) "v├ñlily├Ânti" | |
(hi) "space" | |
(si) "space" | |
(vi) "space" | |
(kk) "ð▒ð¥Ðü ð¥ÐÇÐïð¢" | |
(mk) "ð▓ÐüðÁð╗ðÁð¢ð░" | |
(sk) "medzerník" | |
(uk) "ð┐ÐÇð¥ð▒Ðûð╗" | |
(el) "╬┤╬╣╬¼¤â¤ä╬À╬╝╬▒" | |
(gl) "espazo" | |
(ml) "Ó┤©ÓÁìÔÇîÓ┤¬ÓÁåÓ┤»ÓÁìÔÇîÓ┤©ÓÁì" | |
(nl) "spatie" | |
(pl) "spacja" | |
(sl) "preslednica" | |
(tl) "space" | |
(am) "ßè¡ßììßë░ßëÁ" | |
(km) "space" | |
(bn) "space" | |
(in) "spasi" | |
(kn) "space" | |
(mn) "ðÀð░ð╣" | |
(ko) "ýèñÝÄÿýØ┤ýèñÙ░ö" | |
(lo) "Ó║ìÓ║░Ó║½Ó║ºÓ╗êÓ║▓Ó║ç" | |
(ro) "space" | |
(sq) "hapësirë" | |
(ar) "┘üÏÂϺÏí" | |
(fr) "espace" | |
(hr) "svemir" | |
(mr) "space" | |
(or) "Ó¼©Ó¡ìÓ¼¬Ó¡çÓ¼©Ó¡ìÔÇì" | |
(sr) "Ðéð░ÐüÐéðÁÐÇ ðÀð░ ÐÇð░ðÀð╝ð░ð║" | |
(b+sr+Latn) "taster za razmak" | |
(tr) "boşluk" | |
(ur) "space" | |
(as) "space" | |
(bs) "razmak" | |
(cs) "mezerník" | |
(es) "Espacio" | |
(is) "bilslá" | |
(ms) "ruang" | |
(et) "t├╝hik" | |
(it) "SPAZIO" | |
(lt) "ÔÇ×spaceÔÇ£" | |
(pt) "espaço" | |
(eu) "zuriunea" | |
(gu) "space" | |
(hu) "Sz├│k├Âz" | |
(ru) "ðƒÐÇð¥ð▒ðÁð╗" | |
(zu) "space" | |
(lv) "atstarpes taustiņš" | |
(sv) "blanksteg" | |
(iw) "οÎòÎòÎù" | |
(sw) "space" | |
(hy) "ıóıíÍüıíı┐" | |
(ky) "ð▒ð¥ÐêÐéÐâð║" | |
(my) "space" | |
(az) "space" | |
(uz) "Probel" | |
(en-rCA) "space" | |
(fr-rCA) "espace" | |
(en-rGB) "space" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄspaceÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "þ®║þÖ¢ÚìÁ" | |
(zh-rCN) "þ®║µá╝Úö«" | |
(en-rIN) "space" | |
(pt-rBR) "espaço" | |
(es-rUS) "espacio" | |
(pt-rPT) "espaço" | |
(en-rAU) "space" | |
(zh-rTW) "þ®║µá╝ÚìÁ" | |
resource 0x7f0c0010 string/abc_menu_sym_shortcut_label | |
() "Sym+" | |
(ca) "Sym+" | |
(da) "Sym+" | |
(fa) "ÔÇÄSym+ÔÇÄ" | |
(ja) "Sym+" | |
(ka) "Sym+" | |
(pa) "Sym+" | |
(ta) "Sym Ó««Ó«▒Ó»ìÓ«▒Ó»üÓ««Ó»ì" | |
(nb) "Sym+" | |
(be) "Sym +" | |
(de) "Sym-Taste +" | |
(ne) "Sym+" | |
(te) "Sym+" | |
(af) "Simbool+" | |
(bg) "Sym+" | |
(th) "Sym+" | |
(fi) "Sym+" | |
(hi) "Sym+" | |
(si) "Sym+" | |
(vi) "Sym+" | |
(kk) "Sym+" | |
(mk) "Sym+" | |
(sk) "Sym+" | |
(uk) "Sym+" | |
(el) "Sym+" | |
(gl) "Sym +" | |
(ml) "Sym+" | |
(nl) "Sym +" | |
(pl) "Sym+" | |
(sl) "Sym +" | |
(tl) "Sym+" | |
(am) "Sym+" | |
(km) "Sym+" | |
(bn) "Sym+" | |
(in) "Sym+" | |
(kn) "Sym+" | |
(mn) "Sym+" | |
(ko) "Sym+" | |
(lo) "Sym+" | |
(ro) "Sym+" | |
(sq) "Sym+" | |
(ar) "Sym+" | |
(fr) "Sym+" | |
(hr) "Sym+" | |
(mr) "Sym+" | |
(or) "Sym+" | |
(sr) "Sym+" | |
(b+sr+Latn) "Sym+" | |
(tr) "Sym+" | |
(ur) "Sym+ÔÇÄ" | |
(as) "Sym+" | |
(bs) "Sym+" | |
(cs) "Sym+" | |
(es) "Sym +" | |
(is) "Sym+" | |
(ms) "Sym+" | |
(et) "Sym +" | |
(it) "SYM +" | |
(lt) "ÔÇ×SymÔÇ£ +" | |
(pt) "Sym+" | |
(eu) "Sym +" | |
(gu) "Sym+" | |
(hu) "Sym+" | |
(ru) "Sym +" | |
(zu) "Sym+" | |
(lv) "Simbolu taustiņš +" | |
(sv) "Symbol + " | |
(iw) "Sym+" | |
(sw) "Sym+" | |
(hy) "Sym+" | |
(ky) "Sym+" | |
(my) "Sym+" | |
(az) "Sym+" | |
(uz) "Sym+" | |
(en-rCA) "Sym+" | |
(fr-rCA) "Sym+" | |
(en-rGB) "Sym+" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄSym+ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "Sym +" | |
(zh-rCN) "Sym+" | |
(en-rIN) "Sym+" | |
(pt-rBR) "Sym+" | |
(es-rUS) "Sym+" | |
(pt-rPT) "Sym +" | |
(en-rAU) "Sym+" | |
(zh-rTW) "Sym +" | |
resource 0x7f0c0011 string/abc_prepend_shortcut_label | |
() "Menu+" | |
(ca) "Men├║+" | |
(da) "Menu+" | |
(fa) "منو+" | |
(ja) "Menu+" | |
(ka) "Menu+" | |
(pa) "Menu+" | |
(ta) "Menu Ó««Ó«▒Ó»ìÓ«▒Ó»üÓ««Ó»ì" | |
(nb) "Meny+" | |
(be) "ð£ðÁð¢ÐÄ┬á+" | |
(de) "Menütaste +" | |
(ne) "Menu+" | |
(te) "Menu+" | |
(af) "Kieslys+" | |
(bg) "Menu+" | |
(th) "Ó╣ÇÓ©íÓ©ÖÓ©╣+" | |
(fi) "Valikko+" | |
(hi) "Menu+" | |
(si) "Menu+" | |
(vi) "Menu+" | |
(kk) "Menu+" | |
(mk) "Menu+" | |
(sk) "Menu+" | |
(uk) "Menu+" | |
(el) "Menu+" | |
(gl) "Men├║ +" | |
(ml) "Ó┤«ÓÁåÓ┤¿ÓÁü+" | |
(nl) "Menu +" | |
(pl) "Menu+" | |
(sl) "Meni +" | |
(tl) "Menu+" | |
(am) "Menu+" | |
(km) "Menu+" | |
(bn) "Menu+" | |
(in) "Menu+" | |
(kn) "Menu+" | |
(mn) "ðªÐìÐü+" | |
(ko) "Menu+" | |
(lo) "Menu+" | |
(ro) "Meniu+" | |
(sq) "Menyja+" | |
(ar) "Ϻ┘ä┘éϺϪ┘àÏ®+" | |
(fr) "Menu+" | |
(hr) "Menu+" | |
(mr) "Óñ«ÓÑçÓñ¿ÓÑé+" | |
(or) "Ó¼«Ó¡çÓ¼¿Ó¡ü" | |
(sr) "Menu+" | |
(b+sr+Latn) "Menu+" | |
(tr) "Men├╝+" | |
(ur) "Menu+ÔÇÄ" | |
(as) "Menu+" | |
(bs) "Menu+" | |
(cs) "Menu+" | |
(es) "Menú +" | |
(is) "Valmynd+" | |
(ms) "Menu+" | |
(et) "Men├╝├╝ +" | |
(it) "MENU +" | |
(lt) "ÔÇ×MenuÔÇ£ +" | |
(pt) "Menu+" | |
(eu) "Menua +" | |
(gu) "Menu+" | |
(hu) "Menu+" | |
(ru) "ð£ðÁð¢ÐÄ┬á+" | |
(zu) "Imenyu+" | |
(lv) "Poga Izvēlne +" | |
(sv) "Meny + " | |
(iw) "άÎñοÎÖÎÿ+" | |
(sw) "Menu+" | |
(hy) "Menu+" | |
(ky) "Menu+" | |
(my) "Menu+" | |
(az) "Menyu+" | |
(uz) "Menyu+" | |
(en-rCA) "Menu+" | |
(fr-rCA) "Menu+" | |
(en-rGB) "Menu+" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄMenu+ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "Menu +" | |
(zh-rCN) "Menu+" | |
(en-rIN) "Menu+" | |
(pt-rBR) "Menu+" | |
(es-rUS) "Men├║+" | |
(pt-rPT) "Menu +" | |
(en-rAU) "Menu+" | |
(zh-rTW) "Menu +" | |
resource 0x7f0c0012 string/abc_search_hint | |
() "Search" | |
(ca) "Cerca" | |
(da) "S├©gÔǪ" | |
(fa) "ϼÏ│Ϭϼ┘êÔǪÔÇÅ" | |
(ja) "µñ£þ┤óÔǪ" | |
(ka) "ßâ½ßâÿßâößâæßâÉÔǪ" | |
(pa) "Ó¿ûÓ®ïÓ¿£ÔǪ" | |
(ta) "Ó«ñÓ»çÓ«ƒÓ»üÓ«òÔǪ" | |
(nb) "S├©k" | |
(be) "ðƒð¥ÐêÐâð║ÔǪ" | |
(de) "Suchen" | |
(ne) "ÓñûÓÑïÓñ£ÓÑìÓñ¿ÓÑüÓñ╣ÓÑïÓñ©ÓÑìÔǪ" | |
(te) "Ó░ÁÓ▒åÓ░ñÓ░òÓ░éÓ░íÓ░┐ÔǪ" | |
(af) "Soek " | |
(bg) "ðóÐèÐÇÐüðÁÐéðÁÔǪ" | |
(th) "Ó©äÓ╣ëÓ©ÖÓ©½Ó©▓ÔǪ" | |
(fi) "Haku" | |
(hi) "" | |
(si) "ÓÀâÓÀ£ÓÂ║ÓÂ▒ÓÀèÓÂ▒..." | |
(vi) "T├¼m kiß║┐mÔǪ" | |
(kk) "ðåðÀð┤ðÁÐâÔǪ" | |
(mk) "ðƒÐÇðÁð▒ð░ÐÇÐâð▓ð░ÐÜðÁÔǪ" | |
(sk) "Vyh─¥ada┼ÑÔǪ" | |
(uk) "ðÆð▓ðÁð┤ÐûÐéÐî ð┐ð¥ÐêÐâð║ð¥ð▓ð©ð╣ ðÀð░ð┐ð©ÐéÔǪ" | |
(el) "╬æ╬¢╬▒╬Â╬«¤ä╬À¤â╬ÀÔǪ" | |
(gl) "Busca" | |
(ml) "Ó┤ñÓ┤┐Ó┤░Ó┤»ÓÁüÓ┤òÔǪ" | |
(nl) "Zoeken" | |
(pl) "Szukaj" | |
(sl) "Iskanje " | |
(tl) "Maghanap" | |
(am) "ßï¡ßìêßêìßîëÔǪ" | |
(km) "ß׃߃Æßף߃éß×äß×Üß×ÇÔǪ" | |
(bn) "Óª©Óª¥Óª░ÓºìÓªÜ ÓªòÓª░ÓºüÓª¿ÔǪ" | |
(in) "Telusuri..." | |
(kn) "Ó▓╣Ó│üÓ▓íÓ│üÓ▓òÓ▓┐ÔǪ" | |
(mn) "ðÑð░ð╣ÐàÔǪ" | |
(ko) "Û▓Çýâë..." | |
(lo) "Ó║èÓ║¡Ó║üÓ║½Ó║▓ÔǪ" | |
(ro) "C─âuta╚øiÔǪ" | |
(sq) "K├½rkoÔǪ" | |
(ar) "ϿϡϽÔǪ" | |
(fr) "Rechercher" | |
(hr) "Pretra┼¥iteÔǪ" | |
(mr) "ÓñÂÓÑïÓñºÓñ¥ÔǪ" | |
(or) "Ó¼©Ó¼░Ó¡ìÓ¼ÜÓ¡ìÓ¼Ü Ó¼òÓ¼░Ó¼¿Ó¡ìÓ¼ñÓ¡üÔǪ" | |
(sr) "ðƒÐÇðÁÐéÐÇð░ðÂð©ÐéðÁÔǪ" | |
(b+sr+Latn) "Pretra┼¥iteÔǪ" | |
(tr) "Ara" | |
(ur) "Ϭ┘äϺÏ┤ ┌®Ï▒█î┌║ÔǪ" | |
(as) "Óª©Óª¿ÓºìÓªºÓª¥Óª¿ ÓªòÓº░ÓªòÔǪ" | |
(bs) "Pretraŝite..." | |
(cs) "Vyhledat" | |
(es) "Buscar" | |
(is) "Leita" | |
(ms) "Cari" | |
(et) "Otsige " | |
(it) "Cerca" | |
(lt) "Ie┼íkotiÔǪ" | |
(pt) "Pesquisar" | |
(eu) "Bilatu" | |
(gu) "Ó¬ÂÓ½ïÓ¬ºÓ½ïÔǪ" | |
(hu) "Keres├®sÔǪ" | |
(ru) "ðÆð▓ðÁð┤ð©ÐéðÁ ðÀð░ð┐ÐÇð¥Ðü" | |
(zu) "Sesha" | |
(lv) "Mekl─ôjietÔǪ" | |
(sv) "S├Âk ÔǪ" | |
(iw) "ÎùÎÖÎñÎòήÔǪ" | |
(sw) "Tafuta" | |
(hy) "ıêÍÇı©ıÂı©Íéı┤ÔǪ" | |
(ky) "ðÿðÀð┤ˮˮÔǪ" | |
(my) "ßÇøßÇ¥ßǼßÇûßÇ¢ßÇ▒ßÇøßÇößÇ║ÔǪ" | |
(az) "Axtarış..." | |
(uz) "Qidirish" | |
(en-rCA) "Search" | |
(fr-rCA) "Rechercher" | |
(en-rGB) "Search" | |
(en-rXC) "Search" | |
(zh-rHK) "µÉ£Õ░ïÔǪ" | |
(zh-rCN) "µÉ£þ┤óÔǪ" | |
(en-rIN) "Search" | |
(pt-rBR) "Pesquisar" | |
(es-rUS) "Buscar" | |
(pt-rPT) "Pesquisar" | |
(en-rAU) "Search" | |
(zh-rTW) "µÉ£Õ░ïÔǪ" | |
resource 0x7f0c0013 string/abc_searchview_description_clear | |
() "Clear query" | |
(ca) "Esborra la consulta" | |
(da) "Ryd foresp├©rgsel" | |
(fa) "┘¥Ïº┌® ┌®Ï▒Ï»┘å ┘¥┘ÅÏ▒Ï│┘àϺ┘å" | |
(ja) "µñ£þ┤óÒé¡Òâ╝Òâ»Òâ╝ÒâëÒéÆÕëèÚÖñ" | |
(ka) "ßâøßâØßâùßâ«ßâØßâòßâ£ßâÿßâí ßâÆßâÉßâíßâúßâñßâùßâÉßâòßâößâæßâÉ" | |
(pa) "Ó¿¬Ó®üÓ®▒Ó¿øÓ¿ùÓ¿┐Ó®▒Ó¿ø Ó¿òÓ¿▓Ó®ÇÓ¿àÓ¿░ Ó¿òÓ¿░Ó®ï" | |
(ta) "Ó«ÁÓ«┐Ó«®Ó«ÁÓ«▓Ó»ê Ó«àÓ«┤Ó«┐Ó«òÓ»ìÓ«òÓ»üÓ««Ó»ì" | |
(nb) "Slett s├©ket" | |
(be) "ðÆÐïð┤ð░ð╗ÐûÐåÐî ðÀð░ð┐ÐïÐé" | |
(de) "Suchanfrage l├Âschen" | |
(ne) "ÓñòÓÑìÓñÁÓÑçÓñ░ÓÑÇ ÓñûÓñ¥Óñ▓ÓÑÇ ÓñùÓñ░ÓÑìÓñ¿ÓÑüÓñ╣ÓÑïÓñ©ÓÑì" | |
(te) "Ó░¬Ó▒ìÓ░░Ó░ÂÓ▒ìÓ░¿Ó░¿Ó▒ü Ó░ñÓ▒ÇÓ░©Ó░┐Ó░ÁÓ▒çÓ░©Ó▒ìÓ░ñÓ▒üÓ░éÓ░ªÓ░┐" | |
(af) "Vee navraag uit" | |
(bg) "ðÿðÀÐçð©ÐüÐéð▓ð░ð¢ðÁ ð¢ð░ ðÀð░ÐÅð▓ð║ð░Ðéð░" | |
(th) "Ó©ÑÓ╣ëÓ©▓Ó©çÓ©äÓ©│Ó©äÓ╣ëÓ©ÖÓ©½Ó©▓" | |
(fi) "Tyhjennä kysely" | |
(hi) "ÓñòÓÑìÔÇìÓñÁÓÑçÓñ░ÓÑÇ Óñ╣ÓñƒÓñ¥ÓñÅÓñé" | |
(si) "ÓÀÇÓÀÆÓ©ÓÀâÓÀöÓ© ÓÀäÓÀÆÓÀâÓÀè ÓÂÜÓÂ╗ÓÂ▒ÓÀèÓÂ▒" | |
(vi) "Xóa truy vấn" | |
(kk) "ðíÊ▒ÐÇð░Ðâð┤Ðï Ë®ÐêÐûÐÇÐâ" | |
(mk) "ðÿÐüÐçð©ÐüÐéð© ð▒ð░ÐÇð░ÐÜðÁ" | |
(sk) "Vymazať dopyt" | |
(uk) "ð×Ðçð©ÐüÐéð©Ðéð© ðÀð░ð┐ð©Ðé" | |
(el) "╬ö╬╣╬▒╬│¤ü╬▒¤å╬« ╬Á¤ü¤ë¤ä╬«╬╝╬▒¤ä╬┐¤é" | |
(gl) "Borra a consulta" | |
(ml) "Ó┤ÜÓÁïÓ┤ªÓÁìÓ┤»Ó┤é Ó┤«Ó┤¥Ó┤»ÓÁìÔÇîÓ┤òÓÁìÓ┤òÓÁüÓ┤ò" | |
(nl) "Zoekopdracht wissen" | |
(pl) "Wyczy┼ø─ç zapytanie" | |
(sl) "Izbris poizvedbe" | |
(tl) "I-clear ang query" | |
(am) "መጠይቅ አጛዳ" | |
(km) "ß׃ß×ÿ߃Æß×óß×Âß×ÅÔÇïß׃߃åß×Äß×¢ß×Ü" | |
(bn) "ÓªòÓºïÓª»Óª╝ÓºçÓª░Óª┐ Óª«ÓºüÓªøÓºç Óª½ÓºçÓª▓ÓºüÓª¿" | |
(in) "Hapus kueri" | |
(kn) "Ó▓¬Ó│ìÓ▓░Ó▓ÂÓ│ìÓ▓¿Ó│åÓ▓»Ó▓¿Ó│ìÓ▓¿Ó│ü Ó▓ñÓ│åÓ▓░Ó▓ÁÓ│üÓ▓ùÓ│èÓ▓│Ó▓┐Ó▓©Ó▓┐" | |
(mn) "ðÉÐüÐâÐâð╗ð│ð░ ð░ÐÇð©ð╗ð│ð░Ðà" | |
(ko) "Û▓Çýâëýû┤ ýé¡ýá£" | |
(lo) "Ó║ÑÓ║ÂÓ║ÜÓ║éÓ╗ìÓ╗ëÓ║äÓ║ºÓ║▓Ó║íÓ║èÓ║¡Ó║üÓ║½Ó║▓" | |
(ro) "╚ÿterge╚øi interogarea" | |
(sq) "Pastro pyetjen" | |
(ar) "┘àÏ¡┘ê ÏÀ┘äÏ¿ Ϻ┘äϿϡϽ" | |
(fr) "Effacer la requête" | |
(hr) "Izbriši upit" | |
(mr) "ÓñòÓÑìÔÇìÓñÁÓÑçÓñ░ÓÑÇ Óñ©Óñ¥Óñ½ ÓñòÓñ░Óñ¥" | |
(or) "Ó¼òÓ¡ìÓ¡▒Ó¡çÓ¼░Ó¡Ç Ó¼ûÓ¼¥Ó¼▓Ó¼┐ Ó¼òÓ¼░Ó¼¿Ó¡ìÓ¼ñÓ¡ü" | |
(sr) "ð×ð▒ÐÇð©Ðêð©ÐéðÁ Ðâð┐ð©Ðé" | |
(b+sr+Latn) "Obrišite upit" | |
(tr) "Sorguyu temizle" | |
(ur) "ϺÏ│Ϭ┘üÏ│ϺÏ▒ ÏÁϺ┘ü ┌®Ï▒█î┌║" | |
(as) "Óª©Óª¿ÓºìÓªºÓª¥Óª¿ ÓªòÓº░Óª¥ Óª¬ÓºìÓº░ÓªÂÓºìÓª¿ Óª«ÓªÜÓªò" | |
(bs) "Obriši upit" | |
(cs) "Smazat dotaz" | |
(es) "Borrar consulta" | |
(is) "Hreinsa fyrirspurn" | |
(ms) "Kosongkan pertanyaan" | |
(et) "Päringu tühistamine" | |
(it) "Cancella query" | |
(lt) "Išvalyti uŝklausą" | |
(pt) "Limpar consulta" | |
(eu) "Garbitu kontsulta" | |
(gu) "Ó¬òÓ½ìÓ¬ÁÓ½çÓ¬░Ó½Ç Ó¬©Ó¬¥Ó¬½ Ó¬òÓ¬░Ó½ï" | |
(hu) "Lek├®rdez├®s t├Ârl├®se" | |
(ru) "ðúð┤ð░ð╗ð©ÐéÐî ðÀð░ð┐ÐÇð¥Ðü" | |
(zu) "Sula inkinga" | |
(lv) "Not─½r─½t vaic─üjumu" | |
(sv) "Ta bort frågan" | |
(iw) "Î×ÎùÎÖκά ÎöήÎÉÎÖΣάÎö" | |
(sw) "Futa hoja" | |
(hy) "ıïıÂı╗ıÑı¼ ı░ıíÍÇÍüı©Íéı┤ı¿" | |
(ky) "ðíÐâÐÇð░ð╝ð┤Ðï Ë®ÐçÊ»ÐÇʻʻ" | |
(my) "ßÇøßÇ¥ßǼßÇûßÇ¢ßÇ▒ßÇÖßÇ¥ßÇ»ßÇÇßÇ¡ßÇ» ßÇûßÇÜßÇ║ßÇøßÇ¥ßǼßÇ©ßÇøßÇößÇ║" | |
(az) "Sor─ƒunu silin" | |
(uz) "SoÔÇÿrovni oÔÇÿchirish" | |
(en-rCA) "Clear query" | |
(fr-rCA) "Effacer la requête" | |
(en-rGB) "Clear query" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄClear queryÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "µ©àÚÖñµƒÑÞ®ó" | |
(zh-rCN) "µ©àÚÖñµƒÑÞ»ó" | |
(en-rIN) "Clear query" | |
(pt-rBR) "Limpar consulta" | |
(es-rUS) "Borrar consulta" | |
(pt-rPT) "Limpar consulta" | |
(en-rAU) "Clear query" | |
(zh-rTW) "µ©àÚÖñµƒÑÞ®ó" | |
resource 0x7f0c0014 string/abc_searchview_description_query | |
() "Search query" | |
(ca) "Consulta de cerca" | |
(da) "S├©geforesp├©rgsel" | |
(fa) "Ï»Ï▒Ï«┘êϺÏ│Ϭ ϼÏ│Ϭϼ┘ê" | |
(ja) "µñ£þ┤óÒé¡Òâ╝Òâ»Òâ╝Òâë" | |
(ka) "ßâøßâØßâùßâ«ßâØßâòßâ£ßâÿßâí ßâ½ßâÿßâößâæßâÉ" | |
(pa) "Ó¿ûÓ®ïÓ¿£ Ó¿¬Ó®üÓ®▒Ó¿øÓ¿ùÓ¿┐Ó®▒Ó¿ø" | |
(ta) "Ó«ñÓ»çÓ«ƒÓ«▓Ó»ì Ó«ÁÓ«┐Ó«®Ó«ÁÓ«▓Ó»ì" | |
(nb) "S├©keord" | |
(be) "ðƒð¥ÐêÐâð║ð░ð▓Ðï ðÀð░ð┐ÐïÐé" | |
(de) "Suchanfrage" | |
(ne) "ÓñûÓÑïÓñ£ Óñ¬ÓÑìÓñ░ÓñÂÓÑìÓñ¿" | |
(te) "Ó░ÂÓ▒ïÓ░ºÓ░¿ Ó░¬Ó▒ìÓ░░Ó░ÂÓ▒ìÓ░¿" | |
(af) "Soektognavraag" | |
(bg) "ðùð░ÐÅð▓ð║ð░ ðÀð░ ÐéÐèÐÇÐüðÁð¢ðÁ" | |
(th) "Ó©äÓ©│Ó©äÓ╣ëÓ©ÖÓ©½Ó©▓" | |
(fi) "Hakukysely" | |
(hi) "Óñ©Óñ░ÓÑìÓñÜ ÓñòÓÑìÓñÁÓÑçÓñ░ÓÑÇ" | |
(si) "ÓÀâÓÀÖÓÀÇÓÀöÓ©ÓÀè ÓÀÇÓÀÆÓ©ÓÀâÓÀöÓ©" | |
(vi) "Truy vấn tìm kiếm" | |
(kk) "ðåðÀð┤ðÁÐâ ÐüÊ▒ÐÇð░ÐâÐï" | |
(mk) "ðƒÐÇðÁð▒ð░ÐÇð░Ðÿ ð▒ð░ÐÇð░ÐÜðÁ" | |
(sk) "Vyhĝadávací dopyt" | |
(uk) "ðƒð¥ÐêÐâð║ð¥ð▓ð©ð╣ ðÀð░ð┐ð©Ðé" | |
(el) "╬ò¤ü¤Ä¤ä╬À╬╝╬▒ ╬▒╬¢╬▒╬Â╬«¤ä╬À¤â╬À¤é" | |
(gl) "Busca a consulta" | |
(ml) "Ó┤ÜÓÁïÓ┤ªÓÁìÓ┤»Ó┤é Ó┤ñÓ┤┐Ó┤░Ó┤»ÓÁüÓ┤ò" | |
(nl) "Zoekopdracht" | |
(pl) "Zapytanie" | |
(sl) "Iskalna poizvedba" | |
(tl) "Query sa paghahanap" | |
(am) "የፍለጋ መጠይቅ" | |
(km) "ß׃߃Æßף߃éß×äß×Üß×Çß׃߃åß×Äß×¢ß×ÜÔÇï" | |
(bn) "Óª©Óª¥Óª░ÓºìÓªÜ ÓªòÓºïÓª»Óª╝ÓºçÓª░Óª┐" | |
(in) "Telusuri kueri" | |
(kn) "Ó▓¬Ó│ìÓ▓░Ó▓ÂÓ│ìÓ▓¿Ó│åÓ▓»Ó▓¿Ó│ìÓ▓¿Ó│ü Ó▓╣Ó│üÓ▓íÓ│üÓ▓òÓ▓┐" | |
(mn) "ðÑð░ð╣Ðà ð░ÐüÐâÐâð╗ð│ð░" | |
(ko) "Û▓Çýâëýû┤" | |
(lo) "Ó║äÓ║│Ó║¬Ó║│Ó║ÑÓ║▒Ó║ÜÓ║äÓ║╗Ó╗ëÓ║ÖÓ║½Ó║▓" | |
(ro) "Termen de c─âutare" | |
(sq) "Kërko pyetjen" | |
(ar) "ÏÀ┘äÏ¿ ϿϡϽ" | |
(fr) "Requête de recherche" | |
(hr) "Upit za pretraŝivanje" | |
(mr) "ÓñÂÓÑïÓñº ÓñòÓÑìÓñÁÓÑçÓñ░ÓÑÇ" | |
(or) "Ó¼©Ó¼░Ó¡ìÓ¼ÜÓ¡ìÓ¼Ü Ó¼òÓ¡ìÓ¡▒Ó¡çÓ¼░Ó¡Ç" | |
(sr) "ðƒÐÇðÁÐéÐÇð░ðÂð©ÐéðÁ Ðâð┐ð©Ðé" | |
(b+sr+Latn) "Pretraŝite upit" | |
(tr) "Arama sorgusu" | |
(ur) "Ϭ┘äϺÏ┤ ┌®Ïº ϺÏ│Ϭ┘üÏ│ϺÏ▒" | |
(as) "Óª©Óª¿ÓºìÓªºÓª¥Óª¿ ÓªòÓº░Óª¥ Óª¬ÓºìÓº░ÓªÂÓºìÓª¿" | |
(bs) "Pretraŝi upit" | |
(cs) "Dotaz pro vyhledávání" | |
(es) "Consulta de b├║squeda" | |
(is) "Leitarfyrirspurn" | |
(ms) "Pertanyaan carian" | |
(et) "Otsingupäring" | |
(it) "Query di ricerca" | |
(lt) "Paieškos uŝklausa" | |
(pt) "Consulta de pesquisa" | |
(eu) "Bilaketa-kontsulta" | |
(gu) "Ó¬ÂÓ½ïÓ¬º Ó¬òÓ½ìÓ¬ÁÓ½çÓ¬░Ó½Ç" | |
(hu) "Keres├®si lek├®rdez├®s" | |
(ru) "ðƒð¥ð©Ðüð║ð¥ð▓Ðïð╣ ðÀð░ð┐ÐÇð¥Ðü" | |
(zu) "Sesha umbuzo" | |
(lv) "Meklēšanas vaicājums" | |
(sv) "S├Âkfr├Ñga" | |
(iw) "ήÎÉÎÖΣάά ÎùÎÖÎñÎòή" | |
(sw) "Hoja ya utafutaji" | |
(hy) "ıêÍÇı©ıÂı┤ıíı ı░ıíÍÇÍüı©Íéı┤" | |
(ky) "ðÿðÀð┤ðÁð╗ð│ðÁð¢ ÐüÐâÐÇð░ð╝" | |
(my) "ßÇøßÇ¥ßǼßÇûßÇ¢ßÇ▒ßÇøßÇößÇ║ ßÇÖßÇ▒ßÇ©ßÇüßÇ¢ßÇößÇ║ßÇ©" | |
(az) "Axtarış sorğusu" | |
(uz) "Qidiruv soÔÇÿrovi" | |
(en-rCA) "Search query" | |
(fr-rCA) "Requête de recherche" | |
(en-rGB) "Search query" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄSearch queryÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "µÉ£Õ░﵃ÑÞ®ó" | |
(zh-rCN) "µÉ£þ┤óµƒÑÞ»ó" | |
(en-rIN) "Search query" | |
(pt-rBR) "Consulta de pesquisa" | |
(es-rUS) "B├║squeda" | |
(pt-rPT) "Consulta de pesquisa" | |
(en-rAU) "Search query" | |
(zh-rTW) "µÉ£Õ░﵃ÑÞ®ó" | |
resource 0x7f0c0015 string/abc_searchview_description_search | |
() "Search" | |
(ca) "Cerca" | |
(da) "S├©g" | |
(fa) "ϼÏ│Ϭϼ┘ê" | |
(ja) "µñ£þ┤ó" | |
(ka) "ძიება" | |
(pa) "Ó¿ûÓ®ïÓ¿£" | |
(ta) "Ó«ñÓ»çÓ«ƒÓ»üÓ««Ó»ì" | |
(nb) "S├©k" | |
(be) "ðƒð¥ÐêÐâð║" | |
(de) "Suche" | |
(ne) "" | |
(te) "Ó░ÂÓ▒ïÓ░ºÓ░¿" | |
(af) "Soek" | |
(bg) "ðóÐèÐÇÐüðÁð¢ðÁ" | |
(th) "Ó©äÓ╣ëÓ©ÖÓ©½Ó©▓" | |
(fi) "Haku" | |
(hi) "" | |
(si) "ÓÀâÓÀÖÓÀÇÓÀôÓ©" | |
(vi) "Tìm kiếm" | |
(kk) "ðåðÀð┤ðÁÐâ" | |
(mk) "ðƒÐÇðÁð▒ð░ÐÇð░Ðÿ" | |
(sk) "Hĝadať" | |
(uk) "ðƒð¥ÐêÐâð║" | |
(el) "╬æ╬¢╬▒╬Â╬«¤ä╬À¤â╬À" | |
(gl) "Realiza buscas" | |
(ml) "Ó┤ñÓ┤┐Ó┤░Ó┤»ÓÁüÓ┤ò" | |
(nl) "Zoeken" | |
(pl) "Szukaj" | |
(sl) "Iskanje" | |
(tl) "Maghanap" | |
(am) "ßììßêêßîï" | |
(km) "ß׃߃Æßף߃éß×äß×Üß×Ç" | |
(bn) "Óª©Óª¥Óª░ÓºìÓªÜ ÓªòÓª░ÓºüÓª¿" | |
(in) "Telusuri" | |
(kn) "Ó▓╣Ó│üÓ▓íÓ│üÓ▓òÓ▓┐" | |
(mn) "ðÑð░ð╣Ðà" | |
(ko) "Û▓Çýâë" | |
(lo) "Ó║èÓ║¡Ó║üÓ║½Ó║▓" | |
(ro) "C─âuta╚øi" | |
(sq) "Kërko" | |
(ar) "Ϻ┘äϿϡϽ" | |
(fr) "Rechercher" | |
(hr) "Pretraŝi" | |
(mr) "ÓñÂÓÑïÓñº" | |
(or) "Ó¼©Ó¼░Ó¡ìÓ¼ÜÓ¡ìÓ¼Ü Ó¼òÓ¼░Ó¼¿Ó¡ìÓ¼ñÓ¡ü" | |
(sr) "ðƒÐÇðÁÐéÐÇð░ðÂð©ÐéðÁ" | |
(b+sr+Latn) "Pretraŝite" | |
(tr) "Ara" | |
(ur) "Ϭ┘äϺÏ┤ ┌®Ï▒█î┌║" | |
(as) "Óª©Óª¿ÓºìÓªºÓª¥Óª¿" | |
(bs) "Pretraŝi" | |
(cs) "Hledat" | |
(es) "Buscar" | |
(is) "Leit" | |
(ms) "Cari" | |
(et) "Otsing" | |
(it) "Cerca" | |
(lt) "Ieškoti" | |
(pt) "Pesquisar" | |
(eu) "Bilatu" | |
(gu) "Ó¬ÂÓ½ïÓ¬ºÓ½ï" | |
(hu) "Keres├®s" | |
(ru) "ðƒð¥ð©Ðüð║" | |
(zu) "Sesha" | |
(lv) "Mekl─ôt" | |
(sv) "S├Âk" | |
(iw) "ÎùÎÖÎñÎòή" | |
(sw) "Tafuta" | |
(hy) "ıêÍÇı©ıÂıÑı¼" | |
(ky) "ðÿðÀð┤ˮˮ" | |
(my) "ßÇøßÇ¥ßǼßÇøßÇößÇ║" | |
(az) "Axtar─▒n" | |
(uz) "Qidiruv" | |
(en-rCA) "Search" | |
(fr-rCA) "Rechercher" | |
(en-rGB) "Search" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄSearchÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "µÉ£Õ░ï" | |
(zh-rCN) "µÉ£þ┤ó" | |
(en-rIN) "Search" | |
(pt-rBR) "Pesquisar" | |
(es-rUS) "Buscar" | |
(pt-rPT) "Pesquisar" | |
(en-rAU) "Search" | |
(zh-rTW) "µÉ£Õ░ï" | |
resource 0x7f0c0016 string/abc_searchview_description_submit | |
() "Submit query" | |
(ca) "Envia la consulta" | |
(da) "Indsend foresp├©rgsel" | |
(fa) "ϺÏ▒Ï│Ϻ┘ä ┘¥┘ÅÏ▒Ï│┘àϺ┘å" | |
(ja) "µñ£þ┤óÒé¡Òâ╝Òâ»Òâ╝ÒâëÒéÆÚÇüõ┐í" | |
(ka) "ßâøßâØßâùßâ«ßâØßâòßâ£ßâÿßâí ßâÆßâÉßâôßâÉßâÆßâûßâÉßâòßâ£ßâÉ" | |
(pa) "Ó¿¬Ó®üÓ®▒Ó¿øÓ¿ùÓ¿┐Ó®▒Ó¿ø Ó¿©Ó¿¬Ó®üÓ¿░Ó¿ª Ó¿òÓ¿░Ó®ï" | |
(ta) "Ó«ÁÓ«┐Ó«®Ó«ÁÓ«▓Ó»êÓ«ÜÓ»ì Ó«ÜÓ««Ó«░Ó»ìÓ«¬Ó»ìÓ«¬Ó«┐Ó«òÓ»ìÓ«òÓ»üÓ««Ó»ì" | |
(nb) "Utf├©r s├©ket" | |
(be) "ðÉð┤ð┐ÐÇð░ð▓ÐûÐåÐî ðÀð░ð┐ÐïÐé" | |
(de) "Anfrage senden" | |
(ne) "ÓñòÓÑìÓñÁÓÑçÓñ░ÓÑÇ Óñ¬ÓÑçÓñ© ÓñùÓñ░ÓÑìÓñ¿ÓÑüÓñ╣ÓÑïÓñ©ÓÑì" | |
(te) "Ó░¬Ó▒ìÓ░░Ó░ÂÓ▒ìÓ░¿Ó░¿Ó░┐ Ó░©Ó░«Ó░░Ó▒ìÓ░¬Ó░┐Ó░©Ó▒ìÓ░ñÓ▒üÓ░éÓ░ªÓ░┐" | |
(af) "Dien navraag in" | |
(bg) "ðÿðÀð┐ÐÇð░Ðëð░ð¢ðÁ ð¢ð░ ðÀð░ÐÅð▓ð║ð░Ðéð░" | |
(th) "Ó©¬Ó╣êÓ©çÓ©äÓ©│Ó©äÓ╣ëÓ©ÖÓ©½Ó©▓" | |
(fi) "Lähetä kysely" | |
(hi) "ÓñòÓÑìÓñÁÓÑçÓñ░ÓÑÇ Óñ©Óñ¼Óñ«Óñ┐Óñƒ ÓñòÓñ░ÓÑçÓñé" | |
(si) "ÓÀÇÓÀÆÓ©ÓÀâÓÀöÓ© ÓÂ║ÓÀ£Ó©ÓÀö ÓÂÜÓÂ╗ÓÂ▒ÓÀèÓÂ▒" | |
(vi) "Gửi truy vấn" | |
(kk) "ðíÊ▒ÐÇð░Ðâð┤Ðï ðÂÐûð▒ðÁÐÇÐâ" | |
(mk) "ðƒð¥ð┤ð¢ðÁÐüð© ð▒ð░ÐÇð░ÐÜðÁ" | |
(sk) "Odoslať dopyt" | |
(uk) "ðØð░ÐûÐüð╗ð░Ðéð© ðÀð░ð┐ð©Ðé" | |
(el) "╬ѤÇ╬┐╬▓╬┐╬╗╬« ╬Á¤ü¤ë¤ä╬«╬╝╬▒¤ä╬┐¤é" | |
(gl) "Envía a consulta" | |
(ml) "Ó┤ÜÓÁïÓ┤ªÓÁìÓ┤»Ó┤é Ó┤©Ó┤«ÓÁ╝Ó┤¬ÓÁìÓ┤¬Ó┤┐Ó┤òÓÁìÓ┤òÓÁüÓ┤ò" | |
(nl) "Zoekopdracht verzenden" | |
(pl) "Wy┼ølij zapytanie" | |
(sl) "Pošiljanje poizvedbe" | |
(tl) "Isumite ang query" | |
(am) "ßêÿßîáßï¡ßëà ßèáßêÁßîêßëú" | |
(km) "ß×èß×Âß×Ç߃ïß×öß×ë߃Æß×çß×╝ß×ôÔÇïß׃߃åß×Äß×¢ß×Ü" | |
(bn) "ÓªòÓºïÓª»Óª╝ÓºçÓª░Óª┐ Óª£Óª«Óª¥ ÓªªÓª┐Óª¿" | |
(in) "Kirim kueri" | |
(kn) "Ó▓¬Ó│ìÓ▓░Ó▓ÂÓ│ìÓ▓¿Ó│åÓ▓»Ó▓¿Ó│ìÓ▓¿Ó│ü Ó▓©Ó▓▓Ó│ìÓ▓▓Ó▓┐Ó▓©Ó▓┐" | |
(mn) "ðÉÐüÐâÐâð╗ð│ð░ ð©ð╗ð│ÐìÐìÐà" | |
(ko) "Û▓Çýâëýû┤ Ù│┤Ùé┤Û©░" | |
(lo) "Ó║¬Ó║╗Ó╗êÓ║çÓ║éÓ╗ìÓ╗ëÓ║íÓ║╣Ó║Ö" | |
(ro) "Trimite╚øi interogarea" | |
(sq) "Dërgo pyetjen" | |
(ar) "ÏÑÏ▒Ï│Ϻ┘ä ÏÀ┘äÏ¿ Ϻ┘äϿϡϽ" | |
(fr) "Envoyer la requête" | |
(hr) "Pošalji upit" | |
(mr) "ÓñòÓÑìÓñÁÓÑçÓñ░ÓÑÇ Óñ©Óñ¼Óñ«Óñ┐Óñƒ ÓñòÓñ░Óñ¥" | |
(or) "Ó¼òÓ¡ìÓ¡▒Ó¡çÓ¼░Ó¡Ç Ó¼ªÓ¼¥Ó¼ûÓ¼▓ Ó¼òÓ¼░Ó¼¿Ó¡ìÓ¼ñÓ¡ü" | |
(sr) "ðƒð¥Ðêð░ÐÖð©ÐéðÁ Ðâð┐ð©Ðé" | |
(b+sr+Latn) "Pošaljite upit" | |
(tr) "Sorguyu g├Ânder" | |
(ur) "ϺÏ│Ϭ┘üÏ│ϺÏ▒ ϼ┘àÏ╣ ┌®Ï▒ϺϪ█î┌║" | |
(as) "Óª¬ÓºìÓº░ÓªÂÓºìÓª¿ ÓªªÓª¥ÓªûÓª┐Óª▓ ÓªòÓº░Óªò" | |
(bs) "Pošalji upit" | |
(cs) "Odeslat dotaz" | |
(es) "Enviar consulta" | |
(is) "Senda fyrirspurn" | |
(ms) "Serah pertanyaan" | |
(et) "Päringu esitamine" | |
(it) "Invia query" | |
(lt) "Pateikti uŝklausą" | |
(pt) "Enviar consulta" | |
(eu) "Bidali kontsulta" | |
(gu) "Ó¬òÓ½ìÓ¬ÁÓ½çÓ¬░Ó½Ç Ó¬©Ó¬¼Ó¬«Ó¬┐Ó¬ƒ Ó¬òÓ¬░Ó½ï" | |
(hu) "Lek├®rdez├®s k├╝ld├®se" | |
(ru) "ð×Ðéð┐ÐÇð░ð▓ð©ÐéÐî ðÀð░ð┐ÐÇð¥Ðü" | |
(zu) "Thumela umbuzo" | |
(lv) "Iesniegt vaic─üjumu" | |
(sv) "Skicka fråga" | |
(iw) "ήΣÎÖÎùά ήÎÉÎÖΣάÎö" | |
(sw) "Wasilisha hoja" | |
(hy) "ıêÍéı▓ıíÍÇı»ıÑı¼ ı░ıíÍÇÍüı©Íéı┤ı¿" | |
(ky) "ðíÐâÐÇð░ð╝ Ðéð░ð┐ÐêÐïÐÇÐâÐâ" | |
(my) "ßÇøßÇ¥ßǼßÇûßÇ¢ßÇ▒ßÇàßÇøßǼ ßÇíßÇüßÇ╗ßÇÇßÇ║ßÇíßÇ£ßÇÇßÇ║ßÇÇßÇ¡ßÇ» ßÇòßÇ▒ßÇ©ßÇòßÇ¡ßÇ»ßÇÀßÇøßÇößÇ║" | |
(az) "Sor─ƒunu g├Ând╔Örin" | |
(uz) "SoÔÇÿrov yaratish" | |
(en-rCA) "Submit query" | |
(fr-rCA) "Envoyer la requête" | |
(en-rGB) "Submit query" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄSubmit queryÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "µÅÉõ║ñµƒÑÞ®ó" | |
(zh-rCN) "µÅÉõ║ñµƒÑÞ»ó" | |
(en-rIN) "Submit query" | |
(pt-rBR) "Enviar consulta" | |
(es-rUS) "Enviar consulta" | |
(pt-rPT) "Enviar consulta" | |
(en-rAU) "Submit query" | |
(zh-rTW) "µÅÉõ║ñµƒÑÞ®ó" | |
resource 0x7f0c0017 string/abc_searchview_description_voice | |
() "Voice search" | |
(ca) "Cerca per veu" | |
(da) "Tales├©gning" | |
(fa) "ϼÏ│Ϭϼ┘ê█î ┌»┘üϬϺÏ▒█î" | |
(ja) "Úƒ│Õú░µñ£þ┤ó" | |
(ka) "ßâ«ßâøßâØßâòßâÉßâ£ßâÿ ßâ½ßâÿßâößâæßâÉ" | |
(pa) "Ó¿àÓ¿ÁÓ¿¥Ó¿£Ó¿╝Ó®Ç Ó¿ûÓ®ïÓ¿£" | |
(ta) "Ó«òÓ»üÓ«░Ó«▓Ó»ì Ó«ñÓ»çÓ«ƒÓ«▓Ó»ì" | |
(nb) "Tales├©k" | |
(be) "ðôð░ð╗ð░Ðüð░ð▓Ðï ð┐ð¥ÐêÐâð║" | |
(de) "Sprachsuche" | |
(ne) "ÓñåÓñÁÓñ¥Óñ£Óñ«Óñ¥ ÓñåÓñºÓñ¥Óñ░Óñ┐Óññ ÓñûÓÑïÓñ£ÓÑÇ" | |
(te) "Ó░ÁÓ░¥Ó░»Ó░┐Ó░©Ó▒ì Ó░ÂÓ▒ïÓ░ºÓ░¿" | |
(af) "Stemsoektog" | |
(bg) "ðôð╗ð░Ðüð¥ð▓ð¥ ÐéÐèÐÇÐüðÁð¢ðÁ" | |
(th) "Ó©äÓ╣ëÓ©ÖÓ©½Ó©▓Ó©öÓ╣ëÓ©ºÓ©óÓ╣ÇÓ©¬Ó©ÁÓ©óÓ©ç" | |
(fi) "Puhehaku" | |
(hi) "Óñ¼ÓÑïÓñ▓ÓñòÓñ░ ÓñûÓÑïÓñ£ÓÑçÓñé" | |
(si) "ÓÀäÓ¼ ÓÀâÓÀÖÓÀÇÓÀôÓ©" | |
(vi) "Tìm kiếm bằng giọng nói" | |
(kk) "ðöð░ÐâÐïÐüð┐ðÁð¢ ÐûðÀð┤ðÁÐâ" | |
(mk) "ðôð╗ð░Ðüð¥ð▓ð¢ð¥ ð┐ÐÇðÁð▒ð░ÐÇÐâð▓ð░ÐÜðÁ" | |
(sk) "Hlasov├® vyh─¥ad├ívanie" | |
(uk) "ðôð¥ð╗ð¥Ðüð¥ð▓ð©ð╣ ð┐ð¥ÐêÐâð║" | |
(el) "╬ª¤ë╬¢╬À¤ä╬╣╬║╬« ╬▒╬¢╬▒╬Â╬«¤ä╬À¤â╬À" | |
(gl) "Busca por voz" | |
(ml) "Ó┤©Ó┤éÓ┤©Ó┤¥Ó┤░Ó┤ñÓÁìÓ┤ñÓ┤┐Ó┤▓ÓÁéÓ┤ƒÓÁå Ó┤ñÓ┤┐Ó┤░Ó┤»ÓÁüÓ┤ò" | |
(nl) "Gesproken zoekopdracht" | |
(pl) "Wyszukiwanie głosowe" | |
(sl) "Glasovno iskanje" | |
(tl) "Paghahanap gamit ang boses" | |
(am) "ßï¿ßïÁßêØßî¢ ßììßêêßîï" | |
(km) "ß׃߃Æßף߃éß×äß×Üß×ÇÔÇïß×Åß×Âß×ÿÔÇïß׃߃åß×í߃üß×ä" | |
(bn) "Óª¡Óª»Óª╝ÓºçÓª© Óª©Óª¥Óª░ÓºìÓªÜ ÓªòÓª░ÓºüÓª¿" | |
(in) "Penelusuran suara" | |
(kn) "Ó▓ºÓ│ìÓ▓ÁÓ▓¿Ó▓┐ Ó▓╣Ó│üÓ▓íÓ│üÓ▓òÓ▓¥Ó▓ƒ" | |
(mn) "ðöÐâÐâÐé Ðàð░ð╣ð╗Ðé" | |
(ko) "ýØîýä▒ Û▓Çýâë" | |
(lo) "Ó║èÓ║¡Ó║üÓ║½Ó║▓Ó║öÓ╗ëÓ║ºÓ║ìÓ║¬Ó║¢Ó║ç" | |
(ro) "C─âutare vocal─â" | |
(sq) "Kërkim me zë" | |
(ar) "ϿϡϽ ÏÁ┘êϬ┘è" | |
(fr) "Recherche vocale" | |
(hr) "Glasovno pretraŝivanje" | |
(mr) "ÓñÁÓÑìÓñ╣ÓÑëÓñçÓñ© ÓñÂÓÑïÓñº" | |
(or) "Ó¼¡Ó¼ÅÓ¼©Ó¡ìÔÇî Ó¼©Ó¼░Ó¡ìÓ¼ÜÓ¡ìÓ¼Ü" | |
(sr) "ðôð╗ð░Ðüð¥ð▓ð¢ð░ ð┐ÐÇðÁÐéÐÇð░ð│ð░" | |
(b+sr+Latn) "Glasovna pretraga" | |
(tr) "Sesli arama" | |
(ur) "ÏÁ┘êϬ█î Ϭ┘äϺÏ┤" | |
(as) "ÓªòÓªúÓºìÓªáÓªºÓºìÓª¼Óª¿Óª┐Óº░ ÓªªÓºìÓª¼Óª¥Óº░Óª¥ Óª©Óª¿ÓºìÓªºÓª¥Óª¿" | |
(bs) "Glasovno pretraŝivanje" | |
(cs) "Hlasov├® vyhled├ív├ín├¡" | |
(es) "B├║squeda por voz" | |
(is) "Raddleit" | |
(ms) "Carian suara" | |
(et) "Häälotsing" | |
(it) "Ricerca vocale" | |
(lt) "Paieška balsu" | |
(pt) "Pesquisa por voz" | |
(eu) "Ahozko bilaketa" | |
(gu) "Ó¬ÁÓ½ëÓ¬çÓ¬© Ó¬ÂÓ½ïÓ¬º" | |
(hu) "Hangalap├║ keres├®s" | |
(ru) "ðôð¥ð╗ð¥Ðüð¥ð▓ð¥ð╣ ð┐ð¥ð©Ðüð║" | |
(zu) "Ukusesha ngezwi" | |
(lv) "Mekl─ôt ar balsi" | |
(sv) "R├Âsts├Âkning" | |
(iw) "ÎùÎÖÎñÎòή κÎòΣÎÖ" | |
(sw) "Kutafuta kwa kutamka" | |
(hy) "ıüıíıÁıÂıíıÁı½ıÂ ı©ÍÇı©ıÂı©Íéı┤" | |
(ky) "Ê«ð¢ ð╝ðÁð¢ðÁð¢ ð©ðÀð┤ˮˮ" | |
(my) "ßÇíßÇ×ßÇÂßÇûßÇ╝ßÇäßÇÀßÇ║ ßÇøßÇ¥ßǼßÇøßÇößÇ║" | |
(az) "Səsli axtarış" | |
(uz) "Ovozli qidiruv" | |
(en-rCA) "Voice search" | |
(fr-rCA) "Recherche vocale" | |
(en-rGB) "Voice search" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄVoice searchÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "Þ¬×Úƒ│µÉ£Õ░ï" | |
(zh-rCN) "Þ»¡Úƒ│µÉ£þ┤ó" | |
(en-rIN) "Voice search" | |
(pt-rBR) "Pesquisa por voz" | |
(es-rUS) "B├║squeda por voz" | |
(pt-rPT) "Pesquisa por voz" | |
(en-rAU) "Voice search" | |
(zh-rTW) "Þ¬×Úƒ│µÉ£Õ░ï" | |
resource 0x7f0c0018 string/abc_shareactionprovider_share_with | |
() "Share with" | |
(ca) "Comparteix amb" | |
(da) "Del med" | |
(fa) "┘ç┘àÔÇîÏ▒Ï│Ϻ┘å█î ϿϺ" | |
(ja) "Õà▒µ£ë" | |
(ka) "გაზიარება:" | |
(pa) "Ó¿çÓ¿© Ó¿¿Ó¿¥Ó¿▓ Ó¿©Ó¿¥Ó¿éÓ¿ØÓ¿¥ Ó¿òÓ¿░Ó®ï" | |
(ta) "Ó«çÓ«ñÓ«┐Ó«▓Ó»ì Ó«¬Ó«òÓ«┐Ó«░Ó»ì" | |
(nb) "Del med" | |
(be) "ðÉð▒ð░ð│Ðâð╗ÐûÐåÐî ð┐ÐÇð░ðÀ" | |
(de) "Teilen mit" | |
(ne) "Óñ»Óñ©Óñ«Óñ¥Óñ░ÓÑìÓñ½Óññ ÓñåÓñªÓñ¥Óñ¿ Óñ¬ÓÑìÓñ░ÓñªÓñ¥Óñ¿ ÓñùÓñ░ÓÑìÓñ¿ÓÑüÓñ╣ÓÑïÓñ©ÓÑì" | |
(te) "Ó░ÁÓ▒ÇÓ░░Ó░┐Ó░ñÓ▒ï Ó░ÀÓ▒çÓ░░Ó▒ì Ó░ÜÓ▒çÓ░©Ó▒ìÓ░ñÓ▒üÓ░éÓ░ªÓ░┐" | |
(af) "Deel met" | |
(bg) "ðíð┐ð¥ð┤ðÁð╗ÐÅð¢ðÁ ÐüÐèÐü:" | |
(th) "Ó╣üÓ©èÓ©úÓ╣îÓ©üÓ©▒Ó©Ü" | |
(fi) "Jaa" | |
(hi) "ÓñçÓñ©Óñ©ÓÑç ÓñÂÓÑçÓñ»Óñ░ ÓñòÓñ░ÓÑçÓñé:" | |
(si) "ÓÀâÓ©Ó£ ÓÂÂÓÀÖÓ»ÓÀÅ Ó£ÓÂ▒ÓÀèÓÂ▒" | |
(vi) "Chia sß║╗ vß╗øi" | |
(kk) "ðæË®ð╗ÐûÐüÐâ" | |
(mk) "ðíð┐ð¥ð┤ðÁð╗ð© Ðüð¥" | |
(sk) "Zdieĝať s" | |
(uk) "ðƒð¥ð┤Ðûð╗ð©Ðéð©ÐüÐÅ:" | |
(el) "╬Ü╬┐╬╣╬¢╬┐¤Ç╬┐╬»╬À¤â╬À ¤â╬Á" | |
(gl) "Comparte contido con" | |
(ml) "Ó┤çÓ┤¿Ó┤┐Ó┤¬ÓÁìÓ┤¬Ó┤▒Ó┤»ÓÁüÓ┤¿ÓÁìÓ┤¿Ó┤ñÓÁüÓ┤«Ó┤¥Ó┤»Ó┤┐ Ó┤¬Ó┤ÖÓÁìÓ┤òÓ┤┐Ó┤ƒÓÁüÓ┤ò" | |
(nl) "Delen met" | |
(pl) "Udost─Öpnij przez:" | |
(sl) "Skupna raba z:" | |
(tl) "Ibahagi sa/kay" | |
(am) "ßèáßîïßê½ ßëá" | |
(km) "ß×à߃éß×Çß×Ü߃åß×øßƒéß×ÇÔÇïß×çß×ÂÔÇïß×ÿß×¢ß×Ö" | |
(bn) "ÓªÂÓºçÓª»Óª╝Óª¥Óª░ ÓªòÓª░ÓºüÓª¿" | |
(in) "Bagikan dengan" | |
(kn) "Ó▓çÓ▓ÁÓ▓░Ó│èÓ▓éÓ▓ªÓ▓┐Ó▓ùÓ│å Ó▓╣Ó▓éÓ▓ÜÓ▓┐Ó▓òÓ│èÓ▓│Ó│ìÓ▓│Ó▓┐" | |
(mn) "ðöð░ÐÇð░ð░ÐàÐéð░ð╣ ÐàÐâð▓ð░ð░ð╗Ðåð░Ðà" | |
(ko) "Û│Áý£á ÙîÇýâü:" | |
(lo) "Ó╗üÓ║ÜÓ╗êÓ║çÓ║øÓ║▒Ó║ÖÓ║üÓ║▒Ó║Ü" | |
(ro) "Trimite╚øi la" | |
(sq) "Ndaje me" | |
(ar) "┘àÏ┤ϺÏ▒┘âÏ® ┘àÏ╣" | |
(fr) "Partager avec" | |
(hr) "Dijeli s" | |
(mr) "Óñ»Óñ¥ÓñéÓñÜÓÑìÓñ»Óñ¥Óñ©ÓÑïÓñ¼Óññ ÓñÂÓÑçÓñàÓñ░ ÓñòÓñ░Óñ¥" | |
(or) "Ó¼ÅÓ¼╣Ó¼¥Ó¼ÖÓ¡ìÓ¼ò Ó¼©Ó¼╣ Ó¼©Ó¡çÓ¡ƒÓ¼¥Ó¼░Ó¡ìÔÇî Ó¼òÓ¼░Ó¼¿Ó¡ìÓ¼ñÓ¡ü" | |
(sr) "ðöðÁð╗ð©ÐéðÁ ð┐ð¥ð╝ð¥ÐøÐâ" | |
(b+sr+Latn) "Delite pomo─çu" | |
(tr) "┼×ununla payla┼ƒ:" | |
(ur) "ϺÏ│ ┌®█Æ Ï│ϺϬ┌¥ ϺÏ┤ϬÏ▒Ϻ┌® ┌®Ï▒█î┌║" | |
(as) "ÓªçÓª»Óª╝Óª¥Óº░ Óª£Óº░Óª┐Óª»Óª╝ÓªñÓºç ÓªÂÓºìÓª¼ÓºçÓª»Óª╝Óª¥Óº░ ÓªòÓº░Óªò" | |
(bs) "Dijeli sa" | |
(cs) "Sdílet s" | |
(es) "Compartir con" | |
(is) "Deila me├░" | |
(ms) "Kongsi dengan" | |
(et) "Jaga:" | |
(it) "Condividi con" | |
(lt) "Bendrinti su" | |
(pt) "Compartilhar com" | |
(eu) "Partekatu honekin" | |
(gu) "Ó¬åÓ¬¿Ó½Ç Ó¬©Ó¬¥Ó¬ÑÓ½ç Ó¬ÂÓ½çÓ¬░ Ó¬òÓ¬░Ó½ï" | |
(hu) "Megoszt├ís a k├Âvetkez┼ævel:" | |
(ru) "ðƒð¥ð┤ðÁð╗ð©ÐéÐîÐüÐÅ Ðü ð┐ð¥ð╝ð¥ÐëÐîÐÄ" | |
(zu) "Yabelana no" | |
(lv) "Kop─½got ar:" | |
(sv) "Dela med" | |
(iw) "ήÎÖάÎòÎú ÎóÎØ" | |
(sw) "Shiriki na" | |
(hy) "È┐ı½ı¢ı¥ıÑı¼ÔǪ" | |
(ky) "ðóË®ð╝Ë®ð¢ð║Ê» ð╝ðÁð¢ðÁð¢ ð▒Ë®ð╗Ê»Ðêʻʻ" | |
(my) "ßÇößÇ¥ßÇäßÇÀßÇ║ ßÇÖßÇ╗ßÇ¥ßÇØßÇ▒ßÇøßÇößÇ║" | |
(az) "Paylaşın" | |
(uz) "Ulashish" | |
(en-rCA) "Share with" | |
(fr-rCA) "Partager avec" | |
(en-rGB) "Share with" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄShare withÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "Õêåõ║½Õ░ìÞ▒í" | |
(zh-rCN) "Õêåõ║½Õ»╣Þ▒í" | |
(en-rIN) "Share with" | |
(pt-rBR) "Compartilhar com" | |
(es-rUS) "Compartir con" | |
(pt-rPT) "Partilhar com" | |
(en-rAU) "Share with" | |
(zh-rTW) "Õêåõ║½Õ░ìÞ▒í" | |
resource 0x7f0c0019 string/abc_shareactionprovider_share_with_application | |
() "Share with %s" | |
(ca) "Comparteix amb %s" | |
(da) "Del med %s" | |
(fa) "┘ç┘àÔÇîÏ▒Ï│Ϻ┘å█î ϿϺ %s" | |
(ja) "%sÒü¿Õà▒µ£ë" | |
(ka) "%s-ით გაზიარება" | |
(pa) "%s Ó¿¿Ó¿¥Ó¿▓ Ó¿©Ó¿¥Ó¿éÓ¿ØÓ¿¥ Ó¿òÓ¿░Ó®ï" | |
(ta) "%s Ó««Ó»éÓ«▓Ó««Ó»ì Ó«¬Ó«òÓ«┐Ó«░Ó»ì" | |
(nb) "Del med %s" | |
(be) "ðÉð▒ð░ð│Ðâð╗ÐûÐåÐî ð┐ÐÇð░ðÀ ð┐ÐÇð░ð│ÐÇð░ð╝Ðâ "%s"" | |
(de) "Mit %s teilen" | |
(ne) "%s Óñ«Óñ¥Óñ░ÓÑìÓñ½Óññ ÓñåÓñªÓñ¥Óñ¿ Óñ¬ÓÑìÓñ░ÓñªÓñ¥Óñ¿ ÓñùÓñ░ÓÑìÓñ¿ÓÑüÓñ╣ÓÑïÓñ©ÓÑì" | |
(te) "%sÓ░ñÓ▒ï Ó░ÀÓ▒çÓ░░Ó▒ì Ó░ÜÓ▒çÓ░©Ó▒ìÓ░ñÓ▒üÓ░éÓ░ªÓ░┐" | |
(af) "Deel met %s" | |
(bg) "ðíð┐ð¥ð┤ðÁð╗ÐÅð¢ðÁ ÐüÐèÐü: %s" | |
(th) "Ó╣üÓ©èÓ©úÓ╣îÓ©ùÓ©▓Ó©ç %s" | |
(fi) "Jaa: %s" | |
(hi) "%s Óñ©ÓÑç ÓñÂÓÑçÓñ»Óñ░ ÓñòÓñ░ÓÑçÓñé" | |
(si) "%s ÓÀâÓ©Óƒ ÓÂÂÓÀÖÓ»ÓÀÅ Ó£ÓÂ▒ÓÀèÓÂ▒" | |
(vi) "Chia sß║╗ vß╗øi %s" | |
(kk) "%s Êøð¥ð╗ð┤ð░ð¢ð▒ð░ÐüÐïð╝ðÁð¢ ð▒Ë®ð╗ÐûÐüÐâ" | |
(mk) "ðíð┐ð¥ð┤ðÁð╗ð© Ðüð¥ %s" | |
(sk) "Zdieĝať s aplikáciou %s" | |
(uk) "ðƒð¥ð┤Ðûð╗ð©Ðéð©ÐüÐÅ ÐçðÁÐÇðÁðÀ ð┤ð¥ð┤ð░Ðéð¥ð║ %s" | |
(el) "╬Ü╬┐╬╣╬¢╬┐¤Ç╬┐╬»╬À¤â╬À ¤â¤ä╬À╬¢ ╬Á¤å╬▒¤ü╬╝╬┐╬│╬« %s" | |
(gl) "Comparte contido coa aplicaci├│n %s" | |
(ml) "%s Ó┤ÄÓ┤¿ÓÁìÓ┤¿Ó┤ñÓÁüÓ┤«Ó┤¥Ó┤»Ó┤┐ Ó┤¬Ó┤ÖÓÁìÓ┤òÓ┤┐Ó┤ƒÓÁüÓ┤ò" | |
(nl) "Delen met %s" | |
(pl) "Udost─Öpnij przez: %s" | |
(sl) "Skupna raba z drugimi prek aplikacije %s" | |
(tl) "Ibahagi gamit ang %s" | |
(am) "ßêê%s ßèáßîïßê½" | |
(km) "ß×à߃éß×ÇÔÇïß×Ü߃åß×øßƒéß×ÇÔÇïß×çß×ÂÔÇïß×ÿß×¢ß×Ö %s" | |
(bn) "%s-ÓªÅÓª░ Óª©Óª¥ÓªÑÓºç ÓªÂÓºçÓª»Óª╝Óª¥Óª░ ÓªòÓª░ÓºüÓª¿" | |
(in) "Bagikan dengan %s" | |
(kn) "%s Ó▓¿Ó│èÓ▓éÓ▓ªÓ▓┐Ó▓ùÓ│å Ó▓╣Ó▓éÓ▓ÜÓ▓┐Ó▓òÓ│èÓ▓│Ó│ìÓ▓│Ó▓┐" | |
(mn) "%s-Ðéð░ð╣ ÐàÐâð▓ð░ð░ð╗Ðåð░Ðà" | |
(ko) "%sÛ│╝(ýÖÇ) Û│Áý£á" | |
(lo) "Ó╗üÓ║ÜÓ╗êÓ║çÓ║øÓ║▒Ó║ÖÓ║öÓ╗ëÓ║ºÓ║ì %s" | |
(ro) "Trimite╚øi folosind %s" | |
(sq) "Ndaje me %s" | |
(ar) "┘àÏ┤ϺÏ▒┘âÏ® ┘àÏ╣ %s" | |
(fr) "Partager avec %s" | |
(hr) "Dijeli putem aplikacije %s" | |
(mr) "%s Óñ©Óñ╣ ÓñÂÓÑçÓñàÓñ░ ÓñòÓñ░Óñ¥" | |
(or) "%s Ó¼©Ó¼╣ Ó¼©Ó¡çÓ¡ƒÓ¼¥Ó¼░Ó¡ìÔÇì Ó¼òÓ¼░Ó¼¿Ó¡ìÓ¼ñÓ¡ü" | |
(sr) "ðöðÁð╗ð©ÐéðÁ ð┐ð¥ð╝ð¥ÐøÐâ ð░ð┐ð╗ð©ð║ð░Ðåð©ÐÿðÁ %s" | |
(b+sr+Latn) "Delite pomo─çu aplikacije %s" | |
(tr) "%s ile paylaş" | |
(ur) "%s ┌®█Æ Ï│ϺϬ┌¥ ϺÏ┤ϬÏ▒Ϻ┌® ┌®Ï▒█î┌║" | |
(as) "%sÓº░ Óª£Óº░Óª┐Óª»Óª╝ÓªñÓºç ÓªÂÓºìÓª¼ÓºçÓª»Óª╝Óª¥Óº░ ÓªòÓº░Óªò" | |
(bs) "Dijeli putem aplikacije %s" | |
(cs) "Sdílet s aplikací %s" | |
(es) "Compartir con %s" | |
(is) "Deila me├░ %s" | |
(ms) "Kongsi dengan %s" | |
(et) "Jagamine rakendusega %s" | |
(it) "Condividi tramite %s" | |
(lt) "Bendrinti naudojant program─à ÔÇ×%sÔÇ£" | |
(pt) "Compartilhar com %s" | |
(eu) "Partekatu %s aplikazioarekin" | |
(gu) "%sÓ¬¿Ó½Ç Ó¬©Ó¬¥Ó¬ÑÓ½ç Ó¬ÂÓ½çÓ¬░ Ó¬òÓ¬░Ó½ï" | |
(hu) "Megoszt├ís a k├Âvetkez┼æ alkalmaz├íssal: %s" | |
(ru) "ðƒð¥ð┤ðÁð╗ð©ÐéÐîÐüÐÅ Ðü ð┐ð¥ð╝ð¥ÐëÐîÐÄ %s" | |
(zu) "Yabelana ne-%s" | |
(lv) "Kop─½got ar lietojumprogrammu %s" | |
(sv) "Dela med %s" | |
(iw) "ήÎÖάÎòÎú ÎóÎØ %s" | |
(sw) "Shiriki ukitumia %s" | |
(hy) "È┐ı½ı¢ı¥ıÑı¼ %s ı░ıíı¥ıÑı¼ı¥ıíı«ı½ ı┤ı½ı╗ı©Íüı©ı¥" | |
(ky) "%s ð░ÐÇð║Ðïð╗ÐâÐâ ð▒Ë®ð╗Ê»Ðêʻʻ" | |
(my) "%s ßÇûßÇ╝ßÇäßÇÀßÇ║ ßÇÖßÇ╗ßÇ¥ßÇØßÇ▒ßÇøßÇößÇ║" | |
(az) "%s ilə paylaşın" | |
(uz) "%s orqali ulashish" | |
(en-rCA) "Share with %s" | |
(fr-rCA) "Partager avec %s" | |
(en-rGB) "Share with %s" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄShare with ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄ%sÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "õ¢┐þö¿ÒÇî%sÒÇìÕêåõ║½" | |
(zh-rCN) "õ©Ä%sÕêåõ║½" | |
(en-rIN) "Share with %s" | |
(pt-rBR) "Compartilhar com %s" | |
(es-rUS) "Compartir con %s" | |
(pt-rPT) "Partilhar com a aplicação %s" | |
(en-rAU) "Share with %s" | |
(zh-rTW) "ÞêçÒÇî%sÒÇìÕêåõ║½" | |
resource 0x7f0c001a string/abc_toolbar_collapse_description | |
() "Collapse" | |
(ca) "Replega" | |
(da) "Skjul" | |
(fa) "┌®┘ê┌å┌® ┌®Ï▒Ï»┘å" | |
(ja) "µèÿÒéèÒüƒÒüƒÒéÇ" | |
(ka) "ßâ®ßâÉßâÖßâößâ¬ßâòßâÉ" | |
(pa) "Ó¿©Ó¿«Ó®çÓ¿ƒÓ®ï" | |
(ta) "Ó«ÜÓ»üÓ«░Ó»üÓ«òÓ»ìÓ«òÓ»üÓ««Ó»ì" | |
(nb) "Skjul" | |
(be) "ðùð│ð░ÐÇð¢ÐâÐåÐî" | |
(de) "Minimieren" | |
(ne) "Óñ©ÓñéÓñòÓÑìÓñÀÓñ┐Óñ¬ÓÑìÓññ ÓñùÓñ░ÓÑìÓñ¿ÓÑüÓñ╣ÓÑïÓñ©ÓÑì" | |
(te) "Ó░òÓ▒üÓ░ªÓ░┐Ó░©Ó▒ìÓ░ñÓ▒üÓ░éÓ░ªÓ░┐" | |
(af) "Vou in" | |
(bg) "ðíð▓ð©ð▓ð░ð¢ðÁ" | |
(th) "Ó©óÓ©©Ó©Ü" | |
(fi) "Tiivistä" | |
(hi) "ÓñøÓÑïÓñƒÓñ¥ ÓñòÓñ░ÓÑçÓñé" | |
(si) "ÓÀäÓÂÜÓÀöÓÀàÓÂ▒ÓÀèÓÂ▒" | |
(vi) "Thu gọn" | |
(kk) "ðûð©ÐÄ" | |
(mk) "ðíð¥ð▒ðÁÐÇð©" | |
(sk) "Zbaliť" | |
(uk) "ðùð│ð¥ÐÇð¢ÐâÐéð©" | |
(el) "╬ú¤ì╬╝¤Ç¤ä¤à╬¥╬À" | |
(gl) "Contrae" | |
(ml) "Ó┤ÜÓÁüÓ┤░ÓÁüÓ┤òÓÁìÓ┤òÓÁüÓ┤ò" | |
(nl) "Samenvouwen" | |
(pl) "Zwiń" | |
(sl) "Strnitev" | |
(tl) "I-collapse" | |
(am) "ßê░ßëÑßêÁßëÑ" | |
(km) "ß×öß×ä߃Æß×Üß×¢ß×ÿ" | |
(bn) "Óª©ÓªÖÓºìÓªòÓºüÓªÜÓª┐Óªñ ÓªòÓª░ÓºüÓª¿" | |
(in) "Ciutkan" | |
(kn) "Ó▓òÓ│üÓ▓ùÓ│ìÓ▓ùÓ▓┐Ó▓©Ó▓┐" | |
(mn) "ðæÐâÐâð╗ð│ð░Ðà" | |
(ko) "ýáæÛ©░" | |
(lo) "Ó║½Ó║ìÓ╗ìÓ╗ëÓ║ÑÓ║╗Ó║ç" | |
(ro) "Restr├ónge╚øi" | |
(sq) "Palos" | |
(ar) "ϬÏÁÏ║┘èÏ▒" | |
(fr) "R├®duire" | |
(hr) "Saŝmi" | |
(mr) "ÓñòÓÑïÓñ▓ÓÑàÓñ¬ÓÑìÓñ© ÓñòÓñ░Óñ¥" | |
(or) "Ó¼©Ó¼éÓ¼òÓ¡üÓ¼ÜÓ¼┐Ó¼ñ Ó¼òÓ¼░Ó¼¿Ó¡ìÓ¼ñÓ¡ü" | |
(sr) "ðíð║Ðâð┐ð©" | |
(b+sr+Latn) "Skupi" | |
(tr) "Daralt" | |
(ur) "Ï│┌®█î┌æ█î┌║" | |
(as) "Óª©ÓªéÓªòÓºïÓªÜÓª¿ ÓªòÓº░Óªò" | |
(bs) "Suzi" | |
(cs) "Sbalit" | |
(es) "Ocultar" | |
(is) "Minnka" | |
(ms) "Runtuhkan" | |
(et) "Ahendamine" | |
(it) "Comprimi" | |
(lt) "Sutraukti" | |
(pt) "Recolher" | |
(eu) "Tolestu" | |
(gu) "Ó¬©Ó¬éÓ¬òÓ½üÓ¬ÜÓ¬┐Ó¬ñ Ó¬òÓ¬░Ó½ï" | |
(hu) "Összecsukás" | |
(ru) "ðíð▓ðÁÐÇð¢ÐâÐéÐî" | |
(zu) "Goqa" | |
(lv) "Sak─╝aut" | |
(sv) "Komprimera" | |
(iw) "ÎøÎÖÎòÎòÎÑ" | |
(sw) "Kunja" | |
(hy) "È¥ıíı¼ıÑı¼" | |
(ky) "ðûÐïð╣ÐïÐêÐéÐïÐÇÐâÐâ" | |
(my) "ßÇ£ßÇ╗ßÇ¥ßÇ▒ßǼßÇÀßÇòßÇ╝ßÇøßÇößÇ║" | |
(az) "Yığcamlaşdırın" | |
(uz) "YigÔÇÿish" | |
(en-rCA) "Collapse" | |
(fr-rCA) "R├®duire" | |
(en-rGB) "Collapse" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄCollapseÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "µöÂÕÉê" | |
(zh-rCN) "µöÂÞÁÀ" | |
(en-rIN) "Collapse" | |
(pt-rBR) "Recolher" | |
(es-rUS) "Contraer" | |
(pt-rPT) "Reduzir" | |
(en-rAU) "Collapse" | |
(zh-rTW) "µöÂÕÉê" | |
resource 0x7f0c001b string/app_name | |
() "Resources Resolution Bug" | |
resource 0x7f0c001c string/search_menu_title | |
() "Search" | |
(ca) "Cerca" | |
(da) "S├©g" | |
(fa) "ϼÏ│Ϭϼ┘ê" | |
(ja) "µñ£þ┤ó" | |
(ka) "ძიება" | |
(pa) "Ó¿ûÓ®ïÓ¿£" | |
(ta) "Ó«ñÓ»çÓ«ƒÓ«▓Ó»ì" | |
(nb) "S├©k" | |
(be) "ðƒð¥ÐêÐâð║" | |
(de) "Suche" | |
(ne) "" | |
(te) "Ó░ÂÓ▒ïÓ░ºÓ░¿" | |
(af) "Soek" | |
(bg) "ðóÐèÐÇÐüðÁð¢ðÁ" | |
(th) "Ó©äÓ╣ëÓ©ÖÓ©½Ó©▓" | |
(fi) "Haku" | |
(hi) "" | |
(si) "ÓÀâÓÀÖÓÀÇÓÀôÓ©" | |
(vi) "Tìm kiếm" | |
(kk) "ðåðÀð┤ðÁÐâ" | |
(mk) "ðƒÐÇðÁð▒ð░ÐÇð░Ðÿ" | |
(sk) "Hĝadať" | |
(uk) "ðƒð¥ÐêÐâð║" | |
(el) "╬æ╬¢╬▒╬Â╬«¤ä╬À¤â╬À" | |
(gl) "Buscar" | |
(ml) "Ó┤ñÓ┤┐Ó┤░Ó┤»ÓÁüÓ┤ò" | |
(nl) "Zoeken" | |
(pl) "Szukaj" | |
(sl) "Iskanje" | |
(tl) "Maghanap" | |
(am) "ßììßêêßîï" | |
(km) "ß׃߃Æßף߃éß×äß×Üß×Ç" | |
(bn) "Óª©Óª¥Óª░ÓºìÓªÜ ÓªòÓª░ÓºüÓª¿" | |
(in) "Telusuri" | |
(kn) "Ó▓╣Ó│üÓ▓íÓ│üÓ▓òÓ▓┐" | |
(mn) "ðÑð░ð╣Ðà" | |
(ko) "Û▓Çýâë" | |
(lo) "Ó║èÓ║¡Ó║üÓ║½Ó║▓" | |
(ro) "C─âuta╚øi" | |
(sq) "Kërko" | |
(ar) "Ϻ┘äϿϡϽ" | |
(fr) "Rechercher" | |
(hr) "Pretraŝi" | |
(mr) "ÓñÂÓÑïÓñº" | |
(or) "Ó¼©Ó¼░Ó¡ìÓ¼ÜÓ¡ìÓ¼Ü Ó¼òÓ¼░Ó¼¿Ó¡ìÓ¼ñÓ¡ü" | |
(sr) "ðƒÐÇðÁÐéÐÇð░ðÂð©ÐéðÁ" | |
(b+sr+Latn) "Pretraŝite" | |
(tr) "Ara" | |
(ur) "Ϭ┘äϺÏ┤ ┌®Ï▒█î┌║" | |
(as) "Óª©Óª¿ÓºìÓªºÓª¥Óª¿" | |
(bs) "Pretraŝite" | |
(cs) "Hledat" | |
(es) "Buscar" | |
(is) "Leit" | |
(ms) "Cari" | |
(et) "Otsing" | |
(it) "Cerca" | |
(lt) "Ieškoti" | |
(pt) "Pesquisar" | |
(eu) "Bilatu" | |
(gu) "Ó¬ÂÓ½ïÓ¬ºÓ½ï" | |
(hu) "Keres├®s" | |
(ru) "ðƒð¥ð©Ðüð║" | |
(zu) "Sesha" | |
(lv) "Mekl─ôt" | |
(sv) "S├Âk" | |
(iw) "ÎùÎÖÎñÎòή" | |
(sw) "Tafuta" | |
(hy) "ıêÍÇı©ıÂıÑı¼" | |
(ky) "ðÿðÀð┤ˮˮ" | |
(my) "ßÇøßÇ¥ßǼßÇûßÇ¢ßÇ▒ßÇÖßÇ¥ßÇ»" | |
(az) "Axtar─▒n" | |
(uz) "Qidiruv" | |
(en-rCA) "Search" | |
(fr-rCA) "Rechercher" | |
(en-rGB) "Search" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄSearchÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "µÉ£Õ░ï" | |
(zh-rCN) "µÉ£þ┤ó" | |
(en-rIN) "Search" | |
(pt-rBR) "Pesquisar" | |
(es-rUS) "Buscar" | |
(pt-rPT) "Pesquisar" | |
(en-rAU) "Search" | |
(zh-rTW) "µÉ£Õ░ï" | |
resource 0x7f0c001d string/status_bar_notification_info_overflow | |
() "999+" | |
(ca) "999+" | |
(da) "999+" | |
(fa) "999+" | |
(ja) "999+" | |
(ka) "999+" | |
(pa) "999+" | |
(ta) "999+" | |
(nb) "999+" | |
(be) "999+" | |
(de) "999+" | |
(ne) "ÓÑ»ÓÑ»ÓÑ»+" | |
(te) "999+" | |
(af) "999+" | |
(bg) "999+" | |
(th) "999+" | |
(fi) "999+" | |
(hi) "999+" | |
(si) "999+" | |
(vi) "999+" | |
(kk) "999+" | |
(mk) "999+" | |
(sk) "999+" | |
(uk) "999+" | |
(el) "999+" | |
(gl) ">999" | |
(ml) "999+" | |
(nl) "999+" | |
(pl) "999+" | |
(sl) "999+" | |
(tl) "999+" | |
(am) "999+" | |
(km) "999+" | |
(bn) "Óº»Óº»Óº»+" | |
(in) "999+" | |
(kn) "999+" | |
(mn) "999+" | |
(ko) "999+" | |
(lo) "999+" | |
(ro) "999+" | |
(sq) "999+" | |
(ar) "999+" | |
(fr) "999+" | |
(hr) "999+" | |
(mr) "ÓÑ»ÓÑ»ÓÑ»+" | |
(or) "999+" | |
(sr) "999+" | |
(b+sr+Latn) "999+" | |
(tr) "999+" | |
(ur) "+999" | |
(as) "Óº»Óº»Óº»+" | |
(bs) "999+" | |
(cs) "999+" | |
(es) "999+" | |
(is) "999+" | |
(ms) "999+" | |
(et) "999+" | |
(it) "999+" | |
(lt) "999+" | |
(pt) "999+" | |
(eu) "999+" | |
(gu) "999+" | |
(hu) "999+" | |
(ru) ">999" | |
(zu) "999+" | |
(lv) "999+" | |
(sv) "999+" | |
(iw) "999+" | |
(sw) "999+" | |
(hy) "999+" | |
(ky) "999+" | |
(my) "ßüëßüëßüë+" | |
(az) "999+" | |
(uz) "999+" | |
(en-rCA) "999+" | |
(fr-rCA) "999+" | |
(en-rGB) "999+" | |
(en-rXC) "ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÅÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÅÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÅÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄÔÇÄ999+ÔÇÄÔÇÅÔÇÄÔÇÄÔÇÅÔÇÄ" | |
(zh-rHK) "999+" | |
(zh-rCN) "999+" | |
(en-rIN) "999+" | |
(pt-rBR) "999+" | |
(es-rUS) "999+" | |
(pt-rPT) "999+" | |
(en-rAU) "999+" | |
(zh-rTW) "999+" | |
type style id=0d entryCount=350 | |
resource 0x7f0d0000 style/AlertDialog.AppCompat | |
() (style) size=0 parent=style/Base.AlertDialog.AppCompat (0x7f0d0006) | |
resource 0x7f0d0001 style/AlertDialog.AppCompat.Light | |
() (style) size=0 parent=style/Base.AlertDialog.AppCompat.Light (0x7f0d0007) | |
resource 0x7f0d0002 style/Animation.AppCompat.Dialog | |
() (style) size=0 parent=style/Base.Animation.AppCompat.Dialog (0x7f0d0008) | |
resource 0x7f0d0003 style/Animation.AppCompat.DropDownUp | |
() (style) size=0 parent=style/Base.Animation.AppCompat.DropDownUp (0x7f0d0009) | |
resource 0x7f0d0004 style/Animation.AppCompat.Tooltip | |
() (style) size=0 parent=style/Base.Animation.AppCompat.Tooltip (0x7f0d000a) | |
resource 0x7f0d0005 style/AppTheme | |
() (style) size=3 parent=style/Theme.AppCompat.Light.DarkActionBar (0x7f0d0103) | |
colorAccent(0x7f02004f)=@color/colorAccent | |
colorPrimary(0x7f020056)=@color/colorPrimary | |
colorPrimaryDark(0x7f020057)=@color/colorPrimaryDark | |
resource 0x7f0d0006 style/Base.AlertDialog.AppCompat | |
() (style) size=6 parent=0x01030012 | |
0x010100f2=@layout/abc_alert_dialog_material | |
buttonIconDimen(0x7f020041)=@dimen/abc_alert_dialog_button_dimen | |
listItemLayout(0x7f0200d5)=@layout/select_dialog_item_material | |
listLayout(0x7f0200d6)=@layout/abc_select_dialog_material | |
multiChoiceItemLayout(0x7f0200e5)=@layout/select_dialog_multichoice_material | |
singleChoiceItemLayout(0x7f020108)=@layout/select_dialog_singlechoice_material | |
resource 0x7f0d0007 style/Base.AlertDialog.AppCompat.Light | |
() (style) size=0 parent=style/Base.AlertDialog.AppCompat (0x7f0d0006) | |
resource 0x7f0d0008 style/Base.Animation.AppCompat.Dialog | |
() (style) size=2 parent=0x01030000 | |
0x010100b4=@anim/abc_popup_enter | |
0x010100b5=@anim/abc_popup_exit | |
resource 0x7f0d0009 style/Base.Animation.AppCompat.DropDownUp | |
() (style) size=2 parent=0x01030000 | |
0x010100b4=@anim/abc_grow_fade_in_from_bottom | |
0x010100b5=@anim/abc_shrink_fade_out_from_bottom | |
resource 0x7f0d000a style/Base.Animation.AppCompat.Tooltip | |
() (style) size=2 parent=0x01030000 | |
0x010100b4=@anim/abc_tooltip_enter | |
0x010100b5=@anim/abc_tooltip_exit | |
resource 0x7f0d000b style/Base.DialogWindowTitle.AppCompat | |
() (style) size=3 parent=0x01030012 | |
0x01010034=@style/TextAppearance.AppCompat.Title | |
0x01010153=1 | |
0x0101015b=true | |
resource 0x7f0d000c style/Base.DialogWindowTitleBackground.AppCompat | |
() (style) size=4 parent=0x01030012 | |
0x010100d4=@null | |
0x010100d6=?attr/dialogPreferredPadding | |
0x010100d7=@dimen/abc_dialog_padding_top_material | |
0x010100d8=?attr/dialogPreferredPadding | |
resource 0x7f0d000d style/Base.TextAppearance.AppCompat | |
() (style) size=0 parent=0x010301ed | |
resource 0x7f0d000e style/Base.TextAppearance.AppCompat.Body1 | |
() (style) size=0 parent=0x010301f0 | |
resource 0x7f0d000f style/Base.TextAppearance.AppCompat.Body2 | |
() (style) size=0 parent=0x010301ef | |
resource 0x7f0d0010 style/Base.TextAppearance.AppCompat.Button | |
() (style) size=0 parent=0x010301ee | |
resource 0x7f0d0011 style/Base.TextAppearance.AppCompat.Caption | |
() (style) size=0 parent=0x010301f1 | |
resource 0x7f0d0012 style/Base.TextAppearance.AppCompat.Display1 | |
() (style) size=0 parent=0x010301f6 | |
resource 0x7f0d0013 style/Base.TextAppearance.AppCompat.Display2 | |
() (style) size=0 parent=0x010301f5 | |
resource 0x7f0d0014 style/Base.TextAppearance.AppCompat.Display3 | |
() (style) size=0 parent=0x010301f4 | |
resource 0x7f0d0015 style/Base.TextAppearance.AppCompat.Display4 | |
() (style) size=0 parent=0x010301f3 | |
resource 0x7f0d0016 style/Base.TextAppearance.AppCompat.Headline | |
() (style) size=0 parent=0x010301f7 | |
resource 0x7f0d0017 style/Base.TextAppearance.AppCompat.Inverse | |
() (style) size=0 parent=0x010301f8 | |
resource 0x7f0d0018 style/Base.TextAppearance.AppCompat.Large | |
() (style) size=0 parent=0x010301f9 | |
resource 0x7f0d0019 style/Base.TextAppearance.AppCompat.Large.Inverse | |
() (style) size=0 parent=0x010301fa | |
resource 0x7f0d001a style/Base.TextAppearance.AppCompat.Light.Widget.PopupMenu.Large | |
() (style) size=0 parent=0x0103021b | |
resource 0x7f0d001b style/Base.TextAppearance.AppCompat.Light.Widget.PopupMenu.Small | |
() (style) size=0 parent=0x0103021c | |
resource 0x7f0d001c style/Base.TextAppearance.AppCompat.Medium | |
() (style) size=0 parent=0x010301fb | |
resource 0x7f0d001d style/Base.TextAppearance.AppCompat.Medium.Inverse | |
() (style) size=0 parent=0x010301fc | |
resource 0x7f0d001e style/Base.TextAppearance.AppCompat.Menu | |
() (style) size=0 parent=0x010301fd | |
resource 0x7f0d001f style/Base.TextAppearance.AppCompat.SearchResult | |
() (style) size=3 | |
0x01010097=0x00000000 | |
0x01010098=?0x01010036 | |
0x0101009a=?0x0101009a | |
resource 0x7f0d0020 style/Base.TextAppearance.AppCompat.SearchResult.Subtitle | |
() (style) size=0 parent=0x01030204 | |
resource 0x7f0d0021 style/Base.TextAppearance.AppCompat.SearchResult.Title | |
() (style) size=0 parent=0x01030205 | |
resource 0x7f0d0022 style/Base.TextAppearance.AppCompat.Small | |
() (style) size=0 parent=0x01030206 | |
resource 0x7f0d0023 style/Base.TextAppearance.AppCompat.Small.Inverse | |
() (style) size=0 parent=0x01030207 | |
resource 0x7f0d0024 style/Base.TextAppearance.AppCompat.Subhead | |
() (style) size=0 parent=0x01030208 | |
resource 0x7f0d0025 style/Base.TextAppearance.AppCompat.Subhead.Inverse | |
() (style) size=4 parent=style/Base.TextAppearance.AppCompat.Subhead (0x7f0d0024) | |
0x01010098=?0x01010039 | |
0x01010099=?0x0101034f | |
0x0101009a=?0x0101003f | |
0x0101009b=?0x01010350 | |
resource 0x7f0d0026 style/Base.TextAppearance.AppCompat.Title | |
() (style) size=0 parent=0x01030209 | |
resource 0x7f0d0027 style/Base.TextAppearance.AppCompat.Title.Inverse | |
() (style) size=4 parent=style/Base.TextAppearance.AppCompat.Title (0x7f0d0026) | |
0x01010098=?0x01010039 | |
0x01010099=?0x0101034f | |
0x0101009a=?0x0101003f | |
0x0101009b=?0x01010350 | |
resource 0x7f0d0028 style/Base.TextAppearance.AppCompat.Tooltip | |
() (style) size=1 parent=style/Base.TextAppearance.AppCompat (0x7f0d000d) | |
0x01010095=14.000000sp | |
resource 0x7f0d0029 style/Base.TextAppearance.AppCompat.Widget.ActionBar.Menu | |
() (style) size=2 parent=style/TextAppearance.AppCompat.Button (0x7f0d00c0) | |
0x01010098=?attr/actionMenuTextColor | |
textAllCaps(0x7f02011a)=@bool/abc_config_actionMenuItemAllCaps | |
(v23) (style) size=0 parent=0x0103020c | |
resource 0x7f0d002a style/Base.TextAppearance.AppCompat.Widget.ActionBar.Subtitle | |
() (style) size=0 parent=0x0103020d | |
resource 0x7f0d002b style/Base.TextAppearance.AppCompat.Widget.ActionBar.Subtitle.Inverse | |
() (style) size=0 parent=0x0103020e | |
resource 0x7f0d002c style/Base.TextAppearance.AppCompat.Widget.ActionBar.Title | |
() (style) size=0 parent=0x0103020f | |
resource 0x7f0d002d style/Base.TextAppearance.AppCompat.Widget.ActionBar.Title.Inverse | |
() (style) size=0 parent=0x01030210 | |
resource 0x7f0d002e style/Base.TextAppearance.AppCompat.Widget.ActionMode.Subtitle | |
() (style) size=0 parent=0x01030211 | |
resource 0x7f0d002f style/Base.TextAppearance.AppCompat.Widget.ActionMode.Title | |
() (style) size=0 parent=0x01030213 | |
resource 0x7f0d0030 style/Base.TextAppearance.AppCompat.Widget.Button | |
() (style) size=0 parent=0x01030215 | |
resource 0x7f0d0031 style/Base.TextAppearance.AppCompat.Widget.Button.Borderless.Colored | |
() (style) size=1 parent=style/Base.TextAppearance.AppCompat.Widget.Button (0x7f0d0030) | |
0x01010098=@color/abc_btn_colored_borderless_text_material | |
(v24) (style) size=0 parent=0x010302df | |
resource 0x7f0d0032 style/Base.TextAppearance.AppCompat.Widget.Button.Colored | |
() (style) size=1 parent=style/Base.TextAppearance.AppCompat.Widget.Button (0x7f0d0030) | |
0x01010098=@color/abc_btn_colored_text_material | |
(v24) (style) size=0 parent=0x010302de | |
resource 0x7f0d0033 style/Base.TextAppearance.AppCompat.Widget.Button.Inverse | |
() (style) size=1 parent=style/TextAppearance.AppCompat.Button (0x7f0d00c0) | |
0x01010098=?0x01010039 | |
(v23) (style) size=0 parent=0x010302d4 | |
resource 0x7f0d0034 style/Base.TextAppearance.AppCompat.Widget.DropDownItem | |
() (style) size=1 parent=0x01030046 | |
0x01010098=?0x01010037 | |
resource 0x7f0d0035 style/Base.TextAppearance.AppCompat.Widget.PopupMenu.Header | |
() (style) size=3 parent=style/TextAppearance.AppCompat (0x7f0d00bd) | |
0x01010095=@dimen/abc_text_size_menu_header_material | |
0x01010098=?0x01010038 | |
0x010103ac="sans-serif-medium" | |
resource 0x7f0d0036 style/Base.TextAppearance.AppCompat.Widget.PopupMenu.Large | |
() (style) size=0 parent=0x0103021b | |
resource 0x7f0d0037 style/Base.TextAppearance.AppCompat.Widget.PopupMenu.Small | |
() (style) size=0 parent=0x0103021c | |
resource 0x7f0d0038 style/Base.TextAppearance.AppCompat.Widget.Switch | |
() (style) size=0 parent=0x010301ee | |
resource 0x7f0d0039 style/Base.TextAppearance.AppCompat.Widget.TextView.SpinnerItem | |
() (style) size=0 parent=0x01030220 | |
resource 0x7f0d003a style/Base.TextAppearance.Widget.AppCompat.ExpandedMenu.Item | |
() (style) size=1 parent=0x01030044 | |
0x01010098=?0x01010037 | |
resource 0x7f0d003b style/Base.TextAppearance.Widget.AppCompat.Toolbar.Subtitle | |
() (style) size=0 parent=0x0103020d | |
resource 0x7f0d003c style/Base.TextAppearance.Widget.AppCompat.Toolbar.Title | |
() (style) size=0 parent=0x0103020f | |
resource 0x7f0d003d style/Base.Theme.AppCompat | |
() (style) size=0 parent=style/Base.V21.Theme.AppCompat (0x7f0d0052) | |
(v22) (style) size=0 parent=style/Base.V22.Theme.AppCompat (0x7f0d0057) | |
(v23) (style) size=0 parent=style/Base.V23.Theme.AppCompat (0x7f0d0059) | |
(v26) (style) size=0 parent=style/Base.V26.Theme.AppCompat (0x7f0d005b) | |
(v28) (style) size=0 parent=style/Base.V28.Theme.AppCompat (0x7f0d005e) | |
resource 0x7f0d003e style/Base.Theme.AppCompat.CompactMenu | |
() (style) size=3 | |
0x01010074=@style/Widget.AppCompat.ListView.Menu | |
0x010100ae=@style/Animation.AppCompat.DropDownUp | |
0x0101012c=?0x01010041 | |
resource 0x7f0d003f style/Base.Theme.AppCompat.Dialog | |
() (style) size=0 parent=style/Base.V21.Theme.AppCompat.Dialog (0x7f0d0053) | |
(watch) (style) size=2 parent=style/Base.V21.Theme.AppCompat.Dialog (0x7f0d0053) | |
0x01010057=false | |
0x01010490=0.000000dp | |
resource 0x7f0d0040 style/Base.Theme.AppCompat.Dialog.Alert | |
() (style) size=2 parent=style/Base.Theme.AppCompat.Dialog (0x7f0d003f) | |
0x01010356=@dimen/abc_dialog_min_width_major | |
0x01010357=@dimen/abc_dialog_min_width_minor | |
resource 0x7f0d0041 style/Base.Theme.AppCompat.Dialog.FixedSize | |
() (style) size=4 parent=style/Base.Theme.AppCompat.Dialog (0x7f0d003f) | |
windowFixedHeightMajor(0x7f020148)=@dimen/abc_dialog_fixed_height_major | |
windowFixedHeightMinor(0x7f020149)=@dimen/abc_dialog_fixed_height_minor | |
windowFixedWidthMajor(0x7f02014a)=@dimen/abc_dialog_fixed_width_major | |
windowFixedWidthMinor(0x7f02014b)=@dimen/abc_dialog_fixed_width_minor | |
resource 0x7f0d0042 style/Base.Theme.AppCompat.Dialog.MinWidth | |
() (style) size=2 parent=style/Base.Theme.AppCompat.Dialog (0x7f0d003f) | |
0x01010356=@dimen/abc_dialog_min_width_major | |
0x01010357=@dimen/abc_dialog_min_width_minor | |
resource 0x7f0d0043 style/Base.Theme.AppCompat.DialogWhenLarge | |
() (style) size=0 parent=style/Theme.AppCompat (0x7f0d00f5) | |
(large) (style) size=0 parent=style/Base.Theme.AppCompat.Dialog.FixedSize (0x7f0d0041) | |
resource 0x7f0d0044 style/Base.Theme.AppCompat.Light | |
() (style) size=0 parent=style/Base.V21.Theme.AppCompat.Light (0x7f0d0054) | |
(v22) (style) size=0 parent=style/Base.V22.Theme.AppCompat.Light (0x7f0d0058) | |
(v23) (style) size=0 parent=style/Base.V23.Theme.AppCompat.Light (0x7f0d005a) | |
(v26) (style) size=0 parent=style/Base.V26.Theme.AppCompat.Light (0x7f0d005c) | |
(v28) (style) size=0 parent=style/Base.V28.Theme.AppCompat.Light (0x7f0d005f) | |
resource 0x7f0d0045 style/Base.Theme.AppCompat.Light.DarkActionBar | |
() (style) size=6 parent=style/Base.Theme.AppCompat.Light (0x7f0d0044) | |
actionBarPopupTheme(0x7f020002)=@style/ThemeOverlay.AppCompat.Light | |
actionBarTheme(0x7f020009)=@style/ThemeOverlay.AppCompat.Dark.ActionBar | |
actionBarWidgetTheme(0x7f02000a)=@null | |
colorPrimary(0x7f020056)=@color/primary_material_dark | |
colorPrimaryDark(0x7f020057)=@color/primary_dark_material_dark | |
listChoiceBackgroundIndicator(0x7f0200d1)=@drawable/abc_list_selector_holo_dark | |
resource 0x7f0d0046 style/Base.Theme.AppCompat.Light.Dialog | |
() (style) size=0 parent=style/Base.V21.Theme.AppCompat.Light.Dialog (0x7f0d0055) | |
(watch) (style) size=2 parent=style/Base.V21.Theme.AppCompat.Light.Dialog (0x7f0d0055) | |
0x01010057=false | |
0x01010490=0.000000dp | |
resource 0x7f0d0047 style/Base.Theme.AppCompat.Light.Dialog.Alert | |
() (style) size=2 parent=style/Base.Theme.AppCompat.Light.Dialog (0x7f0d0046) | |
0x01010356=@dimen/abc_dialog_min_width_major | |
0x01010357=@dimen/abc_dialog_min_width_minor | |
resource 0x7f0d0048 style/Base.Theme.AppCompat.Light.Dialog.FixedSize | |
() (style) size=4 parent=style/Base.Theme.AppCompat.Light.Dialog (0x7f0d0046) | |
windowFixedHeightMajor(0x7f020148)=@dimen/abc_dialog_fixed_height_major | |
windowFixedHeightMinor(0x7f020149)=@dimen/abc_dialog_fixed_height_minor | |
windowFixedWidthMajor(0x7f02014a)=@dimen/abc_dialog_fixed_width_major | |
windowFixedWidthMinor(0x7f02014b)=@dimen/abc_dialog_fixed_width_minor | |
resource 0x7f0d0049 style/Base.Theme.AppCompat.Light.Dialog.MinWidth | |
() (style) size=2 parent=style/Base.Theme.AppCompat.Light.Dialog (0x7f0d0046) | |
0x01010356=@dimen/abc_dialog_min_width_major | |
0x01010357=@dimen/abc_dialog_min_width_minor | |
resource 0x7f0d004a style/Base.Theme.AppCompat.Light.DialogWhenLarge | |
() (style) size=0 parent=style/Theme.AppCompat.Light (0x7f0d0102) | |
(large) (style) size=0 parent=style/Base.Theme.AppCompat.Light.Dialog.FixedSize (0x7f0d0048) | |
resource 0x7f0d004b style/Base.ThemeOverlay.AppCompat | |
() (style) size=0 parent=style/Platform.ThemeOverlay.AppCompat (0x7f0d00a4) | |
resource 0x7f0d004c style/Base.ThemeOverlay.AppCompat.ActionBar | |
() (style) size=2 parent=style/Base.ThemeOverlay.AppCompat (0x7f0d004b) | |
colorControlNormal(0x7f020054)=?0x01010036 | |
searchViewStyle(0x7f020100)=@style/Widget.AppCompat.SearchView.ActionBar | |
resource 0x7f0d004d style/Base.ThemeOverlay.AppCompat.Dark | |
() (style) size=21 parent=style/Platform.ThemeOverlay.AppCompat.Dark (0x7f0d00a5) | |
0x01010030=@color/foreground_material_dark | |
0x01010031=@color/background_material_dark | |
0x01010036=@color/abc_primary_text_material_dark | |
0x01010037=@color/abc_primary_text_disable_only_material_dark | |
0x01010038=@color/abc_secondary_text_material_dark | |
0x01010039=@color/abc_primary_text_material_light | |
0x0101003a=@color/abc_secondary_text_material_light | |
0x0101003f=@color/abc_hint_foreground_material_light | |
0x01010054=@color/background_material_dark | |
0x01010099=@color/highlighted_text_material_dark | |
0x0101009a=@color/abc_hint_foreground_material_dark | |
0x01010206=@color/foreground_material_light | |
0x01010212=@color/abc_secondary_text_material_dark | |
0x01010213=@color/abc_secondary_text_material_light | |
0x010102ab=@color/abc_background_cache_hint_selector_material_dark | |
colorBackgroundFloating(0x7f020050)=@color/background_floating_material_dark | |
colorButtonNormal(0x7f020051)=@color/button_material_dark | |
colorControlHighlight(0x7f020053)=@color/ripple_material_dark | |
colorControlNormal(0x7f020054)=?0x01010038 | |
colorSwitchThumbNormal(0x7f020058)=@color/switch_thumb_material_dark | |
isLightTheme(0x7f02009a)=false | |
resource 0x7f0d004e style/Base.ThemeOverlay.AppCompat.Dark.ActionBar | |
() (style) size=2 parent=style/Base.ThemeOverlay.AppCompat.Dark (0x7f0d004d) | |
colorControlNormal(0x7f020054)=?0x01010036 | |
searchViewStyle(0x7f020100)=@style/Widget.AppCompat.SearchView.ActionBar | |
resource 0x7f0d004f style/Base.ThemeOverlay.AppCompat.Dialog | |
() (style) size=0 parent=style/Base.V21.ThemeOverlay.AppCompat.Dialog (0x7f0d0056) | |
(watch) (style) size=2 parent=style/Base.V21.ThemeOverlay.AppCompat.Dialog (0x7f0d0056) | |
0x01010057=false | |
0x01010490=0.000000dp | |
resource 0x7f0d0050 style/Base.ThemeOverlay.AppCompat.Dialog.Alert | |
() (style) size=2 parent=style/Base.ThemeOverlay.AppCompat.Dialog (0x7f0d004f) | |
0x01010356=@dimen/abc_dialog_min_width_major | |
0x01010357=@dimen/abc_dialog_min_width_minor | |
resource 0x7f0d0051 style/Base.ThemeOverlay.AppCompat.Light | |
() (style) size=22 parent=style/Platform.ThemeOverlay.AppCompat.Light (0x7f0d00a6) | |
0x01010030=@color/foreground_material_light | |
0x01010031=@color/background_material_light | |
0x01010036=@color/abc_primary_text_material_light | |
0x01010037=@color/abc_primary_text_disable_only_material_light | |
0x01010038=@color/abc_secondary_text_material_light | |
0x01010039=@color/abc_primary_text_material_dark | |
0x0101003a=@color/abc_secondary_text_material_dark | |
0x0101003f=@color/abc_hint_foreground_material_dark | |
0x01010054=@color/background_material_light | |
0x01010099=@color/highlighted_text_material_light | |
0x0101009a=@color/abc_hint_foreground_material_light | |
0x01010206=@color/foreground_material_dark | |
0x01010212=@color/abc_secondary_text_material_light | |
0x01010213=@color/abc_secondary_text_material_dark | |
0x0101028b=@color/abc_primary_text_disable_only_material_dark | |
0x010102ab=@color/abc_background_cache_hint_selector_material_light | |
colorBackgroundFloating(0x7f020050)=@color/background_floating_material_light | |
colorButtonNormal(0x7f020051)=@color/button_material_light | |
colorControlHighlight(0x7f020053)=@color/ripple_material_light | |
colorControlNormal(0x7f020054)=?0x01010038 | |
colorSwitchThumbNormal(0x7f020058)=@color/switch_thumb_material_light | |
isLightTheme(0x7f02009a)=true | |
resource 0x7f0d0052 style/Base.V21.Theme.AppCompat | |
() (style) size=32 parent=style/Base.V7.Theme.AppCompat (0x7f0d0060) | |
0x01010429=?attr/colorControlNormal | |
0x0101042a=?attr/colorControlActivated | |
0x0101042b=?attr/colorButtonNormal | |
0x0101042c=?attr/colorControlHighlight | |
0x01010433=?attr/colorPrimary | |
0x01010434=?attr/colorPrimaryDark | |
0x01010435=?attr/colorAccent | |
actionBarDivider(0x7f020000)=?0x0101039b | |
actionBarItemBackground(0x7f020001)=@drawable/abc_action_bar_item_background_material | |
actionBarSize(0x7f020003)=?0x010102eb | |
actionButtonStyle(0x7f02000b)=?0x010102d8 | |
actionModeBackground(0x7f020010)=?0x010102db | |
actionModeCloseDrawable(0x7f020012)=?0x010102dc | |
borderlessButtonStyle(0x7f020039)=?0x0101032b | |
buttonStyle(0x7f020043)=?0x01010048 | |
buttonStyleSmall(0x7f020044)=?0x01010049 | |
checkboxStyle(0x7f020048)=?0x0101006c | |
checkedTextViewStyle(0x7f020049)=?0x010103c8 | |
dividerHorizontal(0x7f02006c)=?0x0101032c | |
dividerVertical(0x7f02006e)=?0x0101030a | |
editTextBackground(0x7f02007b)=@drawable/abc_edit_text_material | |
editTextColor(0x7f02007c)=?0x01010351 | |
homeAsUpIndicator(0x7f020091)=?0x0101030b | |
listChoiceBackgroundIndicator(0x7f0200d1)=?0x010102f0 | |
listPreferredItemHeightSmall(0x7f0200db)=?0x01010387 | |
radioButtonStyle(0x7f0200fa)=?0x0101007e | |
ratingBarStyle(0x7f0200fb)=?0x0101007c | |
selectableItemBackground(0x7f020102)=?0x0101030e | |
selectableItemBackgroundBorderless(0x7f020103)=?0x0101045c | |
spinnerStyle(0x7f02010b)=?0x01010081 | |
textAppearanceLargePopupMenu(0x7f02011b)=?0x01010301 | |
textAppearanceSmallPopupMenu(0x7f020122)=?0x01010302 | |
resource 0x7f0d0053 style/Base.V21.Theme.AppCompat.Dialog | |
() (style) size=1 parent=style/Base.V7.Theme.AppCompat.Dialog (0x7f0d0061) | |
0x01010490=@dimen/abc_floating_window_z | |
resource 0x7f0d0054 style/Base.V21.Theme.AppCompat.Light | |
() (style) size=32 parent=style/Base.V7.Theme.AppCompat.Light (0x7f0d0062) | |
0x01010429=?attr/colorControlNormal | |
0x0101042a=?attr/colorControlActivated | |
0x0101042b=?attr/colorButtonNormal | |
0x0101042c=?attr/colorControlHighlight | |
0x01010433=?attr/colorPrimary | |
0x01010434=?attr/colorPrimaryDark | |
0x01010435=?attr/colorAccent | |
actionBarDivider(0x7f020000)=?0x0101039b | |
actionBarItemBackground(0x7f020001)=@drawable/abc_action_bar_item_background_material | |
actionBarSize(0x7f020003)=?0x010102eb | |
actionButtonStyle(0x7f02000b)=?0x010102d8 | |
actionModeBackground(0x7f020010)=?0x010102db | |
actionModeCloseDrawable(0x7f020012)=?0x010102dc | |
borderlessButtonStyle(0x7f020039)=?0x0101032b | |
buttonStyle(0x7f020043)=?0x01010048 | |
buttonStyleSmall(0x7f020044)=?0x01010049 | |
checkboxStyle(0x7f020048)=?0x0101006c | |
checkedTextViewStyle(0x7f020049)=?0x010103c8 | |
dividerHorizontal(0x7f02006c)=?0x0101032c | |
dividerVertical(0x7f02006e)=?0x0101030a | |
editTextBackground(0x7f02007b)=@drawable/abc_edit_text_material | |
editTextColor(0x7f02007c)=?0x01010351 | |
homeAsUpIndicator(0x7f020091)=?0x0101030b | |
listChoiceBackgroundIndicator(0x7f0200d1)=?0x010102f0 | |
listPreferredItemHeightSmall(0x7f0200db)=?0x01010387 | |
radioButtonStyle(0x7f0200fa)=?0x0101007e | |
ratingBarStyle(0x7f0200fb)=?0x0101007c | |
selectableItemBackground(0x7f020102)=?0x0101030e | |
selectableItemBackgroundBorderless(0x7f020103)=?0x0101045c | |
spinnerStyle(0x7f02010b)=?0x01010081 | |
textAppearanceLargePopupMenu(0x7f02011b)=?0x01010301 | |
textAppearanceSmallPopupMenu(0x7f020122)=?0x01010302 | |
resource 0x7f0d0055 style/Base.V21.Theme.AppCompat.Light.Dialog | |
() (style) size=1 parent=style/Base.V7.Theme.AppCompat.Light.Dialog (0x7f0d0063) | |
0x01010490=@dimen/abc_floating_window_z | |
resource 0x7f0d0056 style/Base.V21.ThemeOverlay.AppCompat.Dialog | |
() (style) size=1 parent=style/Base.V7.ThemeOverlay.AppCompat.Dialog (0x7f0d0064) | |
0x01010490=@dimen/abc_floating_window_z | |
resource 0x7f0d0057 style/Base.V22.Theme.AppCompat | |
(v22) (style) size=2 parent=style/Base.V21.Theme.AppCompat (0x7f0d0052) | |
actionModeShareDrawable(0x7f020019)=?0x01010479 | |
editTextBackground(0x7f02007b)=?0x01010352 | |
resource 0x7f0d0058 style/Base.V22.Theme.AppCompat.Light | |
(v22) (style) size=2 parent=style/Base.V21.Theme.AppCompat.Light (0x7f0d0054) | |
actionModeShareDrawable(0x7f020019)=?0x01010479 | |
editTextBackground(0x7f02007b)=?0x01010352 | |
resource 0x7f0d0059 style/Base.V23.Theme.AppCompat | |
(v23) (style) size=7 parent=style/Base.V22.Theme.AppCompat (0x7f0d0057) | |
actionBarItemBackground(0x7f020001)=?0x0101039c | |
actionMenuTextAppearance(0x7f02000e)=?0x01010360 | |
actionMenuTextColor(0x7f02000f)=?0x01010361 | |
actionOverflowButtonStyle(0x7f02001d)=?0x010102f6 | |
controlBackground(0x7f020064)=@drawable/abc_control_background_material | |
ratingBarStyleIndicator(0x7f0200fc)=?0x01010210 | |
ratingBarStyleSmall(0x7f0200fd)=?0x0101007d | |
resource 0x7f0d005a style/Base.V23.Theme.AppCompat.Light | |
(v23) (style) size=7 parent=style/Base.V22.Theme.AppCompat.Light (0x7f0d0058) | |
actionBarItemBackground(0x7f020001)=?0x0101039c | |
actionMenuTextAppearance(0x7f02000e)=?0x01010360 | |
actionMenuTextColor(0x7f02000f)=?0x01010361 | |
actionOverflowButtonStyle(0x7f02001d)=?0x010102f6 | |
controlBackground(0x7f020064)=@drawable/abc_control_background_material | |
ratingBarStyleIndicator(0x7f0200fc)=?0x01010210 | |
ratingBarStyleSmall(0x7f0200fd)=?0x0101007d | |
resource 0x7f0d005b style/Base.V26.Theme.AppCompat | |
(v26) (style) size=1 parent=style/Base.V23.Theme.AppCompat (0x7f0d0059) | |
colorError(0x7f020055)=?0x01010543 | |
resource 0x7f0d005c style/Base.V26.Theme.AppCompat.Light | |
(v26) (style) size=1 parent=style/Base.V23.Theme.AppCompat.Light (0x7f0d005a) | |
colorError(0x7f020055)=?0x01010543 | |
resource 0x7f0d005d style/Base.V26.Widget.AppCompat.Toolbar | |
(v26) (style) size=2 parent=style/Base.V7.Widget.AppCompat.Toolbar (0x7f0d0067) | |
0x0101048f=true | |
0x01010540=true | |
resource 0x7f0d005e style/Base.V28.Theme.AppCompat | |
(v28) (style) size=1 parent=style/Base.V26.Theme.AppCompat (0x7f0d005b) | |
dialogCornerRadius(0x7f020067)=?0x01010571 | |
resource 0x7f0d005f style/Base.V28.Theme.AppCompat.Light | |
(v28) (style) size=1 parent=style/Base.V26.Theme.AppCompat.Light (0x7f0d005c) | |
dialogCornerRadius(0x7f020067)=?0x01010571 | |
resource 0x7f0d0060 style/Base.V7.Theme.AppCompat | |
() (style) size=121 parent=style/Platform.AppCompat (0x7f0d00a2) | |
0x0101005e=@0x0106000d | |
0x0101006d=@style/Widget.AppCompat.ListView.DropDown | |
0x01010084=@style/Widget.AppCompat.TextView | |
0x01010086=@style/Widget.AppCompat.DropDownItem.Spinner | |
0x01010089=@style/Widget.AppCompat.TextView.SpinnerItem | |
0x01010207=@style/TextAppearance.AppCompat.Widget.Button | |
actionBarDivider(0x7f020000)=?attr/dividerVertical | |
actionBarItemBackground(0x7f020001)=?attr/selectableItemBackgroundBorderless | |
actionBarPopupTheme(0x7f020002)=@null | |
actionBarSize(0x7f020003)=@dimen/abc_action_bar_default_height_material | |
actionBarSplitStyle(0x7f020004)=?attr/actionBarStyle | |
actionBarStyle(0x7f020005)=@style/Widget.AppCompat.ActionBar.Solid | |
actionBarTabBarStyle(0x7f020006)=@style/Widget.AppCompat.ActionBar.TabBar | |
actionBarTabStyle(0x7f020007)=@style/Widget.AppCompat.ActionBar.TabView | |
actionBarTabTextStyle(0x7f020008)=@style/Widget.AppCompat.ActionBar.TabText | |
actionBarTheme(0x7f020009)=@style/ThemeOverlay.AppCompat.ActionBar | |
actionBarWidgetTheme(0x7f02000a)=@null | |
actionButtonStyle(0x7f02000b)=@style/Widget.AppCompat.ActionButton | |
actionDropDownStyle(0x7f02000c)=@style/Widget.AppCompat.Spinner.DropDown.ActionBar | |
actionMenuTextAppearance(0x7f02000e)=@style/TextAppearance.AppCompat.Widget.ActionBar.Menu | |
actionMenuTextColor(0x7f02000f)=?0x01010037 | |
actionModeBackground(0x7f020010)=@drawable/abc_cab_background_top_material | |
actionModeCloseButtonStyle(0x7f020011)=@style/Widget.AppCompat.ActionButton.CloseMode | |
actionModeCloseDrawable(0x7f020012)=@drawable/abc_ic_ab_back_material | |
actionModeCopyDrawable(0x7f020013)=@drawable/abc_ic_menu_copy_mtrl_am_alpha | |
actionModeCutDrawable(0x7f020014)=@drawable/abc_ic_menu_cut_mtrl_alpha | |
actionModePasteDrawable(0x7f020016)=@drawable/abc_ic_menu_paste_mtrl_am_alpha | |
actionModeSelectAllDrawable(0x7f020018)=@drawable/abc_ic_menu_selectall_mtrl_alpha | |
actionModeShareDrawable(0x7f020019)=@drawable/abc_ic_menu_share_mtrl_alpha | |
actionModeSplitBackground(0x7f02001a)=?attr/colorPrimaryDark | |
actionModeStyle(0x7f02001b)=@style/Widget.AppCompat.ActionMode | |
actionOverflowButtonStyle(0x7f02001d)=@style/Widget.AppCompat.ActionButton.Overflow | |
actionOverflowMenuStyle(0x7f02001e)=@style/Widget.AppCompat.PopupMenu.Overflow | |
activityChooserViewStyle(0x7f020021)=@style/Widget.AppCompat.ActivityChooserView | |
alertDialogCenterButtons(0x7f020023)=false | |
alertDialogStyle(0x7f020024)=@style/AlertDialog.AppCompat | |
alertDialogTheme(0x7f020025)=@style/ThemeOverlay.AppCompat.Dialog.Alert | |
autoCompleteTextViewStyle(0x7f02002b)=@style/Widget.AppCompat.AutoCompleteTextView | |
borderlessButtonStyle(0x7f020039)=@style/Widget.AppCompat.Button.Borderless | |
buttonBarButtonStyle(0x7f02003a)=@style/Widget.AppCompat.Button.ButtonBar.AlertDialog | |
buttonBarNegativeButtonStyle(0x7f02003b)=?attr/buttonBarButtonStyle | |
buttonBarNeutralButtonStyle(0x7f02003c)=?attr/buttonBarButtonStyle | |
buttonBarPositiveButtonStyle(0x7f02003d)=?attr/buttonBarButtonStyle | |
buttonBarStyle(0x7f02003e)=@style/Widget.AppCompat.ButtonBar | |
buttonStyle(0x7f020043)=@style/Widget.AppCompat.Button | |
buttonStyleSmall(0x7f020044)=@style/Widget.AppCompat.Button.Small | |
checkboxStyle(0x7f020048)=@style/Widget.AppCompat.CompoundButton.CheckBox | |
colorAccent(0x7f02004f)=@color/accent_material_dark | |
colorBackgroundFloating(0x7f020050)=@color/background_floating_material_dark | |
colorButtonNormal(0x7f020051)=@color/button_material_dark | |
colorControlActivated(0x7f020052)=?attr/colorAccent | |
colorControlHighlight(0x7f020053)=@color/ripple_material_dark | |
colorControlNormal(0x7f020054)=?0x01010038 | |
colorError(0x7f020055)=@color/error_color_material_dark | |
colorPrimary(0x7f020056)=@color/primary_material_dark | |
colorPrimaryDark(0x7f020057)=@color/primary_dark_material_dark | |
colorSwitchThumbNormal(0x7f020058)=@color/switch_thumb_material_dark | |
controlBackground(0x7f020064)=?attr/selectableItemBackgroundBorderless | |
dialogCornerRadius(0x7f020067)=@dimen/abc_dialog_corner_radius_material | |
dialogPreferredPadding(0x7f020068)=@dimen/abc_dialog_padding_material | |
dialogTheme(0x7f020069)=@style/ThemeOverlay.AppCompat.Dialog | |
dividerHorizontal(0x7f02006c)=@drawable/abc_list_divider_mtrl_alpha | |
dividerVertical(0x7f02006e)=@drawable/abc_list_divider_mtrl_alpha | |
drawerArrowStyle(0x7f020078)=@style/Widget.AppCompat.DrawerArrowToggle | |
dropDownListViewStyle(0x7f020079)=?0x0101006d | |
dropdownListPreferredItemHeight(0x7f02007a)=?attr/listPreferredItemHeightSmall | |
editTextBackground(0x7f02007b)=@drawable/abc_edit_text_material | |
editTextColor(0x7f02007c)=?0x01010036 | |
editTextStyle(0x7f02007d)=@style/Widget.AppCompat.EditText | |
homeAsUpIndicator(0x7f020091)=@drawable/abc_ic_ab_back_material | |
imageButtonStyle(0x7f020097)=@style/Widget.AppCompat.ImageButton | |
isLightTheme(0x7f02009a)=false | |
listChoiceBackgroundIndicator(0x7f0200d1)=@drawable/abc_list_selector_holo_dark | |
listDividerAlertDialog(0x7f0200d4)=@null | |
listMenuViewStyle(0x7f0200d7)=@style/Widget.AppCompat.ListMenuView | |
listPopupWindowStyle(0x7f0200d8)=@style/Widget.AppCompat.ListPopupWindow | |
listPreferredItemHeight(0x7f0200d9)=@dimen/abc_list_item_height_material | |
listPreferredItemHeightLarge(0x7f0200da)=@dimen/abc_list_item_height_large_material | |
listPreferredItemHeightSmall(0x7f0200db)=@dimen/abc_list_item_height_small_material | |
listPreferredItemPaddingEnd(0x7f0200dc)=@dimen/abc_list_item_padding_horizontal_material | |
listPreferredItemPaddingLeft(0x7f0200dd)=@dimen/abc_list_item_padding_horizontal_material | |
listPreferredItemPaddingRight(0x7f0200de)=@dimen/abc_list_item_padding_horizontal_material | |
listPreferredItemPaddingStart(0x7f0200df)=@dimen/abc_list_item_padding_horizontal_material | |
panelBackground(0x7f0200ef)=@drawable/abc_menu_hardkey_panel_mtrl_mult | |
panelMenuListTheme(0x7f0200f0)=@style/Theme.AppCompat.CompactMenu | |
panelMenuListWidth(0x7f0200f1)=@dimen/abc_panel_menu_list_width | |
popupMenuStyle(0x7f0200f2)=@style/Widget.AppCompat.PopupMenu | |
radioButtonStyle(0x7f0200fa)=@style/Widget.AppCompat.CompoundButton.RadioButton | |
ratingBarStyle(0x7f0200fb)=@style/Widget.AppCompat.RatingBar | |
ratingBarStyleIndicator(0x7f0200fc)=@style/Widget.AppCompat.RatingBar.Indicator | |
ratingBarStyleSmall(0x7f0200fd)=@style/Widget.AppCompat.RatingBar.Small | |
searchViewStyle(0x7f020100)=@style/Widget.AppCompat.SearchView | |
seekBarStyle(0x7f020101)=@style/Widget.AppCompat.SeekBar | |
selectableItemBackground(0x7f020102)=@drawable/abc_item_background_holo_dark | |
selectableItemBackgroundBorderless(0x7f020103)=?attr/selectableItemBackground | |
spinnerDropDownItemStyle(0x7f02010a)=@style/Widget.AppCompat.DropDownItem.Spinner | |
spinnerStyle(0x7f02010b)=@style/Widget.AppCompat.Spinner | |
switchStyle(0x7f020118)=@style/Widget.AppCompat.CompoundButton.Switch | |
textAppearanceLargePopupMenu(0x7f02011b)=@style/TextAppearance.AppCompat.Widget.PopupMenu.Large | |
textAppearanceListItem(0x7f02011c)=@style/TextAppearance.AppCompat.Subhead | |
textAppearanceListItemSecondary(0x7f02011d)=@style/TextAppearance.AppCompat.Body1 | |
textAppearanceListItemSmall(0x7f02011e)=@style/TextAppearance.AppCompat.Subhead | |
textAppearancePopupMenuHeader(0x7f02011f)=@style/TextAppearance.AppCompat.Widget.PopupMenu.Header | |
textAppearanceSearchResultSubtitle(0x7f020120)=@style/TextAppearance.AppCompat.SearchResult.Subtitle | |
textAppearanceSearchResultTitle(0x7f020121)=@style/TextAppearance.AppCompat.SearchResult.Title | |
textAppearanceSmallPopupMenu(0x7f020122)=@style/TextAppearance.AppCompat.Widget.PopupMenu.Small | |
textColorAlertDialogListItem(0x7f020123)=@color/abc_primary_text_material_dark | |
textColorSearchUrl(0x7f020124)=@color/abc_search_url_text | |
toolbarNavigationButtonStyle(0x7f02013a)=@style/Widget.AppCompat.Toolbar.Button.Navigation | |
toolbarStyle(0x7f02013b)=@style/Widget.AppCompat.Toolbar | |
tooltipForegroundColor(0x7f02013c)=@color/foreground_material_light | |
tooltipFrameBackground(0x7f02013d)=@drawable/tooltip_frame_light | |
viewInflaterClass(0x7f020143)="androidx.appcompat.app.AppCompatViewInflater" | |
windowActionBar(0x7f020145)=true | |
windowActionBarOverlay(0x7f020146)=false | |
windowActionModeOverlay(0x7f020147)=false | |
windowFixedHeightMajor(0x7f020148)=@null | |
windowFixedHeightMinor(0x7f020149)=@null | |
windowFixedWidthMajor(0x7f02014a)=@null | |
windowFixedWidthMinor(0x7f02014b)=@null | |
windowNoTitle(0x7f02014e)=false | |
resource 0x7f0d0061 style/Base.V7.Theme.AppCompat.Dialog | |
() (style) size=19 parent=style/Base.Theme.AppCompat (0x7f0d003d) | |
0x01010031=?attr/colorBackgroundFloating | |
0x01010054=@drawable/abc_dialog_material_background | |
0x01010055=@null | |
0x01010057=true | |
0x01010059=@null | |
0x0101005b=@style/RtlOverlay.DialogWindowTitle.AppCompat | |
0x0101005c=@style/Base.DialogWindowTitleBackground.AppCompat | |
0x010100ae=@style/Animation.AppCompat.Dialog | |
0x01010214=@null | |
0x0101021f=true | |
0x0101022b=0x00000020 | |
0x010102ab=@null | |
0x0101032b=@style/Widget.AppCompat.Button.Borderless | |
0x0101032e=@style/Widget.AppCompat.ButtonBar.AlertDialog | |
0x0101035b=true | |
listPreferredItemPaddingLeft(0x7f0200dd)=24.000000dp | |
listPreferredItemPaddingRight(0x7f0200de)=24.000000dp | |
windowActionBar(0x7f020145)=false | |
windowActionModeOverlay(0x7f020147)=true | |
resource 0x7f0d0062 style/Base.V7.Theme.AppCompat.Light | |
() (style) size=121 parent=style/Platform.AppCompat.Light (0x7f0d00a3) | |
0x0101005e=@0x0106000d | |
0x0101006d=@style/Widget.AppCompat.ListView.DropDown | |
0x01010084=@style/Widget.AppCompat.TextView | |
0x01010086=@style/Widget.AppCompat.DropDownItem.Spinner | |
0x01010089=@style/Widget.AppCompat.TextView.SpinnerItem | |
0x01010207=@style/TextAppearance.AppCompat.Widget.Button | |
actionBarDivider(0x7f020000)=?attr/dividerVertical | |
actionBarItemBackground(0x7f020001)=?attr/selectableItemBackgroundBorderless | |
actionBarPopupTheme(0x7f020002)=@null | |
actionBarSize(0x7f020003)=@dimen/abc_action_bar_default_height_material | |
actionBarSplitStyle(0x7f020004)=?attr/actionBarStyle | |
actionBarStyle(0x7f020005)=@style/Widget.AppCompat.Light.ActionBar.Solid | |
actionBarTabBarStyle(0x7f020006)=@style/Widget.AppCompat.Light.ActionBar.TabBar | |
actionBarTabStyle(0x7f020007)=@style/Widget.AppCompat.Light.ActionBar.TabView | |
actionBarTabTextStyle(0x7f020008)=@style/Widget.AppCompat.Light.ActionBar.TabText | |
actionBarTheme(0x7f020009)=@style/ThemeOverlay.AppCompat.ActionBar | |
actionBarWidgetTheme(0x7f02000a)=@null | |
actionButtonStyle(0x7f02000b)=@style/Widget.AppCompat.Light.ActionButton | |
actionDropDownStyle(0x7f02000c)=@style/Widget.AppCompat.Light.Spinner.DropDown.ActionBar | |
actionMenuTextAppearance(0x7f02000e)=@style/TextAppearance.AppCompat.Widget.ActionBar.Menu | |
actionMenuTextColor(0x7f02000f)=?0x01010037 | |
actionModeBackground(0x7f020010)=@drawable/abc_cab_background_top_material | |
actionModeCloseButtonStyle(0x7f020011)=@style/Widget.AppCompat.ActionButton.CloseMode | |
actionModeCloseDrawable(0x7f020012)=@drawable/abc_ic_ab_back_material | |
actionModeCopyDrawable(0x7f020013)=@drawable/abc_ic_menu_copy_mtrl_am_alpha | |
actionModeCutDrawable(0x7f020014)=@drawable/abc_ic_menu_cut_mtrl_alpha | |
actionModePasteDrawable(0x7f020016)=@drawable/abc_ic_menu_paste_mtrl_am_alpha | |
actionModeSelectAllDrawable(0x7f020018)=@drawable/abc_ic_menu_selectall_mtrl_alpha | |
actionModeShareDrawable(0x7f020019)=@drawable/abc_ic_menu_share_mtrl_alpha | |
actionModeSplitBackground(0x7f02001a)=?attr/colorPrimaryDark | |
actionModeStyle(0x7f02001b)=@style/Widget.AppCompat.ActionMode | |
actionOverflowButtonStyle(0x7f02001d)=@style/Widget.AppCompat.Light.ActionButton.Overflow | |
actionOverflowMenuStyle(0x7f02001e)=@style/Widget.AppCompat.Light.PopupMenu.Overflow | |
activityChooserViewStyle(0x7f020021)=@style/Widget.AppCompat.ActivityChooserView | |
alertDialogCenterButtons(0x7f020023)=false | |
alertDialogStyle(0x7f020024)=@style/AlertDialog.AppCompat.Light | |
alertDialogTheme(0x7f020025)=@style/ThemeOverlay.AppCompat.Dialog.Alert | |
autoCompleteTextViewStyle(0x7f02002b)=@style/Widget.AppCompat.AutoCompleteTextView | |
borderlessButtonStyle(0x7f020039)=@style/Widget.AppCompat.Button.Borderless | |
buttonBarButtonStyle(0x7f02003a)=@style/Widget.AppCompat.Button.ButtonBar.AlertDialog | |
buttonBarNegativeButtonStyle(0x7f02003b)=?attr/buttonBarButtonStyle | |
buttonBarNeutralButtonStyle(0x7f02003c)=?attr/buttonBarButtonStyle | |
buttonBarPositiveButtonStyle(0x7f02003d)=?attr/buttonBarButtonStyle | |
buttonBarStyle(0x7f02003e)=@style/Widget.AppCompat.ButtonBar | |
buttonStyle(0x7f020043)=@style/Widget.AppCompat.Button | |
buttonStyleSmall(0x7f020044)=@style/Widget.AppCompat.Button.Small | |
checkboxStyle(0x7f020048)=@style/Widget.AppCompat.CompoundButton.CheckBox | |
colorAccent(0x7f02004f)=@color/accent_material_light | |
colorBackgroundFloating(0x7f020050)=@color/background_floating_material_light | |
colorButtonNormal(0x7f020051)=@color/button_material_light | |
colorControlActivated(0x7f020052)=?attr/colorAccent | |
colorControlHighlight(0x7f020053)=@color/ripple_material_light | |
colorControlNormal(0x7f020054)=?0x01010038 | |
colorError(0x7f020055)=@color/error_color_material_light | |
colorPrimary(0x7f020056)=@color/primary_material_light | |
colorPrimaryDark(0x7f020057)=@color/primary_dark_material_light | |
colorSwitchThumbNormal(0x7f020058)=@color/switch_thumb_material_light | |
controlBackground(0x7f020064)=?attr/selectableItemBackgroundBorderless | |
dialogCornerRadius(0x7f020067)=@dimen/abc_dialog_corner_radius_material | |
dialogPreferredPadding(0x7f020068)=@dimen/abc_dialog_padding_material | |
dialogTheme(0x7f020069)=@style/ThemeOverlay.AppCompat.Dialog | |
dividerHorizontal(0x7f02006c)=@drawable/abc_list_divider_mtrl_alpha | |
dividerVertical(0x7f02006e)=@drawable/abc_list_divider_mtrl_alpha | |
drawerArrowStyle(0x7f020078)=@style/Widget.AppCompat.DrawerArrowToggle | |
dropDownListViewStyle(0x7f020079)=?0x0101006d | |
dropdownListPreferredItemHeight(0x7f02007a)=?attr/listPreferredItemHeightSmall | |
editTextBackground(0x7f02007b)=@drawable/abc_edit_text_material | |
editTextColor(0x7f02007c)=?0x01010036 | |
editTextStyle(0x7f02007d)=@style/Widget.AppCompat.EditText | |
homeAsUpIndicator(0x7f020091)=@drawable/abc_ic_ab_back_material | |
imageButtonStyle(0x7f020097)=@style/Widget.AppCompat.ImageButton | |
isLightTheme(0x7f02009a)=true | |
listChoiceBackgroundIndicator(0x7f0200d1)=@drawable/abc_list_selector_holo_light | |
listDividerAlertDialog(0x7f0200d4)=@null | |
listMenuViewStyle(0x7f0200d7)=@style/Widget.AppCompat.ListMenuView | |
listPopupWindowStyle(0x7f0200d8)=@style/Widget.AppCompat.ListPopupWindow | |
listPreferredItemHeight(0x7f0200d9)=@dimen/abc_list_item_height_material | |
listPreferredItemHeightLarge(0x7f0200da)=@dimen/abc_list_item_height_large_material | |
listPreferredItemHeightSmall(0x7f0200db)=@dimen/abc_list_item_height_small_material | |
listPreferredItemPaddingEnd(0x7f0200dc)=@dimen/abc_list_item_padding_horizontal_material | |
listPreferredItemPaddingLeft(0x7f0200dd)=@dimen/abc_list_item_padding_horizontal_material | |
listPreferredItemPaddingRight(0x7f0200de)=@dimen/abc_list_item_padding_horizontal_material | |
listPreferredItemPaddingStart(0x7f0200df)=@dimen/abc_list_item_padding_horizontal_material | |
panelBackground(0x7f0200ef)=@drawable/abc_menu_hardkey_panel_mtrl_mult | |
panelMenuListTheme(0x7f0200f0)=@style/Theme.AppCompat.CompactMenu | |
panelMenuListWidth(0x7f0200f1)=@dimen/abc_panel_menu_list_width | |
popupMenuStyle(0x7f0200f2)=@style/Widget.AppCompat.Light.PopupMenu | |
radioButtonStyle(0x7f0200fa)=@style/Widget.AppCompat.CompoundButton.RadioButton | |
ratingBarStyle(0x7f0200fb)=@style/Widget.AppCompat.RatingBar | |
ratingBarStyleIndicator(0x7f0200fc)=@style/Widget.AppCompat.RatingBar.Indicator | |
ratingBarStyleSmall(0x7f0200fd)=@style/Widget.AppCompat.RatingBar.Small | |
searchViewStyle(0x7f020100)=@style/Widget.AppCompat.Light.SearchView | |
seekBarStyle(0x7f020101)=@style/Widget.AppCompat.SeekBar | |
selectableItemBackground(0x7f020102)=@drawable/abc_item_background_holo_light | |
selectableItemBackgroundBorderless(0x7f020103)=?attr/selectableItemBackground | |
spinnerDropDownItemStyle(0x7f02010a)=@style/Widget.AppCompat.DropDownItem.Spinner | |
spinnerStyle(0x7f02010b)=@style/Widget.AppCompat.Spinner | |
switchStyle(0x7f020118)=@style/Widget.AppCompat.CompoundButton.Switch | |
textAppearanceLargePopupMenu(0x7f02011b)=@style/TextAppearance.AppCompat.Light.Widget.PopupMenu.Large | |
textAppearanceListItem(0x7f02011c)=@style/TextAppearance.AppCompat.Subhead | |
textAppearanceListItemSecondary(0x7f02011d)=@style/TextAppearance.AppCompat.Body1 | |
textAppearanceListItemSmall(0x7f02011e)=@style/TextAppearance.AppCompat.Subhead | |
textAppearancePopupMenuHeader(0x7f02011f)=@style/TextAppearance.AppCompat.Widget.PopupMenu.Header | |
textAppearanceSearchResultSubtitle(0x7f020120)=@style/TextAppearance.AppCompat.SearchResult.Subtitle | |
textAppearanceSearchResultTitle(0x7f020121)=@style/TextAppearance.AppCompat.SearchResult.Title | |
textAppearanceSmallPopupMenu(0x7f020122)=@style/TextAppearance.AppCompat.Light.Widget.PopupMenu.Small | |
textColorAlertDialogListItem(0x7f020123)=@color/abc_primary_text_material_light | |
textColorSearchUrl(0x7f020124)=@color/abc_search_url_text | |
toolbarNavigationButtonStyle(0x7f02013a)=@style/Widget.AppCompat.Toolbar.Button.Navigation | |
toolbarStyle(0x7f02013b)=@style/Widget.AppCompat.Toolbar | |
tooltipForegroundColor(0x7f02013c)=@color/foreground_material_dark | |
tooltipFrameBackground(0x7f02013d)=@drawable/tooltip_frame_dark | |
viewInflaterClass(0x7f020143)="androidx.appcompat.app.AppCompatViewInflater" | |
windowActionBar(0x7f020145)=true | |
windowActionBarOverlay(0x7f020146)=false | |
windowActionModeOverlay(0x7f020147)=false | |
windowFixedHeightMajor(0x7f020148)=@null | |
windowFixedHeightMinor(0x7f020149)=@null | |
windowFixedWidthMajor(0x7f02014a)=@null | |
windowFixedWidthMinor(0x7f02014b)=@null | |
windowNoTitle(0x7f02014e)=false | |
resource 0x7f0d0063 style/Base.V7.Theme.AppCompat.Light.Dialog | |
() (style) size=19 parent=style/Base.Theme.AppCompat.Light (0x7f0d0044) | |
0x01010031=?attr/colorBackgroundFloating | |
0x01010054=@drawable/abc_dialog_material_background | |
0x01010055=@null | |
0x01010057=true | |
0x01010059=@null | |
0x0101005b=@style/RtlOverlay.DialogWindowTitle.AppCompat | |
0x0101005c=@style/Base.DialogWindowTitleBackground.AppCompat | |
0x010100ae=@style/Animation.AppCompat.Dialog | |
0x01010214=@null | |
0x0101021f=true | |
0x0101022b=0x00000020 | |
0x010102ab=@null | |
0x0101032b=@style/Widget.AppCompat.Button.Borderless | |
0x0101032e=@style/Widget.AppCompat.ButtonBar.AlertDialog | |
0x0101035b=true | |
listPreferredItemPaddingLeft(0x7f0200dd)=24.000000dp | |
listPreferredItemPaddingRight(0x7f0200de)=24.000000dp | |
windowActionBar(0x7f020145)=false | |
windowActionModeOverlay(0x7f020147)=true | |
resource 0x7f0d0064 style/Base.V7.ThemeOverlay.AppCompat.Dialog | |
() (style) size=23 parent=style/Base.ThemeOverlay.AppCompat (0x7f0d004b) | |
0x01010031=?attr/colorBackgroundFloating | |
0x01010054=@drawable/abc_dialog_material_background | |
0x01010055=@null | |
0x01010057=true | |
0x01010059=@null | |
0x0101005b=@style/RtlOverlay.DialogWindowTitle.AppCompat | |
0x0101005c=@style/Base.DialogWindowTitleBackground.AppCompat | |
0x010100ae=@style/Animation.AppCompat.Dialog | |
0x01010214=@null | |
0x0101021f=true | |
0x0101022b=0x00000020 | |
0x010102ab=@null | |
0x0101032b=@style/Widget.AppCompat.Button.Borderless | |
0x0101032e=@style/Widget.AppCompat.ButtonBar.AlertDialog | |
0x0101035b=true | |
listPreferredItemPaddingLeft(0x7f0200dd)=24.000000dp | |
listPreferredItemPaddingRight(0x7f0200de)=24.000000dp | |
windowActionBar(0x7f020145)=false | |
windowActionModeOverlay(0x7f020147)=true | |
windowFixedHeightMajor(0x7f020148)=@null | |
windowFixedHeightMinor(0x7f020149)=@null | |
windowFixedWidthMajor(0x7f02014a)=@null | |
windowFixedWidthMinor(0x7f02014b)=@null | |
resource 0x7f0d0065 style/Base.V7.Widget.AppCompat.AutoCompleteTextView | |
() (style) size=6 parent=0x01030027 | |
0x01010034=?0x01010044 | |
0x01010098=?attr/editTextColor | |
0x010100d4=?attr/editTextBackground | |
0x01010175=?attr/listChoiceBackgroundIndicator | |
0x01010176=@drawable/abc_popup_background_mtrl_mult | |
0x01010362=@drawable/abc_text_cursor_material | |
resource 0x7f0d0066 style/Base.V7.Widget.AppCompat.EditText | |
() (style) size=4 parent=0x01030023 | |
0x01010034=?0x01010044 | |
0x01010098=?attr/editTextColor | |
0x010100d4=?attr/editTextBackground | |
0x01010362=@drawable/abc_text_cursor_material | |
resource 0x7f0d0067 style/Base.V7.Widget.AppCompat.Toolbar | |
() (style) size=12 parent=0x01030012 | |
0x010100d6=@dimen/abc_action_bar_default_padding_start_material | |
0x010100d8=@dimen/abc_action_bar_default_padding_end_material | |
0x01010140=?attr/actionBarSize | |
buttonGravity(0x7f020040)=0x00000030 | |
collapseContentDescription(0x7f02004c)=@string/abc_toolbar_collapse_description | |
collapseIcon(0x7f02004d)=?attr/homeAsUpIndicator | |
contentInsetStart(0x7f020062)=16.000000dp | |
contentInsetStartWithNavigation(0x7f020063)=@dimen/abc_action_bar_content_inset_with_nav | |
maxButtonHeight(0x7f0200e2)=@dimen/abc_action_bar_default_height_material | |
subtitleTextAppearance(0x7f020112)=@style/TextAppearance.Widget.AppCompat.Toolbar.Subtitle | |
titleMargin(0x7f020131)=4.000000dp | |
titleTextAppearance(0x7f020137)=@style/TextAppearance.Widget.AppCompat.Toolbar.Title | |
resource 0x7f0d0068 style/Base.Widget.AppCompat.ActionBar | |
() (style) size=16 | |
0x010100af=0x00000010 | |
actionButtonStyle(0x7f02000b)=@style/Widget.AppCompat.ActionButton | |
actionOverflowButtonStyle(0x7f02001d)=@style/Widget.AppCompat.ActionButton.Overflow | |
background(0x7f020031)=@null | |
backgroundSplit(0x7f020032)=@null | |
backgroundStacked(0x7f020033)=@null | |
contentInsetEnd(0x7f02005e)=@dimen/abc_action_bar_content_inset_material | |
contentInsetStart(0x7f020062)=@dimen/abc_action_bar_content_inset_material | |
contentInsetStartWithNavigation(0x7f020063)=@dimen/abc_action_bar_content_inset_with_nav | |
displayOptions(0x7f02006a)=0x00000008 | |
divider(0x7f02006b)=?attr/dividerVertical | |
elevation(0x7f02007e)=@dimen/abc_action_bar_elevation_material | |
height(0x7f02008f)=?attr/actionBarSize | |
popupTheme(0x7f0200f3)=?attr/actionBarPopupTheme | |
subtitleTextStyle(0x7f020114)=@style/TextAppearance.AppCompat.Widget.ActionBar.Subtitle | |
titleTextStyle(0x7f020139)=@style/TextAppearance.AppCompat.Widget.ActionBar.Title | |
resource 0x7f0d0069 style/Base.Widget.AppCompat.ActionBar.Solid | |
() (style) size=3 parent=style/Base.Widget.AppCompat.ActionBar (0x7f0d0068) | |
background(0x7f020031)=?attr/colorPrimary | |
backgroundSplit(0x7f020032)=?attr/colorPrimary | |
backgroundStacked(0x7f020033)=?attr/colorPrimary | |
resource 0x7f0d006a style/Base.Widget.AppCompat.ActionBar.TabBar | |
() (style) size=3 | |
divider(0x7f02006b)=?attr/actionBarDivider | |
dividerPadding(0x7f02006d)=8.000000dp | |
showDividers(0x7f020105)=0x00000002 | |
resource 0x7f0d006b style/Base.Widget.AppCompat.ActionBar.TabText | |
() (style) size=0 parent=0x01030251 | |
resource 0x7f0d006c style/Base.Widget.AppCompat.ActionBar.TabView | |
() (style) size=0 parent=0x01030252 | |
resource 0x7f0d006d style/Base.Widget.AppCompat.ActionButton | |
() (style) size=0 parent=0x01030253 | |
resource 0x7f0d006e style/Base.Widget.AppCompat.ActionButton.CloseMode | |
() (style) size=1 parent=0x01030254 | |
0x0101013f=56.000000dp | |
resource 0x7f0d006f style/Base.Widget.AppCompat.ActionButton.Overflow | |
() (style) size=2 parent=0x01030255 | |
0x01010119=@null | |
srcCompat(0x7f02010d)=@drawable/abc_ic_menu_overflow_material | |
(v23) (style) size=0 parent=0x01030255 | |
resource 0x7f0d0070 style/Base.Widget.AppCompat.ActionMode | |
() (style) size=6 | |
background(0x7f020031)=?attr/actionModeBackground | |
backgroundSplit(0x7f020032)=?attr/actionModeSplitBackground | |
closeItemLayout(0x7f02004b)=@layout/abc_action_mode_close_item_material | |
height(0x7f02008f)=?attr/actionBarSize | |
subtitleTextStyle(0x7f020114)=@style/TextAppearance.AppCompat.Widget.ActionMode.Subtitle | |
titleTextStyle(0x7f020139)=@style/TextAppearance.AppCompat.Widget.ActionMode.Title | |
resource 0x7f0d0071 style/Base.Widget.AppCompat.ActivityChooserView | |
() (style) size=5 | |
0x010100af=0x00000011 | |
0x010100d4=@drawable/abc_ab_share_pack_mtrl_alpha | |
divider(0x7f02006b)=?attr/dividerVertical | |
dividerPadding(0x7f02006d)=6.000000dp | |
showDividers(0x7f020105)=0x00000002 | |
resource 0x7f0d0072 style/Base.Widget.AppCompat.AutoCompleteTextView | |
() (style) size=1 parent=0x01030257 | |
0x010100d4=?attr/editTextBackground | |
resource 0x7f0d0073 style/Base.Widget.AppCompat.Button | |
() (style) size=0 parent=0x01030258 | |
resource 0x7f0d0074 style/Base.Widget.AppCompat.Button.Borderless | |
() (style) size=0 parent=0x01030259 | |
resource 0x7f0d0075 style/Base.Widget.AppCompat.Button.Borderless.Colored | |
() (style) size=1 parent=0x0103025a | |
0x01010098=@color/abc_btn_colored_borderless_text_material | |
(v23) (style) size=0 parent=0x0103025a | |
resource 0x7f0d0076 style/Base.Widget.AppCompat.Button.ButtonBar.AlertDialog | |
() (style) size=2 parent=style/Widget.AppCompat.Button.Borderless.Colored (0x7f0d0120) | |
0x0101013f=64.000000dp | |
0x01010140=@dimen/abc_alert_dialog_button_bar_height | |
resource 0x7f0d0077 style/Base.Widget.AppCompat.Button.Colored | |
() (style) size=2 parent=style/Base.Widget.AppCompat.Button (0x7f0d0073) | |
0x01010034=@style/TextAppearance.AppCompat.Widget.Button.Colored | |
0x010100d4=@drawable/abc_btn_colored_material | |
(v23) (style) size=0 parent=0x010302d3 | |
resource 0x7f0d0078 style/Base.Widget.AppCompat.Button.Small | |
() (style) size=0 parent=0x0103025d | |
resource 0x7f0d0079 style/Base.Widget.AppCompat.ButtonBar | |
() (style) size=0 parent=0x0103025f | |
resource 0x7f0d007a style/Base.Widget.AppCompat.ButtonBar.AlertDialog | |
() (style) size=0 parent=style/Base.Widget.AppCompat.ButtonBar (0x7f0d0079) | |
resource 0x7f0d007b style/Base.Widget.AppCompat.CompoundButton.CheckBox | |
() (style) size=0 parent=0x01030263 | |
resource 0x7f0d007c style/Base.Widget.AppCompat.CompoundButton.RadioButton | |
() (style) size=0 parent=0x01030264 | |
resource 0x7f0d007d style/Base.Widget.AppCompat.CompoundButton.Switch | |
() (style) size=8 parent=0x01030018 | |
0x010100d4=?attr/controlBackground | |
0x01010124=@string/abc_capital_on | |
0x01010125=@string/abc_capital_off | |
0x01010142=@drawable/abc_switch_thumb_material | |
showText(0x7f020106)=false | |
switchPadding(0x7f020117)=@dimen/abc_switch_padding | |
switchTextAppearance(0x7f020119)=@style/TextAppearance.AppCompat.Widget.Switch | |
track(0x7f02013f)=@drawable/abc_switch_track_mtrl_alpha | |
resource 0x7f0d007e style/Base.Widget.AppCompat.DrawerArrowToggle | |
() (style) size=3 parent=style/Base.Widget.AppCompat.DrawerArrowToggle.Common (0x7f0d007f) | |
barLength(0x7f020036)=18.000000dp | |
drawableSize(0x7f020073)=24.000000dp | |
gapBetweenBars(0x7f02008d)=3.000000dp | |
(hdpi) (style) size=3 parent=style/Base.Widget.AppCompat.DrawerArrowToggle.Common (0x7f0d007f) | |
barLength(0x7f020036)=18.659973dp | |
drawableSize(0x7f020073)=24.000000dp | |
gapBetweenBars(0x7f02008d)=3.329987dp | |
resource 0x7f0d007f style/Base.Widget.AppCompat.DrawerArrowToggle.Common | |
() (style) size=5 | |
arrowHeadLength(0x7f020029)=8.000000dp | |
arrowShaftLength(0x7f02002a)=16.000000dp | |
color(0x7f02004e)=?0x01010038 | |
spinBars(0x7f020109)=true | |
thickness(0x7f020127)=2.000000dp | |
resource 0x7f0d0080 style/Base.Widget.AppCompat.DropDownItem.Spinner | |
() (style) size=0 parent=0x01030268 | |
resource 0x7f0d0081 style/Base.Widget.AppCompat.EditText | |
() (style) size=1 parent=0x01030269 | |
0x010100d4=?attr/editTextBackground | |
(v23) (style) size=2 parent=0x01030269 | |
0x010104dd=0 | |
0x010104de=0 | |
resource 0x7f0d0082 style/Base.Widget.AppCompat.ImageButton | |
() (style) size=0 parent=0x0103026e | |
resource 0x7f0d0083 style/Base.Widget.AppCompat.Light.ActionBar | |
() (style) size=2 parent=style/Base.Widget.AppCompat.ActionBar (0x7f0d0068) | |
actionButtonStyle(0x7f02000b)=@style/Widget.AppCompat.Light.ActionButton | |
actionOverflowButtonStyle(0x7f02001d)=@style/Widget.AppCompat.Light.ActionButton.Overflow | |
resource 0x7f0d0084 style/Base.Widget.AppCompat.Light.ActionBar.Solid | |
() (style) size=3 parent=style/Base.Widget.AppCompat.Light.ActionBar (0x7f0d0083) | |
background(0x7f020031)=?attr/colorPrimary | |
backgroundSplit(0x7f020032)=?attr/colorPrimary | |
backgroundStacked(0x7f020033)=?attr/colorPrimary | |
resource 0x7f0d0085 style/Base.Widget.AppCompat.Light.ActionBar.TabBar | |
() (style) size=0 parent=style/Base.Widget.AppCompat.ActionBar.TabBar (0x7f0d006a) | |
resource 0x7f0d0086 style/Base.Widget.AppCompat.Light.ActionBar.TabText | |
() (style) size=0 parent=0x01030292 | |
resource 0x7f0d0087 style/Base.Widget.AppCompat.Light.ActionBar.TabText.Inverse | |
() (style) size=0 parent=0x01030292 | |
resource 0x7f0d0088 style/Base.Widget.AppCompat.Light.ActionBar.TabView | |
() (style) size=0 parent=0x01030293 | |
resource 0x7f0d0089 style/Base.Widget.AppCompat.Light.PopupMenu | |
() (style) size=0 parent=0x010302b4 | |
resource 0x7f0d008a style/Base.Widget.AppCompat.Light.PopupMenu.Overflow | |
() (style) size=2 parent=style/Base.Widget.AppCompat.Light.PopupMenu (0x7f0d0089) | |
0x010102ac=16777212.000000dp | |
0x01010462=true | |
resource 0x7f0d008b style/Base.Widget.AppCompat.ListMenuView | |
() (style) size=1 parent=0x01030012 | |
subMenuArrow(0x7f02010f)=@drawable/abc_ic_arrow_drop_right_black_24dp | |
resource 0x7f0d008c style/Base.Widget.AppCompat.ListPopupWindow | |
() (style) size=0 parent=0x0103026f | |
resource 0x7f0d008d style/Base.Widget.AppCompat.ListView | |
() (style) size=0 parent=0x01030270 | |
resource 0x7f0d008e style/Base.Widget.AppCompat.ListView.DropDown | |
() (style) size=0 parent=0x01030271 | |
resource 0x7f0d008f style/Base.Widget.AppCompat.ListView.Menu | |
() (style) size=0 parent=style/Base.Widget.AppCompat.ListView (0x7f0d008d) | |
resource 0x7f0d0090 style/Base.Widget.AppCompat.PopupMenu | |
() (style) size=0 parent=0x01030273 | |
resource 0x7f0d0091 style/Base.Widget.AppCompat.PopupMenu.Overflow | |
() (style) size=2 parent=style/Base.Widget.AppCompat.PopupMenu (0x7f0d0090) | |
0x010102ac=16777212.000000dp | |
0x01010462=true | |
resource 0x7f0d0092 style/Base.Widget.AppCompat.PopupWindow | |
() (style) size=0 parent=0x01030036 | |
resource 0x7f0d0093 style/Base.Widget.AppCompat.ProgressBar | |
() (style) size=0 parent=0x01030276 | |
resource 0x7f0d0094 style/Base.Widget.AppCompat.ProgressBar.Horizontal | |
() (style) size=0 parent=0x01030277 | |
resource 0x7f0d0095 style/Base.Widget.AppCompat.RatingBar | |
() (style) size=0 parent=0x0103027b | |
resource 0x7f0d0096 style/Base.Widget.AppCompat.RatingBar.Indicator | |
() (style) size=6 parent=0x01030021 | |
0x01010120=36.000000dp | |
0x0101013b=@drawable/abc_ratingbar_indicator_material | |
0x0101013c=@drawable/abc_ratingbar_indicator_material | |
0x01010140=36.000000dp | |
0x01010142=@null | |
0x01010147=true | |
(v23) (style) size=0 parent=0x0103027c | |
resource 0x7f0d0097 style/Base.Widget.AppCompat.RatingBar.Small | |
() (style) size=6 parent=0x01030021 | |
0x01010120=16.000000dp | |
0x0101013b=@drawable/abc_ratingbar_small_material | |
0x0101013c=@drawable/abc_ratingbar_small_material | |
0x01010140=16.000000dp | |
0x01010142=@null | |
0x01010147=true | |
(v23) (style) size=0 parent=0x0103027d | |
resource 0x7f0d0098 style/Base.Widget.AppCompat.SearchView | |
() (style) size=10 parent=0x01030012 | |
closeIcon(0x7f02004a)=@drawable/abc_ic_clear_material | |
commitIcon(0x7f020059)=@drawable/abc_ic_commit_search_api_mtrl_alpha | |
goIcon(0x7f02008e)=@drawable/abc_ic_go_search_api_material | |
layout(0x7f02009d)=@layout/abc_search_view | |
queryBackground(0x7f0200f8)=@drawable/abc_textfield_search_material | |
searchHintIcon(0x7f0200fe)=@drawable/abc_ic_search_api_material | |
searchIcon(0x7f0200ff)=@drawable/abc_ic_search_api_material | |
submitBackground(0x7f020110)=@drawable/abc_textfield_search_material | |
suggestionRowLayout(0x7f020115)=@layout/abc_search_dropdown_item_icons_2line | |
voiceIcon(0x7f020144)=@drawable/abc_ic_voice_search_api_material | |
resource 0x7f0d0099 style/Base.Widget.AppCompat.SearchView.ActionBar | |
() (style) size=4 parent=style/Base.Widget.AppCompat.SearchView (0x7f0d0098) | |
defaultQueryHint(0x7f020066)=@string/abc_search_hint | |
queryBackground(0x7f0200f8)=@null | |
searchHintIcon(0x7f0200fe)=@null | |
submitBackground(0x7f020110)=@null | |
resource 0x7f0d009a style/Base.Widget.AppCompat.SeekBar | |
() (style) size=0 parent=0x01030280 | |
resource 0x7f0d009b style/Base.Widget.AppCompat.SeekBar.Discrete | |
() (style) size=1 parent=style/Base.Widget.AppCompat.SeekBar (0x7f0d009a) | |
tickMark(0x7f02012b)=@drawable/abc_seekbar_tick_mark_material | |
resource 0x7f0d009c style/Base.Widget.AppCompat.Spinner | |
() (style) size=0 parent=0x01030283 | |
resource 0x7f0d009d style/Base.Widget.AppCompat.Spinner.Underlined | |
() (style) size=1 parent=style/Base.Widget.AppCompat.Spinner (0x7f0d009c) | |
0x010100d4=@drawable/abc_spinner_textfield_background_material | |
(ldltr) (style) size=0 parent=0x01030284 | |
(v23) (style) size=0 parent=0x01030284 | |
resource 0x7f0d009e style/Base.Widget.AppCompat.TextView | |
() (style) size=0 parent=0x01030287 | |
(v23) (style) size=2 parent=0x01030287 | |
0x010104dd=1 | |
0x010104de=0 | |
resource 0x7f0d009f style/Base.Widget.AppCompat.TextView.SpinnerItem | |
() (style) size=0 parent=0x01030288 | |
resource 0x7f0d00a0 style/Base.Widget.AppCompat.Toolbar | |
() (style) size=0 parent=style/Base.V7.Widget.AppCompat.Toolbar (0x7f0d0067) | |
(v26) (style) size=0 parent=style/Base.V26.Widget.AppCompat.Toolbar (0x7f0d005d) | |
resource 0x7f0d00a1 style/Base.Widget.AppCompat.Toolbar.Button.Navigation | |
() (style) size=0 parent=0x0103028b | |
resource 0x7f0d00a2 style/Platform.AppCompat | |
() (style) size=0 parent=style/Platform.V21.AppCompat (0x7f0d00a7) | |
(v25) (style) size=0 parent=style/Platform.V25.AppCompat (0x7f0d00a9) | |
resource 0x7f0d00a3 style/Platform.AppCompat.Light | |
() (style) size=0 parent=style/Platform.V21.AppCompat.Light (0x7f0d00a8) | |
(v25) (style) size=0 parent=style/Platform.V25.AppCompat.Light (0x7f0d00aa) | |
resource 0x7f0d00a4 style/Platform.ThemeOverlay.AppCompat | |
() (style) size=7 | |
0x01010429=?attr/colorControlNormal | |
0x0101042a=?attr/colorControlActivated | |
0x0101042b=?attr/colorButtonNormal | |
0x0101042c=?attr/colorControlHighlight | |
0x01010433=?attr/colorPrimary | |
0x01010434=?attr/colorPrimaryDark | |
0x01010435=?attr/colorAccent | |
resource 0x7f0d00a5 style/Platform.ThemeOverlay.AppCompat.Dark | |
() (style) size=0 parent=style/Platform.ThemeOverlay.AppCompat (0x7f0d00a4) | |
resource 0x7f0d00a6 style/Platform.ThemeOverlay.AppCompat.Light | |
() (style) size=0 parent=style/Platform.ThemeOverlay.AppCompat (0x7f0d00a4) | |
resource 0x7f0d00a7 style/Platform.V21.AppCompat | |
() (style) size=6 parent=0x0103022e | |
0x0101003f=@color/abc_hint_foreground_material_light | |
0x0101009a=@color/abc_hint_foreground_material_dark | |
0x0101009b=?0x01010435 | |
0x0101032e=?attr/buttonBarStyle | |
0x0101032f=?attr/buttonBarButtonStyle | |
0x01010350=?0x01010435 | |
resource 0x7f0d00a8 style/Platform.V21.AppCompat.Light | |
() (style) size=6 parent=0x01030241 | |
0x0101003f=@color/abc_hint_foreground_material_dark | |
0x0101009a=@color/abc_hint_foreground_material_light | |
0x0101009b=?0x01010435 | |
0x0101032e=?attr/buttonBarStyle | |
0x0101032f=?attr/buttonBarButtonStyle | |
0x01010350=?0x01010435 | |
resource 0x7f0d00a9 style/Platform.V25.AppCompat | |
(v25) (style) size=0 parent=0x0103022e | |
resource 0x7f0d00aa style/Platform.V25.AppCompat.Light | |
(v25) (style) size=0 parent=0x01030241 | |
resource 0x7f0d00ab style/Platform.Widget.AppCompat.Spinner | |
() (style) size=0 parent=0x010300a5 | |
resource 0x7f0d00ac style/RtlOverlay.DialogWindowTitle.AppCompat | |
() (style) size=1 parent=style/Base.DialogWindowTitle.AppCompat (0x7f0d000b) | |
0x010103b1=5 | |
resource 0x7f0d00ad style/RtlOverlay.Widget.AppCompat.ActionBar.TitleItem | |
() (style) size=2 parent=0x01030012 | |
0x010100b3=0x00800013 | |
0x010103b4=8.000000dp | |
resource 0x7f0d00ae style/RtlOverlay.Widget.AppCompat.DialogTitle.Icon | |
() (style) size=1 parent=0x01030012 | |
0x010103b6=8.000000dp | |
resource 0x7f0d00af style/RtlOverlay.Widget.AppCompat.PopupMenuItem | |
() (style) size=1 parent=0x01030012 | |
0x010103b4=16.000000dp | |
resource 0x7f0d00b0 style/RtlOverlay.Widget.AppCompat.PopupMenuItem.InternalGroup | |
() (style) size=1 parent=0x01030012 | |
0x010103b5=16.000000dp | |
resource 0x7f0d00b1 style/RtlOverlay.Widget.AppCompat.PopupMenuItem.Shortcut | |
() (style) size=2 parent=0x01030012 | |
0x010103b1=6 | |
0x010103b5=16.000000dp | |
resource 0x7f0d00b2 style/RtlOverlay.Widget.AppCompat.PopupMenuItem.SubmenuArrow | |
() (style) size=1 parent=0x01030012 | |
0x010103b5=8.000000dp | |
resource 0x7f0d00b3 style/RtlOverlay.Widget.AppCompat.PopupMenuItem.Text | |
() (style) size=2 parent=0x01030012 | |
0x010103b1=5 | |
0x010103bb=true | |
resource 0x7f0d00b4 style/RtlOverlay.Widget.AppCompat.PopupMenuItem.Title | |
() (style) size=2 parent=0x01030012 | |
0x010103b1=5 | |
0x010103b5=16.000000dp | |
resource 0x7f0d00b5 style/RtlOverlay.Widget.AppCompat.Search.DropDown | |
() (style) size=2 parent=0x01030012 | |
0x010103b3=@dimen/abc_dropdownitem_text_padding_left | |
0x010103b4=4.000000dp | |
resource 0x7f0d00b6 style/RtlOverlay.Widget.AppCompat.Search.DropDown.Icon1 | |
() (style) size=1 parent=0x01030012 | |
0x010103bb=true | |
resource 0x7f0d00b7 style/RtlOverlay.Widget.AppCompat.Search.DropDown.Icon2 | |
() (style) size=1 parent=0x01030012 | |
0x010103b7=@id/edit_query | |
resource 0x7f0d00b8 style/RtlOverlay.Widget.AppCompat.Search.DropDown.Query | |
() (style) size=1 parent=0x01030012 | |
0x010103bc=true | |
resource 0x7f0d00b9 style/RtlOverlay.Widget.AppCompat.Search.DropDown.Text | |
() (style) size=2 parent=style/Base.Widget.AppCompat.DropDownItem.Spinner (0x7f0d0080) | |
0x010103b7=@0x01020008 | |
0x010103b8=@0x01020007 | |
resource 0x7f0d00ba style/RtlOverlay.Widget.AppCompat.SearchView.MagIcon | |
() (style) size=1 parent=0x01030012 | |
0x010103b5=@dimen/abc_dropdownitem_text_padding_left | |
resource 0x7f0d00bb style/RtlUnderlay.Widget.AppCompat.ActionButton | |
() (style) size=2 parent=0x01030012 | |
0x010103b3=12.000000dp | |
0x010103b4=12.000000dp | |
resource 0x7f0d00bc style/RtlUnderlay.Widget.AppCompat.ActionButton.Overflow | |
() (style) size=2 parent=style/Base.Widget.AppCompat.ActionButton (0x7f0d006d) | |
0x010103b3=@dimen/abc_action_bar_overflow_padding_start_material | |
0x010103b4=@dimen/abc_action_bar_overflow_padding_end_material | |
resource 0x7f0d00bd style/TextAppearance.AppCompat | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat (0x7f0d000d) | |
resource 0x7f0d00be style/TextAppearance.AppCompat.Body1 | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Body1 (0x7f0d000e) | |
resource 0x7f0d00bf style/TextAppearance.AppCompat.Body2 | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Body2 (0x7f0d000f) | |
resource 0x7f0d00c0 style/TextAppearance.AppCompat.Button | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Button (0x7f0d0010) | |
resource 0x7f0d00c1 style/TextAppearance.AppCompat.Caption | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Caption (0x7f0d0011) | |
resource 0x7f0d00c2 style/TextAppearance.AppCompat.Display1 | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Display1 (0x7f0d0012) | |
resource 0x7f0d00c3 style/TextAppearance.AppCompat.Display2 | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Display2 (0x7f0d0013) | |
resource 0x7f0d00c4 style/TextAppearance.AppCompat.Display3 | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Display3 (0x7f0d0014) | |
resource 0x7f0d00c5 style/TextAppearance.AppCompat.Display4 | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Display4 (0x7f0d0015) | |
resource 0x7f0d00c6 style/TextAppearance.AppCompat.Headline | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Headline (0x7f0d0016) | |
resource 0x7f0d00c7 style/TextAppearance.AppCompat.Inverse | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Inverse (0x7f0d0017) | |
resource 0x7f0d00c8 style/TextAppearance.AppCompat.Large | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Large (0x7f0d0018) | |
resource 0x7f0d00c9 style/TextAppearance.AppCompat.Large.Inverse | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Large.Inverse (0x7f0d0019) | |
resource 0x7f0d00ca style/TextAppearance.AppCompat.Light.SearchResult.Subtitle | |
() (style) size=0 parent=style/TextAppearance.AppCompat.SearchResult.Subtitle (0x7f0d00d1) | |
resource 0x7f0d00cb style/TextAppearance.AppCompat.Light.SearchResult.Title | |
() (style) size=0 parent=style/TextAppearance.AppCompat.SearchResult.Title (0x7f0d00d2) | |
resource 0x7f0d00cc style/TextAppearance.AppCompat.Light.Widget.PopupMenu.Large | |
() (style) size=0 parent=style/TextAppearance.AppCompat.Widget.PopupMenu.Large (0x7f0d00e9) | |
resource 0x7f0d00cd style/TextAppearance.AppCompat.Light.Widget.PopupMenu.Small | |
() (style) size=0 parent=style/TextAppearance.AppCompat.Widget.PopupMenu.Small (0x7f0d00ea) | |
resource 0x7f0d00ce style/TextAppearance.AppCompat.Medium | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Medium (0x7f0d001c) | |
resource 0x7f0d00cf style/TextAppearance.AppCompat.Medium.Inverse | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Medium.Inverse (0x7f0d001d) | |
resource 0x7f0d00d0 style/TextAppearance.AppCompat.Menu | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Menu (0x7f0d001e) | |
resource 0x7f0d00d1 style/TextAppearance.AppCompat.SearchResult.Subtitle | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.SearchResult.Subtitle (0x7f0d0020) | |
resource 0x7f0d00d2 style/TextAppearance.AppCompat.SearchResult.Title | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.SearchResult.Title (0x7f0d0021) | |
resource 0x7f0d00d3 style/TextAppearance.AppCompat.Small | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Small (0x7f0d0022) | |
resource 0x7f0d00d4 style/TextAppearance.AppCompat.Small.Inverse | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Small.Inverse (0x7f0d0023) | |
resource 0x7f0d00d5 style/TextAppearance.AppCompat.Subhead | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Subhead (0x7f0d0024) | |
resource 0x7f0d00d6 style/TextAppearance.AppCompat.Subhead.Inverse | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Subhead.Inverse (0x7f0d0025) | |
resource 0x7f0d00d7 style/TextAppearance.AppCompat.Title | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Title (0x7f0d0026) | |
resource 0x7f0d00d8 style/TextAppearance.AppCompat.Title.Inverse | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Title.Inverse (0x7f0d0027) | |
resource 0x7f0d00d9 style/TextAppearance.AppCompat.Tooltip | |
() (style) size=2 parent=style/TextAppearance.AppCompat (0x7f0d00bd) | |
0x01010095=14.000000sp | |
0x010103ac="sans-serif" | |
resource 0x7f0d00da style/TextAppearance.AppCompat.Widget.ActionBar.Menu | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Widget.ActionBar.Menu (0x7f0d0029) | |
resource 0x7f0d00db style/TextAppearance.AppCompat.Widget.ActionBar.Subtitle | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Widget.ActionBar.Subtitle (0x7f0d002a) | |
resource 0x7f0d00dc style/TextAppearance.AppCompat.Widget.ActionBar.Subtitle.Inverse | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Widget.ActionBar.Subtitle.Inverse (0x7f0d002b) | |
resource 0x7f0d00dd style/TextAppearance.AppCompat.Widget.ActionBar.Title | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Widget.ActionBar.Title (0x7f0d002c) | |
resource 0x7f0d00de style/TextAppearance.AppCompat.Widget.ActionBar.Title.Inverse | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Widget.ActionBar.Title.Inverse (0x7f0d002d) | |
resource 0x7f0d00df style/TextAppearance.AppCompat.Widget.ActionMode.Subtitle | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Widget.ActionMode.Subtitle (0x7f0d002e) | |
resource 0x7f0d00e0 style/TextAppearance.AppCompat.Widget.ActionMode.Subtitle.Inverse | |
() (style) size=0 parent=style/TextAppearance.AppCompat.Widget.ActionMode.Subtitle (0x7f0d00df) | |
resource 0x7f0d00e1 style/TextAppearance.AppCompat.Widget.ActionMode.Title | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Widget.ActionMode.Title (0x7f0d002f) | |
resource 0x7f0d00e2 style/TextAppearance.AppCompat.Widget.ActionMode.Title.Inverse | |
() (style) size=0 parent=style/TextAppearance.AppCompat.Widget.ActionMode.Title (0x7f0d00e1) | |
resource 0x7f0d00e3 style/TextAppearance.AppCompat.Widget.Button | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Widget.Button (0x7f0d0030) | |
resource 0x7f0d00e4 style/TextAppearance.AppCompat.Widget.Button.Borderless.Colored | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Widget.Button.Borderless.Colored (0x7f0d0031) | |
resource 0x7f0d00e5 style/TextAppearance.AppCompat.Widget.Button.Colored | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Widget.Button.Colored (0x7f0d0032) | |
resource 0x7f0d00e6 style/TextAppearance.AppCompat.Widget.Button.Inverse | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Widget.Button.Inverse (0x7f0d0033) | |
resource 0x7f0d00e7 style/TextAppearance.AppCompat.Widget.DropDownItem | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Widget.DropDownItem (0x7f0d0034) | |
resource 0x7f0d00e8 style/TextAppearance.AppCompat.Widget.PopupMenu.Header | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Widget.PopupMenu.Header (0x7f0d0035) | |
resource 0x7f0d00e9 style/TextAppearance.AppCompat.Widget.PopupMenu.Large | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Widget.PopupMenu.Large (0x7f0d0036) | |
resource 0x7f0d00ea style/TextAppearance.AppCompat.Widget.PopupMenu.Small | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Widget.PopupMenu.Small (0x7f0d0037) | |
resource 0x7f0d00eb style/TextAppearance.AppCompat.Widget.Switch | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Widget.Switch (0x7f0d0038) | |
resource 0x7f0d00ec style/TextAppearance.AppCompat.Widget.TextView.SpinnerItem | |
() (style) size=0 parent=style/Base.TextAppearance.AppCompat.Widget.TextView.SpinnerItem (0x7f0d0039) | |
resource 0x7f0d00ed style/TextAppearance.Compat.Notification | |
() (style) size=0 parent=0x010301fe | |
resource 0x7f0d00ee style/TextAppearance.Compat.Notification.Info | |
() (style) size=0 parent=0x01030200 | |
resource 0x7f0d00ef style/TextAppearance.Compat.Notification.Line2 | |
() (style) size=0 parent=style/TextAppearance.Compat.Notification.Info (0x7f0d00ee) | |
resource 0x7f0d00f0 style/TextAppearance.Compat.Notification.Time | |
() (style) size=0 parent=0x01030202 | |
resource 0x7f0d00f1 style/TextAppearance.Compat.Notification.Title | |
() (style) size=0 parent=0x01030203 | |
resource 0x7f0d00f2 style/TextAppearance.Widget.AppCompat.ExpandedMenu.Item | |
() (style) size=0 parent=style/Base.TextAppearance.Widget.AppCompat.ExpandedMenu.Item (0x7f0d003a) | |
resource 0x7f0d00f3 style/TextAppearance.Widget.AppCompat.Toolbar.Subtitle | |
() (style) size=0 parent=style/Base.TextAppearance.Widget.AppCompat.Toolbar.Subtitle (0x7f0d003b) | |
resource 0x7f0d00f4 style/TextAppearance.Widget.AppCompat.Toolbar.Title | |
() (style) size=0 parent=style/Base.TextAppearance.Widget.AppCompat.Toolbar.Title (0x7f0d003c) | |
resource 0x7f0d00f5 style/Theme.AppCompat | |
() (style) size=0 parent=style/Base.Theme.AppCompat (0x7f0d003d) | |
resource 0x7f0d00f6 style/Theme.AppCompat.CompactMenu | |
() (style) size=0 parent=style/Base.Theme.AppCompat.CompactMenu (0x7f0d003e) | |
resource 0x7f0d00f7 style/Theme.AppCompat.DayNight | |
() (style) size=0 parent=style/Theme.AppCompat.Light (0x7f0d0102) | |
(night) (style) size=0 parent=style/Theme.AppCompat (0x7f0d00f5) | |
resource 0x7f0d00f8 style/Theme.AppCompat.DayNight.DarkActionBar | |
() (style) size=0 parent=style/Theme.AppCompat.Light.DarkActionBar (0x7f0d0103) | |
(night) (style) size=0 parent=style/Theme.AppCompat (0x7f0d00f5) | |
resource 0x7f0d00f9 style/Theme.AppCompat.DayNight.Dialog | |
() (style) size=0 parent=style/Theme.AppCompat.Light.Dialog (0x7f0d0104) | |
(night) (style) size=0 parent=style/Theme.AppCompat.Dialog (0x7f0d00fe) | |
resource 0x7f0d00fa style/Theme.AppCompat.DayNight.Dialog.Alert | |
() (style) size=0 parent=style/Theme.AppCompat.Light.Dialog.Alert (0x7f0d0105) | |
(night) (style) size=0 parent=style/Theme.AppCompat.Dialog.Alert (0x7f0d00ff) | |
resource 0x7f0d00fb style/Theme.AppCompat.DayNight.Dialog.MinWidth | |
() (style) size=0 parent=style/Theme.AppCompat.Light.Dialog.MinWidth (0x7f0d0106) | |
(night) (style) size=0 parent=style/Theme.AppCompat.Dialog.MinWidth (0x7f0d0100) | |
resource 0x7f0d00fc style/Theme.AppCompat.DayNight.DialogWhenLarge | |
() (style) size=0 parent=style/Theme.AppCompat.Light.DialogWhenLarge (0x7f0d0107) | |
(night) (style) size=0 parent=style/Theme.AppCompat.DialogWhenLarge (0x7f0d0101) | |
resource 0x7f0d00fd style/Theme.AppCompat.DayNight.NoActionBar | |
() (style) size=0 parent=style/Theme.AppCompat.Light.NoActionBar (0x7f0d0108) | |
(night) (style) size=0 parent=style/Theme.AppCompat.NoActionBar (0x7f0d0109) | |
resource 0x7f0d00fe style/Theme.AppCompat.Dialog | |
() (style) size=0 parent=style/Base.Theme.AppCompat.Dialog (0x7f0d003f) | |
resource 0x7f0d00ff style/Theme.AppCompat.Dialog.Alert | |
() (style) size=0 parent=style/Base.Theme.AppCompat.Dialog.Alert (0x7f0d0040) | |
resource 0x7f0d0100 style/Theme.AppCompat.Dialog.MinWidth | |
() (style) size=0 parent=style/Base.Theme.AppCompat.Dialog.MinWidth (0x7f0d0042) | |
resource 0x7f0d0101 style/Theme.AppCompat.DialogWhenLarge | |
() (style) size=0 parent=style/Base.Theme.AppCompat.DialogWhenLarge (0x7f0d0043) | |
resource 0x7f0d0102 style/Theme.AppCompat.Light | |
() (style) size=0 parent=style/Base.Theme.AppCompat.Light (0x7f0d0044) | |
resource 0x7f0d0103 style/Theme.AppCompat.Light.DarkActionBar | |
() (style) size=0 parent=style/Base.Theme.AppCompat.Light.DarkActionBar (0x7f0d0045) | |
resource 0x7f0d0104 style/Theme.AppCompat.Light.Dialog | |
() (style) size=0 parent=style/Base.Theme.AppCompat.Light.Dialog (0x7f0d0046) | |
resource 0x7f0d0105 style/Theme.AppCompat.Light.Dialog.Alert | |
() (style) size=0 parent=style/Base.Theme.AppCompat.Light.Dialog.Alert (0x7f0d0047) | |
resource 0x7f0d0106 style/Theme.AppCompat.Light.Dialog.MinWidth | |
() (style) size=0 parent=style/Base.Theme.AppCompat.Light.Dialog.MinWidth (0x7f0d0049) | |
resource 0x7f0d0107 style/Theme.AppCompat.Light.DialogWhenLarge | |
() (style) size=0 parent=style/Base.Theme.AppCompat.Light.DialogWhenLarge (0x7f0d004a) | |
resource 0x7f0d0108 style/Theme.AppCompat.Light.NoActionBar | |
() (style) size=2 parent=style/Theme.AppCompat.Light (0x7f0d0102) | |
windowActionBar(0x7f020145)=false | |
windowNoTitle(0x7f02014e)=true | |
resource 0x7f0d0109 style/Theme.AppCompat.NoActionBar | |
() (style) size=2 parent=style/Theme.AppCompat (0x7f0d00f5) | |
windowActionBar(0x7f020145)=false | |
windowNoTitle(0x7f02014e)=true | |
resource 0x7f0d010a style/ThemeOverlay.AppCompat | |
() (style) size=0 parent=style/Base.ThemeOverlay.AppCompat (0x7f0d004b) | |
resource 0x7f0d010b style/ThemeOverlay.AppCompat.ActionBar | |
() (style) size=0 parent=style/Base.ThemeOverlay.AppCompat.ActionBar (0x7f0d004c) | |
resource 0x7f0d010c style/ThemeOverlay.AppCompat.Dark | |
() (style) size=0 parent=style/Base.ThemeOverlay.AppCompat.Dark (0x7f0d004d) | |
resource 0x7f0d010d style/ThemeOverlay.AppCompat.Dark.ActionBar | |
() (style) size=0 parent=style/Base.ThemeOverlay.AppCompat.Dark.ActionBar (0x7f0d004e) | |
resource 0x7f0d010e style/ThemeOverlay.AppCompat.DayNight | |
() (style) size=0 parent=style/ThemeOverlay.AppCompat.Light (0x7f0d0112) | |
(night) (style) size=0 parent=style/ThemeOverlay.AppCompat.Dark (0x7f0d010c) | |
resource 0x7f0d010f style/ThemeOverlay.AppCompat.DayNight.ActionBar | |
() (style) size=2 parent=style/ThemeOverlay.AppCompat.DayNight (0x7f0d010e) | |
colorControlNormal(0x7f020054)=?0x01010036 | |
searchViewStyle(0x7f020100)=@style/Widget.AppCompat.SearchView.ActionBar | |
resource 0x7f0d0110 style/ThemeOverlay.AppCompat.Dialog | |
() (style) size=0 parent=style/Base.ThemeOverlay.AppCompat.Dialog (0x7f0d004f) | |
resource 0x7f0d0111 style/ThemeOverlay.AppCompat.Dialog.Alert | |
() (style) size=0 parent=style/Base.ThemeOverlay.AppCompat.Dialog.Alert (0x7f0d0050) | |
resource 0x7f0d0112 style/ThemeOverlay.AppCompat.Light | |
() (style) size=0 parent=style/Base.ThemeOverlay.AppCompat.Light (0x7f0d0051) | |
resource 0x7f0d0113 style/Widget.AppCompat.ActionBar | |
() (style) size=0 parent=style/Base.Widget.AppCompat.ActionBar (0x7f0d0068) | |
resource 0x7f0d0114 style/Widget.AppCompat.ActionBar.Solid | |
() (style) size=0 parent=style/Base.Widget.AppCompat.ActionBar.Solid (0x7f0d0069) | |
resource 0x7f0d0115 style/Widget.AppCompat.ActionBar.TabBar | |
() (style) size=0 parent=style/Base.Widget.AppCompat.ActionBar.TabBar (0x7f0d006a) | |
resource 0x7f0d0116 style/Widget.AppCompat.ActionBar.TabText | |
() (style) size=0 parent=style/Base.Widget.AppCompat.ActionBar.TabText (0x7f0d006b) | |
resource 0x7f0d0117 style/Widget.AppCompat.ActionBar.TabView | |
() (style) size=0 parent=style/Base.Widget.AppCompat.ActionBar.TabView (0x7f0d006c) | |
resource 0x7f0d0118 style/Widget.AppCompat.ActionButton | |
() (style) size=0 parent=style/Base.Widget.AppCompat.ActionButton (0x7f0d006d) | |
resource 0x7f0d0119 style/Widget.AppCompat.ActionButton.CloseMode | |
() (style) size=0 parent=style/Base.Widget.AppCompat.ActionButton.CloseMode (0x7f0d006e) | |
resource 0x7f0d011a style/Widget.AppCompat.ActionButton.Overflow | |
() (style) size=0 parent=style/Base.Widget.AppCompat.ActionButton.Overflow (0x7f0d006f) | |
resource 0x7f0d011b style/Widget.AppCompat.ActionMode | |
() (style) size=0 parent=style/Base.Widget.AppCompat.ActionMode (0x7f0d0070) | |
resource 0x7f0d011c style/Widget.AppCompat.ActivityChooserView | |
() (style) size=0 parent=style/Base.Widget.AppCompat.ActivityChooserView (0x7f0d0071) | |
resource 0x7f0d011d style/Widget.AppCompat.AutoCompleteTextView | |
() (style) size=0 parent=style/Base.Widget.AppCompat.AutoCompleteTextView (0x7f0d0072) | |
resource 0x7f0d011e style/Widget.AppCompat.Button | |
() (style) size=0 parent=style/Base.Widget.AppCompat.Button (0x7f0d0073) | |
resource 0x7f0d011f style/Widget.AppCompat.Button.Borderless | |
() (style) size=0 parent=style/Base.Widget.AppCompat.Button.Borderless (0x7f0d0074) | |
resource 0x7f0d0120 style/Widget.AppCompat.Button.Borderless.Colored | |
() (style) size=0 parent=style/Base.Widget.AppCompat.Button.Borderless.Colored (0x7f0d0075) | |
resource 0x7f0d0121 style/Widget.AppCompat.Button.ButtonBar.AlertDialog | |
() (style) size=0 parent=style/Base.Widget.AppCompat.Button.ButtonBar.AlertDialog (0x7f0d0076) | |
resource 0x7f0d0122 style/Widget.AppCompat.Button.Colored | |
() (style) size=0 parent=style/Base.Widget.AppCompat.Button.Colored (0x7f0d0077) | |
resource 0x7f0d0123 style/Widget.AppCompat.Button.Small | |
() (style) size=0 parent=style/Base.Widget.AppCompat.Button.Small (0x7f0d0078) | |
resource 0x7f0d0124 style/Widget.AppCompat.ButtonBar | |
() (style) size=0 parent=style/Base.Widget.AppCompat.ButtonBar (0x7f0d0079) | |
resource 0x7f0d0125 style/Widget.AppCompat.ButtonBar.AlertDialog | |
() (style) size=0 parent=style/Base.Widget.AppCompat.ButtonBar.AlertDialog (0x7f0d007a) | |
resource 0x7f0d0126 style/Widget.AppCompat.CompoundButton.CheckBox | |
() (style) size=0 parent=style/Base.Widget.AppCompat.CompoundButton.CheckBox (0x7f0d007b) | |
resource 0x7f0d0127 style/Widget.AppCompat.CompoundButton.RadioButton | |
() (style) size=0 parent=style/Base.Widget.AppCompat.CompoundButton.RadioButton (0x7f0d007c) | |
resource 0x7f0d0128 style/Widget.AppCompat.CompoundButton.Switch | |
() (style) size=0 parent=style/Base.Widget.AppCompat.CompoundButton.Switch (0x7f0d007d) | |
resource 0x7f0d0129 style/Widget.AppCompat.DrawerArrowToggle | |
() (style) size=1 parent=style/Base.Widget.AppCompat.DrawerArrowToggle (0x7f0d007e) | |
color(0x7f02004e)=?attr/colorControlNormal | |
resource 0x7f0d012a style/Widget.AppCompat.DropDownItem.Spinner | |
() (style) size=0 parent=style/RtlOverlay.Widget.AppCompat.Search.DropDown.Text (0x7f0d00b9) | |
resource 0x7f0d012b style/Widget.AppCompat.EditText | |
() (style) size=0 parent=style/Base.Widget.AppCompat.EditText (0x7f0d0081) | |
resource 0x7f0d012c style/Widget.AppCompat.ImageButton | |
() (style) size=0 parent=style/Base.Widget.AppCompat.ImageButton (0x7f0d0082) | |
resource 0x7f0d012d style/Widget.AppCompat.Light.ActionBar | |
() (style) size=0 parent=style/Base.Widget.AppCompat.Light.ActionBar (0x7f0d0083) | |
resource 0x7f0d012e style/Widget.AppCompat.Light.ActionBar.Solid | |
() (style) size=0 parent=style/Base.Widget.AppCompat.Light.ActionBar.Solid (0x7f0d0084) | |
resource 0x7f0d012f style/Widget.AppCompat.Light.ActionBar.Solid.Inverse | |
() (style) size=0 parent=style/Widget.AppCompat.Light.ActionBar.Solid (0x7f0d012e) | |
resource 0x7f0d0130 style/Widget.AppCompat.Light.ActionBar.TabBar | |
() (style) size=0 parent=style/Base.Widget.AppCompat.Light.ActionBar.TabBar (0x7f0d0085) | |
resource 0x7f0d0131 style/Widget.AppCompat.Light.ActionBar.TabBar.Inverse | |
() (style) size=0 parent=style/Widget.AppCompat.Light.ActionBar.TabBar (0x7f0d0130) | |
resource 0x7f0d0132 style/Widget.AppCompat.Light.ActionBar.TabText | |
() (style) size=0 parent=style/Base.Widget.AppCompat.Light.ActionBar.TabText (0x7f0d0086) | |
resource 0x7f0d0133 style/Widget.AppCompat.Light.ActionBar.TabText.Inverse | |
() (style) size=0 parent=style/Base.Widget.AppCompat.Light.ActionBar.TabText.Inverse (0x7f0d0087) | |
resource 0x7f0d0134 style/Widget.AppCompat.Light.ActionBar.TabView | |
() (style) size=0 parent=style/Base.Widget.AppCompat.Light.ActionBar.TabView (0x7f0d0088) | |
resource 0x7f0d0135 style/Widget.AppCompat.Light.ActionBar.TabView.Inverse | |
() (style) size=0 parent=style/Widget.AppCompat.Light.ActionBar.TabView (0x7f0d0134) | |
resource 0x7f0d0136 style/Widget.AppCompat.Light.ActionButton | |
() (style) size=0 parent=style/Widget.AppCompat.ActionButton (0x7f0d0118) | |
resource 0x7f0d0137 style/Widget.AppCompat.Light.ActionButton.CloseMode | |
() (style) size=0 parent=style/Widget.AppCompat.ActionButton.CloseMode (0x7f0d0119) | |
resource 0x7f0d0138 style/Widget.AppCompat.Light.ActionButton.Overflow | |
() (style) size=0 parent=style/Widget.AppCompat.ActionButton.Overflow (0x7f0d011a) | |
resource 0x7f0d0139 style/Widget.AppCompat.Light.ActionMode.Inverse | |
() (style) size=0 parent=style/Widget.AppCompat.ActionMode (0x7f0d011b) | |
resource 0x7f0d013a style/Widget.AppCompat.Light.ActivityChooserView | |
() (style) size=0 parent=style/Widget.AppCompat.ActivityChooserView (0x7f0d011c) | |
resource 0x7f0d013b style/Widget.AppCompat.Light.AutoCompleteTextView | |
() (style) size=0 parent=style/Widget.AppCompat.AutoCompleteTextView (0x7f0d011d) | |
resource 0x7f0d013c style/Widget.AppCompat.Light.DropDownItem.Spinner | |
() (style) size=0 parent=style/Widget.AppCompat.DropDownItem.Spinner (0x7f0d012a) | |
resource 0x7f0d013d style/Widget.AppCompat.Light.ListPopupWindow | |
() (style) size=0 parent=style/Widget.AppCompat.ListPopupWindow (0x7f0d0144) | |
resource 0x7f0d013e style/Widget.AppCompat.Light.ListView.DropDown | |
() (style) size=0 parent=style/Widget.AppCompat.ListView.DropDown (0x7f0d0146) | |
resource 0x7f0d013f style/Widget.AppCompat.Light.PopupMenu | |
() (style) size=0 parent=style/Base.Widget.AppCompat.Light.PopupMenu (0x7f0d0089) | |
resource 0x7f0d0140 style/Widget.AppCompat.Light.PopupMenu.Overflow | |
() (style) size=0 parent=style/Base.Widget.AppCompat.Light.PopupMenu.Overflow (0x7f0d008a) | |
resource 0x7f0d0141 style/Widget.AppCompat.Light.SearchView | |
() (style) size=0 parent=style/Widget.AppCompat.SearchView (0x7f0d0150) | |
resource 0x7f0d0142 style/Widget.AppCompat.Light.Spinner.DropDown.ActionBar | |
() (style) size=0 parent=style/Widget.AppCompat.Spinner.DropDown.ActionBar (0x7f0d0156) | |
resource 0x7f0d0143 style/Widget.AppCompat.ListMenuView | |
() (style) size=0 parent=style/Base.Widget.AppCompat.ListMenuView (0x7f0d008b) | |
resource 0x7f0d0144 style/Widget.AppCompat.ListPopupWindow | |
() (style) size=0 parent=style/Base.Widget.AppCompat.ListPopupWindow (0x7f0d008c) | |
resource 0x7f0d0145 style/Widget.AppCompat.ListView | |
() (style) size=0 parent=style/Base.Widget.AppCompat.ListView (0x7f0d008d) | |
resource 0x7f0d0146 style/Widget.AppCompat.ListView.DropDown | |
() (style) size=0 parent=style/Base.Widget.AppCompat.ListView.DropDown (0x7f0d008e) | |
resource 0x7f0d0147 style/Widget.AppCompat.ListView.Menu | |
() (style) size=0 parent=style/Base.Widget.AppCompat.ListView.Menu (0x7f0d008f) | |
resource 0x7f0d0148 style/Widget.AppCompat.PopupMenu | |
() (style) size=0 parent=style/Base.Widget.AppCompat.PopupMenu (0x7f0d0090) | |
resource 0x7f0d0149 style/Widget.AppCompat.PopupMenu.Overflow | |
() (style) size=0 parent=style/Base.Widget.AppCompat.PopupMenu.Overflow (0x7f0d0091) | |
resource 0x7f0d014a style/Widget.AppCompat.PopupWindow | |
() (style) size=0 parent=style/Base.Widget.AppCompat.PopupWindow (0x7f0d0092) | |
resource 0x7f0d014b style/Widget.AppCompat.ProgressBar | |
() (style) size=0 parent=style/Base.Widget.AppCompat.ProgressBar (0x7f0d0093) | |
resource 0x7f0d014c style/Widget.AppCompat.ProgressBar.Horizontal | |
() (style) size=0 parent=style/Base.Widget.AppCompat.ProgressBar.Horizontal (0x7f0d0094) | |
resource 0x7f0d014d style/Widget.AppCompat.RatingBar | |
() (style) size=0 parent=style/Base.Widget.AppCompat.RatingBar (0x7f0d0095) | |
resource 0x7f0d014e style/Widget.AppCompat.RatingBar.Indicator | |
() (style) size=0 parent=style/Base.Widget.AppCompat.RatingBar.Indicator (0x7f0d0096) | |
resource 0x7f0d014f style/Widget.AppCompat.RatingBar.Small | |
() (style) size=0 parent=style/Base.Widget.AppCompat.RatingBar.Small (0x7f0d0097) | |
resource 0x7f0d0150 style/Widget.AppCompat.SearchView | |
() (style) size=0 parent=style/Base.Widget.AppCompat.SearchView (0x7f0d0098) | |
resource 0x7f0d0151 style/Widget.AppCompat.SearchView.ActionBar | |
() (style) size=0 parent=style/Base.Widget.AppCompat.SearchView.ActionBar (0x7f0d0099) | |
resource 0x7f0d0152 style/Widget.AppCompat.SeekBar | |
() (style) size=0 parent=style/Base.Widget.AppCompat.SeekBar (0x7f0d009a) | |
resource 0x7f0d0153 style/Widget.AppCompat.SeekBar.Discrete | |
() (style) size=0 parent=style/Base.Widget.AppCompat.SeekBar.Discrete (0x7f0d009b) | |
resource 0x7f0d0154 style/Widget.AppCompat.Spinner | |
() (style) size=0 parent=style/Base.Widget.AppCompat.Spinner (0x7f0d009c) | |
resource 0x7f0d0155 style/Widget.AppCompat.Spinner.DropDown | |
() (style) size=0 parent=style/Widget.AppCompat.Spinner (0x7f0d0154) | |
resource 0x7f0d0156 style/Widget.AppCompat.Spinner.DropDown.ActionBar | |
() (style) size=0 parent=style/Widget.AppCompat.Spinner.DropDown (0x7f0d0155) | |
resource 0x7f0d0157 style/Widget.AppCompat.Spinner.Underlined | |
() (style) size=0 parent=style/Base.Widget.AppCompat.Spinner.Underlined (0x7f0d009d) | |
resource 0x7f0d0158 style/Widget.AppCompat.TextView | |
() (style) size=0 parent=style/Base.Widget.AppCompat.TextView (0x7f0d009e) | |
resource 0x7f0d0159 style/Widget.AppCompat.TextView.SpinnerItem | |
() (style) size=0 parent=style/Base.Widget.AppCompat.TextView.SpinnerItem (0x7f0d009f) | |
resource 0x7f0d015a style/Widget.AppCompat.Toolbar | |
() (style) size=0 parent=style/Base.Widget.AppCompat.Toolbar (0x7f0d00a0) | |
resource 0x7f0d015b style/Widget.AppCompat.Toolbar.Button.Navigation | |
() (style) size=0 parent=style/Base.Widget.AppCompat.Toolbar.Button.Navigation (0x7f0d00a1) | |
resource 0x7f0d015c style/Widget.Compat.NotificationActionContainer | |
() (style) size=1 | |
0x010100d4=@drawable/notification_action_background | |
resource 0x7f0d015d style/Widget.Compat.NotificationActionText | |
() (style) size=3 | |
0x01010034=?0x01010207 | |
0x01010095=@dimen/notification_action_text_size | |
0x01010098=@color/androidx_core_secondary_text_default_material_light |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment