Created
January 15, 2019 01:04
-
-
Save iceiix/81accf2e1b2c62e24b8b27ca05d5398c to your computer and use it in GitHub Desktop.
window.js:7196 missing function: emscripten_set_mousemove_callback - emscripten 1.38.22 + winit issue, https://github.com/kripken/emscripten/issues/7525 https://github.com/tomaka/winit/issues/760
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
// Copyright 2010 The Emscripten Authors. All rights reserved. | |
// Emscripten is available under two separate licenses, the MIT license and the | |
// University of Illinois/NCSA Open Source License. Both these licenses can be | |
// found in the LICENSE file. | |
// The Module object: Our interface to the outside world. We import | |
// and export values on it. There are various ways Module can be used: | |
// 1. Not defined. We create it here | |
// 2. A function parameter, function(Module) { ..generated code.. } | |
// 3. pre-run appended it, var Module = {}; ..generated code.. | |
// 4. External script tag defines var Module. | |
// We need to check if Module already exists (e.g. case 3 above). | |
// Substitution will be replaced with actual code on later stage of the build, | |
// this way Closure Compiler will not mangle it (e.g. case 4. above). | |
// Note that if you want to run closure, and also to use Module | |
// after the generated code, you will need to define var Module = {}; | |
// before the code. Then that object will be used in the code, and you | |
// can continue to use Module afterwards as well. | |
var Module = typeof Module !== 'undefined' ? Module : {}; | |
// --pre-jses are emitted after the Module integration code, so that they can | |
// refer to Module (if they choose; they can also define Module) | |
// {{PRE_JSES}} | |
// Sometimes an existing Module object exists with properties | |
// meant to overwrite the default module functionality. Here | |
// we collect those properties and reapply _after_ we configure | |
// the current environment's defaults to avoid having to be so | |
// defensive during initialization. | |
var moduleOverrides = {}; | |
var key; | |
for (key in Module) { | |
if (Module.hasOwnProperty(key)) { | |
moduleOverrides[key] = Module[key]; | |
} | |
} | |
Module['arguments'] = []; | |
Module['thisProgram'] = './this.program'; | |
Module['quit'] = function(status, toThrow) { | |
throw toThrow; | |
}; | |
Module['preRun'] = []; | |
Module['postRun'] = []; | |
// Determine the runtime environment we are in. You can customize this by | |
// setting the ENVIRONMENT setting at compile time (see settings.js). | |
var ENVIRONMENT_IS_WEB = false; | |
var ENVIRONMENT_IS_WORKER = false; | |
var ENVIRONMENT_IS_NODE = false; | |
var ENVIRONMENT_IS_SHELL = false; | |
ENVIRONMENT_IS_WEB = typeof window === 'object'; | |
ENVIRONMENT_IS_WORKER = typeof importScripts === 'function'; | |
ENVIRONMENT_IS_NODE = typeof process === 'object' && typeof require === 'function' && !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_WORKER; | |
ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER; | |
if (Module['ENVIRONMENT']) { | |
throw new Error('Module.ENVIRONMENT has been deprecated. To force the environment, use the ENVIRONMENT compile-time option (for example, -s ENVIRONMENT=web or -s ENVIRONMENT=node)'); | |
} | |
// Three configurations we can be running in: | |
// 1) We could be the application main() thread running in the main JS UI thread. (ENVIRONMENT_IS_WORKER == false and ENVIRONMENT_IS_PTHREAD == false) | |
// 2) We could be the application main() thread proxied to worker. (with Emscripten -s PROXY_TO_WORKER=1) (ENVIRONMENT_IS_WORKER == true, ENVIRONMENT_IS_PTHREAD == false) | |
// 3) We could be an application pthread running in a worker. (ENVIRONMENT_IS_WORKER == true and ENVIRONMENT_IS_PTHREAD == true) | |
// `/` should be present at the end if `scriptDirectory` is not empty | |
var scriptDirectory = ''; | |
function locateFile(path) { | |
if (Module['locateFile']) { | |
return Module['locateFile'](path, scriptDirectory); | |
} else { | |
return scriptDirectory + path; | |
} | |
} | |
if (ENVIRONMENT_IS_NODE) { | |
scriptDirectory = __dirname + '/'; | |
// Expose functionality in the same simple way that the shells work | |
// Note that we pollute the global namespace here, otherwise we break in node | |
var nodeFS; | |
var nodePath; | |
Module['read'] = function shell_read(filename, binary) { | |
var ret; | |
if (!nodeFS) nodeFS = require('fs'); | |
if (!nodePath) nodePath = require('path'); | |
filename = nodePath['normalize'](filename); | |
ret = nodeFS['readFileSync'](filename); | |
return binary ? ret : ret.toString(); | |
}; | |
Module['readBinary'] = function readBinary(filename) { | |
var ret = Module['read'](filename, true); | |
if (!ret.buffer) { | |
ret = new Uint8Array(ret); | |
} | |
assert(ret.buffer); | |
return ret; | |
}; | |
if (process['argv'].length > 1) { | |
Module['thisProgram'] = process['argv'][1].replace(/\\/g, '/'); | |
} | |
Module['arguments'] = process['argv'].slice(2); | |
if (typeof module !== 'undefined') { | |
module['exports'] = Module; | |
} | |
process['on']('uncaughtException', function(ex) { | |
// suppress ExitStatus exceptions from showing an error | |
if (!(ex instanceof ExitStatus)) { | |
throw ex; | |
} | |
}); | |
// Currently node will swallow unhandled rejections, but this behavior is | |
// deprecated, and in the future it will exit with error status. | |
process['on']('unhandledRejection', abort); | |
Module['quit'] = function(status) { | |
process['exit'](status); | |
}; | |
Module['inspect'] = function () { return '[Emscripten Module object]'; }; | |
} else | |
if (ENVIRONMENT_IS_SHELL) { | |
if (typeof read != 'undefined') { | |
Module['read'] = function shell_read(f) { | |
return read(f); | |
}; | |
} | |
Module['readBinary'] = function readBinary(f) { | |
var data; | |
if (typeof readbuffer === 'function') { | |
return new Uint8Array(readbuffer(f)); | |
} | |
data = read(f, 'binary'); | |
assert(typeof data === 'object'); | |
return data; | |
}; | |
if (typeof scriptArgs != 'undefined') { | |
Module['arguments'] = scriptArgs; | |
} else if (typeof arguments != 'undefined') { | |
Module['arguments'] = arguments; | |
} | |
if (typeof quit === 'function') { | |
Module['quit'] = function(status) { | |
quit(status); | |
} | |
} | |
} else | |
if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) { | |
if (ENVIRONMENT_IS_WORKER) { // Check worker, not web, since window could be polyfilled | |
scriptDirectory = self.location.href; | |
} else if (document.currentScript) { // web | |
scriptDirectory = document.currentScript.src; | |
} | |
// blob urls look like blob:http://site.com/etc/etc and we cannot infer anything from them. | |
// otherwise, slice off the final part of the url to find the script directory. | |
// if scriptDirectory does not contain a slash, lastIndexOf will return -1, | |
// and scriptDirectory will correctly be replaced with an empty string. | |
if (scriptDirectory.indexOf('blob:') !== 0) { | |
scriptDirectory = scriptDirectory.substr(0, scriptDirectory.lastIndexOf('/')+1); | |
} else { | |
scriptDirectory = ''; | |
} | |
Module['read'] = function shell_read(url) { | |
var xhr = new XMLHttpRequest(); | |
xhr.open('GET', url, false); | |
xhr.send(null); | |
return xhr.responseText; | |
}; | |
if (ENVIRONMENT_IS_WORKER) { | |
Module['readBinary'] = function readBinary(url) { | |
var xhr = new XMLHttpRequest(); | |
xhr.open('GET', url, false); | |
xhr.responseType = 'arraybuffer'; | |
xhr.send(null); | |
return new Uint8Array(xhr.response); | |
}; | |
} | |
Module['readAsync'] = function readAsync(url, onload, onerror) { | |
var xhr = new XMLHttpRequest(); | |
xhr.open('GET', url, true); | |
xhr.responseType = 'arraybuffer'; | |
xhr.onload = function xhr_onload() { | |
if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0 | |
onload(xhr.response); | |
return; | |
} | |
onerror(); | |
}; | |
xhr.onerror = onerror; | |
xhr.send(null); | |
}; | |
Module['setWindowTitle'] = function(title) { document.title = title }; | |
} else | |
{ | |
throw new Error('environment detection error'); | |
} | |
// Set up the out() and err() hooks, which are how we can print to stdout or | |
// stderr, respectively. | |
// If the user provided Module.print or printErr, use that. Otherwise, | |
// console.log is checked first, as 'print' on the web will open a print dialogue | |
// printErr is preferable to console.warn (works better in shells) | |
// bind(console) is necessary to fix IE/Edge closed dev tools panel behavior. | |
var out = Module['print'] || (typeof console !== 'undefined' ? console.log.bind(console) : (typeof print !== 'undefined' ? print : null)); | |
var err = Module['printErr'] || (typeof printErr !== 'undefined' ? printErr : ((typeof console !== 'undefined' && console.warn.bind(console)) || out)); | |
// Merge back in the overrides | |
for (key in moduleOverrides) { | |
if (moduleOverrides.hasOwnProperty(key)) { | |
Module[key] = moduleOverrides[key]; | |
} | |
} | |
// Free the object hierarchy contained in the overrides, this lets the GC | |
// reclaim data used e.g. in memoryInitializerRequest, which is a large typed array. | |
moduleOverrides = undefined; | |
// perform assertions in shell.js after we set up out() and err(), as otherwise if an assertion fails it cannot print the message | |
assert(typeof Module['memoryInitializerPrefixURL'] === 'undefined', 'Module.memoryInitializerPrefixURL option was removed, use Module.locateFile instead'); | |
assert(typeof Module['pthreadMainPrefixURL'] === 'undefined', 'Module.pthreadMainPrefixURL option was removed, use Module.locateFile instead'); | |
assert(typeof Module['cdInitializerPrefixURL'] === 'undefined', 'Module.cdInitializerPrefixURL option was removed, use Module.locateFile instead'); | |
assert(typeof Module['filePackagePrefixURL'] === 'undefined', 'Module.filePackagePrefixURL option was removed, use Module.locateFile instead'); | |
// Copyright 2017 The Emscripten Authors. All rights reserved. | |
// Emscripten is available under two separate licenses, the MIT license and the | |
// University of Illinois/NCSA Open Source License. Both these licenses can be | |
// found in the LICENSE file. | |
// {{PREAMBLE_ADDITIONS}} | |
var STACK_ALIGN = 16; | |
// stack management, and other functionality that is provided by the compiled code, | |
// should not be used before it is ready | |
stackSave = stackRestore = stackAlloc = function() { | |
abort('cannot use the stack before compiled code is ready to run, and has provided stack access'); | |
}; | |
function staticAlloc(size) { | |
assert(!staticSealed); | |
var ret = STATICTOP; | |
STATICTOP = (STATICTOP + size + 15) & -16; | |
assert(STATICTOP < TOTAL_MEMORY, 'not enough memory for static allocation - increase TOTAL_MEMORY'); | |
return ret; | |
} | |
function dynamicAlloc(size) { | |
assert(DYNAMICTOP_PTR); | |
var ret = HEAP32[DYNAMICTOP_PTR>>2]; | |
var end = (ret + size + 15) & -16; | |
HEAP32[DYNAMICTOP_PTR>>2] = end; | |
if (end >= TOTAL_MEMORY) { | |
var success = enlargeMemory(); | |
if (!success) { | |
HEAP32[DYNAMICTOP_PTR>>2] = ret; | |
return 0; | |
} | |
} | |
return ret; | |
} | |
function alignMemory(size, factor) { | |
if (!factor) factor = STACK_ALIGN; // stack alignment (16-byte) by default | |
return Math.ceil(size / factor) * factor; | |
} | |
function getNativeTypeSize(type) { | |
switch (type) { | |
case 'i1': case 'i8': return 1; | |
case 'i16': return 2; | |
case 'i32': return 4; | |
case 'i64': return 8; | |
case 'float': return 4; | |
case 'double': return 8; | |
default: { | |
if (type[type.length-1] === '*') { | |
return 4; // A pointer | |
} else if (type[0] === 'i') { | |
var bits = parseInt(type.substr(1)); | |
assert(bits % 8 === 0); | |
return bits / 8; | |
} else { | |
return 0; | |
} | |
} | |
} | |
} | |
function warnOnce(text) { | |
if (!warnOnce.shown) warnOnce.shown = {}; | |
if (!warnOnce.shown[text]) { | |
warnOnce.shown[text] = 1; | |
err(text); | |
} | |
} | |
var asm2wasmImports = { // special asm2wasm imports | |
"f64-rem": function(x, y) { | |
return x % y; | |
}, | |
"debugger": function() { | |
debugger; | |
} | |
}; | |
var jsCallStartIndex = 1; | |
var functionPointers = new Array(0); | |
// Add a wasm function to the table. | |
// Attempting to call this with JS function will cause of table.set() to fail | |
function addWasmFunction(func) { | |
var table = Module['wasmTable']; | |
var ret = table.length; | |
table.grow(1); | |
table.set(ret, func); | |
return ret; | |
} | |
// 'sig' parameter is currently only used for LLVM backend under certain | |
// circumstance: RESERVED_FUNCTION_POINTERS=1, EMULATED_FUNCTION_POINTERS=0. | |
function addFunction(func, sig) { | |
var base = 0; | |
for (var i = base; i < base + 0; i++) { | |
if (!functionPointers[i]) { | |
functionPointers[i] = func; | |
return jsCallStartIndex + i; | |
} | |
} | |
throw 'Finished up all reserved function pointers. Use a higher value for RESERVED_FUNCTION_POINTERS.'; | |
} | |
function removeFunction(index) { | |
functionPointers[index-jsCallStartIndex] = null; | |
} | |
var funcWrappers = {}; | |
function getFuncWrapper(func, sig) { | |
if (!func) return; // on null pointer, return undefined | |
assert(sig); | |
if (!funcWrappers[sig]) { | |
funcWrappers[sig] = {}; | |
} | |
var sigCache = funcWrappers[sig]; | |
if (!sigCache[func]) { | |
// optimize away arguments usage in common cases | |
if (sig.length === 1) { | |
sigCache[func] = function dynCall_wrapper() { | |
return dynCall(sig, func); | |
}; | |
} else if (sig.length === 2) { | |
sigCache[func] = function dynCall_wrapper(arg) { | |
return dynCall(sig, func, [arg]); | |
}; | |
} else { | |
// general case | |
sigCache[func] = function dynCall_wrapper() { | |
return dynCall(sig, func, Array.prototype.slice.call(arguments)); | |
}; | |
} | |
} | |
return sigCache[func]; | |
} | |
function makeBigInt(low, high, unsigned) { | |
return unsigned ? ((+((low>>>0)))+((+((high>>>0)))*4294967296.0)) : ((+((low>>>0)))+((+((high|0)))*4294967296.0)); | |
} | |
function dynCall(sig, ptr, args) { | |
if (args && args.length) { | |
assert(args.length == sig.length-1); | |
assert(('dynCall_' + sig) in Module, 'bad function pointer type - no table for sig \'' + sig + '\''); | |
return Module['dynCall_' + sig].apply(null, [ptr].concat(args)); | |
} else { | |
assert(sig.length == 1); | |
assert(('dynCall_' + sig) in Module, 'bad function pointer type - no table for sig \'' + sig + '\''); | |
return Module['dynCall_' + sig].call(null, ptr); | |
} | |
} | |
var tempRet0 = 0; | |
var setTempRet0 = function(value) { | |
tempRet0 = value; | |
} | |
var getTempRet0 = function() { | |
return tempRet0; | |
} | |
function getCompilerSetting(name) { | |
throw 'You must build with -s RETAIN_COMPILER_SETTINGS=1 for getCompilerSetting or emscripten_get_compiler_setting to work'; | |
} | |
var Runtime = { | |
// FIXME backwards compatibility layer for ports. Support some Runtime.* | |
// for now, fix it there, then remove it from here. That way we | |
// can minimize any period of breakage. | |
dynCall: dynCall, // for SDL2 port | |
// helpful errors | |
getTempRet0: function() { abort('getTempRet0() is now a top-level function, after removing the Runtime object. Remove "Runtime."') }, | |
staticAlloc: function() { abort('staticAlloc() is now a top-level function, after removing the Runtime object. Remove "Runtime."') }, | |
stackAlloc: function() { abort('stackAlloc() is now a top-level function, after removing the Runtime object. Remove "Runtime."') }, | |
}; | |
// The address globals begin at. Very low in memory, for code size and optimization opportunities. | |
// Above 0 is static memory, starting with globals. | |
// Then the stack. | |
// Then 'dynamic' memory for sbrk. | |
var GLOBAL_BASE = 1024; | |
// === Preamble library stuff === | |
// Documentation for the public APIs defined in this file must be updated in: | |
// site/source/docs/api_reference/preamble.js.rst | |
// A prebuilt local version of the documentation is available at: | |
// site/build/text/docs/api_reference/preamble.js.txt | |
// You can also build docs locally as HTML or other formats in site/ | |
// An online HTML version (which may be of a different version of Emscripten) | |
// is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html | |
//======================================== | |
// Runtime essentials | |
//======================================== | |
// whether we are quitting the application. no code should run after this. | |
// set in exit() and abort() | |
var ABORT = false; | |
// set by exit() and abort(). Passed to 'onExit' handler. | |
// NOTE: This is also used as the process return code code in shell environments | |
// but only when noExitRuntime is false. | |
var EXITSTATUS = 0; | |
/** @type {function(*, string=)} */ | |
function assert(condition, text) { | |
if (!condition) { | |
abort('Assertion failed: ' + text); | |
} | |
} | |
var globalScope = this; | |
// Returns the C function with a specified identifier (for C++, you need to do manual name mangling) | |
function getCFunc(ident) { | |
var func = Module['_' + ident]; // closure exported function | |
assert(func, 'Cannot call unknown function ' + ident + ', make sure it is exported'); | |
return func; | |
} | |
var JSfuncs = { | |
// Helpers for cwrap -- it can't refer to Runtime directly because it might | |
// be renamed by closure, instead it calls JSfuncs['stackSave'].body to find | |
// out what the minified function name is. | |
'stackSave': function() { | |
stackSave() | |
}, | |
'stackRestore': function() { | |
stackRestore() | |
}, | |
// type conversion from js to c | |
'arrayToC' : function(arr) { | |
var ret = stackAlloc(arr.length); | |
writeArrayToMemory(arr, ret); | |
return ret; | |
}, | |
'stringToC' : function(str) { | |
var ret = 0; | |
if (str !== null && str !== undefined && str !== 0) { // null string | |
// at most 4 bytes per UTF-8 code point, +1 for the trailing '\0' | |
var len = (str.length << 2) + 1; | |
ret = stackAlloc(len); | |
stringToUTF8(str, ret, len); | |
} | |
return ret; | |
} | |
}; | |
// For fast lookup of conversion functions | |
var toC = { | |
'string': JSfuncs['stringToC'], 'array': JSfuncs['arrayToC'] | |
}; | |
// C calling interface. | |
function ccall(ident, returnType, argTypes, args, opts) { | |
function convertReturnValue(ret) { | |
if (returnType === 'string') return Pointer_stringify(ret); | |
if (returnType === 'boolean') return Boolean(ret); | |
return ret; | |
} | |
var func = getCFunc(ident); | |
var cArgs = []; | |
var stack = 0; | |
assert(returnType !== 'array', 'Return type should not be "array".'); | |
if (args) { | |
for (var i = 0; i < args.length; i++) { | |
var converter = toC[argTypes[i]]; | |
if (converter) { | |
if (stack === 0) stack = stackSave(); | |
cArgs[i] = converter(args[i]); | |
} else { | |
cArgs[i] = args[i]; | |
} | |
} | |
} | |
var ret = func.apply(null, cArgs); | |
ret = convertReturnValue(ret); | |
if (stack !== 0) stackRestore(stack); | |
return ret; | |
} | |
function cwrap(ident, returnType, argTypes, opts) { | |
return function() { | |
return ccall(ident, returnType, argTypes, arguments, opts); | |
} | |
} | |
/** @type {function(number, number, string, boolean=)} */ | |
function setValue(ptr, value, type, noSafe) { | |
type = type || 'i8'; | |
if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit | |
switch(type) { | |
case 'i1': HEAP8[((ptr)>>0)]=value; break; | |
case 'i8': HEAP8[((ptr)>>0)]=value; break; | |
case 'i16': HEAP16[((ptr)>>1)]=value; break; | |
case 'i32': HEAP32[((ptr)>>2)]=value; break; | |
case 'i64': (tempI64 = [value>>>0,(tempDouble=value,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((ptr)>>2)]=tempI64[0],HEAP32[(((ptr)+(4))>>2)]=tempI64[1]); break; | |
case 'float': HEAPF32[((ptr)>>2)]=value; break; | |
case 'double': HEAPF64[((ptr)>>3)]=value; break; | |
default: abort('invalid type for setValue: ' + type); | |
} | |
} | |
/** @type {function(number, string, boolean=)} */ | |
function getValue(ptr, type, noSafe) { | |
type = type || 'i8'; | |
if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit | |
switch(type) { | |
case 'i1': return HEAP8[((ptr)>>0)]; | |
case 'i8': return HEAP8[((ptr)>>0)]; | |
case 'i16': return HEAP16[((ptr)>>1)]; | |
case 'i32': return HEAP32[((ptr)>>2)]; | |
case 'i64': return HEAP32[((ptr)>>2)]; | |
case 'float': return HEAPF32[((ptr)>>2)]; | |
case 'double': return HEAPF64[((ptr)>>3)]; | |
default: abort('invalid type for getValue: ' + type); | |
} | |
return null; | |
} | |
var ALLOC_NORMAL = 0; // Tries to use _malloc() | |
var ALLOC_STACK = 1; // Lives for the duration of the current function call | |
var ALLOC_STATIC = 2; // Cannot be freed | |
var ALLOC_DYNAMIC = 3; // Cannot be freed except through sbrk | |
var ALLOC_NONE = 4; // Do not allocate | |
// allocate(): This is for internal use. You can use it yourself as well, but the interface | |
// is a little tricky (see docs right below). The reason is that it is optimized | |
// for multiple syntaxes to save space in generated code. So you should | |
// normally not use allocate(), and instead allocate memory using _malloc(), | |
// initialize it with setValue(), and so forth. | |
// @slab: An array of data, or a number. If a number, then the size of the block to allocate, | |
// in *bytes* (note that this is sometimes confusing: the next parameter does not | |
// affect this!) | |
// @types: Either an array of types, one for each byte (or 0 if no type at that position), | |
// or a single type which is used for the entire block. This only matters if there | |
// is initial data - if @slab is a number, then this does not matter at all and is | |
// ignored. | |
// @allocator: How to allocate memory, see ALLOC_* | |
/** @type {function((TypedArray|Array<number>|number), string, number, number=)} */ | |
function allocate(slab, types, allocator, ptr) { | |
var zeroinit, size; | |
if (typeof slab === 'number') { | |
zeroinit = true; | |
size = slab; | |
} else { | |
zeroinit = false; | |
size = slab.length; | |
} | |
var singleType = typeof types === 'string' ? types : null; | |
var ret; | |
if (allocator == ALLOC_NONE) { | |
ret = ptr; | |
} else { | |
ret = [typeof _malloc === 'function' ? _malloc : staticAlloc, stackAlloc, staticAlloc, dynamicAlloc][allocator === undefined ? ALLOC_STATIC : allocator](Math.max(size, singleType ? 1 : types.length)); | |
} | |
if (zeroinit) { | |
var stop; | |
ptr = ret; | |
assert((ret & 3) == 0); | |
stop = ret + (size & ~3); | |
for (; ptr < stop; ptr += 4) { | |
HEAP32[((ptr)>>2)]=0; | |
} | |
stop = ret + size; | |
while (ptr < stop) { | |
HEAP8[((ptr++)>>0)]=0; | |
} | |
return ret; | |
} | |
if (singleType === 'i8') { | |
if (slab.subarray || slab.slice) { | |
HEAPU8.set(/** @type {!Uint8Array} */ (slab), ret); | |
} else { | |
HEAPU8.set(new Uint8Array(slab), ret); | |
} | |
return ret; | |
} | |
var i = 0, type, typeSize, previousType; | |
while (i < size) { | |
var curr = slab[i]; | |
type = singleType || types[i]; | |
if (type === 0) { | |
i++; | |
continue; | |
} | |
assert(type, 'Must know what type to store in allocate!'); | |
if (type == 'i64') type = 'i32'; // special case: we have one i32 here, and one i32 later | |
setValue(ret+i, curr, type); | |
// no need to look up size unless type changes, so cache it | |
if (previousType !== type) { | |
typeSize = getNativeTypeSize(type); | |
previousType = type; | |
} | |
i += typeSize; | |
} | |
return ret; | |
} | |
// Allocate memory during any stage of startup - static memory early on, dynamic memory later, malloc when ready | |
function getMemory(size) { | |
if (!staticSealed) return staticAlloc(size); | |
if (!runtimeInitialized) return dynamicAlloc(size); | |
return _malloc(size); | |
} | |
/** @type {function(number, number=)} */ | |
function Pointer_stringify(ptr, length) { | |
if (length === 0 || !ptr) return ''; | |
// Find the length, and check for UTF while doing so | |
var hasUtf = 0; | |
var t; | |
var i = 0; | |
while (1) { | |
assert(ptr + i < TOTAL_MEMORY); | |
t = HEAPU8[(((ptr)+(i))>>0)]; | |
hasUtf |= t; | |
if (t == 0 && !length) break; | |
i++; | |
if (length && i == length) break; | |
} | |
if (!length) length = i; | |
var ret = ''; | |
if (hasUtf < 128) { | |
var MAX_CHUNK = 1024; // split up into chunks, because .apply on a huge string can overflow the stack | |
var curr; | |
while (length > 0) { | |
curr = String.fromCharCode.apply(String, HEAPU8.subarray(ptr, ptr + Math.min(length, MAX_CHUNK))); | |
ret = ret ? ret + curr : curr; | |
ptr += MAX_CHUNK; | |
length -= MAX_CHUNK; | |
} | |
return ret; | |
} | |
return UTF8ToString(ptr); | |
} | |
// Given a pointer 'ptr' to a null-terminated ASCII-encoded string in the emscripten HEAP, returns | |
// a copy of that string as a Javascript String object. | |
function AsciiToString(ptr) { | |
var str = ''; | |
while (1) { | |
var ch = HEAP8[((ptr++)>>0)]; | |
if (!ch) return str; | |
str += String.fromCharCode(ch); | |
} | |
} | |
// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', | |
// null-terminated and encoded in ASCII form. The copy will require at most str.length+1 bytes of space in the HEAP. | |
function stringToAscii(str, outPtr) { | |
return writeAsciiToMemory(str, outPtr, false); | |
} | |
// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the given array that contains uint8 values, returns | |
// a copy of that string as a Javascript String object. | |
var UTF8Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf8') : undefined; | |
function UTF8ArrayToString(u8Array, idx) { | |
var endPtr = idx; | |
// TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself. | |
// Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage. | |
while (u8Array[endPtr]) ++endPtr; | |
if (endPtr - idx > 16 && u8Array.subarray && UTF8Decoder) { | |
return UTF8Decoder.decode(u8Array.subarray(idx, endPtr)); | |
} else { | |
var u0, u1, u2, u3, u4, u5; | |
var str = ''; | |
while (1) { | |
// For UTF8 byte structure, see: | |
// http://en.wikipedia.org/wiki/UTF-8#Description | |
// https://www.ietf.org/rfc/rfc2279.txt | |
// https://tools.ietf.org/html/rfc3629 | |
u0 = u8Array[idx++]; | |
if (!u0) return str; | |
if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; } | |
u1 = u8Array[idx++] & 63; | |
if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; } | |
u2 = u8Array[idx++] & 63; | |
if ((u0 & 0xF0) == 0xE0) { | |
u0 = ((u0 & 15) << 12) | (u1 << 6) | u2; | |
} else { | |
u3 = u8Array[idx++] & 63; | |
if ((u0 & 0xF8) == 0xF0) { | |
u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | u3; | |
} else { | |
u4 = u8Array[idx++] & 63; | |
if ((u0 & 0xFC) == 0xF8) { | |
u0 = ((u0 & 3) << 24) | (u1 << 18) | (u2 << 12) | (u3 << 6) | u4; | |
} else { | |
u5 = u8Array[idx++] & 63; | |
u0 = ((u0 & 1) << 30) | (u1 << 24) | (u2 << 18) | (u3 << 12) | (u4 << 6) | u5; | |
} | |
} | |
} | |
if (u0 < 0x10000) { | |
str += String.fromCharCode(u0); | |
} else { | |
var ch = u0 - 0x10000; | |
str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF)); | |
} | |
} | |
} | |
} | |
// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the emscripten HEAP, returns | |
// a copy of that string as a Javascript String object. | |
function UTF8ToString(ptr) { | |
return UTF8ArrayToString(HEAPU8,ptr); | |
} | |
// Copies the given Javascript String object 'str' to the given byte array at address 'outIdx', | |
// encoded in UTF8 form and null-terminated. The copy will require at most str.length*4+1 bytes of space in the HEAP. | |
// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write. | |
// Parameters: | |
// str: the Javascript string to copy. | |
// outU8Array: the array to copy to. Each index in this array is assumed to be one 8-byte element. | |
// outIdx: The starting offset in the array to begin the copying. | |
// maxBytesToWrite: The maximum number of bytes this function can write to the array. | |
// This count should include the null terminator, | |
// i.e. if maxBytesToWrite=1, only the null terminator will be written and nothing else. | |
// maxBytesToWrite=0 does not write any bytes to the output, not even the null terminator. | |
// Returns the number of bytes written, EXCLUDING the null terminator. | |
function stringToUTF8Array(str, outU8Array, outIdx, maxBytesToWrite) { | |
if (!(maxBytesToWrite > 0)) // Parameter maxBytesToWrite is not optional. Negative values, 0, null, undefined and false each don't write out any bytes. | |
return 0; | |
var startIdx = outIdx; | |
var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator. | |
for (var i = 0; i < str.length; ++i) { | |
// Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8. | |
// See http://unicode.org/faq/utf_bom.html#utf16-3 | |
// For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629 | |
var u = str.charCodeAt(i); // possibly a lead surrogate | |
if (u >= 0xD800 && u <= 0xDFFF) { | |
var u1 = str.charCodeAt(++i); | |
u = 0x10000 + ((u & 0x3FF) << 10) | (u1 & 0x3FF); | |
} | |
if (u <= 0x7F) { | |
if (outIdx >= endIdx) break; | |
outU8Array[outIdx++] = u; | |
} else if (u <= 0x7FF) { | |
if (outIdx + 1 >= endIdx) break; | |
outU8Array[outIdx++] = 0xC0 | (u >> 6); | |
outU8Array[outIdx++] = 0x80 | (u & 63); | |
} else if (u <= 0xFFFF) { | |
if (outIdx + 2 >= endIdx) break; | |
outU8Array[outIdx++] = 0xE0 | (u >> 12); | |
outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); | |
outU8Array[outIdx++] = 0x80 | (u & 63); | |
} else if (u <= 0x1FFFFF) { | |
if (outIdx + 3 >= endIdx) break; | |
outU8Array[outIdx++] = 0xF0 | (u >> 18); | |
outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63); | |
outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); | |
outU8Array[outIdx++] = 0x80 | (u & 63); | |
} else if (u <= 0x3FFFFFF) { | |
if (outIdx + 4 >= endIdx) break; | |
outU8Array[outIdx++] = 0xF8 | (u >> 24); | |
outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63); | |
outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63); | |
outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); | |
outU8Array[outIdx++] = 0x80 | (u & 63); | |
} else { | |
if (outIdx + 5 >= endIdx) break; | |
outU8Array[outIdx++] = 0xFC | (u >> 30); | |
outU8Array[outIdx++] = 0x80 | ((u >> 24) & 63); | |
outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63); | |
outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63); | |
outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); | |
outU8Array[outIdx++] = 0x80 | (u & 63); | |
} | |
} | |
// Null-terminate the pointer to the buffer. | |
outU8Array[outIdx] = 0; | |
return outIdx - startIdx; | |
} | |
// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', | |
// null-terminated and encoded in UTF8 form. The copy will require at most str.length*4+1 bytes of space in the HEAP. | |
// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write. | |
// Returns the number of bytes written, EXCLUDING the null terminator. | |
function stringToUTF8(str, outPtr, maxBytesToWrite) { | |
assert(typeof maxBytesToWrite == 'number', 'stringToUTF8(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!'); | |
return stringToUTF8Array(str, HEAPU8,outPtr, maxBytesToWrite); | |
} | |
// Returns the number of bytes the given Javascript string takes if encoded as a UTF8 byte array, EXCLUDING the null terminator byte. | |
function lengthBytesUTF8(str) { | |
var len = 0; | |
for (var i = 0; i < str.length; ++i) { | |
// Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8. | |
// See http://unicode.org/faq/utf_bom.html#utf16-3 | |
var u = str.charCodeAt(i); // possibly a lead surrogate | |
if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF); | |
if (u <= 0x7F) { | |
++len; | |
} else if (u <= 0x7FF) { | |
len += 2; | |
} else if (u <= 0xFFFF) { | |
len += 3; | |
} else if (u <= 0x1FFFFF) { | |
len += 4; | |
} else if (u <= 0x3FFFFFF) { | |
len += 5; | |
} else { | |
len += 6; | |
} | |
} | |
return len; | |
} | |
// Given a pointer 'ptr' to a null-terminated UTF16LE-encoded string in the emscripten HEAP, returns | |
// a copy of that string as a Javascript String object. | |
var UTF16Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf-16le') : undefined; | |
function UTF16ToString(ptr) { | |
assert(ptr % 2 == 0, 'Pointer passed to UTF16ToString must be aligned to two bytes!'); | |
var endPtr = ptr; | |
// TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself. | |
// Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage. | |
var idx = endPtr >> 1; | |
while (HEAP16[idx]) ++idx; | |
endPtr = idx << 1; | |
if (endPtr - ptr > 32 && UTF16Decoder) { | |
return UTF16Decoder.decode(HEAPU8.subarray(ptr, endPtr)); | |
} else { | |
var i = 0; | |
var str = ''; | |
while (1) { | |
var codeUnit = HEAP16[(((ptr)+(i*2))>>1)]; | |
if (codeUnit == 0) return str; | |
++i; | |
// fromCharCode constructs a character from a UTF-16 code unit, so we can pass the UTF16 string right through. | |
str += String.fromCharCode(codeUnit); | |
} | |
} | |
} | |
// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', | |
// null-terminated and encoded in UTF16 form. The copy will require at most str.length*4+2 bytes of space in the HEAP. | |
// Use the function lengthBytesUTF16() to compute the exact number of bytes (excluding null terminator) that this function will write. | |
// Parameters: | |
// str: the Javascript string to copy. | |
// outPtr: Byte address in Emscripten HEAP where to write the string to. | |
// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null | |
// terminator, i.e. if maxBytesToWrite=2, only the null terminator will be written and nothing else. | |
// maxBytesToWrite<2 does not write any bytes to the output, not even the null terminator. | |
// Returns the number of bytes written, EXCLUDING the null terminator. | |
function stringToUTF16(str, outPtr, maxBytesToWrite) { | |
assert(outPtr % 2 == 0, 'Pointer passed to stringToUTF16 must be aligned to two bytes!'); | |
assert(typeof maxBytesToWrite == 'number', 'stringToUTF16(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!'); | |
// Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed. | |
if (maxBytesToWrite === undefined) { | |
maxBytesToWrite = 0x7FFFFFFF; | |
} | |
if (maxBytesToWrite < 2) return 0; | |
maxBytesToWrite -= 2; // Null terminator. | |
var startPtr = outPtr; | |
var numCharsToWrite = (maxBytesToWrite < str.length*2) ? (maxBytesToWrite / 2) : str.length; | |
for (var i = 0; i < numCharsToWrite; ++i) { | |
// charCodeAt returns a UTF-16 encoded code unit, so it can be directly written to the HEAP. | |
var codeUnit = str.charCodeAt(i); // possibly a lead surrogate | |
HEAP16[((outPtr)>>1)]=codeUnit; | |
outPtr += 2; | |
} | |
// Null-terminate the pointer to the HEAP. | |
HEAP16[((outPtr)>>1)]=0; | |
return outPtr - startPtr; | |
} | |
// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte. | |
function lengthBytesUTF16(str) { | |
return str.length*2; | |
} | |
function UTF32ToString(ptr) { | |
assert(ptr % 4 == 0, 'Pointer passed to UTF32ToString must be aligned to four bytes!'); | |
var i = 0; | |
var str = ''; | |
while (1) { | |
var utf32 = HEAP32[(((ptr)+(i*4))>>2)]; | |
if (utf32 == 0) | |
return str; | |
++i; | |
// Gotcha: fromCharCode constructs a character from a UTF-16 encoded code (pair), not from a Unicode code point! So encode the code point to UTF-16 for constructing. | |
// See http://unicode.org/faq/utf_bom.html#utf16-3 | |
if (utf32 >= 0x10000) { | |
var ch = utf32 - 0x10000; | |
str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF)); | |
} else { | |
str += String.fromCharCode(utf32); | |
} | |
} | |
} | |
// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', | |
// null-terminated and encoded in UTF32 form. The copy will require at most str.length*4+4 bytes of space in the HEAP. | |
// Use the function lengthBytesUTF32() to compute the exact number of bytes (excluding null terminator) that this function will write. | |
// Parameters: | |
// str: the Javascript string to copy. | |
// outPtr: Byte address in Emscripten HEAP where to write the string to. | |
// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null | |
// terminator, i.e. if maxBytesToWrite=4, only the null terminator will be written and nothing else. | |
// maxBytesToWrite<4 does not write any bytes to the output, not even the null terminator. | |
// Returns the number of bytes written, EXCLUDING the null terminator. | |
function stringToUTF32(str, outPtr, maxBytesToWrite) { | |
assert(outPtr % 4 == 0, 'Pointer passed to stringToUTF32 must be aligned to four bytes!'); | |
assert(typeof maxBytesToWrite == 'number', 'stringToUTF32(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!'); | |
// Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed. | |
if (maxBytesToWrite === undefined) { | |
maxBytesToWrite = 0x7FFFFFFF; | |
} | |
if (maxBytesToWrite < 4) return 0; | |
var startPtr = outPtr; | |
var endPtr = startPtr + maxBytesToWrite - 4; | |
for (var i = 0; i < str.length; ++i) { | |
// Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap. | |
// See http://unicode.org/faq/utf_bom.html#utf16-3 | |
var codeUnit = str.charCodeAt(i); // possibly a lead surrogate | |
if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) { | |
var trailSurrogate = str.charCodeAt(++i); | |
codeUnit = 0x10000 + ((codeUnit & 0x3FF) << 10) | (trailSurrogate & 0x3FF); | |
} | |
HEAP32[((outPtr)>>2)]=codeUnit; | |
outPtr += 4; | |
if (outPtr + 4 > endPtr) break; | |
} | |
// Null-terminate the pointer to the HEAP. | |
HEAP32[((outPtr)>>2)]=0; | |
return outPtr - startPtr; | |
} | |
// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte. | |
function lengthBytesUTF32(str) { | |
var len = 0; | |
for (var i = 0; i < str.length; ++i) { | |
// Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap. | |
// See http://unicode.org/faq/utf_bom.html#utf16-3 | |
var codeUnit = str.charCodeAt(i); | |
if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) ++i; // possibly a lead surrogate, so skip over the tail surrogate. | |
len += 4; | |
} | |
return len; | |
} | |
// Allocate heap space for a JS string, and write it there. | |
// It is the responsibility of the caller to free() that memory. | |
function allocateUTF8(str) { | |
var size = lengthBytesUTF8(str) + 1; | |
var ret = _malloc(size); | |
if (ret) stringToUTF8Array(str, HEAP8, ret, size); | |
return ret; | |
} | |
// Allocate stack space for a JS string, and write it there. | |
function allocateUTF8OnStack(str) { | |
var size = lengthBytesUTF8(str) + 1; | |
var ret = stackAlloc(size); | |
stringToUTF8Array(str, HEAP8, ret, size); | |
return ret; | |
} | |
function demangle(func) { | |
warnOnce('warning: build with -s DEMANGLE_SUPPORT=1 to link in libcxxabi demangling'); | |
return func; | |
} | |
function demangleAll(text) { | |
var regex = | |
/__Z[\w\d_]+/g; | |
return text.replace(regex, | |
function(x) { | |
var y = demangle(x); | |
return x === y ? x : (y + ' [' + x + ']'); | |
}); | |
} | |
function jsStackTrace() { | |
var err = new Error(); | |
if (!err.stack) { | |
// IE10+ special cases: It does have callstack info, but it is only populated if an Error object is thrown, | |
// so try that as a special-case. | |
try { | |
throw new Error(0); | |
} catch(e) { | |
err = e; | |
} | |
if (!err.stack) { | |
return '(no stack trace available)'; | |
} | |
} | |
return err.stack.toString(); | |
} | |
function stackTrace() { | |
var js = jsStackTrace(); | |
if (Module['extraStackTrace']) js += '\n' + Module['extraStackTrace'](); | |
return demangleAll(js); | |
} | |
// Memory management | |
var PAGE_SIZE = 16384; | |
var WASM_PAGE_SIZE = 65536; | |
var ASMJS_PAGE_SIZE = 16777216; | |
var MIN_TOTAL_MEMORY = 16777216; | |
function alignUp(x, multiple) { | |
if (x % multiple > 0) { | |
x += multiple - (x % multiple); | |
} | |
return x; | |
} | |
var HEAP, | |
/** @type {ArrayBuffer} */ | |
buffer, | |
/** @type {Int8Array} */ | |
HEAP8, | |
/** @type {Uint8Array} */ | |
HEAPU8, | |
/** @type {Int16Array} */ | |
HEAP16, | |
/** @type {Uint16Array} */ | |
HEAPU16, | |
/** @type {Int32Array} */ | |
HEAP32, | |
/** @type {Uint32Array} */ | |
HEAPU32, | |
/** @type {Float32Array} */ | |
HEAPF32, | |
/** @type {Float64Array} */ | |
HEAPF64; | |
function updateGlobalBuffer(buf) { | |
Module['buffer'] = buffer = buf; | |
} | |
function updateGlobalBufferViews() { | |
Module['HEAP8'] = HEAP8 = new Int8Array(buffer); | |
Module['HEAP16'] = HEAP16 = new Int16Array(buffer); | |
Module['HEAP32'] = HEAP32 = new Int32Array(buffer); | |
Module['HEAPU8'] = HEAPU8 = new Uint8Array(buffer); | |
Module['HEAPU16'] = HEAPU16 = new Uint16Array(buffer); | |
Module['HEAPU32'] = HEAPU32 = new Uint32Array(buffer); | |
Module['HEAPF32'] = HEAPF32 = new Float32Array(buffer); | |
Module['HEAPF64'] = HEAPF64 = new Float64Array(buffer); | |
} | |
var STATIC_BASE, STATICTOP, staticSealed; // static area | |
var STACK_BASE, STACKTOP, STACK_MAX; // stack area | |
var DYNAMIC_BASE, DYNAMICTOP_PTR; // dynamic area handled by sbrk | |
STATIC_BASE = STATICTOP = STACK_BASE = STACKTOP = STACK_MAX = DYNAMIC_BASE = DYNAMICTOP_PTR = 0; | |
staticSealed = false; | |
// Initializes the stack cookie. Called at the startup of main and at the startup of each thread in pthreads mode. | |
function writeStackCookie() { | |
assert((STACK_MAX & 3) == 0); | |
HEAPU32[(STACK_MAX >> 2)-1] = 0x02135467; | |
HEAPU32[(STACK_MAX >> 2)-2] = 0x89BACDFE; | |
} | |
function checkStackCookie() { | |
if (HEAPU32[(STACK_MAX >> 2)-1] != 0x02135467 || HEAPU32[(STACK_MAX >> 2)-2] != 0x89BACDFE) { | |
abort('Stack overflow! Stack cookie has been overwritten, expected hex dwords 0x89BACDFE and 0x02135467, but received 0x' + HEAPU32[(STACK_MAX >> 2)-2].toString(16) + ' ' + HEAPU32[(STACK_MAX >> 2)-1].toString(16)); | |
} | |
// Also test the global address 0 for integrity. | |
if (HEAP32[0] !== 0x63736d65 /* 'emsc' */) throw 'Runtime error: The application has corrupted its heap memory area (address zero)!'; | |
} | |
function abortStackOverflow(allocSize) { | |
abort('Stack overflow! Attempted to allocate ' + allocSize + ' bytes on the stack, but stack has only ' + (STACK_MAX - stackSave() + allocSize) + ' bytes available!'); | |
} | |
function abortOnCannotGrowMemory() { | |
abort('Cannot enlarge memory arrays. Either (1) compile with -s TOTAL_MEMORY=X with X higher than the current value ' + TOTAL_MEMORY + ', (2) compile with -s ALLOW_MEMORY_GROWTH=1 which allows increasing the size at runtime, or (3) if you want malloc to return NULL (0) instead of this abort, compile with -s ABORTING_MALLOC=0 '); | |
} | |
function enlargeMemory() { | |
abortOnCannotGrowMemory(); | |
} | |
var TOTAL_STACK = Module['TOTAL_STACK'] || 5242880; | |
var TOTAL_MEMORY = Module['TOTAL_MEMORY'] || 16777216; | |
if (TOTAL_MEMORY < TOTAL_STACK) err('TOTAL_MEMORY should be larger than TOTAL_STACK, was ' + TOTAL_MEMORY + '! (TOTAL_STACK=' + TOTAL_STACK + ')'); | |
// Initialize the runtime's memory | |
// check for full engine support (use string 'subarray' to avoid closure compiler confusion) | |
assert(typeof Int32Array !== 'undefined' && typeof Float64Array !== 'undefined' && Int32Array.prototype.subarray !== undefined && Int32Array.prototype.set !== undefined, | |
'JS engine does not provide full typed array support'); | |
// Use a provided buffer, if there is one, or else allocate a new one | |
if (Module['buffer']) { | |
buffer = Module['buffer']; | |
assert(buffer.byteLength === TOTAL_MEMORY, 'provided buffer should be ' + TOTAL_MEMORY + ' bytes, but it is ' + buffer.byteLength); | |
} else { | |
// Use a WebAssembly memory where available | |
if (typeof WebAssembly === 'object' && typeof WebAssembly.Memory === 'function') { | |
assert(TOTAL_MEMORY % WASM_PAGE_SIZE === 0); | |
Module['wasmMemory'] = new WebAssembly.Memory({ 'initial': TOTAL_MEMORY / WASM_PAGE_SIZE, 'maximum': TOTAL_MEMORY / WASM_PAGE_SIZE }); | |
buffer = Module['wasmMemory'].buffer; | |
} else | |
{ | |
buffer = new ArrayBuffer(TOTAL_MEMORY); | |
} | |
assert(buffer.byteLength === TOTAL_MEMORY); | |
Module['buffer'] = buffer; | |
} | |
updateGlobalBufferViews(); | |
function getTotalMemory() { | |
return TOTAL_MEMORY; | |
} | |
// Endianness check (note: assumes compiler arch was little-endian) | |
HEAP32[0] = 0x63736d65; /* 'emsc' */ | |
HEAP16[1] = 0x6373; | |
if (HEAPU8[2] !== 0x73 || HEAPU8[3] !== 0x63) throw 'Runtime error: expected the system to be little-endian!'; | |
function callRuntimeCallbacks(callbacks) { | |
while(callbacks.length > 0) { | |
var callback = callbacks.shift(); | |
if (typeof callback == 'function') { | |
callback(); | |
continue; | |
} | |
var func = callback.func; | |
if (typeof func === 'number') { | |
if (callback.arg === undefined) { | |
Module['dynCall_v'](func); | |
} else { | |
Module['dynCall_vi'](func, callback.arg); | |
} | |
} else { | |
func(callback.arg === undefined ? null : callback.arg); | |
} | |
} | |
} | |
var __ATPRERUN__ = []; // functions called before the runtime is initialized | |
var __ATINIT__ = []; // functions called during startup | |
var __ATMAIN__ = []; // functions called when main() is to be run | |
var __ATEXIT__ = []; // functions called during shutdown | |
var __ATPOSTRUN__ = []; // functions called after the main() is called | |
var runtimeInitialized = false; | |
var runtimeExited = false; | |
function preRun() { | |
// compatibility - merge in anything from Module['preRun'] at this time | |
if (Module['preRun']) { | |
if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']]; | |
while (Module['preRun'].length) { | |
addOnPreRun(Module['preRun'].shift()); | |
} | |
} | |
callRuntimeCallbacks(__ATPRERUN__); | |
} | |
function ensureInitRuntime() { | |
checkStackCookie(); | |
if (runtimeInitialized) return; | |
runtimeInitialized = true; | |
callRuntimeCallbacks(__ATINIT__); | |
} | |
function preMain() { | |
checkStackCookie(); | |
callRuntimeCallbacks(__ATMAIN__); | |
} | |
function exitRuntime() { | |
checkStackCookie(); | |
callRuntimeCallbacks(__ATEXIT__); | |
runtimeExited = true; | |
} | |
function postRun() { | |
checkStackCookie(); | |
// compatibility - merge in anything from Module['postRun'] at this time | |
if (Module['postRun']) { | |
if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']]; | |
while (Module['postRun'].length) { | |
addOnPostRun(Module['postRun'].shift()); | |
} | |
} | |
callRuntimeCallbacks(__ATPOSTRUN__); | |
} | |
function addOnPreRun(cb) { | |
__ATPRERUN__.unshift(cb); | |
} | |
function addOnInit(cb) { | |
__ATINIT__.unshift(cb); | |
} | |
function addOnPreMain(cb) { | |
__ATMAIN__.unshift(cb); | |
} | |
function addOnExit(cb) { | |
__ATEXIT__.unshift(cb); | |
} | |
function addOnPostRun(cb) { | |
__ATPOSTRUN__.unshift(cb); | |
} | |
// Deprecated: This function should not be called because it is unsafe and does not provide | |
// a maximum length limit of how many bytes it is allowed to write. Prefer calling the | |
// function stringToUTF8Array() instead, which takes in a maximum length that can be used | |
// to be secure from out of bounds writes. | |
/** @deprecated */ | |
function writeStringToMemory(string, buffer, dontAddNull) { | |
warnOnce('writeStringToMemory is deprecated and should not be called! Use stringToUTF8() instead!'); | |
var /** @type {number} */ lastChar, /** @type {number} */ end; | |
if (dontAddNull) { | |
// stringToUTF8Array always appends null. If we don't want to do that, remember the | |
// character that existed at the location where the null will be placed, and restore | |
// that after the write (below). | |
end = buffer + lengthBytesUTF8(string); | |
lastChar = HEAP8[end]; | |
} | |
stringToUTF8(string, buffer, Infinity); | |
if (dontAddNull) HEAP8[end] = lastChar; // Restore the value under the null character. | |
} | |
function writeArrayToMemory(array, buffer) { | |
assert(array.length >= 0, 'writeArrayToMemory array must have a length (should be an array or typed array)') | |
HEAP8.set(array, buffer); | |
} | |
function writeAsciiToMemory(str, buffer, dontAddNull) { | |
for (var i = 0; i < str.length; ++i) { | |
assert(str.charCodeAt(i) === str.charCodeAt(i)&0xff); | |
HEAP8[((buffer++)>>0)]=str.charCodeAt(i); | |
} | |
// Null-terminate the pointer to the HEAP. | |
if (!dontAddNull) HEAP8[((buffer)>>0)]=0; | |
} | |
function unSign(value, bits, ignore) { | |
if (value >= 0) { | |
return value; | |
} | |
return bits <= 32 ? 2*Math.abs(1 << (bits-1)) + value // Need some trickery, since if bits == 32, we are right at the limit of the bits JS uses in bitshifts | |
: Math.pow(2, bits) + value; | |
} | |
function reSign(value, bits, ignore) { | |
if (value <= 0) { | |
return value; | |
} | |
var half = bits <= 32 ? Math.abs(1 << (bits-1)) // abs is needed if bits == 32 | |
: Math.pow(2, bits-1); | |
if (value >= half && (bits <= 32 || value > half)) { // for huge values, we can hit the precision limit and always get true here. so don't do that | |
// but, in general there is no perfect solution here. With 64-bit ints, we get rounding and errors | |
// TODO: In i64 mode 1, resign the two parts separately and safely | |
value = -2*half + value; // Cannot bitshift half, as it may be at the limit of the bits JS uses in bitshifts | |
} | |
return value; | |
} | |
assert(Math.imul, 'This browser does not support Math.imul(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill'); | |
assert(Math.fround, 'This browser does not support Math.fround(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill'); | |
assert(Math.clz32, 'This browser does not support Math.clz32(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill'); | |
assert(Math.trunc, 'This browser does not support Math.trunc(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill'); | |
var Math_abs = Math.abs; | |
var Math_cos = Math.cos; | |
var Math_sin = Math.sin; | |
var Math_tan = Math.tan; | |
var Math_acos = Math.acos; | |
var Math_asin = Math.asin; | |
var Math_atan = Math.atan; | |
var Math_atan2 = Math.atan2; | |
var Math_exp = Math.exp; | |
var Math_log = Math.log; | |
var Math_sqrt = Math.sqrt; | |
var Math_ceil = Math.ceil; | |
var Math_floor = Math.floor; | |
var Math_pow = Math.pow; | |
var Math_imul = Math.imul; | |
var Math_fround = Math.fround; | |
var Math_round = Math.round; | |
var Math_min = Math.min; | |
var Math_max = Math.max; | |
var Math_clz32 = Math.clz32; | |
var Math_trunc = Math.trunc; | |
// A counter of dependencies for calling run(). If we need to | |
// do asynchronous work before running, increment this and | |
// decrement it. Incrementing must happen in a place like | |
// Module.preRun (used by emcc to add file preloading). | |
// Note that you can add dependencies in preRun, even though | |
// it happens right before run - run will be postponed until | |
// the dependencies are met. | |
var runDependencies = 0; | |
var runDependencyWatcher = null; | |
var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled | |
var runDependencyTracking = {}; | |
function getUniqueRunDependency(id) { | |
var orig = id; | |
while (1) { | |
if (!runDependencyTracking[id]) return id; | |
id = orig + Math.random(); | |
} | |
return id; | |
} | |
function addRunDependency(id) { | |
runDependencies++; | |
if (Module['monitorRunDependencies']) { | |
Module['monitorRunDependencies'](runDependencies); | |
} | |
if (id) { | |
assert(!runDependencyTracking[id]); | |
runDependencyTracking[id] = 1; | |
if (runDependencyWatcher === null && typeof setInterval !== 'undefined') { | |
// Check for missing dependencies every few seconds | |
runDependencyWatcher = setInterval(function() { | |
if (ABORT) { | |
clearInterval(runDependencyWatcher); | |
runDependencyWatcher = null; | |
return; | |
} | |
var shown = false; | |
for (var dep in runDependencyTracking) { | |
if (!shown) { | |
shown = true; | |
err('still waiting on run dependencies:'); | |
} | |
err('dependency: ' + dep); | |
} | |
if (shown) { | |
err('(end of list)'); | |
} | |
}, 10000); | |
} | |
} else { | |
err('warning: run dependency added without ID'); | |
} | |
} | |
function removeRunDependency(id) { | |
runDependencies--; | |
if (Module['monitorRunDependencies']) { | |
Module['monitorRunDependencies'](runDependencies); | |
} | |
if (id) { | |
assert(runDependencyTracking[id]); | |
delete runDependencyTracking[id]; | |
} else { | |
err('warning: run dependency removed without ID'); | |
} | |
if (runDependencies == 0) { | |
if (runDependencyWatcher !== null) { | |
clearInterval(runDependencyWatcher); | |
runDependencyWatcher = null; | |
} | |
if (dependenciesFulfilled) { | |
var callback = dependenciesFulfilled; | |
dependenciesFulfilled = null; | |
callback(); // can add another dependenciesFulfilled | |
} | |
} | |
} | |
Module["preloadedImages"] = {}; // maps url to image data | |
Module["preloadedAudios"] = {}; // maps url to audio data | |
var memoryInitializer = null; | |
// Copyright 2017 The Emscripten Authors. All rights reserved. | |
// Emscripten is available under two separate licenses, the MIT license and the | |
// University of Illinois/NCSA Open Source License. Both these licenses can be | |
// found in the LICENSE file. | |
// Prefix of data URIs emitted by SINGLE_FILE and related options. | |
var dataURIPrefix = 'data:application/octet-stream;base64,'; | |
// Indicates whether filename is a base64 data URI. | |
function isDataURI(filename) { | |
return String.prototype.startsWith ? | |
filename.startsWith(dataURIPrefix) : | |
filename.indexOf(dataURIPrefix) === 0; | |
} | |
function integrateWasmJS() { | |
// wasm.js has several methods for creating the compiled code module here: | |
// * 'native-wasm' : use native WebAssembly support in the browser | |
// * 'interpret-s-expr': load s-expression code from a .wast and interpret | |
// * 'interpret-binary': load binary wasm and interpret | |
// * 'interpret-asm2wasm': load asm.js code, translate to wasm, and interpret | |
// * 'asmjs': no wasm, just load the asm.js code and use that (good for testing) | |
// The method is set at compile time (BINARYEN_METHOD) | |
// The method can be a comma-separated list, in which case, we will try the | |
// options one by one. Some of them can fail gracefully, and then we can try | |
// the next. | |
// inputs | |
var method = 'native-wasm'; | |
var wasmTextFile = 'window-249ef5c0208313a1.wast'; | |
var wasmBinaryFile = 'window-249ef5c0208313a1.wasm'; | |
var asmjsCodeFile = 'window-249ef5c0208313a1.temp.asm.js'; | |
if (!isDataURI(wasmTextFile)) { | |
wasmTextFile = locateFile(wasmTextFile); | |
} | |
if (!isDataURI(wasmBinaryFile)) { | |
wasmBinaryFile = locateFile(wasmBinaryFile); | |
} | |
if (!isDataURI(asmjsCodeFile)) { | |
asmjsCodeFile = locateFile(asmjsCodeFile); | |
} | |
// utilities | |
var wasmPageSize = 64*1024; | |
var info = { | |
'global': null, | |
'env': null, | |
'asm2wasm': asm2wasmImports, | |
'parent': Module // Module inside wasm-js.cpp refers to wasm-js.cpp; this allows access to the outside program. | |
}; | |
var exports = null; | |
function mergeMemory(newBuffer) { | |
// The wasm instance creates its memory. But static init code might have written to | |
// buffer already, including the mem init file, and we must copy it over in a proper merge. | |
// TODO: avoid this copy, by avoiding such static init writes | |
// TODO: in shorter term, just copy up to the last static init write | |
var oldBuffer = Module['buffer']; | |
if (newBuffer.byteLength < oldBuffer.byteLength) { | |
err('the new buffer in mergeMemory is smaller than the previous one. in native wasm, we should grow memory here'); | |
} | |
var oldView = new Int8Array(oldBuffer); | |
var newView = new Int8Array(newBuffer); | |
newView.set(oldView); | |
updateGlobalBuffer(newBuffer); | |
updateGlobalBufferViews(); | |
} | |
function getBinary() { | |
try { | |
if (Module['wasmBinary']) { | |
return new Uint8Array(Module['wasmBinary']); | |
} | |
if (Module['readBinary']) { | |
return Module['readBinary'](wasmBinaryFile); | |
} else { | |
throw "both async and sync fetching of the wasm failed"; | |
} | |
} | |
catch (err) { | |
abort(err); | |
} | |
} | |
function getBinaryPromise() { | |
// if we don't have the binary yet, and have the Fetch api, use that | |
// in some environments, like Electron's render process, Fetch api may be present, but have a different context than expected, let's only use it on the Web | |
if (!Module['wasmBinary'] && (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && typeof fetch === 'function') { | |
return fetch(wasmBinaryFile, { credentials: 'same-origin' }).then(function(response) { | |
if (!response['ok']) { | |
throw "failed to load wasm binary file at '" + wasmBinaryFile + "'"; | |
} | |
return response['arrayBuffer'](); | |
}).catch(function () { | |
return getBinary(); | |
}); | |
} | |
// Otherwise, getBinary should be able to get it synchronously | |
return new Promise(function(resolve, reject) { | |
resolve(getBinary()); | |
}); | |
} | |
// do-method functions | |
function doNativeWasm(global, env, providedBuffer) { | |
if (typeof WebAssembly !== 'object') { | |
// when the method is just native-wasm, our error message can be very specific | |
abort('No WebAssembly support found. Build with -s WASM=0 to target JavaScript instead.'); | |
err('no native wasm support detected'); | |
return false; | |
} | |
// prepare memory import | |
if (!(Module['wasmMemory'] instanceof WebAssembly.Memory)) { | |
err('no native wasm Memory in use'); | |
return false; | |
} | |
env['memory'] = Module['wasmMemory']; | |
// Load the wasm module and create an instance of using native support in the JS engine. | |
info['global'] = { | |
'NaN': NaN, | |
'Infinity': Infinity | |
}; | |
info['global.Math'] = Math; | |
info['env'] = env; | |
// handle a generated wasm instance, receiving its exports and | |
// performing other necessary setup | |
function receiveInstance(instance, module) { | |
exports = instance.exports; | |
if (exports.memory) mergeMemory(exports.memory); | |
Module['asm'] = exports; | |
Module["usingWasm"] = true; | |
removeRunDependency('wasm-instantiate'); | |
} | |
addRunDependency('wasm-instantiate'); | |
// User shell pages can write their own Module.instantiateWasm = function(imports, successCallback) callback | |
// to manually instantiate the Wasm module themselves. This allows pages to run the instantiation parallel | |
// to any other async startup actions they are performing. | |
if (Module['instantiateWasm']) { | |
try { | |
return Module['instantiateWasm'](info, receiveInstance); | |
} catch(e) { | |
err('Module.instantiateWasm callback failed with error: ' + e); | |
return false; | |
} | |
} | |
// Async compilation can be confusing when an error on the page overwrites Module | |
// (for example, if the order of elements is wrong, and the one defining Module is | |
// later), so we save Module and check it later. | |
var trueModule = Module; | |
function receiveInstantiatedSource(output) { | |
// 'output' is a WebAssemblyInstantiatedSource object which has both the module and instance. | |
// receiveInstance() will swap in the exports (to Module.asm) so they can be called | |
assert(Module === trueModule, 'the Module object should not be replaced during async compilation - perhaps the order of HTML elements is wrong?'); | |
trueModule = null; | |
receiveInstance(output['instance'], output['module']); | |
} | |
function instantiateArrayBuffer(receiver) { | |
getBinaryPromise().then(function(binary) { | |
return WebAssembly.instantiate(binary, info); | |
}).then(receiver, function(reason) { | |
err('failed to asynchronously prepare wasm: ' + reason); | |
abort(reason); | |
}); | |
} | |
// Prefer streaming instantiation if available. | |
if (!Module['wasmBinary'] && | |
typeof WebAssembly.instantiateStreaming === 'function' && | |
!isDataURI(wasmBinaryFile) && | |
typeof fetch === 'function') { | |
WebAssembly.instantiateStreaming(fetch(wasmBinaryFile, { credentials: 'same-origin' }), info) | |
.then(receiveInstantiatedSource, function(reason) { | |
// We expect the most common failure cause to be a bad MIME type for the binary, | |
// in which case falling back to ArrayBuffer instantiation should work. | |
err('wasm streaming compile failed: ' + reason); | |
err('falling back to ArrayBuffer instantiation'); | |
instantiateArrayBuffer(receiveInstantiatedSource); | |
}); | |
} else { | |
instantiateArrayBuffer(receiveInstantiatedSource); | |
} | |
return {}; // no exports yet; we'll fill them in later | |
} | |
// We may have a preloaded value in Module.asm, save it | |
Module['asmPreload'] = Module['asm']; | |
// Memory growth integration code | |
var asmjsReallocBuffer = Module['reallocBuffer']; | |
var wasmReallocBuffer = function(size) { | |
var PAGE_MULTIPLE = Module["usingWasm"] ? WASM_PAGE_SIZE : ASMJS_PAGE_SIZE; // In wasm, heap size must be a multiple of 64KB. In asm.js, they need to be multiples of 16MB. | |
size = alignUp(size, PAGE_MULTIPLE); // round up to wasm page size | |
var old = Module['buffer']; | |
var oldSize = old.byteLength; | |
if (Module["usingWasm"]) { | |
// native wasm support | |
try { | |
var result = Module['wasmMemory'].grow((size - oldSize) / wasmPageSize); // .grow() takes a delta compared to the previous size | |
if (result !== (-1 | 0)) { | |
// success in native wasm memory growth, get the buffer from the memory | |
return Module['buffer'] = Module['wasmMemory'].buffer; | |
} else { | |
return null; | |
} | |
} catch(e) { | |
console.error('Module.reallocBuffer: Attempted to grow from ' + oldSize + ' bytes to ' + size + ' bytes, but got error: ' + e); | |
return null; | |
} | |
} | |
}; | |
Module['reallocBuffer'] = function(size) { | |
if (finalMethod === 'asmjs') { | |
return asmjsReallocBuffer(size); | |
} else { | |
return wasmReallocBuffer(size); | |
} | |
}; | |
// we may try more than one; this is the final one, that worked and we are using | |
var finalMethod = ''; | |
// Provide an "asm.js function" for the application, called to "link" the asm.js module. We instantiate | |
// the wasm module at that time, and it receives imports and provides exports and so forth, the app | |
// doesn't need to care that it is wasm or polyfilled wasm or asm.js. | |
Module['asm'] = function(global, env, providedBuffer) { | |
// import table | |
if (!env['table']) { | |
assert(Module['wasmTableSize'] !== undefined); | |
var TABLE_SIZE = Module['wasmTableSize']; | |
var MAX_TABLE_SIZE = Module['wasmMaxTableSize']; | |
if (typeof WebAssembly === 'object' && typeof WebAssembly.Table === 'function') { | |
if (MAX_TABLE_SIZE !== undefined) { | |
env['table'] = new WebAssembly.Table({ 'initial': TABLE_SIZE, 'maximum': MAX_TABLE_SIZE, 'element': 'anyfunc' }); | |
} else { | |
env['table'] = new WebAssembly.Table({ 'initial': TABLE_SIZE, element: 'anyfunc' }); | |
} | |
} else { | |
env['table'] = new Array(TABLE_SIZE); // works in binaryen interpreter at least | |
} | |
Module['wasmTable'] = env['table']; | |
} | |
if (!env['__memory_base']) { | |
env['__memory_base'] = Module['STATIC_BASE']; // tell the memory segments where to place themselves | |
} | |
if (!env['__table_base']) { | |
env['__table_base'] = 0; // table starts at 0 by default, in dynamic linking this will change | |
} | |
// try the methods. each should return the exports if it succeeded | |
var exports; | |
exports = doNativeWasm(global, env, providedBuffer); | |
assert(exports, 'no binaryen method succeeded. consider enabling more options, like interpreting, if you want that: http://kripken.github.io/emscripten-site/docs/compiling/WebAssembly.html#binaryen-methods'); | |
return exports; | |
}; | |
var methodHandler = Module['asm']; // note our method handler, as we may modify Module['asm'] later | |
} | |
integrateWasmJS(); | |
// === Body === | |
var ASM_CONSTS = [function() { }]; | |
function _emscripten_asm_const_v(code) { | |
return ASM_CONSTS[code](); | |
} | |
STATIC_BASE = GLOBAL_BASE; | |
STATICTOP = STATIC_BASE + 32576; | |
/* global initializers */ __ATINIT__.push({ func: function() { ___emscripten_environ_constructor() } }); | |
var STATIC_BUMP = 32576; | |
Module["STATIC_BASE"] = STATIC_BASE; | |
Module["STATIC_BUMP"] = STATIC_BUMP; | |
/* no memory initializer */ | |
var tempDoublePtr = STATICTOP; STATICTOP += 16; | |
assert(tempDoublePtr % 8 == 0); | |
function copyTempFloat(ptr) { // functions, because inlining this code increases code size too much | |
HEAP8[tempDoublePtr] = HEAP8[ptr]; | |
HEAP8[tempDoublePtr+1] = HEAP8[ptr+1]; | |
HEAP8[tempDoublePtr+2] = HEAP8[ptr+2]; | |
HEAP8[tempDoublePtr+3] = HEAP8[ptr+3]; | |
} | |
function copyTempDouble(ptr) { | |
HEAP8[tempDoublePtr] = HEAP8[ptr]; | |
HEAP8[tempDoublePtr+1] = HEAP8[ptr+1]; | |
HEAP8[tempDoublePtr+2] = HEAP8[ptr+2]; | |
HEAP8[tempDoublePtr+3] = HEAP8[ptr+3]; | |
HEAP8[tempDoublePtr+4] = HEAP8[ptr+4]; | |
HEAP8[tempDoublePtr+5] = HEAP8[ptr+5]; | |
HEAP8[tempDoublePtr+6] = HEAP8[ptr+6]; | |
HEAP8[tempDoublePtr+7] = HEAP8[ptr+7]; | |
} | |
// {{PRE_LIBRARY}} | |
function __emscripten_traverse_stack(args) { | |
if (!args || !args.callee || !args.callee.name) { | |
return [null, '', '']; | |
} | |
var funstr = args.callee.toString(); | |
var funcname = args.callee.name; | |
var str = '('; | |
var first = true; | |
for (var i in args) { | |
var a = args[i]; | |
if (!first) { | |
str += ", "; | |
} | |
first = false; | |
if (typeof a === 'number' || typeof a === 'string') { | |
str += a; | |
} else { | |
str += '(' + typeof a + ')'; | |
} | |
} | |
str += ')'; | |
var caller = args.callee.caller; | |
args = caller ? caller.arguments : []; | |
if (first) | |
str = ''; | |
return [args, funcname, str]; | |
}function _emscripten_get_callstack_js(flags) { | |
var callstack = jsStackTrace(); | |
// Find the symbols in the callstack that corresponds to the functions that report callstack information, and remove everyhing up to these from the output. | |
var iThisFunc = callstack.lastIndexOf('_emscripten_log'); | |
var iThisFunc2 = callstack.lastIndexOf('_emscripten_get_callstack'); | |
var iNextLine = callstack.indexOf('\n', Math.max(iThisFunc, iThisFunc2))+1; | |
callstack = callstack.slice(iNextLine); | |
// If user requested to see the original source stack, but no source map information is available, just fall back to showing the JS stack. | |
if (flags & 8/*EM_LOG_C_STACK*/ && typeof emscripten_source_map === 'undefined') { | |
warnOnce('Source map information is not available, emscripten_log with EM_LOG_C_STACK will be ignored. Build with "--pre-js $EMSCRIPTEN/src/emscripten-source-map.min.js" linker flag to add source map loading to code.'); | |
flags ^= 8/*EM_LOG_C_STACK*/; | |
flags |= 16/*EM_LOG_JS_STACK*/; | |
} | |
var stack_args = null; | |
if (flags & 128 /*EM_LOG_FUNC_PARAMS*/) { | |
// To get the actual parameters to the functions, traverse the stack via the unfortunately deprecated 'arguments.callee' method, if it works: | |
stack_args = __emscripten_traverse_stack(arguments); | |
while (stack_args[1].indexOf('_emscripten_') >= 0) | |
stack_args = __emscripten_traverse_stack(stack_args[0]); | |
} | |
// Process all lines: | |
var lines = callstack.split('\n'); | |
callstack = ''; | |
var newFirefoxRe = new RegExp('\\s*(.*?)@(.*?):([0-9]+):([0-9]+)'); // New FF30 with column info: extract components of form ' Object._main@http://server.com:4324:12' | |
var firefoxRe = new RegExp('\\s*(.*?)@(.*):(.*)(:(.*))?'); // Old FF without column info: extract components of form ' Object._main@http://server.com:4324' | |
var chromeRe = new RegExp('\\s*at (.*?) \\\((.*):(.*):(.*)\\\)'); // Extract components of form ' at Object._main (http://server.com/file.html:4324:12)' | |
for (var l in lines) { | |
var line = lines[l]; | |
var jsSymbolName = ''; | |
var file = ''; | |
var lineno = 0; | |
var column = 0; | |
var parts = chromeRe.exec(line); | |
if (parts && parts.length == 5) { | |
jsSymbolName = parts[1]; | |
file = parts[2]; | |
lineno = parts[3]; | |
column = parts[4]; | |
} else { | |
parts = newFirefoxRe.exec(line); | |
if (!parts) parts = firefoxRe.exec(line); | |
if (parts && parts.length >= 4) { | |
jsSymbolName = parts[1]; | |
file = parts[2]; | |
lineno = parts[3]; | |
column = parts[4]|0; // Old Firefox doesn't carry column information, but in new FF30, it is present. See https://bugzilla.mozilla.org/show_bug.cgi?id=762556 | |
} else { | |
// Was not able to extract this line for demangling/sourcemapping purposes. Output it as-is. | |
callstack += line + '\n'; | |
continue; | |
} | |
} | |
// Try to demangle the symbol, but fall back to showing the original JS symbol name if not available. | |
var cSymbolName = (flags & 32/*EM_LOG_DEMANGLE*/) ? demangle(jsSymbolName) : jsSymbolName; | |
if (!cSymbolName) { | |
cSymbolName = jsSymbolName; | |
} | |
var haveSourceMap = false; | |
if (flags & 8/*EM_LOG_C_STACK*/) { | |
var orig = emscripten_source_map.originalPositionFor({line: lineno, column: column}); | |
haveSourceMap = (orig && orig.source); | |
if (haveSourceMap) { | |
if (flags & 64/*EM_LOG_NO_PATHS*/) { | |
orig.source = orig.source.substring(orig.source.replace(/\\/g, "/").lastIndexOf('/')+1); | |
} | |
callstack += ' at ' + cSymbolName + ' (' + orig.source + ':' + orig.line + ':' + orig.column + ')\n'; | |
} | |
} | |
if ((flags & 16/*EM_LOG_JS_STACK*/) || !haveSourceMap) { | |
if (flags & 64/*EM_LOG_NO_PATHS*/) { | |
file = file.substring(file.replace(/\\/g, "/").lastIndexOf('/')+1); | |
} | |
callstack += (haveSourceMap ? (' = '+jsSymbolName) : (' at '+cSymbolName)) + ' (' + file + ':' + lineno + ':' + column + ')\n'; | |
} | |
// If we are still keeping track with the callstack by traversing via 'arguments.callee', print the function parameters as well. | |
if (flags & 128 /*EM_LOG_FUNC_PARAMS*/ && stack_args[0]) { | |
if (stack_args[1] == jsSymbolName && stack_args[2].length > 0) { | |
callstack = callstack.replace(/\s+$/, ''); | |
callstack += ' with values: ' + stack_args[1] + stack_args[2] + '\n'; | |
} | |
stack_args = __emscripten_traverse_stack(stack_args[0]); | |
} | |
} | |
// Trim extra whitespace at the end of the output. | |
callstack = callstack.replace(/\s+$/, ''); | |
return callstack; | |
}function __Unwind_Backtrace(func, arg) { | |
var trace = _emscripten_get_callstack_js(); | |
var parts = trace.split('\n'); | |
for (var i = 0; i < parts.length; i++) { | |
var ret = Module['dynCall_iii'](func, 0, arg); | |
if (ret !== 0) return; | |
} | |
} | |
function __Unwind_FindEnclosingFunction() { | |
return 0; // we cannot succeed | |
} | |
function __Unwind_GetIPInfo() { | |
abort('Unwind_GetIPInfo'); | |
} | |
var ENV={};function ___buildEnvironment(environ) { | |
// WARNING: Arbitrary limit! | |
var MAX_ENV_VALUES = 64; | |
var TOTAL_ENV_SIZE = 1024; | |
// Statically allocate memory for the environment. | |
var poolPtr; | |
var envPtr; | |
if (!___buildEnvironment.called) { | |
___buildEnvironment.called = true; | |
// Set default values. Use string keys for Closure Compiler compatibility. | |
ENV['USER'] = ENV['LOGNAME'] = 'web_user'; | |
ENV['PATH'] = '/'; | |
ENV['PWD'] = '/'; | |
ENV['HOME'] = '/home/web_user'; | |
ENV['LANG'] = 'C.UTF-8'; | |
ENV['_'] = Module['thisProgram']; | |
// Allocate memory. | |
poolPtr = getMemory(TOTAL_ENV_SIZE); | |
envPtr = getMemory(MAX_ENV_VALUES * 4); | |
HEAP32[((envPtr)>>2)]=poolPtr; | |
HEAP32[((environ)>>2)]=envPtr; | |
} else { | |
envPtr = HEAP32[((environ)>>2)]; | |
poolPtr = HEAP32[((envPtr)>>2)]; | |
} | |
// Collect key=value lines. | |
var strings = []; | |
var totalSize = 0; | |
for (var key in ENV) { | |
if (typeof ENV[key] === 'string') { | |
var line = key + '=' + ENV[key]; | |
strings.push(line); | |
totalSize += line.length; | |
} | |
} | |
if (totalSize > TOTAL_ENV_SIZE) { | |
throw new Error('Environment size exceeded TOTAL_ENV_SIZE!'); | |
} | |
// Make new. | |
var ptrSize = 4; | |
for (var i = 0; i < strings.length; i++) { | |
var line = strings[i]; | |
writeAsciiToMemory(line, poolPtr); | |
HEAP32[(((envPtr)+(i * ptrSize))>>2)]=poolPtr; | |
poolPtr += line.length + 1; | |
} | |
HEAP32[(((envPtr)+(strings.length * ptrSize))>>2)]=0; | |
} | |
function ___cxa_allocate_exception(size) { | |
return _malloc(size); | |
} | |
function ___cxa_find_matching_catch_2() { | |
return ___cxa_find_matching_catch.apply(null, arguments); | |
} | |
function ___cxa_find_matching_catch_3() { | |
return ___cxa_find_matching_catch.apply(null, arguments); | |
} | |
function ___cxa_free_exception(ptr) { | |
try { | |
return _free(ptr); | |
} catch(e) { // XXX FIXME | |
err('exception during cxa_free_exception: ' + e); | |
} | |
} | |
function __ZSt18uncaught_exceptionv() { // std::uncaught_exception() | |
return !!__ZSt18uncaught_exceptionv.uncaught_exception; | |
} | |
var EXCEPTIONS={last:0,caught:[],infos:{},deAdjust:function (adjusted) { | |
if (!adjusted || EXCEPTIONS.infos[adjusted]) return adjusted; | |
for (var key in EXCEPTIONS.infos) { | |
var ptr = +key; // the iteration key is a string, and if we throw this, it must be an integer as that is what we look for | |
var adj = EXCEPTIONS.infos[ptr].adjusted; | |
var len = adj.length; | |
for (var i = 0; i < len; i++) { | |
if (adj[i] === adjusted) { | |
return ptr; | |
} | |
} | |
} | |
return adjusted; | |
},addRef:function (ptr) { | |
if (!ptr) return; | |
var info = EXCEPTIONS.infos[ptr]; | |
info.refcount++; | |
},decRef:function (ptr) { | |
if (!ptr) return; | |
var info = EXCEPTIONS.infos[ptr]; | |
assert(info.refcount > 0); | |
info.refcount--; | |
// A rethrown exception can reach refcount 0; it must not be discarded | |
// Its next handler will clear the rethrown flag and addRef it, prior to | |
// final decRef and destruction here | |
if (info.refcount === 0 && !info.rethrown) { | |
if (info.destructor) { | |
Module['dynCall_vi'](info.destructor, ptr); | |
} | |
delete EXCEPTIONS.infos[ptr]; | |
___cxa_free_exception(ptr); | |
} | |
},clearRef:function (ptr) { | |
if (!ptr) return; | |
var info = EXCEPTIONS.infos[ptr]; | |
info.refcount = 0; | |
}}; | |
function ___resumeException(ptr) { | |
if (!EXCEPTIONS.last) { EXCEPTIONS.last = ptr; } | |
throw ptr; | |
}function ___cxa_find_matching_catch() { | |
var thrown = EXCEPTIONS.last; | |
if (!thrown) { | |
// just pass through the null ptr | |
return ((setTempRet0(0),0)|0); | |
} | |
var info = EXCEPTIONS.infos[thrown]; | |
var throwntype = info.type; | |
if (!throwntype) { | |
// just pass through the thrown ptr | |
return ((setTempRet0(0),thrown)|0); | |
} | |
var typeArray = Array.prototype.slice.call(arguments); | |
var pointer = Module['___cxa_is_pointer_type'](throwntype); | |
// can_catch receives a **, add indirection | |
if (!___cxa_find_matching_catch.buffer) ___cxa_find_matching_catch.buffer = _malloc(4); | |
HEAP32[((___cxa_find_matching_catch.buffer)>>2)]=thrown; | |
thrown = ___cxa_find_matching_catch.buffer; | |
// The different catch blocks are denoted by different types. | |
// Due to inheritance, those types may not precisely match the | |
// type of the thrown object. Find one which matches, and | |
// return the type of the catch block which should be called. | |
for (var i = 0; i < typeArray.length; i++) { | |
if (typeArray[i] && Module['___cxa_can_catch'](typeArray[i], throwntype, thrown)) { | |
thrown = HEAP32[((thrown)>>2)]; // undo indirection | |
info.adjusted.push(thrown); | |
return ((setTempRet0(typeArray[i]),thrown)|0); | |
} | |
} | |
// Shouldn't happen unless we have bogus data in typeArray | |
// or encounter a type for which emscripten doesn't have suitable | |
// typeinfo defined. Best-efforts match just in case. | |
thrown = HEAP32[((thrown)>>2)]; // undo indirection | |
return ((setTempRet0(throwntype),thrown)|0); | |
}function ___cxa_throw(ptr, type, destructor) { | |
EXCEPTIONS.infos[ptr] = { | |
ptr: ptr, | |
adjusted: [ptr], | |
type: type, | |
destructor: destructor, | |
refcount: 0, | |
caught: false, | |
rethrown: false | |
}; | |
EXCEPTIONS.last = ptr; | |
if (!("uncaught_exception" in __ZSt18uncaught_exceptionv)) { | |
__ZSt18uncaught_exceptionv.uncaught_exception = 1; | |
} else { | |
__ZSt18uncaught_exceptionv.uncaught_exception++; | |
} | |
throw ptr; | |
} | |
function ___gxx_personality_v0() { | |
} | |
function ___lock() {} | |
function ___setErrNo(value) { | |
if (Module['___errno_location']) HEAP32[((Module['___errno_location']())>>2)]=value; | |
else err('failed to set errno from JS'); | |
return value; | |
} | |
var PATH={splitPath:function (filename) { | |
var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/; | |
return splitPathRe.exec(filename).slice(1); | |
},normalizeArray:function (parts, allowAboveRoot) { | |
// if the path tries to go above the root, `up` ends up > 0 | |
var up = 0; | |
for (var i = parts.length - 1; i >= 0; i--) { | |
var last = parts[i]; | |
if (last === '.') { | |
parts.splice(i, 1); | |
} else if (last === '..') { | |
parts.splice(i, 1); | |
up++; | |
} else if (up) { | |
parts.splice(i, 1); | |
up--; | |
} | |
} | |
// if the path is allowed to go above the root, restore leading ..s | |
if (allowAboveRoot) { | |
for (; up; up--) { | |
parts.unshift('..'); | |
} | |
} | |
return parts; | |
},normalize:function (path) { | |
var isAbsolute = path.charAt(0) === '/', | |
trailingSlash = path.substr(-1) === '/'; | |
// Normalize the path | |
path = PATH.normalizeArray(path.split('/').filter(function(p) { | |
return !!p; | |
}), !isAbsolute).join('/'); | |
if (!path && !isAbsolute) { | |
path = '.'; | |
} | |
if (path && trailingSlash) { | |
path += '/'; | |
} | |
return (isAbsolute ? '/' : '') + path; | |
},dirname:function (path) { | |
var result = PATH.splitPath(path), | |
root = result[0], | |
dir = result[1]; | |
if (!root && !dir) { | |
// No dirname whatsoever | |
return '.'; | |
} | |
if (dir) { | |
// It has a dirname, strip trailing slash | |
dir = dir.substr(0, dir.length - 1); | |
} | |
return root + dir; | |
},basename:function (path) { | |
// EMSCRIPTEN return '/'' for '/', not an empty string | |
if (path === '/') return '/'; | |
var lastSlash = path.lastIndexOf('/'); | |
if (lastSlash === -1) return path; | |
return path.substr(lastSlash+1); | |
},extname:function (path) { | |
return PATH.splitPath(path)[3]; | |
},join:function () { | |
var paths = Array.prototype.slice.call(arguments, 0); | |
return PATH.normalize(paths.join('/')); | |
},join2:function (l, r) { | |
return PATH.normalize(l + '/' + r); | |
},resolve:function () { | |
var resolvedPath = '', | |
resolvedAbsolute = false; | |
for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) { | |
var path = (i >= 0) ? arguments[i] : FS.cwd(); | |
// Skip empty and invalid entries | |
if (typeof path !== 'string') { | |
throw new TypeError('Arguments to path.resolve must be strings'); | |
} else if (!path) { | |
return ''; // an invalid portion invalidates the whole thing | |
} | |
resolvedPath = path + '/' + resolvedPath; | |
resolvedAbsolute = path.charAt(0) === '/'; | |
} | |
// At this point the path should be resolved to a full absolute path, but | |
// handle relative paths to be safe (might happen when process.cwd() fails) | |
resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter(function(p) { | |
return !!p; | |
}), !resolvedAbsolute).join('/'); | |
return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.'; | |
},relative:function (from, to) { | |
from = PATH.resolve(from).substr(1); | |
to = PATH.resolve(to).substr(1); | |
function trim(arr) { | |
var start = 0; | |
for (; start < arr.length; start++) { | |
if (arr[start] !== '') break; | |
} | |
var end = arr.length - 1; | |
for (; end >= 0; end--) { | |
if (arr[end] !== '') break; | |
} | |
if (start > end) return []; | |
return arr.slice(start, end - start + 1); | |
} | |
var fromParts = trim(from.split('/')); | |
var toParts = trim(to.split('/')); | |
var length = Math.min(fromParts.length, toParts.length); | |
var samePartsLength = length; | |
for (var i = 0; i < length; i++) { | |
if (fromParts[i] !== toParts[i]) { | |
samePartsLength = i; | |
break; | |
} | |
} | |
var outputParts = []; | |
for (var i = samePartsLength; i < fromParts.length; i++) { | |
outputParts.push('..'); | |
} | |
outputParts = outputParts.concat(toParts.slice(samePartsLength)); | |
return outputParts.join('/'); | |
}}; | |
var TTY={ttys:[],init:function () { | |
// https://github.com/kripken/emscripten/pull/1555 | |
// if (ENVIRONMENT_IS_NODE) { | |
// // currently, FS.init does not distinguish if process.stdin is a file or TTY | |
// // device, it always assumes it's a TTY device. because of this, we're forcing | |
// // process.stdin to UTF8 encoding to at least make stdin reading compatible | |
// // with text files until FS.init can be refactored. | |
// process['stdin']['setEncoding']('utf8'); | |
// } | |
},shutdown:function () { | |
// https://github.com/kripken/emscripten/pull/1555 | |
// if (ENVIRONMENT_IS_NODE) { | |
// // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)? | |
// // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation | |
// // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists? | |
// // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle | |
// // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call | |
// process['stdin']['pause'](); | |
// } | |
},register:function (dev, ops) { | |
TTY.ttys[dev] = { input: [], output: [], ops: ops }; | |
FS.registerDevice(dev, TTY.stream_ops); | |
},stream_ops:{open:function (stream) { | |
var tty = TTY.ttys[stream.node.rdev]; | |
if (!tty) { | |
throw new FS.ErrnoError(ERRNO_CODES.ENODEV); | |
} | |
stream.tty = tty; | |
stream.seekable = false; | |
},close:function (stream) { | |
// flush any pending line data | |
stream.tty.ops.flush(stream.tty); | |
},flush:function (stream) { | |
stream.tty.ops.flush(stream.tty); | |
},read:function (stream, buffer, offset, length, pos /* ignored */) { | |
if (!stream.tty || !stream.tty.ops.get_char) { | |
throw new FS.ErrnoError(ERRNO_CODES.ENXIO); | |
} | |
var bytesRead = 0; | |
for (var i = 0; i < length; i++) { | |
var result; | |
try { | |
result = stream.tty.ops.get_char(stream.tty); | |
} catch (e) { | |
throw new FS.ErrnoError(ERRNO_CODES.EIO); | |
} | |
if (result === undefined && bytesRead === 0) { | |
throw new FS.ErrnoError(ERRNO_CODES.EAGAIN); | |
} | |
if (result === null || result === undefined) break; | |
bytesRead++; | |
buffer[offset+i] = result; | |
} | |
if (bytesRead) { | |
stream.node.timestamp = Date.now(); | |
} | |
return bytesRead; | |
},write:function (stream, buffer, offset, length, pos) { | |
if (!stream.tty || !stream.tty.ops.put_char) { | |
throw new FS.ErrnoError(ERRNO_CODES.ENXIO); | |
} | |
try { | |
for (var i = 0; i < length; i++) { | |
stream.tty.ops.put_char(stream.tty, buffer[offset+i]); | |
} | |
} catch (e) { | |
throw new FS.ErrnoError(ERRNO_CODES.EIO); | |
} | |
if (length) { | |
stream.node.timestamp = Date.now(); | |
} | |
return i; | |
}},default_tty_ops:{get_char:function (tty) { | |
if (!tty.input.length) { | |
var result = null; | |
if (ENVIRONMENT_IS_NODE) { | |
// we will read data by chunks of BUFSIZE | |
var BUFSIZE = 256; | |
var buf = new Buffer(BUFSIZE); | |
var bytesRead = 0; | |
var isPosixPlatform = (process.platform != 'win32'); // Node doesn't offer a direct check, so test by exclusion | |
var fd = process.stdin.fd; | |
if (isPosixPlatform) { | |
// Linux and Mac cannot use process.stdin.fd (which isn't set up as sync) | |
var usingDevice = false; | |
try { | |
fd = fs.openSync('/dev/stdin', 'r'); | |
usingDevice = true; | |
} catch (e) {} | |
} | |
try { | |
bytesRead = fs.readSync(fd, buf, 0, BUFSIZE, null); | |
} catch(e) { | |
// Cross-platform differences: on Windows, reading EOF throws an exception, but on other OSes, | |
// reading EOF returns 0. Uniformize behavior by treating the EOF exception to return 0. | |
if (e.toString().indexOf('EOF') != -1) bytesRead = 0; | |
else throw e; | |
} | |
if (usingDevice) { fs.closeSync(fd); } | |
if (bytesRead > 0) { | |
result = buf.slice(0, bytesRead).toString('utf-8'); | |
} else { | |
result = null; | |
} | |
} else if (typeof window != 'undefined' && | |
typeof window.prompt == 'function') { | |
// Browser. | |
result = window.prompt('Input: '); // returns null on cancel | |
if (result !== null) { | |
result += '\n'; | |
} | |
} else if (typeof readline == 'function') { | |
// Command line. | |
result = readline(); | |
if (result !== null) { | |
result += '\n'; | |
} | |
} | |
if (!result) { | |
return null; | |
} | |
tty.input = intArrayFromString(result, true); | |
} | |
return tty.input.shift(); | |
},put_char:function (tty, val) { | |
if (val === null || val === 10) { | |
out(UTF8ArrayToString(tty.output, 0)); | |
tty.output = []; | |
} else { | |
if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle. | |
} | |
},flush:function (tty) { | |
if (tty.output && tty.output.length > 0) { | |
out(UTF8ArrayToString(tty.output, 0)); | |
tty.output = []; | |
} | |
}},default_tty1_ops:{put_char:function (tty, val) { | |
if (val === null || val === 10) { | |
err(UTF8ArrayToString(tty.output, 0)); | |
tty.output = []; | |
} else { | |
if (val != 0) tty.output.push(val); | |
} | |
},flush:function (tty) { | |
if (tty.output && tty.output.length > 0) { | |
err(UTF8ArrayToString(tty.output, 0)); | |
tty.output = []; | |
} | |
}}}; | |
var MEMFS={ops_table:null,mount:function (mount) { | |
return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0); | |
},createNode:function (parent, name, mode, dev) { | |
if (FS.isBlkdev(mode) || FS.isFIFO(mode)) { | |
// no supported | |
throw new FS.ErrnoError(ERRNO_CODES.EPERM); | |
} | |
if (!MEMFS.ops_table) { | |
MEMFS.ops_table = { | |
dir: { | |
node: { | |
getattr: MEMFS.node_ops.getattr, | |
setattr: MEMFS.node_ops.setattr, | |
lookup: MEMFS.node_ops.lookup, | |
mknod: MEMFS.node_ops.mknod, | |
rename: MEMFS.node_ops.rename, | |
unlink: MEMFS.node_ops.unlink, | |
rmdir: MEMFS.node_ops.rmdir, | |
readdir: MEMFS.node_ops.readdir, | |
symlink: MEMFS.node_ops.symlink | |
}, | |
stream: { | |
llseek: MEMFS.stream_ops.llseek | |
} | |
}, | |
file: { | |
node: { | |
getattr: MEMFS.node_ops.getattr, | |
setattr: MEMFS.node_ops.setattr | |
}, | |
stream: { | |
llseek: MEMFS.stream_ops.llseek, | |
read: MEMFS.stream_ops.read, | |
write: MEMFS.stream_ops.write, | |
allocate: MEMFS.stream_ops.allocate, | |
mmap: MEMFS.stream_ops.mmap, | |
msync: MEMFS.stream_ops.msync | |
} | |
}, | |
link: { | |
node: { | |
getattr: MEMFS.node_ops.getattr, | |
setattr: MEMFS.node_ops.setattr, | |
readlink: MEMFS.node_ops.readlink | |
}, | |
stream: {} | |
}, | |
chrdev: { | |
node: { | |
getattr: MEMFS.node_ops.getattr, | |
setattr: MEMFS.node_ops.setattr | |
}, | |
stream: FS.chrdev_stream_ops | |
} | |
}; | |
} | |
var node = FS.createNode(parent, name, mode, dev); | |
if (FS.isDir(node.mode)) { | |
node.node_ops = MEMFS.ops_table.dir.node; | |
node.stream_ops = MEMFS.ops_table.dir.stream; | |
node.contents = {}; | |
} else if (FS.isFile(node.mode)) { | |
node.node_ops = MEMFS.ops_table.file.node; | |
node.stream_ops = MEMFS.ops_table.file.stream; | |
node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.length which gives the whole capacity. | |
// When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred | |
// for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size | |
// penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme. | |
node.contents = null; | |
} else if (FS.isLink(node.mode)) { | |
node.node_ops = MEMFS.ops_table.link.node; | |
node.stream_ops = MEMFS.ops_table.link.stream; | |
} else if (FS.isChrdev(node.mode)) { | |
node.node_ops = MEMFS.ops_table.chrdev.node; | |
node.stream_ops = MEMFS.ops_table.chrdev.stream; | |
} | |
node.timestamp = Date.now(); | |
// add the new node to the parent | |
if (parent) { | |
parent.contents[name] = node; | |
} | |
return node; | |
},getFileDataAsRegularArray:function (node) { | |
if (node.contents && node.contents.subarray) { | |
var arr = []; | |
for (var i = 0; i < node.usedBytes; ++i) arr.push(node.contents[i]); | |
return arr; // Returns a copy of the original data. | |
} | |
return node.contents; // No-op, the file contents are already in a JS array. Return as-is. | |
},getFileDataAsTypedArray:function (node) { | |
if (!node.contents) return new Uint8Array; | |
if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes. | |
return new Uint8Array(node.contents); | |
},expandFileStorage:function (node, newCapacity) { | |
// If we are asked to expand the size of a file that already exists, revert to using a standard JS array to store the file | |
// instead of a typed array. This makes resizing the array more flexible because we can just .push() elements at the back to | |
// increase the size. | |
if (node.contents && node.contents.subarray && newCapacity > node.contents.length) { | |
node.contents = MEMFS.getFileDataAsRegularArray(node); | |
node.usedBytes = node.contents.length; // We might be writing to a lazy-loaded file which had overridden this property, so force-reset it. | |
} | |
if (!node.contents || node.contents.subarray) { // Keep using a typed array if creating a new storage, or if old one was a typed array as well. | |
var prevCapacity = node.contents ? node.contents.length : 0; | |
if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough. | |
// Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity. | |
// For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to | |
// avoid overshooting the allocation cap by a very large margin. | |
var CAPACITY_DOUBLING_MAX = 1024 * 1024; | |
newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) | 0); | |
if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding. | |
var oldContents = node.contents; | |
node.contents = new Uint8Array(newCapacity); // Allocate new storage. | |
if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage. | |
return; | |
} | |
// Not using a typed array to back the file storage. Use a standard JS array instead. | |
if (!node.contents && newCapacity > 0) node.contents = []; | |
while (node.contents.length < newCapacity) node.contents.push(0); | |
},resizeFileStorage:function (node, newSize) { | |
if (node.usedBytes == newSize) return; | |
if (newSize == 0) { | |
node.contents = null; // Fully decommit when requesting a resize to zero. | |
node.usedBytes = 0; | |
return; | |
} | |
if (!node.contents || node.contents.subarray) { // Resize a typed array if that is being used as the backing store. | |
var oldContents = node.contents; | |
node.contents = new Uint8Array(new ArrayBuffer(newSize)); // Allocate new storage. | |
if (oldContents) { | |
node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage. | |
} | |
node.usedBytes = newSize; | |
return; | |
} | |
// Backing with a JS array. | |
if (!node.contents) node.contents = []; | |
if (node.contents.length > newSize) node.contents.length = newSize; | |
else while (node.contents.length < newSize) node.contents.push(0); | |
node.usedBytes = newSize; | |
},node_ops:{getattr:function (node) { | |
var attr = {}; | |
// device numbers reuse inode numbers. | |
attr.dev = FS.isChrdev(node.mode) ? node.id : 1; | |
attr.ino = node.id; | |
attr.mode = node.mode; | |
attr.nlink = 1; | |
attr.uid = 0; | |
attr.gid = 0; | |
attr.rdev = node.rdev; | |
if (FS.isDir(node.mode)) { | |
attr.size = 4096; | |
} else if (FS.isFile(node.mode)) { | |
attr.size = node.usedBytes; | |
} else if (FS.isLink(node.mode)) { | |
attr.size = node.link.length; | |
} else { | |
attr.size = 0; | |
} | |
attr.atime = new Date(node.timestamp); | |
attr.mtime = new Date(node.timestamp); | |
attr.ctime = new Date(node.timestamp); | |
// NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize), | |
// but this is not required by the standard. | |
attr.blksize = 4096; | |
attr.blocks = Math.ceil(attr.size / attr.blksize); | |
return attr; | |
},setattr:function (node, attr) { | |
if (attr.mode !== undefined) { | |
node.mode = attr.mode; | |
} | |
if (attr.timestamp !== undefined) { | |
node.timestamp = attr.timestamp; | |
} | |
if (attr.size !== undefined) { | |
MEMFS.resizeFileStorage(node, attr.size); | |
} | |
},lookup:function (parent, name) { | |
throw FS.genericErrors[ERRNO_CODES.ENOENT]; | |
},mknod:function (parent, name, mode, dev) { | |
return MEMFS.createNode(parent, name, mode, dev); | |
},rename:function (old_node, new_dir, new_name) { | |
// if we're overwriting a directory at new_name, make sure it's empty. | |
if (FS.isDir(old_node.mode)) { | |
var new_node; | |
try { | |
new_node = FS.lookupNode(new_dir, new_name); | |
} catch (e) { | |
} | |
if (new_node) { | |
for (var i in new_node.contents) { | |
throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY); | |
} | |
} | |
} | |
// do the internal rewiring | |
delete old_node.parent.contents[old_node.name]; | |
old_node.name = new_name; | |
new_dir.contents[new_name] = old_node; | |
old_node.parent = new_dir; | |
},unlink:function (parent, name) { | |
delete parent.contents[name]; | |
},rmdir:function (parent, name) { | |
var node = FS.lookupNode(parent, name); | |
for (var i in node.contents) { | |
throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY); | |
} | |
delete parent.contents[name]; | |
},readdir:function (node) { | |
var entries = ['.', '..'] | |
for (var key in node.contents) { | |
if (!node.contents.hasOwnProperty(key)) { | |
continue; | |
} | |
entries.push(key); | |
} | |
return entries; | |
},symlink:function (parent, newname, oldpath) { | |
var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0); | |
node.link = oldpath; | |
return node; | |
},readlink:function (node) { | |
if (!FS.isLink(node.mode)) { | |
throw new FS.ErrnoError(ERRNO_CODES.EINVAL); | |
} | |
return node.link; | |
}},stream_ops:{read:function (stream, buffer, offset, length, position) { | |
var contents = stream.node.contents; | |
if (position >= stream.node.usedBytes) return 0; | |
var size = Math.min(stream.node.usedBytes - position, length); | |
assert(size >= 0); | |
if (size > 8 && contents.subarray) { // non-trivial, and typed array | |
buffer.set(contents.subarray(position, position + size), offset); | |
} else { | |
for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i]; | |
} | |
return size; | |
},write:function (stream, buffer, offset, length, position, canOwn) { | |
if (!length) return 0; | |
var node = stream.node; | |
node.timestamp = Date.now(); | |
if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array? | |
if (canOwn) { | |
assert(position === 0, 'canOwn must imply no weird position inside the file'); | |
node.contents = buffer.subarray(offset, offset + length); | |
node.usedBytes = length; | |
return length; | |
} else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data. | |
node.contents = new Uint8Array(buffer.subarray(offset, offset + length)); | |
node.usedBytes = length; | |
return length; | |
} else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file? | |
node.contents.set(buffer.subarray(offset, offset + length), position); | |
return length; | |
} | |
} | |
// Appending to an existing file and we need to reallocate, or source data did not come as a typed array. | |
MEMFS.expandFileStorage(node, position+length); | |
if (node.contents.subarray && buffer.subarray) node.contents.set(buffer.subarray(offset, offset + length), position); // Use typed array write if available. | |
else { | |
for (var i = 0; i < length; i++) { | |
node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not. | |
} | |
} | |
node.usedBytes = Math.max(node.usedBytes, position+length); | |
return length; | |
},llseek:function (stream, offset, whence) { | |
var position = offset; | |
if (whence === 1) { // SEEK_CUR. | |
position += stream.position; | |
} else if (whence === 2) { // SEEK_END. | |
if (FS.isFile(stream.node.mode)) { | |
position += stream.node.usedBytes; | |
} | |
} | |
if (position < 0) { | |
throw new FS.ErrnoError(ERRNO_CODES.EINVAL); | |
} | |
return position; | |
},allocate:function (stream, offset, length) { | |
MEMFS.expandFileStorage(stream.node, offset + length); | |
stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length); | |
},mmap:function (stream, buffer, offset, length, position, prot, flags) { | |
if (!FS.isFile(stream.node.mode)) { | |
throw new FS.ErrnoError(ERRNO_CODES.ENODEV); | |
} | |
var ptr; | |
var allocated; | |
var contents = stream.node.contents; | |
// Only make a new copy when MAP_PRIVATE is specified. | |
if ( !(flags & 2) && | |
(contents.buffer === buffer || contents.buffer === buffer.buffer) ) { | |
// We can't emulate MAP_SHARED when the file is not backed by the buffer | |
// we're mapping to (e.g. the HEAP buffer). | |
allocated = false; | |
ptr = contents.byteOffset; | |
} else { | |
// Try to avoid unnecessary slices. | |
if (position > 0 || position + length < stream.node.usedBytes) { | |
if (contents.subarray) { | |
contents = contents.subarray(position, position + length); | |
} else { | |
contents = Array.prototype.slice.call(contents, position, position + length); | |
} | |
} | |
allocated = true; | |
ptr = _malloc(length); | |
if (!ptr) { | |
throw new FS.ErrnoError(ERRNO_CODES.ENOMEM); | |
} | |
buffer.set(contents, ptr); | |
} | |
return { ptr: ptr, allocated: allocated }; | |
},msync:function (stream, buffer, offset, length, mmapFlags) { | |
if (!FS.isFile(stream.node.mode)) { | |
throw new FS.ErrnoError(ERRNO_CODES.ENODEV); | |
} | |
if (mmapFlags & 2) { | |
// MAP_PRIVATE calls need not to be synced back to underlying fs | |
return 0; | |
} | |
var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false); | |
// should we check if bytesWritten and length are the same? | |
return 0; | |
}}}; | |
var IDBFS={dbs:{},indexedDB:function () { | |
if (typeof indexedDB !== 'undefined') return indexedDB; | |
var ret = null; | |
if (typeof window === 'object') ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB; | |
assert(ret, 'IDBFS used, but indexedDB not supported'); | |
return ret; | |
},DB_VERSION:21,DB_STORE_NAME:"FILE_DATA",mount:function (mount) { | |
// reuse all of the core MEMFS functionality | |
return MEMFS.mount.apply(null, arguments); | |
},syncfs:function (mount, populate, callback) { | |
IDBFS.getLocalSet(mount, function(err, local) { | |
if (err) return callback(err); | |
IDBFS.getRemoteSet(mount, function(err, remote) { | |
if (err) return callback(err); | |
var src = populate ? remote : local; | |
var dst = populate ? local : remote; | |
IDBFS.reconcile(src, dst, callback); | |
}); | |
}); | |
},getDB:function (name, callback) { | |
// check the cache first | |
var db = IDBFS.dbs[name]; | |
if (db) { | |
return callback(null, db); | |
} | |
var req; | |
try { | |
req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION); | |
} catch (e) { | |
return callback(e); | |
} | |
if (!req) { | |
return callback("Unable to connect to IndexedDB"); | |
} | |
req.onupgradeneeded = function(e) { | |
var db = e.target.result; | |
var transaction = e.target.transaction; | |
var fileStore; | |
if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) { | |
fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME); | |
} else { | |
fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME); | |
} | |
if (!fileStore.indexNames.contains('timestamp')) { | |
fileStore.createIndex('timestamp', 'timestamp', { unique: false }); | |
} | |
}; | |
req.onsuccess = function() { | |
db = req.result; | |
// add to the cache | |
IDBFS.dbs[name] = db; | |
callback(null, db); | |
}; | |
req.onerror = function(e) { | |
callback(this.error); | |
e.preventDefault(); | |
}; | |
},getLocalSet:function (mount, callback) { | |
var entries = {}; | |
function isRealDir(p) { | |
return p !== '.' && p !== '..'; | |
}; | |
function toAbsolute(root) { | |
return function(p) { | |
return PATH.join2(root, p); | |
} | |
}; | |
var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint)); | |
while (check.length) { | |
var path = check.pop(); | |
var stat; | |
try { | |
stat = FS.stat(path); | |
} catch (e) { | |
return callback(e); | |
} | |
if (FS.isDir(stat.mode)) { | |
check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path))); | |
} | |
entries[path] = { timestamp: stat.mtime }; | |
} | |
return callback(null, { type: 'local', entries: entries }); | |
},getRemoteSet:function (mount, callback) { | |
var entries = {}; | |
IDBFS.getDB(mount.mountpoint, function(err, db) { | |
if (err) return callback(err); | |
try { | |
var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readonly'); | |
transaction.onerror = function(e) { | |
callback(this.error); | |
e.preventDefault(); | |
}; | |
var store = transaction.objectStore(IDBFS.DB_STORE_NAME); | |
var index = store.index('timestamp'); | |
index.openKeyCursor().onsuccess = function(event) { | |
var cursor = event.target.result; | |
if (!cursor) { | |
return callback(null, { type: 'remote', db: db, entries: entries }); | |
} | |
entries[cursor.primaryKey] = { timestamp: cursor.key }; | |
cursor.continue(); | |
}; | |
} catch (e) { | |
return callback(e); | |
} | |
}); | |
},loadLocalEntry:function (path, callback) { | |
var stat, node; | |
try { | |
var lookup = FS.lookupPath(path); | |
node = lookup.node; | |
stat = FS.stat(path); | |
} catch (e) { | |
return callback(e); | |
} | |
if (FS.isDir(stat.mode)) { | |
return callback(null, { timestamp: stat.mtime, mode: stat.mode }); | |
} else if (FS.isFile(stat.mode)) { | |
// Performance consideration: storing a normal JavaScript array to a IndexedDB is much slower than storing a typed array. | |
// Therefore always convert the file contents to a typed array first before writing the data to IndexedDB. | |
node.contents = MEMFS.getFileDataAsTypedArray(node); | |
return callback(null, { timestamp: stat.mtime, mode: stat.mode, contents: node.contents }); | |
} else { | |
return callback(new Error('node type not supported')); | |
} | |
},storeLocalEntry:function (path, entry, callback) { | |
try { | |
if (FS.isDir(entry.mode)) { | |
FS.mkdir(path, entry.mode); | |
} else if (FS.isFile(entry.mode)) { | |
FS.writeFile(path, entry.contents, { canOwn: true }); | |
} else { | |
return callback(new Error('node type not supported')); | |
} | |
FS.chmod(path, entry.mode); | |
FS.utime(path, entry.timestamp, entry.timestamp); | |
} catch (e) { | |
return callback(e); | |
} | |
callback(null); | |
},removeLocalEntry:function (path, callback) { | |
try { | |
var lookup = FS.lookupPath(path); | |
var stat = FS.stat(path); | |
if (FS.isDir(stat.mode)) { | |
FS.rmdir(path); | |
} else if (FS.isFile(stat.mode)) { | |
FS.unlink(path); | |
} | |
} catch (e) { | |
return callback(e); | |
} | |
callback(null); | |
},loadRemoteEntry:function (store, path, callback) { | |
var req = store.get(path); | |
req.onsuccess = function(event) { callback(null, event.target.result); }; | |
req.onerror = function(e) { | |
callback(this.error); | |
e.preventDefault(); | |
}; | |
},storeRemoteEntry:function (store, path, entry, callback) { | |
var req = store.put(entry, path); | |
req.onsuccess = function() { callback(null); }; | |
req.onerror = function(e) { | |
callback(this.error); | |
e.preventDefault(); | |
}; | |
},removeRemoteEntry:function (store, path, callback) { | |
var req = store.delete(path); | |
req.onsuccess = function() { callback(null); }; | |
req.onerror = function(e) { | |
callback(this.error); | |
e.preventDefault(); | |
}; | |
},reconcile:function (src, dst, callback) { | |
var total = 0; | |
var create = []; | |
Object.keys(src.entries).forEach(function (key) { | |
var e = src.entries[key]; | |
var e2 = dst.entries[key]; | |
if (!e2 || e.timestamp > e2.timestamp) { | |
create.push(key); | |
total++; | |
} | |
}); | |
var remove = []; | |
Object.keys(dst.entries).forEach(function (key) { | |
var e = dst.entries[key]; | |
var e2 = src.entries[key]; | |
if (!e2) { | |
remove.push(key); | |
total++; | |
} | |
}); | |
if (!total) { | |
return callback(null); | |
} | |
var errored = false; | |
var completed = 0; | |
var db = src.type === 'remote' ? src.db : dst.db; | |
var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readwrite'); | |
var store = transaction.objectStore(IDBFS.DB_STORE_NAME); | |
function done(err) { | |
if (err) { | |
if (!done.errored) { | |
done.errored = true; | |
return callback(err); | |
} | |
return; | |
} | |
if (++completed >= total) { | |
return callback(null); | |
} | |
}; | |
transaction.onerror = function(e) { | |
done(this.error); | |
e.preventDefault(); | |
}; | |
// sort paths in ascending order so directory entries are created | |
// before the files inside them | |
create.sort().forEach(function (path) { | |
if (dst.type === 'local') { | |
IDBFS.loadRemoteEntry(store, path, function (err, entry) { | |
if (err) return done(err); | |
IDBFS.storeLocalEntry(path, entry, done); | |
}); | |
} else { | |
IDBFS.loadLocalEntry(path, function (err, entry) { | |
if (err) return done(err); | |
IDBFS.storeRemoteEntry(store, path, entry, done); | |
}); | |
} | |
}); | |
// sort paths in descending order so files are deleted before their | |
// parent directories | |
remove.sort().reverse().forEach(function(path) { | |
if (dst.type === 'local') { | |
IDBFS.removeLocalEntry(path, done); | |
} else { | |
IDBFS.removeRemoteEntry(store, path, done); | |
} | |
}); | |
}}; | |
var NODEFS={isWindows:false,staticInit:function () { | |
NODEFS.isWindows = !!process.platform.match(/^win/); | |
var flags = process["binding"]("constants"); | |
// Node.js 4 compatibility: it has no namespaces for constants | |
if (flags["fs"]) { | |
flags = flags["fs"]; | |
} | |
NODEFS.flagsForNodeMap = { | |
"1024": flags["O_APPEND"], | |
"64": flags["O_CREAT"], | |
"128": flags["O_EXCL"], | |
"0": flags["O_RDONLY"], | |
"2": flags["O_RDWR"], | |
"4096": flags["O_SYNC"], | |
"512": flags["O_TRUNC"], | |
"1": flags["O_WRONLY"] | |
}; | |
},bufferFrom:function (arrayBuffer) { | |
// Node.js < 4.5 compatibility: Buffer.from does not support ArrayBuffer | |
// Buffer.from before 4.5 was just a method inherited from Uint8Array | |
// Buffer.alloc has been added with Buffer.from together, so check it instead | |
return Buffer.alloc ? Buffer.from(arrayBuffer) : new Buffer(arrayBuffer); | |
},mount:function (mount) { | |
assert(ENVIRONMENT_IS_NODE); | |
return NODEFS.createNode(null, '/', NODEFS.getMode(mount.opts.root), 0); | |
},createNode:function (parent, name, mode, dev) { | |
if (!FS.isDir(mode) && !FS.isFile(mode) && !FS.isLink(mode)) { | |
throw new FS.ErrnoError(ERRNO_CODES.EINVAL); | |
} | |
var node = FS.createNode(parent, name, mode); | |
node.node_ops = NODEFS.node_ops; | |
node.stream_ops = NODEFS.stream_ops; | |
return node; | |
},getMode:function (path) { | |
var stat; | |
try { | |
stat = fs.lstatSync(path); | |
if (NODEFS.isWindows) { | |
// Node.js on Windows never represents permission bit 'x', so | |
// propagate read bits to execute bits | |
stat.mode = stat.mode | ((stat.mode & 292) >> 2); | |
} | |
} catch (e) { | |
if (!e.code) throw e; | |
throw new FS.ErrnoError(ERRNO_CODES[e.code]); | |
} | |
return stat.mode; | |
},realPath:function (node) { | |
var parts = []; | |
while (node.parent !== node) { | |
parts.push(node.name); | |
node = node.parent; | |
} | |
parts.push(node.mount.opts.root); | |
parts.reverse(); | |
return PATH.join.apply(null, parts); | |
},flagsForNode:function (flags) { | |
flags &= ~0x200000 /*O_PATH*/; // Ignore this flag from musl, otherwise node.js fails to open the file. | |
flags &= ~0x800 /*O_NONBLOCK*/; // Ignore this flag from musl, otherwise node.js fails to open the file. | |
flags &= ~0x8000 /*O_LARGEFILE*/; // Ignore this flag from musl, otherwise node.js fails to open the file. | |
flags &= ~0x80000 /*O_CLOEXEC*/; // Some applications may pass it; it makes no sense for a single process. | |
var newFlags = 0; | |
for (var k in NODEFS.flagsForNodeMap) { | |
if (flags & k) { | |
newFlags |= NODEFS.flagsForNodeMap[k]; | |
flags ^= k; | |
} | |
} | |
if (!flags) { | |
return newFlags; | |
} else { | |
throw new FS.ErrnoError(ERRNO_CODES.EINVAL); | |
} | |
},node_ops:{getattr:function (node) { | |
var path = NODEFS.realPath(node); | |
var stat; | |
try { | |
stat = fs.lstatSync(path); | |
} catch (e) { | |
if (!e.code) throw e; | |
throw new FS.ErrnoError(ERRNO_CODES[e.code]); | |
} | |
// node.js v0.10.20 doesn't report blksize and blocks on Windows. Fake them with default blksize of 4096. | |
// See http://support.microsoft.com/kb/140365 | |
if (NODEFS.isWindows && !stat.blksize) { | |
stat.blksize = 4096; | |
} | |
if (NODEFS.isWindows && !stat.blocks) { | |
stat.blocks = (stat.size+stat.blksize-1)/stat.blksize|0; | |
} | |
return { | |
dev: stat.dev, | |
ino: stat.ino, | |
mode: stat.mode, | |
nlink: stat.nlink, | |
uid: stat.uid, | |
gid: stat.gid, | |
rdev: stat.rdev, | |
size: stat.size, | |
atime: stat.atime, | |
mtime: stat.mtime, | |
ctime: stat.ctime, | |
blksize: stat.blksize, | |
blocks: stat.blocks | |
}; | |
},setattr:function (node, attr) { | |
var path = NODEFS.realPath(node); | |
try { | |
if (attr.mode !== undefined) { | |
fs.chmodSync(path, attr.mode); | |
// update the common node structure mode as well | |
node.mode = attr.mode; | |
} | |
if (attr.timestamp !== undefined) { | |
var date = new Date(attr.timestamp); | |
fs.utimesSync(path, date, date); | |
} | |
if (attr.size !== undefined) { | |
fs.truncateSync(path, attr.size); | |
} | |
} catch (e) { | |
if (!e.code) throw e; | |
throw new FS.ErrnoError(ERRNO_CODES[e.code]); | |
} | |
},lookup:function (parent, name) { | |
var path = PATH.join2(NODEFS.realPath(parent), name); | |
var mode = NODEFS.getMode(path); | |
return NODEFS.createNode(parent, name, mode); | |
},mknod:function (parent, name, mode, dev) { | |
var node = NODEFS.createNode(parent, name, mode, dev); | |
// create the backing node for this in the fs root as well | |
var path = NODEFS.realPath(node); | |
try { | |
if (FS.isDir(node.mode)) { | |
fs.mkdirSync(path, node.mode); | |
} else { | |
fs.writeFileSync(path, '', { mode: node.mode }); | |
} | |
} catch (e) { | |
if (!e.code) throw e; | |
throw new FS.ErrnoError(ERRNO_CODES[e.code]); | |
} | |
return node; | |
},rename:function (oldNode, newDir, newName) { | |
var oldPath = NODEFS.realPath(oldNode); | |
var newPath = PATH.join2(NODEFS.realPath(newDir), newName); | |
try { | |
fs.renameSync(oldPath, newPath); | |
} catch (e) { | |
if (!e.code) throw e; | |
throw new FS.ErrnoError(ERRNO_CODES[e.code]); | |
} | |
},unlink:function (parent, name) { | |
var path = PATH.join2(NODEFS.realPath(parent), name); | |
try { | |
fs.unlinkSync(path); | |
} catch (e) { | |
if (!e.code) throw e; | |
throw new FS.ErrnoError(ERRNO_CODES[e.code]); | |
} | |
},rmdir:function (parent, name) { | |
var path = PATH.join2(NODEFS.realPath(parent), name); | |
try { | |
fs.rmdirSync(path); | |
} catch (e) { | |
if (!e.code) throw e; | |
throw new FS.ErrnoError(ERRNO_CODES[e.code]); | |
} | |
},readdir:function (node) { | |
var path = NODEFS.realPath(node); | |
try { | |
return fs.readdirSync(path); | |
} catch (e) { | |
if (!e.code) throw e; | |
throw new FS.ErrnoError(ERRNO_CODES[e.code]); | |
} | |
},symlink:function (parent, newName, oldPath) { | |
var newPath = PATH.join2(NODEFS.realPath(parent), newName); | |
try { | |
fs.symlinkSync(oldPath, newPath); | |
} catch (e) { | |
if (!e.code) throw e; | |
throw new FS.ErrnoError(ERRNO_CODES[e.code]); | |
} | |
},readlink:function (node) { | |
var path = NODEFS.realPath(node); | |
try { | |
path = fs.readlinkSync(path); | |
path = NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root), path); | |
return path; | |
} catch (e) { | |
if (!e.code) throw e; | |
throw new FS.ErrnoError(ERRNO_CODES[e.code]); | |
} | |
}},stream_ops:{open:function (stream) { | |
var path = NODEFS.realPath(stream.node); | |
try { | |
if (FS.isFile(stream.node.mode)) { | |
stream.nfd = fs.openSync(path, NODEFS.flagsForNode(stream.flags)); | |
} | |
} catch (e) { | |
if (!e.code) throw e; | |
throw new FS.ErrnoError(ERRNO_CODES[e.code]); | |
} | |
},close:function (stream) { | |
try { | |
if (FS.isFile(stream.node.mode) && stream.nfd) { | |
fs.closeSync(stream.nfd); | |
} | |
} catch (e) { | |
if (!e.code) throw e; | |
throw new FS.ErrnoError(ERRNO_CODES[e.code]); | |
} | |
},read:function (stream, buffer, offset, length, position) { | |
// Node.js < 6 compatibility: node errors on 0 length reads | |
if (length === 0) return 0; | |
try { | |
return fs.readSync(stream.nfd, NODEFS.bufferFrom(buffer.buffer), offset, length, position); | |
} catch (e) { | |
throw new FS.ErrnoError(ERRNO_CODES[e.code]); | |
} | |
},write:function (stream, buffer, offset, length, position) { | |
try { | |
return fs.writeSync(stream.nfd, NODEFS.bufferFrom(buffer.buffer), offset, length, position); | |
} catch (e) { | |
throw new FS.ErrnoError(ERRNO_CODES[e.code]); | |
} | |
},llseek:function (stream, offset, whence) { | |
var position = offset; | |
if (whence === 1) { // SEEK_CUR. | |
position += stream.position; | |
} else if (whence === 2) { // SEEK_END. | |
if (FS.isFile(stream.node.mode)) { | |
try { | |
var stat = fs.fstatSync(stream.nfd); | |
position += stat.size; | |
} catch (e) { | |
throw new FS.ErrnoError(ERRNO_CODES[e.code]); | |
} | |
} | |
} | |
if (position < 0) { | |
throw new FS.ErrnoError(ERRNO_CODES.EINVAL); | |
} | |
return position; | |
}}}; | |
var WORKERFS={DIR_MODE:16895,FILE_MODE:33279,reader:null,mount:function (mount) { | |
assert(ENVIRONMENT_IS_WORKER); | |
if (!WORKERFS.reader) WORKERFS.reader = new FileReaderSync(); | |
var root = WORKERFS.createNode(null, '/', WORKERFS.DIR_MODE, 0); | |
var createdParents = {}; | |
function ensureParent(path) { | |
// return the parent node, creating subdirs as necessary | |
var parts = path.split('/'); | |
var parent = root; | |
for (var i = 0; i < parts.length-1; i++) { | |
var curr = parts.slice(0, i+1).join('/'); | |
// Issue 4254: Using curr as a node name will prevent the node | |
// from being found in FS.nameTable when FS.open is called on | |
// a path which holds a child of this node, | |
// given that all FS functions assume node names | |
// are just their corresponding parts within their given path, | |
// rather than incremental aggregates which include their parent's | |
// directories. | |
if (!createdParents[curr]) { | |
createdParents[curr] = WORKERFS.createNode(parent, parts[i], WORKERFS.DIR_MODE, 0); | |
} | |
parent = createdParents[curr]; | |
} | |
return parent; | |
} | |
function base(path) { | |
var parts = path.split('/'); | |
return parts[parts.length-1]; | |
} | |
// We also accept FileList here, by using Array.prototype | |
Array.prototype.forEach.call(mount.opts["files"] || [], function(file) { | |
WORKERFS.createNode(ensureParent(file.name), base(file.name), WORKERFS.FILE_MODE, 0, file, file.lastModifiedDate); | |
}); | |
(mount.opts["blobs"] || []).forEach(function(obj) { | |
WORKERFS.createNode(ensureParent(obj["name"]), base(obj["name"]), WORKERFS.FILE_MODE, 0, obj["data"]); | |
}); | |
(mount.opts["packages"] || []).forEach(function(pack) { | |
pack['metadata'].files.forEach(function(file) { | |
var name = file.filename.substr(1); // remove initial slash | |
WORKERFS.createNode(ensureParent(name), base(name), WORKERFS.FILE_MODE, 0, pack['blob'].slice(file.start, file.end)); | |
}); | |
}); | |
return root; | |
},createNode:function (parent, name, mode, dev, contents, mtime) { | |
var node = FS.createNode(parent, name, mode); | |
node.mode = mode; | |
node.node_ops = WORKERFS.node_ops; | |
node.stream_ops = WORKERFS.stream_ops; | |
node.timestamp = (mtime || new Date).getTime(); | |
assert(WORKERFS.FILE_MODE !== WORKERFS.DIR_MODE); | |
if (mode === WORKERFS.FILE_MODE) { | |
node.size = contents.size; | |
node.contents = contents; | |
} else { | |
node.size = 4096; | |
node.contents = {}; | |
} | |
if (parent) { | |
parent.contents[name] = node; | |
} | |
return node; | |
},node_ops:{getattr:function (node) { | |
return { | |
dev: 1, | |
ino: undefined, | |
mode: node.mode, | |
nlink: 1, | |
uid: 0, | |
gid: 0, | |
rdev: undefined, | |
size: node.size, | |
atime: new Date(node.timestamp), | |
mtime: new Date(node.timestamp), | |
ctime: new Date(node.timestamp), | |
blksize: 4096, | |
blocks: Math.ceil(node.size / 4096), | |
}; | |
},setattr:function (node, attr) { | |
if (attr.mode !== undefined) { | |
node.mode = attr.mode; | |
} | |
if (attr.timestamp !== undefined) { | |
node.timestamp = attr.timestamp; | |
} | |
},lookup:function (parent, name) { | |
throw new FS.ErrnoError(ERRNO_CODES.ENOENT); | |
},mknod:function (parent, name, mode, dev) { | |
throw new FS.ErrnoError(ERRNO_CODES.EPERM); | |
},rename:function (oldNode, newDir, newName) { | |
throw new FS.ErrnoError(ERRNO_CODES.EPERM); | |
},unlink:function (parent, name) { | |
throw new FS.ErrnoError(ERRNO_CODES.EPERM); | |
},rmdir:function (parent, name) { | |
throw new FS.ErrnoError(ERRNO_CODES.EPERM); | |
},readdir:function (node) { | |
var entries = ['.', '..']; | |
for (var key in node.contents) { | |
if (!node.contents.hasOwnProperty(key)) { | |
continue; | |
} | |
entries.push(key); | |
} | |
return entries; | |
},symlink:function (parent, newName, oldPath) { | |
throw new FS.ErrnoError(ERRNO_CODES.EPERM); | |
},readlink:function (node) { | |
throw new FS.ErrnoError(ERRNO_CODES.EPERM); | |
}},stream_ops:{read:function (stream, buffer, offset, length, position) { | |
if (position >= stream.node.size) return 0; | |
var chunk = stream.node.contents.slice(position, position + length); | |
var ab = WORKERFS.reader.readAsArrayBuffer(chunk); | |
buffer.set(new Uint8Array(ab), offset); | |
return chunk.size; | |
},write:function (stream, buffer, offset, length, position) { | |
throw new FS.ErrnoError(ERRNO_CODES.EIO); | |
},llseek:function (stream, offset, whence) { | |
var position = offset; | |
if (whence === 1) { // SEEK_CUR. | |
position += stream.position; | |
} else if (whence === 2) { // SEEK_END. | |
if (FS.isFile(stream.node.mode)) { | |
position += stream.node.size; | |
} | |
} | |
if (position < 0) { | |
throw new FS.ErrnoError(ERRNO_CODES.EINVAL); | |
} | |
return position; | |
}}}; | |
var ERRNO_MESSAGES={0:"Success",1:"Not super-user",2:"No such file or directory",3:"No such process",4:"Interrupted system call",5:"I/O error",6:"No such device or address",7:"Arg list too long",8:"Exec format error",9:"Bad file number",10:"No children",11:"No more processes",12:"Not enough core",13:"Permission denied",14:"Bad address",15:"Block device required",16:"Mount device busy",17:"File exists",18:"Cross-device link",19:"No such device",20:"Not a directory",21:"Is a directory",22:"Invalid argument",23:"Too many open files in system",24:"Too many open files",25:"Not a typewriter",26:"Text file busy",27:"File too large",28:"No space left on device",29:"Illegal seek",30:"Read only file system",31:"Too many links",32:"Broken pipe",33:"Math arg out of domain of func",34:"Math result not representable",35:"File locking deadlock error",36:"File or path name too long",37:"No record locks available",38:"Function not implemented",39:"Directory not empty",40:"Too many symbolic links",42:"No message of desired type",43:"Identifier removed",44:"Channel number out of range",45:"Level 2 not synchronized",46:"Level 3 halted",47:"Level 3 reset",48:"Link number out of range",49:"Protocol driver not attached",50:"No CSI structure available",51:"Level 2 halted",52:"Invalid exchange",53:"Invalid request descriptor",54:"Exchange full",55:"No anode",56:"Invalid request code",57:"Invalid slot",59:"Bad font file fmt",60:"Device not a stream",61:"No data (for no delay io)",62:"Timer expired",63:"Out of streams resources",64:"Machine is not on the network",65:"Package not installed",66:"The object is remote",67:"The link has been severed",68:"Advertise error",69:"Srmount error",70:"Communication error on send",71:"Protocol error",72:"Multihop attempted",73:"Cross mount point (not really error)",74:"Trying to read unreadable message",75:"Value too large for defined data type",76:"Given log. name not unique",77:"f.d. invalid for this operation",78:"Remote address changed",79:"Can access a needed shared lib",80:"Accessing a corrupted shared lib",81:".lib section in a.out corrupted",82:"Attempting to link in too many libs",83:"Attempting to exec a shared library",84:"Illegal byte sequence",86:"Streams pipe error",87:"Too many users",88:"Socket operation on non-socket",89:"Destination address required",90:"Message too long",91:"Protocol wrong type for socket",92:"Protocol not available",93:"Unknown protocol",94:"Socket type not supported",95:"Not supported",96:"Protocol family not supported",97:"Address family not supported by protocol family",98:"Address already in use",99:"Address not available",100:"Network interface is not configured",101:"Network is unreachable",102:"Connection reset by network",103:"Connection aborted",104:"Connection reset by peer",105:"No buffer space available",106:"Socket is already connected",107:"Socket is not connected",108:"Can't send after socket shutdown",109:"Too many references",110:"Connection timed out",111:"Connection refused",112:"Host is down",113:"Host is unreachable",114:"Socket already connected",115:"Connection already in progress",116:"Stale file handle",122:"Quota exceeded",123:"No medium (in tape drive)",125:"Operation canceled",130:"Previous owner died",131:"State not recoverable"}; | |
var ERRNO_CODES={EPERM:1,ENOENT:2,ESRCH:3,EINTR:4,EIO:5,ENXIO:6,E2BIG:7,ENOEXEC:8,EBADF:9,ECHILD:10,EAGAIN:11,EWOULDBLOCK:11,ENOMEM:12,EACCES:13,EFAULT:14,ENOTBLK:15,EBUSY:16,EEXIST:17,EXDEV:18,ENODEV:19,ENOTDIR:20,EISDIR:21,EINVAL:22,ENFILE:23,EMFILE:24,ENOTTY:25,ETXTBSY:26,EFBIG:27,ENOSPC:28,ESPIPE:29,EROFS:30,EMLINK:31,EPIPE:32,EDOM:33,ERANGE:34,ENOMSG:42,EIDRM:43,ECHRNG:44,EL2NSYNC:45,EL3HLT:46,EL3RST:47,ELNRNG:48,EUNATCH:49,ENOCSI:50,EL2HLT:51,EDEADLK:35,ENOLCK:37,EBADE:52,EBADR:53,EXFULL:54,ENOANO:55,EBADRQC:56,EBADSLT:57,EDEADLOCK:35,EBFONT:59,ENOSTR:60,ENODATA:61,ETIME:62,ENOSR:63,ENONET:64,ENOPKG:65,EREMOTE:66,ENOLINK:67,EADV:68,ESRMNT:69,ECOMM:70,EPROTO:71,EMULTIHOP:72,EDOTDOT:73,EBADMSG:74,ENOTUNIQ:76,EBADFD:77,EREMCHG:78,ELIBACC:79,ELIBBAD:80,ELIBSCN:81,ELIBMAX:82,ELIBEXEC:83,ENOSYS:38,ENOTEMPTY:39,ENAMETOOLONG:36,ELOOP:40,EOPNOTSUPP:95,EPFNOSUPPORT:96,ECONNRESET:104,ENOBUFS:105,EAFNOSUPPORT:97,EPROTOTYPE:91,ENOTSOCK:88,ENOPROTOOPT:92,ESHUTDOWN:108,ECONNREFUSED:111,EADDRINUSE:98,ECONNABORTED:103,ENETUNREACH:101,ENETDOWN:100,ETIMEDOUT:110,EHOSTDOWN:112,EHOSTUNREACH:113,EINPROGRESS:115,EALREADY:114,EDESTADDRREQ:89,EMSGSIZE:90,EPROTONOSUPPORT:93,ESOCKTNOSUPPORT:94,EADDRNOTAVAIL:99,ENETRESET:102,EISCONN:106,ENOTCONN:107,ETOOMANYREFS:109,EUSERS:87,EDQUOT:122,ESTALE:116,ENOTSUP:95,ENOMEDIUM:123,EILSEQ:84,EOVERFLOW:75,ECANCELED:125,ENOTRECOVERABLE:131,EOWNERDEAD:130,ESTRPIPE:86}; | |
var _stdin=STATICTOP; STATICTOP += 16;; | |
var _stdout=STATICTOP; STATICTOP += 16;; | |
var _stderr=STATICTOP; STATICTOP += 16;;var FS={root:null,mounts:[],devices:{},streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,syncFSRequests:0,handleFSError:function (e) { | |
if (!(e instanceof FS.ErrnoError)) throw e + ' : ' + stackTrace(); | |
return ___setErrNo(e.errno); | |
},lookupPath:function (path, opts) { | |
path = PATH.resolve(FS.cwd(), path); | |
opts = opts || {}; | |
if (!path) return { path: '', node: null }; | |
var defaults = { | |
follow_mount: true, | |
recurse_count: 0 | |
}; | |
for (var key in defaults) { | |
if (opts[key] === undefined) { | |
opts[key] = defaults[key]; | |
} | |
} | |
if (opts.recurse_count > 8) { // max recursive lookup of 8 | |
throw new FS.ErrnoError(40); | |
} | |
// split the path | |
var parts = PATH.normalizeArray(path.split('/').filter(function(p) { | |
return !!p; | |
}), false); | |
// start at the root | |
var current = FS.root; | |
var current_path = '/'; | |
for (var i = 0; i < parts.length; i++) { | |
var islast = (i === parts.length-1); | |
if (islast && opts.parent) { | |
// stop resolving | |
break; | |
} | |
current = FS.lookupNode(current, parts[i]); | |
current_path = PATH.join2(current_path, parts[i]); | |
// jump to the mount's root node if this is a mountpoint | |
if (FS.isMountpoint(current)) { | |
if (!islast || (islast && opts.follow_mount)) { | |
current = current.mounted.root; | |
} | |
} | |
// by default, lookupPath will not follow a symlink if it is the final path component. | |
// setting opts.follow = true will override this behavior. | |
if (!islast || opts.follow) { | |
var count = 0; | |
while (FS.isLink(current.mode)) { | |
var link = FS.readlink(current_path); | |
current_path = PATH.resolve(PATH.dirname(current_path), link); | |
var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count }); | |
current = lookup.node; | |
if (count++ > 40) { // limit max consecutive symlinks to 40 (SYMLOOP_MAX). | |
throw new FS.ErrnoError(40); | |
} | |
} | |
} | |
} | |
return { path: current_path, node: current }; | |
},getPath:function (node) { | |
var path; | |
while (true) { | |
if (FS.isRoot(node)) { | |
var mount = node.mount.mountpoint; | |
if (!path) return mount; | |
return mount[mount.length-1] !== '/' ? mount + '/' + path : mount + path; | |
} | |
path = path ? node.name + '/' + path : node.name; | |
node = node.parent; | |
} | |
},hashName:function (parentid, name) { | |
var hash = 0; | |
for (var i = 0; i < name.length; i++) { | |
hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0; | |
} | |
return ((parentid + hash) >>> 0) % FS.nameTable.length; | |
},hashAddNode:function (node) { | |
var hash = FS.hashName(node.parent.id, node.name); | |
node.name_next = FS.nameTable[hash]; | |
FS.nameTable[hash] = node; | |
},hashRemoveNode:function (node) { | |
var hash = FS.hashName(node.parent.id, node.name); | |
if (FS.nameTable[hash] === node) { | |
FS.nameTable[hash] = node.name_next; | |
} else { | |
var current = FS.nameTable[hash]; | |
while (current) { | |
if (current.name_next === node) { | |
current.name_next = node.name_next; | |
break; | |
} | |
current = current.name_next; | |
} | |
} | |
},lookupNode:function (parent, name) { | |
var err = FS.mayLookup(parent); | |
if (err) { | |
throw new FS.ErrnoError(err, parent); | |
} | |
var hash = FS.hashName(parent.id, name); | |
for (var node = FS.nameTable[hash]; node; node = node.name_next) { | |
var nodeName = node.name; | |
if (node.parent.id === parent.id && nodeName === name) { | |
return node; | |
} | |
} | |
// if we failed to find it in the cache, call into the VFS | |
return FS.lookup(parent, name); | |
},createNode:function (parent, name, mode, rdev) { | |
if (!FS.FSNode) { | |
FS.FSNode = function(parent, name, mode, rdev) { | |
if (!parent) { | |
parent = this; // root node sets parent to itself | |
} | |
this.parent = parent; | |
this.mount = parent.mount; | |
this.mounted = null; | |
this.id = FS.nextInode++; | |
this.name = name; | |
this.mode = mode; | |
this.node_ops = {}; | |
this.stream_ops = {}; | |
this.rdev = rdev; | |
}; | |
FS.FSNode.prototype = {}; | |
// compatibility | |
var readMode = 292 | 73; | |
var writeMode = 146; | |
// NOTE we must use Object.defineProperties instead of individual calls to | |
// Object.defineProperty in order to make closure compiler happy | |
Object.defineProperties(FS.FSNode.prototype, { | |
read: { | |
get: function() { return (this.mode & readMode) === readMode; }, | |
set: function(val) { val ? this.mode |= readMode : this.mode &= ~readMode; } | |
}, | |
write: { | |
get: function() { return (this.mode & writeMode) === writeMode; }, | |
set: function(val) { val ? this.mode |= writeMode : this.mode &= ~writeMode; } | |
}, | |
isFolder: { | |
get: function() { return FS.isDir(this.mode); } | |
}, | |
isDevice: { | |
get: function() { return FS.isChrdev(this.mode); } | |
} | |
}); | |
} | |
var node = new FS.FSNode(parent, name, mode, rdev); | |
FS.hashAddNode(node); | |
return node; | |
},destroyNode:function (node) { | |
FS.hashRemoveNode(node); | |
},isRoot:function (node) { | |
return node === node.parent; | |
},isMountpoint:function (node) { | |
return !!node.mounted; | |
},isFile:function (mode) { | |
return (mode & 61440) === 32768; | |
},isDir:function (mode) { | |
return (mode & 61440) === 16384; | |
},isLink:function (mode) { | |
return (mode & 61440) === 40960; | |
},isChrdev:function (mode) { | |
return (mode & 61440) === 8192; | |
},isBlkdev:function (mode) { | |
return (mode & 61440) === 24576; | |
},isFIFO:function (mode) { | |
return (mode & 61440) === 4096; | |
},isSocket:function (mode) { | |
return (mode & 49152) === 49152; | |
},flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:function (str) { | |
var flags = FS.flagModes[str]; | |
if (typeof flags === 'undefined') { | |
throw new Error('Unknown file open mode: ' + str); | |
} | |
return flags; | |
},flagsToPermissionString:function (flag) { | |
var perms = ['r', 'w', 'rw'][flag & 3]; | |
if ((flag & 512)) { | |
perms += 'w'; | |
} | |
return perms; | |
},nodePermissions:function (node, perms) { | |
if (FS.ignorePermissions) { | |
return 0; | |
} | |
// return 0 if any user, group or owner bits are set. | |
if (perms.indexOf('r') !== -1 && !(node.mode & 292)) { | |
return 13; | |
} else if (perms.indexOf('w') !== -1 && !(node.mode & 146)) { | |
return 13; | |
} else if (perms.indexOf('x') !== -1 && !(node.mode & 73)) { | |
return 13; | |
} | |
return 0; | |
},mayLookup:function (dir) { | |
var err = FS.nodePermissions(dir, 'x'); | |
if (err) return err; | |
if (!dir.node_ops.lookup) return 13; | |
return 0; | |
},mayCreate:function (dir, name) { | |
try { | |
var node = FS.lookupNode(dir, name); | |
return 17; | |
} catch (e) { | |
} | |
return FS.nodePermissions(dir, 'wx'); | |
},mayDelete:function (dir, name, isdir) { | |
var node; | |
try { | |
node = FS.lookupNode(dir, name); | |
} catch (e) { | |
return e.errno; | |
} | |
var err = FS.nodePermissions(dir, 'wx'); | |
if (err) { | |
return err; | |
} | |
if (isdir) { | |
if (!FS.isDir(node.mode)) { | |
return 20; | |
} | |
if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) { | |
return 16; | |
} | |
} else { | |
if (FS.isDir(node.mode)) { | |
return 21; | |
} | |
} | |
return 0; | |
},mayOpen:function (node, flags) { | |
if (!node) { | |
return 2; | |
} | |
if (FS.isLink(node.mode)) { | |
return 40; | |
} else if (FS.isDir(node.mode)) { | |
if (FS.flagsToPermissionString(flags) !== 'r' || // opening for write | |
(flags & 512)) { // TODO: check for O_SEARCH? (== search for dir only) | |
return 21; | |
} | |
} | |
return FS.nodePermissions(node, FS.flagsToPermissionString(flags)); | |
},MAX_OPEN_FDS:4096,nextfd:function (fd_start, fd_end) { | |
fd_start = fd_start || 0; | |
fd_end = fd_end || FS.MAX_OPEN_FDS; | |
for (var fd = fd_start; fd <= fd_end; fd++) { | |
if (!FS.streams[fd]) { | |
return fd; | |
} | |
} | |
throw new FS.ErrnoError(24); | |
},getStream:function (fd) { | |
return FS.streams[fd]; | |
},createStream:function (stream, fd_start, fd_end) { | |
if (!FS.FSStream) { | |
FS.FSStream = function(){}; | |
FS.FSStream.prototype = {}; | |
// compatibility | |
Object.defineProperties(FS.FSStream.prototype, { | |
object: { | |
get: function() { return this.node; }, | |
set: function(val) { this.node = val; } | |
}, | |
isRead: { | |
get: function() { return (this.flags & 2097155) !== 1; } | |
}, | |
isWrite: { | |
get: function() { return (this.flags & 2097155) !== 0; } | |
}, | |
isAppend: { | |
get: function() { return (this.flags & 1024); } | |
} | |
}); | |
} | |
// clone it, so we can return an instance of FSStream | |
var newStream = new FS.FSStream(); | |
for (var p in stream) { | |
newStream[p] = stream[p]; | |
} | |
stream = newStream; | |
var fd = FS.nextfd(fd_start, fd_end); | |
stream.fd = fd; | |
FS.streams[fd] = stream; | |
return stream; | |
},closeStream:function (fd) { | |
FS.streams[fd] = null; | |
},chrdev_stream_ops:{open:function (stream) { | |
var device = FS.getDevice(stream.node.rdev); | |
// override node's stream ops with the device's | |
stream.stream_ops = device.stream_ops; | |
// forward the open call | |
if (stream.stream_ops.open) { | |
stream.stream_ops.open(stream); | |
} | |
},llseek:function () { | |
throw new FS.ErrnoError(29); | |
}},major:function (dev) { | |
return ((dev) >> 8); | |
},minor:function (dev) { | |
return ((dev) & 0xff); | |
},makedev:function (ma, mi) { | |
return ((ma) << 8 | (mi)); | |
},registerDevice:function (dev, ops) { | |
FS.devices[dev] = { stream_ops: ops }; | |
},getDevice:function (dev) { | |
return FS.devices[dev]; | |
},getMounts:function (mount) { | |
var mounts = []; | |
var check = [mount]; | |
while (check.length) { | |
var m = check.pop(); | |
mounts.push(m); | |
check.push.apply(check, m.mounts); | |
} | |
return mounts; | |
},syncfs:function (populate, callback) { | |
if (typeof(populate) === 'function') { | |
callback = populate; | |
populate = false; | |
} | |
FS.syncFSRequests++; | |
if (FS.syncFSRequests > 1) { | |
console.log('warning: ' + FS.syncFSRequests + ' FS.syncfs operations in flight at once, probably just doing extra work'); | |
} | |
var mounts = FS.getMounts(FS.root.mount); | |
var completed = 0; | |
function doCallback(err) { | |
assert(FS.syncFSRequests > 0); | |
FS.syncFSRequests--; | |
return callback(err); | |
} | |
function done(err) { | |
if (err) { | |
if (!done.errored) { | |
done.errored = true; | |
return doCallback(err); | |
} | |
return; | |
} | |
if (++completed >= mounts.length) { | |
doCallback(null); | |
} | |
}; | |
// sync all mounts | |
mounts.forEach(function (mount) { | |
if (!mount.type.syncfs) { | |
return done(null); | |
} | |
mount.type.syncfs(mount, populate, done); | |
}); | |
},mount:function (type, opts, mountpoint) { | |
var root = mountpoint === '/'; | |
var pseudo = !mountpoint; | |
var node; | |
if (root && FS.root) { | |
throw new FS.ErrnoError(16); | |
} else if (!root && !pseudo) { | |
var lookup = FS.lookupPath(mountpoint, { follow_mount: false }); | |
mountpoint = lookup.path; // use the absolute path | |
node = lookup.node; | |
if (FS.isMountpoint(node)) { | |
throw new FS.ErrnoError(16); | |
} | |
if (!FS.isDir(node.mode)) { | |
throw new FS.ErrnoError(20); | |
} | |
} | |
var mount = { | |
type: type, | |
opts: opts, | |
mountpoint: mountpoint, | |
mounts: [] | |
}; | |
// create a root node for the fs | |
var mountRoot = type.mount(mount); | |
mountRoot.mount = mount; | |
mount.root = mountRoot; | |
if (root) { | |
FS.root = mountRoot; | |
} else if (node) { | |
// set as a mountpoint | |
node.mounted = mount; | |
// add the new mount to the current mount's children | |
if (node.mount) { | |
node.mount.mounts.push(mount); | |
} | |
} | |
return mountRoot; | |
},unmount:function (mountpoint) { | |
var lookup = FS.lookupPath(mountpoint, { follow_mount: false }); | |
if (!FS.isMountpoint(lookup.node)) { | |
throw new FS.ErrnoError(22); | |
} | |
// destroy the nodes for this mount, and all its child mounts | |
var node = lookup.node; | |
var mount = node.mounted; | |
var mounts = FS.getMounts(mount); | |
Object.keys(FS.nameTable).forEach(function (hash) { | |
var current = FS.nameTable[hash]; | |
while (current) { | |
var next = current.name_next; | |
if (mounts.indexOf(current.mount) !== -1) { | |
FS.destroyNode(current); | |
} | |
current = next; | |
} | |
}); | |
// no longer a mountpoint | |
node.mounted = null; | |
// remove this mount from the child mounts | |
var idx = node.mount.mounts.indexOf(mount); | |
assert(idx !== -1); | |
node.mount.mounts.splice(idx, 1); | |
},lookup:function (parent, name) { | |
return parent.node_ops.lookup(parent, name); | |
},mknod:function (path, mode, dev) { | |
var lookup = FS.lookupPath(path, { parent: true }); | |
var parent = lookup.node; | |
var name = PATH.basename(path); | |
if (!name || name === '.' || name === '..') { | |
throw new FS.ErrnoError(22); | |
} | |
var err = FS.mayCreate(parent, name); | |
if (err) { | |
throw new FS.ErrnoError(err); | |
} | |
if (!parent.node_ops.mknod) { | |
throw new FS.ErrnoError(1); | |
} | |
return parent.node_ops.mknod(parent, name, mode, dev); | |
},create:function (path, mode) { | |
mode = mode !== undefined ? mode : 438 /* 0666 */; | |
mode &= 4095; | |
mode |= 32768; | |
return FS.mknod(path, mode, 0); | |
},mkdir:function (path, mode) { | |
mode = mode !== undefined ? mode : 511 /* 0777 */; | |
mode &= 511 | 512; | |
mode |= 16384; | |
return FS.mknod(path, mode, 0); | |
},mkdirTree:function (path, mode) { | |
var dirs = path.split('/'); | |
var d = ''; | |
for (var i = 0; i < dirs.length; ++i) { | |
if (!dirs[i]) continue; | |
d += '/' + dirs[i]; | |
try { | |
FS.mkdir(d, mode); | |
} catch(e) { | |
if (e.errno != 17) throw e; | |
} | |
} | |
},mkdev:function (path, mode, dev) { | |
if (typeof(dev) === 'undefined') { | |
dev = mode; | |
mode = 438 /* 0666 */; | |
} | |
mode |= 8192; | |
return FS.mknod(path, mode, dev); | |
},symlink:function (oldpath, newpath) { | |
if (!PATH.resolve(oldpath)) { | |
throw new FS.ErrnoError(2); | |
} | |
var lookup = FS.lookupPath(newpath, { parent: true }); | |
var parent = lookup.node; | |
if (!parent) { | |
throw new FS.ErrnoError(2); | |
} | |
var newname = PATH.basename(newpath); | |
var err = FS.mayCreate(parent, newname); | |
if (err) { | |
throw new FS.ErrnoError(err); | |
} | |
if (!parent.node_ops.symlink) { | |
throw new FS.ErrnoError(1); | |
} | |
return parent.node_ops.symlink(parent, newname, oldpath); | |
},rename:function (old_path, new_path) { | |
var old_dirname = PATH.dirname(old_path); | |
var new_dirname = PATH.dirname(new_path); | |
var old_name = PATH.basename(old_path); | |
var new_name = PATH.basename(new_path); | |
// parents must exist | |
var lookup, old_dir, new_dir; | |
try { | |
lookup = FS.lookupPath(old_path, { parent: true }); | |
old_dir = lookup.node; | |
lookup = FS.lookupPath(new_path, { parent: true }); | |
new_dir = lookup.node; | |
} catch (e) { | |
throw new FS.ErrnoError(16); | |
} | |
if (!old_dir || !new_dir) throw new FS.ErrnoError(2); | |
// need to be part of the same mount | |
if (old_dir.mount !== new_dir.mount) { | |
throw new FS.ErrnoError(18); | |
} | |
// source must exist | |
var old_node = FS.lookupNode(old_dir, old_name); | |
// old path should not be an ancestor of the new path | |
var relative = PATH.relative(old_path, new_dirname); | |
if (relative.charAt(0) !== '.') { | |
throw new FS.ErrnoError(22); | |
} | |
// new path should not be an ancestor of the old path | |
relative = PATH.relative(new_path, old_dirname); | |
if (relative.charAt(0) !== '.') { | |
throw new FS.ErrnoError(39); | |
} | |
// see if the new path already exists | |
var new_node; | |
try { | |
new_node = FS.lookupNode(new_dir, new_name); | |
} catch (e) { | |
// not fatal | |
} | |
// early out if nothing needs to change | |
if (old_node === new_node) { | |
return; | |
} | |
// we'll need to delete the old entry | |
var isdir = FS.isDir(old_node.mode); | |
var err = FS.mayDelete(old_dir, old_name, isdir); | |
if (err) { | |
throw new FS.ErrnoError(err); | |
} | |
// need delete permissions if we'll be overwriting. | |
// need create permissions if new doesn't already exist. | |
err = new_node ? | |
FS.mayDelete(new_dir, new_name, isdir) : | |
FS.mayCreate(new_dir, new_name); | |
if (err) { | |
throw new FS.ErrnoError(err); | |
} | |
if (!old_dir.node_ops.rename) { | |
throw new FS.ErrnoError(1); | |
} | |
if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) { | |
throw new FS.ErrnoError(16); | |
} | |
// if we are going to change the parent, check write permissions | |
if (new_dir !== old_dir) { | |
err = FS.nodePermissions(old_dir, 'w'); | |
if (err) { | |
throw new FS.ErrnoError(err); | |
} | |
} | |
try { | |
if (FS.trackingDelegate['willMovePath']) { | |
FS.trackingDelegate['willMovePath'](old_path, new_path); | |
} | |
} catch(e) { | |
console.log("FS.trackingDelegate['willMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message); | |
} | |
// remove the node from the lookup hash | |
FS.hashRemoveNode(old_node); | |
// do the underlying fs rename | |
try { | |
old_dir.node_ops.rename(old_node, new_dir, new_name); | |
} catch (e) { | |
throw e; | |
} finally { | |
// add the node back to the hash (in case node_ops.rename | |
// changed its name) | |
FS.hashAddNode(old_node); | |
} | |
try { | |
if (FS.trackingDelegate['onMovePath']) FS.trackingDelegate['onMovePath'](old_path, new_path); | |
} catch(e) { | |
console.log("FS.trackingDelegate['onMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message); | |
} | |
},rmdir:function (path) { | |
var lookup = FS.lookupPath(path, { parent: true }); | |
var parent = lookup.node; | |
var name = PATH.basename(path); | |
var node = FS.lookupNode(parent, name); | |
var err = FS.mayDelete(parent, name, true); | |
if (err) { | |
throw new FS.ErrnoError(err); | |
} | |
if (!parent.node_ops.rmdir) { | |
throw new FS.ErrnoError(1); | |
} | |
if (FS.isMountpoint(node)) { | |
throw new FS.ErrnoError(16); | |
} | |
try { | |
if (FS.trackingDelegate['willDeletePath']) { | |
FS.trackingDelegate['willDeletePath'](path); | |
} | |
} catch(e) { | |
console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message); | |
} | |
parent.node_ops.rmdir(parent, name); | |
FS.destroyNode(node); | |
try { | |
if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path); | |
} catch(e) { | |
console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message); | |
} | |
},readdir:function (path) { | |
var lookup = FS.lookupPath(path, { follow: true }); | |
var node = lookup.node; | |
if (!node.node_ops.readdir) { | |
throw new FS.ErrnoError(20); | |
} | |
return node.node_ops.readdir(node); | |
},unlink:function (path) { | |
var lookup = FS.lookupPath(path, { parent: true }); | |
var parent = lookup.node; | |
var name = PATH.basename(path); | |
var node = FS.lookupNode(parent, name); | |
var err = FS.mayDelete(parent, name, false); | |
if (err) { | |
// According to POSIX, we should map EISDIR to EPERM, but | |
// we instead do what Linux does (and we must, as we use | |
// the musl linux libc). | |
throw new FS.ErrnoError(err); | |
} | |
if (!parent.node_ops.unlink) { | |
throw new FS.ErrnoError(1); | |
} | |
if (FS.isMountpoint(node)) { | |
throw new FS.ErrnoError(16); | |
} | |
try { | |
if (FS.trackingDelegate['willDeletePath']) { | |
FS.trackingDelegate['willDeletePath'](path); | |
} | |
} catch(e) { | |
console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message); | |
} | |
parent.node_ops.unlink(parent, name); | |
FS.destroyNode(node); | |
try { | |
if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path); | |
} catch(e) { | |
console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message); | |
} | |
},readlink:function (path) { | |
var lookup = FS.lookupPath(path); | |
var link = lookup.node; | |
if (!link) { | |
throw new FS.ErrnoError(2); | |
} | |
if (!link.node_ops.readlink) { | |
throw new FS.ErrnoError(22); | |
} | |
return PATH.resolve(FS.getPath(link.parent), link.node_ops.readlink(link)); | |
},stat:function (path, dontFollow) { | |
var lookup = FS.lookupPath(path, { follow: !dontFollow }); | |
var node = lookup.node; | |
if (!node) { | |
throw new FS.ErrnoError(2); | |
} | |
if (!node.node_ops.getattr) { | |
throw new FS.ErrnoError(1); | |
} | |
return node.node_ops.getattr(node); | |
},lstat:function (path) { | |
return FS.stat(path, true); | |
},chmod:function (path, mode, dontFollow) { | |
var node; | |
if (typeof path === 'string') { | |
var lookup = FS.lookupPath(path, { follow: !dontFollow }); | |
node = lookup.node; | |
} else { | |
node = path; | |
} | |
if (!node.node_ops.setattr) { | |
throw new FS.ErrnoError(1); | |
} | |
node.node_ops.setattr(node, { | |
mode: (mode & 4095) | (node.mode & ~4095), | |
timestamp: Date.now() | |
}); | |
},lchmod:function (path, mode) { | |
FS.chmod(path, mode, true); | |
},fchmod:function (fd, mode) { | |
var stream = FS.getStream(fd); | |
if (!stream) { | |
throw new FS.ErrnoError(9); | |
} | |
FS.chmod(stream.node, mode); | |
},chown:function (path, uid, gid, dontFollow) { | |
var node; | |
if (typeof path === 'string') { | |
var lookup = FS.lookupPath(path, { follow: !dontFollow }); | |
node = lookup.node; | |
} else { | |
node = path; | |
} | |
if (!node.node_ops.setattr) { | |
throw new FS.ErrnoError(1); | |
} | |
node.node_ops.setattr(node, { | |
timestamp: Date.now() | |
// we ignore the uid / gid for now | |
}); | |
},lchown:function (path, uid, gid) { | |
FS.chown(path, uid, gid, true); | |
},fchown:function (fd, uid, gid) { | |
var stream = FS.getStream(fd); | |
if (!stream) { | |
throw new FS.ErrnoError(9); | |
} | |
FS.chown(stream.node, uid, gid); | |
},truncate:function (path, len) { | |
if (len < 0) { | |
throw new FS.ErrnoError(22); | |
} | |
var node; | |
if (typeof path === 'string') { | |
var lookup = FS.lookupPath(path, { follow: true }); | |
node = lookup.node; | |
} else { | |
node = path; | |
} | |
if (!node.node_ops.setattr) { | |
throw new FS.ErrnoError(1); | |
} | |
if (FS.isDir(node.mode)) { | |
throw new FS.ErrnoError(21); | |
} | |
if (!FS.isFile(node.mode)) { | |
throw new FS.ErrnoError(22); | |
} | |
var err = FS.nodePermissions(node, 'w'); | |
if (err) { | |
throw new FS.ErrnoError(err); | |
} | |
node.node_ops.setattr(node, { | |
size: len, | |
timestamp: Date.now() | |
}); | |
},ftruncate:function (fd, len) { | |
var stream = FS.getStream(fd); | |
if (!stream) { | |
throw new FS.ErrnoError(9); | |
} | |
if ((stream.flags & 2097155) === 0) { | |
throw new FS.ErrnoError(22); | |
} | |
FS.truncate(stream.node, len); | |
},utime:function (path, atime, mtime) { | |
var lookup = FS.lookupPath(path, { follow: true }); | |
var node = lookup.node; | |
node.node_ops.setattr(node, { | |
timestamp: Math.max(atime, mtime) | |
}); | |
},open:function (path, flags, mode, fd_start, fd_end) { | |
if (path === "") { | |
throw new FS.ErrnoError(2); | |
} | |
flags = typeof flags === 'string' ? FS.modeStringToFlags(flags) : flags; | |
mode = typeof mode === 'undefined' ? 438 /* 0666 */ : mode; | |
if ((flags & 64)) { | |
mode = (mode & 4095) | 32768; | |
} else { | |
mode = 0; | |
} | |
var node; | |
if (typeof path === 'object') { | |
node = path; | |
} else { | |
path = PATH.normalize(path); | |
try { | |
var lookup = FS.lookupPath(path, { | |
follow: !(flags & 131072) | |
}); | |
node = lookup.node; | |
} catch (e) { | |
// ignore | |
} | |
} | |
// perhaps we need to create the node | |
var created = false; | |
if ((flags & 64)) { | |
if (node) { | |
// if O_CREAT and O_EXCL are set, error out if the node already exists | |
if ((flags & 128)) { | |
throw new FS.ErrnoError(17); | |
} | |
} else { | |
// node doesn't exist, try to create it | |
node = FS.mknod(path, mode, 0); | |
created = true; | |
} | |
} | |
if (!node) { | |
throw new FS.ErrnoError(2); | |
} | |
// can't truncate a device | |
if (FS.isChrdev(node.mode)) { | |
flags &= ~512; | |
} | |
// if asked only for a directory, then this must be one | |
if ((flags & 65536) && !FS.isDir(node.mode)) { | |
throw new FS.ErrnoError(20); | |
} | |
// check permissions, if this is not a file we just created now (it is ok to | |
// create and write to a file with read-only permissions; it is read-only | |
// for later use) | |
if (!created) { | |
var err = FS.mayOpen(node, flags); | |
if (err) { | |
throw new FS.ErrnoError(err); | |
} | |
} | |
// do truncation if necessary | |
if ((flags & 512)) { | |
FS.truncate(node, 0); | |
} | |
// we've already handled these, don't pass down to the underlying vfs | |
flags &= ~(128 | 512); | |
// register the stream with the filesystem | |
var stream = FS.createStream({ | |
node: node, | |
path: FS.getPath(node), // we want the absolute path to the node | |
flags: flags, | |
seekable: true, | |
position: 0, | |
stream_ops: node.stream_ops, | |
// used by the file family libc calls (fopen, fwrite, ferror, etc.) | |
ungotten: [], | |
error: false | |
}, fd_start, fd_end); | |
// call the new stream's open function | |
if (stream.stream_ops.open) { | |
stream.stream_ops.open(stream); | |
} | |
if (Module['logReadFiles'] && !(flags & 1)) { | |
if (!FS.readFiles) FS.readFiles = {}; | |
if (!(path in FS.readFiles)) { | |
FS.readFiles[path] = 1; | |
console.log("FS.trackingDelegate error on read file: " + path); | |
} | |
} | |
try { | |
if (FS.trackingDelegate['onOpenFile']) { | |
var trackingFlags = 0; | |
if ((flags & 2097155) !== 1) { | |
trackingFlags |= FS.tracking.openFlags.READ; | |
} | |
if ((flags & 2097155) !== 0) { | |
trackingFlags |= FS.tracking.openFlags.WRITE; | |
} | |
FS.trackingDelegate['onOpenFile'](path, trackingFlags); | |
} | |
} catch(e) { | |
console.log("FS.trackingDelegate['onOpenFile']('"+path+"', flags) threw an exception: " + e.message); | |
} | |
return stream; | |
},close:function (stream) { | |
if (FS.isClosed(stream)) { | |
throw new FS.ErrnoError(9); | |
} | |
if (stream.getdents) stream.getdents = null; // free readdir state | |
try { | |
if (stream.stream_ops.close) { | |
stream.stream_ops.close(stream); | |
} | |
} catch (e) { | |
throw e; | |
} finally { | |
FS.closeStream(stream.fd); | |
} | |
stream.fd = null; | |
},isClosed:function (stream) { | |
return stream.fd === null; | |
},llseek:function (stream, offset, whence) { | |
if (FS.isClosed(stream)) { | |
throw new FS.ErrnoError(9); | |
} | |
if (!stream.seekable || !stream.stream_ops.llseek) { | |
throw new FS.ErrnoError(29); | |
} | |
stream.position = stream.stream_ops.llseek(stream, offset, whence); | |
stream.ungotten = []; | |
return stream.position; | |
},read:function (stream, buffer, offset, length, position) { | |
if (length < 0 || position < 0) { | |
throw new FS.ErrnoError(22); | |
} | |
if (FS.isClosed(stream)) { | |
throw new FS.ErrnoError(9); | |
} | |
if ((stream.flags & 2097155) === 1) { | |
throw new FS.ErrnoError(9); | |
} | |
if (FS.isDir(stream.node.mode)) { | |
throw new FS.ErrnoError(21); | |
} | |
if (!stream.stream_ops.read) { | |
throw new FS.ErrnoError(22); | |
} | |
var seeking = typeof position !== 'undefined'; | |
if (!seeking) { | |
position = stream.position; | |
} else if (!stream.seekable) { | |
throw new FS.ErrnoError(29); | |
} | |
var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position); | |
if (!seeking) stream.position += bytesRead; | |
return bytesRead; | |
},write:function (stream, buffer, offset, length, position, canOwn) { | |
if (length < 0 || position < 0) { | |
throw new FS.ErrnoError(22); | |
} | |
if (FS.isClosed(stream)) { | |
throw new FS.ErrnoError(9); | |
} | |
if ((stream.flags & 2097155) === 0) { | |
throw new FS.ErrnoError(9); | |
} | |
if (FS.isDir(stream.node.mode)) { | |
throw new FS.ErrnoError(21); | |
} | |
if (!stream.stream_ops.write) { | |
throw new FS.ErrnoError(22); | |
} | |
if (stream.flags & 1024) { | |
// seek to the end before writing in append mode | |
FS.llseek(stream, 0, 2); | |
} | |
var seeking = typeof position !== 'undefined'; | |
if (!seeking) { | |
position = stream.position; | |
} else if (!stream.seekable) { | |
throw new FS.ErrnoError(29); | |
} | |
var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn); | |
if (!seeking) stream.position += bytesWritten; | |
try { | |
if (stream.path && FS.trackingDelegate['onWriteToFile']) FS.trackingDelegate['onWriteToFile'](stream.path); | |
} catch(e) { | |
console.log("FS.trackingDelegate['onWriteToFile']('"+path+"') threw an exception: " + e.message); | |
} | |
return bytesWritten; | |
},allocate:function (stream, offset, length) { | |
if (FS.isClosed(stream)) { | |
throw new FS.ErrnoError(9); | |
} | |
if (offset < 0 || length <= 0) { | |
throw new FS.ErrnoError(22); | |
} | |
if ((stream.flags & 2097155) === 0) { | |
throw new FS.ErrnoError(9); | |
} | |
if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) { | |
throw new FS.ErrnoError(19); | |
} | |
if (!stream.stream_ops.allocate) { | |
throw new FS.ErrnoError(95); | |
} | |
stream.stream_ops.allocate(stream, offset, length); | |
},mmap:function (stream, buffer, offset, length, position, prot, flags) { | |
// TODO if PROT is PROT_WRITE, make sure we have write access | |
if ((stream.flags & 2097155) === 1) { | |
throw new FS.ErrnoError(13); | |
} | |
if (!stream.stream_ops.mmap) { | |
throw new FS.ErrnoError(19); | |
} | |
return stream.stream_ops.mmap(stream, buffer, offset, length, position, prot, flags); | |
},msync:function (stream, buffer, offset, length, mmapFlags) { | |
if (!stream || !stream.stream_ops.msync) { | |
return 0; | |
} | |
return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags); | |
},munmap:function (stream) { | |
return 0; | |
},ioctl:function (stream, cmd, arg) { | |
if (!stream.stream_ops.ioctl) { | |
throw new FS.ErrnoError(25); | |
} | |
return stream.stream_ops.ioctl(stream, cmd, arg); | |
},readFile:function (path, opts) { | |
opts = opts || {}; | |
opts.flags = opts.flags || 'r'; | |
opts.encoding = opts.encoding || 'binary'; | |
if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') { | |
throw new Error('Invalid encoding type "' + opts.encoding + '"'); | |
} | |
var ret; | |
var stream = FS.open(path, opts.flags); | |
var stat = FS.stat(path); | |
var length = stat.size; | |
var buf = new Uint8Array(length); | |
FS.read(stream, buf, 0, length, 0); | |
if (opts.encoding === 'utf8') { | |
ret = UTF8ArrayToString(buf, 0); | |
} else if (opts.encoding === 'binary') { | |
ret = buf; | |
} | |
FS.close(stream); | |
return ret; | |
},writeFile:function (path, data, opts) { | |
opts = opts || {}; | |
opts.flags = opts.flags || 'w'; | |
var stream = FS.open(path, opts.flags, opts.mode); | |
if (typeof data === 'string') { | |
var buf = new Uint8Array(lengthBytesUTF8(data)+1); | |
var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length); | |
FS.write(stream, buf, 0, actualNumBytes, undefined, opts.canOwn); | |
} else if (ArrayBuffer.isView(data)) { | |
FS.write(stream, data, 0, data.byteLength, undefined, opts.canOwn); | |
} else { | |
throw new Error('Unsupported data type'); | |
} | |
FS.close(stream); | |
},cwd:function () { | |
return FS.currentPath; | |
},chdir:function (path) { | |
var lookup = FS.lookupPath(path, { follow: true }); | |
if (lookup.node === null) { | |
throw new FS.ErrnoError(2); | |
} | |
if (!FS.isDir(lookup.node.mode)) { | |
throw new FS.ErrnoError(20); | |
} | |
var err = FS.nodePermissions(lookup.node, 'x'); | |
if (err) { | |
throw new FS.ErrnoError(err); | |
} | |
FS.currentPath = lookup.path; | |
},createDefaultDirectories:function () { | |
FS.mkdir('/tmp'); | |
FS.mkdir('/home'); | |
FS.mkdir('/home/web_user'); | |
},createDefaultDevices:function () { | |
// create /dev | |
FS.mkdir('/dev'); | |
// setup /dev/null | |
FS.registerDevice(FS.makedev(1, 3), { | |
read: function() { return 0; }, | |
write: function(stream, buffer, offset, length, pos) { return length; } | |
}); | |
FS.mkdev('/dev/null', FS.makedev(1, 3)); | |
// setup /dev/tty and /dev/tty1 | |
// stderr needs to print output using Module['printErr'] | |
// so we register a second tty just for it. | |
TTY.register(FS.makedev(5, 0), TTY.default_tty_ops); | |
TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops); | |
FS.mkdev('/dev/tty', FS.makedev(5, 0)); | |
FS.mkdev('/dev/tty1', FS.makedev(6, 0)); | |
// setup /dev/[u]random | |
var random_device; | |
if (typeof crypto !== 'undefined') { | |
// for modern web browsers | |
var randomBuffer = new Uint8Array(1); | |
random_device = function() { crypto.getRandomValues(randomBuffer); return randomBuffer[0]; }; | |
} else if (ENVIRONMENT_IS_NODE) { | |
// for nodejs | |
random_device = function() { return require('crypto')['randomBytes'](1)[0]; }; | |
} else { | |
// default for ES5 platforms | |
random_device = function() { abort("random_device"); /*Math.random() is not safe for random number generation, so this fallback random_device implementation aborts... see kripken/emscripten/pull/7096 */ }; | |
} | |
FS.createDevice('/dev', 'random', random_device); | |
FS.createDevice('/dev', 'urandom', random_device); | |
// we're not going to emulate the actual shm device, | |
// just create the tmp dirs that reside in it commonly | |
FS.mkdir('/dev/shm'); | |
FS.mkdir('/dev/shm/tmp'); | |
},createSpecialDirectories:function () { | |
// create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the name of the stream for fd 6 (see test_unistd_ttyname) | |
FS.mkdir('/proc'); | |
FS.mkdir('/proc/self'); | |
FS.mkdir('/proc/self/fd'); | |
FS.mount({ | |
mount: function() { | |
var node = FS.createNode('/proc/self', 'fd', 16384 | 511 /* 0777 */, 73); | |
node.node_ops = { | |
lookup: function(parent, name) { | |
var fd = +name; | |
var stream = FS.getStream(fd); | |
if (!stream) throw new FS.ErrnoError(9); | |
var ret = { | |
parent: null, | |
mount: { mountpoint: 'fake' }, | |
node_ops: { readlink: function() { return stream.path } } | |
}; | |
ret.parent = ret; // make it look like a simple root node | |
return ret; | |
} | |
}; | |
return node; | |
} | |
}, {}, '/proc/self/fd'); | |
},createStandardStreams:function () { | |
// TODO deprecate the old functionality of a single | |
// input / output callback and that utilizes FS.createDevice | |
// and instead require a unique set of stream ops | |
// by default, we symlink the standard streams to the | |
// default tty devices. however, if the standard streams | |
// have been overwritten we create a unique device for | |
// them instead. | |
if (Module['stdin']) { | |
FS.createDevice('/dev', 'stdin', Module['stdin']); | |
} else { | |
FS.symlink('/dev/tty', '/dev/stdin'); | |
} | |
if (Module['stdout']) { | |
FS.createDevice('/dev', 'stdout', null, Module['stdout']); | |
} else { | |
FS.symlink('/dev/tty', '/dev/stdout'); | |
} | |
if (Module['stderr']) { | |
FS.createDevice('/dev', 'stderr', null, Module['stderr']); | |
} else { | |
FS.symlink('/dev/tty1', '/dev/stderr'); | |
} | |
// open default streams for the stdin, stdout and stderr devices | |
var stdin = FS.open('/dev/stdin', 'r'); | |
assert(stdin.fd === 0, 'invalid handle for stdin (' + stdin.fd + ')'); | |
var stdout = FS.open('/dev/stdout', 'w'); | |
assert(stdout.fd === 1, 'invalid handle for stdout (' + stdout.fd + ')'); | |
var stderr = FS.open('/dev/stderr', 'w'); | |
assert(stderr.fd === 2, 'invalid handle for stderr (' + stderr.fd + ')'); | |
},ensureErrnoError:function () { | |
if (FS.ErrnoError) return; | |
FS.ErrnoError = function ErrnoError(errno, node) { | |
this.node = node; | |
this.setErrno = function(errno) { | |
this.errno = errno; | |
for (var key in ERRNO_CODES) { | |
if (ERRNO_CODES[key] === errno) { | |
this.code = key; | |
break; | |
} | |
} | |
}; | |
this.setErrno(errno); | |
this.message = ERRNO_MESSAGES[errno]; | |
// Node.js compatibility: assigning on this.stack fails on Node 4 (but fixed on Node 8) | |
if (this.stack) Object.defineProperty(this, "stack", { value: (new Error).stack, writable: true }); | |
if (this.stack) this.stack = demangleAll(this.stack); | |
}; | |
FS.ErrnoError.prototype = new Error(); | |
FS.ErrnoError.prototype.constructor = FS.ErrnoError; | |
// Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info) | |
[2].forEach(function(code) { | |
FS.genericErrors[code] = new FS.ErrnoError(code); | |
FS.genericErrors[code].stack = '<generic error, no stack>'; | |
}); | |
},staticInit:function () { | |
FS.ensureErrnoError(); | |
FS.nameTable = new Array(4096); | |
FS.mount(MEMFS, {}, '/'); | |
FS.createDefaultDirectories(); | |
FS.createDefaultDevices(); | |
FS.createSpecialDirectories(); | |
FS.filesystems = { | |
'MEMFS': MEMFS, | |
'IDBFS': IDBFS, | |
'NODEFS': NODEFS, | |
'WORKERFS': WORKERFS, | |
}; | |
},init:function (input, output, error) { | |
assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)'); | |
FS.init.initialized = true; | |
FS.ensureErrnoError(); | |
// Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here | |
Module['stdin'] = input || Module['stdin']; | |
Module['stdout'] = output || Module['stdout']; | |
Module['stderr'] = error || Module['stderr']; | |
FS.createStandardStreams(); | |
},quit:function () { | |
FS.init.initialized = false; | |
// force-flush all streams, so we get musl std streams printed out | |
var fflush = Module['_fflush']; | |
if (fflush) fflush(0); | |
// close all of our streams | |
for (var i = 0; i < FS.streams.length; i++) { | |
var stream = FS.streams[i]; | |
if (!stream) { | |
continue; | |
} | |
FS.close(stream); | |
} | |
},getMode:function (canRead, canWrite) { | |
var mode = 0; | |
if (canRead) mode |= 292 | 73; | |
if (canWrite) mode |= 146; | |
return mode; | |
},joinPath:function (parts, forceRelative) { | |
var path = PATH.join.apply(null, parts); | |
if (forceRelative && path[0] == '/') path = path.substr(1); | |
return path; | |
},absolutePath:function (relative, base) { | |
return PATH.resolve(base, relative); | |
},standardizePath:function (path) { | |
return PATH.normalize(path); | |
},findObject:function (path, dontResolveLastLink) { | |
var ret = FS.analyzePath(path, dontResolveLastLink); | |
if (ret.exists) { | |
return ret.object; | |
} else { | |
___setErrNo(ret.error); | |
return null; | |
} | |
},analyzePath:function (path, dontResolveLastLink) { | |
// operate from within the context of the symlink's target | |
try { | |
var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink }); | |
path = lookup.path; | |
} catch (e) { | |
} | |
var ret = { | |
isRoot: false, exists: false, error: 0, name: null, path: null, object: null, | |
parentExists: false, parentPath: null, parentObject: null | |
}; | |
try { | |
var lookup = FS.lookupPath(path, { parent: true }); | |
ret.parentExists = true; | |
ret.parentPath = lookup.path; | |
ret.parentObject = lookup.node; | |
ret.name = PATH.basename(path); | |
lookup = FS.lookupPath(path, { follow: !dontResolveLastLink }); | |
ret.exists = true; | |
ret.path = lookup.path; | |
ret.object = lookup.node; | |
ret.name = lookup.node.name; | |
ret.isRoot = lookup.path === '/'; | |
} catch (e) { | |
ret.error = e.errno; | |
}; | |
return ret; | |
},createFolder:function (parent, name, canRead, canWrite) { | |
var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); | |
var mode = FS.getMode(canRead, canWrite); | |
return FS.mkdir(path, mode); | |
},createPath:function (parent, path, canRead, canWrite) { | |
parent = typeof parent === 'string' ? parent : FS.getPath(parent); | |
var parts = path.split('/').reverse(); | |
while (parts.length) { | |
var part = parts.pop(); | |
if (!part) continue; | |
var current = PATH.join2(parent, part); | |
try { | |
FS.mkdir(current); | |
} catch (e) { | |
// ignore EEXIST | |
} | |
parent = current; | |
} | |
return current; | |
},createFile:function (parent, name, properties, canRead, canWrite) { | |
var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); | |
var mode = FS.getMode(canRead, canWrite); | |
return FS.create(path, mode); | |
},createDataFile:function (parent, name, data, canRead, canWrite, canOwn) { | |
var path = name ? PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name) : parent; | |
var mode = FS.getMode(canRead, canWrite); | |
var node = FS.create(path, mode); | |
if (data) { | |
if (typeof data === 'string') { | |
var arr = new Array(data.length); | |
for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i); | |
data = arr; | |
} | |
// make sure we can write to the file | |
FS.chmod(node, mode | 146); | |
var stream = FS.open(node, 'w'); | |
FS.write(stream, data, 0, data.length, 0, canOwn); | |
FS.close(stream); | |
FS.chmod(node, mode); | |
} | |
return node; | |
},createDevice:function (parent, name, input, output) { | |
var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); | |
var mode = FS.getMode(!!input, !!output); | |
if (!FS.createDevice.major) FS.createDevice.major = 64; | |
var dev = FS.makedev(FS.createDevice.major++, 0); | |
// Create a fake device that a set of stream ops to emulate | |
// the old behavior. | |
FS.registerDevice(dev, { | |
open: function(stream) { | |
stream.seekable = false; | |
}, | |
close: function(stream) { | |
// flush any pending line data | |
if (output && output.buffer && output.buffer.length) { | |
output(10); | |
} | |
}, | |
read: function(stream, buffer, offset, length, pos /* ignored */) { | |
var bytesRead = 0; | |
for (var i = 0; i < length; i++) { | |
var result; | |
try { | |
result = input(); | |
} catch (e) { | |
throw new FS.ErrnoError(5); | |
} | |
if (result === undefined && bytesRead === 0) { | |
throw new FS.ErrnoError(11); | |
} | |
if (result === null || result === undefined) break; | |
bytesRead++; | |
buffer[offset+i] = result; | |
} | |
if (bytesRead) { | |
stream.node.timestamp = Date.now(); | |
} | |
return bytesRead; | |
}, | |
write: function(stream, buffer, offset, length, pos) { | |
for (var i = 0; i < length; i++) { | |
try { | |
output(buffer[offset+i]); | |
} catch (e) { | |
throw new FS.ErrnoError(5); | |
} | |
} | |
if (length) { | |
stream.node.timestamp = Date.now(); | |
} | |
return i; | |
} | |
}); | |
return FS.mkdev(path, mode, dev); | |
},createLink:function (parent, name, target, canRead, canWrite) { | |
var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); | |
return FS.symlink(target, path); | |
},forceLoadFile:function (obj) { | |
if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true; | |
var success = true; | |
if (typeof XMLHttpRequest !== 'undefined') { | |
throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread."); | |
} else if (Module['read']) { | |
// Command-line. | |
try { | |
// WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as | |
// read() will try to parse UTF8. | |
obj.contents = intArrayFromString(Module['read'](obj.url), true); | |
obj.usedBytes = obj.contents.length; | |
} catch (e) { | |
success = false; | |
} | |
} else { | |
throw new Error('Cannot load without read() or XMLHttpRequest.'); | |
} | |
if (!success) ___setErrNo(5); | |
return success; | |
},createLazyFile:function (parent, name, url, canRead, canWrite) { | |
// Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse. | |
function LazyUint8Array() { | |
this.lengthKnown = false; | |
this.chunks = []; // Loaded chunks. Index is the chunk number | |
} | |
LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) { | |
if (idx > this.length-1 || idx < 0) { | |
return undefined; | |
} | |
var chunkOffset = idx % this.chunkSize; | |
var chunkNum = (idx / this.chunkSize)|0; | |
return this.getter(chunkNum)[chunkOffset]; | |
} | |
LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) { | |
this.getter = getter; | |
} | |
LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() { | |
// Find length | |
var xhr = new XMLHttpRequest(); | |
xhr.open('HEAD', url, false); | |
xhr.send(null); | |
if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); | |
var datalength = Number(xhr.getResponseHeader("Content-length")); | |
var header; | |
var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes"; | |
var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip"; | |
var chunkSize = 1024*1024; // Chunk size in bytes | |
if (!hasByteServing) chunkSize = datalength; | |
// Function to get a range from the remote URL. | |
var doXHR = (function(from, to) { | |
if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!"); | |
if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!"); | |
// TODO: Use mozResponseArrayBuffer, responseStream, etc. if available. | |
var xhr = new XMLHttpRequest(); | |
xhr.open('GET', url, false); | |
if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to); | |
// Some hints to the browser that we want binary data. | |
if (typeof Uint8Array != 'undefined') xhr.responseType = 'arraybuffer'; | |
if (xhr.overrideMimeType) { | |
xhr.overrideMimeType('text/plain; charset=x-user-defined'); | |
} | |
xhr.send(null); | |
if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); | |
if (xhr.response !== undefined) { | |
return new Uint8Array(xhr.response || []); | |
} else { | |
return intArrayFromString(xhr.responseText || '', true); | |
} | |
}); | |
var lazyArray = this; | |
lazyArray.setDataGetter(function(chunkNum) { | |
var start = chunkNum * chunkSize; | |
var end = (chunkNum+1) * chunkSize - 1; // including this byte | |
end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block | |
if (typeof(lazyArray.chunks[chunkNum]) === "undefined") { | |
lazyArray.chunks[chunkNum] = doXHR(start, end); | |
} | |
if (typeof(lazyArray.chunks[chunkNum]) === "undefined") throw new Error("doXHR failed!"); | |
return lazyArray.chunks[chunkNum]; | |
}); | |
if (usesGzip || !datalength) { | |
// if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length | |
chunkSize = datalength = 1; // this will force getter(0)/doXHR do download the whole file | |
datalength = this.getter(0).length; | |
chunkSize = datalength; | |
console.log("LazyFiles on gzip forces download of the whole file when length is accessed"); | |
} | |
this._length = datalength; | |
this._chunkSize = chunkSize; | |
this.lengthKnown = true; | |
} | |
if (typeof XMLHttpRequest !== 'undefined') { | |
if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc'; | |
var lazyArray = new LazyUint8Array(); | |
Object.defineProperties(lazyArray, { | |
length: { | |
get: function() { | |
if(!this.lengthKnown) { | |
this.cacheLength(); | |
} | |
return this._length; | |
} | |
}, | |
chunkSize: { | |
get: function() { | |
if(!this.lengthKnown) { | |
this.cacheLength(); | |
} | |
return this._chunkSize; | |
} | |
} | |
}); | |
var properties = { isDevice: false, contents: lazyArray }; | |
} else { | |
var properties = { isDevice: false, url: url }; | |
} | |
var node = FS.createFile(parent, name, properties, canRead, canWrite); | |
// This is a total hack, but I want to get this lazy file code out of the | |
// core of MEMFS. If we want to keep this lazy file concept I feel it should | |
// be its own thin LAZYFS proxying calls to MEMFS. | |
if (properties.contents) { | |
node.contents = properties.contents; | |
} else if (properties.url) { | |
node.contents = null; | |
node.url = properties.url; | |
} | |
// Add a function that defers querying the file size until it is asked the first time. | |
Object.defineProperties(node, { | |
usedBytes: { | |
get: function() { return this.contents.length; } | |
} | |
}); | |
// override each stream op with one that tries to force load the lazy file first | |
var stream_ops = {}; | |
var keys = Object.keys(node.stream_ops); | |
keys.forEach(function(key) { | |
var fn = node.stream_ops[key]; | |
stream_ops[key] = function forceLoadLazyFile() { | |
if (!FS.forceLoadFile(node)) { | |
throw new FS.ErrnoError(5); | |
} | |
return fn.apply(null, arguments); | |
}; | |
}); | |
// use a custom read function | |
stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) { | |
if (!FS.forceLoadFile(node)) { | |
throw new FS.ErrnoError(5); | |
} | |
var contents = stream.node.contents; | |
if (position >= contents.length) | |
return 0; | |
var size = Math.min(contents.length - position, length); | |
assert(size >= 0); | |
if (contents.slice) { // normal array | |
for (var i = 0; i < size; i++) { | |
buffer[offset + i] = contents[position + i]; | |
} | |
} else { | |
for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR | |
buffer[offset + i] = contents.get(position + i); | |
} | |
} | |
return size; | |
}; | |
node.stream_ops = stream_ops; | |
return node; | |
},createPreloadedFile:function (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) { | |
Browser.init(); // XXX perhaps this method should move onto Browser? | |
// TODO we should allow people to just pass in a complete filename instead | |
// of parent and name being that we just join them anyways | |
var fullname = name ? PATH.resolve(PATH.join2(parent, name)) : parent; | |
var dep = getUniqueRunDependency('cp ' + fullname); // might have several active requests for the same fullname | |
function processData(byteArray) { | |
function finish(byteArray) { | |
if (preFinish) preFinish(); | |
if (!dontCreateFile) { | |
FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn); | |
} | |
if (onload) onload(); | |
removeRunDependency(dep); | |
} | |
var handled = false; | |
Module['preloadPlugins'].forEach(function(plugin) { | |
if (handled) return; | |
if (plugin['canHandle'](fullname)) { | |
plugin['handle'](byteArray, fullname, finish, function() { | |
if (onerror) onerror(); | |
removeRunDependency(dep); | |
}); | |
handled = true; | |
} | |
}); | |
if (!handled) finish(byteArray); | |
} | |
addRunDependency(dep); | |
if (typeof url == 'string') { | |
Browser.asyncLoad(url, function(byteArray) { | |
processData(byteArray); | |
}, onerror); | |
} else { | |
processData(url); | |
} | |
},indexedDB:function () { | |
return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB; | |
},DB_NAME:function () { | |
return 'EM_FS_' + window.location.pathname; | |
},DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:function (paths, onload, onerror) { | |
onload = onload || function(){}; | |
onerror = onerror || function(){}; | |
var indexedDB = FS.indexedDB(); | |
try { | |
var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION); | |
} catch (e) { | |
return onerror(e); | |
} | |
openRequest.onupgradeneeded = function openRequest_onupgradeneeded() { | |
console.log('creating db'); | |
var db = openRequest.result; | |
db.createObjectStore(FS.DB_STORE_NAME); | |
}; | |
openRequest.onsuccess = function openRequest_onsuccess() { | |
var db = openRequest.result; | |
var transaction = db.transaction([FS.DB_STORE_NAME], 'readwrite'); | |
var files = transaction.objectStore(FS.DB_STORE_NAME); | |
var ok = 0, fail = 0, total = paths.length; | |
function finish() { | |
if (fail == 0) onload(); else onerror(); | |
} | |
paths.forEach(function(path) { | |
var putRequest = files.put(FS.analyzePath(path).object.contents, path); | |
putRequest.onsuccess = function putRequest_onsuccess() { ok++; if (ok + fail == total) finish() }; | |
putRequest.onerror = function putRequest_onerror() { fail++; if (ok + fail == total) finish() }; | |
}); | |
transaction.onerror = onerror; | |
}; | |
openRequest.onerror = onerror; | |
},loadFilesFromDB:function (paths, onload, onerror) { | |
onload = onload || function(){}; | |
onerror = onerror || function(){}; | |
var indexedDB = FS.indexedDB(); | |
try { | |
var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION); | |
} catch (e) { | |
return onerror(e); | |
} | |
openRequest.onupgradeneeded = onerror; // no database to load from | |
openRequest.onsuccess = function openRequest_onsuccess() { | |
var db = openRequest.result; | |
try { | |
var transaction = db.transaction([FS.DB_STORE_NAME], 'readonly'); | |
} catch(e) { | |
onerror(e); | |
return; | |
} | |
var files = transaction.objectStore(FS.DB_STORE_NAME); | |
var ok = 0, fail = 0, total = paths.length; | |
function finish() { | |
if (fail == 0) onload(); else onerror(); | |
} | |
paths.forEach(function(path) { | |
var getRequest = files.get(path); | |
getRequest.onsuccess = function getRequest_onsuccess() { | |
if (FS.analyzePath(path).exists) { | |
FS.unlink(path); | |
} | |
FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true); | |
ok++; | |
if (ok + fail == total) finish(); | |
}; | |
getRequest.onerror = function getRequest_onerror() { fail++; if (ok + fail == total) finish() }; | |
}); | |
transaction.onerror = onerror; | |
}; | |
openRequest.onerror = onerror; | |
}};var SYSCALLS={DEFAULT_POLLMASK:5,mappings:{},umask:511,calculateAt:function (dirfd, path) { | |
if (path[0] !== '/') { | |
// relative path | |
var dir; | |
if (dirfd === -100) { | |
dir = FS.cwd(); | |
} else { | |
var dirstream = FS.getStream(dirfd); | |
if (!dirstream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); | |
dir = dirstream.path; | |
} | |
path = PATH.join2(dir, path); | |
} | |
return path; | |
},doStat:function (func, path, buf) { | |
try { | |
var stat = func(path); | |
} catch (e) { | |
if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) { | |
// an error occurred while trying to look up the path; we should just report ENOTDIR | |
return -ERRNO_CODES.ENOTDIR; | |
} | |
throw e; | |
} | |
HEAP32[((buf)>>2)]=stat.dev; | |
HEAP32[(((buf)+(4))>>2)]=0; | |
HEAP32[(((buf)+(8))>>2)]=stat.ino; | |
HEAP32[(((buf)+(12))>>2)]=stat.mode; | |
HEAP32[(((buf)+(16))>>2)]=stat.nlink; | |
HEAP32[(((buf)+(20))>>2)]=stat.uid; | |
HEAP32[(((buf)+(24))>>2)]=stat.gid; | |
HEAP32[(((buf)+(28))>>2)]=stat.rdev; | |
HEAP32[(((buf)+(32))>>2)]=0; | |
HEAP32[(((buf)+(36))>>2)]=stat.size; | |
HEAP32[(((buf)+(40))>>2)]=4096; | |
HEAP32[(((buf)+(44))>>2)]=stat.blocks; | |
HEAP32[(((buf)+(48))>>2)]=(stat.atime.getTime() / 1000)|0; | |
HEAP32[(((buf)+(52))>>2)]=0; | |
HEAP32[(((buf)+(56))>>2)]=(stat.mtime.getTime() / 1000)|0; | |
HEAP32[(((buf)+(60))>>2)]=0; | |
HEAP32[(((buf)+(64))>>2)]=(stat.ctime.getTime() / 1000)|0; | |
HEAP32[(((buf)+(68))>>2)]=0; | |
HEAP32[(((buf)+(72))>>2)]=stat.ino; | |
return 0; | |
},doMsync:function (addr, stream, len, flags) { | |
var buffer = new Uint8Array(HEAPU8.subarray(addr, addr + len)); | |
FS.msync(stream, buffer, 0, len, flags); | |
},doMkdir:function (path, mode) { | |
// remove a trailing slash, if one - /a/b/ has basename of '', but | |
// we want to create b in the context of this function | |
path = PATH.normalize(path); | |
if (path[path.length-1] === '/') path = path.substr(0, path.length-1); | |
FS.mkdir(path, mode, 0); | |
return 0; | |
},doMknod:function (path, mode, dev) { | |
// we don't want this in the JS API as it uses mknod to create all nodes. | |
switch (mode & 61440) { | |
case 32768: | |
case 8192: | |
case 24576: | |
case 4096: | |
case 49152: | |
break; | |
default: return -ERRNO_CODES.EINVAL; | |
} | |
FS.mknod(path, mode, dev); | |
return 0; | |
},doReadlink:function (path, buf, bufsize) { | |
if (bufsize <= 0) return -ERRNO_CODES.EINVAL; | |
var ret = FS.readlink(path); | |
var len = Math.min(bufsize, lengthBytesUTF8(ret)); | |
var endChar = HEAP8[buf+len]; | |
stringToUTF8(ret, buf, bufsize+1); | |
// readlink is one of the rare functions that write out a C string, but does never append a null to the output buffer(!) | |
// stringToUTF8() always appends a null byte, so restore the character under the null byte after the write. | |
HEAP8[buf+len] = endChar; | |
return len; | |
},doAccess:function (path, amode) { | |
if (amode & ~7) { | |
// need a valid mode | |
return -ERRNO_CODES.EINVAL; | |
} | |
var node; | |
var lookup = FS.lookupPath(path, { follow: true }); | |
node = lookup.node; | |
var perms = ''; | |
if (amode & 4) perms += 'r'; | |
if (amode & 2) perms += 'w'; | |
if (amode & 1) perms += 'x'; | |
if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) { | |
return -ERRNO_CODES.EACCES; | |
} | |
return 0; | |
},doDup:function (path, flags, suggestFD) { | |
var suggest = FS.getStream(suggestFD); | |
if (suggest) FS.close(suggest); | |
return FS.open(path, flags, 0, suggestFD, suggestFD).fd; | |
},doReadv:function (stream, iov, iovcnt, offset) { | |
var ret = 0; | |
for (var i = 0; i < iovcnt; i++) { | |
var ptr = HEAP32[(((iov)+(i*8))>>2)]; | |
var len = HEAP32[(((iov)+(i*8 + 4))>>2)]; | |
var curr = FS.read(stream, HEAP8,ptr, len, offset); | |
if (curr < 0) return -1; | |
ret += curr; | |
if (curr < len) break; // nothing more to read | |
} | |
return ret; | |
},doWritev:function (stream, iov, iovcnt, offset) { | |
var ret = 0; | |
for (var i = 0; i < iovcnt; i++) { | |
var ptr = HEAP32[(((iov)+(i*8))>>2)]; | |
var len = HEAP32[(((iov)+(i*8 + 4))>>2)]; | |
var curr = FS.write(stream, HEAP8,ptr, len, offset); | |
if (curr < 0) return -1; | |
ret += curr; | |
} | |
return ret; | |
},varargs:0,get:function (varargs) { | |
SYSCALLS.varargs += 4; | |
var ret = HEAP32[(((SYSCALLS.varargs)-(4))>>2)]; | |
return ret; | |
},getStr:function () { | |
var ret = Pointer_stringify(SYSCALLS.get()); | |
return ret; | |
},getStreamFromFD:function () { | |
var stream = FS.getStream(SYSCALLS.get()); | |
if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); | |
return stream; | |
},getSocketFromFD:function () { | |
var socket = SOCKFS.getSocket(SYSCALLS.get()); | |
if (!socket) throw new FS.ErrnoError(ERRNO_CODES.EBADF); | |
return socket; | |
},getSocketAddress:function (allowNull) { | |
var addrp = SYSCALLS.get(), addrlen = SYSCALLS.get(); | |
if (allowNull && addrp === 0) return null; | |
var info = __read_sockaddr(addrp, addrlen); | |
if (info.errno) throw new FS.ErrnoError(info.errno); | |
info.addr = DNS.lookup_addr(info.addr) || info.addr; | |
return info; | |
},get64:function () { | |
var low = SYSCALLS.get(), high = SYSCALLS.get(); | |
if (low >= 0) assert(high === 0); | |
else assert(high === -1); | |
return low; | |
},getZero:function () { | |
assert(SYSCALLS.get() === 0); | |
}};function ___syscall140(which, varargs) {SYSCALLS.varargs = varargs; | |
try { | |
// llseek | |
var stream = SYSCALLS.getStreamFromFD(), offset_high = SYSCALLS.get(), offset_low = SYSCALLS.get(), result = SYSCALLS.get(), whence = SYSCALLS.get(); | |
// NOTE: offset_high is unused - Emscripten's off_t is 32-bit | |
var offset = offset_low; | |
FS.llseek(stream, offset, whence); | |
HEAP32[((result)>>2)]=stream.position; | |
if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state | |
return 0; | |
} catch (e) { | |
if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); | |
return -e.errno; | |
} | |
} | |
function ___syscall146(which, varargs) {SYSCALLS.varargs = varargs; | |
try { | |
// writev | |
var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get(); | |
return SYSCALLS.doWritev(stream, iov, iovcnt); | |
} catch (e) { | |
if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); | |
return -e.errno; | |
} | |
} | |
function ___syscall4(which, varargs) {SYSCALLS.varargs = varargs; | |
try { | |
// write | |
var stream = SYSCALLS.getStreamFromFD(), buf = SYSCALLS.get(), count = SYSCALLS.get(); | |
return FS.write(stream, HEAP8,buf, count); | |
} catch (e) { | |
if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); | |
return -e.errno; | |
} | |
} | |
function ___syscall54(which, varargs) {SYSCALLS.varargs = varargs; | |
try { | |
// ioctl | |
var stream = SYSCALLS.getStreamFromFD(), op = SYSCALLS.get(); | |
switch (op) { | |
case 21509: | |
case 21505: { | |
if (!stream.tty) return -ERRNO_CODES.ENOTTY; | |
return 0; | |
} | |
case 21510: | |
case 21511: | |
case 21512: | |
case 21506: | |
case 21507: | |
case 21508: { | |
if (!stream.tty) return -ERRNO_CODES.ENOTTY; | |
return 0; // no-op, not actually adjusting terminal settings | |
} | |
case 21519: { | |
if (!stream.tty) return -ERRNO_CODES.ENOTTY; | |
var argp = SYSCALLS.get(); | |
HEAP32[((argp)>>2)]=0; | |
return 0; | |
} | |
case 21520: { | |
if (!stream.tty) return -ERRNO_CODES.ENOTTY; | |
return -ERRNO_CODES.EINVAL; // not supported | |
} | |
case 21531: { | |
var argp = SYSCALLS.get(); | |
return FS.ioctl(stream, op, argp); | |
} | |
case 21523: { | |
// TODO: in theory we should write to the winsize struct that gets | |
// passed in, but for now musl doesn't read anything on it | |
if (!stream.tty) return -ERRNO_CODES.ENOTTY; | |
return 0; | |
} | |
case 21524: { | |
// TODO: technically, this ioctl call should change the window size. | |
// but, since emscripten doesn't have any concept of a terminal window | |
// yet, we'll just silently throw it away as we do TIOCGWINSZ | |
if (!stream.tty) return -ERRNO_CODES.ENOTTY; | |
return 0; | |
} | |
default: abort('bad ioctl syscall ' + op); | |
} | |
} catch (e) { | |
if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); | |
return -e.errno; | |
} | |
} | |
function ___syscall6(which, varargs) {SYSCALLS.varargs = varargs; | |
try { | |
// close | |
var stream = SYSCALLS.getStreamFromFD(); | |
FS.close(stream); | |
return 0; | |
} catch (e) { | |
if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); | |
return -e.errno; | |
} | |
} | |
function ___unlock() {} | |
function _abort() { | |
Module['abort'](); | |
} | |
function _dlopen(/* ... */) { | |
abort("To use dlopen, you need to use Emscripten's linking support, see https://github.com/kripken/emscripten/wiki/Linking"); | |
}function _dladdr() { | |
return _dlopen.apply(null, arguments) | |
} | |
var _emscripten_asm_const=true; | |
function _emscripten_set_main_loop_timing(mode, value) { | |
Browser.mainLoop.timingMode = mode; | |
Browser.mainLoop.timingValue = value; | |
if (!Browser.mainLoop.func) { | |
console.error('emscripten_set_main_loop_timing: Cannot set timing mode for main loop since a main loop does not exist! Call emscripten_set_main_loop first to set one up.'); | |
return 1; // Return non-zero on failure, can't set timing mode when there is no main loop. | |
} | |
if (mode == 0 /*EM_TIMING_SETTIMEOUT*/) { | |
Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setTimeout() { | |
var timeUntilNextTick = Math.max(0, Browser.mainLoop.tickStartTime + value - _emscripten_get_now())|0; | |
setTimeout(Browser.mainLoop.runner, timeUntilNextTick); // doing this each time means that on exception, we stop | |
}; | |
Browser.mainLoop.method = 'timeout'; | |
} else if (mode == 1 /*EM_TIMING_RAF*/) { | |
Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_rAF() { | |
Browser.requestAnimationFrame(Browser.mainLoop.runner); | |
}; | |
Browser.mainLoop.method = 'rAF'; | |
} else if (mode == 2 /*EM_TIMING_SETIMMEDIATE*/) { | |
if (typeof setImmediate === 'undefined') { | |
// Emulate setImmediate. (note: not a complete polyfill, we don't emulate clearImmediate() to keep code size to minimum, since not needed) | |
var setImmediates = []; | |
var emscriptenMainLoopMessageId = 'setimmediate'; | |
function Browser_setImmediate_messageHandler(event) { | |
// When called in current thread or Worker, the main loop ID is structured slightly different to accommodate for --proxy-to-worker runtime listening to Worker events, | |
// so check for both cases. | |
if (event.data === emscriptenMainLoopMessageId || event.data.target === emscriptenMainLoopMessageId) { | |
event.stopPropagation(); | |
setImmediates.shift()(); | |
} | |
} | |
addEventListener("message", Browser_setImmediate_messageHandler, true); | |
setImmediate = function Browser_emulated_setImmediate(func) { | |
setImmediates.push(func); | |
if (ENVIRONMENT_IS_WORKER) { | |
if (Module['setImmediates'] === undefined) Module['setImmediates'] = []; | |
Module['setImmediates'].push(func); | |
postMessage({target: emscriptenMainLoopMessageId}); // In --proxy-to-worker, route the message via proxyClient.js | |
} else postMessage(emscriptenMainLoopMessageId, "*"); // On the main thread, can just send the message to itself. | |
} | |
} | |
Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setImmediate() { | |
setImmediate(Browser.mainLoop.runner); | |
}; | |
Browser.mainLoop.method = 'immediate'; | |
} | |
return 0; | |
} | |
function _emscripten_get_now() { abort() }function _emscripten_set_main_loop(func, fps, simulateInfiniteLoop, arg, noSetTiming) { | |
Module['noExitRuntime'] = true; | |
assert(!Browser.mainLoop.func, 'emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters.'); | |
Browser.mainLoop.func = func; | |
Browser.mainLoop.arg = arg; | |
var browserIterationFunc; | |
if (typeof arg !== 'undefined') { | |
browserIterationFunc = function() { | |
Module['dynCall_vi'](func, arg); | |
}; | |
} else { | |
browserIterationFunc = function() { | |
Module['dynCall_v'](func); | |
}; | |
} | |
var thisMainLoopId = Browser.mainLoop.currentlyRunningMainloop; | |
Browser.mainLoop.runner = function Browser_mainLoop_runner() { | |
if (ABORT) return; | |
if (Browser.mainLoop.queue.length > 0) { | |
var start = Date.now(); | |
var blocker = Browser.mainLoop.queue.shift(); | |
blocker.func(blocker.arg); | |
if (Browser.mainLoop.remainingBlockers) { | |
var remaining = Browser.mainLoop.remainingBlockers; | |
var next = remaining%1 == 0 ? remaining-1 : Math.floor(remaining); | |
if (blocker.counted) { | |
Browser.mainLoop.remainingBlockers = next; | |
} else { | |
// not counted, but move the progress along a tiny bit | |
next = next + 0.5; // do not steal all the next one's progress | |
Browser.mainLoop.remainingBlockers = (8*remaining + next)/9; | |
} | |
} | |
console.log('main loop blocker "' + blocker.name + '" took ' + (Date.now() - start) + ' ms'); //, left: ' + Browser.mainLoop.remainingBlockers); | |
Browser.mainLoop.updateStatus(); | |
// catches pause/resume main loop from blocker execution | |
if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return; | |
setTimeout(Browser.mainLoop.runner, 0); | |
return; | |
} | |
// catch pauses from non-main loop sources | |
if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return; | |
// Implement very basic swap interval control | |
Browser.mainLoop.currentFrameNumber = Browser.mainLoop.currentFrameNumber + 1 | 0; | |
if (Browser.mainLoop.timingMode == 1/*EM_TIMING_RAF*/ && Browser.mainLoop.timingValue > 1 && Browser.mainLoop.currentFrameNumber % Browser.mainLoop.timingValue != 0) { | |
// Not the scheduled time to render this frame - skip. | |
Browser.mainLoop.scheduler(); | |
return; | |
} else if (Browser.mainLoop.timingMode == 0/*EM_TIMING_SETTIMEOUT*/) { | |
Browser.mainLoop.tickStartTime = _emscripten_get_now(); | |
} | |
// Signal GL rendering layer that processing of a new frame is about to start. This helps it optimize | |
// VBO double-buffering and reduce GPU stalls. | |
if (Browser.mainLoop.method === 'timeout' && Module.ctx) { | |
err('Looks like you are rendering without using requestAnimationFrame for the main loop. You should use 0 for the frame rate in emscripten_set_main_loop in order to use requestAnimationFrame, as that can greatly improve your frame rates!'); | |
Browser.mainLoop.method = ''; // just warn once per call to set main loop | |
} | |
Browser.mainLoop.runIter(browserIterationFunc); | |
checkStackCookie(); | |
// catch pauses from the main loop itself | |
if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return; | |
// Queue new audio data. This is important to be right after the main loop invocation, so that we will immediately be able | |
// to queue the newest produced audio samples. | |
// TODO: Consider adding pre- and post- rAF callbacks so that GL.newRenderingFrameStarted() and SDL.audio.queueNewAudioData() | |
// do not need to be hardcoded into this function, but can be more generic. | |
if (typeof SDL === 'object' && SDL.audio && SDL.audio.queueNewAudioData) SDL.audio.queueNewAudioData(); | |
Browser.mainLoop.scheduler(); | |
} | |
if (!noSetTiming) { | |
if (fps && fps > 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 1000.0 / fps); | |
else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, 1); // Do rAF by rendering each frame (no decimating) | |
Browser.mainLoop.scheduler(); | |
} | |
if (simulateInfiniteLoop) { | |
throw 'SimulateInfiniteLoop'; | |
} | |
}var Browser={mainLoop:{scheduler:null,method:"",currentlyRunningMainloop:0,func:null,arg:0,timingMode:0,timingValue:0,currentFrameNumber:0,queue:[],pause:function () { | |
Browser.mainLoop.scheduler = null; | |
Browser.mainLoop.currentlyRunningMainloop++; // Incrementing this signals the previous main loop that it's now become old, and it must return. | |
},resume:function () { | |
Browser.mainLoop.currentlyRunningMainloop++; | |
var timingMode = Browser.mainLoop.timingMode; | |
var timingValue = Browser.mainLoop.timingValue; | |
var func = Browser.mainLoop.func; | |
Browser.mainLoop.func = null; | |
_emscripten_set_main_loop(func, 0, false, Browser.mainLoop.arg, true /* do not set timing and call scheduler, we will do it on the next lines */); | |
_emscripten_set_main_loop_timing(timingMode, timingValue); | |
Browser.mainLoop.scheduler(); | |
},updateStatus:function () { | |
if (Module['setStatus']) { | |
var message = Module['statusMessage'] || 'Please wait...'; | |
var remaining = Browser.mainLoop.remainingBlockers; | |
var expected = Browser.mainLoop.expectedBlockers; | |
if (remaining) { | |
if (remaining < expected) { | |
Module['setStatus'](message + ' (' + (expected - remaining) + '/' + expected + ')'); | |
} else { | |
Module['setStatus'](message); | |
} | |
} else { | |
Module['setStatus'](''); | |
} | |
} | |
},runIter:function (func) { | |
if (ABORT) return; | |
if (Module['preMainLoop']) { | |
var preRet = Module['preMainLoop'](); | |
if (preRet === false) { | |
return; // |return false| skips a frame | |
} | |
} | |
try { | |
func(); | |
} catch (e) { | |
if (e instanceof ExitStatus) { | |
return; | |
} else { | |
if (e && typeof e === 'object' && e.stack) err('exception thrown: ' + [e, e.stack]); | |
throw e; | |
} | |
} | |
if (Module['postMainLoop']) Module['postMainLoop'](); | |
}},isFullscreen:false,pointerLock:false,moduleContextCreatedCallbacks:[],workers:[],init:function () { | |
if (!Module["preloadPlugins"]) Module["preloadPlugins"] = []; // needs to exist even in workers | |
if (Browser.initted) return; | |
Browser.initted = true; | |
try { | |
new Blob(); | |
Browser.hasBlobConstructor = true; | |
} catch(e) { | |
Browser.hasBlobConstructor = false; | |
console.log("warning: no blob constructor, cannot create blobs with mimetypes"); | |
} | |
Browser.BlobBuilder = typeof MozBlobBuilder != "undefined" ? MozBlobBuilder : (typeof WebKitBlobBuilder != "undefined" ? WebKitBlobBuilder : (!Browser.hasBlobConstructor ? console.log("warning: no BlobBuilder") : null)); | |
Browser.URLObject = typeof window != "undefined" ? (window.URL ? window.URL : window.webkitURL) : undefined; | |
if (!Module.noImageDecoding && typeof Browser.URLObject === 'undefined') { | |
console.log("warning: Browser does not support creating object URLs. Built-in browser image decoding will not be available."); | |
Module.noImageDecoding = true; | |
} | |
// Support for plugins that can process preloaded files. You can add more of these to | |
// your app by creating and appending to Module.preloadPlugins. | |
// | |
// Each plugin is asked if it can handle a file based on the file's name. If it can, | |
// it is given the file's raw data. When it is done, it calls a callback with the file's | |
// (possibly modified) data. For example, a plugin might decompress a file, or it | |
// might create some side data structure for use later (like an Image element, etc.). | |
var imagePlugin = {}; | |
imagePlugin['canHandle'] = function imagePlugin_canHandle(name) { | |
return !Module.noImageDecoding && /\.(jpg|jpeg|png|bmp)$/i.test(name); | |
}; | |
imagePlugin['handle'] = function imagePlugin_handle(byteArray, name, onload, onerror) { | |
var b = null; | |
if (Browser.hasBlobConstructor) { | |
try { | |
b = new Blob([byteArray], { type: Browser.getMimetype(name) }); | |
if (b.size !== byteArray.length) { // Safari bug #118630 | |
// Safari's Blob can only take an ArrayBuffer | |
b = new Blob([(new Uint8Array(byteArray)).buffer], { type: Browser.getMimetype(name) }); | |
} | |
} catch(e) { | |
warnOnce('Blob constructor present but fails: ' + e + '; falling back to blob builder'); | |
} | |
} | |
if (!b) { | |
var bb = new Browser.BlobBuilder(); | |
bb.append((new Uint8Array(byteArray)).buffer); // we need to pass a buffer, and must copy the array to get the right data range | |
b = bb.getBlob(); | |
} | |
var url = Browser.URLObject.createObjectURL(b); | |
assert(typeof url == 'string', 'createObjectURL must return a url as a string'); | |
var img = new Image(); | |
img.onload = function img_onload() { | |
assert(img.complete, 'Image ' + name + ' could not be decoded'); | |
var canvas = document.createElement('canvas'); | |
canvas.width = img.width; | |
canvas.height = img.height; | |
var ctx = canvas.getContext('2d'); | |
ctx.drawImage(img, 0, 0); | |
Module["preloadedImages"][name] = canvas; | |
Browser.URLObject.revokeObjectURL(url); | |
if (onload) onload(byteArray); | |
}; | |
img.onerror = function img_onerror(event) { | |
console.log('Image ' + url + ' could not be decoded'); | |
if (onerror) onerror(); | |
}; | |
img.src = url; | |
}; | |
Module['preloadPlugins'].push(imagePlugin); | |
var audioPlugin = {}; | |
audioPlugin['canHandle'] = function audioPlugin_canHandle(name) { | |
return !Module.noAudioDecoding && name.substr(-4) in { '.ogg': 1, '.wav': 1, '.mp3': 1 }; | |
}; | |
audioPlugin['handle'] = function audioPlugin_handle(byteArray, name, onload, onerror) { | |
var done = false; | |
function finish(audio) { | |
if (done) return; | |
done = true; | |
Module["preloadedAudios"][name] = audio; | |
if (onload) onload(byteArray); | |
} | |
function fail() { | |
if (done) return; | |
done = true; | |
Module["preloadedAudios"][name] = new Audio(); // empty shim | |
if (onerror) onerror(); | |
} | |
if (Browser.hasBlobConstructor) { | |
try { | |
var b = new Blob([byteArray], { type: Browser.getMimetype(name) }); | |
} catch(e) { | |
return fail(); | |
} | |
var url = Browser.URLObject.createObjectURL(b); // XXX we never revoke this! | |
assert(typeof url == 'string', 'createObjectURL must return a url as a string'); | |
var audio = new Audio(); | |
audio.addEventListener('canplaythrough', function() { finish(audio) }, false); // use addEventListener due to chromium bug 124926 | |
audio.onerror = function audio_onerror(event) { | |
if (done) return; | |
console.log('warning: browser could not fully decode audio ' + name + ', trying slower base64 approach'); | |
function encode64(data) { | |
var BASE = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'; | |
var PAD = '='; | |
var ret = ''; | |
var leftchar = 0; | |
var leftbits = 0; | |
for (var i = 0; i < data.length; i++) { | |
leftchar = (leftchar << 8) | data[i]; | |
leftbits += 8; | |
while (leftbits >= 6) { | |
var curr = (leftchar >> (leftbits-6)) & 0x3f; | |
leftbits -= 6; | |
ret += BASE[curr]; | |
} | |
} | |
if (leftbits == 2) { | |
ret += BASE[(leftchar&3) << 4]; | |
ret += PAD + PAD; | |
} else if (leftbits == 4) { | |
ret += BASE[(leftchar&0xf) << 2]; | |
ret += PAD; | |
} | |
return ret; | |
} | |
audio.src = 'data:audio/x-' + name.substr(-3) + ';base64,' + encode64(byteArray); | |
finish(audio); // we don't wait for confirmation this worked - but it's worth trying | |
}; | |
audio.src = url; | |
// workaround for chrome bug 124926 - we do not always get oncanplaythrough or onerror | |
Browser.safeSetTimeout(function() { | |
finish(audio); // try to use it even though it is not necessarily ready to play | |
}, 10000); | |
} else { | |
return fail(); | |
} | |
}; | |
Module['preloadPlugins'].push(audioPlugin); | |
// Canvas event setup | |
function pointerLockChange() { | |
Browser.pointerLock = document['pointerLockElement'] === Module['canvas'] || | |
document['mozPointerLockElement'] === Module['canvas'] || | |
document['webkitPointerLockElement'] === Module['canvas'] || | |
document['msPointerLockElement'] === Module['canvas']; | |
} | |
var canvas = Module['canvas']; | |
if (canvas) { | |
// forced aspect ratio can be enabled by defining 'forcedAspectRatio' on Module | |
// Module['forcedAspectRatio'] = 4 / 3; | |
canvas.requestPointerLock = canvas['requestPointerLock'] || | |
canvas['mozRequestPointerLock'] || | |
canvas['webkitRequestPointerLock'] || | |
canvas['msRequestPointerLock'] || | |
function(){}; | |
canvas.exitPointerLock = document['exitPointerLock'] || | |
document['mozExitPointerLock'] || | |
document['webkitExitPointerLock'] || | |
document['msExitPointerLock'] || | |
function(){}; // no-op if function does not exist | |
canvas.exitPointerLock = canvas.exitPointerLock.bind(document); | |
document.addEventListener('pointerlockchange', pointerLockChange, false); | |
document.addEventListener('mozpointerlockchange', pointerLockChange, false); | |
document.addEventListener('webkitpointerlockchange', pointerLockChange, false); | |
document.addEventListener('mspointerlockchange', pointerLockChange, false); | |
if (Module['elementPointerLock']) { | |
canvas.addEventListener("click", function(ev) { | |
if (!Browser.pointerLock && Module['canvas'].requestPointerLock) { | |
Module['canvas'].requestPointerLock(); | |
ev.preventDefault(); | |
} | |
}, false); | |
} | |
} | |
},createContext:function (canvas, useWebGL, setInModule, webGLContextAttributes) { | |
if (useWebGL && Module.ctx && canvas == Module.canvas) return Module.ctx; // no need to recreate GL context if it's already been created for this canvas. | |
var ctx; | |
var contextHandle; | |
if (useWebGL) { | |
// For GLES2/desktop GL compatibility, adjust a few defaults to be different to WebGL defaults, so that they align better with the desktop defaults. | |
var contextAttributes = { | |
antialias: false, | |
alpha: false | |
}; | |
if (webGLContextAttributes) { | |
for (var attribute in webGLContextAttributes) { | |
contextAttributes[attribute] = webGLContextAttributes[attribute]; | |
} | |
} | |
contextHandle = GL.createContext(canvas, contextAttributes); | |
if (contextHandle) { | |
ctx = GL.getContext(contextHandle).GLctx; | |
} | |
} else { | |
ctx = canvas.getContext('2d'); | |
} | |
if (!ctx) return null; | |
if (setInModule) { | |
if (!useWebGL) assert(typeof GLctx === 'undefined', 'cannot set in module if GLctx is used, but we are a non-GL context that would replace it'); | |
Module.ctx = ctx; | |
if (useWebGL) GL.makeContextCurrent(contextHandle); | |
Module.useWebGL = useWebGL; | |
Browser.moduleContextCreatedCallbacks.forEach(function(callback) { callback() }); | |
Browser.init(); | |
} | |
return ctx; | |
},destroyContext:function (canvas, useWebGL, setInModule) {},fullscreenHandlersInstalled:false,lockPointer:undefined,resizeCanvas:undefined,requestFullscreen:function (lockPointer, resizeCanvas, vrDevice) { | |
Browser.lockPointer = lockPointer; | |
Browser.resizeCanvas = resizeCanvas; | |
Browser.vrDevice = vrDevice; | |
if (typeof Browser.lockPointer === 'undefined') Browser.lockPointer = true; | |
if (typeof Browser.resizeCanvas === 'undefined') Browser.resizeCanvas = false; | |
if (typeof Browser.vrDevice === 'undefined') Browser.vrDevice = null; | |
var canvas = Module['canvas']; | |
function fullscreenChange() { | |
Browser.isFullscreen = false; | |
var canvasContainer = canvas.parentNode; | |
if ((document['fullscreenElement'] || document['mozFullScreenElement'] || | |
document['msFullscreenElement'] || document['webkitFullscreenElement'] || | |
document['webkitCurrentFullScreenElement']) === canvasContainer) { | |
canvas.exitFullscreen = document['exitFullscreen'] || | |
document['cancelFullScreen'] || | |
document['mozCancelFullScreen'] || | |
document['msExitFullscreen'] || | |
document['webkitCancelFullScreen'] || | |
function() {}; | |
canvas.exitFullscreen = canvas.exitFullscreen.bind(document); | |
if (Browser.lockPointer) canvas.requestPointerLock(); | |
Browser.isFullscreen = true; | |
if (Browser.resizeCanvas) { | |
Browser.setFullscreenCanvasSize(); | |
} else { | |
Browser.updateCanvasDimensions(canvas); | |
} | |
} else { | |
// remove the full screen specific parent of the canvas again to restore the HTML structure from before going full screen | |
canvasContainer.parentNode.insertBefore(canvas, canvasContainer); | |
canvasContainer.parentNode.removeChild(canvasContainer); | |
if (Browser.resizeCanvas) { | |
Browser.setWindowedCanvasSize(); | |
} else { | |
Browser.updateCanvasDimensions(canvas); | |
} | |
} | |
if (Module['onFullScreen']) Module['onFullScreen'](Browser.isFullscreen); | |
if (Module['onFullscreen']) Module['onFullscreen'](Browser.isFullscreen); | |
} | |
if (!Browser.fullscreenHandlersInstalled) { | |
Browser.fullscreenHandlersInstalled = true; | |
document.addEventListener('fullscreenchange', fullscreenChange, false); | |
document.addEventListener('mozfullscreenchange', fullscreenChange, false); | |
document.addEventListener('webkitfullscreenchange', fullscreenChange, false); | |
document.addEventListener('MSFullscreenChange', fullscreenChange, false); | |
} | |
// create a new parent to ensure the canvas has no siblings. this allows browsers to optimize full screen performance when its parent is the full screen root | |
var canvasContainer = document.createElement("div"); | |
canvas.parentNode.insertBefore(canvasContainer, canvas); | |
canvasContainer.appendChild(canvas); | |
// use parent of canvas as full screen root to allow aspect ratio correction (Firefox stretches the root to screen size) | |
canvasContainer.requestFullscreen = canvasContainer['requestFullscreen'] || | |
canvasContainer['mozRequestFullScreen'] || | |
canvasContainer['msRequestFullscreen'] || | |
(canvasContainer['webkitRequestFullscreen'] ? function() { canvasContainer['webkitRequestFullscreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null) || | |
(canvasContainer['webkitRequestFullScreen'] ? function() { canvasContainer['webkitRequestFullScreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null); | |
if (vrDevice) { | |
canvasContainer.requestFullscreen({ vrDisplay: vrDevice }); | |
} else { | |
canvasContainer.requestFullscreen(); | |
} | |
},requestFullScreen:function (lockPointer, resizeCanvas, vrDevice) { | |
err('Browser.requestFullScreen() is deprecated. Please call Browser.requestFullscreen instead.'); | |
Browser.requestFullScreen = function(lockPointer, resizeCanvas, vrDevice) { | |
return Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice); | |
} | |
return Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice); | |
},nextRAF:0,fakeRequestAnimationFrame:function (func) { | |
// try to keep 60fps between calls to here | |
var now = Date.now(); | |
if (Browser.nextRAF === 0) { | |
Browser.nextRAF = now + 1000/60; | |
} else { | |
while (now + 2 >= Browser.nextRAF) { // fudge a little, to avoid timer jitter causing us to do lots of delay:0 | |
Browser.nextRAF += 1000/60; | |
} | |
} | |
var delay = Math.max(Browser.nextRAF - now, 0); | |
setTimeout(func, delay); | |
},requestAnimationFrame:function requestAnimationFrame(func) { | |
if (typeof window === 'undefined') { // Provide fallback to setTimeout if window is undefined (e.g. in Node.js) | |
Browser.fakeRequestAnimationFrame(func); | |
} else { | |
if (!window.requestAnimationFrame) { | |
window.requestAnimationFrame = window['requestAnimationFrame'] || | |
window['mozRequestAnimationFrame'] || | |
window['webkitRequestAnimationFrame'] || | |
window['msRequestAnimationFrame'] || | |
window['oRequestAnimationFrame'] || | |
Browser.fakeRequestAnimationFrame; | |
} | |
window.requestAnimationFrame(func); | |
} | |
},safeCallback:function (func) { | |
return function() { | |
if (!ABORT) return func.apply(null, arguments); | |
}; | |
},allowAsyncCallbacks:true,queuedAsyncCallbacks:[],pauseAsyncCallbacks:function () { | |
Browser.allowAsyncCallbacks = false; | |
},resumeAsyncCallbacks:function () { // marks future callbacks as ok to execute, and synchronously runs any remaining ones right now | |
Browser.allowAsyncCallbacks = true; | |
if (Browser.queuedAsyncCallbacks.length > 0) { | |
var callbacks = Browser.queuedAsyncCallbacks; | |
Browser.queuedAsyncCallbacks = []; | |
callbacks.forEach(function(func) { | |
func(); | |
}); | |
} | |
},safeRequestAnimationFrame:function (func) { | |
return Browser.requestAnimationFrame(function() { | |
if (ABORT) return; | |
if (Browser.allowAsyncCallbacks) { | |
func(); | |
} else { | |
Browser.queuedAsyncCallbacks.push(func); | |
} | |
}); | |
},safeSetTimeout:function (func, timeout) { | |
Module['noExitRuntime'] = true; | |
return setTimeout(function() { | |
if (ABORT) return; | |
if (Browser.allowAsyncCallbacks) { | |
func(); | |
} else { | |
Browser.queuedAsyncCallbacks.push(func); | |
} | |
}, timeout); | |
},safeSetInterval:function (func, timeout) { | |
Module['noExitRuntime'] = true; | |
return setInterval(function() { | |
if (ABORT) return; | |
if (Browser.allowAsyncCallbacks) { | |
func(); | |
} // drop it on the floor otherwise, next interval will kick in | |
}, timeout); | |
},getMimetype:function (name) { | |
return { | |
'jpg': 'image/jpeg', | |
'jpeg': 'image/jpeg', | |
'png': 'image/png', | |
'bmp': 'image/bmp', | |
'ogg': 'audio/ogg', | |
'wav': 'audio/wav', | |
'mp3': 'audio/mpeg' | |
}[name.substr(name.lastIndexOf('.')+1)]; | |
},getUserMedia:function (func) { | |
if(!window.getUserMedia) { | |
window.getUserMedia = navigator['getUserMedia'] || | |
navigator['mozGetUserMedia']; | |
} | |
window.getUserMedia(func); | |
},getMovementX:function (event) { | |
return event['movementX'] || | |
event['mozMovementX'] || | |
event['webkitMovementX'] || | |
0; | |
},getMovementY:function (event) { | |
return event['movementY'] || | |
event['mozMovementY'] || | |
event['webkitMovementY'] || | |
0; | |
},getMouseWheelDelta:function (event) { | |
var delta = 0; | |
switch (event.type) { | |
case 'DOMMouseScroll': | |
delta = event.detail; | |
break; | |
case 'mousewheel': | |
delta = event.wheelDelta; | |
break; | |
case 'wheel': | |
delta = event['deltaY']; | |
break; | |
default: | |
throw 'unrecognized mouse wheel event: ' + event.type; | |
} | |
return delta; | |
},mouseX:0,mouseY:0,mouseMovementX:0,mouseMovementY:0,touches:{},lastTouches:{},calculateMouseEvent:function (event) { // event should be mousemove, mousedown or mouseup | |
if (Browser.pointerLock) { | |
// When the pointer is locked, calculate the coordinates | |
// based on the movement of the mouse. | |
// Workaround for Firefox bug 764498 | |
if (event.type != 'mousemove' && | |
('mozMovementX' in event)) { | |
Browser.mouseMovementX = Browser.mouseMovementY = 0; | |
} else { | |
Browser.mouseMovementX = Browser.getMovementX(event); | |
Browser.mouseMovementY = Browser.getMovementY(event); | |
} | |
// check if SDL is available | |
if (typeof SDL != "undefined") { | |
Browser.mouseX = SDL.mouseX + Browser.mouseMovementX; | |
Browser.mouseY = SDL.mouseY + Browser.mouseMovementY; | |
} else { | |
// just add the mouse delta to the current absolut mouse position | |
// FIXME: ideally this should be clamped against the canvas size and zero | |
Browser.mouseX += Browser.mouseMovementX; | |
Browser.mouseY += Browser.mouseMovementY; | |
} | |
} else { | |
// Otherwise, calculate the movement based on the changes | |
// in the coordinates. | |
var rect = Module["canvas"].getBoundingClientRect(); | |
var cw = Module["canvas"].width; | |
var ch = Module["canvas"].height; | |
// Neither .scrollX or .pageXOffset are defined in a spec, but | |
// we prefer .scrollX because it is currently in a spec draft. | |
// (see: http://www.w3.org/TR/2013/WD-cssom-view-20131217/) | |
var scrollX = ((typeof window.scrollX !== 'undefined') ? window.scrollX : window.pageXOffset); | |
var scrollY = ((typeof window.scrollY !== 'undefined') ? window.scrollY : window.pageYOffset); | |
// If this assert lands, it's likely because the browser doesn't support scrollX or pageXOffset | |
// and we have no viable fallback. | |
assert((typeof scrollX !== 'undefined') && (typeof scrollY !== 'undefined'), 'Unable to retrieve scroll position, mouse positions likely broken.'); | |
if (event.type === 'touchstart' || event.type === 'touchend' || event.type === 'touchmove') { | |
var touch = event.touch; | |
if (touch === undefined) { | |
return; // the "touch" property is only defined in SDL | |
} | |
var adjustedX = touch.pageX - (scrollX + rect.left); | |
var adjustedY = touch.pageY - (scrollY + rect.top); | |
adjustedX = adjustedX * (cw / rect.width); | |
adjustedY = adjustedY * (ch / rect.height); | |
var coords = { x: adjustedX, y: adjustedY }; | |
if (event.type === 'touchstart') { | |
Browser.lastTouches[touch.identifier] = coords; | |
Browser.touches[touch.identifier] = coords; | |
} else if (event.type === 'touchend' || event.type === 'touchmove') { | |
var last = Browser.touches[touch.identifier]; | |
if (!last) last = coords; | |
Browser.lastTouches[touch.identifier] = last; | |
Browser.touches[touch.identifier] = coords; | |
} | |
return; | |
} | |
var x = event.pageX - (scrollX + rect.left); | |
var y = event.pageY - (scrollY + rect.top); | |
// the canvas might be CSS-scaled compared to its backbuffer; | |
// SDL-using content will want mouse coordinates in terms | |
// of backbuffer units. | |
x = x * (cw / rect.width); | |
y = y * (ch / rect.height); | |
Browser.mouseMovementX = x - Browser.mouseX; | |
Browser.mouseMovementY = y - Browser.mouseY; | |
Browser.mouseX = x; | |
Browser.mouseY = y; | |
} | |
},asyncLoad:function (url, onload, onerror, noRunDep) { | |
var dep = !noRunDep ? getUniqueRunDependency('al ' + url) : ''; | |
Module['readAsync'](url, function(arrayBuffer) { | |
assert(arrayBuffer, 'Loading data file "' + url + '" failed (no arrayBuffer).'); | |
onload(new Uint8Array(arrayBuffer)); | |
if (dep) removeRunDependency(dep); | |
}, function(event) { | |
if (onerror) { | |
onerror(); | |
} else { | |
throw 'Loading data file "' + url + '" failed.'; | |
} | |
}); | |
if (dep) addRunDependency(dep); | |
},resizeListeners:[],updateResizeListeners:function () { | |
var canvas = Module['canvas']; | |
Browser.resizeListeners.forEach(function(listener) { | |
listener(canvas.width, canvas.height); | |
}); | |
},setCanvasSize:function (width, height, noUpdates) { | |
var canvas = Module['canvas']; | |
Browser.updateCanvasDimensions(canvas, width, height); | |
if (!noUpdates) Browser.updateResizeListeners(); | |
},windowedWidth:0,windowedHeight:0,setFullscreenCanvasSize:function () { | |
// check if SDL is available | |
if (typeof SDL != "undefined") { | |
var flags = HEAPU32[((SDL.screen)>>2)]; | |
flags = flags | 0x00800000; // set SDL_FULLSCREEN flag | |
HEAP32[((SDL.screen)>>2)]=flags | |
} | |
Browser.updateCanvasDimensions(Module['canvas']); | |
Browser.updateResizeListeners(); | |
},setWindowedCanvasSize:function () { | |
// check if SDL is available | |
if (typeof SDL != "undefined") { | |
var flags = HEAPU32[((SDL.screen)>>2)]; | |
flags = flags & ~0x00800000; // clear SDL_FULLSCREEN flag | |
HEAP32[((SDL.screen)>>2)]=flags | |
} | |
Browser.updateCanvasDimensions(Module['canvas']); | |
Browser.updateResizeListeners(); | |
},updateCanvasDimensions:function (canvas, wNative, hNative) { | |
if (wNative && hNative) { | |
canvas.widthNative = wNative; | |
canvas.heightNative = hNative; | |
} else { | |
wNative = canvas.widthNative; | |
hNative = canvas.heightNative; | |
} | |
var w = wNative; | |
var h = hNative; | |
if (Module['forcedAspectRatio'] && Module['forcedAspectRatio'] > 0) { | |
if (w/h < Module['forcedAspectRatio']) { | |
w = Math.round(h * Module['forcedAspectRatio']); | |
} else { | |
h = Math.round(w / Module['forcedAspectRatio']); | |
} | |
} | |
if (((document['fullscreenElement'] || document['mozFullScreenElement'] || | |
document['msFullscreenElement'] || document['webkitFullscreenElement'] || | |
document['webkitCurrentFullScreenElement']) === canvas.parentNode) && (typeof screen != 'undefined')) { | |
var factor = Math.min(screen.width / w, screen.height / h); | |
w = Math.round(w * factor); | |
h = Math.round(h * factor); | |
} | |
if (Browser.resizeCanvas) { | |
if (canvas.width != w) canvas.width = w; | |
if (canvas.height != h) canvas.height = h; | |
if (typeof canvas.style != 'undefined') { | |
canvas.style.removeProperty( "width"); | |
canvas.style.removeProperty("height"); | |
} | |
} else { | |
if (canvas.width != wNative) canvas.width = wNative; | |
if (canvas.height != hNative) canvas.height = hNative; | |
if (typeof canvas.style != 'undefined') { | |
if (w != wNative || h != hNative) { | |
canvas.style.setProperty( "width", w + "px", "important"); | |
canvas.style.setProperty("height", h + "px", "important"); | |
} else { | |
canvas.style.removeProperty( "width"); | |
canvas.style.removeProperty("height"); | |
} | |
} | |
} | |
},wgetRequests:{},nextWgetRequestHandle:0,getNextWgetRequestHandle:function () { | |
var handle = Browser.nextWgetRequestHandle; | |
Browser.nextWgetRequestHandle++; | |
return handle; | |
}};function _emscripten_cancel_main_loop() { | |
Browser.mainLoop.pause(); | |
Browser.mainLoop.func = null; | |
} | |
function _emscripten_get_canvas_element_size(target, width, height) { | |
var canvas = JSEvents.findCanvasEventTarget(target); | |
if (!canvas) return -4; | |
HEAP32[((width)>>2)]=canvas.width; | |
HEAP32[((height)>>2)]=canvas.height; | |
}function __get_canvas_element_size(target) { | |
var stackTop = stackSave(); | |
var w = stackAlloc(8); | |
var h = w + 4; | |
var targetInt = stackAlloc(target.id.length+1); | |
stringToUTF8(target.id, targetInt, target.id.length+1); | |
var ret = _emscripten_get_canvas_element_size(targetInt, w, h); | |
var size = [HEAP32[((w)>>2)], HEAP32[((h)>>2)]]; | |
stackRestore(stackTop); | |
return size; | |
} | |
function _emscripten_set_canvas_element_size(target, width, height) { | |
var canvas = JSEvents.findCanvasEventTarget(target); | |
if (!canvas) return -4; | |
canvas.width = width; | |
canvas.height = height; | |
return 0; | |
}function __set_canvas_element_size(target, width, height) { | |
if (!target.controlTransferredOffscreen) { | |
target.width = width; | |
target.height = height; | |
} else { | |
// This function is being called from high-level JavaScript code instead of asm.js/Wasm, | |
// and it needs to synchronously proxy over to another thread, so marshal the string onto the heap to do the call. | |
var stackTop = stackSave(); | |
var targetInt = stackAlloc(target.id.length+1); | |
stringToUTF8(target.id, targetInt, target.id.length+1); | |
_emscripten_set_canvas_element_size(targetInt, width, height); | |
stackRestore(stackTop); | |
} | |
}var JSEvents={keyEvent:0,mouseEvent:0,wheelEvent:0,uiEvent:0,focusEvent:0,deviceOrientationEvent:0,deviceMotionEvent:0,fullscreenChangeEvent:0,pointerlockChangeEvent:0,visibilityChangeEvent:0,touchEvent:0,previousFullscreenElement:null,previousScreenX:null,previousScreenY:null,removeEventListenersRegistered:false,removeAllEventListeners:function () { | |
for(var i = JSEvents.eventHandlers.length-1; i >= 0; --i) { | |
JSEvents._removeHandler(i); | |
} | |
JSEvents.eventHandlers = []; | |
JSEvents.deferredCalls = []; | |
},registerRemoveEventListeners:function () { | |
if (!JSEvents.removeEventListenersRegistered) { | |
__ATEXIT__.push(JSEvents.removeAllEventListeners); | |
JSEvents.removeEventListenersRegistered = true; | |
} | |
},findEventTarget:function (target) { | |
try { | |
// The sensible "default" target varies between events, but use window as the default | |
// since DOM events mostly can default to that. Specific callback registrations | |
// override their own defaults. | |
if (!target) return window; | |
if (typeof target === "number") target = Pointer_stringify(target); | |
if (target === '#window') return window; | |
else if (target === '#document') return document; | |
else if (target === '#screen') return window.screen; | |
else if (target === '#canvas') return Module['canvas']; | |
return (typeof target === 'string') ? document.getElementById(target) : target; | |
} catch(e) { | |
// In Web Workers, some objects above, such as '#document' do not exist. Gracefully | |
// return null for them. | |
return null; | |
} | |
},findCanvasEventTarget:function (target) { | |
if (typeof target === 'number') target = Pointer_stringify(target); | |
if (!target || target === '#canvas') { | |
if (typeof GL !== 'undefined' && GL.offscreenCanvases['canvas']) return GL.offscreenCanvases['canvas']; // TODO: Remove this line, target '#canvas' should refer only to Module['canvas'], not to GL.offscreenCanvases['canvas'] - but need stricter tests to be able to remove this line. | |
return Module['canvas']; | |
} | |
if (typeof GL !== 'undefined' && GL.offscreenCanvases[target]) return GL.offscreenCanvases[target]; | |
return JSEvents.findEventTarget(target); | |
},deferredCalls:[],deferCall:function (targetFunction, precedence, argsList) { | |
function arraysHaveEqualContent(arrA, arrB) { | |
if (arrA.length != arrB.length) return false; | |
for(var i in arrA) { | |
if (arrA[i] != arrB[i]) return false; | |
} | |
return true; | |
} | |
// Test if the given call was already queued, and if so, don't add it again. | |
for(var i in JSEvents.deferredCalls) { | |
var call = JSEvents.deferredCalls[i]; | |
if (call.targetFunction == targetFunction && arraysHaveEqualContent(call.argsList, argsList)) { | |
return; | |
} | |
} | |
JSEvents.deferredCalls.push({ | |
targetFunction: targetFunction, | |
precedence: precedence, | |
argsList: argsList | |
}); | |
JSEvents.deferredCalls.sort(function(x,y) { return x.precedence < y.precedence; }); | |
},removeDeferredCalls:function (targetFunction) { | |
for(var i = 0; i < JSEvents.deferredCalls.length; ++i) { | |
if (JSEvents.deferredCalls[i].targetFunction == targetFunction) { | |
JSEvents.deferredCalls.splice(i, 1); | |
--i; | |
} | |
} | |
},canPerformEventHandlerRequests:function () { | |
return JSEvents.inEventHandler && JSEvents.currentEventHandler.allowsDeferredCalls; | |
},runDeferredCalls:function () { | |
if (!JSEvents.canPerformEventHandlerRequests()) { | |
return; | |
} | |
for(var i = 0; i < JSEvents.deferredCalls.length; ++i) { | |
var call = JSEvents.deferredCalls[i]; | |
JSEvents.deferredCalls.splice(i, 1); | |
--i; | |
call.targetFunction.apply(this, call.argsList); | |
} | |
},inEventHandler:0,currentEventHandler:null,eventHandlers:[],isInternetExplorer:function () { return navigator.userAgent.indexOf('MSIE') !== -1 || navigator.appVersion.indexOf('Trident/') > 0; },removeAllHandlersOnTarget:function (target, eventTypeString) { | |
for(var i = 0; i < JSEvents.eventHandlers.length; ++i) { | |
if (JSEvents.eventHandlers[i].target == target && | |
(!eventTypeString || eventTypeString == JSEvents.eventHandlers[i].eventTypeString)) { | |
JSEvents._removeHandler(i--); | |
} | |
} | |
},_removeHandler:function (i) { | |
var h = JSEvents.eventHandlers[i]; | |
h.target.removeEventListener(h.eventTypeString, h.eventListenerFunc, h.useCapture); | |
JSEvents.eventHandlers.splice(i, 1); | |
},registerOrRemoveHandler:function (eventHandler) { | |
var jsEventHandler = function jsEventHandler(event) { | |
// Increment nesting count for the event handler. | |
++JSEvents.inEventHandler; | |
JSEvents.currentEventHandler = eventHandler; | |
// Process any old deferred calls the user has placed. | |
JSEvents.runDeferredCalls(); | |
// Process the actual event, calls back to user C code handler. | |
eventHandler.handlerFunc(event); | |
// Process any new deferred calls that were placed right now from this event handler. | |
JSEvents.runDeferredCalls(); | |
// Out of event handler - restore nesting count. | |
--JSEvents.inEventHandler; | |
} | |
if (eventHandler.callbackfunc) { | |
eventHandler.eventListenerFunc = jsEventHandler; | |
eventHandler.target.addEventListener(eventHandler.eventTypeString, jsEventHandler, eventHandler.useCapture); | |
JSEvents.eventHandlers.push(eventHandler); | |
JSEvents.registerRemoveEventListeners(); | |
} else { | |
for(var i = 0; i < JSEvents.eventHandlers.length; ++i) { | |
if (JSEvents.eventHandlers[i].target == eventHandler.target | |
&& JSEvents.eventHandlers[i].eventTypeString == eventHandler.eventTypeString) { | |
JSEvents._removeHandler(i--); | |
} | |
} | |
} | |
},registerKeyEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { | |
if (!JSEvents.keyEvent) JSEvents.keyEvent = _malloc( 164 ); | |
var keyEventHandlerFunc = function(event) { | |
var e = event || window.event; | |
var keyEventData = JSEvents.keyEvent; | |
stringToUTF8(e.key ? e.key : "", keyEventData + 0, 32); | |
stringToUTF8(e.code ? e.code : "", keyEventData + 32, 32); | |
HEAP32[(((keyEventData)+(64))>>2)]=e.location; | |
HEAP32[(((keyEventData)+(68))>>2)]=e.ctrlKey; | |
HEAP32[(((keyEventData)+(72))>>2)]=e.shiftKey; | |
HEAP32[(((keyEventData)+(76))>>2)]=e.altKey; | |
HEAP32[(((keyEventData)+(80))>>2)]=e.metaKey; | |
HEAP32[(((keyEventData)+(84))>>2)]=e.repeat; | |
stringToUTF8(e.locale ? e.locale : "", keyEventData + 88, 32); | |
stringToUTF8(e.char ? e.char : "", keyEventData + 120, 32); | |
HEAP32[(((keyEventData)+(152))>>2)]=e.charCode; | |
HEAP32[(((keyEventData)+(156))>>2)]=e.keyCode; | |
HEAP32[(((keyEventData)+(160))>>2)]=e.which; | |
if (Module['dynCall_iiii'](callbackfunc, eventTypeId, keyEventData, userData)) e.preventDefault(); | |
}; | |
var eventHandler = { | |
target: JSEvents.findEventTarget(target), | |
allowsDeferredCalls: JSEvents.isInternetExplorer() ? false : true, // MSIE doesn't allow fullscreen and pointerlock requests from key handlers, others do. | |
eventTypeString: eventTypeString, | |
callbackfunc: callbackfunc, | |
handlerFunc: keyEventHandlerFunc, | |
useCapture: useCapture | |
}; | |
JSEvents.registerOrRemoveHandler(eventHandler); | |
},getBoundingClientRectOrZeros:function (target) { | |
return target.getBoundingClientRect ? target.getBoundingClientRect() : { left: 0, top: 0 }; | |
},fillMouseEventData:function (eventStruct, e, target) { | |
HEAPF64[((eventStruct)>>3)]=JSEvents.tick(); | |
HEAP32[(((eventStruct)+(8))>>2)]=e.screenX; | |
HEAP32[(((eventStruct)+(12))>>2)]=e.screenY; | |
HEAP32[(((eventStruct)+(16))>>2)]=e.clientX; | |
HEAP32[(((eventStruct)+(20))>>2)]=e.clientY; | |
HEAP32[(((eventStruct)+(24))>>2)]=e.ctrlKey; | |
HEAP32[(((eventStruct)+(28))>>2)]=e.shiftKey; | |
HEAP32[(((eventStruct)+(32))>>2)]=e.altKey; | |
HEAP32[(((eventStruct)+(36))>>2)]=e.metaKey; | |
HEAP16[(((eventStruct)+(40))>>1)]=e.button; | |
HEAP16[(((eventStruct)+(42))>>1)]=e.buttons; | |
HEAP32[(((eventStruct)+(44))>>2)]=e["movementX"] || e["mozMovementX"] || e["webkitMovementX"] || (e.screenX-JSEvents.previousScreenX); | |
HEAP32[(((eventStruct)+(48))>>2)]=e["movementY"] || e["mozMovementY"] || e["webkitMovementY"] || (e.screenY-JSEvents.previousScreenY); | |
if (Module['canvas']) { | |
var rect = Module['canvas'].getBoundingClientRect(); | |
HEAP32[(((eventStruct)+(60))>>2)]=e.clientX - rect.left; | |
HEAP32[(((eventStruct)+(64))>>2)]=e.clientY - rect.top; | |
} else { // Canvas is not initialized, return 0. | |
HEAP32[(((eventStruct)+(60))>>2)]=0; | |
HEAP32[(((eventStruct)+(64))>>2)]=0; | |
} | |
if (target) { | |
var rect = JSEvents.getBoundingClientRectOrZeros(target); | |
HEAP32[(((eventStruct)+(52))>>2)]=e.clientX - rect.left; | |
HEAP32[(((eventStruct)+(56))>>2)]=e.clientY - rect.top; | |
} else { // No specific target passed, return 0. | |
HEAP32[(((eventStruct)+(52))>>2)]=0; | |
HEAP32[(((eventStruct)+(56))>>2)]=0; | |
} | |
// wheel and mousewheel events contain wrong screenX/screenY on chrome/opera | |
// https://github.com/kripken/emscripten/pull/4997 | |
// https://bugs.chromium.org/p/chromium/issues/detail?id=699956 | |
if (e.type !== 'wheel' && e.type !== 'mousewheel') { | |
JSEvents.previousScreenX = e.screenX; | |
JSEvents.previousScreenY = e.screenY; | |
} | |
},registerMouseEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { | |
if (!JSEvents.mouseEvent) JSEvents.mouseEvent = _malloc( 72 ); | |
target = JSEvents.findEventTarget(target); | |
var mouseEventHandlerFunc = function(event) { | |
var e = event || window.event; | |
// TODO: Make this access thread safe, or this could update live while app is reading it. | |
JSEvents.fillMouseEventData(JSEvents.mouseEvent, e, target); | |
if (Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.mouseEvent, userData)) e.preventDefault(); | |
}; | |
var eventHandler = { | |
target: target, | |
allowsDeferredCalls: eventTypeString != 'mousemove' && eventTypeString != 'mouseenter' && eventTypeString != 'mouseleave', // Mouse move events do not allow fullscreen/pointer lock requests to be handled in them! | |
eventTypeString: eventTypeString, | |
callbackfunc: callbackfunc, | |
handlerFunc: mouseEventHandlerFunc, | |
useCapture: useCapture | |
}; | |
// In IE, mousedown events don't either allow deferred calls to be run! | |
if (JSEvents.isInternetExplorer() && eventTypeString == 'mousedown') eventHandler.allowsDeferredCalls = false; | |
JSEvents.registerOrRemoveHandler(eventHandler); | |
},registerWheelEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { | |
if (!JSEvents.wheelEvent) JSEvents.wheelEvent = _malloc( 104 ); | |
target = JSEvents.findEventTarget(target); | |
// The DOM Level 3 events spec event 'wheel' | |
var wheelHandlerFunc = function(event) { | |
var e = event || window.event; | |
var wheelEvent = JSEvents.wheelEvent; | |
JSEvents.fillMouseEventData(wheelEvent, e, target); | |
HEAPF64[(((wheelEvent)+(72))>>3)]=e["deltaX"]; | |
HEAPF64[(((wheelEvent)+(80))>>3)]=e["deltaY"]; | |
HEAPF64[(((wheelEvent)+(88))>>3)]=e["deltaZ"]; | |
HEAP32[(((wheelEvent)+(96))>>2)]=e["deltaMode"]; | |
if (Module['dynCall_iiii'](callbackfunc, eventTypeId, wheelEvent, userData)) e.preventDefault(); | |
}; | |
// The 'mousewheel' event as implemented in Safari 6.0.5 | |
var mouseWheelHandlerFunc = function(event) { | |
var e = event || window.event; | |
JSEvents.fillMouseEventData(JSEvents.wheelEvent, e, target); | |
HEAPF64[(((JSEvents.wheelEvent)+(72))>>3)]=e["wheelDeltaX"] || 0; | |
HEAPF64[(((JSEvents.wheelEvent)+(80))>>3)]=-(e["wheelDeltaY"] ? e["wheelDeltaY"] : e["wheelDelta"]) /* 1. Invert to unify direction with the DOM Level 3 wheel event. 2. MSIE does not provide wheelDeltaY, so wheelDelta is used as a fallback. */; | |
HEAPF64[(((JSEvents.wheelEvent)+(88))>>3)]=0 /* Not available */; | |
HEAP32[(((JSEvents.wheelEvent)+(96))>>2)]=0 /* DOM_DELTA_PIXEL */; | |
var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.wheelEvent, userData); | |
if (shouldCancel) { | |
e.preventDefault(); | |
} | |
}; | |
var eventHandler = { | |
target: target, | |
allowsDeferredCalls: true, | |
eventTypeString: eventTypeString, | |
callbackfunc: callbackfunc, | |
handlerFunc: (eventTypeString == 'wheel') ? wheelHandlerFunc : mouseWheelHandlerFunc, | |
useCapture: useCapture | |
}; | |
JSEvents.registerOrRemoveHandler(eventHandler); | |
},pageScrollPos:function () { | |
if (window.pageXOffset > 0 || window.pageYOffset > 0) { | |
return [window.pageXOffset, window.pageYOffset]; | |
} | |
if (typeof document.documentElement.scrollLeft !== 'undefined' || typeof document.documentElement.scrollTop !== 'undefined') { | |
return [document.documentElement.scrollLeft, document.documentElement.scrollTop]; | |
} | |
return [document.body.scrollLeft|0, document.body.scrollTop|0]; | |
},registerUiEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { | |
if (!JSEvents.uiEvent) JSEvents.uiEvent = _malloc( 36 ); | |
if (eventTypeString == "scroll" && !target) { | |
target = document; // By default read scroll events on document rather than window. | |
} else { | |
target = JSEvents.findEventTarget(target); | |
} | |
var uiEventHandlerFunc = function(event) { | |
var e = event || window.event; | |
if (e.target != target) { | |
// Never take ui events such as scroll via a 'bubbled' route, but always from the direct element that | |
// was targeted. Otherwise e.g. if app logs a message in response to a page scroll, the Emscripten log | |
// message box could cause to scroll, generating a new (bubbled) scroll message, causing a new log print, | |
// causing a new scroll, etc.. | |
return; | |
} | |
var scrollPos = JSEvents.pageScrollPos(); | |
var uiEvent = JSEvents.uiEvent; | |
HEAP32[((uiEvent)>>2)]=e.detail; | |
HEAP32[(((uiEvent)+(4))>>2)]=document.body.clientWidth; | |
HEAP32[(((uiEvent)+(8))>>2)]=document.body.clientHeight; | |
HEAP32[(((uiEvent)+(12))>>2)]=window.innerWidth; | |
HEAP32[(((uiEvent)+(16))>>2)]=window.innerHeight; | |
HEAP32[(((uiEvent)+(20))>>2)]=window.outerWidth; | |
HEAP32[(((uiEvent)+(24))>>2)]=window.outerHeight; | |
HEAP32[(((uiEvent)+(28))>>2)]=scrollPos[0]; | |
HEAP32[(((uiEvent)+(32))>>2)]=scrollPos[1]; | |
if (Module['dynCall_iiii'](callbackfunc, eventTypeId, uiEvent, userData)) e.preventDefault(); | |
}; | |
var eventHandler = { | |
target: target, | |
allowsDeferredCalls: false, // Neither scroll or resize events allow running requests inside them. | |
eventTypeString: eventTypeString, | |
callbackfunc: callbackfunc, | |
handlerFunc: uiEventHandlerFunc, | |
useCapture: useCapture | |
}; | |
JSEvents.registerOrRemoveHandler(eventHandler); | |
},getNodeNameForTarget:function (target) { | |
if (!target) return ''; | |
if (target == window) return '#window'; | |
if (target == window.screen) return '#screen'; | |
return (target && target.nodeName) ? target.nodeName : ''; | |
},registerFocusEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { | |
if (!JSEvents.focusEvent) JSEvents.focusEvent = _malloc( 256 ); | |
var focusEventHandlerFunc = function(event) { | |
var e = event || window.event; | |
var nodeName = JSEvents.getNodeNameForTarget(e.target); | |
var id = e.target.id ? e.target.id : ''; | |
var focusEvent = JSEvents.focusEvent; | |
stringToUTF8(nodeName, focusEvent + 0, 128); | |
stringToUTF8(id, focusEvent + 128, 128); | |
if (Module['dynCall_iiii'](callbackfunc, eventTypeId, focusEvent, userData)) e.preventDefault(); | |
}; | |
var eventHandler = { | |
target: JSEvents.findEventTarget(target), | |
allowsDeferredCalls: false, | |
eventTypeString: eventTypeString, | |
callbackfunc: callbackfunc, | |
handlerFunc: focusEventHandlerFunc, | |
useCapture: useCapture | |
}; | |
JSEvents.registerOrRemoveHandler(eventHandler); | |
},tick:function () { | |
if (window['performance'] && window['performance']['now']) return window['performance']['now'](); | |
else return Date.now(); | |
},fillDeviceOrientationEventData:function (eventStruct, e, target) { | |
HEAPF64[((eventStruct)>>3)]=JSEvents.tick(); | |
HEAPF64[(((eventStruct)+(8))>>3)]=e.alpha; | |
HEAPF64[(((eventStruct)+(16))>>3)]=e.beta; | |
HEAPF64[(((eventStruct)+(24))>>3)]=e.gamma; | |
HEAP32[(((eventStruct)+(32))>>2)]=e.absolute; | |
},registerDeviceOrientationEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { | |
if (!JSEvents.deviceOrientationEvent) JSEvents.deviceOrientationEvent = _malloc( 40 ); | |
var deviceOrientationEventHandlerFunc = function(event) { | |
var e = event || window.event; | |
JSEvents.fillDeviceOrientationEventData(JSEvents.deviceOrientationEvent, e, target); // TODO: Thread-safety with respect to emscripten_get_deviceorientation_status() | |
if (Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.deviceOrientationEvent, userData)) e.preventDefault(); | |
}; | |
var eventHandler = { | |
target: JSEvents.findEventTarget(target), | |
allowsDeferredCalls: false, | |
eventTypeString: eventTypeString, | |
callbackfunc: callbackfunc, | |
handlerFunc: deviceOrientationEventHandlerFunc, | |
useCapture: useCapture | |
}; | |
JSEvents.registerOrRemoveHandler(eventHandler); | |
},fillDeviceMotionEventData:function (eventStruct, e, target) { | |
HEAPF64[((eventStruct)>>3)]=JSEvents.tick(); | |
HEAPF64[(((eventStruct)+(8))>>3)]=e.acceleration.x; | |
HEAPF64[(((eventStruct)+(16))>>3)]=e.acceleration.y; | |
HEAPF64[(((eventStruct)+(24))>>3)]=e.acceleration.z; | |
HEAPF64[(((eventStruct)+(32))>>3)]=e.accelerationIncludingGravity.x; | |
HEAPF64[(((eventStruct)+(40))>>3)]=e.accelerationIncludingGravity.y; | |
HEAPF64[(((eventStruct)+(48))>>3)]=e.accelerationIncludingGravity.z; | |
HEAPF64[(((eventStruct)+(56))>>3)]=e.rotationRate.alpha; | |
HEAPF64[(((eventStruct)+(64))>>3)]=e.rotationRate.beta; | |
HEAPF64[(((eventStruct)+(72))>>3)]=e.rotationRate.gamma; | |
},registerDeviceMotionEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { | |
if (!JSEvents.deviceMotionEvent) JSEvents.deviceMotionEvent = _malloc( 80 ); | |
var deviceMotionEventHandlerFunc = function(event) { | |
var e = event || window.event; | |
JSEvents.fillDeviceMotionEventData(JSEvents.deviceMotionEvent, e, target); // TODO: Thread-safety with respect to emscripten_get_devicemotion_status() | |
if (Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.deviceMotionEvent, userData)) e.preventDefault(); | |
}; | |
var eventHandler = { | |
target: JSEvents.findEventTarget(target), | |
allowsDeferredCalls: false, | |
eventTypeString: eventTypeString, | |
callbackfunc: callbackfunc, | |
handlerFunc: deviceMotionEventHandlerFunc, | |
useCapture: useCapture | |
}; | |
JSEvents.registerOrRemoveHandler(eventHandler); | |
},screenOrientation:function () { | |
if (!window.screen) return undefined; | |
return window.screen.orientation || window.screen.mozOrientation || window.screen.webkitOrientation || window.screen.msOrientation; | |
},fillOrientationChangeEventData:function (eventStruct, e) { | |
var orientations = ["portrait-primary", "portrait-secondary", "landscape-primary", "landscape-secondary"]; | |
var orientations2 = ["portrait", "portrait", "landscape", "landscape"]; | |
var orientationString = JSEvents.screenOrientation(); | |
var orientation = orientations.indexOf(orientationString); | |
if (orientation == -1) { | |
orientation = orientations2.indexOf(orientationString); | |
} | |
HEAP32[((eventStruct)>>2)]=1 << orientation; | |
HEAP32[(((eventStruct)+(4))>>2)]=window.orientation; | |
},registerOrientationChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { | |
if (!JSEvents.orientationChangeEvent) JSEvents.orientationChangeEvent = _malloc( 8 ); | |
if (!target) { | |
target = window.screen; // Orientation events need to be captured from 'window.screen' instead of 'window' | |
} else { | |
target = JSEvents.findEventTarget(target); | |
} | |
var orientationChangeEventHandlerFunc = function(event) { | |
var e = event || window.event; | |
var orientationChangeEvent = JSEvents.orientationChangeEvent; | |
JSEvents.fillOrientationChangeEventData(orientationChangeEvent, e); | |
if (Module['dynCall_iiii'](callbackfunc, eventTypeId, orientationChangeEvent, userData)) e.preventDefault(); | |
}; | |
if (eventTypeString == "orientationchange" && window.screen.mozOrientation !== undefined) { | |
eventTypeString = "mozorientationchange"; | |
} | |
var eventHandler = { | |
target: target, | |
allowsDeferredCalls: false, | |
eventTypeString: eventTypeString, | |
callbackfunc: callbackfunc, | |
handlerFunc: orientationChangeEventHandlerFunc, | |
useCapture: useCapture | |
}; | |
JSEvents.registerOrRemoveHandler(eventHandler); | |
},fullscreenEnabled:function () { | |
return document.fullscreenEnabled || document.mozFullScreenEnabled || document.webkitFullscreenEnabled || document.msFullscreenEnabled; | |
},fillFullscreenChangeEventData:function (eventStruct, e) { | |
var fullscreenElement = document.fullscreenElement || document.mozFullScreenElement || document.webkitFullscreenElement || document.msFullscreenElement; | |
var isFullscreen = !!fullscreenElement; | |
HEAP32[((eventStruct)>>2)]=isFullscreen; | |
HEAP32[(((eventStruct)+(4))>>2)]=JSEvents.fullscreenEnabled(); | |
// If transitioning to fullscreen, report info about the element that is now fullscreen. | |
// If transitioning to windowed mode, report info about the element that just was fullscreen. | |
var reportedElement = isFullscreen ? fullscreenElement : JSEvents.previousFullscreenElement; | |
var nodeName = JSEvents.getNodeNameForTarget(reportedElement); | |
var id = (reportedElement && reportedElement.id) ? reportedElement.id : ''; | |
stringToUTF8(nodeName, eventStruct + 8, 128); | |
stringToUTF8(id, eventStruct + 136, 128); | |
HEAP32[(((eventStruct)+(264))>>2)]=reportedElement ? reportedElement.clientWidth : 0; | |
HEAP32[(((eventStruct)+(268))>>2)]=reportedElement ? reportedElement.clientHeight : 0; | |
HEAP32[(((eventStruct)+(272))>>2)]=screen.width; | |
HEAP32[(((eventStruct)+(276))>>2)]=screen.height; | |
if (isFullscreen) { | |
JSEvents.previousFullscreenElement = fullscreenElement; | |
} | |
},registerFullscreenChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { | |
if (!JSEvents.fullscreenChangeEvent) JSEvents.fullscreenChangeEvent = _malloc( 280 ); | |
if (!target) target = document; // Fullscreen change events need to be captured from 'document' by default instead of 'window' | |
else target = JSEvents.findEventTarget(target); | |
var fullscreenChangeEventhandlerFunc = function(event) { | |
var e = event || window.event; | |
var fullscreenChangeEvent = JSEvents.fullscreenChangeEvent; | |
JSEvents.fillFullscreenChangeEventData(fullscreenChangeEvent, e); | |
if (Module['dynCall_iiii'](callbackfunc, eventTypeId, fullscreenChangeEvent, userData)) e.preventDefault(); | |
}; | |
var eventHandler = { | |
target: target, | |
allowsDeferredCalls: false, | |
eventTypeString: eventTypeString, | |
callbackfunc: callbackfunc, | |
handlerFunc: fullscreenChangeEventhandlerFunc, | |
useCapture: useCapture | |
}; | |
JSEvents.registerOrRemoveHandler(eventHandler); | |
},resizeCanvasForFullscreen:function (target, strategy) { | |
var restoreOldStyle = __registerRestoreOldStyle(target); | |
var cssWidth = strategy.softFullscreen ? window.innerWidth : screen.width; | |
var cssHeight = strategy.softFullscreen ? window.innerHeight : screen.height; | |
var rect = target.getBoundingClientRect(); | |
var windowedCssWidth = rect.right - rect.left; | |
var windowedCssHeight = rect.bottom - rect.top; | |
var canvasSize = __get_canvas_element_size(target); | |
var windowedRttWidth = canvasSize[0]; | |
var windowedRttHeight = canvasSize[1]; | |
if (strategy.scaleMode == 3) { | |
__setLetterbox(target, (cssHeight - windowedCssHeight) / 2, (cssWidth - windowedCssWidth) / 2); | |
cssWidth = windowedCssWidth; | |
cssHeight = windowedCssHeight; | |
} else if (strategy.scaleMode == 2) { | |
if (cssWidth*windowedRttHeight < windowedRttWidth*cssHeight) { | |
var desiredCssHeight = windowedRttHeight * cssWidth / windowedRttWidth; | |
__setLetterbox(target, (cssHeight - desiredCssHeight) / 2, 0); | |
cssHeight = desiredCssHeight; | |
} else { | |
var desiredCssWidth = windowedRttWidth * cssHeight / windowedRttHeight; | |
__setLetterbox(target, 0, (cssWidth - desiredCssWidth) / 2); | |
cssWidth = desiredCssWidth; | |
} | |
} | |
// If we are adding padding, must choose a background color or otherwise Chrome will give the | |
// padding a default white color. Do it only if user has not customized their own background color. | |
if (!target.style.backgroundColor) target.style.backgroundColor = 'black'; | |
// IE11 does the same, but requires the color to be set in the document body. | |
if (!document.body.style.backgroundColor) document.body.style.backgroundColor = 'black'; // IE11 | |
// Firefox always shows black letterboxes independent of style color. | |
target.style.width = cssWidth + 'px'; | |
target.style.height = cssHeight + 'px'; | |
if (strategy.filteringMode == 1) { | |
target.style.imageRendering = 'optimizeSpeed'; | |
target.style.imageRendering = '-moz-crisp-edges'; | |
target.style.imageRendering = '-o-crisp-edges'; | |
target.style.imageRendering = '-webkit-optimize-contrast'; | |
target.style.imageRendering = 'optimize-contrast'; | |
target.style.imageRendering = 'crisp-edges'; | |
target.style.imageRendering = 'pixelated'; | |
} | |
var dpiScale = (strategy.canvasResolutionScaleMode == 2) ? window.devicePixelRatio : 1; | |
if (strategy.canvasResolutionScaleMode != 0) { | |
var newWidth = (cssWidth * dpiScale)|0; | |
var newHeight = (cssHeight * dpiScale)|0; | |
__set_canvas_element_size(target, newWidth, newHeight); | |
if (target.GLctxObject) target.GLctxObject.GLctx.viewport(0, 0, newWidth, newHeight); | |
} | |
return restoreOldStyle; | |
},requestFullscreen:function (target, strategy) { | |
// EMSCRIPTEN_FULLSCREEN_SCALE_DEFAULT + EMSCRIPTEN_FULLSCREEN_CANVAS_SCALE_NONE is a mode where no extra logic is performed to the DOM elements. | |
if (strategy.scaleMode != 0 || strategy.canvasResolutionScaleMode != 0) { | |
JSEvents.resizeCanvasForFullscreen(target, strategy); | |
} | |
if (target.requestFullscreen) { | |
target.requestFullscreen(); | |
} else if (target.msRequestFullscreen) { | |
target.msRequestFullscreen(); | |
} else if (target.mozRequestFullScreen) { | |
target.mozRequestFullScreen(); | |
} else if (target.mozRequestFullscreen) { | |
target.mozRequestFullscreen(); | |
} else if (target.webkitRequestFullscreen) { | |
target.webkitRequestFullscreen(Element.ALLOW_KEYBOARD_INPUT); | |
} else { | |
if (typeof JSEvents.fullscreenEnabled() === 'undefined') { | |
return -1; | |
} else { | |
return -3; | |
} | |
} | |
if (strategy.canvasResizedCallback) { | |
Module['dynCall_iiii'](strategy.canvasResizedCallback, 37, 0, strategy.canvasResizedCallbackUserData); | |
} | |
return 0; | |
},fillPointerlockChangeEventData:function (eventStruct, e) { | |
var pointerLockElement = document.pointerLockElement || document.mozPointerLockElement || document.webkitPointerLockElement || document.msPointerLockElement; | |
var isPointerlocked = !!pointerLockElement; | |
HEAP32[((eventStruct)>>2)]=isPointerlocked; | |
var nodeName = JSEvents.getNodeNameForTarget(pointerLockElement); | |
var id = (pointerLockElement && pointerLockElement.id) ? pointerLockElement.id : ''; | |
stringToUTF8(nodeName, eventStruct + 4, 128); | |
stringToUTF8(id, eventStruct + 132, 128); | |
},registerPointerlockChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { | |
if (!JSEvents.pointerlockChangeEvent) JSEvents.pointerlockChangeEvent = _malloc( 260 ); | |
if (!target) target = document; // Pointer lock change events need to be captured from 'document' by default instead of 'window' | |
else target = JSEvents.findEventTarget(target); | |
var pointerlockChangeEventHandlerFunc = function(event) { | |
var e = event || window.event; | |
var pointerlockChangeEvent = JSEvents.pointerlockChangeEvent; | |
JSEvents.fillPointerlockChangeEventData(pointerlockChangeEvent, e); | |
if (Module['dynCall_iiii'](callbackfunc, eventTypeId, pointerlockChangeEvent, userData)) e.preventDefault(); | |
}; | |
var eventHandler = { | |
target: target, | |
allowsDeferredCalls: false, | |
eventTypeString: eventTypeString, | |
callbackfunc: callbackfunc, | |
handlerFunc: pointerlockChangeEventHandlerFunc, | |
useCapture: useCapture | |
}; | |
JSEvents.registerOrRemoveHandler(eventHandler); | |
},registerPointerlockErrorEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { | |
if (!target) target = document; // Pointer lock events need to be captured from 'document' by default instead of 'window' | |
else target = JSEvents.findEventTarget(target); | |
var pointerlockErrorEventHandlerFunc = function(event) { | |
var e = event || window.event; | |
if (Module['dynCall_iiii'](callbackfunc, eventTypeId, 0, userData)) e.preventDefault(); | |
}; | |
var eventHandler = { | |
target: target, | |
allowsDeferredCalls: false, | |
eventTypeString: eventTypeString, | |
callbackfunc: callbackfunc, | |
handlerFunc: pointerlockErrorEventHandlerFunc, | |
useCapture: useCapture | |
}; | |
JSEvents.registerOrRemoveHandler(eventHandler); | |
},requestPointerLock:function (target) { | |
if (target.requestPointerLock) { | |
target.requestPointerLock(); | |
} else if (target.mozRequestPointerLock) { | |
target.mozRequestPointerLock(); | |
} else if (target.webkitRequestPointerLock) { | |
target.webkitRequestPointerLock(); | |
} else if (target.msRequestPointerLock) { | |
target.msRequestPointerLock(); | |
} else { | |
// document.body is known to accept pointer lock, so use that to differentiate if the user passed a bad element, | |
// or if the whole browser just doesn't support the feature. | |
if (document.body.requestPointerLock || document.body.mozRequestPointerLock || document.body.webkitRequestPointerLock || document.body.msRequestPointerLock) { | |
return -3; | |
} else { | |
return -1; | |
} | |
} | |
return 0; | |
},fillVisibilityChangeEventData:function (eventStruct, e) { | |
var visibilityStates = [ "hidden", "visible", "prerender", "unloaded" ]; | |
var visibilityState = visibilityStates.indexOf(document.visibilityState); | |
HEAP32[((eventStruct)>>2)]=document.hidden; | |
HEAP32[(((eventStruct)+(4))>>2)]=visibilityState; | |
},registerVisibilityChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { | |
if (!JSEvents.visibilityChangeEvent) JSEvents.visibilityChangeEvent = _malloc( 8 ); | |
if (!target) target = document; // Visibility change events need to be captured from 'document' by default instead of 'window' | |
else target = JSEvents.findEventTarget(target); | |
var visibilityChangeEventHandlerFunc = function(event) { | |
var e = event || window.event; | |
var visibilityChangeEvent = JSEvents.visibilityChangeEvent; | |
JSEvents.fillVisibilityChangeEventData(visibilityChangeEvent, e); | |
if (Module['dynCall_iiii'](callbackfunc, eventTypeId, visibilityChangeEvent, userData)) e.preventDefault(); | |
}; | |
var eventHandler = { | |
target: target, | |
allowsDeferredCalls: false, | |
eventTypeString: eventTypeString, | |
callbackfunc: callbackfunc, | |
handlerFunc: visibilityChangeEventHandlerFunc, | |
useCapture: useCapture | |
}; | |
JSEvents.registerOrRemoveHandler(eventHandler); | |
},registerTouchEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { | |
if (!JSEvents.touchEvent) JSEvents.touchEvent = _malloc( 1684 ); | |
target = JSEvents.findEventTarget(target); | |
var touchEventHandlerFunc = function(event) { | |
var e = event || window.event; | |
var touches = {}; | |
for(var i = 0; i < e.touches.length; ++i) { | |
var touch = e.touches[i]; | |
touches[touch.identifier] = touch; | |
} | |
for(var i = 0; i < e.changedTouches.length; ++i) { | |
var touch = e.changedTouches[i]; | |
touches[touch.identifier] = touch; | |
touch.changed = true; | |
} | |
for(var i = 0; i < e.targetTouches.length; ++i) { | |
var touch = e.targetTouches[i]; | |
touches[touch.identifier].onTarget = true; | |
} | |
var touchEvent = JSEvents.touchEvent; | |
var ptr = touchEvent; | |
HEAP32[(((ptr)+(4))>>2)]=e.ctrlKey; | |
HEAP32[(((ptr)+(8))>>2)]=e.shiftKey; | |
HEAP32[(((ptr)+(12))>>2)]=e.altKey; | |
HEAP32[(((ptr)+(16))>>2)]=e.metaKey; | |
ptr += 20; // Advance to the start of the touch array. | |
var canvasRect = Module['canvas'] ? Module['canvas'].getBoundingClientRect() : undefined; | |
var targetRect = JSEvents.getBoundingClientRectOrZeros(target); | |
var numTouches = 0; | |
for(var i in touches) { | |
var t = touches[i]; | |
HEAP32[((ptr)>>2)]=t.identifier; | |
HEAP32[(((ptr)+(4))>>2)]=t.screenX; | |
HEAP32[(((ptr)+(8))>>2)]=t.screenY; | |
HEAP32[(((ptr)+(12))>>2)]=t.clientX; | |
HEAP32[(((ptr)+(16))>>2)]=t.clientY; | |
HEAP32[(((ptr)+(20))>>2)]=t.pageX; | |
HEAP32[(((ptr)+(24))>>2)]=t.pageY; | |
HEAP32[(((ptr)+(28))>>2)]=t.changed; | |
HEAP32[(((ptr)+(32))>>2)]=t.onTarget; | |
if (canvasRect) { | |
HEAP32[(((ptr)+(44))>>2)]=t.clientX - canvasRect.left; | |
HEAP32[(((ptr)+(48))>>2)]=t.clientY - canvasRect.top; | |
} else { | |
HEAP32[(((ptr)+(44))>>2)]=0; | |
HEAP32[(((ptr)+(48))>>2)]=0; | |
} | |
HEAP32[(((ptr)+(36))>>2)]=t.clientX - targetRect.left; | |
HEAP32[(((ptr)+(40))>>2)]=t.clientY - targetRect.top; | |
ptr += 52; | |
if (++numTouches >= 32) { | |
break; | |
} | |
} | |
HEAP32[((touchEvent)>>2)]=numTouches; | |
if (Module['dynCall_iiii'](callbackfunc, eventTypeId, touchEvent, userData)) e.preventDefault(); | |
}; | |
var eventHandler = { | |
target: target, | |
allowsDeferredCalls: eventTypeString == 'touchstart' || eventTypeString == 'touchend', | |
eventTypeString: eventTypeString, | |
callbackfunc: callbackfunc, | |
handlerFunc: touchEventHandlerFunc, | |
useCapture: useCapture | |
}; | |
JSEvents.registerOrRemoveHandler(eventHandler); | |
},fillGamepadEventData:function (eventStruct, e) { | |
HEAPF64[((eventStruct)>>3)]=e.timestamp; | |
for(var i = 0; i < e.axes.length; ++i) { | |
HEAPF64[(((eventStruct+i*8)+(16))>>3)]=e.axes[i]; | |
} | |
for(var i = 0; i < e.buttons.length; ++i) { | |
if (typeof(e.buttons[i]) === 'object') { | |
HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i].value; | |
} else { | |
HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i]; | |
} | |
} | |
for(var i = 0; i < e.buttons.length; ++i) { | |
if (typeof(e.buttons[i]) === 'object') { | |
HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i].pressed; | |
} else { | |
HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i] == 1.0; | |
} | |
} | |
HEAP32[(((eventStruct)+(1296))>>2)]=e.connected; | |
HEAP32[(((eventStruct)+(1300))>>2)]=e.index; | |
HEAP32[(((eventStruct)+(8))>>2)]=e.axes.length; | |
HEAP32[(((eventStruct)+(12))>>2)]=e.buttons.length; | |
stringToUTF8(e.id, eventStruct + 1304, 64); | |
stringToUTF8(e.mapping, eventStruct + 1368, 64); | |
},registerGamepadEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { | |
if (!JSEvents.gamepadEvent) JSEvents.gamepadEvent = _malloc( 1432 ); | |
var gamepadEventHandlerFunc = function(event) { | |
var e = event || window.event; | |
var gamepadEvent = JSEvents.gamepadEvent; | |
JSEvents.fillGamepadEventData(gamepadEvent, e.gamepad); | |
if (Module['dynCall_iiii'](callbackfunc, eventTypeId, gamepadEvent, userData)) e.preventDefault(); | |
}; | |
var eventHandler = { | |
target: JSEvents.findEventTarget(target), | |
allowsDeferredCalls: true, | |
eventTypeString: eventTypeString, | |
callbackfunc: callbackfunc, | |
handlerFunc: gamepadEventHandlerFunc, | |
useCapture: useCapture | |
}; | |
JSEvents.registerOrRemoveHandler(eventHandler); | |
},registerBeforeUnloadEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { | |
var beforeUnloadEventHandlerFunc = function(event) { | |
var e = event || window.event; | |
// Note: This is always called on the main browser thread, since it needs synchronously return a value! | |
var confirmationMessage = Module['dynCall_iiii'](callbackfunc, eventTypeId, 0, userData); | |
if (confirmationMessage) { | |
confirmationMessage = Pointer_stringify(confirmationMessage); | |
} | |
if (confirmationMessage) { | |
e.preventDefault(); | |
e.returnValue = confirmationMessage; | |
return confirmationMessage; | |
} | |
}; | |
var eventHandler = { | |
target: JSEvents.findEventTarget(target), | |
allowsDeferredCalls: false, | |
eventTypeString: eventTypeString, | |
callbackfunc: callbackfunc, | |
handlerFunc: beforeUnloadEventHandlerFunc, | |
useCapture: useCapture | |
}; | |
JSEvents.registerOrRemoveHandler(eventHandler); | |
},battery:function () { return navigator.battery || navigator.mozBattery || navigator.webkitBattery; },fillBatteryEventData:function (eventStruct, e) { | |
HEAPF64[((eventStruct)>>3)]=e.chargingTime; | |
HEAPF64[(((eventStruct)+(8))>>3)]=e.dischargingTime; | |
HEAPF64[(((eventStruct)+(16))>>3)]=e.level; | |
HEAP32[(((eventStruct)+(24))>>2)]=e.charging; | |
},registerBatteryEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { | |
if (!JSEvents.batteryEvent) JSEvents.batteryEvent = _malloc( 32 ); | |
var batteryEventHandlerFunc = function(event) { | |
var e = event || window.event; | |
var batteryEvent = JSEvents.batteryEvent; | |
JSEvents.fillBatteryEventData(batteryEvent, JSEvents.battery()); | |
if (Module['dynCall_iiii'](callbackfunc, eventTypeId, batteryEvent, userData)) e.preventDefault(); | |
}; | |
var eventHandler = { | |
target: JSEvents.findEventTarget(target), | |
allowsDeferredCalls: false, | |
eventTypeString: eventTypeString, | |
callbackfunc: callbackfunc, | |
handlerFunc: batteryEventHandlerFunc, | |
useCapture: useCapture | |
}; | |
JSEvents.registerOrRemoveHandler(eventHandler); | |
},registerWebGlEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { | |
if (!target) target = Module['canvas']; | |
var webGlEventHandlerFunc = function(event) { | |
var e = event || window.event; | |
if (Module['dynCall_iiii'](callbackfunc, eventTypeId, 0, userData)) e.preventDefault(); | |
}; | |
var eventHandler = { | |
target: JSEvents.findEventTarget(target), | |
allowsDeferredCalls: false, | |
eventTypeString: eventTypeString, | |
callbackfunc: callbackfunc, | |
handlerFunc: webGlEventHandlerFunc, | |
useCapture: useCapture | |
}; | |
JSEvents.registerOrRemoveHandler(eventHandler); | |
}};var __currentFullscreenStrategy={};function _emscripten_exit_fullscreen() { | |
if (typeof JSEvents.fullscreenEnabled() === 'undefined') return -1; | |
// Make sure no queued up calls will fire after this. | |
JSEvents.removeDeferredCalls(JSEvents.requestFullscreen); | |
if (document.exitFullscreen) { | |
document.exitFullscreen(); | |
} else if (document.msExitFullscreen) { | |
document.msExitFullscreen(); | |
} else if (document.mozCancelFullScreen) { | |
document.mozCancelFullScreen(); | |
} else if (document.webkitExitFullscreen) { | |
document.webkitExitFullscreen(); | |
} else { | |
return -1; | |
} | |
if (__currentFullscreenStrategy.canvasResizedCallback) { | |
Module['dynCall_iiii'](__currentFullscreenStrategy.canvasResizedCallback, 37, 0, __currentFullscreenStrategy.canvasResizedCallbackUserData); | |
} | |
return 0; | |
} | |
function _emscripten_exit_pointerlock() { | |
// Make sure no queued up calls will fire after this. | |
JSEvents.removeDeferredCalls(JSEvents.requestPointerLock); | |
if (document.exitPointerLock) { | |
document.exitPointerLock(); | |
} else if (document.msExitPointerLock) { | |
document.msExitPointerLock(); | |
} else if (document.mozExitPointerLock) { | |
document.mozExitPointerLock(); | |
} else if (document.webkitExitPointerLock) { | |
document.webkitExitPointerLock(); | |
} else { | |
return -1; | |
} | |
return 0; | |
} | |
function _emscripten_get_device_pixel_ratio() { | |
return window.devicePixelRatio || 1.0; | |
} | |
function _emscripten_hide_mouse() { | |
var styleSheet = document.styleSheets[0]; | |
var rules = styleSheet.cssRules; | |
for (var i = 0; i < rules.length; i++) { | |
if (rules[i].cssText.substr(0, 6) == 'canvas') { | |
styleSheet.deleteRule(i); | |
i--; | |
} | |
} | |
styleSheet.insertRule('canvas.emscripten { border: 1px solid black; cursor: none; }', 0); | |
} | |
function __setLetterbox(element, topBottom, leftRight) { | |
if (JSEvents.isInternetExplorer()) { | |
// Cannot use padding on IE11, because IE11 computes padding in addition to the size, unlike | |
// other browsers, which treat padding to be part of the size. | |
// e.g. | |
// FF, Chrome: If CSS size = 1920x1080, padding-leftright = 460, padding-topbottomx40, then content size = (1920 - 2*460) x (1080-2*40) = 1000x1000px, and total element size = 1920x1080px. | |
// IE11: If CSS size = 1920x1080, padding-leftright = 460, padding-topbottomx40, then content size = 1920x1080px and total element size = (1920+2*460) x (1080+2*40)px. | |
// IE11 treats margin like Chrome and FF treat padding. | |
element.style.marginLeft = element.style.marginRight = leftRight + 'px'; | |
element.style.marginTop = element.style.marginBottom = topBottom + 'px'; | |
} else { | |
// Cannot use margin to specify letterboxes in FF or Chrome, since those ignore margins in fullscreen mode. | |
element.style.paddingLeft = element.style.paddingRight = leftRight + 'px'; | |
element.style.paddingTop = element.style.paddingBottom = topBottom + 'px'; | |
} | |
}function __emscripten_do_request_fullscreen(target, strategy) { | |
if (typeof JSEvents.fullscreenEnabled() === 'undefined') return -1; | |
if (!JSEvents.fullscreenEnabled()) return -3; | |
if (!target) target = '#canvas'; | |
target = JSEvents.findEventTarget(target); | |
if (!target) return -4; | |
if (!target.requestFullscreen && !target.msRequestFullscreen && !target.mozRequestFullScreen && !target.mozRequestFullscreen && !target.webkitRequestFullscreen) { | |
return -3; | |
} | |
var canPerformRequests = JSEvents.canPerformEventHandlerRequests(); | |
// Queue this function call if we're not currently in an event handler and the user saw it appropriate to do so. | |
if (!canPerformRequests) { | |
if (strategy.deferUntilInEventHandler) { | |
JSEvents.deferCall(JSEvents.requestFullscreen, 1 /* priority over pointer lock */, [target, strategy]); | |
return 1; | |
} else { | |
return -2; | |
} | |
} | |
return JSEvents.requestFullscreen(target, strategy); | |
}function _emscripten_request_fullscreen(target, deferUntilInEventHandler) { | |
var strategy = {}; | |
// These options perform no added logic, but just bare request fullscreen. | |
strategy.scaleMode = 0; | |
strategy.canvasResolutionScaleMode = 0; | |
strategy.filteringMode = 0; | |
strategy.deferUntilInEventHandler = deferUntilInEventHandler; | |
strategy.canvasResizedCallbackTargetThread = 2; | |
return __emscripten_do_request_fullscreen(target, strategy); | |
} | |
function _emscripten_request_pointerlock(target, deferUntilInEventHandler) { | |
if (!target) target = '#canvas'; | |
target = JSEvents.findEventTarget(target); | |
if (!target) return -4; | |
if (!target.requestPointerLock && !target.mozRequestPointerLock && !target.webkitRequestPointerLock && !target.msRequestPointerLock) { | |
return -1; | |
} | |
var canPerformRequests = JSEvents.canPerformEventHandlerRequests(); | |
// Queue this function call if we're not currently in an event handler and the user saw it appropriate to do so. | |
if (!canPerformRequests) { | |
if (deferUntilInEventHandler) { | |
JSEvents.deferCall(JSEvents.requestPointerLock, 2 /* priority below fullscreen */, [target]); | |
return 1; | |
} else { | |
return -2; | |
} | |
} | |
return JSEvents.requestPointerLock(target); | |
} | |
function _emscripten_set_element_css_size(target, width, height) { | |
if (target) target = JSEvents.findEventTarget(target); | |
else target = Module['canvas']; | |
if (!target) return -4; | |
target.style.width = width + "px"; | |
target.style.height = height + "px"; | |
return 0; | |
} | |
function _emscripten_set_fullscreenchange_callback() { | |
err('missing function: emscripten_set_fullscreenchange_callback'); abort(-1); | |
} | |
function _emscripten_set_keydown_callback() { | |
err('missing function: emscripten_set_keydown_callback'); abort(-1); | |
} | |
function _emscripten_set_keyup_callback() { | |
err('missing function: emscripten_set_keyup_callback'); abort(-1); | |
} | |
function _emscripten_set_mousedown_callback() { | |
err('missing function: emscripten_set_mousedown_callback'); abort(-1); | |
} | |
function _emscripten_set_mousemove_callback() { | |
err('missing function: emscripten_set_mousemove_callback'); abort(-1); | |
} | |
function _emscripten_set_mouseup_callback() { | |
err('missing function: emscripten_set_mouseup_callback'); abort(-1); | |
} | |
function _emscripten_set_pointerlockchange_callback() { | |
err('missing function: emscripten_set_pointerlockchange_callback'); abort(-1); | |
} | |
function _emscripten_set_touchcancel_callback() { | |
err('missing function: emscripten_set_touchcancel_callback'); abort(-1); | |
} | |
function _emscripten_set_touchend_callback() { | |
err('missing function: emscripten_set_touchend_callback'); abort(-1); | |
} | |
function _emscripten_set_touchmove_callback() { | |
err('missing function: emscripten_set_touchmove_callback'); abort(-1); | |
} | |
function _emscripten_set_touchstart_callback() { | |
err('missing function: emscripten_set_touchstart_callback'); abort(-1); | |
} | |
function _getenv(name) { | |
// char *getenv(const char *name); | |
// http://pubs.opengroup.org/onlinepubs/009695399/functions/getenv.html | |
if (name === 0) return 0; | |
name = Pointer_stringify(name); | |
if (!ENV.hasOwnProperty(name)) return 0; | |
if (_getenv.ret) _free(_getenv.ret); | |
_getenv.ret = allocateUTF8(ENV[name]); | |
return _getenv.ret; | |
} | |
function _llvm_trap() { | |
abort('trap!'); | |
} | |
function _emscripten_memcpy_big(dest, src, num) { | |
HEAPU8.set(HEAPU8.subarray(src, src+num), dest); | |
return dest; | |
} | |
function _usleep(useconds) { | |
// int usleep(useconds_t useconds); | |
// http://pubs.opengroup.org/onlinepubs/000095399/functions/usleep.html | |
// We're single-threaded, so use a busy loop. Super-ugly. | |
var msec = useconds / 1000; | |
if ((ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && self['performance'] && self['performance']['now']) { | |
var start = self['performance']['now'](); | |
while (self['performance']['now']() - start < msec) { | |
// Do nothing. | |
} | |
} else { | |
var start = Date.now(); | |
while (Date.now() - start < msec) { | |
// Do nothing. | |
} | |
} | |
return 0; | |
}function _nanosleep(rqtp, rmtp) { | |
// int nanosleep(const struct timespec *rqtp, struct timespec *rmtp); | |
var seconds = HEAP32[((rqtp)>>2)]; | |
var nanoseconds = HEAP32[(((rqtp)+(4))>>2)]; | |
if (rmtp !== 0) { | |
HEAP32[((rmtp)>>2)]=0; | |
HEAP32[(((rmtp)+(4))>>2)]=0; | |
} | |
return _usleep((seconds * 1e6) + (nanoseconds / 1000)); | |
} | |
function _pthread_cond_destroy() { return 0; } | |
function _pthread_cond_init() { return 0; } | |
function _pthread_cond_signal() { return 0; } | |
function _pthread_cond_wait() { return 0; } | |
function _pthread_condattr_destroy() { return 0; } | |
function _pthread_condattr_init() { return 0; } | |
function _pthread_condattr_setclock() { return 0; } | |
function _pthread_mutex_destroy() {} | |
function _pthread_mutex_init() {} | |
function _pthread_mutexattr_destroy() {} | |
function _pthread_mutexattr_init() {} | |
function _pthread_mutexattr_settype() {} | |
function _pthread_rwlock_rdlock() { return 0; } | |
function _pthread_rwlock_unlock() { return 0; } | |
FS.staticInit();__ATINIT__.unshift(function() { if (!Module["noFSInit"] && !FS.init.initialized) FS.init() });__ATMAIN__.push(function() { FS.ignorePermissions = false });__ATEXIT__.push(function() { FS.quit() });; | |
__ATINIT__.unshift(function() { TTY.init() });__ATEXIT__.push(function() { TTY.shutdown() });; | |
if (ENVIRONMENT_IS_NODE) { var fs = require("fs"); var NODEJS_PATH = require("path"); NODEFS.staticInit(); }; | |
Module["requestFullScreen"] = function Module_requestFullScreen(lockPointer, resizeCanvas, vrDevice) { err("Module.requestFullScreen is deprecated. Please call Module.requestFullscreen instead."); Module["requestFullScreen"] = Module["requestFullscreen"]; Browser.requestFullScreen(lockPointer, resizeCanvas, vrDevice) }; | |
Module["requestFullscreen"] = function Module_requestFullscreen(lockPointer, resizeCanvas, vrDevice) { Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice) }; | |
Module["requestAnimationFrame"] = function Module_requestAnimationFrame(func) { Browser.requestAnimationFrame(func) }; | |
Module["setCanvasSize"] = function Module_setCanvasSize(width, height, noUpdates) { Browser.setCanvasSize(width, height, noUpdates) }; | |
Module["pauseMainLoop"] = function Module_pauseMainLoop() { Browser.mainLoop.pause() }; | |
Module["resumeMainLoop"] = function Module_resumeMainLoop() { Browser.mainLoop.resume() }; | |
Module["getUserMedia"] = function Module_getUserMedia() { Browser.getUserMedia() } | |
Module["createContext"] = function Module_createContext(canvas, useWebGL, setInModule, webGLContextAttributes) { return Browser.createContext(canvas, useWebGL, setInModule, webGLContextAttributes) }; | |
if (ENVIRONMENT_IS_NODE) { | |
_emscripten_get_now = function _emscripten_get_now_actual() { | |
var t = process['hrtime'](); | |
return t[0] * 1e3 + t[1] / 1e6; | |
}; | |
} else if (typeof dateNow !== 'undefined') { | |
_emscripten_get_now = dateNow; | |
} else if (typeof self === 'object' && self['performance'] && typeof self['performance']['now'] === 'function') { | |
_emscripten_get_now = function() { return self['performance']['now'](); }; | |
} else if (typeof performance === 'object' && typeof performance['now'] === 'function') { | |
_emscripten_get_now = function() { return performance['now'](); }; | |
} else { | |
_emscripten_get_now = Date.now; | |
}; | |
DYNAMICTOP_PTR = staticAlloc(4); | |
STACK_BASE = STACKTOP = alignMemory(STATICTOP); | |
STACK_MAX = STACK_BASE + TOTAL_STACK; | |
DYNAMIC_BASE = alignMemory(STACK_MAX); | |
HEAP32[DYNAMICTOP_PTR>>2] = DYNAMIC_BASE; | |
staticSealed = true; // seal the static portion of memory | |
assert(DYNAMIC_BASE < TOTAL_MEMORY, "TOTAL_MEMORY not big enough for stack"); | |
var ASSERTIONS = true; | |
// Copyright 2017 The Emscripten Authors. All rights reserved. | |
// Emscripten is available under two separate licenses, the MIT license and the | |
// University of Illinois/NCSA Open Source License. Both these licenses can be | |
// found in the LICENSE file. | |
/** @type {function(string, boolean=, number=)} */ | |
function intArrayFromString(stringy, dontAddNull, length) { | |
var len = length > 0 ? length : lengthBytesUTF8(stringy)+1; | |
var u8array = new Array(len); | |
var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length); | |
if (dontAddNull) u8array.length = numBytesWritten; | |
return u8array; | |
} | |
function intArrayToString(array) { | |
var ret = []; | |
for (var i = 0; i < array.length; i++) { | |
var chr = array[i]; | |
if (chr > 0xFF) { | |
if (ASSERTIONS) { | |
assert(false, 'Character code ' + chr + ' (' + String.fromCharCode(chr) + ') at offset ' + i + ' not in 0x00-0xFF.'); | |
} | |
chr &= 0xFF; | |
} | |
ret.push(String.fromCharCode(chr)); | |
} | |
return ret.join(''); | |
} | |
function nullFunc_i(x) { err("Invalid function pointer called with signature 'i'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) } | |
function nullFunc_ii(x) { err("Invalid function pointer called with signature 'ii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) } | |
function nullFunc_iii(x) { err("Invalid function pointer called with signature 'iii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) } | |
function nullFunc_iiii(x) { err("Invalid function pointer called with signature 'iiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) } | |
function nullFunc_ji(x) { err("Invalid function pointer called with signature 'ji'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) } | |
function nullFunc_v(x) { err("Invalid function pointer called with signature 'v'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) } | |
function nullFunc_vi(x) { err("Invalid function pointer called with signature 'vi'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) } | |
function nullFunc_vidd(x) { err("Invalid function pointer called with signature 'vidd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) } | |
function nullFunc_vii(x) { err("Invalid function pointer called with signature 'vii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) } | |
function nullFunc_viii(x) { err("Invalid function pointer called with signature 'viii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) } | |
function nullFunc_viiii(x) { err("Invalid function pointer called with signature 'viiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) } | |
function nullFunc_viiiii(x) { err("Invalid function pointer called with signature 'viiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) } | |
function nullFunc_viiiiiii(x) { err("Invalid function pointer called with signature 'viiiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) } | |
Module['wasmTableSize'] = 6400; | |
Module['wasmMaxTableSize'] = 6400; | |
function invoke_i(index) { | |
var sp = stackSave(); | |
try { | |
return Module["dynCall_i"](index); | |
} catch(e) { | |
stackRestore(sp); | |
if (typeof e !== 'number' && e !== 'longjmp') throw e; | |
Module["setThrew"](1, 0); | |
} | |
} | |
function invoke_ii(index,a1) { | |
var sp = stackSave(); | |
try { | |
return Module["dynCall_ii"](index,a1); | |
} catch(e) { | |
stackRestore(sp); | |
if (typeof e !== 'number' && e !== 'longjmp') throw e; | |
Module["setThrew"](1, 0); | |
} | |
} | |
function invoke_iii(index,a1,a2) { | |
var sp = stackSave(); | |
try { | |
return Module["dynCall_iii"](index,a1,a2); | |
} catch(e) { | |
stackRestore(sp); | |
if (typeof e !== 'number' && e !== 'longjmp') throw e; | |
Module["setThrew"](1, 0); | |
} | |
} | |
function invoke_iiii(index,a1,a2,a3) { | |
var sp = stackSave(); | |
try { | |
return Module["dynCall_iiii"](index,a1,a2,a3); | |
} catch(e) { | |
stackRestore(sp); | |
if (typeof e !== 'number' && e !== 'longjmp') throw e; | |
Module["setThrew"](1, 0); | |
} | |
} | |
function invoke_v(index) { | |
var sp = stackSave(); | |
try { | |
Module["dynCall_v"](index); | |
} catch(e) { | |
stackRestore(sp); | |
if (typeof e !== 'number' && e !== 'longjmp') throw e; | |
Module["setThrew"](1, 0); | |
} | |
} | |
function invoke_vi(index,a1) { | |
var sp = stackSave(); | |
try { | |
Module["dynCall_vi"](index,a1); | |
} catch(e) { | |
stackRestore(sp); | |
if (typeof e !== 'number' && e !== 'longjmp') throw e; | |
Module["setThrew"](1, 0); | |
} | |
} | |
function invoke_vidd(index,a1,a2,a3) { | |
var sp = stackSave(); | |
try { | |
Module["dynCall_vidd"](index,a1,a2,a3); | |
} catch(e) { | |
stackRestore(sp); | |
if (typeof e !== 'number' && e !== 'longjmp') throw e; | |
Module["setThrew"](1, 0); | |
} | |
} | |
function invoke_vii(index,a1,a2) { | |
var sp = stackSave(); | |
try { | |
Module["dynCall_vii"](index,a1,a2); | |
} catch(e) { | |
stackRestore(sp); | |
if (typeof e !== 'number' && e !== 'longjmp') throw e; | |
Module["setThrew"](1, 0); | |
} | |
} | |
function invoke_viii(index,a1,a2,a3) { | |
var sp = stackSave(); | |
try { | |
Module["dynCall_viii"](index,a1,a2,a3); | |
} catch(e) { | |
stackRestore(sp); | |
if (typeof e !== 'number' && e !== 'longjmp') throw e; | |
Module["setThrew"](1, 0); | |
} | |
} | |
function invoke_viiii(index,a1,a2,a3,a4) { | |
var sp = stackSave(); | |
try { | |
Module["dynCall_viiii"](index,a1,a2,a3,a4); | |
} catch(e) { | |
stackRestore(sp); | |
if (typeof e !== 'number' && e !== 'longjmp') throw e; | |
Module["setThrew"](1, 0); | |
} | |
} | |
function invoke_viiiii(index,a1,a2,a3,a4,a5) { | |
var sp = stackSave(); | |
try { | |
Module["dynCall_viiiii"](index,a1,a2,a3,a4,a5); | |
} catch(e) { | |
stackRestore(sp); | |
if (typeof e !== 'number' && e !== 'longjmp') throw e; | |
Module["setThrew"](1, 0); | |
} | |
} | |
function invoke_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7) { | |
var sp = stackSave(); | |
try { | |
Module["dynCall_viiiiiii"](index,a1,a2,a3,a4,a5,a6,a7); | |
} catch(e) { | |
stackRestore(sp); | |
if (typeof e !== 'number' && e !== 'longjmp') throw e; | |
Module["setThrew"](1, 0); | |
} | |
} | |
Module.asmGlobalArg = {}; | |
Module.asmLibraryArg = { "abort": abort, "assert": assert, "enlargeMemory": enlargeMemory, "getTotalMemory": getTotalMemory, "setTempRet0": setTempRet0, "getTempRet0": getTempRet0, "abortOnCannotGrowMemory": abortOnCannotGrowMemory, "abortStackOverflow": abortStackOverflow, "nullFunc_i": nullFunc_i, "nullFunc_ii": nullFunc_ii, "nullFunc_iii": nullFunc_iii, "nullFunc_iiii": nullFunc_iiii, "nullFunc_ji": nullFunc_ji, "nullFunc_v": nullFunc_v, "nullFunc_vi": nullFunc_vi, "nullFunc_vidd": nullFunc_vidd, "nullFunc_vii": nullFunc_vii, "nullFunc_viii": nullFunc_viii, "nullFunc_viiii": nullFunc_viiii, "nullFunc_viiiii": nullFunc_viiiii, "nullFunc_viiiiiii": nullFunc_viiiiiii, "invoke_i": invoke_i, "invoke_ii": invoke_ii, "invoke_iii": invoke_iii, "invoke_iiii": invoke_iiii, "invoke_v": invoke_v, "invoke_vi": invoke_vi, "invoke_vidd": invoke_vidd, "invoke_vii": invoke_vii, "invoke_viii": invoke_viii, "invoke_viiii": invoke_viiii, "invoke_viiiii": invoke_viiiii, "invoke_viiiiiii": invoke_viiiiiii, "__Unwind_Backtrace": __Unwind_Backtrace, "__Unwind_FindEnclosingFunction": __Unwind_FindEnclosingFunction, "__Unwind_GetIPInfo": __Unwind_GetIPInfo, "__ZSt18uncaught_exceptionv": __ZSt18uncaught_exceptionv, "___buildEnvironment": ___buildEnvironment, "___cxa_allocate_exception": ___cxa_allocate_exception, "___cxa_find_matching_catch": ___cxa_find_matching_catch, "___cxa_find_matching_catch_2": ___cxa_find_matching_catch_2, "___cxa_find_matching_catch_3": ___cxa_find_matching_catch_3, "___cxa_free_exception": ___cxa_free_exception, "___cxa_throw": ___cxa_throw, "___gxx_personality_v0": ___gxx_personality_v0, "___lock": ___lock, "___resumeException": ___resumeException, "___setErrNo": ___setErrNo, "___syscall140": ___syscall140, "___syscall146": ___syscall146, "___syscall4": ___syscall4, "___syscall54": ___syscall54, "___syscall6": ___syscall6, "___unlock": ___unlock, "__emscripten_do_request_fullscreen": __emscripten_do_request_fullscreen, "__emscripten_traverse_stack": __emscripten_traverse_stack, "__get_canvas_element_size": __get_canvas_element_size, "__setLetterbox": __setLetterbox, "__set_canvas_element_size": __set_canvas_element_size, "_abort": _abort, "_dladdr": _dladdr, "_dlopen": _dlopen, "_emscripten_asm_const_v": _emscripten_asm_const_v, "_emscripten_cancel_main_loop": _emscripten_cancel_main_loop, "_emscripten_exit_fullscreen": _emscripten_exit_fullscreen, "_emscripten_exit_pointerlock": _emscripten_exit_pointerlock, "_emscripten_get_callstack_js": _emscripten_get_callstack_js, "_emscripten_get_canvas_element_size": _emscripten_get_canvas_element_size, "_emscripten_get_device_pixel_ratio": _emscripten_get_device_pixel_ratio, "_emscripten_get_now": _emscripten_get_now, "_emscripten_hide_mouse": _emscripten_hide_mouse, "_emscripten_memcpy_big": _emscripten_memcpy_big, "_emscripten_request_fullscreen": _emscripten_request_fullscreen, "_emscripten_request_pointerlock": _emscripten_request_pointerlock, "_emscripten_set_canvas_element_size": _emscripten_set_canvas_element_size, "_emscripten_set_element_css_size": _emscripten_set_element_css_size, "_emscripten_set_fullscreenchange_callback": _emscripten_set_fullscreenchange_callback, "_emscripten_set_keydown_callback": _emscripten_set_keydown_callback, "_emscripten_set_keyup_callback": _emscripten_set_keyup_callback, "_emscripten_set_main_loop": _emscripten_set_main_loop, "_emscripten_set_main_loop_timing": _emscripten_set_main_loop_timing, "_emscripten_set_mousedown_callback": _emscripten_set_mousedown_callback, "_emscripten_set_mousemove_callback": _emscripten_set_mousemove_callback, "_emscripten_set_mouseup_callback": _emscripten_set_mouseup_callback, "_emscripten_set_pointerlockchange_callback": _emscripten_set_pointerlockchange_callback, "_emscripten_set_touchcancel_callback": _emscripten_set_touchcancel_callback, "_emscripten_set_touchend_callback": _emscripten_set_touchend_callback, "_emscripten_set_touchmove_callback": _emscripten_set_touchmove_callback, "_emscripten_set_touchstart_callback": _emscripten_set_touchstart_callback, "_getenv": _getenv, "_llvm_trap": _llvm_trap, "_nanosleep": _nanosleep, "_pthread_cond_destroy": _pthread_cond_destroy, "_pthread_cond_init": _pthread_cond_init, "_pthread_cond_signal": _pthread_cond_signal, "_pthread_cond_wait": _pthread_cond_wait, "_pthread_condattr_destroy": _pthread_condattr_destroy, "_pthread_condattr_init": _pthread_condattr_init, "_pthread_condattr_setclock": _pthread_condattr_setclock, "_pthread_mutex_destroy": _pthread_mutex_destroy, "_pthread_mutex_init": _pthread_mutex_init, "_pthread_mutexattr_destroy": _pthread_mutexattr_destroy, "_pthread_mutexattr_init": _pthread_mutexattr_init, "_pthread_mutexattr_settype": _pthread_mutexattr_settype, "_pthread_rwlock_rdlock": _pthread_rwlock_rdlock, "_pthread_rwlock_unlock": _pthread_rwlock_unlock, "_usleep": _usleep, "DYNAMICTOP_PTR": DYNAMICTOP_PTR, "tempDoublePtr": tempDoublePtr, "STACKTOP": STACKTOP, "STACK_MAX": STACK_MAX }; | |
// EMSCRIPTEN_START_ASM | |
var asm =Module["asm"]// EMSCRIPTEN_END_ASM | |
(Module.asmGlobalArg, Module.asmLibraryArg, buffer); | |
var real____emscripten_environ_constructor = asm["___emscripten_environ_constructor"]; asm["___emscripten_environ_constructor"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return real____emscripten_environ_constructor.apply(null, arguments); | |
}; | |
var real____errno_location = asm["___errno_location"]; asm["___errno_location"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return real____errno_location.apply(null, arguments); | |
}; | |
var real___get_environ = asm["__get_environ"]; asm["__get_environ"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return real___get_environ.apply(null, arguments); | |
}; | |
var real__fflush = asm["_fflush"]; asm["_fflush"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return real__fflush.apply(null, arguments); | |
}; | |
var real__free = asm["_free"]; asm["_free"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return real__free.apply(null, arguments); | |
}; | |
var real__htonl = asm["_htonl"]; asm["_htonl"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return real__htonl.apply(null, arguments); | |
}; | |
var real__htons = asm["_htons"]; asm["_htons"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return real__htons.apply(null, arguments); | |
}; | |
var real__llvm_bswap_i16 = asm["_llvm_bswap_i16"]; asm["_llvm_bswap_i16"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return real__llvm_bswap_i16.apply(null, arguments); | |
}; | |
var real__llvm_bswap_i32 = asm["_llvm_bswap_i32"]; asm["_llvm_bswap_i32"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return real__llvm_bswap_i32.apply(null, arguments); | |
}; | |
var real__llvm_round_f64 = asm["_llvm_round_f64"]; asm["_llvm_round_f64"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return real__llvm_round_f64.apply(null, arguments); | |
}; | |
var real__main = asm["_main"]; asm["_main"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return real__main.apply(null, arguments); | |
}; | |
var real__malloc = asm["_malloc"]; asm["_malloc"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return real__malloc.apply(null, arguments); | |
}; | |
var real__memmove = asm["_memmove"]; asm["_memmove"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return real__memmove.apply(null, arguments); | |
}; | |
var real__ntohs = asm["_ntohs"]; asm["_ntohs"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return real__ntohs.apply(null, arguments); | |
}; | |
var real__pthread_mutex_lock = asm["_pthread_mutex_lock"]; asm["_pthread_mutex_lock"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return real__pthread_mutex_lock.apply(null, arguments); | |
}; | |
var real__pthread_mutex_unlock = asm["_pthread_mutex_unlock"]; asm["_pthread_mutex_unlock"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return real__pthread_mutex_unlock.apply(null, arguments); | |
}; | |
var real__rust_eh_personality = asm["_rust_eh_personality"]; asm["_rust_eh_personality"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return real__rust_eh_personality.apply(null, arguments); | |
}; | |
var real__sbrk = asm["_sbrk"]; asm["_sbrk"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return real__sbrk.apply(null, arguments); | |
}; | |
var real_establishStackSpace = asm["establishStackSpace"]; asm["establishStackSpace"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return real_establishStackSpace.apply(null, arguments); | |
}; | |
var real_setThrew = asm["setThrew"]; asm["setThrew"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return real_setThrew.apply(null, arguments); | |
}; | |
var real_stackAlloc = asm["stackAlloc"]; asm["stackAlloc"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return real_stackAlloc.apply(null, arguments); | |
}; | |
var real_stackRestore = asm["stackRestore"]; asm["stackRestore"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return real_stackRestore.apply(null, arguments); | |
}; | |
var real_stackSave = asm["stackSave"]; asm["stackSave"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return real_stackSave.apply(null, arguments); | |
}; | |
Module["asm"] = asm; | |
var ___emscripten_environ_constructor = Module["___emscripten_environ_constructor"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["___emscripten_environ_constructor"].apply(null, arguments) }; | |
var ___errno_location = Module["___errno_location"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["___errno_location"].apply(null, arguments) }; | |
var __get_environ = Module["__get_environ"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["__get_environ"].apply(null, arguments) }; | |
var _fflush = Module["_fflush"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["_fflush"].apply(null, arguments) }; | |
var _free = Module["_free"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["_free"].apply(null, arguments) }; | |
var _htonl = Module["_htonl"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["_htonl"].apply(null, arguments) }; | |
var _htons = Module["_htons"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["_htons"].apply(null, arguments) }; | |
var _llvm_bswap_i16 = Module["_llvm_bswap_i16"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["_llvm_bswap_i16"].apply(null, arguments) }; | |
var _llvm_bswap_i32 = Module["_llvm_bswap_i32"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["_llvm_bswap_i32"].apply(null, arguments) }; | |
var _llvm_round_f64 = Module["_llvm_round_f64"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["_llvm_round_f64"].apply(null, arguments) }; | |
var _main = Module["_main"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["_main"].apply(null, arguments) }; | |
var _malloc = Module["_malloc"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["_malloc"].apply(null, arguments) }; | |
var _memcpy = Module["_memcpy"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["_memcpy"].apply(null, arguments) }; | |
var _memmove = Module["_memmove"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["_memmove"].apply(null, arguments) }; | |
var _memset = Module["_memset"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["_memset"].apply(null, arguments) }; | |
var _ntohs = Module["_ntohs"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["_ntohs"].apply(null, arguments) }; | |
var _pthread_mutex_lock = Module["_pthread_mutex_lock"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["_pthread_mutex_lock"].apply(null, arguments) }; | |
var _pthread_mutex_unlock = Module["_pthread_mutex_unlock"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["_pthread_mutex_unlock"].apply(null, arguments) }; | |
var _rust_eh_personality = Module["_rust_eh_personality"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["_rust_eh_personality"].apply(null, arguments) }; | |
var _sbrk = Module["_sbrk"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["_sbrk"].apply(null, arguments) }; | |
var establishStackSpace = Module["establishStackSpace"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["establishStackSpace"].apply(null, arguments) }; | |
var setThrew = Module["setThrew"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["setThrew"].apply(null, arguments) }; | |
var stackAlloc = Module["stackAlloc"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["stackAlloc"].apply(null, arguments) }; | |
var stackRestore = Module["stackRestore"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["stackRestore"].apply(null, arguments) }; | |
var stackSave = Module["stackSave"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["stackSave"].apply(null, arguments) }; | |
var dynCall_i = Module["dynCall_i"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["dynCall_i"].apply(null, arguments) }; | |
var dynCall_ii = Module["dynCall_ii"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["dynCall_ii"].apply(null, arguments) }; | |
var dynCall_iii = Module["dynCall_iii"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["dynCall_iii"].apply(null, arguments) }; | |
var dynCall_iiii = Module["dynCall_iiii"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["dynCall_iiii"].apply(null, arguments) }; | |
var dynCall_ji = Module["dynCall_ji"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["dynCall_ji"].apply(null, arguments) }; | |
var dynCall_v = Module["dynCall_v"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["dynCall_v"].apply(null, arguments) }; | |
var dynCall_vi = Module["dynCall_vi"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["dynCall_vi"].apply(null, arguments) }; | |
var dynCall_vidd = Module["dynCall_vidd"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["dynCall_vidd"].apply(null, arguments) }; | |
var dynCall_vii = Module["dynCall_vii"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["dynCall_vii"].apply(null, arguments) }; | |
var dynCall_viii = Module["dynCall_viii"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["dynCall_viii"].apply(null, arguments) }; | |
var dynCall_viiii = Module["dynCall_viiii"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["dynCall_viiii"].apply(null, arguments) }; | |
var dynCall_viiiii = Module["dynCall_viiiii"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["dynCall_viiiii"].apply(null, arguments) }; | |
var dynCall_viiiiiii = Module["dynCall_viiiiiii"] = function() { | |
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)'); | |
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); | |
return Module["asm"]["dynCall_viiiiiii"].apply(null, arguments) }; | |
; | |
// === Auto-generated postamble setup entry stuff === | |
Module['asm'] = asm; | |
if (!Module["intArrayFromString"]) Module["intArrayFromString"] = function() { abort("'intArrayFromString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["intArrayToString"]) Module["intArrayToString"] = function() { abort("'intArrayToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["ccall"]) Module["ccall"] = function() { abort("'ccall' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["cwrap"]) Module["cwrap"] = function() { abort("'cwrap' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["setValue"]) Module["setValue"] = function() { abort("'setValue' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["getValue"]) Module["getValue"] = function() { abort("'getValue' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["allocate"]) Module["allocate"] = function() { abort("'allocate' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["getMemory"]) Module["getMemory"] = function() { abort("'getMemory' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you") }; | |
if (!Module["Pointer_stringify"]) Module["Pointer_stringify"] = function() { abort("'Pointer_stringify' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["AsciiToString"]) Module["AsciiToString"] = function() { abort("'AsciiToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["stringToAscii"]) Module["stringToAscii"] = function() { abort("'stringToAscii' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["UTF8ArrayToString"]) Module["UTF8ArrayToString"] = function() { abort("'UTF8ArrayToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["UTF8ToString"]) Module["UTF8ToString"] = function() { abort("'UTF8ToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["stringToUTF8Array"]) Module["stringToUTF8Array"] = function() { abort("'stringToUTF8Array' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["stringToUTF8"]) Module["stringToUTF8"] = function() { abort("'stringToUTF8' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["lengthBytesUTF8"]) Module["lengthBytesUTF8"] = function() { abort("'lengthBytesUTF8' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["UTF16ToString"]) Module["UTF16ToString"] = function() { abort("'UTF16ToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["stringToUTF16"]) Module["stringToUTF16"] = function() { abort("'stringToUTF16' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["lengthBytesUTF16"]) Module["lengthBytesUTF16"] = function() { abort("'lengthBytesUTF16' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["UTF32ToString"]) Module["UTF32ToString"] = function() { abort("'UTF32ToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["stringToUTF32"]) Module["stringToUTF32"] = function() { abort("'stringToUTF32' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["lengthBytesUTF32"]) Module["lengthBytesUTF32"] = function() { abort("'lengthBytesUTF32' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["allocateUTF8"]) Module["allocateUTF8"] = function() { abort("'allocateUTF8' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["stackTrace"]) Module["stackTrace"] = function() { abort("'stackTrace' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["addOnPreRun"]) Module["addOnPreRun"] = function() { abort("'addOnPreRun' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["addOnInit"]) Module["addOnInit"] = function() { abort("'addOnInit' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["addOnPreMain"]) Module["addOnPreMain"] = function() { abort("'addOnPreMain' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["addOnExit"]) Module["addOnExit"] = function() { abort("'addOnExit' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["addOnPostRun"]) Module["addOnPostRun"] = function() { abort("'addOnPostRun' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["writeStringToMemory"]) Module["writeStringToMemory"] = function() { abort("'writeStringToMemory' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["writeArrayToMemory"]) Module["writeArrayToMemory"] = function() { abort("'writeArrayToMemory' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["writeAsciiToMemory"]) Module["writeAsciiToMemory"] = function() { abort("'writeAsciiToMemory' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["addRunDependency"]) Module["addRunDependency"] = function() { abort("'addRunDependency' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you") }; | |
if (!Module["removeRunDependency"]) Module["removeRunDependency"] = function() { abort("'removeRunDependency' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you") }; | |
if (!Module["ENV"]) Module["ENV"] = function() { abort("'ENV' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["FS"]) Module["FS"] = function() { abort("'FS' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["FS_createFolder"]) Module["FS_createFolder"] = function() { abort("'FS_createFolder' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you") }; | |
if (!Module["FS_createPath"]) Module["FS_createPath"] = function() { abort("'FS_createPath' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you") }; | |
if (!Module["FS_createDataFile"]) Module["FS_createDataFile"] = function() { abort("'FS_createDataFile' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you") }; | |
if (!Module["FS_createPreloadedFile"]) Module["FS_createPreloadedFile"] = function() { abort("'FS_createPreloadedFile' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you") }; | |
if (!Module["FS_createLazyFile"]) Module["FS_createLazyFile"] = function() { abort("'FS_createLazyFile' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you") }; | |
if (!Module["FS_createLink"]) Module["FS_createLink"] = function() { abort("'FS_createLink' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you") }; | |
if (!Module["FS_createDevice"]) Module["FS_createDevice"] = function() { abort("'FS_createDevice' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you") }; | |
if (!Module["FS_unlink"]) Module["FS_unlink"] = function() { abort("'FS_unlink' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you") }; | |
if (!Module["GL"]) Module["GL"] = function() { abort("'GL' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["staticAlloc"]) Module["staticAlloc"] = function() { abort("'staticAlloc' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["dynamicAlloc"]) Module["dynamicAlloc"] = function() { abort("'dynamicAlloc' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["warnOnce"]) Module["warnOnce"] = function() { abort("'warnOnce' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["loadDynamicLibrary"]) Module["loadDynamicLibrary"] = function() { abort("'loadDynamicLibrary' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["loadWebAssemblyModule"]) Module["loadWebAssemblyModule"] = function() { abort("'loadWebAssemblyModule' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["getLEB"]) Module["getLEB"] = function() { abort("'getLEB' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["getFunctionTables"]) Module["getFunctionTables"] = function() { abort("'getFunctionTables' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["alignFunctionTables"]) Module["alignFunctionTables"] = function() { abort("'alignFunctionTables' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["registerFunctions"]) Module["registerFunctions"] = function() { abort("'registerFunctions' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["addFunction"]) Module["addFunction"] = function() { abort("'addFunction' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["removeFunction"]) Module["removeFunction"] = function() { abort("'removeFunction' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["getFuncWrapper"]) Module["getFuncWrapper"] = function() { abort("'getFuncWrapper' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["prettyPrint"]) Module["prettyPrint"] = function() { abort("'prettyPrint' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["makeBigInt"]) Module["makeBigInt"] = function() { abort("'makeBigInt' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["dynCall"]) Module["dynCall"] = function() { abort("'dynCall' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["getCompilerSetting"]) Module["getCompilerSetting"] = function() { abort("'getCompilerSetting' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["stackSave"]) Module["stackSave"] = function() { abort("'stackSave' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["stackRestore"]) Module["stackRestore"] = function() { abort("'stackRestore' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["stackAlloc"]) Module["stackAlloc"] = function() { abort("'stackAlloc' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["establishStackSpace"]) Module["establishStackSpace"] = function() { abort("'establishStackSpace' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["print"]) Module["print"] = function() { abort("'print' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["printErr"]) Module["printErr"] = function() { abort("'printErr' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["getTempRet0"]) Module["getTempRet0"] = function() { abort("'getTempRet0' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; | |
if (!Module["setTempRet0"]) Module["setTempRet0"] = function() { abort("'setTempRet0' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };if (!Module["ALLOC_NORMAL"]) Object.defineProperty(Module, "ALLOC_NORMAL", { get: function() { abort("'ALLOC_NORMAL' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") } }); | |
if (!Module["ALLOC_STACK"]) Object.defineProperty(Module, "ALLOC_STACK", { get: function() { abort("'ALLOC_STACK' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") } }); | |
if (!Module["ALLOC_STATIC"]) Object.defineProperty(Module, "ALLOC_STATIC", { get: function() { abort("'ALLOC_STATIC' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") } }); | |
if (!Module["ALLOC_DYNAMIC"]) Object.defineProperty(Module, "ALLOC_DYNAMIC", { get: function() { abort("'ALLOC_DYNAMIC' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") } }); | |
if (!Module["ALLOC_NONE"]) Object.defineProperty(Module, "ALLOC_NONE", { get: function() { abort("'ALLOC_NONE' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") } }); | |
/** | |
* @constructor | |
* @extends {Error} | |
* @this {ExitStatus} | |
*/ | |
function ExitStatus(status) { | |
this.name = "ExitStatus"; | |
this.message = "Program terminated with exit(" + status + ")"; | |
this.status = status; | |
}; | |
ExitStatus.prototype = new Error(); | |
ExitStatus.prototype.constructor = ExitStatus; | |
var calledMain = false; | |
dependenciesFulfilled = function runCaller() { | |
// If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false) | |
if (!Module['calledRun']) run(); | |
if (!Module['calledRun']) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled | |
} | |
Module['callMain'] = function callMain(args) { | |
assert(runDependencies == 0, 'cannot call main when async dependencies remain! (listen on __ATMAIN__)'); | |
assert(__ATPRERUN__.length == 0, 'cannot call main when preRun functions remain to be called'); | |
args = args || []; | |
ensureInitRuntime(); | |
var argc = args.length+1; | |
var argv = stackAlloc((argc + 1) * 4); | |
HEAP32[argv >> 2] = allocateUTF8OnStack(Module['thisProgram']); | |
for (var i = 1; i < argc; i++) { | |
HEAP32[(argv >> 2) + i] = allocateUTF8OnStack(args[i - 1]); | |
} | |
HEAP32[(argv >> 2) + argc] = 0; | |
try { | |
var ret = Module['_main'](argc, argv, 0); | |
// if we're not running an evented main loop, it's time to exit | |
exit(ret, /* implicit = */ true); | |
} | |
catch(e) { | |
if (e instanceof ExitStatus) { | |
// exit() throws this once it's done to make sure execution | |
// has been stopped completely | |
return; | |
} else if (e == 'SimulateInfiniteLoop') { | |
// running an evented main loop, don't immediately exit | |
Module['noExitRuntime'] = true; | |
return; | |
} else { | |
var toLog = e; | |
if (e && typeof e === 'object' && e.stack) { | |
toLog = [e, e.stack]; | |
} | |
err('exception thrown: ' + toLog); | |
Module['quit'](1, e); | |
} | |
} finally { | |
calledMain = true; | |
} | |
} | |
/** @type {function(Array=)} */ | |
function run(args) { | |
args = args || Module['arguments']; | |
if (runDependencies > 0) { | |
return; | |
} | |
writeStackCookie(); | |
preRun(); | |
if (runDependencies > 0) return; // a preRun added a dependency, run will be called later | |
if (Module['calledRun']) return; // run may have just been called through dependencies being fulfilled just in this very frame | |
function doRun() { | |
if (Module['calledRun']) return; // run may have just been called while the async setStatus time below was happening | |
Module['calledRun'] = true; | |
if (ABORT) return; | |
ensureInitRuntime(); | |
preMain(); | |
if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized'](); | |
if (Module['_main'] && shouldRunNow) Module['callMain'](args); | |
postRun(); | |
} | |
if (Module['setStatus']) { | |
Module['setStatus']('Running...'); | |
setTimeout(function() { | |
setTimeout(function() { | |
Module['setStatus'](''); | |
}, 1); | |
doRun(); | |
}, 1); | |
} else { | |
doRun(); | |
} | |
checkStackCookie(); | |
} | |
Module['run'] = run; | |
function checkUnflushedContent() { | |
// Compiler settings do not allow exiting the runtime, so flushing | |
// the streams is not possible. but in ASSERTIONS mode we check | |
// if there was something to flush, and if so tell the user they | |
// should request that the runtime be exitable. | |
// Normally we would not even include flush() at all, but in ASSERTIONS | |
// builds we do so just for this check, and here we see if there is any | |
// content to flush, that is, we check if there would have been | |
// something a non-ASSERTIONS build would have not seen. | |
// How we flush the streams depends on whether we are in FILESYSTEM=0 | |
// mode (which has its own special function for this; otherwise, all | |
// the code is inside libc) | |
var print = out; | |
var printErr = err; | |
var has = false; | |
out = err = function(x) { | |
has = true; | |
} | |
try { // it doesn't matter if it fails | |
var flush = Module['_fflush']; | |
if (flush) flush(0); | |
// also flush in the JS FS layer | |
var hasFS = true; | |
if (hasFS) { | |
['stdout', 'stderr'].forEach(function(name) { | |
var info = FS.analyzePath('/dev/' + name); | |
if (!info) return; | |
var stream = info.object; | |
var rdev = stream.rdev; | |
var tty = TTY.ttys[rdev]; | |
if (tty && tty.output && tty.output.length) { | |
has = true; | |
} | |
}); | |
} | |
} catch(e) {} | |
out = print; | |
err = printErr; | |
if (has) { | |
warnOnce('stdio streams had content in them that was not flushed. you should set EXIT_RUNTIME to 1 (see the FAQ), or make sure to emit a newline when you printf etc.'); | |
} | |
} | |
function exit(status, implicit) { | |
checkUnflushedContent(); | |
// if this is just main exit-ing implicitly, and the status is 0, then we | |
// don't need to do anything here and can just leave. if the status is | |
// non-zero, though, then we need to report it. | |
// (we may have warned about this earlier, if a situation justifies doing so) | |
if (implicit && Module['noExitRuntime'] && status === 0) { | |
return; | |
} | |
if (Module['noExitRuntime']) { | |
// if exit() was called, we may warn the user if the runtime isn't actually being shut down | |
if (!implicit) { | |
err('exit(' + status + ') called, but EXIT_RUNTIME is not set, so halting execution but not exiting the runtime or preventing further async execution (build with EXIT_RUNTIME=1, if you want a true shutdown)'); | |
} | |
} else { | |
ABORT = true; | |
EXITSTATUS = status; | |
exitRuntime(); | |
if (Module['onExit']) Module['onExit'](status); | |
} | |
Module['quit'](status, new ExitStatus(status)); | |
} | |
var abortDecorators = []; | |
function abort(what) { | |
if (Module['onAbort']) { | |
Module['onAbort'](what); | |
} | |
if (what !== undefined) { | |
out(what); | |
err(what); | |
what = JSON.stringify(what) | |
} else { | |
what = ''; | |
} | |
ABORT = true; | |
EXITSTATUS = 1; | |
var extra = ''; | |
var output = 'abort(' + what + ') at ' + stackTrace() + extra; | |
if (abortDecorators) { | |
abortDecorators.forEach(function(decorator) { | |
output = decorator(output, what); | |
}); | |
} | |
throw output; | |
} | |
Module['abort'] = abort; | |
if (Module['preInit']) { | |
if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']]; | |
while (Module['preInit'].length > 0) { | |
Module['preInit'].pop()(); | |
} | |
} | |
// shouldRunNow refers to calling main(), not run(). | |
var shouldRunNow = true; | |
if (Module['noInitialRun']) { | |
shouldRunNow = false; | |
} | |
Module["noExitRuntime"] = true; | |
run(); | |
// {{MODULE_ADDITIONS}} | |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment