Last active
October 8, 2020 19:29
-
-
Save ptosco/09f6be5af7266227e3cacd7a5f559f0d to your computer and use it in GitHub Desktop.
Chirality edge cases
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
<!DOCTYPE html> | |
<html> | |
<head><meta charset="utf-8" /> | |
<title>ChiralityEdgeCases</title> | |
<script src="https://cdnjs.cloudflare.com/ajax/libs/require.js/2.1.10/require.min.js"></script> | |
<script src="https://cdnjs.cloudflare.com/ajax/libs/jquery/2.0.3/jquery.min.js"></script> | |
<style type="text/css"> | |
/*! | |
* | |
* Twitter Bootstrap | |
* | |
*/ | |
/*! | |
* Bootstrap v3.3.7 (http://getbootstrap.com) | |
* Copyright 2011-2016 Twitter, Inc. | |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) | |
*/ | |
/*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */ | |
html { | |
font-family: sans-serif; | |
-ms-text-size-adjust: 100%; | |
-webkit-text-size-adjust: 100%; | |
} | |
body { | |
margin: 0; | |
} | |
article, | |
aside, | |
details, | |
figcaption, | |
figure, | |
footer, | |
header, | |
hgroup, | |
main, | |
menu, | |
nav, | |
section, | |
summary { | |
display: block; | |
} | |
audio, | |
canvas, | |
progress, | |
video { | |
display: inline-block; | |
vertical-align: baseline; | |
} | |
audio:not([controls]) { | |
display: none; | |
height: 0; | |
} | |
[hidden], | |
template { | |
display: none; | |
} | |
a { | |
background-color: transparent; | |
} | |
a:active, | |
a:hover { | |
outline: 0; | |
} | |
abbr[title] { | |
border-bottom: 1px dotted; | |
} | |
b, | |
strong { | |
font-weight: bold; | |
} | |
dfn { | |
font-style: italic; | |
} | |
h1 { | |
font-size: 2em; | |
margin: 0.67em 0; | |
} | |
mark { | |
background: #ff0; | |
color: #000; | |
} | |
small { | |
font-size: 80%; | |
} | |
sub, | |
sup { | |
font-size: 75%; | |
line-height: 0; | |
position: relative; | |
vertical-align: baseline; | |
} | |
sup { | |
top: -0.5em; | |
} | |
sub { | |
bottom: -0.25em; | |
} | |
img { | |
border: 0; | |
} | |
svg:not(:root) { | |
overflow: hidden; | |
} | |
figure { | |
margin: 1em 40px; | |
} | |
hr { | |
box-sizing: content-box; | |
height: 0; | |
} | |
pre { | |
overflow: auto; | |
} | |
code, | |
kbd, | |
pre, | |
samp { | |
font-family: monospace, monospace; | |
font-size: 1em; | |
} | |
button, | |
input, | |
optgroup, | |
select, | |
textarea { | |
color: inherit; | |
font: inherit; | |
margin: 0; | |
} | |
button { | |
overflow: visible; | |
} | |
button, | |
select { | |
text-transform: none; | |
} | |
button, | |
html input[type="button"], | |
input[type="reset"], | |
input[type="submit"] { | |
-webkit-appearance: button; | |
cursor: pointer; | |
} | |
button[disabled], | |
html input[disabled] { | |
cursor: default; | |
} | |
button::-moz-focus-inner, | |
input::-moz-focus-inner { | |
border: 0; | |
padding: 0; | |
} | |
input { | |
line-height: normal; | |
} | |
input[type="checkbox"], | |
input[type="radio"] { | |
box-sizing: border-box; | |
padding: 0; | |
} | |
input[type="number"]::-webkit-inner-spin-button, | |
input[type="number"]::-webkit-outer-spin-button { | |
height: auto; | |
} | |
input[type="search"] { | |
-webkit-appearance: textfield; | |
box-sizing: content-box; | |
} | |
input[type="search"]::-webkit-search-cancel-button, | |
input[type="search"]::-webkit-search-decoration { | |
-webkit-appearance: none; | |
} | |
fieldset { | |
border: 1px solid #c0c0c0; | |
margin: 0 2px; | |
padding: 0.35em 0.625em 0.75em; | |
} | |
legend { | |
border: 0; | |
padding: 0; | |
} | |
textarea { | |
overflow: auto; | |
} | |
optgroup { | |
font-weight: bold; | |
} | |
table { | |
border-collapse: collapse; | |
border-spacing: 0; | |
} | |
td, | |
th { | |
padding: 0; | |
} | |
/*! Source: https://github.com/h5bp/html5-boilerplate/blob/master/src/css/main.css */ | |
@media print { | |
*, | |
*:before, | |
*:after { | |
background: transparent !important; | |
box-shadow: none !important; | |
text-shadow: none !important; | |
} | |
a, | |
a:visited { | |
text-decoration: underline; | |
} | |
a[href]:after { | |
content: " (" attr(href) ")"; | |
} | |
abbr[title]:after { | |
content: " (" attr(title) ")"; | |
} | |
a[href^="#"]:after, | |
a[href^="javascript:"]:after { | |
content: ""; | |
} | |
pre, | |
blockquote { | |
border: 1px solid #999; | |
page-break-inside: avoid; | |
} | |
thead { | |
display: table-header-group; | |
} | |
tr, | |
img { | |
page-break-inside: avoid; | |
} | |
img { | |
max-width: 100% !important; | |
} | |
p, | |
h2, | |
h3 { | |
orphans: 3; | |
widows: 3; | |
} | |
h2, | |
h3 { | |
page-break-after: avoid; | |
} | |
.navbar { | |
display: none; | |
} | |
.btn > .caret, | |
.dropup > .btn > .caret { | |
border-top-color: #000 !important; | |
} | |
.label { | |
border: 1px solid #000; | |
} | |
.table { | |
border-collapse: collapse !important; | |
} | |
.table td, | |
.table th { | |
background-color: #fff !important; | |
} | |
.table-bordered th, | |
.table-bordered td { | |
border: 1px solid #ddd !important; | |
} | |
} | |
@font-face { | |
font-family: 'Glyphicons Halflings'; | |
src: url('../components/bootstrap/fonts/glyphicons-halflings-regular.eot'); | |
src: url('../components/bootstrap/fonts/glyphicons-halflings-regular.eot?#iefix') format('embedded-opentype'), url('../components/bootstrap/fonts/glyphicons-halflings-regular.woff2') format('woff2'), url('../components/bootstrap/fonts/glyphicons-halflings-regular.woff') format('woff'), url('../components/bootstrap/fonts/glyphicons-halflings-regular.ttf') format('truetype'), url('../components/bootstrap/fonts/glyphicons-halflings-regular.svg#glyphicons_halflingsregular') format('svg'); | |
} | |
.glyphicon { | |
position: relative; | |
top: 1px; | |
display: inline-block; | |
font-family: 'Glyphicons Halflings'; | |
font-style: normal; | |
font-weight: normal; | |
line-height: 1; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
} | |
.glyphicon-asterisk:before { | |
content: "\002a"; | |
} | |
.glyphicon-plus:before { | |
content: "\002b"; | |
} | |
.glyphicon-euro:before, | |
.glyphicon-eur:before { | |
content: "\20ac"; | |
} | |
.glyphicon-minus:before { | |
content: "\2212"; | |
} | |
.glyphicon-cloud:before { | |
content: "\2601"; | |
} | |
.glyphicon-envelope:before { | |
content: "\2709"; | |
} | |
.glyphicon-pencil:before { | |
content: "\270f"; | |
} | |
.glyphicon-glass:before { | |
content: "\e001"; | |
} | |
.glyphicon-music:before { | |
content: "\e002"; | |
} | |
.glyphicon-search:before { | |
content: "\e003"; | |
} | |
.glyphicon-heart:before { | |
content: "\e005"; | |
} | |
.glyphicon-star:before { | |
content: "\e006"; | |
} | |
.glyphicon-star-empty:before { | |
content: "\e007"; | |
} | |
.glyphicon-user:before { | |
content: "\e008"; | |
} | |
.glyphicon-film:before { | |
content: "\e009"; | |
} | |
.glyphicon-th-large:before { | |
content: "\e010"; | |
} | |
.glyphicon-th:before { | |
content: "\e011"; | |
} | |
.glyphicon-th-list:before { | |
content: "\e012"; | |
} | |
.glyphicon-ok:before { | |
content: "\e013"; | |
} | |
.glyphicon-remove:before { | |
content: "\e014"; | |
} | |
.glyphicon-zoom-in:before { | |
content: "\e015"; | |
} | |
.glyphicon-zoom-out:before { | |
content: "\e016"; | |
} | |
.glyphicon-off:before { | |
content: "\e017"; | |
} | |
.glyphicon-signal:before { | |
content: "\e018"; | |
} | |
.glyphicon-cog:before { | |
content: "\e019"; | |
} | |
.glyphicon-trash:before { | |
content: "\e020"; | |
} | |
.glyphicon-home:before { | |
content: "\e021"; | |
} | |
.glyphicon-file:before { | |
content: "\e022"; | |
} | |
.glyphicon-time:before { | |
content: "\e023"; | |
} | |
.glyphicon-road:before { | |
content: "\e024"; | |
} | |
.glyphicon-download-alt:before { | |
content: "\e025"; | |
} | |
.glyphicon-download:before { | |
content: "\e026"; | |
} | |
.glyphicon-upload:before { | |
content: "\e027"; | |
} | |
.glyphicon-inbox:before { | |
content: "\e028"; | |
} | |
.glyphicon-play-circle:before { | |
content: "\e029"; | |
} | |
.glyphicon-repeat:before { | |
content: "\e030"; | |
} | |
.glyphicon-refresh:before { | |
content: "\e031"; | |
} | |
.glyphicon-list-alt:before { | |
content: "\e032"; | |
} | |
.glyphicon-lock:before { | |
content: "\e033"; | |
} | |
.glyphicon-flag:before { | |
content: "\e034"; | |
} | |
.glyphicon-headphones:before { | |
content: "\e035"; | |
} | |
.glyphicon-volume-off:before { | |
content: "\e036"; | |
} | |
.glyphicon-volume-down:before { | |
content: "\e037"; | |
} | |
.glyphicon-volume-up:before { | |
content: "\e038"; | |
} | |
.glyphicon-qrcode:before { | |
content: "\e039"; | |
} | |
.glyphicon-barcode:before { | |
content: "\e040"; | |
} | |
.glyphicon-tag:before { | |
content: "\e041"; | |
} | |
.glyphicon-tags:before { | |
content: "\e042"; | |
} | |
.glyphicon-book:before { | |
content: "\e043"; | |
} | |
.glyphicon-bookmark:before { | |
content: "\e044"; | |
} | |
.glyphicon-print:before { | |
content: "\e045"; | |
} | |
.glyphicon-camera:before { | |
content: "\e046"; | |
} | |
.glyphicon-font:before { | |
content: "\e047"; | |
} | |
.glyphicon-bold:before { | |
content: "\e048"; | |
} | |
.glyphicon-italic:before { | |
content: "\e049"; | |
} | |
.glyphicon-text-height:before { | |
content: "\e050"; | |
} | |
.glyphicon-text-width:before { | |
content: "\e051"; | |
} | |
.glyphicon-align-left:before { | |
content: "\e052"; | |
} | |
.glyphicon-align-center:before { | |
content: "\e053"; | |
} | |
.glyphicon-align-right:before { | |
content: "\e054"; | |
} | |
.glyphicon-align-justify:before { | |
content: "\e055"; | |
} | |
.glyphicon-list:before { | |
content: "\e056"; | |
} | |
.glyphicon-indent-left:before { | |
content: "\e057"; | |
} | |
.glyphicon-indent-right:before { | |
content: "\e058"; | |
} | |
.glyphicon-facetime-video:before { | |
content: "\e059"; | |
} | |
.glyphicon-picture:before { | |
content: "\e060"; | |
} | |
.glyphicon-map-marker:before { | |
content: "\e062"; | |
} | |
.glyphicon-adjust:before { | |
content: "\e063"; | |
} | |
.glyphicon-tint:before { | |
content: "\e064"; | |
} | |
.glyphicon-edit:before { | |
content: "\e065"; | |
} | |
.glyphicon-share:before { | |
content: "\e066"; | |
} | |
.glyphicon-check:before { | |
content: "\e067"; | |
} | |
.glyphicon-move:before { | |
content: "\e068"; | |
} | |
.glyphicon-step-backward:before { | |
content: "\e069"; | |
} | |
.glyphicon-fast-backward:before { | |
content: "\e070"; | |
} | |
.glyphicon-backward:before { | |
content: "\e071"; | |
} | |
.glyphicon-play:before { | |
content: "\e072"; | |
} | |
.glyphicon-pause:before { | |
content: "\e073"; | |
} | |
.glyphicon-stop:before { | |
content: "\e074"; | |
} | |
.glyphicon-forward:before { | |
content: "\e075"; | |
} | |
.glyphicon-fast-forward:before { | |
content: "\e076"; | |
} | |
.glyphicon-step-forward:before { | |
content: "\e077"; | |
} | |
.glyphicon-eject:before { | |
content: "\e078"; | |
} | |
.glyphicon-chevron-left:before { | |
content: "\e079"; | |
} | |
.glyphicon-chevron-right:before { | |
content: "\e080"; | |
} | |
.glyphicon-plus-sign:before { | |
content: "\e081"; | |
} | |
.glyphicon-minus-sign:before { | |
content: "\e082"; | |
} | |
.glyphicon-remove-sign:before { | |
content: "\e083"; | |
} | |
.glyphicon-ok-sign:before { | |
content: "\e084"; | |
} | |
.glyphicon-question-sign:before { | |
content: "\e085"; | |
} | |
.glyphicon-info-sign:before { | |
content: "\e086"; | |
} | |
.glyphicon-screenshot:before { | |
content: "\e087"; | |
} | |
.glyphicon-remove-circle:before { | |
content: "\e088"; | |
} | |
.glyphicon-ok-circle:before { | |
content: "\e089"; | |
} | |
.glyphicon-ban-circle:before { | |
content: "\e090"; | |
} | |
.glyphicon-arrow-left:before { | |
content: "\e091"; | |
} | |
.glyphicon-arrow-right:before { | |
content: "\e092"; | |
} | |
.glyphicon-arrow-up:before { | |
content: "\e093"; | |
} | |
.glyphicon-arrow-down:before { | |
content: "\e094"; | |
} | |
.glyphicon-share-alt:before { | |
content: "\e095"; | |
} | |
.glyphicon-resize-full:before { | |
content: "\e096"; | |
} | |
.glyphicon-resize-small:before { | |
content: "\e097"; | |
} | |
.glyphicon-exclamation-sign:before { | |
content: "\e101"; | |
} | |
.glyphicon-gift:before { | |
content: "\e102"; | |
} | |
.glyphicon-leaf:before { | |
content: "\e103"; | |
} | |
.glyphicon-fire:before { | |
content: "\e104"; | |
} | |
.glyphicon-eye-open:before { | |
content: "\e105"; | |
} | |
.glyphicon-eye-close:before { | |
content: "\e106"; | |
} | |
.glyphicon-warning-sign:before { | |
content: "\e107"; | |
} | |
.glyphicon-plane:before { | |
content: "\e108"; | |
} | |
.glyphicon-calendar:before { | |
content: "\e109"; | |
} | |
.glyphicon-random:before { | |
content: "\e110"; | |
} | |
.glyphicon-comment:before { | |
content: "\e111"; | |
} | |
.glyphicon-magnet:before { | |
content: "\e112"; | |
} | |
.glyphicon-chevron-up:before { | |
content: "\e113"; | |
} | |
.glyphicon-chevron-down:before { | |
content: "\e114"; | |
} | |
.glyphicon-retweet:before { | |
content: "\e115"; | |
} | |
.glyphicon-shopping-cart:before { | |
content: "\e116"; | |
} | |
.glyphicon-folder-close:before { | |
content: "\e117"; | |
} | |
.glyphicon-folder-open:before { | |
content: "\e118"; | |
} | |
.glyphicon-resize-vertical:before { | |
content: "\e119"; | |
} | |
.glyphicon-resize-horizontal:before { | |
content: "\e120"; | |
} | |
.glyphicon-hdd:before { | |
content: "\e121"; | |
} | |
.glyphicon-bullhorn:before { | |
content: "\e122"; | |
} | |
.glyphicon-bell:before { | |
content: "\e123"; | |
} | |
.glyphicon-certificate:before { | |
content: "\e124"; | |
} | |
.glyphicon-thumbs-up:before { | |
content: "\e125"; | |
} | |
.glyphicon-thumbs-down:before { | |
content: "\e126"; | |
} | |
.glyphicon-hand-right:before { | |
content: "\e127"; | |
} | |
.glyphicon-hand-left:before { | |
content: "\e128"; | |
} | |
.glyphicon-hand-up:before { | |
content: "\e129"; | |
} | |
.glyphicon-hand-down:before { | |
content: "\e130"; | |
} | |
.glyphicon-circle-arrow-right:before { | |
content: "\e131"; | |
} | |
.glyphicon-circle-arrow-left:before { | |
content: "\e132"; | |
} | |
.glyphicon-circle-arrow-up:before { | |
content: "\e133"; | |
} | |
.glyphicon-circle-arrow-down:before { | |
content: "\e134"; | |
} | |
.glyphicon-globe:before { | |
content: "\e135"; | |
} | |
.glyphicon-wrench:before { | |
content: "\e136"; | |
} | |
.glyphicon-tasks:before { | |
content: "\e137"; | |
} | |
.glyphicon-filter:before { | |
content: "\e138"; | |
} | |
.glyphicon-briefcase:before { | |
content: "\e139"; | |
} | |
.glyphicon-fullscreen:before { | |
content: "\e140"; | |
} | |
.glyphicon-dashboard:before { | |
content: "\e141"; | |
} | |
.glyphicon-paperclip:before { | |
content: "\e142"; | |
} | |
.glyphicon-heart-empty:before { | |
content: "\e143"; | |
} | |
.glyphicon-link:before { | |
content: "\e144"; | |
} | |
.glyphicon-phone:before { | |
content: "\e145"; | |
} | |
.glyphicon-pushpin:before { | |
content: "\e146"; | |
} | |
.glyphicon-usd:before { | |
content: "\e148"; | |
} | |
.glyphicon-gbp:before { | |
content: "\e149"; | |
} | |
.glyphicon-sort:before { | |
content: "\e150"; | |
} | |
.glyphicon-sort-by-alphabet:before { | |
content: "\e151"; | |
} | |
.glyphicon-sort-by-alphabet-alt:before { | |
content: "\e152"; | |
} | |
.glyphicon-sort-by-order:before { | |
content: "\e153"; | |
} | |
.glyphicon-sort-by-order-alt:before { | |
content: "\e154"; | |
} | |
.glyphicon-sort-by-attributes:before { | |
content: "\e155"; | |
} | |
.glyphicon-sort-by-attributes-alt:before { | |
content: "\e156"; | |
} | |
.glyphicon-unchecked:before { | |
content: "\e157"; | |
} | |
.glyphicon-expand:before { | |
content: "\e158"; | |
} | |
.glyphicon-collapse-down:before { | |
content: "\e159"; | |
} | |
.glyphicon-collapse-up:before { | |
content: "\e160"; | |
} | |
.glyphicon-log-in:before { | |
content: "\e161"; | |
} | |
.glyphicon-flash:before { | |
content: "\e162"; | |
} | |
.glyphicon-log-out:before { | |
content: "\e163"; | |
} | |
.glyphicon-new-window:before { | |
content: "\e164"; | |
} | |
.glyphicon-record:before { | |
content: "\e165"; | |
} | |
.glyphicon-save:before { | |
content: "\e166"; | |
} | |
.glyphicon-open:before { | |
content: "\e167"; | |
} | |
.glyphicon-saved:before { | |
content: "\e168"; | |
} | |
.glyphicon-import:before { | |
content: "\e169"; | |
} | |
.glyphicon-export:before { | |
content: "\e170"; | |
} | |
.glyphicon-send:before { | |
content: "\e171"; | |
} | |
.glyphicon-floppy-disk:before { | |
content: "\e172"; | |
} | |
.glyphicon-floppy-saved:before { | |
content: "\e173"; | |
} | |
.glyphicon-floppy-remove:before { | |
content: "\e174"; | |
} | |
.glyphicon-floppy-save:before { | |
content: "\e175"; | |
} | |
.glyphicon-floppy-open:before { | |
content: "\e176"; | |
} | |
.glyphicon-credit-card:before { | |
content: "\e177"; | |
} | |
.glyphicon-transfer:before { | |
content: "\e178"; | |
} | |
.glyphicon-cutlery:before { | |
content: "\e179"; | |
} | |
.glyphicon-header:before { | |
content: "\e180"; | |
} | |
.glyphicon-compressed:before { | |
content: "\e181"; | |
} | |
.glyphicon-earphone:before { | |
content: "\e182"; | |
} | |
.glyphicon-phone-alt:before { | |
content: "\e183"; | |
} | |
.glyphicon-tower:before { | |
content: "\e184"; | |
} | |
.glyphicon-stats:before { | |
content: "\e185"; | |
} | |
.glyphicon-sd-video:before { | |
content: "\e186"; | |
} | |
.glyphicon-hd-video:before { | |
content: "\e187"; | |
} | |
.glyphicon-subtitles:before { | |
content: "\e188"; | |
} | |
.glyphicon-sound-stereo:before { | |
content: "\e189"; | |
} | |
.glyphicon-sound-dolby:before { | |
content: "\e190"; | |
} | |
.glyphicon-sound-5-1:before { | |
content: "\e191"; | |
} | |
.glyphicon-sound-6-1:before { | |
content: "\e192"; | |
} | |
.glyphicon-sound-7-1:before { | |
content: "\e193"; | |
} | |
.glyphicon-copyright-mark:before { | |
content: "\e194"; | |
} | |
.glyphicon-registration-mark:before { | |
content: "\e195"; | |
} | |
.glyphicon-cloud-download:before { | |
content: "\e197"; | |
} | |
.glyphicon-cloud-upload:before { | |
content: "\e198"; | |
} | |
.glyphicon-tree-conifer:before { | |
content: "\e199"; | |
} | |
.glyphicon-tree-deciduous:before { | |
content: "\e200"; | |
} | |
.glyphicon-cd:before { | |
content: "\e201"; | |
} | |
.glyphicon-save-file:before { | |
content: "\e202"; | |
} | |
.glyphicon-open-file:before { | |
content: "\e203"; | |
} | |
.glyphicon-level-up:before { | |
content: "\e204"; | |
} | |
.glyphicon-copy:before { | |
content: "\e205"; | |
} | |
.glyphicon-paste:before { | |
content: "\e206"; | |
} | |
.glyphicon-alert:before { | |
content: "\e209"; | |
} | |
.glyphicon-equalizer:before { | |
content: "\e210"; | |
} | |
.glyphicon-king:before { | |
content: "\e211"; | |
} | |
.glyphicon-queen:before { | |
content: "\e212"; | |
} | |
.glyphicon-pawn:before { | |
content: "\e213"; | |
} | |
.glyphicon-bishop:before { | |
content: "\e214"; | |
} | |
.glyphicon-knight:before { | |
content: "\e215"; | |
} | |
.glyphicon-baby-formula:before { | |
content: "\e216"; | |
} | |
.glyphicon-tent:before { | |
content: "\26fa"; | |
} | |
.glyphicon-blackboard:before { | |
content: "\e218"; | |
} | |
.glyphicon-bed:before { | |
content: "\e219"; | |
} | |
.glyphicon-apple:before { | |
content: "\f8ff"; | |
} | |
.glyphicon-erase:before { | |
content: "\e221"; | |
} | |
.glyphicon-hourglass:before { | |
content: "\231b"; | |
} | |
.glyphicon-lamp:before { | |
content: "\e223"; | |
} | |
.glyphicon-duplicate:before { | |
content: "\e224"; | |
} | |
.glyphicon-piggy-bank:before { | |
content: "\e225"; | |
} | |
.glyphicon-scissors:before { | |
content: "\e226"; | |
} | |
.glyphicon-bitcoin:before { | |
content: "\e227"; | |
} | |
.glyphicon-btc:before { | |
content: "\e227"; | |
} | |
.glyphicon-xbt:before { | |
content: "\e227"; | |
} | |
.glyphicon-yen:before { | |
content: "\00a5"; | |
} | |
.glyphicon-jpy:before { | |
content: "\00a5"; | |
} | |
.glyphicon-ruble:before { | |
content: "\20bd"; | |
} | |
.glyphicon-rub:before { | |
content: "\20bd"; | |
} | |
.glyphicon-scale:before { | |
content: "\e230"; | |
} | |
.glyphicon-ice-lolly:before { | |
content: "\e231"; | |
} | |
.glyphicon-ice-lolly-tasted:before { | |
content: "\e232"; | |
} | |
.glyphicon-education:before { | |
content: "\e233"; | |
} | |
.glyphicon-option-horizontal:before { | |
content: "\e234"; | |
} | |
.glyphicon-option-vertical:before { | |
content: "\e235"; | |
} | |
.glyphicon-menu-hamburger:before { | |
content: "\e236"; | |
} | |
.glyphicon-modal-window:before { | |
content: "\e237"; | |
} | |
.glyphicon-oil:before { | |
content: "\e238"; | |
} | |
.glyphicon-grain:before { | |
content: "\e239"; | |
} | |
.glyphicon-sunglasses:before { | |
content: "\e240"; | |
} | |
.glyphicon-text-size:before { | |
content: "\e241"; | |
} | |
.glyphicon-text-color:before { | |
content: "\e242"; | |
} | |
.glyphicon-text-background:before { | |
content: "\e243"; | |
} | |
.glyphicon-object-align-top:before { | |
content: "\e244"; | |
} | |
.glyphicon-object-align-bottom:before { | |
content: "\e245"; | |
} | |
.glyphicon-object-align-horizontal:before { | |
content: "\e246"; | |
} | |
.glyphicon-object-align-left:before { | |
content: "\e247"; | |
} | |
.glyphicon-object-align-vertical:before { | |
content: "\e248"; | |
} | |
.glyphicon-object-align-right:before { | |
content: "\e249"; | |
} | |
.glyphicon-triangle-right:before { | |
content: "\e250"; | |
} | |
.glyphicon-triangle-left:before { | |
content: "\e251"; | |
} | |
.glyphicon-triangle-bottom:before { | |
content: "\e252"; | |
} | |
.glyphicon-triangle-top:before { | |
content: "\e253"; | |
} | |
.glyphicon-console:before { | |
content: "\e254"; | |
} | |
.glyphicon-superscript:before { | |
content: "\e255"; | |
} | |
.glyphicon-subscript:before { | |
content: "\e256"; | |
} | |
.glyphicon-menu-left:before { | |
content: "\e257"; | |
} | |
.glyphicon-menu-right:before { | |
content: "\e258"; | |
} | |
.glyphicon-menu-down:before { | |
content: "\e259"; | |
} | |
.glyphicon-menu-up:before { | |
content: "\e260"; | |
} | |
* { | |
-webkit-box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
box-sizing: border-box; | |
} | |
*:before, | |
*:after { | |
-webkit-box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
box-sizing: border-box; | |
} | |
html { | |
font-size: 10px; | |
-webkit-tap-highlight-color: rgba(0, 0, 0, 0); | |
} | |
body { | |
font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; | |
font-size: 13px; | |
line-height: 1.42857143; | |
color: #000; | |
background-color: #fff; | |
} | |
input, | |
button, | |
select, | |
textarea { | |
font-family: inherit; | |
font-size: inherit; | |
line-height: inherit; | |
} | |
a { | |
color: #337ab7; | |
text-decoration: none; | |
} | |
a:hover, | |
a:focus { | |
color: #23527c; | |
text-decoration: underline; | |
} | |
a:focus { | |
outline: 5px auto -webkit-focus-ring-color; | |
outline-offset: -2px; | |
} | |
figure { | |
margin: 0; | |
} | |
img { | |
vertical-align: middle; | |
} | |
.img-responsive, | |
.thumbnail > img, | |
.thumbnail a > img, | |
.carousel-inner > .item > img, | |
.carousel-inner > .item > a > img { | |
display: block; | |
max-width: 100%; | |
height: auto; | |
} | |
.img-rounded { | |
border-radius: 3px; | |
} | |
.img-thumbnail { | |
padding: 4px; | |
line-height: 1.42857143; | |
background-color: #fff; | |
border: 1px solid #ddd; | |
border-radius: 2px; | |
-webkit-transition: all 0.2s ease-in-out; | |
-o-transition: all 0.2s ease-in-out; | |
transition: all 0.2s ease-in-out; | |
display: inline-block; | |
max-width: 100%; | |
height: auto; | |
} | |
.img-circle { | |
border-radius: 50%; | |
} | |
hr { | |
margin-top: 18px; | |
margin-bottom: 18px; | |
border: 0; | |
border-top: 1px solid #eeeeee; | |
} | |
.sr-only { | |
position: absolute; | |
width: 1px; | |
height: 1px; | |
margin: -1px; | |
padding: 0; | |
overflow: hidden; | |
clip: rect(0, 0, 0, 0); | |
border: 0; | |
} | |
.sr-only-focusable:active, | |
.sr-only-focusable:focus { | |
position: static; | |
width: auto; | |
height: auto; | |
margin: 0; | |
overflow: visible; | |
clip: auto; | |
} | |
[role="button"] { | |
cursor: pointer; | |
} | |
h1, | |
h2, | |
h3, | |
h4, | |
h5, | |
h6, | |
.h1, | |
.h2, | |
.h3, | |
.h4, | |
.h5, | |
.h6 { | |
font-family: inherit; | |
font-weight: 500; | |
line-height: 1.1; | |
color: inherit; | |
} | |
h1 small, | |
h2 small, | |
h3 small, | |
h4 small, | |
h5 small, | |
h6 small, | |
.h1 small, | |
.h2 small, | |
.h3 small, | |
.h4 small, | |
.h5 small, | |
.h6 small, | |
h1 .small, | |
h2 .small, | |
h3 .small, | |
h4 .small, | |
h5 .small, | |
h6 .small, | |
.h1 .small, | |
.h2 .small, | |
.h3 .small, | |
.h4 .small, | |
.h5 .small, | |
.h6 .small { | |
font-weight: normal; | |
line-height: 1; | |
color: #777777; | |
} | |
h1, | |
.h1, | |
h2, | |
.h2, | |
h3, | |
.h3 { | |
margin-top: 18px; | |
margin-bottom: 9px; | |
} | |
h1 small, | |
.h1 small, | |
h2 small, | |
.h2 small, | |
h3 small, | |
.h3 small, | |
h1 .small, | |
.h1 .small, | |
h2 .small, | |
.h2 .small, | |
h3 .small, | |
.h3 .small { | |
font-size: 65%; | |
} | |
h4, | |
.h4, | |
h5, | |
.h5, | |
h6, | |
.h6 { | |
margin-top: 9px; | |
margin-bottom: 9px; | |
} | |
h4 small, | |
.h4 small, | |
h5 small, | |
.h5 small, | |
h6 small, | |
.h6 small, | |
h4 .small, | |
.h4 .small, | |
h5 .small, | |
.h5 .small, | |
h6 .small, | |
.h6 .small { | |
font-size: 75%; | |
} | |
h1, | |
.h1 { | |
font-size: 33px; | |
} | |
h2, | |
.h2 { | |
font-size: 27px; | |
} | |
h3, | |
.h3 { | |
font-size: 23px; | |
} | |
h4, | |
.h4 { | |
font-size: 17px; | |
} | |
h5, | |
.h5 { | |
font-size: 13px; | |
} | |
h6, | |
.h6 { | |
font-size: 12px; | |
} | |
p { | |
margin: 0 0 9px; | |
} | |
.lead { | |
margin-bottom: 18px; | |
font-size: 14px; | |
font-weight: 300; | |
line-height: 1.4; | |
} | |
@media (min-width: 768px) { | |
.lead { | |
font-size: 19.5px; | |
} | |
} | |
small, | |
.small { | |
font-size: 92%; | |
} | |
mark, | |
.mark { | |
background-color: #fcf8e3; | |
padding: .2em; | |
} | |
.text-left { | |
text-align: left; | |
} | |
.text-right { | |
text-align: right; | |
} | |
.text-center { | |
text-align: center; | |
} | |
.text-justify { | |
text-align: justify; | |
} | |
.text-nowrap { | |
white-space: nowrap; | |
} | |
.text-lowercase { | |
text-transform: lowercase; | |
} | |
.text-uppercase { | |
text-transform: uppercase; | |
} | |
.text-capitalize { | |
text-transform: capitalize; | |
} | |
.text-muted { | |
color: #777777; | |
} | |
.text-primary { | |
color: #337ab7; | |
} | |
a.text-primary:hover, | |
a.text-primary:focus { | |
color: #286090; | |
} | |
.text-success { | |
color: #3c763d; | |
} | |
a.text-success:hover, | |
a.text-success:focus { | |
color: #2b542c; | |
} | |
.text-info { | |
color: #31708f; | |
} | |
a.text-info:hover, | |
a.text-info:focus { | |
color: #245269; | |
} | |
.text-warning { | |
color: #8a6d3b; | |
} | |
a.text-warning:hover, | |
a.text-warning:focus { | |
color: #66512c; | |
} | |
.text-danger { | |
color: #a94442; | |
} | |
a.text-danger:hover, | |
a.text-danger:focus { | |
color: #843534; | |
} | |
.bg-primary { | |
color: #fff; | |
background-color: #337ab7; | |
} | |
a.bg-primary:hover, | |
a.bg-primary:focus { | |
background-color: #286090; | |
} | |
.bg-success { | |
background-color: #dff0d8; | |
} | |
a.bg-success:hover, | |
a.bg-success:focus { | |
background-color: #c1e2b3; | |
} | |
.bg-info { | |
background-color: #d9edf7; | |
} | |
a.bg-info:hover, | |
a.bg-info:focus { | |
background-color: #afd9ee; | |
} | |
.bg-warning { | |
background-color: #fcf8e3; | |
} | |
a.bg-warning:hover, | |
a.bg-warning:focus { | |
background-color: #f7ecb5; | |
} | |
.bg-danger { | |
background-color: #f2dede; | |
} | |
a.bg-danger:hover, | |
a.bg-danger:focus { | |
background-color: #e4b9b9; | |
} | |
.page-header { | |
padding-bottom: 8px; | |
margin: 36px 0 18px; | |
border-bottom: 1px solid #eeeeee; | |
} | |
ul, | |
ol { | |
margin-top: 0; | |
margin-bottom: 9px; | |
} | |
ul ul, | |
ol ul, | |
ul ol, | |
ol ol { | |
margin-bottom: 0; | |
} | |
.list-unstyled { | |
padding-left: 0; | |
list-style: none; | |
} | |
.list-inline { | |
padding-left: 0; | |
list-style: none; | |
margin-left: -5px; | |
} | |
.list-inline > li { | |
display: inline-block; | |
padding-left: 5px; | |
padding-right: 5px; | |
} | |
dl { | |
margin-top: 0; | |
margin-bottom: 18px; | |
} | |
dt, | |
dd { | |
line-height: 1.42857143; | |
} | |
dt { | |
font-weight: bold; | |
} | |
dd { | |
margin-left: 0; | |
} | |
@media (min-width: 541px) { | |
.dl-horizontal dt { | |
float: left; | |
width: 160px; | |
clear: left; | |
text-align: right; | |
overflow: hidden; | |
text-overflow: ellipsis; | |
white-space: nowrap; | |
} | |
.dl-horizontal dd { | |
margin-left: 180px; | |
} | |
} | |
abbr[title], | |
abbr[data-original-title] { | |
cursor: help; | |
border-bottom: 1px dotted #777777; | |
} | |
.initialism { | |
font-size: 90%; | |
text-transform: uppercase; | |
} | |
blockquote { | |
padding: 9px 18px; | |
margin: 0 0 18px; | |
font-size: inherit; | |
border-left: 5px solid #eeeeee; | |
} | |
blockquote p:last-child, | |
blockquote ul:last-child, | |
blockquote ol:last-child { | |
margin-bottom: 0; | |
} | |
blockquote footer, | |
blockquote small, | |
blockquote .small { | |
display: block; | |
font-size: 80%; | |
line-height: 1.42857143; | |
color: #777777; | |
} | |
blockquote footer:before, | |
blockquote small:before, | |
blockquote .small:before { | |
content: '\2014 \00A0'; | |
} | |
.blockquote-reverse, | |
blockquote.pull-right { | |
padding-right: 15px; | |
padding-left: 0; | |
border-right: 5px solid #eeeeee; | |
border-left: 0; | |
text-align: right; | |
} | |
.blockquote-reverse footer:before, | |
blockquote.pull-right footer:before, | |
.blockquote-reverse small:before, | |
blockquote.pull-right small:before, | |
.blockquote-reverse .small:before, | |
blockquote.pull-right .small:before { | |
content: ''; | |
} | |
.blockquote-reverse footer:after, | |
blockquote.pull-right footer:after, | |
.blockquote-reverse small:after, | |
blockquote.pull-right small:after, | |
.blockquote-reverse .small:after, | |
blockquote.pull-right .small:after { | |
content: '\00A0 \2014'; | |
} | |
address { | |
margin-bottom: 18px; | |
font-style: normal; | |
line-height: 1.42857143; | |
} | |
code, | |
kbd, | |
pre, | |
samp { | |
font-family: monospace; | |
} | |
code { | |
padding: 2px 4px; | |
font-size: 90%; | |
color: #c7254e; | |
background-color: #f9f2f4; | |
border-radius: 2px; | |
} | |
kbd { | |
padding: 2px 4px; | |
font-size: 90%; | |
color: #888; | |
background-color: transparent; | |
border-radius: 1px; | |
box-shadow: inset 0 -1px 0 rgba(0, 0, 0, 0.25); | |
} | |
kbd kbd { | |
padding: 0; | |
font-size: 100%; | |
font-weight: bold; | |
box-shadow: none; | |
} | |
pre { | |
display: block; | |
padding: 8.5px; | |
margin: 0 0 9px; | |
font-size: 12px; | |
line-height: 1.42857143; | |
word-break: break-all; | |
word-wrap: break-word; | |
color: #333333; | |
background-color: #f5f5f5; | |
border: 1px solid #ccc; | |
border-radius: 2px; | |
} | |
pre code { | |
padding: 0; | |
font-size: inherit; | |
color: inherit; | |
white-space: pre-wrap; | |
background-color: transparent; | |
border-radius: 0; | |
} | |
.pre-scrollable { | |
max-height: 340px; | |
overflow-y: scroll; | |
} | |
.container { | |
margin-right: auto; | |
margin-left: auto; | |
padding-left: 0px; | |
padding-right: 0px; | |
} | |
@media (min-width: 768px) { | |
.container { | |
width: 768px; | |
} | |
} | |
@media (min-width: 992px) { | |
.container { | |
width: 940px; | |
} | |
} | |
@media (min-width: 1200px) { | |
.container { | |
width: 1140px; | |
} | |
} | |
.container-fluid { | |
margin-right: auto; | |
margin-left: auto; | |
padding-left: 0px; | |
padding-right: 0px; | |
} | |
.row { | |
margin-left: 0px; | |
margin-right: 0px; | |
} | |
.col-xs-1, .col-sm-1, .col-md-1, .col-lg-1, .col-xs-2, .col-sm-2, .col-md-2, .col-lg-2, .col-xs-3, .col-sm-3, .col-md-3, .col-lg-3, .col-xs-4, .col-sm-4, .col-md-4, .col-lg-4, .col-xs-5, .col-sm-5, .col-md-5, .col-lg-5, .col-xs-6, .col-sm-6, .col-md-6, .col-lg-6, .col-xs-7, .col-sm-7, .col-md-7, .col-lg-7, .col-xs-8, .col-sm-8, .col-md-8, .col-lg-8, .col-xs-9, .col-sm-9, .col-md-9, .col-lg-9, .col-xs-10, .col-sm-10, .col-md-10, .col-lg-10, .col-xs-11, .col-sm-11, .col-md-11, .col-lg-11, .col-xs-12, .col-sm-12, .col-md-12, .col-lg-12 { | |
position: relative; | |
min-height: 1px; | |
padding-left: 0px; | |
padding-right: 0px; | |
} | |
.col-xs-1, .col-xs-2, .col-xs-3, .col-xs-4, .col-xs-5, .col-xs-6, .col-xs-7, .col-xs-8, .col-xs-9, .col-xs-10, .col-xs-11, .col-xs-12 { | |
float: left; | |
} | |
.col-xs-12 { | |
width: 100%; | |
} | |
.col-xs-11 { | |
width: 91.66666667%; | |
} | |
.col-xs-10 { | |
width: 83.33333333%; | |
} | |
.col-xs-9 { | |
width: 75%; | |
} | |
.col-xs-8 { | |
width: 66.66666667%; | |
} | |
.col-xs-7 { | |
width: 58.33333333%; | |
} | |
.col-xs-6 { | |
width: 50%; | |
} | |
.col-xs-5 { | |
width: 41.66666667%; | |
} | |
.col-xs-4 { | |
width: 33.33333333%; | |
} | |
.col-xs-3 { | |
width: 25%; | |
} | |
.col-xs-2 { | |
width: 16.66666667%; | |
} | |
.col-xs-1 { | |
width: 8.33333333%; | |
} | |
.col-xs-pull-12 { | |
right: 100%; | |
} | |
.col-xs-pull-11 { | |
right: 91.66666667%; | |
} | |
.col-xs-pull-10 { | |
right: 83.33333333%; | |
} | |
.col-xs-pull-9 { | |
right: 75%; | |
} | |
.col-xs-pull-8 { | |
right: 66.66666667%; | |
} | |
.col-xs-pull-7 { | |
right: 58.33333333%; | |
} | |
.col-xs-pull-6 { | |
right: 50%; | |
} | |
.col-xs-pull-5 { | |
right: 41.66666667%; | |
} | |
.col-xs-pull-4 { | |
right: 33.33333333%; | |
} | |
.col-xs-pull-3 { | |
right: 25%; | |
} | |
.col-xs-pull-2 { | |
right: 16.66666667%; | |
} | |
.col-xs-pull-1 { | |
right: 8.33333333%; | |
} | |
.col-xs-pull-0 { | |
right: auto; | |
} | |
.col-xs-push-12 { | |
left: 100%; | |
} | |
.col-xs-push-11 { | |
left: 91.66666667%; | |
} | |
.col-xs-push-10 { | |
left: 83.33333333%; | |
} | |
.col-xs-push-9 { | |
left: 75%; | |
} | |
.col-xs-push-8 { | |
left: 66.66666667%; | |
} | |
.col-xs-push-7 { | |
left: 58.33333333%; | |
} | |
.col-xs-push-6 { | |
left: 50%; | |
} | |
.col-xs-push-5 { | |
left: 41.66666667%; | |
} | |
.col-xs-push-4 { | |
left: 33.33333333%; | |
} | |
.col-xs-push-3 { | |
left: 25%; | |
} | |
.col-xs-push-2 { | |
left: 16.66666667%; | |
} | |
.col-xs-push-1 { | |
left: 8.33333333%; | |
} | |
.col-xs-push-0 { | |
left: auto; | |
} | |
.col-xs-offset-12 { | |
margin-left: 100%; | |
} | |
.col-xs-offset-11 { | |
margin-left: 91.66666667%; | |
} | |
.col-xs-offset-10 { | |
margin-left: 83.33333333%; | |
} | |
.col-xs-offset-9 { | |
margin-left: 75%; | |
} | |
.col-xs-offset-8 { | |
margin-left: 66.66666667%; | |
} | |
.col-xs-offset-7 { | |
margin-left: 58.33333333%; | |
} | |
.col-xs-offset-6 { | |
margin-left: 50%; | |
} | |
.col-xs-offset-5 { | |
margin-left: 41.66666667%; | |
} | |
.col-xs-offset-4 { | |
margin-left: 33.33333333%; | |
} | |
.col-xs-offset-3 { | |
margin-left: 25%; | |
} | |
.col-xs-offset-2 { | |
margin-left: 16.66666667%; | |
} | |
.col-xs-offset-1 { | |
margin-left: 8.33333333%; | |
} | |
.col-xs-offset-0 { | |
margin-left: 0%; | |
} | |
@media (min-width: 768px) { | |
.col-sm-1, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9, .col-sm-10, .col-sm-11, .col-sm-12 { | |
float: left; | |
} | |
.col-sm-12 { | |
width: 100%; | |
} | |
.col-sm-11 { | |
width: 91.66666667%; | |
} | |
.col-sm-10 { | |
width: 83.33333333%; | |
} | |
.col-sm-9 { | |
width: 75%; | |
} | |
.col-sm-8 { | |
width: 66.66666667%; | |
} | |
.col-sm-7 { | |
width: 58.33333333%; | |
} | |
.col-sm-6 { | |
width: 50%; | |
} | |
.col-sm-5 { | |
width: 41.66666667%; | |
} | |
.col-sm-4 { | |
width: 33.33333333%; | |
} | |
.col-sm-3 { | |
width: 25%; | |
} | |
.col-sm-2 { | |
width: 16.66666667%; | |
} | |
.col-sm-1 { | |
width: 8.33333333%; | |
} | |
.col-sm-pull-12 { | |
right: 100%; | |
} | |
.col-sm-pull-11 { | |
right: 91.66666667%; | |
} | |
.col-sm-pull-10 { | |
right: 83.33333333%; | |
} | |
.col-sm-pull-9 { | |
right: 75%; | |
} | |
.col-sm-pull-8 { | |
right: 66.66666667%; | |
} | |
.col-sm-pull-7 { | |
right: 58.33333333%; | |
} | |
.col-sm-pull-6 { | |
right: 50%; | |
} | |
.col-sm-pull-5 { | |
right: 41.66666667%; | |
} | |
.col-sm-pull-4 { | |
right: 33.33333333%; | |
} | |
.col-sm-pull-3 { | |
right: 25%; | |
} | |
.col-sm-pull-2 { | |
right: 16.66666667%; | |
} | |
.col-sm-pull-1 { | |
right: 8.33333333%; | |
} | |
.col-sm-pull-0 { | |
right: auto; | |
} | |
.col-sm-push-12 { | |
left: 100%; | |
} | |
.col-sm-push-11 { | |
left: 91.66666667%; | |
} | |
.col-sm-push-10 { | |
left: 83.33333333%; | |
} | |
.col-sm-push-9 { | |
left: 75%; | |
} | |
.col-sm-push-8 { | |
left: 66.66666667%; | |
} | |
.col-sm-push-7 { | |
left: 58.33333333%; | |
} | |
.col-sm-push-6 { | |
left: 50%; | |
} | |
.col-sm-push-5 { | |
left: 41.66666667%; | |
} | |
.col-sm-push-4 { | |
left: 33.33333333%; | |
} | |
.col-sm-push-3 { | |
left: 25%; | |
} | |
.col-sm-push-2 { | |
left: 16.66666667%; | |
} | |
.col-sm-push-1 { | |
left: 8.33333333%; | |
} | |
.col-sm-push-0 { | |
left: auto; | |
} | |
.col-sm-offset-12 { | |
margin-left: 100%; | |
} | |
.col-sm-offset-11 { | |
margin-left: 91.66666667%; | |
} | |
.col-sm-offset-10 { | |
margin-left: 83.33333333%; | |
} | |
.col-sm-offset-9 { | |
margin-left: 75%; | |
} | |
.col-sm-offset-8 { | |
margin-left: 66.66666667%; | |
} | |
.col-sm-offset-7 { | |
margin-left: 58.33333333%; | |
} | |
.col-sm-offset-6 { | |
margin-left: 50%; | |
} | |
.col-sm-offset-5 { | |
margin-left: 41.66666667%; | |
} | |
.col-sm-offset-4 { | |
margin-left: 33.33333333%; | |
} | |
.col-sm-offset-3 { | |
margin-left: 25%; | |
} | |
.col-sm-offset-2 { | |
margin-left: 16.66666667%; | |
} | |
.col-sm-offset-1 { | |
margin-left: 8.33333333%; | |
} | |
.col-sm-offset-0 { | |
margin-left: 0%; | |
} | |
} | |
@media (min-width: 992px) { | |
.col-md-1, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9, .col-md-10, .col-md-11, .col-md-12 { | |
float: left; | |
} | |
.col-md-12 { | |
width: 100%; | |
} | |
.col-md-11 { | |
width: 91.66666667%; | |
} | |
.col-md-10 { | |
width: 83.33333333%; | |
} | |
.col-md-9 { | |
width: 75%; | |
} | |
.col-md-8 { | |
width: 66.66666667%; | |
} | |
.col-md-7 { | |
width: 58.33333333%; | |
} | |
.col-md-6 { | |
width: 50%; | |
} | |
.col-md-5 { | |
width: 41.66666667%; | |
} | |
.col-md-4 { | |
width: 33.33333333%; | |
} | |
.col-md-3 { | |
width: 25%; | |
} | |
.col-md-2 { | |
width: 16.66666667%; | |
} | |
.col-md-1 { | |
width: 8.33333333%; | |
} | |
.col-md-pull-12 { | |
right: 100%; | |
} | |
.col-md-pull-11 { | |
right: 91.66666667%; | |
} | |
.col-md-pull-10 { | |
right: 83.33333333%; | |
} | |
.col-md-pull-9 { | |
right: 75%; | |
} | |
.col-md-pull-8 { | |
right: 66.66666667%; | |
} | |
.col-md-pull-7 { | |
right: 58.33333333%; | |
} | |
.col-md-pull-6 { | |
right: 50%; | |
} | |
.col-md-pull-5 { | |
right: 41.66666667%; | |
} | |
.col-md-pull-4 { | |
right: 33.33333333%; | |
} | |
.col-md-pull-3 { | |
right: 25%; | |
} | |
.col-md-pull-2 { | |
right: 16.66666667%; | |
} | |
.col-md-pull-1 { | |
right: 8.33333333%; | |
} | |
.col-md-pull-0 { | |
right: auto; | |
} | |
.col-md-push-12 { | |
left: 100%; | |
} | |
.col-md-push-11 { | |
left: 91.66666667%; | |
} | |
.col-md-push-10 { | |
left: 83.33333333%; | |
} | |
.col-md-push-9 { | |
left: 75%; | |
} | |
.col-md-push-8 { | |
left: 66.66666667%; | |
} | |
.col-md-push-7 { | |
left: 58.33333333%; | |
} | |
.col-md-push-6 { | |
left: 50%; | |
} | |
.col-md-push-5 { | |
left: 41.66666667%; | |
} | |
.col-md-push-4 { | |
left: 33.33333333%; | |
} | |
.col-md-push-3 { | |
left: 25%; | |
} | |
.col-md-push-2 { | |
left: 16.66666667%; | |
} | |
.col-md-push-1 { | |
left: 8.33333333%; | |
} | |
.col-md-push-0 { | |
left: auto; | |
} | |
.col-md-offset-12 { | |
margin-left: 100%; | |
} | |
.col-md-offset-11 { | |
margin-left: 91.66666667%; | |
} | |
.col-md-offset-10 { | |
margin-left: 83.33333333%; | |
} | |
.col-md-offset-9 { | |
margin-left: 75%; | |
} | |
.col-md-offset-8 { | |
margin-left: 66.66666667%; | |
} | |
.col-md-offset-7 { | |
margin-left: 58.33333333%; | |
} | |
.col-md-offset-6 { | |
margin-left: 50%; | |
} | |
.col-md-offset-5 { | |
margin-left: 41.66666667%; | |
} | |
.col-md-offset-4 { | |
margin-left: 33.33333333%; | |
} | |
.col-md-offset-3 { | |
margin-left: 25%; | |
} | |
.col-md-offset-2 { | |
margin-left: 16.66666667%; | |
} | |
.col-md-offset-1 { | |
margin-left: 8.33333333%; | |
} | |
.col-md-offset-0 { | |
margin-left: 0%; | |
} | |
} | |
@media (min-width: 1200px) { | |
.col-lg-1, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9, .col-lg-10, .col-lg-11, .col-lg-12 { | |
float: left; | |
} | |
.col-lg-12 { | |
width: 100%; | |
} | |
.col-lg-11 { | |
width: 91.66666667%; | |
} | |
.col-lg-10 { | |
width: 83.33333333%; | |
} | |
.col-lg-9 { | |
width: 75%; | |
} | |
.col-lg-8 { | |
width: 66.66666667%; | |
} | |
.col-lg-7 { | |
width: 58.33333333%; | |
} | |
.col-lg-6 { | |
width: 50%; | |
} | |
.col-lg-5 { | |
width: 41.66666667%; | |
} | |
.col-lg-4 { | |
width: 33.33333333%; | |
} | |
.col-lg-3 { | |
width: 25%; | |
} | |
.col-lg-2 { | |
width: 16.66666667%; | |
} | |
.col-lg-1 { | |
width: 8.33333333%; | |
} | |
.col-lg-pull-12 { | |
right: 100%; | |
} | |
.col-lg-pull-11 { | |
right: 91.66666667%; | |
} | |
.col-lg-pull-10 { | |
right: 83.33333333%; | |
} | |
.col-lg-pull-9 { | |
right: 75%; | |
} | |
.col-lg-pull-8 { | |
right: 66.66666667%; | |
} | |
.col-lg-pull-7 { | |
right: 58.33333333%; | |
} | |
.col-lg-pull-6 { | |
right: 50%; | |
} | |
.col-lg-pull-5 { | |
right: 41.66666667%; | |
} | |
.col-lg-pull-4 { | |
right: 33.33333333%; | |
} | |
.col-lg-pull-3 { | |
right: 25%; | |
} | |
.col-lg-pull-2 { | |
right: 16.66666667%; | |
} | |
.col-lg-pull-1 { | |
right: 8.33333333%; | |
} | |
.col-lg-pull-0 { | |
right: auto; | |
} | |
.col-lg-push-12 { | |
left: 100%; | |
} | |
.col-lg-push-11 { | |
left: 91.66666667%; | |
} | |
.col-lg-push-10 { | |
left: 83.33333333%; | |
} | |
.col-lg-push-9 { | |
left: 75%; | |
} | |
.col-lg-push-8 { | |
left: 66.66666667%; | |
} | |
.col-lg-push-7 { | |
left: 58.33333333%; | |
} | |
.col-lg-push-6 { | |
left: 50%; | |
} | |
.col-lg-push-5 { | |
left: 41.66666667%; | |
} | |
.col-lg-push-4 { | |
left: 33.33333333%; | |
} | |
.col-lg-push-3 { | |
left: 25%; | |
} | |
.col-lg-push-2 { | |
left: 16.66666667%; | |
} | |
.col-lg-push-1 { | |
left: 8.33333333%; | |
} | |
.col-lg-push-0 { | |
left: auto; | |
} | |
.col-lg-offset-12 { | |
margin-left: 100%; | |
} | |
.col-lg-offset-11 { | |
margin-left: 91.66666667%; | |
} | |
.col-lg-offset-10 { | |
margin-left: 83.33333333%; | |
} | |
.col-lg-offset-9 { | |
margin-left: 75%; | |
} | |
.col-lg-offset-8 { | |
margin-left: 66.66666667%; | |
} | |
.col-lg-offset-7 { | |
margin-left: 58.33333333%; | |
} | |
.col-lg-offset-6 { | |
margin-left: 50%; | |
} | |
.col-lg-offset-5 { | |
margin-left: 41.66666667%; | |
} | |
.col-lg-offset-4 { | |
margin-left: 33.33333333%; | |
} | |
.col-lg-offset-3 { | |
margin-left: 25%; | |
} | |
.col-lg-offset-2 { | |
margin-left: 16.66666667%; | |
} | |
.col-lg-offset-1 { | |
margin-left: 8.33333333%; | |
} | |
.col-lg-offset-0 { | |
margin-left: 0%; | |
} | |
} | |
table { | |
background-color: transparent; | |
} | |
caption { | |
padding-top: 8px; | |
padding-bottom: 8px; | |
color: #777777; | |
text-align: left; | |
} | |
th { | |
text-align: left; | |
} | |
.table { | |
width: 100%; | |
max-width: 100%; | |
margin-bottom: 18px; | |
} | |
.table > thead > tr > th, | |
.table > tbody > tr > th, | |
.table > tfoot > tr > th, | |
.table > thead > tr > td, | |
.table > tbody > tr > td, | |
.table > tfoot > tr > td { | |
padding: 8px; | |
line-height: 1.42857143; | |
vertical-align: top; | |
border-top: 1px solid #ddd; | |
} | |
.table > thead > tr > th { | |
vertical-align: bottom; | |
border-bottom: 2px solid #ddd; | |
} | |
.table > caption + thead > tr:first-child > th, | |
.table > colgroup + thead > tr:first-child > th, | |
.table > thead:first-child > tr:first-child > th, | |
.table > caption + thead > tr:first-child > td, | |
.table > colgroup + thead > tr:first-child > td, | |
.table > thead:first-child > tr:first-child > td { | |
border-top: 0; | |
} | |
.table > tbody + tbody { | |
border-top: 2px solid #ddd; | |
} | |
.table .table { | |
background-color: #fff; | |
} | |
.table-condensed > thead > tr > th, | |
.table-condensed > tbody > tr > th, | |
.table-condensed > tfoot > tr > th, | |
.table-condensed > thead > tr > td, | |
.table-condensed > tbody > tr > td, | |
.table-condensed > tfoot > tr > td { | |
padding: 5px; | |
} | |
.table-bordered { | |
border: 1px solid #ddd; | |
} | |
.table-bordered > thead > tr > th, | |
.table-bordered > tbody > tr > th, | |
.table-bordered > tfoot > tr > th, | |
.table-bordered > thead > tr > td, | |
.table-bordered > tbody > tr > td, | |
.table-bordered > tfoot > tr > td { | |
border: 1px solid #ddd; | |
} | |
.table-bordered > thead > tr > th, | |
.table-bordered > thead > tr > td { | |
border-bottom-width: 2px; | |
} | |
.table-striped > tbody > tr:nth-of-type(odd) { | |
background-color: #f9f9f9; | |
} | |
.table-hover > tbody > tr:hover { | |
background-color: #f5f5f5; | |
} | |
table col[class*="col-"] { | |
position: static; | |
float: none; | |
display: table-column; | |
} | |
table td[class*="col-"], | |
table th[class*="col-"] { | |
position: static; | |
float: none; | |
display: table-cell; | |
} | |
.table > thead > tr > td.active, | |
.table > tbody > tr > td.active, | |
.table > tfoot > tr > td.active, | |
.table > thead > tr > th.active, | |
.table > tbody > tr > th.active, | |
.table > tfoot > tr > th.active, | |
.table > thead > tr.active > td, | |
.table > tbody > tr.active > td, | |
.table > tfoot > tr.active > td, | |
.table > thead > tr.active > th, | |
.table > tbody > tr.active > th, | |
.table > tfoot > tr.active > th { | |
background-color: #f5f5f5; | |
} | |
.table-hover > tbody > tr > td.active:hover, | |
.table-hover > tbody > tr > th.active:hover, | |
.table-hover > tbody > tr.active:hover > td, | |
.table-hover > tbody > tr:hover > .active, | |
.table-hover > tbody > tr.active:hover > th { | |
background-color: #e8e8e8; | |
} | |
.table > thead > tr > td.success, | |
.table > tbody > tr > td.success, | |
.table > tfoot > tr > td.success, | |
.table > thead > tr > th.success, | |
.table > tbody > tr > th.success, | |
.table > tfoot > tr > th.success, | |
.table > thead > tr.success > td, | |
.table > tbody > tr.success > td, | |
.table > tfoot > tr.success > td, | |
.table > thead > tr.success > th, | |
.table > tbody > tr.success > th, | |
.table > tfoot > tr.success > th { | |
background-color: #dff0d8; | |
} | |
.table-hover > tbody > tr > td.success:hover, | |
.table-hover > tbody > tr > th.success:hover, | |
.table-hover > tbody > tr.success:hover > td, | |
.table-hover > tbody > tr:hover > .success, | |
.table-hover > tbody > tr.success:hover > th { | |
background-color: #d0e9c6; | |
} | |
.table > thead > tr > td.info, | |
.table > tbody > tr > td.info, | |
.table > tfoot > tr > td.info, | |
.table > thead > tr > th.info, | |
.table > tbody > tr > th.info, | |
.table > tfoot > tr > th.info, | |
.table > thead > tr.info > td, | |
.table > tbody > tr.info > td, | |
.table > tfoot > tr.info > td, | |
.table > thead > tr.info > th, | |
.table > tbody > tr.info > th, | |
.table > tfoot > tr.info > th { | |
background-color: #d9edf7; | |
} | |
.table-hover > tbody > tr > td.info:hover, | |
.table-hover > tbody > tr > th.info:hover, | |
.table-hover > tbody > tr.info:hover > td, | |
.table-hover > tbody > tr:hover > .info, | |
.table-hover > tbody > tr.info:hover > th { | |
background-color: #c4e3f3; | |
} | |
.table > thead > tr > td.warning, | |
.table > tbody > tr > td.warning, | |
.table > tfoot > tr > td.warning, | |
.table > thead > tr > th.warning, | |
.table > tbody > tr > th.warning, | |
.table > tfoot > tr > th.warning, | |
.table > thead > tr.warning > td, | |
.table > tbody > tr.warning > td, | |
.table > tfoot > tr.warning > td, | |
.table > thead > tr.warning > th, | |
.table > tbody > tr.warning > th, | |
.table > tfoot > tr.warning > th { | |
background-color: #fcf8e3; | |
} | |
.table-hover > tbody > tr > td.warning:hover, | |
.table-hover > tbody > tr > th.warning:hover, | |
.table-hover > tbody > tr.warning:hover > td, | |
.table-hover > tbody > tr:hover > .warning, | |
.table-hover > tbody > tr.warning:hover > th { | |
background-color: #faf2cc; | |
} | |
.table > thead > tr > td.danger, | |
.table > tbody > tr > td.danger, | |
.table > tfoot > tr > td.danger, | |
.table > thead > tr > th.danger, | |
.table > tbody > tr > th.danger, | |
.table > tfoot > tr > th.danger, | |
.table > thead > tr.danger > td, | |
.table > tbody > tr.danger > td, | |
.table > tfoot > tr.danger > td, | |
.table > thead > tr.danger > th, | |
.table > tbody > tr.danger > th, | |
.table > tfoot > tr.danger > th { | |
background-color: #f2dede; | |
} | |
.table-hover > tbody > tr > td.danger:hover, | |
.table-hover > tbody > tr > th.danger:hover, | |
.table-hover > tbody > tr.danger:hover > td, | |
.table-hover > tbody > tr:hover > .danger, | |
.table-hover > tbody > tr.danger:hover > th { | |
background-color: #ebcccc; | |
} | |
.table-responsive { | |
overflow-x: auto; | |
min-height: 0.01%; | |
} | |
@media screen and (max-width: 767px) { | |
.table-responsive { | |
width: 100%; | |
margin-bottom: 13.5px; | |
overflow-y: hidden; | |
-ms-overflow-style: -ms-autohiding-scrollbar; | |
border: 1px solid #ddd; | |
} | |
.table-responsive > .table { | |
margin-bottom: 0; | |
} | |
.table-responsive > .table > thead > tr > th, | |
.table-responsive > .table > tbody > tr > th, | |
.table-responsive > .table > tfoot > tr > th, | |
.table-responsive > .table > thead > tr > td, | |
.table-responsive > .table > tbody > tr > td, | |
.table-responsive > .table > tfoot > tr > td { | |
white-space: nowrap; | |
} | |
.table-responsive > .table-bordered { | |
border: 0; | |
} | |
.table-responsive > .table-bordered > thead > tr > th:first-child, | |
.table-responsive > .table-bordered > tbody > tr > th:first-child, | |
.table-responsive > .table-bordered > tfoot > tr > th:first-child, | |
.table-responsive > .table-bordered > thead > tr > td:first-child, | |
.table-responsive > .table-bordered > tbody > tr > td:first-child, | |
.table-responsive > .table-bordered > tfoot > tr > td:first-child { | |
border-left: 0; | |
} | |
.table-responsive > .table-bordered > thead > tr > th:last-child, | |
.table-responsive > .table-bordered > tbody > tr > th:last-child, | |
.table-responsive > .table-bordered > tfoot > tr > th:last-child, | |
.table-responsive > .table-bordered > thead > tr > td:last-child, | |
.table-responsive > .table-bordered > tbody > tr > td:last-child, | |
.table-responsive > .table-bordered > tfoot > tr > td:last-child { | |
border-right: 0; | |
} | |
.table-responsive > .table-bordered > tbody > tr:last-child > th, | |
.table-responsive > .table-bordered > tfoot > tr:last-child > th, | |
.table-responsive > .table-bordered > tbody > tr:last-child > td, | |
.table-responsive > .table-bordered > tfoot > tr:last-child > td { | |
border-bottom: 0; | |
} | |
} | |
fieldset { | |
padding: 0; | |
margin: 0; | |
border: 0; | |
min-width: 0; | |
} | |
legend { | |
display: block; | |
width: 100%; | |
padding: 0; | |
margin-bottom: 18px; | |
font-size: 19.5px; | |
line-height: inherit; | |
color: #333333; | |
border: 0; | |
border-bottom: 1px solid #e5e5e5; | |
} | |
label { | |
display: inline-block; | |
max-width: 100%; | |
margin-bottom: 5px; | |
font-weight: bold; | |
} | |
input[type="search"] { | |
-webkit-box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
box-sizing: border-box; | |
} | |
input[type="radio"], | |
input[type="checkbox"] { | |
margin: 4px 0 0; | |
margin-top: 1px \9; | |
line-height: normal; | |
} | |
input[type="file"] { | |
display: block; | |
} | |
input[type="range"] { | |
display: block; | |
width: 100%; | |
} | |
select[multiple], | |
select[size] { | |
height: auto; | |
} | |
input[type="file"]:focus, | |
input[type="radio"]:focus, | |
input[type="checkbox"]:focus { | |
outline: 5px auto -webkit-focus-ring-color; | |
outline-offset: -2px; | |
} | |
output { | |
display: block; | |
padding-top: 7px; | |
font-size: 13px; | |
line-height: 1.42857143; | |
color: #555555; | |
} | |
.form-control { | |
display: block; | |
width: 100%; | |
height: 32px; | |
padding: 6px 12px; | |
font-size: 13px; | |
line-height: 1.42857143; | |
color: #555555; | |
background-color: #fff; | |
background-image: none; | |
border: 1px solid #ccc; | |
border-radius: 2px; | |
-webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); | |
box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); | |
-webkit-transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s; | |
-o-transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s; | |
transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s; | |
} | |
.form-control:focus { | |
border-color: #66afe9; | |
outline: 0; | |
-webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102, 175, 233, 0.6); | |
box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102, 175, 233, 0.6); | |
} | |
.form-control::-moz-placeholder { | |
color: #999; | |
opacity: 1; | |
} | |
.form-control:-ms-input-placeholder { | |
color: #999; | |
} | |
.form-control::-webkit-input-placeholder { | |
color: #999; | |
} | |
.form-control::-ms-expand { | |
border: 0; | |
background-color: transparent; | |
} | |
.form-control[disabled], | |
.form-control[readonly], | |
fieldset[disabled] .form-control { | |
background-color: #eeeeee; | |
opacity: 1; | |
} | |
.form-control[disabled], | |
fieldset[disabled] .form-control { | |
cursor: not-allowed; | |
} | |
textarea.form-control { | |
height: auto; | |
} | |
input[type="search"] { | |
-webkit-appearance: none; | |
} | |
@media screen and (-webkit-min-device-pixel-ratio: 0) { | |
input[type="date"].form-control, | |
input[type="time"].form-control, | |
input[type="datetime-local"].form-control, | |
input[type="month"].form-control { | |
line-height: 32px; | |
} | |
input[type="date"].input-sm, | |
input[type="time"].input-sm, | |
input[type="datetime-local"].input-sm, | |
input[type="month"].input-sm, | |
.input-group-sm input[type="date"], | |
.input-group-sm input[type="time"], | |
.input-group-sm input[type="datetime-local"], | |
.input-group-sm input[type="month"] { | |
line-height: 30px; | |
} | |
input[type="date"].input-lg, | |
input[type="time"].input-lg, | |
input[type="datetime-local"].input-lg, | |
input[type="month"].input-lg, | |
.input-group-lg input[type="date"], | |
.input-group-lg input[type="time"], | |
.input-group-lg input[type="datetime-local"], | |
.input-group-lg input[type="month"] { | |
line-height: 45px; | |
} | |
} | |
.form-group { | |
margin-bottom: 15px; | |
} | |
.radio, | |
.checkbox { | |
position: relative; | |
display: block; | |
margin-top: 10px; | |
margin-bottom: 10px; | |
} | |
.radio label, | |
.checkbox label { | |
min-height: 18px; | |
padding-left: 20px; | |
margin-bottom: 0; | |
font-weight: normal; | |
cursor: pointer; | |
} | |
.radio input[type="radio"], | |
.radio-inline input[type="radio"], | |
.checkbox input[type="checkbox"], | |
.checkbox-inline input[type="checkbox"] { | |
position: absolute; | |
margin-left: -20px; | |
margin-top: 4px \9; | |
} | |
.radio + .radio, | |
.checkbox + .checkbox { | |
margin-top: -5px; | |
} | |
.radio-inline, | |
.checkbox-inline { | |
position: relative; | |
display: inline-block; | |
padding-left: 20px; | |
margin-bottom: 0; | |
vertical-align: middle; | |
font-weight: normal; | |
cursor: pointer; | |
} | |
.radio-inline + .radio-inline, | |
.checkbox-inline + .checkbox-inline { | |
margin-top: 0; | |
margin-left: 10px; | |
} | |
input[type="radio"][disabled], | |
input[type="checkbox"][disabled], | |
input[type="radio"].disabled, | |
input[type="checkbox"].disabled, | |
fieldset[disabled] input[type="radio"], | |
fieldset[disabled] input[type="checkbox"] { | |
cursor: not-allowed; | |
} | |
.radio-inline.disabled, | |
.checkbox-inline.disabled, | |
fieldset[disabled] .radio-inline, | |
fieldset[disabled] .checkbox-inline { | |
cursor: not-allowed; | |
} | |
.radio.disabled label, | |
.checkbox.disabled label, | |
fieldset[disabled] .radio label, | |
fieldset[disabled] .checkbox label { | |
cursor: not-allowed; | |
} | |
.form-control-static { | |
padding-top: 7px; | |
padding-bottom: 7px; | |
margin-bottom: 0; | |
min-height: 31px; | |
} | |
.form-control-static.input-lg, | |
.form-control-static.input-sm { | |
padding-left: 0; | |
padding-right: 0; | |
} | |
.input-sm { | |
height: 30px; | |
padding: 5px 10px; | |
font-size: 12px; | |
line-height: 1.5; | |
border-radius: 1px; | |
} | |
select.input-sm { | |
height: 30px; | |
line-height: 30px; | |
} | |
textarea.input-sm, | |
select[multiple].input-sm { | |
height: auto; | |
} | |
.form-group-sm .form-control { | |
height: 30px; | |
padding: 5px 10px; | |
font-size: 12px; | |
line-height: 1.5; | |
border-radius: 1px; | |
} | |
.form-group-sm select.form-control { | |
height: 30px; | |
line-height: 30px; | |
} | |
.form-group-sm textarea.form-control, | |
.form-group-sm select[multiple].form-control { | |
height: auto; | |
} | |
.form-group-sm .form-control-static { | |
height: 30px; | |
min-height: 30px; | |
padding: 6px 10px; | |
font-size: 12px; | |
line-height: 1.5; | |
} | |
.input-lg { | |
height: 45px; | |
padding: 10px 16px; | |
font-size: 17px; | |
line-height: 1.3333333; | |
border-radius: 3px; | |
} | |
select.input-lg { | |
height: 45px; | |
line-height: 45px; | |
} | |
textarea.input-lg, | |
select[multiple].input-lg { | |
height: auto; | |
} | |
.form-group-lg .form-control { | |
height: 45px; | |
padding: 10px 16px; | |
font-size: 17px; | |
line-height: 1.3333333; | |
border-radius: 3px; | |
} | |
.form-group-lg select.form-control { | |
height: 45px; | |
line-height: 45px; | |
} | |
.form-group-lg textarea.form-control, | |
.form-group-lg select[multiple].form-control { | |
height: auto; | |
} | |
.form-group-lg .form-control-static { | |
height: 45px; | |
min-height: 35px; | |
padding: 11px 16px; | |
font-size: 17px; | |
line-height: 1.3333333; | |
} | |
.has-feedback { | |
position: relative; | |
} | |
.has-feedback .form-control { | |
padding-right: 40px; | |
} | |
.form-control-feedback { | |
position: absolute; | |
top: 0; | |
right: 0; | |
z-index: 2; | |
display: block; | |
width: 32px; | |
height: 32px; | |
line-height: 32px; | |
text-align: center; | |
pointer-events: none; | |
} | |
.input-lg + .form-control-feedback, | |
.input-group-lg + .form-control-feedback, | |
.form-group-lg .form-control + .form-control-feedback { | |
width: 45px; | |
height: 45px; | |
line-height: 45px; | |
} | |
.input-sm + .form-control-feedback, | |
.input-group-sm + .form-control-feedback, | |
.form-group-sm .form-control + .form-control-feedback { | |
width: 30px; | |
height: 30px; | |
line-height: 30px; | |
} | |
.has-success .help-block, | |
.has-success .control-label, | |
.has-success .radio, | |
.has-success .checkbox, | |
.has-success .radio-inline, | |
.has-success .checkbox-inline, | |
.has-success.radio label, | |
.has-success.checkbox label, | |
.has-success.radio-inline label, | |
.has-success.checkbox-inline label { | |
color: #3c763d; | |
} | |
.has-success .form-control { | |
border-color: #3c763d; | |
-webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); | |
box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); | |
} | |
.has-success .form-control:focus { | |
border-color: #2b542c; | |
-webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #67b168; | |
box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #67b168; | |
} | |
.has-success .input-group-addon { | |
color: #3c763d; | |
border-color: #3c763d; | |
background-color: #dff0d8; | |
} | |
.has-success .form-control-feedback { | |
color: #3c763d; | |
} | |
.has-warning .help-block, | |
.has-warning .control-label, | |
.has-warning .radio, | |
.has-warning .checkbox, | |
.has-warning .radio-inline, | |
.has-warning .checkbox-inline, | |
.has-warning.radio label, | |
.has-warning.checkbox label, | |
.has-warning.radio-inline label, | |
.has-warning.checkbox-inline label { | |
color: #8a6d3b; | |
} | |
.has-warning .form-control { | |
border-color: #8a6d3b; | |
-webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); | |
box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); | |
} | |
.has-warning .form-control:focus { | |
border-color: #66512c; | |
-webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #c0a16b; | |
box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #c0a16b; | |
} | |
.has-warning .input-group-addon { | |
color: #8a6d3b; | |
border-color: #8a6d3b; | |
background-color: #fcf8e3; | |
} | |
.has-warning .form-control-feedback { | |
color: #8a6d3b; | |
} | |
.has-error .help-block, | |
.has-error .control-label, | |
.has-error .radio, | |
.has-error .checkbox, | |
.has-error .radio-inline, | |
.has-error .checkbox-inline, | |
.has-error.radio label, | |
.has-error.checkbox label, | |
.has-error.radio-inline label, | |
.has-error.checkbox-inline label { | |
color: #a94442; | |
} | |
.has-error .form-control { | |
border-color: #a94442; | |
-webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); | |
box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); | |
} | |
.has-error .form-control:focus { | |
border-color: #843534; | |
-webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #ce8483; | |
box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #ce8483; | |
} | |
.has-error .input-group-addon { | |
color: #a94442; | |
border-color: #a94442; | |
background-color: #f2dede; | |
} | |
.has-error .form-control-feedback { | |
color: #a94442; | |
} | |
.has-feedback label ~ .form-control-feedback { | |
top: 23px; | |
} | |
.has-feedback label.sr-only ~ .form-control-feedback { | |
top: 0; | |
} | |
.help-block { | |
display: block; | |
margin-top: 5px; | |
margin-bottom: 10px; | |
color: #404040; | |
} | |
@media (min-width: 768px) { | |
.form-inline .form-group { | |
display: inline-block; | |
margin-bottom: 0; | |
vertical-align: middle; | |
} | |
.form-inline .form-control { | |
display: inline-block; | |
width: auto; | |
vertical-align: middle; | |
} | |
.form-inline .form-control-static { | |
display: inline-block; | |
} | |
.form-inline .input-group { | |
display: inline-table; | |
vertical-align: middle; | |
} | |
.form-inline .input-group .input-group-addon, | |
.form-inline .input-group .input-group-btn, | |
.form-inline .input-group .form-control { | |
width: auto; | |
} | |
.form-inline .input-group > .form-control { | |
width: 100%; | |
} | |
.form-inline .control-label { | |
margin-bottom: 0; | |
vertical-align: middle; | |
} | |
.form-inline .radio, | |
.form-inline .checkbox { | |
display: inline-block; | |
margin-top: 0; | |
margin-bottom: 0; | |
vertical-align: middle; | |
} | |
.form-inline .radio label, | |
.form-inline .checkbox label { | |
padding-left: 0; | |
} | |
.form-inline .radio input[type="radio"], | |
.form-inline .checkbox input[type="checkbox"] { | |
position: relative; | |
margin-left: 0; | |
} | |
.form-inline .has-feedback .form-control-feedback { | |
top: 0; | |
} | |
} | |
.form-horizontal .radio, | |
.form-horizontal .checkbox, | |
.form-horizontal .radio-inline, | |
.form-horizontal .checkbox-inline { | |
margin-top: 0; | |
margin-bottom: 0; | |
padding-top: 7px; | |
} | |
.form-horizontal .radio, | |
.form-horizontal .checkbox { | |
min-height: 25px; | |
} | |
.form-horizontal .form-group { | |
margin-left: 0px; | |
margin-right: 0px; | |
} | |
@media (min-width: 768px) { | |
.form-horizontal .control-label { | |
text-align: right; | |
margin-bottom: 0; | |
padding-top: 7px; | |
} | |
} | |
.form-horizontal .has-feedback .form-control-feedback { | |
right: 0px; | |
} | |
@media (min-width: 768px) { | |
.form-horizontal .form-group-lg .control-label { | |
padding-top: 11px; | |
font-size: 17px; | |
} | |
} | |
@media (min-width: 768px) { | |
.form-horizontal .form-group-sm .control-label { | |
padding-top: 6px; | |
font-size: 12px; | |
} | |
} | |
.btn { | |
display: inline-block; | |
margin-bottom: 0; | |
font-weight: normal; | |
text-align: center; | |
vertical-align: middle; | |
touch-action: manipulation; | |
cursor: pointer; | |
background-image: none; | |
border: 1px solid transparent; | |
white-space: nowrap; | |
padding: 6px 12px; | |
font-size: 13px; | |
line-height: 1.42857143; | |
border-radius: 2px; | |
-webkit-user-select: none; | |
-moz-user-select: none; | |
-ms-user-select: none; | |
user-select: none; | |
} | |
.btn:focus, | |
.btn:active:focus, | |
.btn.active:focus, | |
.btn.focus, | |
.btn:active.focus, | |
.btn.active.focus { | |
outline: 5px auto -webkit-focus-ring-color; | |
outline-offset: -2px; | |
} | |
.btn:hover, | |
.btn:focus, | |
.btn.focus { | |
color: #333; | |
text-decoration: none; | |
} | |
.btn:active, | |
.btn.active { | |
outline: 0; | |
background-image: none; | |
-webkit-box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); | |
box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); | |
} | |
.btn.disabled, | |
.btn[disabled], | |
fieldset[disabled] .btn { | |
cursor: not-allowed; | |
opacity: 0.65; | |
filter: alpha(opacity=65); | |
-webkit-box-shadow: none; | |
box-shadow: none; | |
} | |
a.btn.disabled, | |
fieldset[disabled] a.btn { | |
pointer-events: none; | |
} | |
.btn-default { | |
color: #333; | |
background-color: #fff; | |
border-color: #ccc; | |
} | |
.btn-default:focus, | |
.btn-default.focus { | |
color: #333; | |
background-color: #e6e6e6; | |
border-color: #8c8c8c; | |
} | |
.btn-default:hover { | |
color: #333; | |
background-color: #e6e6e6; | |
border-color: #adadad; | |
} | |
.btn-default:active, | |
.btn-default.active, | |
.open > .dropdown-toggle.btn-default { | |
color: #333; | |
background-color: #e6e6e6; | |
border-color: #adadad; | |
} | |
.btn-default:active:hover, | |
.btn-default.active:hover, | |
.open > .dropdown-toggle.btn-default:hover, | |
.btn-default:active:focus, | |
.btn-default.active:focus, | |
.open > .dropdown-toggle.btn-default:focus, | |
.btn-default:active.focus, | |
.btn-default.active.focus, | |
.open > .dropdown-toggle.btn-default.focus { | |
color: #333; | |
background-color: #d4d4d4; | |
border-color: #8c8c8c; | |
} | |
.btn-default:active, | |
.btn-default.active, | |
.open > .dropdown-toggle.btn-default { | |
background-image: none; | |
} | |
.btn-default.disabled:hover, | |
.btn-default[disabled]:hover, | |
fieldset[disabled] .btn-default:hover, | |
.btn-default.disabled:focus, | |
.btn-default[disabled]:focus, | |
fieldset[disabled] .btn-default:focus, | |
.btn-default.disabled.focus, | |
.btn-default[disabled].focus, | |
fieldset[disabled] .btn-default.focus { | |
background-color: #fff; | |
border-color: #ccc; | |
} | |
.btn-default .badge { | |
color: #fff; | |
background-color: #333; | |
} | |
.btn-primary { | |
color: #fff; | |
background-color: #337ab7; | |
border-color: #2e6da4; | |
} | |
.btn-primary:focus, | |
.btn-primary.focus { | |
color: #fff; | |
background-color: #286090; | |
border-color: #122b40; | |
} | |
.btn-primary:hover { | |
color: #fff; | |
background-color: #286090; | |
border-color: #204d74; | |
} | |
.btn-primary:active, | |
.btn-primary.active, | |
.open > .dropdown-toggle.btn-primary { | |
color: #fff; | |
background-color: #286090; | |
border-color: #204d74; | |
} | |
.btn-primary:active:hover, | |
.btn-primary.active:hover, | |
.open > .dropdown-toggle.btn-primary:hover, | |
.btn-primary:active:focus, | |
.btn-primary.active:focus, | |
.open > .dropdown-toggle.btn-primary:focus, | |
.btn-primary:active.focus, | |
.btn-primary.active.focus, | |
.open > .dropdown-toggle.btn-primary.focus { | |
color: #fff; | |
background-color: #204d74; | |
border-color: #122b40; | |
} | |
.btn-primary:active, | |
.btn-primary.active, | |
.open > .dropdown-toggle.btn-primary { | |
background-image: none; | |
} | |
.btn-primary.disabled:hover, | |
.btn-primary[disabled]:hover, | |
fieldset[disabled] .btn-primary:hover, | |
.btn-primary.disabled:focus, | |
.btn-primary[disabled]:focus, | |
fieldset[disabled] .btn-primary:focus, | |
.btn-primary.disabled.focus, | |
.btn-primary[disabled].focus, | |
fieldset[disabled] .btn-primary.focus { | |
background-color: #337ab7; | |
border-color: #2e6da4; | |
} | |
.btn-primary .badge { | |
color: #337ab7; | |
background-color: #fff; | |
} | |
.btn-success { | |
color: #fff; | |
background-color: #5cb85c; | |
border-color: #4cae4c; | |
} | |
.btn-success:focus, | |
.btn-success.focus { | |
color: #fff; | |
background-color: #449d44; | |
border-color: #255625; | |
} | |
.btn-success:hover { | |
color: #fff; | |
background-color: #449d44; | |
border-color: #398439; | |
} | |
.btn-success:active, | |
.btn-success.active, | |
.open > .dropdown-toggle.btn-success { | |
color: #fff; | |
background-color: #449d44; | |
border-color: #398439; | |
} | |
.btn-success:active:hover, | |
.btn-success.active:hover, | |
.open > .dropdown-toggle.btn-success:hover, | |
.btn-success:active:focus, | |
.btn-success.active:focus, | |
.open > .dropdown-toggle.btn-success:focus, | |
.btn-success:active.focus, | |
.btn-success.active.focus, | |
.open > .dropdown-toggle.btn-success.focus { | |
color: #fff; | |
background-color: #398439; | |
border-color: #255625; | |
} | |
.btn-success:active, | |
.btn-success.active, | |
.open > .dropdown-toggle.btn-success { | |
background-image: none; | |
} | |
.btn-success.disabled:hover, | |
.btn-success[disabled]:hover, | |
fieldset[disabled] .btn-success:hover, | |
.btn-success.disabled:focus, | |
.btn-success[disabled]:focus, | |
fieldset[disabled] .btn-success:focus, | |
.btn-success.disabled.focus, | |
.btn-success[disabled].focus, | |
fieldset[disabled] .btn-success.focus { | |
background-color: #5cb85c; | |
border-color: #4cae4c; | |
} | |
.btn-success .badge { | |
color: #5cb85c; | |
background-color: #fff; | |
} | |
.btn-info { | |
color: #fff; | |
background-color: #5bc0de; | |
border-color: #46b8da; | |
} | |
.btn-info:focus, | |
.btn-info.focus { | |
color: #fff; | |
background-color: #31b0d5; | |
border-color: #1b6d85; | |
} | |
.btn-info:hover { | |
color: #fff; | |
background-color: #31b0d5; | |
border-color: #269abc; | |
} | |
.btn-info:active, | |
.btn-info.active, | |
.open > .dropdown-toggle.btn-info { | |
color: #fff; | |
background-color: #31b0d5; | |
border-color: #269abc; | |
} | |
.btn-info:active:hover, | |
.btn-info.active:hover, | |
.open > .dropdown-toggle.btn-info:hover, | |
.btn-info:active:focus, | |
.btn-info.active:focus, | |
.open > .dropdown-toggle.btn-info:focus, | |
.btn-info:active.focus, | |
.btn-info.active.focus, | |
.open > .dropdown-toggle.btn-info.focus { | |
color: #fff; | |
background-color: #269abc; | |
border-color: #1b6d85; | |
} | |
.btn-info:active, | |
.btn-info.active, | |
.open > .dropdown-toggle.btn-info { | |
background-image: none; | |
} | |
.btn-info.disabled:hover, | |
.btn-info[disabled]:hover, | |
fieldset[disabled] .btn-info:hover, | |
.btn-info.disabled:focus, | |
.btn-info[disabled]:focus, | |
fieldset[disabled] .btn-info:focus, | |
.btn-info.disabled.focus, | |
.btn-info[disabled].focus, | |
fieldset[disabled] .btn-info.focus { | |
background-color: #5bc0de; | |
border-color: #46b8da; | |
} | |
.btn-info .badge { | |
color: #5bc0de; | |
background-color: #fff; | |
} | |
.btn-warning { | |
color: #fff; | |
background-color: #f0ad4e; | |
border-color: #eea236; | |
} | |
.btn-warning:focus, | |
.btn-warning.focus { | |
color: #fff; | |
background-color: #ec971f; | |
border-color: #985f0d; | |
} | |
.btn-warning:hover { | |
color: #fff; | |
background-color: #ec971f; | |
border-color: #d58512; | |
} | |
.btn-warning:active, | |
.btn-warning.active, | |
.open > .dropdown-toggle.btn-warning { | |
color: #fff; | |
background-color: #ec971f; | |
border-color: #d58512; | |
} | |
.btn-warning:active:hover, | |
.btn-warning.active:hover, | |
.open > .dropdown-toggle.btn-warning:hover, | |
.btn-warning:active:focus, | |
.btn-warning.active:focus, | |
.open > .dropdown-toggle.btn-warning:focus, | |
.btn-warning:active.focus, | |
.btn-warning.active.focus, | |
.open > .dropdown-toggle.btn-warning.focus { | |
color: #fff; | |
background-color: #d58512; | |
border-color: #985f0d; | |
} | |
.btn-warning:active, | |
.btn-warning.active, | |
.open > .dropdown-toggle.btn-warning { | |
background-image: none; | |
} | |
.btn-warning.disabled:hover, | |
.btn-warning[disabled]:hover, | |
fieldset[disabled] .btn-warning:hover, | |
.btn-warning.disabled:focus, | |
.btn-warning[disabled]:focus, | |
fieldset[disabled] .btn-warning:focus, | |
.btn-warning.disabled.focus, | |
.btn-warning[disabled].focus, | |
fieldset[disabled] .btn-warning.focus { | |
background-color: #f0ad4e; | |
border-color: #eea236; | |
} | |
.btn-warning .badge { | |
color: #f0ad4e; | |
background-color: #fff; | |
} | |
.btn-danger { | |
color: #fff; | |
background-color: #d9534f; | |
border-color: #d43f3a; | |
} | |
.btn-danger:focus, | |
.btn-danger.focus { | |
color: #fff; | |
background-color: #c9302c; | |
border-color: #761c19; | |
} | |
.btn-danger:hover { | |
color: #fff; | |
background-color: #c9302c; | |
border-color: #ac2925; | |
} | |
.btn-danger:active, | |
.btn-danger.active, | |
.open > .dropdown-toggle.btn-danger { | |
color: #fff; | |
background-color: #c9302c; | |
border-color: #ac2925; | |
} | |
.btn-danger:active:hover, | |
.btn-danger.active:hover, | |
.open > .dropdown-toggle.btn-danger:hover, | |
.btn-danger:active:focus, | |
.btn-danger.active:focus, | |
.open > .dropdown-toggle.btn-danger:focus, | |
.btn-danger:active.focus, | |
.btn-danger.active.focus, | |
.open > .dropdown-toggle.btn-danger.focus { | |
color: #fff; | |
background-color: #ac2925; | |
border-color: #761c19; | |
} | |
.btn-danger:active, | |
.btn-danger.active, | |
.open > .dropdown-toggle.btn-danger { | |
background-image: none; | |
} | |
.btn-danger.disabled:hover, | |
.btn-danger[disabled]:hover, | |
fieldset[disabled] .btn-danger:hover, | |
.btn-danger.disabled:focus, | |
.btn-danger[disabled]:focus, | |
fieldset[disabled] .btn-danger:focus, | |
.btn-danger.disabled.focus, | |
.btn-danger[disabled].focus, | |
fieldset[disabled] .btn-danger.focus { | |
background-color: #d9534f; | |
border-color: #d43f3a; | |
} | |
.btn-danger .badge { | |
color: #d9534f; | |
background-color: #fff; | |
} | |
.btn-link { | |
color: #337ab7; | |
font-weight: normal; | |
border-radius: 0; | |
} | |
.btn-link, | |
.btn-link:active, | |
.btn-link.active, | |
.btn-link[disabled], | |
fieldset[disabled] .btn-link { | |
background-color: transparent; | |
-webkit-box-shadow: none; | |
box-shadow: none; | |
} | |
.btn-link, | |
.btn-link:hover, | |
.btn-link:focus, | |
.btn-link:active { | |
border-color: transparent; | |
} | |
.btn-link:hover, | |
.btn-link:focus { | |
color: #23527c; | |
text-decoration: underline; | |
background-color: transparent; | |
} | |
.btn-link[disabled]:hover, | |
fieldset[disabled] .btn-link:hover, | |
.btn-link[disabled]:focus, | |
fieldset[disabled] .btn-link:focus { | |
color: #777777; | |
text-decoration: none; | |
} | |
.btn-lg, | |
.btn-group-lg > .btn { | |
padding: 10px 16px; | |
font-size: 17px; | |
line-height: 1.3333333; | |
border-radius: 3px; | |
} | |
.btn-sm, | |
.btn-group-sm > .btn { | |
padding: 5px 10px; | |
font-size: 12px; | |
line-height: 1.5; | |
border-radius: 1px; | |
} | |
.btn-xs, | |
.btn-group-xs > .btn { | |
padding: 1px 5px; | |
font-size: 12px; | |
line-height: 1.5; | |
border-radius: 1px; | |
} | |
.btn-block { | |
display: block; | |
width: 100%; | |
} | |
.btn-block + .btn-block { | |
margin-top: 5px; | |
} | |
input[type="submit"].btn-block, | |
input[type="reset"].btn-block, | |
input[type="button"].btn-block { | |
width: 100%; | |
} | |
.fade { | |
opacity: 0; | |
-webkit-transition: opacity 0.15s linear; | |
-o-transition: opacity 0.15s linear; | |
transition: opacity 0.15s linear; | |
} | |
.fade.in { | |
opacity: 1; | |
} | |
.collapse { | |
display: none; | |
} | |
.collapse.in { | |
display: block; | |
} | |
tr.collapse.in { | |
display: table-row; | |
} | |
tbody.collapse.in { | |
display: table-row-group; | |
} | |
.collapsing { | |
position: relative; | |
height: 0; | |
overflow: hidden; | |
-webkit-transition-property: height, visibility; | |
transition-property: height, visibility; | |
-webkit-transition-duration: 0.35s; | |
transition-duration: 0.35s; | |
-webkit-transition-timing-function: ease; | |
transition-timing-function: ease; | |
} | |
.caret { | |
display: inline-block; | |
width: 0; | |
height: 0; | |
margin-left: 2px; | |
vertical-align: middle; | |
border-top: 4px dashed; | |
border-top: 4px solid \9; | |
border-right: 4px solid transparent; | |
border-left: 4px solid transparent; | |
} | |
.dropup, | |
.dropdown { | |
position: relative; | |
} | |
.dropdown-toggle:focus { | |
outline: 0; | |
} | |
.dropdown-menu { | |
position: absolute; | |
top: 100%; | |
left: 0; | |
z-index: 1000; | |
display: none; | |
float: left; | |
min-width: 160px; | |
padding: 5px 0; | |
margin: 2px 0 0; | |
list-style: none; | |
font-size: 13px; | |
text-align: left; | |
background-color: #fff; | |
border: 1px solid #ccc; | |
border: 1px solid rgba(0, 0, 0, 0.15); | |
border-radius: 2px; | |
-webkit-box-shadow: 0 6px 12px rgba(0, 0, 0, 0.175); | |
box-shadow: 0 6px 12px rgba(0, 0, 0, 0.175); | |
background-clip: padding-box; | |
} | |
.dropdown-menu.pull-right { | |
right: 0; | |
left: auto; | |
} | |
.dropdown-menu .divider { | |
height: 1px; | |
margin: 8px 0; | |
overflow: hidden; | |
background-color: #e5e5e5; | |
} | |
.dropdown-menu > li > a { | |
display: block; | |
padding: 3px 20px; | |
clear: both; | |
font-weight: normal; | |
line-height: 1.42857143; | |
color: #333333; | |
white-space: nowrap; | |
} | |
.dropdown-menu > li > a:hover, | |
.dropdown-menu > li > a:focus { | |
text-decoration: none; | |
color: #262626; | |
background-color: #f5f5f5; | |
} | |
.dropdown-menu > .active > a, | |
.dropdown-menu > .active > a:hover, | |
.dropdown-menu > .active > a:focus { | |
color: #fff; | |
text-decoration: none; | |
outline: 0; | |
background-color: #337ab7; | |
} | |
.dropdown-menu > .disabled > a, | |
.dropdown-menu > .disabled > a:hover, | |
.dropdown-menu > .disabled > a:focus { | |
color: #777777; | |
} | |
.dropdown-menu > .disabled > a:hover, | |
.dropdown-menu > .disabled > a:focus { | |
text-decoration: none; | |
background-color: transparent; | |
background-image: none; | |
filter: progid:DXImageTransform.Microsoft.gradient(enabled = false); | |
cursor: not-allowed; | |
} | |
.open > .dropdown-menu { | |
display: block; | |
} | |
.open > a { | |
outline: 0; | |
} | |
.dropdown-menu-right { | |
left: auto; | |
right: 0; | |
} | |
.dropdown-menu-left { | |
left: 0; | |
right: auto; | |
} | |
.dropdown-header { | |
display: block; | |
padding: 3px 20px; | |
font-size: 12px; | |
line-height: 1.42857143; | |
color: #777777; | |
white-space: nowrap; | |
} | |
.dropdown-backdrop { | |
position: fixed; | |
left: 0; | |
right: 0; | |
bottom: 0; | |
top: 0; | |
z-index: 990; | |
} | |
.pull-right > .dropdown-menu { | |
right: 0; | |
left: auto; | |
} | |
.dropup .caret, | |
.navbar-fixed-bottom .dropdown .caret { | |
border-top: 0; | |
border-bottom: 4px dashed; | |
border-bottom: 4px solid \9; | |
content: ""; | |
} | |
.dropup .dropdown-menu, | |
.navbar-fixed-bottom .dropdown .dropdown-menu { | |
top: auto; | |
bottom: 100%; | |
margin-bottom: 2px; | |
} | |
@media (min-width: 541px) { | |
.navbar-right .dropdown-menu { | |
left: auto; | |
right: 0; | |
} | |
.navbar-right .dropdown-menu-left { | |
left: 0; | |
right: auto; | |
} | |
} | |
.btn-group, | |
.btn-group-vertical { | |
position: relative; | |
display: inline-block; | |
vertical-align: middle; | |
} | |
.btn-group > .btn, | |
.btn-group-vertical > .btn { | |
position: relative; | |
float: left; | |
} | |
.btn-group > .btn:hover, | |
.btn-group-vertical > .btn:hover, | |
.btn-group > .btn:focus, | |
.btn-group-vertical > .btn:focus, | |
.btn-group > .btn:active, | |
.btn-group-vertical > .btn:active, | |
.btn-group > .btn.active, | |
.btn-group-vertical > .btn.active { | |
z-index: 2; | |
} | |
.btn-group .btn + .btn, | |
.btn-group .btn + .btn-group, | |
.btn-group .btn-group + .btn, | |
.btn-group .btn-group + .btn-group { | |
margin-left: -1px; | |
} | |
.btn-toolbar { | |
margin-left: -5px; | |
} | |
.btn-toolbar .btn, | |
.btn-toolbar .btn-group, | |
.btn-toolbar .input-group { | |
float: left; | |
} | |
.btn-toolbar > .btn, | |
.btn-toolbar > .btn-group, | |
.btn-toolbar > .input-group { | |
margin-left: 5px; | |
} | |
.btn-group > .btn:not(:first-child):not(:last-child):not(.dropdown-toggle) { | |
border-radius: 0; | |
} | |
.btn-group > .btn:first-child { | |
margin-left: 0; | |
} | |
.btn-group > .btn:first-child:not(:last-child):not(.dropdown-toggle) { | |
border-bottom-right-radius: 0; | |
border-top-right-radius: 0; | |
} | |
.btn-group > .btn:last-child:not(:first-child), | |
.btn-group > .dropdown-toggle:not(:first-child) { | |
border-bottom-left-radius: 0; | |
border-top-left-radius: 0; | |
} | |
.btn-group > .btn-group { | |
float: left; | |
} | |
.btn-group > .btn-group:not(:first-child):not(:last-child) > .btn { | |
border-radius: 0; | |
} | |
.btn-group > .btn-group:first-child:not(:last-child) > .btn:last-child, | |
.btn-group > .btn-group:first-child:not(:last-child) > .dropdown-toggle { | |
border-bottom-right-radius: 0; | |
border-top-right-radius: 0; | |
} | |
.btn-group > .btn-group:last-child:not(:first-child) > .btn:first-child { | |
border-bottom-left-radius: 0; | |
border-top-left-radius: 0; | |
} | |
.btn-group .dropdown-toggle:active, | |
.btn-group.open .dropdown-toggle { | |
outline: 0; | |
} | |
.btn-group > .btn + .dropdown-toggle { | |
padding-left: 8px; | |
padding-right: 8px; | |
} | |
.btn-group > .btn-lg + .dropdown-toggle { | |
padding-left: 12px; | |
padding-right: 12px; | |
} | |
.btn-group.open .dropdown-toggle { | |
-webkit-box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); | |
box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); | |
} | |
.btn-group.open .dropdown-toggle.btn-link { | |
-webkit-box-shadow: none; | |
box-shadow: none; | |
} | |
.btn .caret { | |
margin-left: 0; | |
} | |
.btn-lg .caret { | |
border-width: 5px 5px 0; | |
border-bottom-width: 0; | |
} | |
.dropup .btn-lg .caret { | |
border-width: 0 5px 5px; | |
} | |
.btn-group-vertical > .btn, | |
.btn-group-vertical > .btn-group, | |
.btn-group-vertical > .btn-group > .btn { | |
display: block; | |
float: none; | |
width: 100%; | |
max-width: 100%; | |
} | |
.btn-group-vertical > .btn-group > .btn { | |
float: none; | |
} | |
.btn-group-vertical > .btn + .btn, | |
.btn-group-vertical > .btn + .btn-group, | |
.btn-group-vertical > .btn-group + .btn, | |
.btn-group-vertical > .btn-group + .btn-group { | |
margin-top: -1px; | |
margin-left: 0; | |
} | |
.btn-group-vertical > .btn:not(:first-child):not(:last-child) { | |
border-radius: 0; | |
} | |
.btn-group-vertical > .btn:first-child:not(:last-child) { | |
border-top-right-radius: 2px; | |
border-top-left-radius: 2px; | |
border-bottom-right-radius: 0; | |
border-bottom-left-radius: 0; | |
} | |
.btn-group-vertical > .btn:last-child:not(:first-child) { | |
border-top-right-radius: 0; | |
border-top-left-radius: 0; | |
border-bottom-right-radius: 2px; | |
border-bottom-left-radius: 2px; | |
} | |
.btn-group-vertical > .btn-group:not(:first-child):not(:last-child) > .btn { | |
border-radius: 0; | |
} | |
.btn-group-vertical > .btn-group:first-child:not(:last-child) > .btn:last-child, | |
.btn-group-vertical > .btn-group:first-child:not(:last-child) > .dropdown-toggle { | |
border-bottom-right-radius: 0; | |
border-bottom-left-radius: 0; | |
} | |
.btn-group-vertical > .btn-group:last-child:not(:first-child) > .btn:first-child { | |
border-top-right-radius: 0; | |
border-top-left-radius: 0; | |
} | |
.btn-group-justified { | |
display: table; | |
width: 100%; | |
table-layout: fixed; | |
border-collapse: separate; | |
} | |
.btn-group-justified > .btn, | |
.btn-group-justified > .btn-group { | |
float: none; | |
display: table-cell; | |
width: 1%; | |
} | |
.btn-group-justified > .btn-group .btn { | |
width: 100%; | |
} | |
.btn-group-justified > .btn-group .dropdown-menu { | |
left: auto; | |
} | |
[data-toggle="buttons"] > .btn input[type="radio"], | |
[data-toggle="buttons"] > .btn-group > .btn input[type="radio"], | |
[data-toggle="buttons"] > .btn input[type="checkbox"], | |
[data-toggle="buttons"] > .btn-group > .btn input[type="checkbox"] { | |
position: absolute; | |
clip: rect(0, 0, 0, 0); | |
pointer-events: none; | |
} | |
.input-group { | |
position: relative; | |
display: table; | |
border-collapse: separate; | |
} | |
.input-group[class*="col-"] { | |
float: none; | |
padding-left: 0; | |
padding-right: 0; | |
} | |
.input-group .form-control { | |
position: relative; | |
z-index: 2; | |
float: left; | |
width: 100%; | |
margin-bottom: 0; | |
} | |
.input-group .form-control:focus { | |
z-index: 3; | |
} | |
.input-group-lg > .form-control, | |
.input-group-lg > .input-group-addon, | |
.input-group-lg > .input-group-btn > .btn { | |
height: 45px; | |
padding: 10px 16px; | |
font-size: 17px; | |
line-height: 1.3333333; | |
border-radius: 3px; | |
} | |
select.input-group-lg > .form-control, | |
select.input-group-lg > .input-group-addon, | |
select.input-group-lg > .input-group-btn > .btn { | |
height: 45px; | |
line-height: 45px; | |
} | |
textarea.input-group-lg > .form-control, | |
textarea.input-group-lg > .input-group-addon, | |
textarea.input-group-lg > .input-group-btn > .btn, | |
select[multiple].input-group-lg > .form-control, | |
select[multiple].input-group-lg > .input-group-addon, | |
select[multiple].input-group-lg > .input-group-btn > .btn { | |
height: auto; | |
} | |
.input-group-sm > .form-control, | |
.input-group-sm > .input-group-addon, | |
.input-group-sm > .input-group-btn > .btn { | |
height: 30px; | |
padding: 5px 10px; | |
font-size: 12px; | |
line-height: 1.5; | |
border-radius: 1px; | |
} | |
select.input-group-sm > .form-control, | |
select.input-group-sm > .input-group-addon, | |
select.input-group-sm > .input-group-btn > .btn { | |
height: 30px; | |
line-height: 30px; | |
} | |
textarea.input-group-sm > .form-control, | |
textarea.input-group-sm > .input-group-addon, | |
textarea.input-group-sm > .input-group-btn > .btn, | |
select[multiple].input-group-sm > .form-control, | |
select[multiple].input-group-sm > .input-group-addon, | |
select[multiple].input-group-sm > .input-group-btn > .btn { | |
height: auto; | |
} | |
.input-group-addon, | |
.input-group-btn, | |
.input-group .form-control { | |
display: table-cell; | |
} | |
.input-group-addon:not(:first-child):not(:last-child), | |
.input-group-btn:not(:first-child):not(:last-child), | |
.input-group .form-control:not(:first-child):not(:last-child) { | |
border-radius: 0; | |
} | |
.input-group-addon, | |
.input-group-btn { | |
width: 1%; | |
white-space: nowrap; | |
vertical-align: middle; | |
} | |
.input-group-addon { | |
padding: 6px 12px; | |
font-size: 13px; | |
font-weight: normal; | |
line-height: 1; | |
color: #555555; | |
text-align: center; | |
background-color: #eeeeee; | |
border: 1px solid #ccc; | |
border-radius: 2px; | |
} | |
.input-group-addon.input-sm { | |
padding: 5px 10px; | |
font-size: 12px; | |
border-radius: 1px; | |
} | |
.input-group-addon.input-lg { | |
padding: 10px 16px; | |
font-size: 17px; | |
border-radius: 3px; | |
} | |
.input-group-addon input[type="radio"], | |
.input-group-addon input[type="checkbox"] { | |
margin-top: 0; | |
} | |
.input-group .form-control:first-child, | |
.input-group-addon:first-child, | |
.input-group-btn:first-child > .btn, | |
.input-group-btn:first-child > .btn-group > .btn, | |
.input-group-btn:first-child > .dropdown-toggle, | |
.input-group-btn:last-child > .btn:not(:last-child):not(.dropdown-toggle), | |
.input-group-btn:last-child > .btn-group:not(:last-child) > .btn { | |
border-bottom-right-radius: 0; | |
border-top-right-radius: 0; | |
} | |
.input-group-addon:first-child { | |
border-right: 0; | |
} | |
.input-group .form-control:last-child, | |
.input-group-addon:last-child, | |
.input-group-btn:last-child > .btn, | |
.input-group-btn:last-child > .btn-group > .btn, | |
.input-group-btn:last-child > .dropdown-toggle, | |
.input-group-btn:first-child > .btn:not(:first-child), | |
.input-group-btn:first-child > .btn-group:not(:first-child) > .btn { | |
border-bottom-left-radius: 0; | |
border-top-left-radius: 0; | |
} | |
.input-group-addon:last-child { | |
border-left: 0; | |
} | |
.input-group-btn { | |
position: relative; | |
font-size: 0; | |
white-space: nowrap; | |
} | |
.input-group-btn > .btn { | |
position: relative; | |
} | |
.input-group-btn > .btn + .btn { | |
margin-left: -1px; | |
} | |
.input-group-btn > .btn:hover, | |
.input-group-btn > .btn:focus, | |
.input-group-btn > .btn:active { | |
z-index: 2; | |
} | |
.input-group-btn:first-child > .btn, | |
.input-group-btn:first-child > .btn-group { | |
margin-right: -1px; | |
} | |
.input-group-btn:last-child > .btn, | |
.input-group-btn:last-child > .btn-group { | |
z-index: 2; | |
margin-left: -1px; | |
} | |
.nav { | |
margin-bottom: 0; | |
padding-left: 0; | |
list-style: none; | |
} | |
.nav > li { | |
position: relative; | |
display: block; | |
} | |
.nav > li > a { | |
position: relative; | |
display: block; | |
padding: 10px 15px; | |
} | |
.nav > li > a:hover, | |
.nav > li > a:focus { | |
text-decoration: none; | |
background-color: #eeeeee; | |
} | |
.nav > li.disabled > a { | |
color: #777777; | |
} | |
.nav > li.disabled > a:hover, | |
.nav > li.disabled > a:focus { | |
color: #777777; | |
text-decoration: none; | |
background-color: transparent; | |
cursor: not-allowed; | |
} | |
.nav .open > a, | |
.nav .open > a:hover, | |
.nav .open > a:focus { | |
background-color: #eeeeee; | |
border-color: #337ab7; | |
} | |
.nav .nav-divider { | |
height: 1px; | |
margin: 8px 0; | |
overflow: hidden; | |
background-color: #e5e5e5; | |
} | |
.nav > li > a > img { | |
max-width: none; | |
} | |
.nav-tabs { | |
border-bottom: 1px solid #ddd; | |
} | |
.nav-tabs > li { | |
float: left; | |
margin-bottom: -1px; | |
} | |
.nav-tabs > li > a { | |
margin-right: 2px; | |
line-height: 1.42857143; | |
border: 1px solid transparent; | |
border-radius: 2px 2px 0 0; | |
} | |
.nav-tabs > li > a:hover { | |
border-color: #eeeeee #eeeeee #ddd; | |
} | |
.nav-tabs > li.active > a, | |
.nav-tabs > li.active > a:hover, | |
.nav-tabs > li.active > a:focus { | |
color: #555555; | |
background-color: #fff; | |
border: 1px solid #ddd; | |
border-bottom-color: transparent; | |
cursor: default; | |
} | |
.nav-tabs.nav-justified { | |
width: 100%; | |
border-bottom: 0; | |
} | |
.nav-tabs.nav-justified > li { | |
float: none; | |
} | |
.nav-tabs.nav-justified > li > a { | |
text-align: center; | |
margin-bottom: 5px; | |
} | |
.nav-tabs.nav-justified > .dropdown .dropdown-menu { | |
top: auto; | |
left: auto; | |
} | |
@media (min-width: 768px) { | |
.nav-tabs.nav-justified > li { | |
display: table-cell; | |
width: 1%; | |
} | |
.nav-tabs.nav-justified > li > a { | |
margin-bottom: 0; | |
} | |
} | |
.nav-tabs.nav-justified > li > a { | |
margin-right: 0; | |
border-radius: 2px; | |
} | |
.nav-tabs.nav-justified > .active > a, | |
.nav-tabs.nav-justified > .active > a:hover, | |
.nav-tabs.nav-justified > .active > a:focus { | |
border: 1px solid #ddd; | |
} | |
@media (min-width: 768px) { | |
.nav-tabs.nav-justified > li > a { | |
border-bottom: 1px solid #ddd; | |
border-radius: 2px 2px 0 0; | |
} | |
.nav-tabs.nav-justified > .active > a, | |
.nav-tabs.nav-justified > .active > a:hover, | |
.nav-tabs.nav-justified > .active > a:focus { | |
border-bottom-color: #fff; | |
} | |
} | |
.nav-pills > li { | |
float: left; | |
} | |
.nav-pills > li > a { | |
border-radius: 2px; | |
} | |
.nav-pills > li + li { | |
margin-left: 2px; | |
} | |
.nav-pills > li.active > a, | |
.nav-pills > li.active > a:hover, | |
.nav-pills > li.active > a:focus { | |
color: #fff; | |
background-color: #337ab7; | |
} | |
.nav-stacked > li { | |
float: none; | |
} | |
.nav-stacked > li + li { | |
margin-top: 2px; | |
margin-left: 0; | |
} | |
.nav-justified { | |
width: 100%; | |
} | |
.nav-justified > li { | |
float: none; | |
} | |
.nav-justified > li > a { | |
text-align: center; | |
margin-bottom: 5px; | |
} | |
.nav-justified > .dropdown .dropdown-menu { | |
top: auto; | |
left: auto; | |
} | |
@media (min-width: 768px) { | |
.nav-justified > li { | |
display: table-cell; | |
width: 1%; | |
} | |
.nav-justified > li > a { | |
margin-bottom: 0; | |
} | |
} | |
.nav-tabs-justified { | |
border-bottom: 0; | |
} | |
.nav-tabs-justified > li > a { | |
margin-right: 0; | |
border-radius: 2px; | |
} | |
.nav-tabs-justified > .active > a, | |
.nav-tabs-justified > .active > a:hover, | |
.nav-tabs-justified > .active > a:focus { | |
border: 1px solid #ddd; | |
} | |
@media (min-width: 768px) { | |
.nav-tabs-justified > li > a { | |
border-bottom: 1px solid #ddd; | |
border-radius: 2px 2px 0 0; | |
} | |
.nav-tabs-justified > .active > a, | |
.nav-tabs-justified > .active > a:hover, | |
.nav-tabs-justified > .active > a:focus { | |
border-bottom-color: #fff; | |
} | |
} | |
.tab-content > .tab-pane { | |
display: none; | |
} | |
.tab-content > .active { | |
display: block; | |
} | |
.nav-tabs .dropdown-menu { | |
margin-top: -1px; | |
border-top-right-radius: 0; | |
border-top-left-radius: 0; | |
} | |
.navbar { | |
position: relative; | |
min-height: 30px; | |
margin-bottom: 18px; | |
border: 1px solid transparent; | |
} | |
@media (min-width: 541px) { | |
.navbar { | |
border-radius: 2px; | |
} | |
} | |
@media (min-width: 541px) { | |
.navbar-header { | |
float: left; | |
} | |
} | |
.navbar-collapse { | |
overflow-x: visible; | |
padding-right: 0px; | |
padding-left: 0px; | |
border-top: 1px solid transparent; | |
box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1); | |
-webkit-overflow-scrolling: touch; | |
} | |
.navbar-collapse.in { | |
overflow-y: auto; | |
} | |
@media (min-width: 541px) { | |
.navbar-collapse { | |
width: auto; | |
border-top: 0; | |
box-shadow: none; | |
} | |
.navbar-collapse.collapse { | |
display: block !important; | |
height: auto !important; | |
padding-bottom: 0; | |
overflow: visible !important; | |
} | |
.navbar-collapse.in { | |
overflow-y: visible; | |
} | |
.navbar-fixed-top .navbar-collapse, | |
.navbar-static-top .navbar-collapse, | |
.navbar-fixed-bottom .navbar-collapse { | |
padding-left: 0; | |
padding-right: 0; | |
} | |
} | |
.navbar-fixed-top .navbar-collapse, | |
.navbar-fixed-bottom .navbar-collapse { | |
max-height: 340px; | |
} | |
@media (max-device-width: 540px) and (orientation: landscape) { | |
.navbar-fixed-top .navbar-collapse, | |
.navbar-fixed-bottom .navbar-collapse { | |
max-height: 200px; | |
} | |
} | |
.container > .navbar-header, | |
.container-fluid > .navbar-header, | |
.container > .navbar-collapse, | |
.container-fluid > .navbar-collapse { | |
margin-right: 0px; | |
margin-left: 0px; | |
} | |
@media (min-width: 541px) { | |
.container > .navbar-header, | |
.container-fluid > .navbar-header, | |
.container > .navbar-collapse, | |
.container-fluid > .navbar-collapse { | |
margin-right: 0; | |
margin-left: 0; | |
} | |
} | |
.navbar-static-top { | |
z-index: 1000; | |
border-width: 0 0 1px; | |
} | |
@media (min-width: 541px) { | |
.navbar-static-top { | |
border-radius: 0; | |
} | |
} | |
.navbar-fixed-top, | |
.navbar-fixed-bottom { | |
position: fixed; | |
right: 0; | |
left: 0; | |
z-index: 1030; | |
} | |
@media (min-width: 541px) { | |
.navbar-fixed-top, | |
.navbar-fixed-bottom { | |
border-radius: 0; | |
} | |
} | |
.navbar-fixed-top { | |
top: 0; | |
border-width: 0 0 1px; | |
} | |
.navbar-fixed-bottom { | |
bottom: 0; | |
margin-bottom: 0; | |
border-width: 1px 0 0; | |
} | |
.navbar-brand { | |
float: left; | |
padding: 6px 0px; | |
font-size: 17px; | |
line-height: 18px; | |
height: 30px; | |
} | |
.navbar-brand:hover, | |
.navbar-brand:focus { | |
text-decoration: none; | |
} | |
.navbar-brand > img { | |
display: block; | |
} | |
@media (min-width: 541px) { | |
.navbar > .container .navbar-brand, | |
.navbar > .container-fluid .navbar-brand { | |
margin-left: 0px; | |
} | |
} | |
.navbar-toggle { | |
position: relative; | |
float: right; | |
margin-right: 0px; | |
padding: 9px 10px; | |
margin-top: -2px; | |
margin-bottom: -2px; | |
background-color: transparent; | |
background-image: none; | |
border: 1px solid transparent; | |
border-radius: 2px; | |
} | |
.navbar-toggle:focus { | |
outline: 0; | |
} | |
.navbar-toggle .icon-bar { | |
display: block; | |
width: 22px; | |
height: 2px; | |
border-radius: 1px; | |
} | |
.navbar-toggle .icon-bar + .icon-bar { | |
margin-top: 4px; | |
} | |
@media (min-width: 541px) { | |
.navbar-toggle { | |
display: none; | |
} | |
} | |
.navbar-nav { | |
margin: 3px 0px; | |
} | |
.navbar-nav > li > a { | |
padding-top: 10px; | |
padding-bottom: 10px; | |
line-height: 18px; | |
} | |
@media (max-width: 540px) { | |
.navbar-nav .open .dropdown-menu { | |
position: static; | |
float: none; | |
width: auto; | |
margin-top: 0; | |
background-color: transparent; | |
border: 0; | |
box-shadow: none; | |
} | |
.navbar-nav .open .dropdown-menu > li > a, | |
.navbar-nav .open .dropdown-menu .dropdown-header { | |
padding: 5px 15px 5px 25px; | |
} | |
.navbar-nav .open .dropdown-menu > li > a { | |
line-height: 18px; | |
} | |
.navbar-nav .open .dropdown-menu > li > a:hover, | |
.navbar-nav .open .dropdown-menu > li > a:focus { | |
background-image: none; | |
} | |
} | |
@media (min-width: 541px) { | |
.navbar-nav { | |
float: left; | |
margin: 0; | |
} | |
.navbar-nav > li { | |
float: left; | |
} | |
.navbar-nav > li > a { | |
padding-top: 6px; | |
padding-bottom: 6px; | |
} | |
} | |
.navbar-form { | |
margin-left: 0px; | |
margin-right: 0px; | |
padding: 10px 0px; | |
border-top: 1px solid transparent; | |
border-bottom: 1px solid transparent; | |
-webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1), 0 1px 0 rgba(255, 255, 255, 0.1); | |
box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1), 0 1px 0 rgba(255, 255, 255, 0.1); | |
margin-top: -1px; | |
margin-bottom: -1px; | |
} | |
@media (min-width: 768px) { | |
.navbar-form .form-group { | |
display: inline-block; | |
margin-bottom: 0; | |
vertical-align: middle; | |
} | |
.navbar-form .form-control { | |
display: inline-block; | |
width: auto; | |
vertical-align: middle; | |
} | |
.navbar-form .form-control-static { | |
display: inline-block; | |
} | |
.navbar-form .input-group { | |
display: inline-table; | |
vertical-align: middle; | |
} | |
.navbar-form .input-group .input-group-addon, | |
.navbar-form .input-group .input-group-btn, | |
.navbar-form .input-group .form-control { | |
width: auto; | |
} | |
.navbar-form .input-group > .form-control { | |
width: 100%; | |
} | |
.navbar-form .control-label { | |
margin-bottom: 0; | |
vertical-align: middle; | |
} | |
.navbar-form .radio, | |
.navbar-form .checkbox { | |
display: inline-block; | |
margin-top: 0; | |
margin-bottom: 0; | |
vertical-align: middle; | |
} | |
.navbar-form .radio label, | |
.navbar-form .checkbox label { | |
padding-left: 0; | |
} | |
.navbar-form .radio input[type="radio"], | |
.navbar-form .checkbox input[type="checkbox"] { | |
position: relative; | |
margin-left: 0; | |
} | |
.navbar-form .has-feedback .form-control-feedback { | |
top: 0; | |
} | |
} | |
@media (max-width: 540px) { | |
.navbar-form .form-group { | |
margin-bottom: 5px; | |
} | |
.navbar-form .form-group:last-child { | |
margin-bottom: 0; | |
} | |
} | |
@media (min-width: 541px) { | |
.navbar-form { | |
width: auto; | |
border: 0; | |
margin-left: 0; | |
margin-right: 0; | |
padding-top: 0; | |
padding-bottom: 0; | |
-webkit-box-shadow: none; | |
box-shadow: none; | |
} | |
} | |
.navbar-nav > li > .dropdown-menu { | |
margin-top: 0; | |
border-top-right-radius: 0; | |
border-top-left-radius: 0; | |
} | |
.navbar-fixed-bottom .navbar-nav > li > .dropdown-menu { | |
margin-bottom: 0; | |
border-top-right-radius: 2px; | |
border-top-left-radius: 2px; | |
border-bottom-right-radius: 0; | |
border-bottom-left-radius: 0; | |
} | |
.navbar-btn { | |
margin-top: -1px; | |
margin-bottom: -1px; | |
} | |
.navbar-btn.btn-sm { | |
margin-top: 0px; | |
margin-bottom: 0px; | |
} | |
.navbar-btn.btn-xs { | |
margin-top: 4px; | |
margin-bottom: 4px; | |
} | |
.navbar-text { | |
margin-top: 6px; | |
margin-bottom: 6px; | |
} | |
@media (min-width: 541px) { | |
.navbar-text { | |
float: left; | |
margin-left: 0px; | |
margin-right: 0px; | |
} | |
} | |
@media (min-width: 541px) { | |
.navbar-left { | |
float: left !important; | |
float: left; | |
} | |
.navbar-right { | |
float: right !important; | |
float: right; | |
margin-right: 0px; | |
} | |
.navbar-right ~ .navbar-right { | |
margin-right: 0; | |
} | |
} | |
.navbar-default { | |
background-color: #f8f8f8; | |
border-color: #e7e7e7; | |
} | |
.navbar-default .navbar-brand { | |
color: #777; | |
} | |
.navbar-default .navbar-brand:hover, | |
.navbar-default .navbar-brand:focus { | |
color: #5e5e5e; | |
background-color: transparent; | |
} | |
.navbar-default .navbar-text { | |
color: #777; | |
} | |
.navbar-default .navbar-nav > li > a { | |
color: #777; | |
} | |
.navbar-default .navbar-nav > li > a:hover, | |
.navbar-default .navbar-nav > li > a:focus { | |
color: #333; | |
background-color: transparent; | |
} | |
.navbar-default .navbar-nav > .active > a, | |
.navbar-default .navbar-nav > .active > a:hover, | |
.navbar-default .navbar-nav > .active > a:focus { | |
color: #555; | |
background-color: #e7e7e7; | |
} | |
.navbar-default .navbar-nav > .disabled > a, | |
.navbar-default .navbar-nav > .disabled > a:hover, | |
.navbar-default .navbar-nav > .disabled > a:focus { | |
color: #ccc; | |
background-color: transparent; | |
} | |
.navbar-default .navbar-toggle { | |
border-color: #ddd; | |
} | |
.navbar-default .navbar-toggle:hover, | |
.navbar-default .navbar-toggle:focus { | |
background-color: #ddd; | |
} | |
.navbar-default .navbar-toggle .icon-bar { | |
background-color: #888; | |
} | |
.navbar-default .navbar-collapse, | |
.navbar-default .navbar-form { | |
border-color: #e7e7e7; | |
} | |
.navbar-default .navbar-nav > .open > a, | |
.navbar-default .navbar-nav > .open > a:hover, | |
.navbar-default .navbar-nav > .open > a:focus { | |
background-color: #e7e7e7; | |
color: #555; | |
} | |
@media (max-width: 540px) { | |
.navbar-default .navbar-nav .open .dropdown-menu > li > a { | |
color: #777; | |
} | |
.navbar-default .navbar-nav .open .dropdown-menu > li > a:hover, | |
.navbar-default .navbar-nav .open .dropdown-menu > li > a:focus { | |
color: #333; | |
background-color: transparent; | |
} | |
.navbar-default .navbar-nav .open .dropdown-menu > .active > a, | |
.navbar-default .navbar-nav .open .dropdown-menu > .active > a:hover, | |
.navbar-default .navbar-nav .open .dropdown-menu > .active > a:focus { | |
color: #555; | |
background-color: #e7e7e7; | |
} | |
.navbar-default .navbar-nav .open .dropdown-menu > .disabled > a, | |
.navbar-default .navbar-nav .open .dropdown-menu > .disabled > a:hover, | |
.navbar-default .navbar-nav .open .dropdown-menu > .disabled > a:focus { | |
color: #ccc; | |
background-color: transparent; | |
} | |
} | |
.navbar-default .navbar-link { | |
color: #777; | |
} | |
.navbar-default .navbar-link:hover { | |
color: #333; | |
} | |
.navbar-default .btn-link { | |
color: #777; | |
} | |
.navbar-default .btn-link:hover, | |
.navbar-default .btn-link:focus { | |
color: #333; | |
} | |
.navbar-default .btn-link[disabled]:hover, | |
fieldset[disabled] .navbar-default .btn-link:hover, | |
.navbar-default .btn-link[disabled]:focus, | |
fieldset[disabled] .navbar-default .btn-link:focus { | |
color: #ccc; | |
} | |
.navbar-inverse { | |
background-color: #222; | |
border-color: #080808; | |
} | |
.navbar-inverse .navbar-brand { | |
color: #9d9d9d; | |
} | |
.navbar-inverse .navbar-brand:hover, | |
.navbar-inverse .navbar-brand:focus { | |
color: #fff; | |
background-color: transparent; | |
} | |
.navbar-inverse .navbar-text { | |
color: #9d9d9d; | |
} | |
.navbar-inverse .navbar-nav > li > a { | |
color: #9d9d9d; | |
} | |
.navbar-inverse .navbar-nav > li > a:hover, | |
.navbar-inverse .navbar-nav > li > a:focus { | |
color: #fff; | |
background-color: transparent; | |
} | |
.navbar-inverse .navbar-nav > .active > a, | |
.navbar-inverse .navbar-nav > .active > a:hover, | |
.navbar-inverse .navbar-nav > .active > a:focus { | |
color: #fff; | |
background-color: #080808; | |
} | |
.navbar-inverse .navbar-nav > .disabled > a, | |
.navbar-inverse .navbar-nav > .disabled > a:hover, | |
.navbar-inverse .navbar-nav > .disabled > a:focus { | |
color: #444; | |
background-color: transparent; | |
} | |
.navbar-inverse .navbar-toggle { | |
border-color: #333; | |
} | |
.navbar-inverse .navbar-toggle:hover, | |
.navbar-inverse .navbar-toggle:focus { | |
background-color: #333; | |
} | |
.navbar-inverse .navbar-toggle .icon-bar { | |
background-color: #fff; | |
} | |
.navbar-inverse .navbar-collapse, | |
.navbar-inverse .navbar-form { | |
border-color: #101010; | |
} | |
.navbar-inverse .navbar-nav > .open > a, | |
.navbar-inverse .navbar-nav > .open > a:hover, | |
.navbar-inverse .navbar-nav > .open > a:focus { | |
background-color: #080808; | |
color: #fff; | |
} | |
@media (max-width: 540px) { | |
.navbar-inverse .navbar-nav .open .dropdown-menu > .dropdown-header { | |
border-color: #080808; | |
} | |
.navbar-inverse .navbar-nav .open .dropdown-menu .divider { | |
background-color: #080808; | |
} | |
.navbar-inverse .navbar-nav .open .dropdown-menu > li > a { | |
color: #9d9d9d; | |
} | |
.navbar-inverse .navbar-nav .open .dropdown-menu > li > a:hover, | |
.navbar-inverse .navbar-nav .open .dropdown-menu > li > a:focus { | |
color: #fff; | |
background-color: transparent; | |
} | |
.navbar-inverse .navbar-nav .open .dropdown-menu > .active > a, | |
.navbar-inverse .navbar-nav .open .dropdown-menu > .active > a:hover, | |
.navbar-inverse .navbar-nav .open .dropdown-menu > .active > a:focus { | |
color: #fff; | |
background-color: #080808; | |
} | |
.navbar-inverse .navbar-nav .open .dropdown-menu > .disabled > a, | |
.navbar-inverse .navbar-nav .open .dropdown-menu > .disabled > a:hover, | |
.navbar-inverse .navbar-nav .open .dropdown-menu > .disabled > a:focus { | |
color: #444; | |
background-color: transparent; | |
} | |
} | |
.navbar-inverse .navbar-link { | |
color: #9d9d9d; | |
} | |
.navbar-inverse .navbar-link:hover { | |
color: #fff; | |
} | |
.navbar-inverse .btn-link { | |
color: #9d9d9d; | |
} | |
.navbar-inverse .btn-link:hover, | |
.navbar-inverse .btn-link:focus { | |
color: #fff; | |
} | |
.navbar-inverse .btn-link[disabled]:hover, | |
fieldset[disabled] .navbar-inverse .btn-link:hover, | |
.navbar-inverse .btn-link[disabled]:focus, | |
fieldset[disabled] .navbar-inverse .btn-link:focus { | |
color: #444; | |
} | |
.breadcrumb { | |
padding: 8px 15px; | |
margin-bottom: 18px; | |
list-style: none; | |
background-color: #f5f5f5; | |
border-radius: 2px; | |
} | |
.breadcrumb > li { | |
display: inline-block; | |
} | |
.breadcrumb > li + li:before { | |
content: "/\00a0"; | |
padding: 0 5px; | |
color: #5e5e5e; | |
} | |
.breadcrumb > .active { | |
color: #777777; | |
} | |
.pagination { | |
display: inline-block; | |
padding-left: 0; | |
margin: 18px 0; | |
border-radius: 2px; | |
} | |
.pagination > li { | |
display: inline; | |
} | |
.pagination > li > a, | |
.pagination > li > span { | |
position: relative; | |
float: left; | |
padding: 6px 12px; | |
line-height: 1.42857143; | |
text-decoration: none; | |
color: #337ab7; | |
background-color: #fff; | |
border: 1px solid #ddd; | |
margin-left: -1px; | |
} | |
.pagination > li:first-child > a, | |
.pagination > li:first-child > span { | |
margin-left: 0; | |
border-bottom-left-radius: 2px; | |
border-top-left-radius: 2px; | |
} | |
.pagination > li:last-child > a, | |
.pagination > li:last-child > span { | |
border-bottom-right-radius: 2px; | |
border-top-right-radius: 2px; | |
} | |
.pagination > li > a:hover, | |
.pagination > li > span:hover, | |
.pagination > li > a:focus, | |
.pagination > li > span:focus { | |
z-index: 2; | |
color: #23527c; | |
background-color: #eeeeee; | |
border-color: #ddd; | |
} | |
.pagination > .active > a, | |
.pagination > .active > span, | |
.pagination > .active > a:hover, | |
.pagination > .active > span:hover, | |
.pagination > .active > a:focus, | |
.pagination > .active > span:focus { | |
z-index: 3; | |
color: #fff; | |
background-color: #337ab7; | |
border-color: #337ab7; | |
cursor: default; | |
} | |
.pagination > .disabled > span, | |
.pagination > .disabled > span:hover, | |
.pagination > .disabled > span:focus, | |
.pagination > .disabled > a, | |
.pagination > .disabled > a:hover, | |
.pagination > .disabled > a:focus { | |
color: #777777; | |
background-color: #fff; | |
border-color: #ddd; | |
cursor: not-allowed; | |
} | |
.pagination-lg > li > a, | |
.pagination-lg > li > span { | |
padding: 10px 16px; | |
font-size: 17px; | |
line-height: 1.3333333; | |
} | |
.pagination-lg > li:first-child > a, | |
.pagination-lg > li:first-child > span { | |
border-bottom-left-radius: 3px; | |
border-top-left-radius: 3px; | |
} | |
.pagination-lg > li:last-child > a, | |
.pagination-lg > li:last-child > span { | |
border-bottom-right-radius: 3px; | |
border-top-right-radius: 3px; | |
} | |
.pagination-sm > li > a, | |
.pagination-sm > li > span { | |
padding: 5px 10px; | |
font-size: 12px; | |
line-height: 1.5; | |
} | |
.pagination-sm > li:first-child > a, | |
.pagination-sm > li:first-child > span { | |
border-bottom-left-radius: 1px; | |
border-top-left-radius: 1px; | |
} | |
.pagination-sm > li:last-child > a, | |
.pagination-sm > li:last-child > span { | |
border-bottom-right-radius: 1px; | |
border-top-right-radius: 1px; | |
} | |
.pager { | |
padding-left: 0; | |
margin: 18px 0; | |
list-style: none; | |
text-align: center; | |
} | |
.pager li { | |
display: inline; | |
} | |
.pager li > a, | |
.pager li > span { | |
display: inline-block; | |
padding: 5px 14px; | |
background-color: #fff; | |
border: 1px solid #ddd; | |
border-radius: 15px; | |
} | |
.pager li > a:hover, | |
.pager li > a:focus { | |
text-decoration: none; | |
background-color: #eeeeee; | |
} | |
.pager .next > a, | |
.pager .next > span { | |
float: right; | |
} | |
.pager .previous > a, | |
.pager .previous > span { | |
float: left; | |
} | |
.pager .disabled > a, | |
.pager .disabled > a:hover, | |
.pager .disabled > a:focus, | |
.pager .disabled > span { | |
color: #777777; | |
background-color: #fff; | |
cursor: not-allowed; | |
} | |
.label { | |
display: inline; | |
padding: .2em .6em .3em; | |
font-size: 75%; | |
font-weight: bold; | |
line-height: 1; | |
color: #fff; | |
text-align: center; | |
white-space: nowrap; | |
vertical-align: baseline; | |
border-radius: .25em; | |
} | |
a.label:hover, | |
a.label:focus { | |
color: #fff; | |
text-decoration: none; | |
cursor: pointer; | |
} | |
.label:empty { | |
display: none; | |
} | |
.btn .label { | |
position: relative; | |
top: -1px; | |
} | |
.label-default { | |
background-color: #777777; | |
} | |
.label-default[href]:hover, | |
.label-default[href]:focus { | |
background-color: #5e5e5e; | |
} | |
.label-primary { | |
background-color: #337ab7; | |
} | |
.label-primary[href]:hover, | |
.label-primary[href]:focus { | |
background-color: #286090; | |
} | |
.label-success { | |
background-color: #5cb85c; | |
} | |
.label-success[href]:hover, | |
.label-success[href]:focus { | |
background-color: #449d44; | |
} | |
.label-info { | |
background-color: #5bc0de; | |
} | |
.label-info[href]:hover, | |
.label-info[href]:focus { | |
background-color: #31b0d5; | |
} | |
.label-warning { | |
background-color: #f0ad4e; | |
} | |
.label-warning[href]:hover, | |
.label-warning[href]:focus { | |
background-color: #ec971f; | |
} | |
.label-danger { | |
background-color: #d9534f; | |
} | |
.label-danger[href]:hover, | |
.label-danger[href]:focus { | |
background-color: #c9302c; | |
} | |
.badge { | |
display: inline-block; | |
min-width: 10px; | |
padding: 3px 7px; | |
font-size: 12px; | |
font-weight: bold; | |
color: #fff; | |
line-height: 1; | |
vertical-align: middle; | |
white-space: nowrap; | |
text-align: center; | |
background-color: #777777; | |
border-radius: 10px; | |
} | |
.badge:empty { | |
display: none; | |
} | |
.btn .badge { | |
position: relative; | |
top: -1px; | |
} | |
.btn-xs .badge, | |
.btn-group-xs > .btn .badge { | |
top: 0; | |
padding: 1px 5px; | |
} | |
a.badge:hover, | |
a.badge:focus { | |
color: #fff; | |
text-decoration: none; | |
cursor: pointer; | |
} | |
.list-group-item.active > .badge, | |
.nav-pills > .active > a > .badge { | |
color: #337ab7; | |
background-color: #fff; | |
} | |
.list-group-item > .badge { | |
float: right; | |
} | |
.list-group-item > .badge + .badge { | |
margin-right: 5px; | |
} | |
.nav-pills > li > a > .badge { | |
margin-left: 3px; | |
} | |
.jumbotron { | |
padding-top: 30px; | |
padding-bottom: 30px; | |
margin-bottom: 30px; | |
color: inherit; | |
background-color: #eeeeee; | |
} | |
.jumbotron h1, | |
.jumbotron .h1 { | |
color: inherit; | |
} | |
.jumbotron p { | |
margin-bottom: 15px; | |
font-size: 20px; | |
font-weight: 200; | |
} | |
.jumbotron > hr { | |
border-top-color: #d5d5d5; | |
} | |
.container .jumbotron, | |
.container-fluid .jumbotron { | |
border-radius: 3px; | |
padding-left: 0px; | |
padding-right: 0px; | |
} | |
.jumbotron .container { | |
max-width: 100%; | |
} | |
@media screen and (min-width: 768px) { | |
.jumbotron { | |
padding-top: 48px; | |
padding-bottom: 48px; | |
} | |
.container .jumbotron, | |
.container-fluid .jumbotron { | |
padding-left: 60px; | |
padding-right: 60px; | |
} | |
.jumbotron h1, | |
.jumbotron .h1 { | |
font-size: 59px; | |
} | |
} | |
.thumbnail { | |
display: block; | |
padding: 4px; | |
margin-bottom: 18px; | |
line-height: 1.42857143; | |
background-color: #fff; | |
border: 1px solid #ddd; | |
border-radius: 2px; | |
-webkit-transition: border 0.2s ease-in-out; | |
-o-transition: border 0.2s ease-in-out; | |
transition: border 0.2s ease-in-out; | |
} | |
.thumbnail > img, | |
.thumbnail a > img { | |
margin-left: auto; | |
margin-right: auto; | |
} | |
a.thumbnail:hover, | |
a.thumbnail:focus, | |
a.thumbnail.active { | |
border-color: #337ab7; | |
} | |
.thumbnail .caption { | |
padding: 9px; | |
color: #000; | |
} | |
.alert { | |
padding: 15px; | |
margin-bottom: 18px; | |
border: 1px solid transparent; | |
border-radius: 2px; | |
} | |
.alert h4 { | |
margin-top: 0; | |
color: inherit; | |
} | |
.alert .alert-link { | |
font-weight: bold; | |
} | |
.alert > p, | |
.alert > ul { | |
margin-bottom: 0; | |
} | |
.alert > p + p { | |
margin-top: 5px; | |
} | |
.alert-dismissable, | |
.alert-dismissible { | |
padding-right: 35px; | |
} | |
.alert-dismissable .close, | |
.alert-dismissible .close { | |
position: relative; | |
top: -2px; | |
right: -21px; | |
color: inherit; | |
} | |
.alert-success { | |
background-color: #dff0d8; | |
border-color: #d6e9c6; | |
color: #3c763d; | |
} | |
.alert-success hr { | |
border-top-color: #c9e2b3; | |
} | |
.alert-success .alert-link { | |
color: #2b542c; | |
} | |
.alert-info { | |
background-color: #d9edf7; | |
border-color: #bce8f1; | |
color: #31708f; | |
} | |
.alert-info hr { | |
border-top-color: #a6e1ec; | |
} | |
.alert-info .alert-link { | |
color: #245269; | |
} | |
.alert-warning { | |
background-color: #fcf8e3; | |
border-color: #faebcc; | |
color: #8a6d3b; | |
} | |
.alert-warning hr { | |
border-top-color: #f7e1b5; | |
} | |
.alert-warning .alert-link { | |
color: #66512c; | |
} | |
.alert-danger { | |
background-color: #f2dede; | |
border-color: #ebccd1; | |
color: #a94442; | |
} | |
.alert-danger hr { | |
border-top-color: #e4b9c0; | |
} | |
.alert-danger .alert-link { | |
color: #843534; | |
} | |
@-webkit-keyframes progress-bar-stripes { | |
from { | |
background-position: 40px 0; | |
} | |
to { | |
background-position: 0 0; | |
} | |
} | |
@keyframes progress-bar-stripes { | |
from { | |
background-position: 40px 0; | |
} | |
to { | |
background-position: 0 0; | |
} | |
} | |
.progress { | |
overflow: hidden; | |
height: 18px; | |
margin-bottom: 18px; | |
background-color: #f5f5f5; | |
border-radius: 2px; | |
-webkit-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1); | |
box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1); | |
} | |
.progress-bar { | |
float: left; | |
width: 0%; | |
height: 100%; | |
font-size: 12px; | |
line-height: 18px; | |
color: #fff; | |
text-align: center; | |
background-color: #337ab7; | |
-webkit-box-shadow: inset 0 -1px 0 rgba(0, 0, 0, 0.15); | |
box-shadow: inset 0 -1px 0 rgba(0, 0, 0, 0.15); | |
-webkit-transition: width 0.6s ease; | |
-o-transition: width 0.6s ease; | |
transition: width 0.6s ease; | |
} | |
.progress-striped .progress-bar, | |
.progress-bar-striped { | |
background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
background-size: 40px 40px; | |
} | |
.progress.active .progress-bar, | |
.progress-bar.active { | |
-webkit-animation: progress-bar-stripes 2s linear infinite; | |
-o-animation: progress-bar-stripes 2s linear infinite; | |
animation: progress-bar-stripes 2s linear infinite; | |
} | |
.progress-bar-success { | |
background-color: #5cb85c; | |
} | |
.progress-striped .progress-bar-success { | |
background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
} | |
.progress-bar-info { | |
background-color: #5bc0de; | |
} | |
.progress-striped .progress-bar-info { | |
background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
} | |
.progress-bar-warning { | |
background-color: #f0ad4e; | |
} | |
.progress-striped .progress-bar-warning { | |
background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
} | |
.progress-bar-danger { | |
background-color: #d9534f; | |
} | |
.progress-striped .progress-bar-danger { | |
background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); | |
} | |
.media { | |
margin-top: 15px; | |
} | |
.media:first-child { | |
margin-top: 0; | |
} | |
.media, | |
.media-body { | |
zoom: 1; | |
overflow: hidden; | |
} | |
.media-body { | |
width: 10000px; | |
} | |
.media-object { | |
display: block; | |
} | |
.media-object.img-thumbnail { | |
max-width: none; | |
} | |
.media-right, | |
.media > .pull-right { | |
padding-left: 10px; | |
} | |
.media-left, | |
.media > .pull-left { | |
padding-right: 10px; | |
} | |
.media-left, | |
.media-right, | |
.media-body { | |
display: table-cell; | |
vertical-align: top; | |
} | |
.media-middle { | |
vertical-align: middle; | |
} | |
.media-bottom { | |
vertical-align: bottom; | |
} | |
.media-heading { | |
margin-top: 0; | |
margin-bottom: 5px; | |
} | |
.media-list { | |
padding-left: 0; | |
list-style: none; | |
} | |
.list-group { | |
margin-bottom: 20px; | |
padding-left: 0; | |
} | |
.list-group-item { | |
position: relative; | |
display: block; | |
padding: 10px 15px; | |
margin-bottom: -1px; | |
background-color: #fff; | |
border: 1px solid #ddd; | |
} | |
.list-group-item:first-child { | |
border-top-right-radius: 2px; | |
border-top-left-radius: 2px; | |
} | |
.list-group-item:last-child { | |
margin-bottom: 0; | |
border-bottom-right-radius: 2px; | |
border-bottom-left-radius: 2px; | |
} | |
a.list-group-item, | |
button.list-group-item { | |
color: #555; | |
} | |
a.list-group-item .list-group-item-heading, | |
button.list-group-item .list-group-item-heading { | |
color: #333; | |
} | |
a.list-group-item:hover, | |
button.list-group-item:hover, | |
a.list-group-item:focus, | |
button.list-group-item:focus { | |
text-decoration: none; | |
color: #555; | |
background-color: #f5f5f5; | |
} | |
button.list-group-item { | |
width: 100%; | |
text-align: left; | |
} | |
.list-group-item.disabled, | |
.list-group-item.disabled:hover, | |
.list-group-item.disabled:focus { | |
background-color: #eeeeee; | |
color: #777777; | |
cursor: not-allowed; | |
} | |
.list-group-item.disabled .list-group-item-heading, | |
.list-group-item.disabled:hover .list-group-item-heading, | |
.list-group-item.disabled:focus .list-group-item-heading { | |
color: inherit; | |
} | |
.list-group-item.disabled .list-group-item-text, | |
.list-group-item.disabled:hover .list-group-item-text, | |
.list-group-item.disabled:focus .list-group-item-text { | |
color: #777777; | |
} | |
.list-group-item.active, | |
.list-group-item.active:hover, | |
.list-group-item.active:focus { | |
z-index: 2; | |
color: #fff; | |
background-color: #337ab7; | |
border-color: #337ab7; | |
} | |
.list-group-item.active .list-group-item-heading, | |
.list-group-item.active:hover .list-group-item-heading, | |
.list-group-item.active:focus .list-group-item-heading, | |
.list-group-item.active .list-group-item-heading > small, | |
.list-group-item.active:hover .list-group-item-heading > small, | |
.list-group-item.active:focus .list-group-item-heading > small, | |
.list-group-item.active .list-group-item-heading > .small, | |
.list-group-item.active:hover .list-group-item-heading > .small, | |
.list-group-item.active:focus .list-group-item-heading > .small { | |
color: inherit; | |
} | |
.list-group-item.active .list-group-item-text, | |
.list-group-item.active:hover .list-group-item-text, | |
.list-group-item.active:focus .list-group-item-text { | |
color: #c7ddef; | |
} | |
.list-group-item-success { | |
color: #3c763d; | |
background-color: #dff0d8; | |
} | |
a.list-group-item-success, | |
button.list-group-item-success { | |
color: #3c763d; | |
} | |
a.list-group-item-success .list-group-item-heading, | |
button.list-group-item-success .list-group-item-heading { | |
color: inherit; | |
} | |
a.list-group-item-success:hover, | |
button.list-group-item-success:hover, | |
a.list-group-item-success:focus, | |
button.list-group-item-success:focus { | |
color: #3c763d; | |
background-color: #d0e9c6; | |
} | |
a.list-group-item-success.active, | |
button.list-group-item-success.active, | |
a.list-group-item-success.active:hover, | |
button.list-group-item-success.active:hover, | |
a.list-group-item-success.active:focus, | |
button.list-group-item-success.active:focus { | |
color: #fff; | |
background-color: #3c763d; | |
border-color: #3c763d; | |
} | |
.list-group-item-info { | |
color: #31708f; | |
background-color: #d9edf7; | |
} | |
a.list-group-item-info, | |
button.list-group-item-info { | |
color: #31708f; | |
} | |
a.list-group-item-info .list-group-item-heading, | |
button.list-group-item-info .list-group-item-heading { | |
color: inherit; | |
} | |
a.list-group-item-info:hover, | |
button.list-group-item-info:hover, | |
a.list-group-item-info:focus, | |
button.list-group-item-info:focus { | |
color: #31708f; | |
background-color: #c4e3f3; | |
} | |
a.list-group-item-info.active, | |
button.list-group-item-info.active, | |
a.list-group-item-info.active:hover, | |
button.list-group-item-info.active:hover, | |
a.list-group-item-info.active:focus, | |
button.list-group-item-info.active:focus { | |
color: #fff; | |
background-color: #31708f; | |
border-color: #31708f; | |
} | |
.list-group-item-warning { | |
color: #8a6d3b; | |
background-color: #fcf8e3; | |
} | |
a.list-group-item-warning, | |
button.list-group-item-warning { | |
color: #8a6d3b; | |
} | |
a.list-group-item-warning .list-group-item-heading, | |
button.list-group-item-warning .list-group-item-heading { | |
color: inherit; | |
} | |
a.list-group-item-warning:hover, | |
button.list-group-item-warning:hover, | |
a.list-group-item-warning:focus, | |
button.list-group-item-warning:focus { | |
color: #8a6d3b; | |
background-color: #faf2cc; | |
} | |
a.list-group-item-warning.active, | |
button.list-group-item-warning.active, | |
a.list-group-item-warning.active:hover, | |
button.list-group-item-warning.active:hover, | |
a.list-group-item-warning.active:focus, | |
button.list-group-item-warning.active:focus { | |
color: #fff; | |
background-color: #8a6d3b; | |
border-color: #8a6d3b; | |
} | |
.list-group-item-danger { | |
color: #a94442; | |
background-color: #f2dede; | |
} | |
a.list-group-item-danger, | |
button.list-group-item-danger { | |
color: #a94442; | |
} | |
a.list-group-item-danger .list-group-item-heading, | |
button.list-group-item-danger .list-group-item-heading { | |
color: inherit; | |
} | |
a.list-group-item-danger:hover, | |
button.list-group-item-danger:hover, | |
a.list-group-item-danger:focus, | |
button.list-group-item-danger:focus { | |
color: #a94442; | |
background-color: #ebcccc; | |
} | |
a.list-group-item-danger.active, | |
button.list-group-item-danger.active, | |
a.list-group-item-danger.active:hover, | |
button.list-group-item-danger.active:hover, | |
a.list-group-item-danger.active:focus, | |
button.list-group-item-danger.active:focus { | |
color: #fff; | |
background-color: #a94442; | |
border-color: #a94442; | |
} | |
.list-group-item-heading { | |
margin-top: 0; | |
margin-bottom: 5px; | |
} | |
.list-group-item-text { | |
margin-bottom: 0; | |
line-height: 1.3; | |
} | |
.panel { | |
margin-bottom: 18px; | |
background-color: #fff; | |
border: 1px solid transparent; | |
border-radius: 2px; | |
-webkit-box-shadow: 0 1px 1px rgba(0, 0, 0, 0.05); | |
box-shadow: 0 1px 1px rgba(0, 0, 0, 0.05); | |
} | |
.panel-body { | |
padding: 15px; | |
} | |
.panel-heading { | |
padding: 10px 15px; | |
border-bottom: 1px solid transparent; | |
border-top-right-radius: 1px; | |
border-top-left-radius: 1px; | |
} | |
.panel-heading > .dropdown .dropdown-toggle { | |
color: inherit; | |
} | |
.panel-title { | |
margin-top: 0; | |
margin-bottom: 0; | |
font-size: 15px; | |
color: inherit; | |
} | |
.panel-title > a, | |
.panel-title > small, | |
.panel-title > .small, | |
.panel-title > small > a, | |
.panel-title > .small > a { | |
color: inherit; | |
} | |
.panel-footer { | |
padding: 10px 15px; | |
background-color: #f5f5f5; | |
border-top: 1px solid #ddd; | |
border-bottom-right-radius: 1px; | |
border-bottom-left-radius: 1px; | |
} | |
.panel > .list-group, | |
.panel > .panel-collapse > .list-group { | |
margin-bottom: 0; | |
} | |
.panel > .list-group .list-group-item, | |
.panel > .panel-collapse > .list-group .list-group-item { | |
border-width: 1px 0; | |
border-radius: 0; | |
} | |
.panel > .list-group:first-child .list-group-item:first-child, | |
.panel > .panel-collapse > .list-group:first-child .list-group-item:first-child { | |
border-top: 0; | |
border-top-right-radius: 1px; | |
border-top-left-radius: 1px; | |
} | |
.panel > .list-group:last-child .list-group-item:last-child, | |
.panel > .panel-collapse > .list-group:last-child .list-group-item:last-child { | |
border-bottom: 0; | |
border-bottom-right-radius: 1px; | |
border-bottom-left-radius: 1px; | |
} | |
.panel > .panel-heading + .panel-collapse > .list-group .list-group-item:first-child { | |
border-top-right-radius: 0; | |
border-top-left-radius: 0; | |
} | |
.panel-heading + .list-group .list-group-item:first-child { | |
border-top-width: 0; | |
} | |
.list-group + .panel-footer { | |
border-top-width: 0; | |
} | |
.panel > .table, | |
.panel > .table-responsive > .table, | |
.panel > .panel-collapse > .table { | |
margin-bottom: 0; | |
} | |
.panel > .table caption, | |
.panel > .table-responsive > .table caption, | |
.panel > .panel-collapse > .table caption { | |
padding-left: 15px; | |
padding-right: 15px; | |
} | |
.panel > .table:first-child, | |
.panel > .table-responsive:first-child > .table:first-child { | |
border-top-right-radius: 1px; | |
border-top-left-radius: 1px; | |
} | |
.panel > .table:first-child > thead:first-child > tr:first-child, | |
.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child, | |
.panel > .table:first-child > tbody:first-child > tr:first-child, | |
.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child { | |
border-top-left-radius: 1px; | |
border-top-right-radius: 1px; | |
} | |
.panel > .table:first-child > thead:first-child > tr:first-child td:first-child, | |
.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child td:first-child, | |
.panel > .table:first-child > tbody:first-child > tr:first-child td:first-child, | |
.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child td:first-child, | |
.panel > .table:first-child > thead:first-child > tr:first-child th:first-child, | |
.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child th:first-child, | |
.panel > .table:first-child > tbody:first-child > tr:first-child th:first-child, | |
.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child th:first-child { | |
border-top-left-radius: 1px; | |
} | |
.panel > .table:first-child > thead:first-child > tr:first-child td:last-child, | |
.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child td:last-child, | |
.panel > .table:first-child > tbody:first-child > tr:first-child td:last-child, | |
.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child td:last-child, | |
.panel > .table:first-child > thead:first-child > tr:first-child th:last-child, | |
.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child th:last-child, | |
.panel > .table:first-child > tbody:first-child > tr:first-child th:last-child, | |
.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child th:last-child { | |
border-top-right-radius: 1px; | |
} | |
.panel > .table:last-child, | |
.panel > .table-responsive:last-child > .table:last-child { | |
border-bottom-right-radius: 1px; | |
border-bottom-left-radius: 1px; | |
} | |
.panel > .table:last-child > tbody:last-child > tr:last-child, | |
.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child, | |
.panel > .table:last-child > tfoot:last-child > tr:last-child, | |
.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child { | |
border-bottom-left-radius: 1px; | |
border-bottom-right-radius: 1px; | |
} | |
.panel > .table:last-child > tbody:last-child > tr:last-child td:first-child, | |
.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child td:first-child, | |
.panel > .table:last-child > tfoot:last-child > tr:last-child td:first-child, | |
.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child td:first-child, | |
.panel > .table:last-child > tbody:last-child > tr:last-child th:first-child, | |
.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child th:first-child, | |
.panel > .table:last-child > tfoot:last-child > tr:last-child th:first-child, | |
.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child th:first-child { | |
border-bottom-left-radius: 1px; | |
} | |
.panel > .table:last-child > tbody:last-child > tr:last-child td:last-child, | |
.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child td:last-child, | |
.panel > .table:last-child > tfoot:last-child > tr:last-child td:last-child, | |
.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child td:last-child, | |
.panel > .table:last-child > tbody:last-child > tr:last-child th:last-child, | |
.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child th:last-child, | |
.panel > .table:last-child > tfoot:last-child > tr:last-child th:last-child, | |
.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child th:last-child { | |
border-bottom-right-radius: 1px; | |
} | |
.panel > .panel-body + .table, | |
.panel > .panel-body + .table-responsive, | |
.panel > .table + .panel-body, | |
.panel > .table-responsive + .panel-body { | |
border-top: 1px solid #ddd; | |
} | |
.panel > .table > tbody:first-child > tr:first-child th, | |
.panel > .table > tbody:first-child > tr:first-child td { | |
border-top: 0; | |
} | |
.panel > .table-bordered, | |
.panel > .table-responsive > .table-bordered { | |
border: 0; | |
} | |
.panel > .table-bordered > thead > tr > th:first-child, | |
.panel > .table-responsive > .table-bordered > thead > tr > th:first-child, | |
.panel > .table-bordered > tbody > tr > th:first-child, | |
.panel > .table-responsive > .table-bordered > tbody > tr > th:first-child, | |
.panel > .table-bordered > tfoot > tr > th:first-child, | |
.panel > .table-responsive > .table-bordered > tfoot > tr > th:first-child, | |
.panel > .table-bordered > thead > tr > td:first-child, | |
.panel > .table-responsive > .table-bordered > thead > tr > td:first-child, | |
.panel > .table-bordered > tbody > tr > td:first-child, | |
.panel > .table-responsive > .table-bordered > tbody > tr > td:first-child, | |
.panel > .table-bordered > tfoot > tr > td:first-child, | |
.panel > .table-responsive > .table-bordered > tfoot > tr > td:first-child { | |
border-left: 0; | |
} | |
.panel > .table-bordered > thead > tr > th:last-child, | |
.panel > .table-responsive > .table-bordered > thead > tr > th:last-child, | |
.panel > .table-bordered > tbody > tr > th:last-child, | |
.panel > .table-responsive > .table-bordered > tbody > tr > th:last-child, | |
.panel > .table-bordered > tfoot > tr > th:last-child, | |
.panel > .table-responsive > .table-bordered > tfoot > tr > th:last-child, | |
.panel > .table-bordered > thead > tr > td:last-child, | |
.panel > .table-responsive > .table-bordered > thead > tr > td:last-child, | |
.panel > .table-bordered > tbody > tr > td:last-child, | |
.panel > .table-responsive > .table-bordered > tbody > tr > td:last-child, | |
.panel > .table-bordered > tfoot > tr > td:last-child, | |
.panel > .table-responsive > .table-bordered > tfoot > tr > td:last-child { | |
border-right: 0; | |
} | |
.panel > .table-bordered > thead > tr:first-child > td, | |
.panel > .table-responsive > .table-bordered > thead > tr:first-child > td, | |
.panel > .table-bordered > tbody > tr:first-child > td, | |
.panel > .table-responsive > .table-bordered > tbody > tr:first-child > td, | |
.panel > .table-bordered > thead > tr:first-child > th, | |
.panel > .table-responsive > .table-bordered > thead > tr:first-child > th, | |
.panel > .table-bordered > tbody > tr:first-child > th, | |
.panel > .table-responsive > .table-bordered > tbody > tr:first-child > th { | |
border-bottom: 0; | |
} | |
.panel > .table-bordered > tbody > tr:last-child > td, | |
.panel > .table-responsive > .table-bordered > tbody > tr:last-child > td, | |
.panel > .table-bordered > tfoot > tr:last-child > td, | |
.panel > .table-responsive > .table-bordered > tfoot > tr:last-child > td, | |
.panel > .table-bordered > tbody > tr:last-child > th, | |
.panel > .table-responsive > .table-bordered > tbody > tr:last-child > th, | |
.panel > .table-bordered > tfoot > tr:last-child > th, | |
.panel > .table-responsive > .table-bordered > tfoot > tr:last-child > th { | |
border-bottom: 0; | |
} | |
.panel > .table-responsive { | |
border: 0; | |
margin-bottom: 0; | |
} | |
.panel-group { | |
margin-bottom: 18px; | |
} | |
.panel-group .panel { | |
margin-bottom: 0; | |
border-radius: 2px; | |
} | |
.panel-group .panel + .panel { | |
margin-top: 5px; | |
} | |
.panel-group .panel-heading { | |
border-bottom: 0; | |
} | |
.panel-group .panel-heading + .panel-collapse > .panel-body, | |
.panel-group .panel-heading + .panel-collapse > .list-group { | |
border-top: 1px solid #ddd; | |
} | |
.panel-group .panel-footer { | |
border-top: 0; | |
} | |
.panel-group .panel-footer + .panel-collapse .panel-body { | |
border-bottom: 1px solid #ddd; | |
} | |
.panel-default { | |
border-color: #ddd; | |
} | |
.panel-default > .panel-heading { | |
color: #333333; | |
background-color: #f5f5f5; | |
border-color: #ddd; | |
} | |
.panel-default > .panel-heading + .panel-collapse > .panel-body { | |
border-top-color: #ddd; | |
} | |
.panel-default > .panel-heading .badge { | |
color: #f5f5f5; | |
background-color: #333333; | |
} | |
.panel-default > .panel-footer + .panel-collapse > .panel-body { | |
border-bottom-color: #ddd; | |
} | |
.panel-primary { | |
border-color: #337ab7; | |
} | |
.panel-primary > .panel-heading { | |
color: #fff; | |
background-color: #337ab7; | |
border-color: #337ab7; | |
} | |
.panel-primary > .panel-heading + .panel-collapse > .panel-body { | |
border-top-color: #337ab7; | |
} | |
.panel-primary > .panel-heading .badge { | |
color: #337ab7; | |
background-color: #fff; | |
} | |
.panel-primary > .panel-footer + .panel-collapse > .panel-body { | |
border-bottom-color: #337ab7; | |
} | |
.panel-success { | |
border-color: #d6e9c6; | |
} | |
.panel-success > .panel-heading { | |
color: #3c763d; | |
background-color: #dff0d8; | |
border-color: #d6e9c6; | |
} | |
.panel-success > .panel-heading + .panel-collapse > .panel-body { | |
border-top-color: #d6e9c6; | |
} | |
.panel-success > .panel-heading .badge { | |
color: #dff0d8; | |
background-color: #3c763d; | |
} | |
.panel-success > .panel-footer + .panel-collapse > .panel-body { | |
border-bottom-color: #d6e9c6; | |
} | |
.panel-info { | |
border-color: #bce8f1; | |
} | |
.panel-info > .panel-heading { | |
color: #31708f; | |
background-color: #d9edf7; | |
border-color: #bce8f1; | |
} | |
.panel-info > .panel-heading + .panel-collapse > .panel-body { | |
border-top-color: #bce8f1; | |
} | |
.panel-info > .panel-heading .badge { | |
color: #d9edf7; | |
background-color: #31708f; | |
} | |
.panel-info > .panel-footer + .panel-collapse > .panel-body { | |
border-bottom-color: #bce8f1; | |
} | |
.panel-warning { | |
border-color: #faebcc; | |
} | |
.panel-warning > .panel-heading { | |
color: #8a6d3b; | |
background-color: #fcf8e3; | |
border-color: #faebcc; | |
} | |
.panel-warning > .panel-heading + .panel-collapse > .panel-body { | |
border-top-color: #faebcc; | |
} | |
.panel-warning > .panel-heading .badge { | |
color: #fcf8e3; | |
background-color: #8a6d3b; | |
} | |
.panel-warning > .panel-footer + .panel-collapse > .panel-body { | |
border-bottom-color: #faebcc; | |
} | |
.panel-danger { | |
border-color: #ebccd1; | |
} | |
.panel-danger > .panel-heading { | |
color: #a94442; | |
background-color: #f2dede; | |
border-color: #ebccd1; | |
} | |
.panel-danger > .panel-heading + .panel-collapse > .panel-body { | |
border-top-color: #ebccd1; | |
} | |
.panel-danger > .panel-heading .badge { | |
color: #f2dede; | |
background-color: #a94442; | |
} | |
.panel-danger > .panel-footer + .panel-collapse > .panel-body { | |
border-bottom-color: #ebccd1; | |
} | |
.embed-responsive { | |
position: relative; | |
display: block; | |
height: 0; | |
padding: 0; | |
overflow: hidden; | |
} | |
.embed-responsive .embed-responsive-item, | |
.embed-responsive iframe, | |
.embed-responsive embed, | |
.embed-responsive object, | |
.embed-responsive video { | |
position: absolute; | |
top: 0; | |
left: 0; | |
bottom: 0; | |
height: 100%; | |
width: 100%; | |
border: 0; | |
} | |
.embed-responsive-16by9 { | |
padding-bottom: 56.25%; | |
} | |
.embed-responsive-4by3 { | |
padding-bottom: 75%; | |
} | |
.well { | |
min-height: 20px; | |
padding: 19px; | |
margin-bottom: 20px; | |
background-color: #f5f5f5; | |
border: 1px solid #e3e3e3; | |
border-radius: 2px; | |
-webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.05); | |
box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.05); | |
} | |
.well blockquote { | |
border-color: #ddd; | |
border-color: rgba(0, 0, 0, 0.15); | |
} | |
.well-lg { | |
padding: 24px; | |
border-radius: 3px; | |
} | |
.well-sm { | |
padding: 9px; | |
border-radius: 1px; | |
} | |
.close { | |
float: right; | |
font-size: 19.5px; | |
font-weight: bold; | |
line-height: 1; | |
color: #000; | |
text-shadow: 0 1px 0 #fff; | |
opacity: 0.2; | |
filter: alpha(opacity=20); | |
} | |
.close:hover, | |
.close:focus { | |
color: #000; | |
text-decoration: none; | |
cursor: pointer; | |
opacity: 0.5; | |
filter: alpha(opacity=50); | |
} | |
button.close { | |
padding: 0; | |
cursor: pointer; | |
background: transparent; | |
border: 0; | |
-webkit-appearance: none; | |
} | |
.modal-open { | |
overflow: hidden; | |
} | |
.modal { | |
display: none; | |
overflow: hidden; | |
position: fixed; | |
top: 0; | |
right: 0; | |
bottom: 0; | |
left: 0; | |
z-index: 1050; | |
-webkit-overflow-scrolling: touch; | |
outline: 0; | |
} | |
.modal.fade .modal-dialog { | |
-webkit-transform: translate(0, -25%); | |
-ms-transform: translate(0, -25%); | |
-o-transform: translate(0, -25%); | |
transform: translate(0, -25%); | |
-webkit-transition: -webkit-transform 0.3s ease-out; | |
-moz-transition: -moz-transform 0.3s ease-out; | |
-o-transition: -o-transform 0.3s ease-out; | |
transition: transform 0.3s ease-out; | |
} | |
.modal.in .modal-dialog { | |
-webkit-transform: translate(0, 0); | |
-ms-transform: translate(0, 0); | |
-o-transform: translate(0, 0); | |
transform: translate(0, 0); | |
} | |
.modal-open .modal { | |
overflow-x: hidden; | |
overflow-y: auto; | |
} | |
.modal-dialog { | |
position: relative; | |
width: auto; | |
margin: 10px; | |
} | |
.modal-content { | |
position: relative; | |
background-color: #fff; | |
border: 1px solid #999; | |
border: 1px solid rgba(0, 0, 0, 0.2); | |
border-radius: 3px; | |
-webkit-box-shadow: 0 3px 9px rgba(0, 0, 0, 0.5); | |
box-shadow: 0 3px 9px rgba(0, 0, 0, 0.5); | |
background-clip: padding-box; | |
outline: 0; | |
} | |
.modal-backdrop { | |
position: fixed; | |
top: 0; | |
right: 0; | |
bottom: 0; | |
left: 0; | |
z-index: 1040; | |
background-color: #000; | |
} | |
.modal-backdrop.fade { | |
opacity: 0; | |
filter: alpha(opacity=0); | |
} | |
.modal-backdrop.in { | |
opacity: 0.5; | |
filter: alpha(opacity=50); | |
} | |
.modal-header { | |
padding: 15px; | |
border-bottom: 1px solid #e5e5e5; | |
} | |
.modal-header .close { | |
margin-top: -2px; | |
} | |
.modal-title { | |
margin: 0; | |
line-height: 1.42857143; | |
} | |
.modal-body { | |
position: relative; | |
padding: 15px; | |
} | |
.modal-footer { | |
padding: 15px; | |
text-align: right; | |
border-top: 1px solid #e5e5e5; | |
} | |
.modal-footer .btn + .btn { | |
margin-left: 5px; | |
margin-bottom: 0; | |
} | |
.modal-footer .btn-group .btn + .btn { | |
margin-left: -1px; | |
} | |
.modal-footer .btn-block + .btn-block { | |
margin-left: 0; | |
} | |
.modal-scrollbar-measure { | |
position: absolute; | |
top: -9999px; | |
width: 50px; | |
height: 50px; | |
overflow: scroll; | |
} | |
@media (min-width: 768px) { | |
.modal-dialog { | |
width: 600px; | |
margin: 30px auto; | |
} | |
.modal-content { | |
-webkit-box-shadow: 0 5px 15px rgba(0, 0, 0, 0.5); | |
box-shadow: 0 5px 15px rgba(0, 0, 0, 0.5); | |
} | |
.modal-sm { | |
width: 300px; | |
} | |
} | |
@media (min-width: 992px) { | |
.modal-lg { | |
width: 900px; | |
} | |
} | |
.tooltip { | |
position: absolute; | |
z-index: 1070; | |
display: block; | |
font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; | |
font-style: normal; | |
font-weight: normal; | |
letter-spacing: normal; | |
line-break: auto; | |
line-height: 1.42857143; | |
text-align: left; | |
text-align: start; | |
text-decoration: none; | |
text-shadow: none; | |
text-transform: none; | |
white-space: normal; | |
word-break: normal; | |
word-spacing: normal; | |
word-wrap: normal; | |
font-size: 12px; | |
opacity: 0; | |
filter: alpha(opacity=0); | |
} | |
.tooltip.in { | |
opacity: 0.9; | |
filter: alpha(opacity=90); | |
} | |
.tooltip.top { | |
margin-top: -3px; | |
padding: 5px 0; | |
} | |
.tooltip.right { | |
margin-left: 3px; | |
padding: 0 5px; | |
} | |
.tooltip.bottom { | |
margin-top: 3px; | |
padding: 5px 0; | |
} | |
.tooltip.left { | |
margin-left: -3px; | |
padding: 0 5px; | |
} | |
.tooltip-inner { | |
max-width: 200px; | |
padding: 3px 8px; | |
color: #fff; | |
text-align: center; | |
background-color: #000; | |
border-radius: 2px; | |
} | |
.tooltip-arrow { | |
position: absolute; | |
width: 0; | |
height: 0; | |
border-color: transparent; | |
border-style: solid; | |
} | |
.tooltip.top .tooltip-arrow { | |
bottom: 0; | |
left: 50%; | |
margin-left: -5px; | |
border-width: 5px 5px 0; | |
border-top-color: #000; | |
} | |
.tooltip.top-left .tooltip-arrow { | |
bottom: 0; | |
right: 5px; | |
margin-bottom: -5px; | |
border-width: 5px 5px 0; | |
border-top-color: #000; | |
} | |
.tooltip.top-right .tooltip-arrow { | |
bottom: 0; | |
left: 5px; | |
margin-bottom: -5px; | |
border-width: 5px 5px 0; | |
border-top-color: #000; | |
} | |
.tooltip.right .tooltip-arrow { | |
top: 50%; | |
left: 0; | |
margin-top: -5px; | |
border-width: 5px 5px 5px 0; | |
border-right-color: #000; | |
} | |
.tooltip.left .tooltip-arrow { | |
top: 50%; | |
right: 0; | |
margin-top: -5px; | |
border-width: 5px 0 5px 5px; | |
border-left-color: #000; | |
} | |
.tooltip.bottom .tooltip-arrow { | |
top: 0; | |
left: 50%; | |
margin-left: -5px; | |
border-width: 0 5px 5px; | |
border-bottom-color: #000; | |
} | |
.tooltip.bottom-left .tooltip-arrow { | |
top: 0; | |
right: 5px; | |
margin-top: -5px; | |
border-width: 0 5px 5px; | |
border-bottom-color: #000; | |
} | |
.tooltip.bottom-right .tooltip-arrow { | |
top: 0; | |
left: 5px; | |
margin-top: -5px; | |
border-width: 0 5px 5px; | |
border-bottom-color: #000; | |
} | |
.popover { | |
position: absolute; | |
top: 0; | |
left: 0; | |
z-index: 1060; | |
display: none; | |
max-width: 276px; | |
padding: 1px; | |
font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; | |
font-style: normal; | |
font-weight: normal; | |
letter-spacing: normal; | |
line-break: auto; | |
line-height: 1.42857143; | |
text-align: left; | |
text-align: start; | |
text-decoration: none; | |
text-shadow: none; | |
text-transform: none; | |
white-space: normal; | |
word-break: normal; | |
word-spacing: normal; | |
word-wrap: normal; | |
font-size: 13px; | |
background-color: #fff; | |
background-clip: padding-box; | |
border: 1px solid #ccc; | |
border: 1px solid rgba(0, 0, 0, 0.2); | |
border-radius: 3px; | |
-webkit-box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2); | |
box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2); | |
} | |
.popover.top { | |
margin-top: -10px; | |
} | |
.popover.right { | |
margin-left: 10px; | |
} | |
.popover.bottom { | |
margin-top: 10px; | |
} | |
.popover.left { | |
margin-left: -10px; | |
} | |
.popover-title { | |
margin: 0; | |
padding: 8px 14px; | |
font-size: 13px; | |
background-color: #f7f7f7; | |
border-bottom: 1px solid #ebebeb; | |
border-radius: 2px 2px 0 0; | |
} | |
.popover-content { | |
padding: 9px 14px; | |
} | |
.popover > .arrow, | |
.popover > .arrow:after { | |
position: absolute; | |
display: block; | |
width: 0; | |
height: 0; | |
border-color: transparent; | |
border-style: solid; | |
} | |
.popover > .arrow { | |
border-width: 11px; | |
} | |
.popover > .arrow:after { | |
border-width: 10px; | |
content: ""; | |
} | |
.popover.top > .arrow { | |
left: 50%; | |
margin-left: -11px; | |
border-bottom-width: 0; | |
border-top-color: #999999; | |
border-top-color: rgba(0, 0, 0, 0.25); | |
bottom: -11px; | |
} | |
.popover.top > .arrow:after { | |
content: " "; | |
bottom: 1px; | |
margin-left: -10px; | |
border-bottom-width: 0; | |
border-top-color: #fff; | |
} | |
.popover.right > .arrow { | |
top: 50%; | |
left: -11px; | |
margin-top: -11px; | |
border-left-width: 0; | |
border-right-color: #999999; | |
border-right-color: rgba(0, 0, 0, 0.25); | |
} | |
.popover.right > .arrow:after { | |
content: " "; | |
left: 1px; | |
bottom: -10px; | |
border-left-width: 0; | |
border-right-color: #fff; | |
} | |
.popover.bottom > .arrow { | |
left: 50%; | |
margin-left: -11px; | |
border-top-width: 0; | |
border-bottom-color: #999999; | |
border-bottom-color: rgba(0, 0, 0, 0.25); | |
top: -11px; | |
} | |
.popover.bottom > .arrow:after { | |
content: " "; | |
top: 1px; | |
margin-left: -10px; | |
border-top-width: 0; | |
border-bottom-color: #fff; | |
} | |
.popover.left > .arrow { | |
top: 50%; | |
right: -11px; | |
margin-top: -11px; | |
border-right-width: 0; | |
border-left-color: #999999; | |
border-left-color: rgba(0, 0, 0, 0.25); | |
} | |
.popover.left > .arrow:after { | |
content: " "; | |
right: 1px; | |
border-right-width: 0; | |
border-left-color: #fff; | |
bottom: -10px; | |
} | |
.carousel { | |
position: relative; | |
} | |
.carousel-inner { | |
position: relative; | |
overflow: hidden; | |
width: 100%; | |
} | |
.carousel-inner > .item { | |
display: none; | |
position: relative; | |
-webkit-transition: 0.6s ease-in-out left; | |
-o-transition: 0.6s ease-in-out left; | |
transition: 0.6s ease-in-out left; | |
} | |
.carousel-inner > .item > img, | |
.carousel-inner > .item > a > img { | |
line-height: 1; | |
} | |
@media all and (transform-3d), (-webkit-transform-3d) { | |
.carousel-inner > .item { | |
-webkit-transition: -webkit-transform 0.6s ease-in-out; | |
-moz-transition: -moz-transform 0.6s ease-in-out; | |
-o-transition: -o-transform 0.6s ease-in-out; | |
transition: transform 0.6s ease-in-out; | |
-webkit-backface-visibility: hidden; | |
-moz-backface-visibility: hidden; | |
backface-visibility: hidden; | |
-webkit-perspective: 1000px; | |
-moz-perspective: 1000px; | |
perspective: 1000px; | |
} | |
.carousel-inner > .item.next, | |
.carousel-inner > .item.active.right { | |
-webkit-transform: translate3d(100%, 0, 0); | |
transform: translate3d(100%, 0, 0); | |
left: 0; | |
} | |
.carousel-inner > .item.prev, | |
.carousel-inner > .item.active.left { | |
-webkit-transform: translate3d(-100%, 0, 0); | |
transform: translate3d(-100%, 0, 0); | |
left: 0; | |
} | |
.carousel-inner > .item.next.left, | |
.carousel-inner > .item.prev.right, | |
.carousel-inner > .item.active { | |
-webkit-transform: translate3d(0, 0, 0); | |
transform: translate3d(0, 0, 0); | |
left: 0; | |
} | |
} | |
.carousel-inner > .active, | |
.carousel-inner > .next, | |
.carousel-inner > .prev { | |
display: block; | |
} | |
.carousel-inner > .active { | |
left: 0; | |
} | |
.carousel-inner > .next, | |
.carousel-inner > .prev { | |
position: absolute; | |
top: 0; | |
width: 100%; | |
} | |
.carousel-inner > .next { | |
left: 100%; | |
} | |
.carousel-inner > .prev { | |
left: -100%; | |
} | |
.carousel-inner > .next.left, | |
.carousel-inner > .prev.right { | |
left: 0; | |
} | |
.carousel-inner > .active.left { | |
left: -100%; | |
} | |
.carousel-inner > .active.right { | |
left: 100%; | |
} | |
.carousel-control { | |
position: absolute; | |
top: 0; | |
left: 0; | |
bottom: 0; | |
width: 15%; | |
opacity: 0.5; | |
filter: alpha(opacity=50); | |
font-size: 20px; | |
color: #fff; | |
text-align: center; | |
text-shadow: 0 1px 2px rgba(0, 0, 0, 0.6); | |
background-color: rgba(0, 0, 0, 0); | |
} | |
.carousel-control.left { | |
background-image: -webkit-linear-gradient(left, rgba(0, 0, 0, 0.5) 0%, rgba(0, 0, 0, 0.0001) 100%); | |
background-image: -o-linear-gradient(left, rgba(0, 0, 0, 0.5) 0%, rgba(0, 0, 0, 0.0001) 100%); | |
background-image: linear-gradient(to right, rgba(0, 0, 0, 0.5) 0%, rgba(0, 0, 0, 0.0001) 100%); | |
background-repeat: repeat-x; | |
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#80000000', endColorstr='#00000000', GradientType=1); | |
} | |
.carousel-control.right { | |
left: auto; | |
right: 0; | |
background-image: -webkit-linear-gradient(left, rgba(0, 0, 0, 0.0001) 0%, rgba(0, 0, 0, 0.5) 100%); | |
background-image: -o-linear-gradient(left, rgba(0, 0, 0, 0.0001) 0%, rgba(0, 0, 0, 0.5) 100%); | |
background-image: linear-gradient(to right, rgba(0, 0, 0, 0.0001) 0%, rgba(0, 0, 0, 0.5) 100%); | |
background-repeat: repeat-x; | |
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#00000000', endColorstr='#80000000', GradientType=1); | |
} | |
.carousel-control:hover, | |
.carousel-control:focus { | |
outline: 0; | |
color: #fff; | |
text-decoration: none; | |
opacity: 0.9; | |
filter: alpha(opacity=90); | |
} | |
.carousel-control .icon-prev, | |
.carousel-control .icon-next, | |
.carousel-control .glyphicon-chevron-left, | |
.carousel-control .glyphicon-chevron-right { | |
position: absolute; | |
top: 50%; | |
margin-top: -10px; | |
z-index: 5; | |
display: inline-block; | |
} | |
.carousel-control .icon-prev, | |
.carousel-control .glyphicon-chevron-left { | |
left: 50%; | |
margin-left: -10px; | |
} | |
.carousel-control .icon-next, | |
.carousel-control .glyphicon-chevron-right { | |
right: 50%; | |
margin-right: -10px; | |
} | |
.carousel-control .icon-prev, | |
.carousel-control .icon-next { | |
width: 20px; | |
height: 20px; | |
line-height: 1; | |
font-family: serif; | |
} | |
.carousel-control .icon-prev:before { | |
content: '\2039'; | |
} | |
.carousel-control .icon-next:before { | |
content: '\203a'; | |
} | |
.carousel-indicators { | |
position: absolute; | |
bottom: 10px; | |
left: 50%; | |
z-index: 15; | |
width: 60%; | |
margin-left: -30%; | |
padding-left: 0; | |
list-style: none; | |
text-align: center; | |
} | |
.carousel-indicators li { | |
display: inline-block; | |
width: 10px; | |
height: 10px; | |
margin: 1px; | |
text-indent: -999px; | |
border: 1px solid #fff; | |
border-radius: 10px; | |
cursor: pointer; | |
background-color: #000 \9; | |
background-color: rgba(0, 0, 0, 0); | |
} | |
.carousel-indicators .active { | |
margin: 0; | |
width: 12px; | |
height: 12px; | |
background-color: #fff; | |
} | |
.carousel-caption { | |
position: absolute; | |
left: 15%; | |
right: 15%; | |
bottom: 20px; | |
z-index: 10; | |
padding-top: 20px; | |
padding-bottom: 20px; | |
color: #fff; | |
text-align: center; | |
text-shadow: 0 1px 2px rgba(0, 0, 0, 0.6); | |
} | |
.carousel-caption .btn { | |
text-shadow: none; | |
} | |
@media screen and (min-width: 768px) { | |
.carousel-control .glyphicon-chevron-left, | |
.carousel-control .glyphicon-chevron-right, | |
.carousel-control .icon-prev, | |
.carousel-control .icon-next { | |
width: 30px; | |
height: 30px; | |
margin-top: -10px; | |
font-size: 30px; | |
} | |
.carousel-control .glyphicon-chevron-left, | |
.carousel-control .icon-prev { | |
margin-left: -10px; | |
} | |
.carousel-control .glyphicon-chevron-right, | |
.carousel-control .icon-next { | |
margin-right: -10px; | |
} | |
.carousel-caption { | |
left: 20%; | |
right: 20%; | |
padding-bottom: 30px; | |
} | |
.carousel-indicators { | |
bottom: 20px; | |
} | |
} | |
.clearfix:before, | |
.clearfix:after, | |
.dl-horizontal dd:before, | |
.dl-horizontal dd:after, | |
.container:before, | |
.container:after, | |
.container-fluid:before, | |
.container-fluid:after, | |
.row:before, | |
.row:after, | |
.form-horizontal .form-group:before, | |
.form-horizontal .form-group:after, | |
.btn-toolbar:before, | |
.btn-toolbar:after, | |
.btn-group-vertical > .btn-group:before, | |
.btn-group-vertical > .btn-group:after, | |
.nav:before, | |
.nav:after, | |
.navbar:before, | |
.navbar:after, | |
.navbar-header:before, | |
.navbar-header:after, | |
.navbar-collapse:before, | |
.navbar-collapse:after, | |
.pager:before, | |
.pager:after, | |
.panel-body:before, | |
.panel-body:after, | |
.modal-header:before, | |
.modal-header:after, | |
.modal-footer:before, | |
.modal-footer:after, | |
.item_buttons:before, | |
.item_buttons:after { | |
content: " "; | |
display: table; | |
} | |
.clearfix:after, | |
.dl-horizontal dd:after, | |
.container:after, | |
.container-fluid:after, | |
.row:after, | |
.form-horizontal .form-group:after, | |
.btn-toolbar:after, | |
.btn-group-vertical > .btn-group:after, | |
.nav:after, | |
.navbar:after, | |
.navbar-header:after, | |
.navbar-collapse:after, | |
.pager:after, | |
.panel-body:after, | |
.modal-header:after, | |
.modal-footer:after, | |
.item_buttons:after { | |
clear: both; | |
} | |
.center-block { | |
display: block; | |
margin-left: auto; | |
margin-right: auto; | |
} | |
.pull-right { | |
float: right !important; | |
} | |
.pull-left { | |
float: left !important; | |
} | |
.hide { | |
display: none !important; | |
} | |
.show { | |
display: block !important; | |
} | |
.invisible { | |
visibility: hidden; | |
} | |
.text-hide { | |
font: 0/0 a; | |
color: transparent; | |
text-shadow: none; | |
background-color: transparent; | |
border: 0; | |
} | |
.hidden { | |
display: none !important; | |
} | |
.affix { | |
position: fixed; | |
} | |
@-ms-viewport { | |
width: device-width; | |
} | |
.visible-xs, | |
.visible-sm, | |
.visible-md, | |
.visible-lg { | |
display: none !important; | |
} | |
.visible-xs-block, | |
.visible-xs-inline, | |
.visible-xs-inline-block, | |
.visible-sm-block, | |
.visible-sm-inline, | |
.visible-sm-inline-block, | |
.visible-md-block, | |
.visible-md-inline, | |
.visible-md-inline-block, | |
.visible-lg-block, | |
.visible-lg-inline, | |
.visible-lg-inline-block { | |
display: none !important; | |
} | |
@media (max-width: 767px) { | |
.visible-xs { | |
display: block !important; | |
} | |
table.visible-xs { | |
display: table !important; | |
} | |
tr.visible-xs { | |
display: table-row !important; | |
} | |
th.visible-xs, | |
td.visible-xs { | |
display: table-cell !important; | |
} | |
} | |
@media (max-width: 767px) { | |
.visible-xs-block { | |
display: block !important; | |
} | |
} | |
@media (max-width: 767px) { | |
.visible-xs-inline { | |
display: inline !important; | |
} | |
} | |
@media (max-width: 767px) { | |
.visible-xs-inline-block { | |
display: inline-block !important; | |
} | |
} | |
@media (min-width: 768px) and (max-width: 991px) { | |
.visible-sm { | |
display: block !important; | |
} | |
table.visible-sm { | |
display: table !important; | |
} | |
tr.visible-sm { | |
display: table-row !important; | |
} | |
th.visible-sm, | |
td.visible-sm { | |
display: table-cell !important; | |
} | |
} | |
@media (min-width: 768px) and (max-width: 991px) { | |
.visible-sm-block { | |
display: block !important; | |
} | |
} | |
@media (min-width: 768px) and (max-width: 991px) { | |
.visible-sm-inline { | |
display: inline !important; | |
} | |
} | |
@media (min-width: 768px) and (max-width: 991px) { | |
.visible-sm-inline-block { | |
display: inline-block !important; | |
} | |
} | |
@media (min-width: 992px) and (max-width: 1199px) { | |
.visible-md { | |
display: block !important; | |
} | |
table.visible-md { | |
display: table !important; | |
} | |
tr.visible-md { | |
display: table-row !important; | |
} | |
th.visible-md, | |
td.visible-md { | |
display: table-cell !important; | |
} | |
} | |
@media (min-width: 992px) and (max-width: 1199px) { | |
.visible-md-block { | |
display: block !important; | |
} | |
} | |
@media (min-width: 992px) and (max-width: 1199px) { | |
.visible-md-inline { | |
display: inline !important; | |
} | |
} | |
@media (min-width: 992px) and (max-width: 1199px) { | |
.visible-md-inline-block { | |
display: inline-block !important; | |
} | |
} | |
@media (min-width: 1200px) { | |
.visible-lg { | |
display: block !important; | |
} | |
table.visible-lg { | |
display: table !important; | |
} | |
tr.visible-lg { | |
display: table-row !important; | |
} | |
th.visible-lg, | |
td.visible-lg { | |
display: table-cell !important; | |
} | |
} | |
@media (min-width: 1200px) { | |
.visible-lg-block { | |
display: block !important; | |
} | |
} | |
@media (min-width: 1200px) { | |
.visible-lg-inline { | |
display: inline !important; | |
} | |
} | |
@media (min-width: 1200px) { | |
.visible-lg-inline-block { | |
display: inline-block !important; | |
} | |
} | |
@media (max-width: 767px) { | |
.hidden-xs { | |
display: none !important; | |
} | |
} | |
@media (min-width: 768px) and (max-width: 991px) { | |
.hidden-sm { | |
display: none !important; | |
} | |
} | |
@media (min-width: 992px) and (max-width: 1199px) { | |
.hidden-md { | |
display: none !important; | |
} | |
} | |
@media (min-width: 1200px) { | |
.hidden-lg { | |
display: none !important; | |
} | |
} | |
.visible-print { | |
display: none !important; | |
} | |
@media print { | |
.visible-print { | |
display: block !important; | |
} | |
table.visible-print { | |
display: table !important; | |
} | |
tr.visible-print { | |
display: table-row !important; | |
} | |
th.visible-print, | |
td.visible-print { | |
display: table-cell !important; | |
} | |
} | |
.visible-print-block { | |
display: none !important; | |
} | |
@media print { | |
.visible-print-block { | |
display: block !important; | |
} | |
} | |
.visible-print-inline { | |
display: none !important; | |
} | |
@media print { | |
.visible-print-inline { | |
display: inline !important; | |
} | |
} | |
.visible-print-inline-block { | |
display: none !important; | |
} | |
@media print { | |
.visible-print-inline-block { | |
display: inline-block !important; | |
} | |
} | |
@media print { | |
.hidden-print { | |
display: none !important; | |
} | |
} | |
/*! | |
* | |
* Font Awesome | |
* | |
*/ | |
/*! | |
* Font Awesome 4.7.0 by @davegandy - http://fontawesome.io - @fontawesome | |
* License - http://fontawesome.io/license (Font: SIL OFL 1.1, CSS: MIT License) | |
*/ | |
/* FONT PATH | |
* -------------------------- */ | |
@font-face { | |
font-family: 'FontAwesome'; | |
src: url('../components/font-awesome/fonts/fontawesome-webfont.eot?v=4.7.0'); | |
src: url('../components/font-awesome/fonts/fontawesome-webfont.eot?#iefix&v=4.7.0') format('embedded-opentype'), url('../components/font-awesome/fonts/fontawesome-webfont.woff2?v=4.7.0') format('woff2'), url('../components/font-awesome/fonts/fontawesome-webfont.woff?v=4.7.0') format('woff'), url('../components/font-awesome/fonts/fontawesome-webfont.ttf?v=4.7.0') format('truetype'), url('../components/font-awesome/fonts/fontawesome-webfont.svg?v=4.7.0#fontawesomeregular') format('svg'); | |
font-weight: normal; | |
font-style: normal; | |
} | |
.fa { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
} | |
/* makes the font 33% larger relative to the icon container */ | |
.fa-lg { | |
font-size: 1.33333333em; | |
line-height: 0.75em; | |
vertical-align: -15%; | |
} | |
.fa-2x { | |
font-size: 2em; | |
} | |
.fa-3x { | |
font-size: 3em; | |
} | |
.fa-4x { | |
font-size: 4em; | |
} | |
.fa-5x { | |
font-size: 5em; | |
} | |
.fa-fw { | |
width: 1.28571429em; | |
text-align: center; | |
} | |
.fa-ul { | |
padding-left: 0; | |
margin-left: 2.14285714em; | |
list-style-type: none; | |
} | |
.fa-ul > li { | |
position: relative; | |
} | |
.fa-li { | |
position: absolute; | |
left: -2.14285714em; | |
width: 2.14285714em; | |
top: 0.14285714em; | |
text-align: center; | |
} | |
.fa-li.fa-lg { | |
left: -1.85714286em; | |
} | |
.fa-border { | |
padding: .2em .25em .15em; | |
border: solid 0.08em #eee; | |
border-radius: .1em; | |
} | |
.fa-pull-left { | |
float: left; | |
} | |
.fa-pull-right { | |
float: right; | |
} | |
.fa.fa-pull-left { | |
margin-right: .3em; | |
} | |
.fa.fa-pull-right { | |
margin-left: .3em; | |
} | |
/* Deprecated as of 4.4.0 */ | |
.pull-right { | |
float: right; | |
} | |
.pull-left { | |
float: left; | |
} | |
.fa.pull-left { | |
margin-right: .3em; | |
} | |
.fa.pull-right { | |
margin-left: .3em; | |
} | |
.fa-spin { | |
-webkit-animation: fa-spin 2s infinite linear; | |
animation: fa-spin 2s infinite linear; | |
} | |
.fa-pulse { | |
-webkit-animation: fa-spin 1s infinite steps(8); | |
animation: fa-spin 1s infinite steps(8); | |
} | |
@-webkit-keyframes fa-spin { | |
0% { | |
-webkit-transform: rotate(0deg); | |
transform: rotate(0deg); | |
} | |
100% { | |
-webkit-transform: rotate(359deg); | |
transform: rotate(359deg); | |
} | |
} | |
@keyframes fa-spin { | |
0% { | |
-webkit-transform: rotate(0deg); | |
transform: rotate(0deg); | |
} | |
100% { | |
-webkit-transform: rotate(359deg); | |
transform: rotate(359deg); | |
} | |
} | |
.fa-rotate-90 { | |
-ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=1)"; | |
-webkit-transform: rotate(90deg); | |
-ms-transform: rotate(90deg); | |
transform: rotate(90deg); | |
} | |
.fa-rotate-180 { | |
-ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=2)"; | |
-webkit-transform: rotate(180deg); | |
-ms-transform: rotate(180deg); | |
transform: rotate(180deg); | |
} | |
.fa-rotate-270 { | |
-ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=3)"; | |
-webkit-transform: rotate(270deg); | |
-ms-transform: rotate(270deg); | |
transform: rotate(270deg); | |
} | |
.fa-flip-horizontal { | |
-ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1)"; | |
-webkit-transform: scale(-1, 1); | |
-ms-transform: scale(-1, 1); | |
transform: scale(-1, 1); | |
} | |
.fa-flip-vertical { | |
-ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)"; | |
-webkit-transform: scale(1, -1); | |
-ms-transform: scale(1, -1); | |
transform: scale(1, -1); | |
} | |
:root .fa-rotate-90, | |
:root .fa-rotate-180, | |
:root .fa-rotate-270, | |
:root .fa-flip-horizontal, | |
:root .fa-flip-vertical { | |
filter: none; | |
} | |
.fa-stack { | |
position: relative; | |
display: inline-block; | |
width: 2em; | |
height: 2em; | |
line-height: 2em; | |
vertical-align: middle; | |
} | |
.fa-stack-1x, | |
.fa-stack-2x { | |
position: absolute; | |
left: 0; | |
width: 100%; | |
text-align: center; | |
} | |
.fa-stack-1x { | |
line-height: inherit; | |
} | |
.fa-stack-2x { | |
font-size: 2em; | |
} | |
.fa-inverse { | |
color: #fff; | |
} | |
/* Font Awesome uses the Unicode Private Use Area (PUA) to ensure screen | |
readers do not read off random characters that represent icons */ | |
.fa-glass:before { | |
content: "\f000"; | |
} | |
.fa-music:before { | |
content: "\f001"; | |
} | |
.fa-search:before { | |
content: "\f002"; | |
} | |
.fa-envelope-o:before { | |
content: "\f003"; | |
} | |
.fa-heart:before { | |
content: "\f004"; | |
} | |
.fa-star:before { | |
content: "\f005"; | |
} | |
.fa-star-o:before { | |
content: "\f006"; | |
} | |
.fa-user:before { | |
content: "\f007"; | |
} | |
.fa-film:before { | |
content: "\f008"; | |
} | |
.fa-th-large:before { | |
content: "\f009"; | |
} | |
.fa-th:before { | |
content: "\f00a"; | |
} | |
.fa-th-list:before { | |
content: "\f00b"; | |
} | |
.fa-check:before { | |
content: "\f00c"; | |
} | |
.fa-remove:before, | |
.fa-close:before, | |
.fa-times:before { | |
content: "\f00d"; | |
} | |
.fa-search-plus:before { | |
content: "\f00e"; | |
} | |
.fa-search-minus:before { | |
content: "\f010"; | |
} | |
.fa-power-off:before { | |
content: "\f011"; | |
} | |
.fa-signal:before { | |
content: "\f012"; | |
} | |
.fa-gear:before, | |
.fa-cog:before { | |
content: "\f013"; | |
} | |
.fa-trash-o:before { | |
content: "\f014"; | |
} | |
.fa-home:before { | |
content: "\f015"; | |
} | |
.fa-file-o:before { | |
content: "\f016"; | |
} | |
.fa-clock-o:before { | |
content: "\f017"; | |
} | |
.fa-road:before { | |
content: "\f018"; | |
} | |
.fa-download:before { | |
content: "\f019"; | |
} | |
.fa-arrow-circle-o-down:before { | |
content: "\f01a"; | |
} | |
.fa-arrow-circle-o-up:before { | |
content: "\f01b"; | |
} | |
.fa-inbox:before { | |
content: "\f01c"; | |
} | |
.fa-play-circle-o:before { | |
content: "\f01d"; | |
} | |
.fa-rotate-right:before, | |
.fa-repeat:before { | |
content: "\f01e"; | |
} | |
.fa-refresh:before { | |
content: "\f021"; | |
} | |
.fa-list-alt:before { | |
content: "\f022"; | |
} | |
.fa-lock:before { | |
content: "\f023"; | |
} | |
.fa-flag:before { | |
content: "\f024"; | |
} | |
.fa-headphones:before { | |
content: "\f025"; | |
} | |
.fa-volume-off:before { | |
content: "\f026"; | |
} | |
.fa-volume-down:before { | |
content: "\f027"; | |
} | |
.fa-volume-up:before { | |
content: "\f028"; | |
} | |
.fa-qrcode:before { | |
content: "\f029"; | |
} | |
.fa-barcode:before { | |
content: "\f02a"; | |
} | |
.fa-tag:before { | |
content: "\f02b"; | |
} | |
.fa-tags:before { | |
content: "\f02c"; | |
} | |
.fa-book:before { | |
content: "\f02d"; | |
} | |
.fa-bookmark:before { | |
content: "\f02e"; | |
} | |
.fa-print:before { | |
content: "\f02f"; | |
} | |
.fa-camera:before { | |
content: "\f030"; | |
} | |
.fa-font:before { | |
content: "\f031"; | |
} | |
.fa-bold:before { | |
content: "\f032"; | |
} | |
.fa-italic:before { | |
content: "\f033"; | |
} | |
.fa-text-height:before { | |
content: "\f034"; | |
} | |
.fa-text-width:before { | |
content: "\f035"; | |
} | |
.fa-align-left:before { | |
content: "\f036"; | |
} | |
.fa-align-center:before { | |
content: "\f037"; | |
} | |
.fa-align-right:before { | |
content: "\f038"; | |
} | |
.fa-align-justify:before { | |
content: "\f039"; | |
} | |
.fa-list:before { | |
content: "\f03a"; | |
} | |
.fa-dedent:before, | |
.fa-outdent:before { | |
content: "\f03b"; | |
} | |
.fa-indent:before { | |
content: "\f03c"; | |
} | |
.fa-video-camera:before { | |
content: "\f03d"; | |
} | |
.fa-photo:before, | |
.fa-image:before, | |
.fa-picture-o:before { | |
content: "\f03e"; | |
} | |
.fa-pencil:before { | |
content: "\f040"; | |
} | |
.fa-map-marker:before { | |
content: "\f041"; | |
} | |
.fa-adjust:before { | |
content: "\f042"; | |
} | |
.fa-tint:before { | |
content: "\f043"; | |
} | |
.fa-edit:before, | |
.fa-pencil-square-o:before { | |
content: "\f044"; | |
} | |
.fa-share-square-o:before { | |
content: "\f045"; | |
} | |
.fa-check-square-o:before { | |
content: "\f046"; | |
} | |
.fa-arrows:before { | |
content: "\f047"; | |
} | |
.fa-step-backward:before { | |
content: "\f048"; | |
} | |
.fa-fast-backward:before { | |
content: "\f049"; | |
} | |
.fa-backward:before { | |
content: "\f04a"; | |
} | |
.fa-play:before { | |
content: "\f04b"; | |
} | |
.fa-pause:before { | |
content: "\f04c"; | |
} | |
.fa-stop:before { | |
content: "\f04d"; | |
} | |
.fa-forward:before { | |
content: "\f04e"; | |
} | |
.fa-fast-forward:before { | |
content: "\f050"; | |
} | |
.fa-step-forward:before { | |
content: "\f051"; | |
} | |
.fa-eject:before { | |
content: "\f052"; | |
} | |
.fa-chevron-left:before { | |
content: "\f053"; | |
} | |
.fa-chevron-right:before { | |
content: "\f054"; | |
} | |
.fa-plus-circle:before { | |
content: "\f055"; | |
} | |
.fa-minus-circle:before { | |
content: "\f056"; | |
} | |
.fa-times-circle:before { | |
content: "\f057"; | |
} | |
.fa-check-circle:before { | |
content: "\f058"; | |
} | |
.fa-question-circle:before { | |
content: "\f059"; | |
} | |
.fa-info-circle:before { | |
content: "\f05a"; | |
} | |
.fa-crosshairs:before { | |
content: "\f05b"; | |
} | |
.fa-times-circle-o:before { | |
content: "\f05c"; | |
} | |
.fa-check-circle-o:before { | |
content: "\f05d"; | |
} | |
.fa-ban:before { | |
content: "\f05e"; | |
} | |
.fa-arrow-left:before { | |
content: "\f060"; | |
} | |
.fa-arrow-right:before { | |
content: "\f061"; | |
} | |
.fa-arrow-up:before { | |
content: "\f062"; | |
} | |
.fa-arrow-down:before { | |
content: "\f063"; | |
} | |
.fa-mail-forward:before, | |
.fa-share:before { | |
content: "\f064"; | |
} | |
.fa-expand:before { | |
content: "\f065"; | |
} | |
.fa-compress:before { | |
content: "\f066"; | |
} | |
.fa-plus:before { | |
content: "\f067"; | |
} | |
.fa-minus:before { | |
content: "\f068"; | |
} | |
.fa-asterisk:before { | |
content: "\f069"; | |
} | |
.fa-exclamation-circle:before { | |
content: "\f06a"; | |
} | |
.fa-gift:before { | |
content: "\f06b"; | |
} | |
.fa-leaf:before { | |
content: "\f06c"; | |
} | |
.fa-fire:before { | |
content: "\f06d"; | |
} | |
.fa-eye:before { | |
content: "\f06e"; | |
} | |
.fa-eye-slash:before { | |
content: "\f070"; | |
} | |
.fa-warning:before, | |
.fa-exclamation-triangle:before { | |
content: "\f071"; | |
} | |
.fa-plane:before { | |
content: "\f072"; | |
} | |
.fa-calendar:before { | |
content: "\f073"; | |
} | |
.fa-random:before { | |
content: "\f074"; | |
} | |
.fa-comment:before { | |
content: "\f075"; | |
} | |
.fa-magnet:before { | |
content: "\f076"; | |
} | |
.fa-chevron-up:before { | |
content: "\f077"; | |
} | |
.fa-chevron-down:before { | |
content: "\f078"; | |
} | |
.fa-retweet:before { | |
content: "\f079"; | |
} | |
.fa-shopping-cart:before { | |
content: "\f07a"; | |
} | |
.fa-folder:before { | |
content: "\f07b"; | |
} | |
.fa-folder-open:before { | |
content: "\f07c"; | |
} | |
.fa-arrows-v:before { | |
content: "\f07d"; | |
} | |
.fa-arrows-h:before { | |
content: "\f07e"; | |
} | |
.fa-bar-chart-o:before, | |
.fa-bar-chart:before { | |
content: "\f080"; | |
} | |
.fa-twitter-square:before { | |
content: "\f081"; | |
} | |
.fa-facebook-square:before { | |
content: "\f082"; | |
} | |
.fa-camera-retro:before { | |
content: "\f083"; | |
} | |
.fa-key:before { | |
content: "\f084"; | |
} | |
.fa-gears:before, | |
.fa-cogs:before { | |
content: "\f085"; | |
} | |
.fa-comments:before { | |
content: "\f086"; | |
} | |
.fa-thumbs-o-up:before { | |
content: "\f087"; | |
} | |
.fa-thumbs-o-down:before { | |
content: "\f088"; | |
} | |
.fa-star-half:before { | |
content: "\f089"; | |
} | |
.fa-heart-o:before { | |
content: "\f08a"; | |
} | |
.fa-sign-out:before { | |
content: "\f08b"; | |
} | |
.fa-linkedin-square:before { | |
content: "\f08c"; | |
} | |
.fa-thumb-tack:before { | |
content: "\f08d"; | |
} | |
.fa-external-link:before { | |
content: "\f08e"; | |
} | |
.fa-sign-in:before { | |
content: "\f090"; | |
} | |
.fa-trophy:before { | |
content: "\f091"; | |
} | |
.fa-github-square:before { | |
content: "\f092"; | |
} | |
.fa-upload:before { | |
content: "\f093"; | |
} | |
.fa-lemon-o:before { | |
content: "\f094"; | |
} | |
.fa-phone:before { | |
content: "\f095"; | |
} | |
.fa-square-o:before { | |
content: "\f096"; | |
} | |
.fa-bookmark-o:before { | |
content: "\f097"; | |
} | |
.fa-phone-square:before { | |
content: "\f098"; | |
} | |
.fa-twitter:before { | |
content: "\f099"; | |
} | |
.fa-facebook-f:before, | |
.fa-facebook:before { | |
content: "\f09a"; | |
} | |
.fa-github:before { | |
content: "\f09b"; | |
} | |
.fa-unlock:before { | |
content: "\f09c"; | |
} | |
.fa-credit-card:before { | |
content: "\f09d"; | |
} | |
.fa-feed:before, | |
.fa-rss:before { | |
content: "\f09e"; | |
} | |
.fa-hdd-o:before { | |
content: "\f0a0"; | |
} | |
.fa-bullhorn:before { | |
content: "\f0a1"; | |
} | |
.fa-bell:before { | |
content: "\f0f3"; | |
} | |
.fa-certificate:before { | |
content: "\f0a3"; | |
} | |
.fa-hand-o-right:before { | |
content: "\f0a4"; | |
} | |
.fa-hand-o-left:before { | |
content: "\f0a5"; | |
} | |
.fa-hand-o-up:before { | |
content: "\f0a6"; | |
} | |
.fa-hand-o-down:before { | |
content: "\f0a7"; | |
} | |
.fa-arrow-circle-left:before { | |
content: "\f0a8"; | |
} | |
.fa-arrow-circle-right:before { | |
content: "\f0a9"; | |
} | |
.fa-arrow-circle-up:before { | |
content: "\f0aa"; | |
} | |
.fa-arrow-circle-down:before { | |
content: "\f0ab"; | |
} | |
.fa-globe:before { | |
content: "\f0ac"; | |
} | |
.fa-wrench:before { | |
content: "\f0ad"; | |
} | |
.fa-tasks:before { | |
content: "\f0ae"; | |
} | |
.fa-filter:before { | |
content: "\f0b0"; | |
} | |
.fa-briefcase:before { | |
content: "\f0b1"; | |
} | |
.fa-arrows-alt:before { | |
content: "\f0b2"; | |
} | |
.fa-group:before, | |
.fa-users:before { | |
content: "\f0c0"; | |
} | |
.fa-chain:before, | |
.fa-link:before { | |
content: "\f0c1"; | |
} | |
.fa-cloud:before { | |
content: "\f0c2"; | |
} | |
.fa-flask:before { | |
content: "\f0c3"; | |
} | |
.fa-cut:before, | |
.fa-scissors:before { | |
content: "\f0c4"; | |
} | |
.fa-copy:before, | |
.fa-files-o:before { | |
content: "\f0c5"; | |
} | |
.fa-paperclip:before { | |
content: "\f0c6"; | |
} | |
.fa-save:before, | |
.fa-floppy-o:before { | |
content: "\f0c7"; | |
} | |
.fa-square:before { | |
content: "\f0c8"; | |
} | |
.fa-navicon:before, | |
.fa-reorder:before, | |
.fa-bars:before { | |
content: "\f0c9"; | |
} | |
.fa-list-ul:before { | |
content: "\f0ca"; | |
} | |
.fa-list-ol:before { | |
content: "\f0cb"; | |
} | |
.fa-strikethrough:before { | |
content: "\f0cc"; | |
} | |
.fa-underline:before { | |
content: "\f0cd"; | |
} | |
.fa-table:before { | |
content: "\f0ce"; | |
} | |
.fa-magic:before { | |
content: "\f0d0"; | |
} | |
.fa-truck:before { | |
content: "\f0d1"; | |
} | |
.fa-pinterest:before { | |
content: "\f0d2"; | |
} | |
.fa-pinterest-square:before { | |
content: "\f0d3"; | |
} | |
.fa-google-plus-square:before { | |
content: "\f0d4"; | |
} | |
.fa-google-plus:before { | |
content: "\f0d5"; | |
} | |
.fa-money:before { | |
content: "\f0d6"; | |
} | |
.fa-caret-down:before { | |
content: "\f0d7"; | |
} | |
.fa-caret-up:before { | |
content: "\f0d8"; | |
} | |
.fa-caret-left:before { | |
content: "\f0d9"; | |
} | |
.fa-caret-right:before { | |
content: "\f0da"; | |
} | |
.fa-columns:before { | |
content: "\f0db"; | |
} | |
.fa-unsorted:before, | |
.fa-sort:before { | |
content: "\f0dc"; | |
} | |
.fa-sort-down:before, | |
.fa-sort-desc:before { | |
content: "\f0dd"; | |
} | |
.fa-sort-up:before, | |
.fa-sort-asc:before { | |
content: "\f0de"; | |
} | |
.fa-envelope:before { | |
content: "\f0e0"; | |
} | |
.fa-linkedin:before { | |
content: "\f0e1"; | |
} | |
.fa-rotate-left:before, | |
.fa-undo:before { | |
content: "\f0e2"; | |
} | |
.fa-legal:before, | |
.fa-gavel:before { | |
content: "\f0e3"; | |
} | |
.fa-dashboard:before, | |
.fa-tachometer:before { | |
content: "\f0e4"; | |
} | |
.fa-comment-o:before { | |
content: "\f0e5"; | |
} | |
.fa-comments-o:before { | |
content: "\f0e6"; | |
} | |
.fa-flash:before, | |
.fa-bolt:before { | |
content: "\f0e7"; | |
} | |
.fa-sitemap:before { | |
content: "\f0e8"; | |
} | |
.fa-umbrella:before { | |
content: "\f0e9"; | |
} | |
.fa-paste:before, | |
.fa-clipboard:before { | |
content: "\f0ea"; | |
} | |
.fa-lightbulb-o:before { | |
content: "\f0eb"; | |
} | |
.fa-exchange:before { | |
content: "\f0ec"; | |
} | |
.fa-cloud-download:before { | |
content: "\f0ed"; | |
} | |
.fa-cloud-upload:before { | |
content: "\f0ee"; | |
} | |
.fa-user-md:before { | |
content: "\f0f0"; | |
} | |
.fa-stethoscope:before { | |
content: "\f0f1"; | |
} | |
.fa-suitcase:before { | |
content: "\f0f2"; | |
} | |
.fa-bell-o:before { | |
content: "\f0a2"; | |
} | |
.fa-coffee:before { | |
content: "\f0f4"; | |
} | |
.fa-cutlery:before { | |
content: "\f0f5"; | |
} | |
.fa-file-text-o:before { | |
content: "\f0f6"; | |
} | |
.fa-building-o:before { | |
content: "\f0f7"; | |
} | |
.fa-hospital-o:before { | |
content: "\f0f8"; | |
} | |
.fa-ambulance:before { | |
content: "\f0f9"; | |
} | |
.fa-medkit:before { | |
content: "\f0fa"; | |
} | |
.fa-fighter-jet:before { | |
content: "\f0fb"; | |
} | |
.fa-beer:before { | |
content: "\f0fc"; | |
} | |
.fa-h-square:before { | |
content: "\f0fd"; | |
} | |
.fa-plus-square:before { | |
content: "\f0fe"; | |
} | |
.fa-angle-double-left:before { | |
content: "\f100"; | |
} | |
.fa-angle-double-right:before { | |
content: "\f101"; | |
} | |
.fa-angle-double-up:before { | |
content: "\f102"; | |
} | |
.fa-angle-double-down:before { | |
content: "\f103"; | |
} | |
.fa-angle-left:before { | |
content: "\f104"; | |
} | |
.fa-angle-right:before { | |
content: "\f105"; | |
} | |
.fa-angle-up:before { | |
content: "\f106"; | |
} | |
.fa-angle-down:before { | |
content: "\f107"; | |
} | |
.fa-desktop:before { | |
content: "\f108"; | |
} | |
.fa-laptop:before { | |
content: "\f109"; | |
} | |
.fa-tablet:before { | |
content: "\f10a"; | |
} | |
.fa-mobile-phone:before, | |
.fa-mobile:before { | |
content: "\f10b"; | |
} | |
.fa-circle-o:before { | |
content: "\f10c"; | |
} | |
.fa-quote-left:before { | |
content: "\f10d"; | |
} | |
.fa-quote-right:before { | |
content: "\f10e"; | |
} | |
.fa-spinner:before { | |
content: "\f110"; | |
} | |
.fa-circle:before { | |
content: "\f111"; | |
} | |
.fa-mail-reply:before, | |
.fa-reply:before { | |
content: "\f112"; | |
} | |
.fa-github-alt:before { | |
content: "\f113"; | |
} | |
.fa-folder-o:before { | |
content: "\f114"; | |
} | |
.fa-folder-open-o:before { | |
content: "\f115"; | |
} | |
.fa-smile-o:before { | |
content: "\f118"; | |
} | |
.fa-frown-o:before { | |
content: "\f119"; | |
} | |
.fa-meh-o:before { | |
content: "\f11a"; | |
} | |
.fa-gamepad:before { | |
content: "\f11b"; | |
} | |
.fa-keyboard-o:before { | |
content: "\f11c"; | |
} | |
.fa-flag-o:before { | |
content: "\f11d"; | |
} | |
.fa-flag-checkered:before { | |
content: "\f11e"; | |
} | |
.fa-terminal:before { | |
content: "\f120"; | |
} | |
.fa-code:before { | |
content: "\f121"; | |
} | |
.fa-mail-reply-all:before, | |
.fa-reply-all:before { | |
content: "\f122"; | |
} | |
.fa-star-half-empty:before, | |
.fa-star-half-full:before, | |
.fa-star-half-o:before { | |
content: "\f123"; | |
} | |
.fa-location-arrow:before { | |
content: "\f124"; | |
} | |
.fa-crop:before { | |
content: "\f125"; | |
} | |
.fa-code-fork:before { | |
content: "\f126"; | |
} | |
.fa-unlink:before, | |
.fa-chain-broken:before { | |
content: "\f127"; | |
} | |
.fa-question:before { | |
content: "\f128"; | |
} | |
.fa-info:before { | |
content: "\f129"; | |
} | |
.fa-exclamation:before { | |
content: "\f12a"; | |
} | |
.fa-superscript:before { | |
content: "\f12b"; | |
} | |
.fa-subscript:before { | |
content: "\f12c"; | |
} | |
.fa-eraser:before { | |
content: "\f12d"; | |
} | |
.fa-puzzle-piece:before { | |
content: "\f12e"; | |
} | |
.fa-microphone:before { | |
content: "\f130"; | |
} | |
.fa-microphone-slash:before { | |
content: "\f131"; | |
} | |
.fa-shield:before { | |
content: "\f132"; | |
} | |
.fa-calendar-o:before { | |
content: "\f133"; | |
} | |
.fa-fire-extinguisher:before { | |
content: "\f134"; | |
} | |
.fa-rocket:before { | |
content: "\f135"; | |
} | |
.fa-maxcdn:before { | |
content: "\f136"; | |
} | |
.fa-chevron-circle-left:before { | |
content: "\f137"; | |
} | |
.fa-chevron-circle-right:before { | |
content: "\f138"; | |
} | |
.fa-chevron-circle-up:before { | |
content: "\f139"; | |
} | |
.fa-chevron-circle-down:before { | |
content: "\f13a"; | |
} | |
.fa-html5:before { | |
content: "\f13b"; | |
} | |
.fa-css3:before { | |
content: "\f13c"; | |
} | |
.fa-anchor:before { | |
content: "\f13d"; | |
} | |
.fa-unlock-alt:before { | |
content: "\f13e"; | |
} | |
.fa-bullseye:before { | |
content: "\f140"; | |
} | |
.fa-ellipsis-h:before { | |
content: "\f141"; | |
} | |
.fa-ellipsis-v:before { | |
content: "\f142"; | |
} | |
.fa-rss-square:before { | |
content: "\f143"; | |
} | |
.fa-play-circle:before { | |
content: "\f144"; | |
} | |
.fa-ticket:before { | |
content: "\f145"; | |
} | |
.fa-minus-square:before { | |
content: "\f146"; | |
} | |
.fa-minus-square-o:before { | |
content: "\f147"; | |
} | |
.fa-level-up:before { | |
content: "\f148"; | |
} | |
.fa-level-down:before { | |
content: "\f149"; | |
} | |
.fa-check-square:before { | |
content: "\f14a"; | |
} | |
.fa-pencil-square:before { | |
content: "\f14b"; | |
} | |
.fa-external-link-square:before { | |
content: "\f14c"; | |
} | |
.fa-share-square:before { | |
content: "\f14d"; | |
} | |
.fa-compass:before { | |
content: "\f14e"; | |
} | |
.fa-toggle-down:before, | |
.fa-caret-square-o-down:before { | |
content: "\f150"; | |
} | |
.fa-toggle-up:before, | |
.fa-caret-square-o-up:before { | |
content: "\f151"; | |
} | |
.fa-toggle-right:before, | |
.fa-caret-square-o-right:before { | |
content: "\f152"; | |
} | |
.fa-euro:before, | |
.fa-eur:before { | |
content: "\f153"; | |
} | |
.fa-gbp:before { | |
content: "\f154"; | |
} | |
.fa-dollar:before, | |
.fa-usd:before { | |
content: "\f155"; | |
} | |
.fa-rupee:before, | |
.fa-inr:before { | |
content: "\f156"; | |
} | |
.fa-cny:before, | |
.fa-rmb:before, | |
.fa-yen:before, | |
.fa-jpy:before { | |
content: "\f157"; | |
} | |
.fa-ruble:before, | |
.fa-rouble:before, | |
.fa-rub:before { | |
content: "\f158"; | |
} | |
.fa-won:before, | |
.fa-krw:before { | |
content: "\f159"; | |
} | |
.fa-bitcoin:before, | |
.fa-btc:before { | |
content: "\f15a"; | |
} | |
.fa-file:before { | |
content: "\f15b"; | |
} | |
.fa-file-text:before { | |
content: "\f15c"; | |
} | |
.fa-sort-alpha-asc:before { | |
content: "\f15d"; | |
} | |
.fa-sort-alpha-desc:before { | |
content: "\f15e"; | |
} | |
.fa-sort-amount-asc:before { | |
content: "\f160"; | |
} | |
.fa-sort-amount-desc:before { | |
content: "\f161"; | |
} | |
.fa-sort-numeric-asc:before { | |
content: "\f162"; | |
} | |
.fa-sort-numeric-desc:before { | |
content: "\f163"; | |
} | |
.fa-thumbs-up:before { | |
content: "\f164"; | |
} | |
.fa-thumbs-down:before { | |
content: "\f165"; | |
} | |
.fa-youtube-square:before { | |
content: "\f166"; | |
} | |
.fa-youtube:before { | |
content: "\f167"; | |
} | |
.fa-xing:before { | |
content: "\f168"; | |
} | |
.fa-xing-square:before { | |
content: "\f169"; | |
} | |
.fa-youtube-play:before { | |
content: "\f16a"; | |
} | |
.fa-dropbox:before { | |
content: "\f16b"; | |
} | |
.fa-stack-overflow:before { | |
content: "\f16c"; | |
} | |
.fa-instagram:before { | |
content: "\f16d"; | |
} | |
.fa-flickr:before { | |
content: "\f16e"; | |
} | |
.fa-adn:before { | |
content: "\f170"; | |
} | |
.fa-bitbucket:before { | |
content: "\f171"; | |
} | |
.fa-bitbucket-square:before { | |
content: "\f172"; | |
} | |
.fa-tumblr:before { | |
content: "\f173"; | |
} | |
.fa-tumblr-square:before { | |
content: "\f174"; | |
} | |
.fa-long-arrow-down:before { | |
content: "\f175"; | |
} | |
.fa-long-arrow-up:before { | |
content: "\f176"; | |
} | |
.fa-long-arrow-left:before { | |
content: "\f177"; | |
} | |
.fa-long-arrow-right:before { | |
content: "\f178"; | |
} | |
.fa-apple:before { | |
content: "\f179"; | |
} | |
.fa-windows:before { | |
content: "\f17a"; | |
} | |
.fa-android:before { | |
content: "\f17b"; | |
} | |
.fa-linux:before { | |
content: "\f17c"; | |
} | |
.fa-dribbble:before { | |
content: "\f17d"; | |
} | |
.fa-skype:before { | |
content: "\f17e"; | |
} | |
.fa-foursquare:before { | |
content: "\f180"; | |
} | |
.fa-trello:before { | |
content: "\f181"; | |
} | |
.fa-female:before { | |
content: "\f182"; | |
} | |
.fa-male:before { | |
content: "\f183"; | |
} | |
.fa-gittip:before, | |
.fa-gratipay:before { | |
content: "\f184"; | |
} | |
.fa-sun-o:before { | |
content: "\f185"; | |
} | |
.fa-moon-o:before { | |
content: "\f186"; | |
} | |
.fa-archive:before { | |
content: "\f187"; | |
} | |
.fa-bug:before { | |
content: "\f188"; | |
} | |
.fa-vk:before { | |
content: "\f189"; | |
} | |
.fa-weibo:before { | |
content: "\f18a"; | |
} | |
.fa-renren:before { | |
content: "\f18b"; | |
} | |
.fa-pagelines:before { | |
content: "\f18c"; | |
} | |
.fa-stack-exchange:before { | |
content: "\f18d"; | |
} | |
.fa-arrow-circle-o-right:before { | |
content: "\f18e"; | |
} | |
.fa-arrow-circle-o-left:before { | |
content: "\f190"; | |
} | |
.fa-toggle-left:before, | |
.fa-caret-square-o-left:before { | |
content: "\f191"; | |
} | |
.fa-dot-circle-o:before { | |
content: "\f192"; | |
} | |
.fa-wheelchair:before { | |
content: "\f193"; | |
} | |
.fa-vimeo-square:before { | |
content: "\f194"; | |
} | |
.fa-turkish-lira:before, | |
.fa-try:before { | |
content: "\f195"; | |
} | |
.fa-plus-square-o:before { | |
content: "\f196"; | |
} | |
.fa-space-shuttle:before { | |
content: "\f197"; | |
} | |
.fa-slack:before { | |
content: "\f198"; | |
} | |
.fa-envelope-square:before { | |
content: "\f199"; | |
} | |
.fa-wordpress:before { | |
content: "\f19a"; | |
} | |
.fa-openid:before { | |
content: "\f19b"; | |
} | |
.fa-institution:before, | |
.fa-bank:before, | |
.fa-university:before { | |
content: "\f19c"; | |
} | |
.fa-mortar-board:before, | |
.fa-graduation-cap:before { | |
content: "\f19d"; | |
} | |
.fa-yahoo:before { | |
content: "\f19e"; | |
} | |
.fa-google:before { | |
content: "\f1a0"; | |
} | |
.fa-reddit:before { | |
content: "\f1a1"; | |
} | |
.fa-reddit-square:before { | |
content: "\f1a2"; | |
} | |
.fa-stumbleupon-circle:before { | |
content: "\f1a3"; | |
} | |
.fa-stumbleupon:before { | |
content: "\f1a4"; | |
} | |
.fa-delicious:before { | |
content: "\f1a5"; | |
} | |
.fa-digg:before { | |
content: "\f1a6"; | |
} | |
.fa-pied-piper-pp:before { | |
content: "\f1a7"; | |
} | |
.fa-pied-piper-alt:before { | |
content: "\f1a8"; | |
} | |
.fa-drupal:before { | |
content: "\f1a9"; | |
} | |
.fa-joomla:before { | |
content: "\f1aa"; | |
} | |
.fa-language:before { | |
content: "\f1ab"; | |
} | |
.fa-fax:before { | |
content: "\f1ac"; | |
} | |
.fa-building:before { | |
content: "\f1ad"; | |
} | |
.fa-child:before { | |
content: "\f1ae"; | |
} | |
.fa-paw:before { | |
content: "\f1b0"; | |
} | |
.fa-spoon:before { | |
content: "\f1b1"; | |
} | |
.fa-cube:before { | |
content: "\f1b2"; | |
} | |
.fa-cubes:before { | |
content: "\f1b3"; | |
} | |
.fa-behance:before { | |
content: "\f1b4"; | |
} | |
.fa-behance-square:before { | |
content: "\f1b5"; | |
} | |
.fa-steam:before { | |
content: "\f1b6"; | |
} | |
.fa-steam-square:before { | |
content: "\f1b7"; | |
} | |
.fa-recycle:before { | |
content: "\f1b8"; | |
} | |
.fa-automobile:before, | |
.fa-car:before { | |
content: "\f1b9"; | |
} | |
.fa-cab:before, | |
.fa-taxi:before { | |
content: "\f1ba"; | |
} | |
.fa-tree:before { | |
content: "\f1bb"; | |
} | |
.fa-spotify:before { | |
content: "\f1bc"; | |
} | |
.fa-deviantart:before { | |
content: "\f1bd"; | |
} | |
.fa-soundcloud:before { | |
content: "\f1be"; | |
} | |
.fa-database:before { | |
content: "\f1c0"; | |
} | |
.fa-file-pdf-o:before { | |
content: "\f1c1"; | |
} | |
.fa-file-word-o:before { | |
content: "\f1c2"; | |
} | |
.fa-file-excel-o:before { | |
content: "\f1c3"; | |
} | |
.fa-file-powerpoint-o:before { | |
content: "\f1c4"; | |
} | |
.fa-file-photo-o:before, | |
.fa-file-picture-o:before, | |
.fa-file-image-o:before { | |
content: "\f1c5"; | |
} | |
.fa-file-zip-o:before, | |
.fa-file-archive-o:before { | |
content: "\f1c6"; | |
} | |
.fa-file-sound-o:before, | |
.fa-file-audio-o:before { | |
content: "\f1c7"; | |
} | |
.fa-file-movie-o:before, | |
.fa-file-video-o:before { | |
content: "\f1c8"; | |
} | |
.fa-file-code-o:before { | |
content: "\f1c9"; | |
} | |
.fa-vine:before { | |
content: "\f1ca"; | |
} | |
.fa-codepen:before { | |
content: "\f1cb"; | |
} | |
.fa-jsfiddle:before { | |
content: "\f1cc"; | |
} | |
.fa-life-bouy:before, | |
.fa-life-buoy:before, | |
.fa-life-saver:before, | |
.fa-support:before, | |
.fa-life-ring:before { | |
content: "\f1cd"; | |
} | |
.fa-circle-o-notch:before { | |
content: "\f1ce"; | |
} | |
.fa-ra:before, | |
.fa-resistance:before, | |
.fa-rebel:before { | |
content: "\f1d0"; | |
} | |
.fa-ge:before, | |
.fa-empire:before { | |
content: "\f1d1"; | |
} | |
.fa-git-square:before { | |
content: "\f1d2"; | |
} | |
.fa-git:before { | |
content: "\f1d3"; | |
} | |
.fa-y-combinator-square:before, | |
.fa-yc-square:before, | |
.fa-hacker-news:before { | |
content: "\f1d4"; | |
} | |
.fa-tencent-weibo:before { | |
content: "\f1d5"; | |
} | |
.fa-qq:before { | |
content: "\f1d6"; | |
} | |
.fa-wechat:before, | |
.fa-weixin:before { | |
content: "\f1d7"; | |
} | |
.fa-send:before, | |
.fa-paper-plane:before { | |
content: "\f1d8"; | |
} | |
.fa-send-o:before, | |
.fa-paper-plane-o:before { | |
content: "\f1d9"; | |
} | |
.fa-history:before { | |
content: "\f1da"; | |
} | |
.fa-circle-thin:before { | |
content: "\f1db"; | |
} | |
.fa-header:before { | |
content: "\f1dc"; | |
} | |
.fa-paragraph:before { | |
content: "\f1dd"; | |
} | |
.fa-sliders:before { | |
content: "\f1de"; | |
} | |
.fa-share-alt:before { | |
content: "\f1e0"; | |
} | |
.fa-share-alt-square:before { | |
content: "\f1e1"; | |
} | |
.fa-bomb:before { | |
content: "\f1e2"; | |
} | |
.fa-soccer-ball-o:before, | |
.fa-futbol-o:before { | |
content: "\f1e3"; | |
} | |
.fa-tty:before { | |
content: "\f1e4"; | |
} | |
.fa-binoculars:before { | |
content: "\f1e5"; | |
} | |
.fa-plug:before { | |
content: "\f1e6"; | |
} | |
.fa-slideshare:before { | |
content: "\f1e7"; | |
} | |
.fa-twitch:before { | |
content: "\f1e8"; | |
} | |
.fa-yelp:before { | |
content: "\f1e9"; | |
} | |
.fa-newspaper-o:before { | |
content: "\f1ea"; | |
} | |
.fa-wifi:before { | |
content: "\f1eb"; | |
} | |
.fa-calculator:before { | |
content: "\f1ec"; | |
} | |
.fa-paypal:before { | |
content: "\f1ed"; | |
} | |
.fa-google-wallet:before { | |
content: "\f1ee"; | |
} | |
.fa-cc-visa:before { | |
content: "\f1f0"; | |
} | |
.fa-cc-mastercard:before { | |
content: "\f1f1"; | |
} | |
.fa-cc-discover:before { | |
content: "\f1f2"; | |
} | |
.fa-cc-amex:before { | |
content: "\f1f3"; | |
} | |
.fa-cc-paypal:before { | |
content: "\f1f4"; | |
} | |
.fa-cc-stripe:before { | |
content: "\f1f5"; | |
} | |
.fa-bell-slash:before { | |
content: "\f1f6"; | |
} | |
.fa-bell-slash-o:before { | |
content: "\f1f7"; | |
} | |
.fa-trash:before { | |
content: "\f1f8"; | |
} | |
.fa-copyright:before { | |
content: "\f1f9"; | |
} | |
.fa-at:before { | |
content: "\f1fa"; | |
} | |
.fa-eyedropper:before { | |
content: "\f1fb"; | |
} | |
.fa-paint-brush:before { | |
content: "\f1fc"; | |
} | |
.fa-birthday-cake:before { | |
content: "\f1fd"; | |
} | |
.fa-area-chart:before { | |
content: "\f1fe"; | |
} | |
.fa-pie-chart:before { | |
content: "\f200"; | |
} | |
.fa-line-chart:before { | |
content: "\f201"; | |
} | |
.fa-lastfm:before { | |
content: "\f202"; | |
} | |
.fa-lastfm-square:before { | |
content: "\f203"; | |
} | |
.fa-toggle-off:before { | |
content: "\f204"; | |
} | |
.fa-toggle-on:before { | |
content: "\f205"; | |
} | |
.fa-bicycle:before { | |
content: "\f206"; | |
} | |
.fa-bus:before { | |
content: "\f207"; | |
} | |
.fa-ioxhost:before { | |
content: "\f208"; | |
} | |
.fa-angellist:before { | |
content: "\f209"; | |
} | |
.fa-cc:before { | |
content: "\f20a"; | |
} | |
.fa-shekel:before, | |
.fa-sheqel:before, | |
.fa-ils:before { | |
content: "\f20b"; | |
} | |
.fa-meanpath:before { | |
content: "\f20c"; | |
} | |
.fa-buysellads:before { | |
content: "\f20d"; | |
} | |
.fa-connectdevelop:before { | |
content: "\f20e"; | |
} | |
.fa-dashcube:before { | |
content: "\f210"; | |
} | |
.fa-forumbee:before { | |
content: "\f211"; | |
} | |
.fa-leanpub:before { | |
content: "\f212"; | |
} | |
.fa-sellsy:before { | |
content: "\f213"; | |
} | |
.fa-shirtsinbulk:before { | |
content: "\f214"; | |
} | |
.fa-simplybuilt:before { | |
content: "\f215"; | |
} | |
.fa-skyatlas:before { | |
content: "\f216"; | |
} | |
.fa-cart-plus:before { | |
content: "\f217"; | |
} | |
.fa-cart-arrow-down:before { | |
content: "\f218"; | |
} | |
.fa-diamond:before { | |
content: "\f219"; | |
} | |
.fa-ship:before { | |
content: "\f21a"; | |
} | |
.fa-user-secret:before { | |
content: "\f21b"; | |
} | |
.fa-motorcycle:before { | |
content: "\f21c"; | |
} | |
.fa-street-view:before { | |
content: "\f21d"; | |
} | |
.fa-heartbeat:before { | |
content: "\f21e"; | |
} | |
.fa-venus:before { | |
content: "\f221"; | |
} | |
.fa-mars:before { | |
content: "\f222"; | |
} | |
.fa-mercury:before { | |
content: "\f223"; | |
} | |
.fa-intersex:before, | |
.fa-transgender:before { | |
content: "\f224"; | |
} | |
.fa-transgender-alt:before { | |
content: "\f225"; | |
} | |
.fa-venus-double:before { | |
content: "\f226"; | |
} | |
.fa-mars-double:before { | |
content: "\f227"; | |
} | |
.fa-venus-mars:before { | |
content: "\f228"; | |
} | |
.fa-mars-stroke:before { | |
content: "\f229"; | |
} | |
.fa-mars-stroke-v:before { | |
content: "\f22a"; | |
} | |
.fa-mars-stroke-h:before { | |
content: "\f22b"; | |
} | |
.fa-neuter:before { | |
content: "\f22c"; | |
} | |
.fa-genderless:before { | |
content: "\f22d"; | |
} | |
.fa-facebook-official:before { | |
content: "\f230"; | |
} | |
.fa-pinterest-p:before { | |
content: "\f231"; | |
} | |
.fa-whatsapp:before { | |
content: "\f232"; | |
} | |
.fa-server:before { | |
content: "\f233"; | |
} | |
.fa-user-plus:before { | |
content: "\f234"; | |
} | |
.fa-user-times:before { | |
content: "\f235"; | |
} | |
.fa-hotel:before, | |
.fa-bed:before { | |
content: "\f236"; | |
} | |
.fa-viacoin:before { | |
content: "\f237"; | |
} | |
.fa-train:before { | |
content: "\f238"; | |
} | |
.fa-subway:before { | |
content: "\f239"; | |
} | |
.fa-medium:before { | |
content: "\f23a"; | |
} | |
.fa-yc:before, | |
.fa-y-combinator:before { | |
content: "\f23b"; | |
} | |
.fa-optin-monster:before { | |
content: "\f23c"; | |
} | |
.fa-opencart:before { | |
content: "\f23d"; | |
} | |
.fa-expeditedssl:before { | |
content: "\f23e"; | |
} | |
.fa-battery-4:before, | |
.fa-battery:before, | |
.fa-battery-full:before { | |
content: "\f240"; | |
} | |
.fa-battery-3:before, | |
.fa-battery-three-quarters:before { | |
content: "\f241"; | |
} | |
.fa-battery-2:before, | |
.fa-battery-half:before { | |
content: "\f242"; | |
} | |
.fa-battery-1:before, | |
.fa-battery-quarter:before { | |
content: "\f243"; | |
} | |
.fa-battery-0:before, | |
.fa-battery-empty:before { | |
content: "\f244"; | |
} | |
.fa-mouse-pointer:before { | |
content: "\f245"; | |
} | |
.fa-i-cursor:before { | |
content: "\f246"; | |
} | |
.fa-object-group:before { | |
content: "\f247"; | |
} | |
.fa-object-ungroup:before { | |
content: "\f248"; | |
} | |
.fa-sticky-note:before { | |
content: "\f249"; | |
} | |
.fa-sticky-note-o:before { | |
content: "\f24a"; | |
} | |
.fa-cc-jcb:before { | |
content: "\f24b"; | |
} | |
.fa-cc-diners-club:before { | |
content: "\f24c"; | |
} | |
.fa-clone:before { | |
content: "\f24d"; | |
} | |
.fa-balance-scale:before { | |
content: "\f24e"; | |
} | |
.fa-hourglass-o:before { | |
content: "\f250"; | |
} | |
.fa-hourglass-1:before, | |
.fa-hourglass-start:before { | |
content: "\f251"; | |
} | |
.fa-hourglass-2:before, | |
.fa-hourglass-half:before { | |
content: "\f252"; | |
} | |
.fa-hourglass-3:before, | |
.fa-hourglass-end:before { | |
content: "\f253"; | |
} | |
.fa-hourglass:before { | |
content: "\f254"; | |
} | |
.fa-hand-grab-o:before, | |
.fa-hand-rock-o:before { | |
content: "\f255"; | |
} | |
.fa-hand-stop-o:before, | |
.fa-hand-paper-o:before { | |
content: "\f256"; | |
} | |
.fa-hand-scissors-o:before { | |
content: "\f257"; | |
} | |
.fa-hand-lizard-o:before { | |
content: "\f258"; | |
} | |
.fa-hand-spock-o:before { | |
content: "\f259"; | |
} | |
.fa-hand-pointer-o:before { | |
content: "\f25a"; | |
} | |
.fa-hand-peace-o:before { | |
content: "\f25b"; | |
} | |
.fa-trademark:before { | |
content: "\f25c"; | |
} | |
.fa-registered:before { | |
content: "\f25d"; | |
} | |
.fa-creative-commons:before { | |
content: "\f25e"; | |
} | |
.fa-gg:before { | |
content: "\f260"; | |
} | |
.fa-gg-circle:before { | |
content: "\f261"; | |
} | |
.fa-tripadvisor:before { | |
content: "\f262"; | |
} | |
.fa-odnoklassniki:before { | |
content: "\f263"; | |
} | |
.fa-odnoklassniki-square:before { | |
content: "\f264"; | |
} | |
.fa-get-pocket:before { | |
content: "\f265"; | |
} | |
.fa-wikipedia-w:before { | |
content: "\f266"; | |
} | |
.fa-safari:before { | |
content: "\f267"; | |
} | |
.fa-chrome:before { | |
content: "\f268"; | |
} | |
.fa-firefox:before { | |
content: "\f269"; | |
} | |
.fa-opera:before { | |
content: "\f26a"; | |
} | |
.fa-internet-explorer:before { | |
content: "\f26b"; | |
} | |
.fa-tv:before, | |
.fa-television:before { | |
content: "\f26c"; | |
} | |
.fa-contao:before { | |
content: "\f26d"; | |
} | |
.fa-500px:before { | |
content: "\f26e"; | |
} | |
.fa-amazon:before { | |
content: "\f270"; | |
} | |
.fa-calendar-plus-o:before { | |
content: "\f271"; | |
} | |
.fa-calendar-minus-o:before { | |
content: "\f272"; | |
} | |
.fa-calendar-times-o:before { | |
content: "\f273"; | |
} | |
.fa-calendar-check-o:before { | |
content: "\f274"; | |
} | |
.fa-industry:before { | |
content: "\f275"; | |
} | |
.fa-map-pin:before { | |
content: "\f276"; | |
} | |
.fa-map-signs:before { | |
content: "\f277"; | |
} | |
.fa-map-o:before { | |
content: "\f278"; | |
} | |
.fa-map:before { | |
content: "\f279"; | |
} | |
.fa-commenting:before { | |
content: "\f27a"; | |
} | |
.fa-commenting-o:before { | |
content: "\f27b"; | |
} | |
.fa-houzz:before { | |
content: "\f27c"; | |
} | |
.fa-vimeo:before { | |
content: "\f27d"; | |
} | |
.fa-black-tie:before { | |
content: "\f27e"; | |
} | |
.fa-fonticons:before { | |
content: "\f280"; | |
} | |
.fa-reddit-alien:before { | |
content: "\f281"; | |
} | |
.fa-edge:before { | |
content: "\f282"; | |
} | |
.fa-credit-card-alt:before { | |
content: "\f283"; | |
} | |
.fa-codiepie:before { | |
content: "\f284"; | |
} | |
.fa-modx:before { | |
content: "\f285"; | |
} | |
.fa-fort-awesome:before { | |
content: "\f286"; | |
} | |
.fa-usb:before { | |
content: "\f287"; | |
} | |
.fa-product-hunt:before { | |
content: "\f288"; | |
} | |
.fa-mixcloud:before { | |
content: "\f289"; | |
} | |
.fa-scribd:before { | |
content: "\f28a"; | |
} | |
.fa-pause-circle:before { | |
content: "\f28b"; | |
} | |
.fa-pause-circle-o:before { | |
content: "\f28c"; | |
} | |
.fa-stop-circle:before { | |
content: "\f28d"; | |
} | |
.fa-stop-circle-o:before { | |
content: "\f28e"; | |
} | |
.fa-shopping-bag:before { | |
content: "\f290"; | |
} | |
.fa-shopping-basket:before { | |
content: "\f291"; | |
} | |
.fa-hashtag:before { | |
content: "\f292"; | |
} | |
.fa-bluetooth:before { | |
content: "\f293"; | |
} | |
.fa-bluetooth-b:before { | |
content: "\f294"; | |
} | |
.fa-percent:before { | |
content: "\f295"; | |
} | |
.fa-gitlab:before { | |
content: "\f296"; | |
} | |
.fa-wpbeginner:before { | |
content: "\f297"; | |
} | |
.fa-wpforms:before { | |
content: "\f298"; | |
} | |
.fa-envira:before { | |
content: "\f299"; | |
} | |
.fa-universal-access:before { | |
content: "\f29a"; | |
} | |
.fa-wheelchair-alt:before { | |
content: "\f29b"; | |
} | |
.fa-question-circle-o:before { | |
content: "\f29c"; | |
} | |
.fa-blind:before { | |
content: "\f29d"; | |
} | |
.fa-audio-description:before { | |
content: "\f29e"; | |
} | |
.fa-volume-control-phone:before { | |
content: "\f2a0"; | |
} | |
.fa-braille:before { | |
content: "\f2a1"; | |
} | |
.fa-assistive-listening-systems:before { | |
content: "\f2a2"; | |
} | |
.fa-asl-interpreting:before, | |
.fa-american-sign-language-interpreting:before { | |
content: "\f2a3"; | |
} | |
.fa-deafness:before, | |
.fa-hard-of-hearing:before, | |
.fa-deaf:before { | |
content: "\f2a4"; | |
} | |
.fa-glide:before { | |
content: "\f2a5"; | |
} | |
.fa-glide-g:before { | |
content: "\f2a6"; | |
} | |
.fa-signing:before, | |
.fa-sign-language:before { | |
content: "\f2a7"; | |
} | |
.fa-low-vision:before { | |
content: "\f2a8"; | |
} | |
.fa-viadeo:before { | |
content: "\f2a9"; | |
} | |
.fa-viadeo-square:before { | |
content: "\f2aa"; | |
} | |
.fa-snapchat:before { | |
content: "\f2ab"; | |
} | |
.fa-snapchat-ghost:before { | |
content: "\f2ac"; | |
} | |
.fa-snapchat-square:before { | |
content: "\f2ad"; | |
} | |
.fa-pied-piper:before { | |
content: "\f2ae"; | |
} | |
.fa-first-order:before { | |
content: "\f2b0"; | |
} | |
.fa-yoast:before { | |
content: "\f2b1"; | |
} | |
.fa-themeisle:before { | |
content: "\f2b2"; | |
} | |
.fa-google-plus-circle:before, | |
.fa-google-plus-official:before { | |
content: "\f2b3"; | |
} | |
.fa-fa:before, | |
.fa-font-awesome:before { | |
content: "\f2b4"; | |
} | |
.fa-handshake-o:before { | |
content: "\f2b5"; | |
} | |
.fa-envelope-open:before { | |
content: "\f2b6"; | |
} | |
.fa-envelope-open-o:before { | |
content: "\f2b7"; | |
} | |
.fa-linode:before { | |
content: "\f2b8"; | |
} | |
.fa-address-book:before { | |
content: "\f2b9"; | |
} | |
.fa-address-book-o:before { | |
content: "\f2ba"; | |
} | |
.fa-vcard:before, | |
.fa-address-card:before { | |
content: "\f2bb"; | |
} | |
.fa-vcard-o:before, | |
.fa-address-card-o:before { | |
content: "\f2bc"; | |
} | |
.fa-user-circle:before { | |
content: "\f2bd"; | |
} | |
.fa-user-circle-o:before { | |
content: "\f2be"; | |
} | |
.fa-user-o:before { | |
content: "\f2c0"; | |
} | |
.fa-id-badge:before { | |
content: "\f2c1"; | |
} | |
.fa-drivers-license:before, | |
.fa-id-card:before { | |
content: "\f2c2"; | |
} | |
.fa-drivers-license-o:before, | |
.fa-id-card-o:before { | |
content: "\f2c3"; | |
} | |
.fa-quora:before { | |
content: "\f2c4"; | |
} | |
.fa-free-code-camp:before { | |
content: "\f2c5"; | |
} | |
.fa-telegram:before { | |
content: "\f2c6"; | |
} | |
.fa-thermometer-4:before, | |
.fa-thermometer:before, | |
.fa-thermometer-full:before { | |
content: "\f2c7"; | |
} | |
.fa-thermometer-3:before, | |
.fa-thermometer-three-quarters:before { | |
content: "\f2c8"; | |
} | |
.fa-thermometer-2:before, | |
.fa-thermometer-half:before { | |
content: "\f2c9"; | |
} | |
.fa-thermometer-1:before, | |
.fa-thermometer-quarter:before { | |
content: "\f2ca"; | |
} | |
.fa-thermometer-0:before, | |
.fa-thermometer-empty:before { | |
content: "\f2cb"; | |
} | |
.fa-shower:before { | |
content: "\f2cc"; | |
} | |
.fa-bathtub:before, | |
.fa-s15:before, | |
.fa-bath:before { | |
content: "\f2cd"; | |
} | |
.fa-podcast:before { | |
content: "\f2ce"; | |
} | |
.fa-window-maximize:before { | |
content: "\f2d0"; | |
} | |
.fa-window-minimize:before { | |
content: "\f2d1"; | |
} | |
.fa-window-restore:before { | |
content: "\f2d2"; | |
} | |
.fa-times-rectangle:before, | |
.fa-window-close:before { | |
content: "\f2d3"; | |
} | |
.fa-times-rectangle-o:before, | |
.fa-window-close-o:before { | |
content: "\f2d4"; | |
} | |
.fa-bandcamp:before { | |
content: "\f2d5"; | |
} | |
.fa-grav:before { | |
content: "\f2d6"; | |
} | |
.fa-etsy:before { | |
content: "\f2d7"; | |
} | |
.fa-imdb:before { | |
content: "\f2d8"; | |
} | |
.fa-ravelry:before { | |
content: "\f2d9"; | |
} | |
.fa-eercast:before { | |
content: "\f2da"; | |
} | |
.fa-microchip:before { | |
content: "\f2db"; | |
} | |
.fa-snowflake-o:before { | |
content: "\f2dc"; | |
} | |
.fa-superpowers:before { | |
content: "\f2dd"; | |
} | |
.fa-wpexplorer:before { | |
content: "\f2de"; | |
} | |
.fa-meetup:before { | |
content: "\f2e0"; | |
} | |
.sr-only { | |
position: absolute; | |
width: 1px; | |
height: 1px; | |
padding: 0; | |
margin: -1px; | |
overflow: hidden; | |
clip: rect(0, 0, 0, 0); | |
border: 0; | |
} | |
.sr-only-focusable:active, | |
.sr-only-focusable:focus { | |
position: static; | |
width: auto; | |
height: auto; | |
margin: 0; | |
overflow: visible; | |
clip: auto; | |
} | |
.sr-only-focusable:active, | |
.sr-only-focusable:focus { | |
position: static; | |
width: auto; | |
height: auto; | |
margin: 0; | |
overflow: visible; | |
clip: auto; | |
} | |
/*! | |
* | |
* IPython base | |
* | |
*/ | |
.modal.fade .modal-dialog { | |
-webkit-transform: translate(0, 0); | |
-ms-transform: translate(0, 0); | |
-o-transform: translate(0, 0); | |
transform: translate(0, 0); | |
} | |
code { | |
color: #000; | |
} | |
pre { | |
font-size: inherit; | |
line-height: inherit; | |
} | |
label { | |
font-weight: normal; | |
} | |
/* Make the page background atleast 100% the height of the view port */ | |
/* Make the page itself atleast 70% the height of the view port */ | |
.border-box-sizing { | |
box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
-webkit-box-sizing: border-box; | |
} | |
.corner-all { | |
border-radius: 2px; | |
} | |
.no-padding { | |
padding: 0px; | |
} | |
/* Flexible box model classes */ | |
/* Taken from Alex Russell http://infrequently.org/2009/08/css-3-progress/ */ | |
/* This file is a compatability layer. It allows the usage of flexible box | |
model layouts accross multiple browsers, including older browsers. The newest, | |
universal implementation of the flexible box model is used when available (see | |
`Modern browsers` comments below). Browsers that are known to implement this | |
new spec completely include: | |
Firefox 28.0+ | |
Chrome 29.0+ | |
Internet Explorer 11+ | |
Opera 17.0+ | |
Browsers not listed, including Safari, are supported via the styling under the | |
`Old browsers` comments below. | |
*/ | |
.hbox { | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: horizontal; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: horizontal; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: horizontal; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: row; | |
align-items: stretch; | |
} | |
.hbox > * { | |
/* Old browsers */ | |
-webkit-box-flex: 0; | |
-moz-box-flex: 0; | |
box-flex: 0; | |
/* Modern browsers */ | |
flex: none; | |
} | |
.vbox { | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: vertical; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: vertical; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: vertical; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: column; | |
align-items: stretch; | |
} | |
.vbox > * { | |
/* Old browsers */ | |
-webkit-box-flex: 0; | |
-moz-box-flex: 0; | |
box-flex: 0; | |
/* Modern browsers */ | |
flex: none; | |
} | |
.hbox.reverse, | |
.vbox.reverse, | |
.reverse { | |
/* Old browsers */ | |
-webkit-box-direction: reverse; | |
-moz-box-direction: reverse; | |
box-direction: reverse; | |
/* Modern browsers */ | |
flex-direction: row-reverse; | |
} | |
.hbox.box-flex0, | |
.vbox.box-flex0, | |
.box-flex0 { | |
/* Old browsers */ | |
-webkit-box-flex: 0; | |
-moz-box-flex: 0; | |
box-flex: 0; | |
/* Modern browsers */ | |
flex: none; | |
width: auto; | |
} | |
.hbox.box-flex1, | |
.vbox.box-flex1, | |
.box-flex1 { | |
/* Old browsers */ | |
-webkit-box-flex: 1; | |
-moz-box-flex: 1; | |
box-flex: 1; | |
/* Modern browsers */ | |
flex: 1; | |
} | |
.hbox.box-flex, | |
.vbox.box-flex, | |
.box-flex { | |
/* Old browsers */ | |
/* Old browsers */ | |
-webkit-box-flex: 1; | |
-moz-box-flex: 1; | |
box-flex: 1; | |
/* Modern browsers */ | |
flex: 1; | |
} | |
.hbox.box-flex2, | |
.vbox.box-flex2, | |
.box-flex2 { | |
/* Old browsers */ | |
-webkit-box-flex: 2; | |
-moz-box-flex: 2; | |
box-flex: 2; | |
/* Modern browsers */ | |
flex: 2; | |
} | |
.box-group1 { | |
/* Deprecated */ | |
-webkit-box-flex-group: 1; | |
-moz-box-flex-group: 1; | |
box-flex-group: 1; | |
} | |
.box-group2 { | |
/* Deprecated */ | |
-webkit-box-flex-group: 2; | |
-moz-box-flex-group: 2; | |
box-flex-group: 2; | |
} | |
.hbox.start, | |
.vbox.start, | |
.start { | |
/* Old browsers */ | |
-webkit-box-pack: start; | |
-moz-box-pack: start; | |
box-pack: start; | |
/* Modern browsers */ | |
justify-content: flex-start; | |
} | |
.hbox.end, | |
.vbox.end, | |
.end { | |
/* Old browsers */ | |
-webkit-box-pack: end; | |
-moz-box-pack: end; | |
box-pack: end; | |
/* Modern browsers */ | |
justify-content: flex-end; | |
} | |
.hbox.center, | |
.vbox.center, | |
.center { | |
/* Old browsers */ | |
-webkit-box-pack: center; | |
-moz-box-pack: center; | |
box-pack: center; | |
/* Modern browsers */ | |
justify-content: center; | |
} | |
.hbox.baseline, | |
.vbox.baseline, | |
.baseline { | |
/* Old browsers */ | |
-webkit-box-pack: baseline; | |
-moz-box-pack: baseline; | |
box-pack: baseline; | |
/* Modern browsers */ | |
justify-content: baseline; | |
} | |
.hbox.stretch, | |
.vbox.stretch, | |
.stretch { | |
/* Old browsers */ | |
-webkit-box-pack: stretch; | |
-moz-box-pack: stretch; | |
box-pack: stretch; | |
/* Modern browsers */ | |
justify-content: stretch; | |
} | |
.hbox.align-start, | |
.vbox.align-start, | |
.align-start { | |
/* Old browsers */ | |
-webkit-box-align: start; | |
-moz-box-align: start; | |
box-align: start; | |
/* Modern browsers */ | |
align-items: flex-start; | |
} | |
.hbox.align-end, | |
.vbox.align-end, | |
.align-end { | |
/* Old browsers */ | |
-webkit-box-align: end; | |
-moz-box-align: end; | |
box-align: end; | |
/* Modern browsers */ | |
align-items: flex-end; | |
} | |
.hbox.align-center, | |
.vbox.align-center, | |
.align-center { | |
/* Old browsers */ | |
-webkit-box-align: center; | |
-moz-box-align: center; | |
box-align: center; | |
/* Modern browsers */ | |
align-items: center; | |
} | |
.hbox.align-baseline, | |
.vbox.align-baseline, | |
.align-baseline { | |
/* Old browsers */ | |
-webkit-box-align: baseline; | |
-moz-box-align: baseline; | |
box-align: baseline; | |
/* Modern browsers */ | |
align-items: baseline; | |
} | |
.hbox.align-stretch, | |
.vbox.align-stretch, | |
.align-stretch { | |
/* Old browsers */ | |
-webkit-box-align: stretch; | |
-moz-box-align: stretch; | |
box-align: stretch; | |
/* Modern browsers */ | |
align-items: stretch; | |
} | |
div.error { | |
margin: 2em; | |
text-align: center; | |
} | |
div.error > h1 { | |
font-size: 500%; | |
line-height: normal; | |
} | |
div.error > p { | |
font-size: 200%; | |
line-height: normal; | |
} | |
div.traceback-wrapper { | |
text-align: left; | |
max-width: 800px; | |
margin: auto; | |
} | |
div.traceback-wrapper pre.traceback { | |
max-height: 600px; | |
overflow: auto; | |
} | |
/** | |
* Primary styles | |
* | |
* Author: Jupyter Development Team | |
*/ | |
body { | |
background-color: #fff; | |
/* This makes sure that the body covers the entire window and needs to | |
be in a different element than the display: box in wrapper below */ | |
position: absolute; | |
left: 0px; | |
right: 0px; | |
top: 0px; | |
bottom: 0px; | |
overflow: visible; | |
} | |
body > #header { | |
/* Initially hidden to prevent FLOUC */ | |
display: none; | |
background-color: #fff; | |
/* Display over codemirror */ | |
position: relative; | |
z-index: 100; | |
} | |
body > #header #header-container { | |
display: flex; | |
flex-direction: row; | |
justify-content: space-between; | |
padding: 5px; | |
padding-bottom: 5px; | |
padding-top: 5px; | |
box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
-webkit-box-sizing: border-box; | |
} | |
body > #header .header-bar { | |
width: 100%; | |
height: 1px; | |
background: #e7e7e7; | |
margin-bottom: -1px; | |
} | |
@media print { | |
body > #header { | |
display: none !important; | |
} | |
} | |
#header-spacer { | |
width: 100%; | |
visibility: hidden; | |
} | |
@media print { | |
#header-spacer { | |
display: none; | |
} | |
} | |
#ipython_notebook { | |
padding-left: 0px; | |
padding-top: 1px; | |
padding-bottom: 1px; | |
} | |
[dir="rtl"] #ipython_notebook { | |
margin-right: 10px; | |
margin-left: 0; | |
} | |
[dir="rtl"] #ipython_notebook.pull-left { | |
float: right !important; | |
float: right; | |
} | |
.flex-spacer { | |
flex: 1; | |
} | |
#noscript { | |
width: auto; | |
padding-top: 16px; | |
padding-bottom: 16px; | |
text-align: center; | |
font-size: 22px; | |
color: red; | |
font-weight: bold; | |
} | |
#ipython_notebook img { | |
height: 28px; | |
} | |
#site { | |
width: 100%; | |
display: none; | |
box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
-webkit-box-sizing: border-box; | |
overflow: auto; | |
} | |
@media print { | |
#site { | |
height: auto !important; | |
} | |
} | |
/* Smaller buttons */ | |
.ui-button .ui-button-text { | |
padding: 0.2em 0.8em; | |
font-size: 77%; | |
} | |
input.ui-button { | |
padding: 0.3em 0.9em; | |
} | |
span#kernel_logo_widget { | |
margin: 0 10px; | |
} | |
span#login_widget { | |
float: right; | |
} | |
[dir="rtl"] span#login_widget { | |
float: left; | |
} | |
span#login_widget > .button, | |
#logout { | |
color: #333; | |
background-color: #fff; | |
border-color: #ccc; | |
} | |
span#login_widget > .button:focus, | |
#logout:focus, | |
span#login_widget > .button.focus, | |
#logout.focus { | |
color: #333; | |
background-color: #e6e6e6; | |
border-color: #8c8c8c; | |
} | |
span#login_widget > .button:hover, | |
#logout:hover { | |
color: #333; | |
background-color: #e6e6e6; | |
border-color: #adadad; | |
} | |
span#login_widget > .button:active, | |
#logout:active, | |
span#login_widget > .button.active, | |
#logout.active, | |
.open > .dropdown-togglespan#login_widget > .button, | |
.open > .dropdown-toggle#logout { | |
color: #333; | |
background-color: #e6e6e6; | |
border-color: #adadad; | |
} | |
span#login_widget > .button:active:hover, | |
#logout:active:hover, | |
span#login_widget > .button.active:hover, | |
#logout.active:hover, | |
.open > .dropdown-togglespan#login_widget > .button:hover, | |
.open > .dropdown-toggle#logout:hover, | |
span#login_widget > .button:active:focus, | |
#logout:active:focus, | |
span#login_widget > .button.active:focus, | |
#logout.active:focus, | |
.open > .dropdown-togglespan#login_widget > .button:focus, | |
.open > .dropdown-toggle#logout:focus, | |
span#login_widget > .button:active.focus, | |
#logout:active.focus, | |
span#login_widget > .button.active.focus, | |
#logout.active.focus, | |
.open > .dropdown-togglespan#login_widget > .button.focus, | |
.open > .dropdown-toggle#logout.focus { | |
color: #333; | |
background-color: #d4d4d4; | |
border-color: #8c8c8c; | |
} | |
span#login_widget > .button:active, | |
#logout:active, | |
span#login_widget > .button.active, | |
#logout.active, | |
.open > .dropdown-togglespan#login_widget > .button, | |
.open > .dropdown-toggle#logout { | |
background-image: none; | |
} | |
span#login_widget > .button.disabled:hover, | |
#logout.disabled:hover, | |
span#login_widget > .button[disabled]:hover, | |
#logout[disabled]:hover, | |
fieldset[disabled] span#login_widget > .button:hover, | |
fieldset[disabled] #logout:hover, | |
span#login_widget > .button.disabled:focus, | |
#logout.disabled:focus, | |
span#login_widget > .button[disabled]:focus, | |
#logout[disabled]:focus, | |
fieldset[disabled] span#login_widget > .button:focus, | |
fieldset[disabled] #logout:focus, | |
span#login_widget > .button.disabled.focus, | |
#logout.disabled.focus, | |
span#login_widget > .button[disabled].focus, | |
#logout[disabled].focus, | |
fieldset[disabled] span#login_widget > .button.focus, | |
fieldset[disabled] #logout.focus { | |
background-color: #fff; | |
border-color: #ccc; | |
} | |
span#login_widget > .button .badge, | |
#logout .badge { | |
color: #fff; | |
background-color: #333; | |
} | |
.nav-header { | |
text-transform: none; | |
} | |
#header > span { | |
margin-top: 10px; | |
} | |
.modal_stretch .modal-dialog { | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: vertical; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: vertical; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: vertical; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: column; | |
align-items: stretch; | |
min-height: 80vh; | |
} | |
.modal_stretch .modal-dialog .modal-body { | |
max-height: calc(100vh - 200px); | |
overflow: auto; | |
flex: 1; | |
} | |
.modal-header { | |
cursor: move; | |
} | |
@media (min-width: 768px) { | |
.modal .modal-dialog { | |
width: 700px; | |
} | |
} | |
@media (min-width: 768px) { | |
select.form-control { | |
margin-left: 12px; | |
margin-right: 12px; | |
} | |
} | |
/*! | |
* | |
* IPython auth | |
* | |
*/ | |
.center-nav { | |
display: inline-block; | |
margin-bottom: -4px; | |
} | |
[dir="rtl"] .center-nav form.pull-left { | |
float: right !important; | |
float: right; | |
} | |
[dir="rtl"] .center-nav .navbar-text { | |
float: right; | |
} | |
[dir="rtl"] .navbar-inner { | |
text-align: right; | |
} | |
[dir="rtl"] div.text-left { | |
text-align: right; | |
} | |
/*! | |
* | |
* IPython tree view | |
* | |
*/ | |
/* We need an invisible input field on top of the sentense*/ | |
/* "Drag file onto the list ..." */ | |
.alternate_upload { | |
background-color: none; | |
display: inline; | |
} | |
.alternate_upload.form { | |
padding: 0; | |
margin: 0; | |
} | |
.alternate_upload input.fileinput { | |
position: absolute; | |
display: block; | |
width: 100%; | |
height: 100%; | |
overflow: hidden; | |
cursor: pointer; | |
opacity: 0; | |
z-index: 2; | |
} | |
.alternate_upload .btn-xs > input.fileinput { | |
margin: -1px -5px; | |
} | |
.alternate_upload .btn-upload { | |
position: relative; | |
height: 22px; | |
} | |
::-webkit-file-upload-button { | |
cursor: pointer; | |
} | |
/** | |
* Primary styles | |
* | |
* Author: Jupyter Development Team | |
*/ | |
ul#tabs { | |
margin-bottom: 4px; | |
} | |
ul#tabs a { | |
padding-top: 6px; | |
padding-bottom: 4px; | |
} | |
[dir="rtl"] ul#tabs.nav-tabs > li { | |
float: right; | |
} | |
[dir="rtl"] ul#tabs.nav.nav-tabs { | |
padding-right: 0; | |
} | |
ul.breadcrumb a:focus, | |
ul.breadcrumb a:hover { | |
text-decoration: none; | |
} | |
ul.breadcrumb i.icon-home { | |
font-size: 16px; | |
margin-right: 4px; | |
} | |
ul.breadcrumb span { | |
color: #5e5e5e; | |
} | |
.list_toolbar { | |
padding: 4px 0 4px 0; | |
vertical-align: middle; | |
} | |
.list_toolbar .tree-buttons { | |
padding-top: 1px; | |
} | |
[dir="rtl"] .list_toolbar .tree-buttons .pull-right { | |
float: left !important; | |
float: left; | |
} | |
[dir="rtl"] .list_toolbar .col-sm-4, | |
[dir="rtl"] .list_toolbar .col-sm-8 { | |
float: right; | |
} | |
.dynamic-buttons { | |
padding-top: 3px; | |
display: inline-block; | |
} | |
.list_toolbar [class*="span"] { | |
min-height: 24px; | |
} | |
.list_header { | |
font-weight: bold; | |
background-color: #EEE; | |
} | |
.list_placeholder { | |
font-weight: bold; | |
padding-top: 4px; | |
padding-bottom: 4px; | |
padding-left: 7px; | |
padding-right: 7px; | |
} | |
.list_container { | |
margin-top: 4px; | |
margin-bottom: 20px; | |
border: 1px solid #ddd; | |
border-radius: 2px; | |
} | |
.list_container > div { | |
border-bottom: 1px solid #ddd; | |
} | |
.list_container > div:hover .list-item { | |
background-color: red; | |
} | |
.list_container > div:last-child { | |
border: none; | |
} | |
.list_item:hover .list_item { | |
background-color: #ddd; | |
} | |
.list_item a { | |
text-decoration: none; | |
} | |
.list_item:hover { | |
background-color: #fafafa; | |
} | |
.list_header > div, | |
.list_item > div { | |
padding-top: 4px; | |
padding-bottom: 4px; | |
padding-left: 7px; | |
padding-right: 7px; | |
line-height: 22px; | |
} | |
.list_header > div input, | |
.list_item > div input { | |
margin-right: 7px; | |
margin-left: 14px; | |
vertical-align: text-bottom; | |
line-height: 22px; | |
position: relative; | |
top: -1px; | |
} | |
.list_header > div .item_link, | |
.list_item > div .item_link { | |
margin-left: -1px; | |
vertical-align: baseline; | |
line-height: 22px; | |
} | |
[dir="rtl"] .list_item > div input { | |
margin-right: 0; | |
} | |
.new-file input[type=checkbox] { | |
visibility: hidden; | |
} | |
.item_name { | |
line-height: 22px; | |
height: 24px; | |
} | |
.item_icon { | |
font-size: 14px; | |
color: #5e5e5e; | |
margin-right: 7px; | |
margin-left: 7px; | |
line-height: 22px; | |
vertical-align: baseline; | |
} | |
.item_modified { | |
margin-right: 7px; | |
margin-left: 7px; | |
} | |
[dir="rtl"] .item_modified.pull-right { | |
float: left !important; | |
float: left; | |
} | |
.item_buttons { | |
line-height: 1em; | |
margin-left: -5px; | |
} | |
.item_buttons .btn, | |
.item_buttons .btn-group, | |
.item_buttons .input-group { | |
float: left; | |
} | |
.item_buttons > .btn, | |
.item_buttons > .btn-group, | |
.item_buttons > .input-group { | |
margin-left: 5px; | |
} | |
.item_buttons .btn { | |
min-width: 13ex; | |
} | |
.item_buttons .running-indicator { | |
padding-top: 4px; | |
color: #5cb85c; | |
} | |
.item_buttons .kernel-name { | |
padding-top: 4px; | |
color: #5bc0de; | |
margin-right: 7px; | |
float: left; | |
} | |
[dir="rtl"] .item_buttons.pull-right { | |
float: left !important; | |
float: left; | |
} | |
[dir="rtl"] .item_buttons .kernel-name { | |
margin-left: 7px; | |
float: right; | |
} | |
.toolbar_info { | |
height: 24px; | |
line-height: 24px; | |
} | |
.list_item input:not([type=checkbox]) { | |
padding-top: 3px; | |
padding-bottom: 3px; | |
height: 22px; | |
line-height: 14px; | |
margin: 0px; | |
} | |
.highlight_text { | |
color: blue; | |
} | |
#project_name { | |
display: inline-block; | |
padding-left: 7px; | |
margin-left: -2px; | |
} | |
#project_name > .breadcrumb { | |
padding: 0px; | |
margin-bottom: 0px; | |
background-color: transparent; | |
font-weight: bold; | |
} | |
.sort_button { | |
display: inline-block; | |
padding-left: 7px; | |
} | |
[dir="rtl"] .sort_button.pull-right { | |
float: left !important; | |
float: left; | |
} | |
#tree-selector { | |
padding-right: 0px; | |
} | |
#button-select-all { | |
min-width: 50px; | |
} | |
[dir="rtl"] #button-select-all.btn { | |
float: right ; | |
} | |
#select-all { | |
margin-left: 7px; | |
margin-right: 2px; | |
margin-top: 2px; | |
height: 16px; | |
} | |
[dir="rtl"] #select-all.pull-left { | |
float: right !important; | |
float: right; | |
} | |
.menu_icon { | |
margin-right: 2px; | |
} | |
.tab-content .row { | |
margin-left: 0px; | |
margin-right: 0px; | |
} | |
.folder_icon:before { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
content: "\f114"; | |
} | |
.folder_icon:before.fa-pull-left { | |
margin-right: .3em; | |
} | |
.folder_icon:before.fa-pull-right { | |
margin-left: .3em; | |
} | |
.folder_icon:before.pull-left { | |
margin-right: .3em; | |
} | |
.folder_icon:before.pull-right { | |
margin-left: .3em; | |
} | |
.notebook_icon:before { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
content: "\f02d"; | |
position: relative; | |
top: -1px; | |
} | |
.notebook_icon:before.fa-pull-left { | |
margin-right: .3em; | |
} | |
.notebook_icon:before.fa-pull-right { | |
margin-left: .3em; | |
} | |
.notebook_icon:before.pull-left { | |
margin-right: .3em; | |
} | |
.notebook_icon:before.pull-right { | |
margin-left: .3em; | |
} | |
.running_notebook_icon:before { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
content: "\f02d"; | |
position: relative; | |
top: -1px; | |
color: #5cb85c; | |
} | |
.running_notebook_icon:before.fa-pull-left { | |
margin-right: .3em; | |
} | |
.running_notebook_icon:before.fa-pull-right { | |
margin-left: .3em; | |
} | |
.running_notebook_icon:before.pull-left { | |
margin-right: .3em; | |
} | |
.running_notebook_icon:before.pull-right { | |
margin-left: .3em; | |
} | |
.file_icon:before { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
content: "\f016"; | |
position: relative; | |
top: -2px; | |
} | |
.file_icon:before.fa-pull-left { | |
margin-right: .3em; | |
} | |
.file_icon:before.fa-pull-right { | |
margin-left: .3em; | |
} | |
.file_icon:before.pull-left { | |
margin-right: .3em; | |
} | |
.file_icon:before.pull-right { | |
margin-left: .3em; | |
} | |
#notebook_toolbar .pull-right { | |
padding-top: 0px; | |
margin-right: -1px; | |
} | |
ul#new-menu { | |
left: auto; | |
right: 0; | |
} | |
#new-menu .dropdown-header { | |
font-size: 10px; | |
border-bottom: 1px solid #e5e5e5; | |
padding: 0 0 3px; | |
margin: -3px 20px 0; | |
} | |
.kernel-menu-icon { | |
padding-right: 12px; | |
width: 24px; | |
content: "\f096"; | |
} | |
.kernel-menu-icon:before { | |
content: "\f096"; | |
} | |
.kernel-menu-icon-current:before { | |
content: "\f00c"; | |
} | |
#tab_content { | |
padding-top: 20px; | |
} | |
#running .panel-group .panel { | |
margin-top: 3px; | |
margin-bottom: 1em; | |
} | |
#running .panel-group .panel .panel-heading { | |
background-color: #EEE; | |
padding-top: 4px; | |
padding-bottom: 4px; | |
padding-left: 7px; | |
padding-right: 7px; | |
line-height: 22px; | |
} | |
#running .panel-group .panel .panel-heading a:focus, | |
#running .panel-group .panel .panel-heading a:hover { | |
text-decoration: none; | |
} | |
#running .panel-group .panel .panel-body { | |
padding: 0px; | |
} | |
#running .panel-group .panel .panel-body .list_container { | |
margin-top: 0px; | |
margin-bottom: 0px; | |
border: 0px; | |
border-radius: 0px; | |
} | |
#running .panel-group .panel .panel-body .list_container .list_item { | |
border-bottom: 1px solid #ddd; | |
} | |
#running .panel-group .panel .panel-body .list_container .list_item:last-child { | |
border-bottom: 0px; | |
} | |
.delete-button { | |
display: none; | |
} | |
.duplicate-button { | |
display: none; | |
} | |
.rename-button { | |
display: none; | |
} | |
.move-button { | |
display: none; | |
} | |
.download-button { | |
display: none; | |
} | |
.shutdown-button { | |
display: none; | |
} | |
.dynamic-instructions { | |
display: inline-block; | |
padding-top: 4px; | |
} | |
/*! | |
* | |
* IPython text editor webapp | |
* | |
*/ | |
.selected-keymap i.fa { | |
padding: 0px 5px; | |
} | |
.selected-keymap i.fa:before { | |
content: "\f00c"; | |
} | |
#mode-menu { | |
overflow: auto; | |
max-height: 20em; | |
} | |
.edit_app #header { | |
-webkit-box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2); | |
box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2); | |
} | |
.edit_app #menubar .navbar { | |
/* Use a negative 1 bottom margin, so the border overlaps the border of the | |
header */ | |
margin-bottom: -1px; | |
} | |
.dirty-indicator { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
width: 20px; | |
} | |
.dirty-indicator.fa-pull-left { | |
margin-right: .3em; | |
} | |
.dirty-indicator.fa-pull-right { | |
margin-left: .3em; | |
} | |
.dirty-indicator.pull-left { | |
margin-right: .3em; | |
} | |
.dirty-indicator.pull-right { | |
margin-left: .3em; | |
} | |
.dirty-indicator-dirty { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
width: 20px; | |
} | |
.dirty-indicator-dirty.fa-pull-left { | |
margin-right: .3em; | |
} | |
.dirty-indicator-dirty.fa-pull-right { | |
margin-left: .3em; | |
} | |
.dirty-indicator-dirty.pull-left { | |
margin-right: .3em; | |
} | |
.dirty-indicator-dirty.pull-right { | |
margin-left: .3em; | |
} | |
.dirty-indicator-clean { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
width: 20px; | |
} | |
.dirty-indicator-clean.fa-pull-left { | |
margin-right: .3em; | |
} | |
.dirty-indicator-clean.fa-pull-right { | |
margin-left: .3em; | |
} | |
.dirty-indicator-clean.pull-left { | |
margin-right: .3em; | |
} | |
.dirty-indicator-clean.pull-right { | |
margin-left: .3em; | |
} | |
.dirty-indicator-clean:before { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
content: "\f00c"; | |
} | |
.dirty-indicator-clean:before.fa-pull-left { | |
margin-right: .3em; | |
} | |
.dirty-indicator-clean:before.fa-pull-right { | |
margin-left: .3em; | |
} | |
.dirty-indicator-clean:before.pull-left { | |
margin-right: .3em; | |
} | |
.dirty-indicator-clean:before.pull-right { | |
margin-left: .3em; | |
} | |
#filename { | |
font-size: 16pt; | |
display: table; | |
padding: 0px 5px; | |
} | |
#current-mode { | |
padding-left: 5px; | |
padding-right: 5px; | |
} | |
#texteditor-backdrop { | |
padding-top: 20px; | |
padding-bottom: 20px; | |
} | |
@media not print { | |
#texteditor-backdrop { | |
background-color: #EEE; | |
} | |
} | |
@media print { | |
#texteditor-backdrop #texteditor-container .CodeMirror-gutter, | |
#texteditor-backdrop #texteditor-container .CodeMirror-gutters { | |
background-color: #fff; | |
} | |
} | |
@media not print { | |
#texteditor-backdrop #texteditor-container .CodeMirror-gutter, | |
#texteditor-backdrop #texteditor-container .CodeMirror-gutters { | |
background-color: #fff; | |
} | |
} | |
@media not print { | |
#texteditor-backdrop #texteditor-container { | |
padding: 0px; | |
background-color: #fff; | |
-webkit-box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2); | |
box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2); | |
} | |
} | |
.CodeMirror-dialog { | |
background-color: #fff; | |
} | |
/*! | |
* | |
* IPython notebook | |
* | |
*/ | |
/* CSS font colors for translated ANSI escape sequences */ | |
/* The color values are a mix of | |
http://www.xcolors.net/dl/baskerville-ivorylight and | |
http://www.xcolors.net/dl/euphrasia */ | |
.ansi-black-fg { | |
color: #3E424D; | |
} | |
.ansi-black-bg { | |
background-color: #3E424D; | |
} | |
.ansi-black-intense-fg { | |
color: #282C36; | |
} | |
.ansi-black-intense-bg { | |
background-color: #282C36; | |
} | |
.ansi-red-fg { | |
color: #E75C58; | |
} | |
.ansi-red-bg { | |
background-color: #E75C58; | |
} | |
.ansi-red-intense-fg { | |
color: #B22B31; | |
} | |
.ansi-red-intense-bg { | |
background-color: #B22B31; | |
} | |
.ansi-green-fg { | |
color: #00A250; | |
} | |
.ansi-green-bg { | |
background-color: #00A250; | |
} | |
.ansi-green-intense-fg { | |
color: #007427; | |
} | |
.ansi-green-intense-bg { | |
background-color: #007427; | |
} | |
.ansi-yellow-fg { | |
color: #DDB62B; | |
} | |
.ansi-yellow-bg { | |
background-color: #DDB62B; | |
} | |
.ansi-yellow-intense-fg { | |
color: #B27D12; | |
} | |
.ansi-yellow-intense-bg { | |
background-color: #B27D12; | |
} | |
.ansi-blue-fg { | |
color: #208FFB; | |
} | |
.ansi-blue-bg { | |
background-color: #208FFB; | |
} | |
.ansi-blue-intense-fg { | |
color: #0065CA; | |
} | |
.ansi-blue-intense-bg { | |
background-color: #0065CA; | |
} | |
.ansi-magenta-fg { | |
color: #D160C4; | |
} | |
.ansi-magenta-bg { | |
background-color: #D160C4; | |
} | |
.ansi-magenta-intense-fg { | |
color: #A03196; | |
} | |
.ansi-magenta-intense-bg { | |
background-color: #A03196; | |
} | |
.ansi-cyan-fg { | |
color: #60C6C8; | |
} | |
.ansi-cyan-bg { | |
background-color: #60C6C8; | |
} | |
.ansi-cyan-intense-fg { | |
color: #258F8F; | |
} | |
.ansi-cyan-intense-bg { | |
background-color: #258F8F; | |
} | |
.ansi-white-fg { | |
color: #C5C1B4; | |
} | |
.ansi-white-bg { | |
background-color: #C5C1B4; | |
} | |
.ansi-white-intense-fg { | |
color: #A1A6B2; | |
} | |
.ansi-white-intense-bg { | |
background-color: #A1A6B2; | |
} | |
.ansi-default-inverse-fg { | |
color: #FFFFFF; | |
} | |
.ansi-default-inverse-bg { | |
background-color: #000000; | |
} | |
.ansi-bold { | |
font-weight: bold; | |
} | |
.ansi-underline { | |
text-decoration: underline; | |
} | |
/* The following styles are deprecated an will be removed in a future version */ | |
.ansibold { | |
font-weight: bold; | |
} | |
.ansi-inverse { | |
outline: 0.5px dotted; | |
} | |
/* use dark versions for foreground, to improve visibility */ | |
.ansiblack { | |
color: black; | |
} | |
.ansired { | |
color: darkred; | |
} | |
.ansigreen { | |
color: darkgreen; | |
} | |
.ansiyellow { | |
color: #c4a000; | |
} | |
.ansiblue { | |
color: darkblue; | |
} | |
.ansipurple { | |
color: darkviolet; | |
} | |
.ansicyan { | |
color: steelblue; | |
} | |
.ansigray { | |
color: gray; | |
} | |
/* and light for background, for the same reason */ | |
.ansibgblack { | |
background-color: black; | |
} | |
.ansibgred { | |
background-color: red; | |
} | |
.ansibggreen { | |
background-color: green; | |
} | |
.ansibgyellow { | |
background-color: yellow; | |
} | |
.ansibgblue { | |
background-color: blue; | |
} | |
.ansibgpurple { | |
background-color: magenta; | |
} | |
.ansibgcyan { | |
background-color: cyan; | |
} | |
.ansibggray { | |
background-color: gray; | |
} | |
div.cell { | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: vertical; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: vertical; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: vertical; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: column; | |
align-items: stretch; | |
border-radius: 2px; | |
box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
-webkit-box-sizing: border-box; | |
border-width: 1px; | |
border-style: solid; | |
border-color: transparent; | |
width: 100%; | |
padding: 5px; | |
/* This acts as a spacer between cells, that is outside the border */ | |
margin: 0px; | |
outline: none; | |
position: relative; | |
overflow: visible; | |
} | |
div.cell:before { | |
position: absolute; | |
display: block; | |
top: -1px; | |
left: -1px; | |
width: 5px; | |
height: calc(100% + 2px); | |
content: ''; | |
background: transparent; | |
} | |
div.cell.jupyter-soft-selected { | |
border-left-color: #E3F2FD; | |
border-left-width: 1px; | |
padding-left: 5px; | |
border-right-color: #E3F2FD; | |
border-right-width: 1px; | |
background: #E3F2FD; | |
} | |
@media print { | |
div.cell.jupyter-soft-selected { | |
border-color: transparent; | |
} | |
} | |
div.cell.selected, | |
div.cell.selected.jupyter-soft-selected { | |
border-color: #ababab; | |
} | |
div.cell.selected:before, | |
div.cell.selected.jupyter-soft-selected:before { | |
position: absolute; | |
display: block; | |
top: -1px; | |
left: -1px; | |
width: 5px; | |
height: calc(100% + 2px); | |
content: ''; | |
background: #42A5F5; | |
} | |
@media print { | |
div.cell.selected, | |
div.cell.selected.jupyter-soft-selected { | |
border-color: transparent; | |
} | |
} | |
.edit_mode div.cell.selected { | |
border-color: #66BB6A; | |
} | |
.edit_mode div.cell.selected:before { | |
position: absolute; | |
display: block; | |
top: -1px; | |
left: -1px; | |
width: 5px; | |
height: calc(100% + 2px); | |
content: ''; | |
background: #66BB6A; | |
} | |
@media print { | |
.edit_mode div.cell.selected { | |
border-color: transparent; | |
} | |
} | |
.prompt { | |
/* This needs to be wide enough for 3 digit prompt numbers: In[100]: */ | |
min-width: 14ex; | |
/* This padding is tuned to match the padding on the CodeMirror editor. */ | |
padding: 0.4em; | |
margin: 0px; | |
font-family: monospace; | |
text-align: right; | |
/* This has to match that of the the CodeMirror class line-height below */ | |
line-height: 1.21429em; | |
/* Don't highlight prompt number selection */ | |
-webkit-touch-callout: none; | |
-webkit-user-select: none; | |
-khtml-user-select: none; | |
-moz-user-select: none; | |
-ms-user-select: none; | |
user-select: none; | |
/* Use default cursor */ | |
cursor: default; | |
} | |
@media (max-width: 540px) { | |
.prompt { | |
text-align: left; | |
} | |
} | |
div.inner_cell { | |
min-width: 0; | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: vertical; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: vertical; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: vertical; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: column; | |
align-items: stretch; | |
/* Old browsers */ | |
-webkit-box-flex: 1; | |
-moz-box-flex: 1; | |
box-flex: 1; | |
/* Modern browsers */ | |
flex: 1; | |
} | |
/* input_area and input_prompt must match in top border and margin for alignment */ | |
div.input_area { | |
border: 1px solid #cfcfcf; | |
border-radius: 2px; | |
background: #f7f7f7; | |
line-height: 1.21429em; | |
} | |
/* This is needed so that empty prompt areas can collapse to zero height when there | |
is no content in the output_subarea and the prompt. The main purpose of this is | |
to make sure that empty JavaScript output_subareas have no height. */ | |
div.prompt:empty { | |
padding-top: 0; | |
padding-bottom: 0; | |
} | |
div.unrecognized_cell { | |
padding: 5px 5px 5px 0px; | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: horizontal; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: horizontal; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: horizontal; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: row; | |
align-items: stretch; | |
} | |
div.unrecognized_cell .inner_cell { | |
border-radius: 2px; | |
padding: 5px; | |
font-weight: bold; | |
color: red; | |
border: 1px solid #cfcfcf; | |
background: #eaeaea; | |
} | |
div.unrecognized_cell .inner_cell a { | |
color: inherit; | |
text-decoration: none; | |
} | |
div.unrecognized_cell .inner_cell a:hover { | |
color: inherit; | |
text-decoration: none; | |
} | |
@media (max-width: 540px) { | |
div.unrecognized_cell > div.prompt { | |
display: none; | |
} | |
} | |
div.code_cell { | |
/* avoid page breaking on code cells when printing */ | |
} | |
@media print { | |
div.code_cell { | |
page-break-inside: avoid; | |
} | |
} | |
/* any special styling for code cells that are currently running goes here */ | |
div.input { | |
page-break-inside: avoid; | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: horizontal; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: horizontal; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: horizontal; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: row; | |
align-items: stretch; | |
} | |
@media (max-width: 540px) { | |
div.input { | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: vertical; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: vertical; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: vertical; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: column; | |
align-items: stretch; | |
} | |
} | |
/* input_area and input_prompt must match in top border and margin for alignment */ | |
div.input_prompt { | |
color: #303F9F; | |
border-top: 1px solid transparent; | |
} | |
div.input_area > div.highlight { | |
margin: 0.4em; | |
border: none; | |
padding: 0px; | |
background-color: transparent; | |
} | |
div.input_area > div.highlight > pre { | |
margin: 0px; | |
border: none; | |
padding: 0px; | |
background-color: transparent; | |
} | |
/* The following gets added to the <head> if it is detected that the user has a | |
* monospace font with inconsistent normal/bold/italic height. See | |
* notebookmain.js. Such fonts will have keywords vertically offset with | |
* respect to the rest of the text. The user should select a better font. | |
* See: https://github.com/ipython/ipython/issues/1503 | |
* | |
* .CodeMirror span { | |
* vertical-align: bottom; | |
* } | |
*/ | |
.CodeMirror { | |
line-height: 1.21429em; | |
/* Changed from 1em to our global default */ | |
font-size: 14px; | |
height: auto; | |
/* Changed to auto to autogrow */ | |
background: none; | |
/* Changed from white to allow our bg to show through */ | |
} | |
.CodeMirror-scroll { | |
/* The CodeMirror docs are a bit fuzzy on if overflow-y should be hidden or visible.*/ | |
/* We have found that if it is visible, vertical scrollbars appear with font size changes.*/ | |
overflow-y: hidden; | |
overflow-x: auto; | |
} | |
.CodeMirror-lines { | |
/* In CM2, this used to be 0.4em, but in CM3 it went to 4px. We need the em value because */ | |
/* we have set a different line-height and want this to scale with that. */ | |
/* Note that this should set vertical padding only, since CodeMirror assumes | |
that horizontal padding will be set on CodeMirror pre */ | |
padding: 0.4em 0; | |
} | |
.CodeMirror-linenumber { | |
padding: 0 8px 0 4px; | |
} | |
.CodeMirror-gutters { | |
border-bottom-left-radius: 2px; | |
border-top-left-radius: 2px; | |
} | |
.CodeMirror pre { | |
/* In CM3 this went to 4px from 0 in CM2. This sets horizontal padding only, | |
use .CodeMirror-lines for vertical */ | |
padding: 0 0.4em; | |
border: 0; | |
border-radius: 0; | |
} | |
.CodeMirror-cursor { | |
border-left: 1.4px solid black; | |
} | |
@media screen and (min-width: 2138px) and (max-width: 4319px) { | |
.CodeMirror-cursor { | |
border-left: 2px solid black; | |
} | |
} | |
@media screen and (min-width: 4320px) { | |
.CodeMirror-cursor { | |
border-left: 4px solid black; | |
} | |
} | |
/* | |
Original style from softwaremaniacs.org (c) Ivan Sagalaev <[email protected]> | |
Adapted from GitHub theme | |
*/ | |
.highlight-base { | |
color: #000; | |
} | |
.highlight-variable { | |
color: #000; | |
} | |
.highlight-variable-2 { | |
color: #1a1a1a; | |
} | |
.highlight-variable-3 { | |
color: #333333; | |
} | |
.highlight-string { | |
color: #BA2121; | |
} | |
.highlight-comment { | |
color: #408080; | |
font-style: italic; | |
} | |
.highlight-number { | |
color: #080; | |
} | |
.highlight-atom { | |
color: #88F; | |
} | |
.highlight-keyword { | |
color: #008000; | |
font-weight: bold; | |
} | |
.highlight-builtin { | |
color: #008000; | |
} | |
.highlight-error { | |
color: #f00; | |
} | |
.highlight-operator { | |
color: #AA22FF; | |
font-weight: bold; | |
} | |
.highlight-meta { | |
color: #AA22FF; | |
} | |
/* previously not defined, copying from default codemirror */ | |
.highlight-def { | |
color: #00f; | |
} | |
.highlight-string-2 { | |
color: #f50; | |
} | |
.highlight-qualifier { | |
color: #555; | |
} | |
.highlight-bracket { | |
color: #997; | |
} | |
.highlight-tag { | |
color: #170; | |
} | |
.highlight-attribute { | |
color: #00c; | |
} | |
.highlight-header { | |
color: blue; | |
} | |
.highlight-quote { | |
color: #090; | |
} | |
.highlight-link { | |
color: #00c; | |
} | |
/* apply the same style to codemirror */ | |
.cm-s-ipython span.cm-keyword { | |
color: #008000; | |
font-weight: bold; | |
} | |
.cm-s-ipython span.cm-atom { | |
color: #88F; | |
} | |
.cm-s-ipython span.cm-number { | |
color: #080; | |
} | |
.cm-s-ipython span.cm-def { | |
color: #00f; | |
} | |
.cm-s-ipython span.cm-variable { | |
color: #000; | |
} | |
.cm-s-ipython span.cm-operator { | |
color: #AA22FF; | |
font-weight: bold; | |
} | |
.cm-s-ipython span.cm-variable-2 { | |
color: #1a1a1a; | |
} | |
.cm-s-ipython span.cm-variable-3 { | |
color: #333333; | |
} | |
.cm-s-ipython span.cm-comment { | |
color: #408080; | |
font-style: italic; | |
} | |
.cm-s-ipython span.cm-string { | |
color: #BA2121; | |
} | |
.cm-s-ipython span.cm-string-2 { | |
color: #f50; | |
} | |
.cm-s-ipython span.cm-meta { | |
color: #AA22FF; | |
} | |
.cm-s-ipython span.cm-qualifier { | |
color: #555; | |
} | |
.cm-s-ipython span.cm-builtin { | |
color: #008000; | |
} | |
.cm-s-ipython span.cm-bracket { | |
color: #997; | |
} | |
.cm-s-ipython span.cm-tag { | |
color: #170; | |
} | |
.cm-s-ipython span.cm-attribute { | |
color: #00c; | |
} | |
.cm-s-ipython span.cm-header { | |
color: blue; | |
} | |
.cm-s-ipython span.cm-quote { | |
color: #090; | |
} | |
.cm-s-ipython span.cm-link { | |
color: #00c; | |
} | |
.cm-s-ipython span.cm-error { | |
color: #f00; | |
} | |
.cm-s-ipython span.cm-tab { | |
background: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAADAAAAAMCAYAAAAkuj5RAAAAAXNSR0IArs4c6QAAAGFJREFUSMft1LsRQFAQheHPowAKoACx3IgEKtaEHujDjORSgWTH/ZOdnZOcM/sgk/kFFWY0qV8foQwS4MKBCS3qR6ixBJvElOobYAtivseIE120FaowJPN75GMu8j/LfMwNjh4HUpwg4LUAAAAASUVORK5CYII=); | |
background-position: right; | |
background-repeat: no-repeat; | |
} | |
div.output_wrapper { | |
/* this position must be relative to enable descendents to be absolute within it */ | |
position: relative; | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: vertical; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: vertical; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: vertical; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: column; | |
align-items: stretch; | |
z-index: 1; | |
} | |
/* class for the output area when it should be height-limited */ | |
div.output_scroll { | |
/* ideally, this would be max-height, but FF barfs all over that */ | |
height: 24em; | |
/* FF needs this *and the wrapper* to specify full width, or it will shrinkwrap */ | |
width: 100%; | |
overflow: auto; | |
border-radius: 2px; | |
-webkit-box-shadow: inset 0 2px 8px rgba(0, 0, 0, 0.8); | |
box-shadow: inset 0 2px 8px rgba(0, 0, 0, 0.8); | |
display: block; | |
} | |
/* output div while it is collapsed */ | |
div.output_collapsed { | |
margin: 0px; | |
padding: 0px; | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: vertical; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: vertical; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: vertical; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: column; | |
align-items: stretch; | |
} | |
div.out_prompt_overlay { | |
height: 100%; | |
padding: 0px 0.4em; | |
position: absolute; | |
border-radius: 2px; | |
} | |
div.out_prompt_overlay:hover { | |
/* use inner shadow to get border that is computed the same on WebKit/FF */ | |
-webkit-box-shadow: inset 0 0 1px #000; | |
box-shadow: inset 0 0 1px #000; | |
background: rgba(240, 240, 240, 0.5); | |
} | |
div.output_prompt { | |
color: #D84315; | |
} | |
/* This class is the outer container of all output sections. */ | |
div.output_area { | |
padding: 0px; | |
page-break-inside: avoid; | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: horizontal; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: horizontal; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: horizontal; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: row; | |
align-items: stretch; | |
} | |
div.output_area .MathJax_Display { | |
text-align: left !important; | |
} | |
div.output_area .rendered_html table { | |
margin-left: 0; | |
margin-right: 0; | |
} | |
div.output_area .rendered_html img { | |
margin-left: 0; | |
margin-right: 0; | |
} | |
div.output_area img, | |
div.output_area svg { | |
max-width: 100%; | |
height: auto; | |
} | |
div.output_area img.unconfined, | |
div.output_area svg.unconfined { | |
max-width: none; | |
} | |
div.output_area .mglyph > img { | |
max-width: none; | |
} | |
/* This is needed to protect the pre formating from global settings such | |
as that of bootstrap */ | |
.output { | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: vertical; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: vertical; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: vertical; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: column; | |
align-items: stretch; | |
} | |
@media (max-width: 540px) { | |
div.output_area { | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: vertical; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: vertical; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: vertical; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: column; | |
align-items: stretch; | |
} | |
} | |
div.output_area pre { | |
margin: 0; | |
padding: 1px 0 1px 0; | |
border: 0; | |
vertical-align: baseline; | |
color: black; | |
background-color: transparent; | |
border-radius: 0; | |
} | |
/* This class is for the output subarea inside the output_area and after | |
the prompt div. */ | |
div.output_subarea { | |
overflow-x: auto; | |
padding: 0.4em; | |
/* Old browsers */ | |
-webkit-box-flex: 1; | |
-moz-box-flex: 1; | |
box-flex: 1; | |
/* Modern browsers */ | |
flex: 1; | |
max-width: calc(100% - 14ex); | |
} | |
div.output_scroll div.output_subarea { | |
overflow-x: visible; | |
} | |
/* The rest of the output_* classes are for special styling of the different | |
output types */ | |
/* all text output has this class: */ | |
div.output_text { | |
text-align: left; | |
color: #000; | |
/* This has to match that of the the CodeMirror class line-height below */ | |
line-height: 1.21429em; | |
} | |
/* stdout/stderr are 'text' as well as 'stream', but execute_result/error are *not* streams */ | |
div.output_stderr { | |
background: #fdd; | |
/* very light red background for stderr */ | |
} | |
div.output_latex { | |
text-align: left; | |
} | |
/* Empty output_javascript divs should have no height */ | |
div.output_javascript:empty { | |
padding: 0; | |
} | |
.js-error { | |
color: darkred; | |
} | |
/* raw_input styles */ | |
div.raw_input_container { | |
line-height: 1.21429em; | |
padding-top: 5px; | |
} | |
pre.raw_input_prompt { | |
/* nothing needed here. */ | |
} | |
input.raw_input { | |
font-family: monospace; | |
font-size: inherit; | |
color: inherit; | |
width: auto; | |
/* make sure input baseline aligns with prompt */ | |
vertical-align: baseline; | |
/* padding + margin = 0.5em between prompt and cursor */ | |
padding: 0em 0.25em; | |
margin: 0em 0.25em; | |
} | |
input.raw_input:focus { | |
box-shadow: none; | |
} | |
p.p-space { | |
margin-bottom: 10px; | |
} | |
div.output_unrecognized { | |
padding: 5px; | |
font-weight: bold; | |
color: red; | |
} | |
div.output_unrecognized a { | |
color: inherit; | |
text-decoration: none; | |
} | |
div.output_unrecognized a:hover { | |
color: inherit; | |
text-decoration: none; | |
} | |
.rendered_html { | |
color: #000; | |
/* any extras will just be numbers: */ | |
} | |
.rendered_html em { | |
font-style: italic; | |
} | |
.rendered_html strong { | |
font-weight: bold; | |
} | |
.rendered_html u { | |
text-decoration: underline; | |
} | |
.rendered_html :link { | |
text-decoration: underline; | |
} | |
.rendered_html :visited { | |
text-decoration: underline; | |
} | |
.rendered_html h1 { | |
font-size: 185.7%; | |
margin: 1.08em 0 0 0; | |
font-weight: bold; | |
line-height: 1.0; | |
} | |
.rendered_html h2 { | |
font-size: 157.1%; | |
margin: 1.27em 0 0 0; | |
font-weight: bold; | |
line-height: 1.0; | |
} | |
.rendered_html h3 { | |
font-size: 128.6%; | |
margin: 1.55em 0 0 0; | |
font-weight: bold; | |
line-height: 1.0; | |
} | |
.rendered_html h4 { | |
font-size: 100%; | |
margin: 2em 0 0 0; | |
font-weight: bold; | |
line-height: 1.0; | |
} | |
.rendered_html h5 { | |
font-size: 100%; | |
margin: 2em 0 0 0; | |
font-weight: bold; | |
line-height: 1.0; | |
font-style: italic; | |
} | |
.rendered_html h6 { | |
font-size: 100%; | |
margin: 2em 0 0 0; | |
font-weight: bold; | |
line-height: 1.0; | |
font-style: italic; | |
} | |
.rendered_html h1:first-child { | |
margin-top: 0.538em; | |
} | |
.rendered_html h2:first-child { | |
margin-top: 0.636em; | |
} | |
.rendered_html h3:first-child { | |
margin-top: 0.777em; | |
} | |
.rendered_html h4:first-child { | |
margin-top: 1em; | |
} | |
.rendered_html h5:first-child { | |
margin-top: 1em; | |
} | |
.rendered_html h6:first-child { | |
margin-top: 1em; | |
} | |
.rendered_html ul:not(.list-inline), | |
.rendered_html ol:not(.list-inline) { | |
padding-left: 2em; | |
} | |
.rendered_html ul { | |
list-style: disc; | |
} | |
.rendered_html ul ul { | |
list-style: square; | |
margin-top: 0; | |
} | |
.rendered_html ul ul ul { | |
list-style: circle; | |
} | |
.rendered_html ol { | |
list-style: decimal; | |
} | |
.rendered_html ol ol { | |
list-style: upper-alpha; | |
margin-top: 0; | |
} | |
.rendered_html ol ol ol { | |
list-style: lower-alpha; | |
} | |
.rendered_html ol ol ol ol { | |
list-style: lower-roman; | |
} | |
.rendered_html ol ol ol ol ol { | |
list-style: decimal; | |
} | |
.rendered_html * + ul { | |
margin-top: 1em; | |
} | |
.rendered_html * + ol { | |
margin-top: 1em; | |
} | |
.rendered_html hr { | |
color: black; | |
background-color: black; | |
} | |
.rendered_html pre { | |
margin: 1em 2em; | |
padding: 0px; | |
background-color: #fff; | |
} | |
.rendered_html code { | |
background-color: #eff0f1; | |
} | |
.rendered_html p code { | |
padding: 1px 5px; | |
} | |
.rendered_html pre code { | |
background-color: #fff; | |
} | |
.rendered_html pre, | |
.rendered_html code { | |
border: 0; | |
color: #000; | |
font-size: 100%; | |
} | |
.rendered_html blockquote { | |
margin: 1em 2em; | |
} | |
.rendered_html table { | |
margin-left: auto; | |
margin-right: auto; | |
border: none; | |
border-collapse: collapse; | |
border-spacing: 0; | |
color: black; | |
font-size: 12px; | |
table-layout: fixed; | |
} | |
.rendered_html thead { | |
border-bottom: 1px solid black; | |
vertical-align: bottom; | |
} | |
.rendered_html tr, | |
.rendered_html th, | |
.rendered_html td { | |
text-align: right; | |
vertical-align: middle; | |
padding: 0.5em 0.5em; | |
line-height: normal; | |
white-space: normal; | |
max-width: none; | |
border: none; | |
} | |
.rendered_html th { | |
font-weight: bold; | |
} | |
.rendered_html tbody tr:nth-child(odd) { | |
background: #f5f5f5; | |
} | |
.rendered_html tbody tr:hover { | |
background: rgba(66, 165, 245, 0.2); | |
} | |
.rendered_html * + table { | |
margin-top: 1em; | |
} | |
.rendered_html p { | |
text-align: left; | |
} | |
.rendered_html * + p { | |
margin-top: 1em; | |
} | |
.rendered_html img { | |
display: block; | |
margin-left: auto; | |
margin-right: auto; | |
} | |
.rendered_html * + img { | |
margin-top: 1em; | |
} | |
.rendered_html img, | |
.rendered_html svg { | |
max-width: 100%; | |
height: auto; | |
} | |
.rendered_html img.unconfined, | |
.rendered_html svg.unconfined { | |
max-width: none; | |
} | |
.rendered_html .alert { | |
margin-bottom: initial; | |
} | |
.rendered_html * + .alert { | |
margin-top: 1em; | |
} | |
[dir="rtl"] .rendered_html p { | |
text-align: right; | |
} | |
div.text_cell { | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: horizontal; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: horizontal; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: horizontal; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: row; | |
align-items: stretch; | |
} | |
@media (max-width: 540px) { | |
div.text_cell > div.prompt { | |
display: none; | |
} | |
} | |
div.text_cell_render { | |
/*font-family: "Helvetica Neue", Arial, Helvetica, Geneva, sans-serif;*/ | |
outline: none; | |
resize: none; | |
width: inherit; | |
border-style: none; | |
padding: 0.5em 0.5em 0.5em 0.4em; | |
color: #000; | |
box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
-webkit-box-sizing: border-box; | |
} | |
a.anchor-link:link { | |
text-decoration: none; | |
padding: 0px 20px; | |
visibility: hidden; | |
} | |
h1:hover .anchor-link, | |
h2:hover .anchor-link, | |
h3:hover .anchor-link, | |
h4:hover .anchor-link, | |
h5:hover .anchor-link, | |
h6:hover .anchor-link { | |
visibility: visible; | |
} | |
.text_cell.rendered .input_area { | |
display: none; | |
} | |
.text_cell.rendered .rendered_html { | |
overflow-x: auto; | |
overflow-y: hidden; | |
} | |
.text_cell.rendered .rendered_html tr, | |
.text_cell.rendered .rendered_html th, | |
.text_cell.rendered .rendered_html td { | |
max-width: none; | |
} | |
.text_cell.unrendered .text_cell_render { | |
display: none; | |
} | |
.text_cell .dropzone .input_area { | |
border: 2px dashed #bababa; | |
margin: -1px; | |
} | |
.cm-header-1, | |
.cm-header-2, | |
.cm-header-3, | |
.cm-header-4, | |
.cm-header-5, | |
.cm-header-6 { | |
font-weight: bold; | |
font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; | |
} | |
.cm-header-1 { | |
font-size: 185.7%; | |
} | |
.cm-header-2 { | |
font-size: 157.1%; | |
} | |
.cm-header-3 { | |
font-size: 128.6%; | |
} | |
.cm-header-4 { | |
font-size: 110%; | |
} | |
.cm-header-5 { | |
font-size: 100%; | |
font-style: italic; | |
} | |
.cm-header-6 { | |
font-size: 100%; | |
font-style: italic; | |
} | |
/*! | |
* | |
* IPython notebook webapp | |
* | |
*/ | |
@media (max-width: 767px) { | |
.notebook_app { | |
padding-left: 0px; | |
padding-right: 0px; | |
} | |
} | |
#ipython-main-app { | |
box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
-webkit-box-sizing: border-box; | |
height: 100%; | |
} | |
div#notebook_panel { | |
margin: 0px; | |
padding: 0px; | |
box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
-webkit-box-sizing: border-box; | |
height: 100%; | |
} | |
div#notebook { | |
font-size: 14px; | |
line-height: 20px; | |
overflow-y: hidden; | |
overflow-x: auto; | |
width: 100%; | |
/* This spaces the page away from the edge of the notebook area */ | |
padding-top: 20px; | |
margin: 0px; | |
outline: none; | |
box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
-webkit-box-sizing: border-box; | |
min-height: 100%; | |
} | |
@media not print { | |
#notebook-container { | |
padding: 15px; | |
background-color: #fff; | |
min-height: 0; | |
-webkit-box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2); | |
box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2); | |
} | |
} | |
@media print { | |
#notebook-container { | |
width: 100%; | |
} | |
} | |
div.ui-widget-content { | |
border: 1px solid #ababab; | |
outline: none; | |
} | |
pre.dialog { | |
background-color: #f7f7f7; | |
border: 1px solid #ddd; | |
border-radius: 2px; | |
padding: 0.4em; | |
padding-left: 2em; | |
} | |
p.dialog { | |
padding: 0.2em; | |
} | |
/* Word-wrap output correctly. This is the CSS3 spelling, though Firefox seems | |
to not honor it correctly. Webkit browsers (Chrome, rekonq, Safari) do. | |
*/ | |
pre, | |
code, | |
kbd, | |
samp { | |
white-space: pre-wrap; | |
} | |
#fonttest { | |
font-family: monospace; | |
} | |
p { | |
margin-bottom: 0; | |
} | |
.end_space { | |
min-height: 100px; | |
transition: height .2s ease; | |
} | |
.notebook_app > #header { | |
-webkit-box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2); | |
box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2); | |
} | |
@media not print { | |
.notebook_app { | |
background-color: #EEE; | |
} | |
} | |
kbd { | |
border-style: solid; | |
border-width: 1px; | |
box-shadow: none; | |
margin: 2px; | |
padding-left: 2px; | |
padding-right: 2px; | |
padding-top: 1px; | |
padding-bottom: 1px; | |
} | |
.jupyter-keybindings { | |
padding: 1px; | |
line-height: 24px; | |
border-bottom: 1px solid gray; | |
} | |
.jupyter-keybindings input { | |
margin: 0; | |
padding: 0; | |
border: none; | |
} | |
.jupyter-keybindings i { | |
padding: 6px; | |
} | |
.well code { | |
background-color: #ffffff; | |
border-color: #ababab; | |
border-width: 1px; | |
border-style: solid; | |
padding: 2px; | |
padding-top: 1px; | |
padding-bottom: 1px; | |
} | |
/* CSS for the cell toolbar */ | |
.celltoolbar { | |
border: thin solid #CFCFCF; | |
border-bottom: none; | |
background: #EEE; | |
border-radius: 2px 2px 0px 0px; | |
width: 100%; | |
height: 29px; | |
padding-right: 4px; | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: horizontal; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: horizontal; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: horizontal; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: row; | |
align-items: stretch; | |
/* Old browsers */ | |
-webkit-box-pack: end; | |
-moz-box-pack: end; | |
box-pack: end; | |
/* Modern browsers */ | |
justify-content: flex-end; | |
display: -webkit-flex; | |
} | |
@media print { | |
.celltoolbar { | |
display: none; | |
} | |
} | |
.ctb_hideshow { | |
display: none; | |
vertical-align: bottom; | |
} | |
/* ctb_show is added to the ctb_hideshow div to show the cell toolbar. | |
Cell toolbars are only shown when the ctb_global_show class is also set. | |
*/ | |
.ctb_global_show .ctb_show.ctb_hideshow { | |
display: block; | |
} | |
.ctb_global_show .ctb_show + .input_area, | |
.ctb_global_show .ctb_show + div.text_cell_input, | |
.ctb_global_show .ctb_show ~ div.text_cell_render { | |
border-top-right-radius: 0px; | |
border-top-left-radius: 0px; | |
} | |
.ctb_global_show .ctb_show ~ div.text_cell_render { | |
border: 1px solid #cfcfcf; | |
} | |
.celltoolbar { | |
font-size: 87%; | |
padding-top: 3px; | |
} | |
.celltoolbar select { | |
display: block; | |
width: 100%; | |
height: 32px; | |
padding: 6px 12px; | |
font-size: 13px; | |
line-height: 1.42857143; | |
color: #555555; | |
background-color: #fff; | |
background-image: none; | |
border: 1px solid #ccc; | |
border-radius: 2px; | |
-webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); | |
box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); | |
-webkit-transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s; | |
-o-transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s; | |
transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s; | |
height: 30px; | |
padding: 5px 10px; | |
font-size: 12px; | |
line-height: 1.5; | |
border-radius: 1px; | |
width: inherit; | |
font-size: inherit; | |
height: 22px; | |
padding: 0px; | |
display: inline-block; | |
} | |
.celltoolbar select:focus { | |
border-color: #66afe9; | |
outline: 0; | |
-webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102, 175, 233, 0.6); | |
box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102, 175, 233, 0.6); | |
} | |
.celltoolbar select::-moz-placeholder { | |
color: #999; | |
opacity: 1; | |
} | |
.celltoolbar select:-ms-input-placeholder { | |
color: #999; | |
} | |
.celltoolbar select::-webkit-input-placeholder { | |
color: #999; | |
} | |
.celltoolbar select::-ms-expand { | |
border: 0; | |
background-color: transparent; | |
} | |
.celltoolbar select[disabled], | |
.celltoolbar select[readonly], | |
fieldset[disabled] .celltoolbar select { | |
background-color: #eeeeee; | |
opacity: 1; | |
} | |
.celltoolbar select[disabled], | |
fieldset[disabled] .celltoolbar select { | |
cursor: not-allowed; | |
} | |
textarea.celltoolbar select { | |
height: auto; | |
} | |
select.celltoolbar select { | |
height: 30px; | |
line-height: 30px; | |
} | |
textarea.celltoolbar select, | |
select[multiple].celltoolbar select { | |
height: auto; | |
} | |
.celltoolbar label { | |
margin-left: 5px; | |
margin-right: 5px; | |
} | |
.tags_button_container { | |
width: 100%; | |
display: flex; | |
} | |
.tag-container { | |
display: flex; | |
flex-direction: row; | |
flex-grow: 1; | |
overflow: hidden; | |
position: relative; | |
} | |
.tag-container > * { | |
margin: 0 4px; | |
} | |
.remove-tag-btn { | |
margin-left: 4px; | |
} | |
.tags-input { | |
display: flex; | |
} | |
.cell-tag:last-child:after { | |
content: ""; | |
position: absolute; | |
right: 0; | |
width: 40px; | |
height: 100%; | |
/* Fade to background color of cell toolbar */ | |
background: linear-gradient(to right, rgba(0, 0, 0, 0), #EEE); | |
} | |
.tags-input > * { | |
margin-left: 4px; | |
} | |
.cell-tag, | |
.tags-input input, | |
.tags-input button { | |
display: block; | |
width: 100%; | |
height: 32px; | |
padding: 6px 12px; | |
font-size: 13px; | |
line-height: 1.42857143; | |
color: #555555; | |
background-color: #fff; | |
background-image: none; | |
border: 1px solid #ccc; | |
border-radius: 2px; | |
-webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); | |
box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); | |
-webkit-transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s; | |
-o-transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s; | |
transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s; | |
height: 30px; | |
padding: 5px 10px; | |
font-size: 12px; | |
line-height: 1.5; | |
border-radius: 1px; | |
box-shadow: none; | |
width: inherit; | |
font-size: inherit; | |
height: 22px; | |
line-height: 22px; | |
padding: 0px 4px; | |
display: inline-block; | |
} | |
.cell-tag:focus, | |
.tags-input input:focus, | |
.tags-input button:focus { | |
border-color: #66afe9; | |
outline: 0; | |
-webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102, 175, 233, 0.6); | |
box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102, 175, 233, 0.6); | |
} | |
.cell-tag::-moz-placeholder, | |
.tags-input input::-moz-placeholder, | |
.tags-input button::-moz-placeholder { | |
color: #999; | |
opacity: 1; | |
} | |
.cell-tag:-ms-input-placeholder, | |
.tags-input input:-ms-input-placeholder, | |
.tags-input button:-ms-input-placeholder { | |
color: #999; | |
} | |
.cell-tag::-webkit-input-placeholder, | |
.tags-input input::-webkit-input-placeholder, | |
.tags-input button::-webkit-input-placeholder { | |
color: #999; | |
} | |
.cell-tag::-ms-expand, | |
.tags-input input::-ms-expand, | |
.tags-input button::-ms-expand { | |
border: 0; | |
background-color: transparent; | |
} | |
.cell-tag[disabled], | |
.tags-input input[disabled], | |
.tags-input button[disabled], | |
.cell-tag[readonly], | |
.tags-input input[readonly], | |
.tags-input button[readonly], | |
fieldset[disabled] .cell-tag, | |
fieldset[disabled] .tags-input input, | |
fieldset[disabled] .tags-input button { | |
background-color: #eeeeee; | |
opacity: 1; | |
} | |
.cell-tag[disabled], | |
.tags-input input[disabled], | |
.tags-input button[disabled], | |
fieldset[disabled] .cell-tag, | |
fieldset[disabled] .tags-input input, | |
fieldset[disabled] .tags-input button { | |
cursor: not-allowed; | |
} | |
textarea.cell-tag, | |
textarea.tags-input input, | |
textarea.tags-input button { | |
height: auto; | |
} | |
select.cell-tag, | |
select.tags-input input, | |
select.tags-input button { | |
height: 30px; | |
line-height: 30px; | |
} | |
textarea.cell-tag, | |
textarea.tags-input input, | |
textarea.tags-input button, | |
select[multiple].cell-tag, | |
select[multiple].tags-input input, | |
select[multiple].tags-input button { | |
height: auto; | |
} | |
.cell-tag, | |
.tags-input button { | |
padding: 0px 4px; | |
} | |
.cell-tag { | |
background-color: #fff; | |
white-space: nowrap; | |
} | |
.tags-input input[type=text]:focus { | |
outline: none; | |
box-shadow: none; | |
border-color: #ccc; | |
} | |
.completions { | |
position: absolute; | |
z-index: 110; | |
overflow: hidden; | |
border: 1px solid #ababab; | |
border-radius: 2px; | |
-webkit-box-shadow: 0px 6px 10px -1px #adadad; | |
box-shadow: 0px 6px 10px -1px #adadad; | |
line-height: 1; | |
} | |
.completions select { | |
background: white; | |
outline: none; | |
border: none; | |
padding: 0px; | |
margin: 0px; | |
overflow: auto; | |
font-family: monospace; | |
font-size: 110%; | |
color: #000; | |
width: auto; | |
} | |
.completions select option.context { | |
color: #286090; | |
} | |
#kernel_logo_widget .current_kernel_logo { | |
display: none; | |
margin-top: -1px; | |
margin-bottom: -1px; | |
width: 32px; | |
height: 32px; | |
} | |
[dir="rtl"] #kernel_logo_widget { | |
float: left !important; | |
float: left; | |
} | |
.modal .modal-body .move-path { | |
display: flex; | |
flex-direction: row; | |
justify-content: space; | |
align-items: center; | |
} | |
.modal .modal-body .move-path .server-root { | |
padding-right: 20px; | |
} | |
.modal .modal-body .move-path .path-input { | |
flex: 1; | |
} | |
#menubar { | |
box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
-webkit-box-sizing: border-box; | |
margin-top: 1px; | |
} | |
#menubar .navbar { | |
border-top: 1px; | |
border-radius: 0px 0px 2px 2px; | |
margin-bottom: 0px; | |
} | |
#menubar .navbar-toggle { | |
float: left; | |
padding-top: 7px; | |
padding-bottom: 7px; | |
border: none; | |
} | |
#menubar .navbar-collapse { | |
clear: left; | |
} | |
[dir="rtl"] #menubar .navbar-toggle { | |
float: right; | |
} | |
[dir="rtl"] #menubar .navbar-collapse { | |
clear: right; | |
} | |
[dir="rtl"] #menubar .navbar-nav { | |
float: right; | |
} | |
[dir="rtl"] #menubar .nav { | |
padding-right: 0px; | |
} | |
[dir="rtl"] #menubar .navbar-nav > li { | |
float: right; | |
} | |
[dir="rtl"] #menubar .navbar-right { | |
float: left !important; | |
} | |
[dir="rtl"] ul.dropdown-menu { | |
text-align: right; | |
left: auto; | |
} | |
[dir="rtl"] ul#new-menu.dropdown-menu { | |
right: auto; | |
left: 0; | |
} | |
.nav-wrapper { | |
border-bottom: 1px solid #e7e7e7; | |
} | |
i.menu-icon { | |
padding-top: 4px; | |
} | |
[dir="rtl"] i.menu-icon.pull-right { | |
float: left !important; | |
float: left; | |
} | |
ul#help_menu li a { | |
overflow: hidden; | |
padding-right: 2.2em; | |
} | |
ul#help_menu li a i { | |
margin-right: -1.2em; | |
} | |
[dir="rtl"] ul#help_menu li a { | |
padding-left: 2.2em; | |
} | |
[dir="rtl"] ul#help_menu li a i { | |
margin-right: 0; | |
margin-left: -1.2em; | |
} | |
[dir="rtl"] ul#help_menu li a i.pull-right { | |
float: left !important; | |
float: left; | |
} | |
.dropdown-submenu { | |
position: relative; | |
} | |
.dropdown-submenu > .dropdown-menu { | |
top: 0; | |
left: 100%; | |
margin-top: -6px; | |
margin-left: -1px; | |
} | |
[dir="rtl"] .dropdown-submenu > .dropdown-menu { | |
right: 100%; | |
margin-right: -1px; | |
} | |
.dropdown-submenu:hover > .dropdown-menu { | |
display: block; | |
} | |
.dropdown-submenu > a:after { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
display: block; | |
content: "\f0da"; | |
float: right; | |
color: #333333; | |
margin-top: 2px; | |
margin-right: -10px; | |
} | |
.dropdown-submenu > a:after.fa-pull-left { | |
margin-right: .3em; | |
} | |
.dropdown-submenu > a:after.fa-pull-right { | |
margin-left: .3em; | |
} | |
.dropdown-submenu > a:after.pull-left { | |
margin-right: .3em; | |
} | |
.dropdown-submenu > a:after.pull-right { | |
margin-left: .3em; | |
} | |
[dir="rtl"] .dropdown-submenu > a:after { | |
float: left; | |
content: "\f0d9"; | |
margin-right: 0; | |
margin-left: -10px; | |
} | |
.dropdown-submenu:hover > a:after { | |
color: #262626; | |
} | |
.dropdown-submenu.pull-left { | |
float: none; | |
} | |
.dropdown-submenu.pull-left > .dropdown-menu { | |
left: -100%; | |
margin-left: 10px; | |
} | |
#notification_area { | |
float: right !important; | |
float: right; | |
z-index: 10; | |
} | |
[dir="rtl"] #notification_area { | |
float: left !important; | |
float: left; | |
} | |
.indicator_area { | |
float: right !important; | |
float: right; | |
color: #777; | |
margin-left: 5px; | |
margin-right: 5px; | |
width: 11px; | |
z-index: 10; | |
text-align: center; | |
width: auto; | |
} | |
[dir="rtl"] .indicator_area { | |
float: left !important; | |
float: left; | |
} | |
#kernel_indicator { | |
float: right !important; | |
float: right; | |
color: #777; | |
margin-left: 5px; | |
margin-right: 5px; | |
width: 11px; | |
z-index: 10; | |
text-align: center; | |
width: auto; | |
border-left: 1px solid; | |
} | |
#kernel_indicator .kernel_indicator_name { | |
padding-left: 5px; | |
padding-right: 5px; | |
} | |
[dir="rtl"] #kernel_indicator { | |
float: left !important; | |
float: left; | |
border-left: 0; | |
border-right: 1px solid; | |
} | |
#modal_indicator { | |
float: right !important; | |
float: right; | |
color: #777; | |
margin-left: 5px; | |
margin-right: 5px; | |
width: 11px; | |
z-index: 10; | |
text-align: center; | |
width: auto; | |
} | |
[dir="rtl"] #modal_indicator { | |
float: left !important; | |
float: left; | |
} | |
#readonly-indicator { | |
float: right !important; | |
float: right; | |
color: #777; | |
margin-left: 5px; | |
margin-right: 5px; | |
width: 11px; | |
z-index: 10; | |
text-align: center; | |
width: auto; | |
margin-top: 2px; | |
margin-bottom: 0px; | |
margin-left: 0px; | |
margin-right: 0px; | |
display: none; | |
} | |
.modal_indicator:before { | |
width: 1.28571429em; | |
text-align: center; | |
} | |
.edit_mode .modal_indicator:before { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
content: "\f040"; | |
} | |
.edit_mode .modal_indicator:before.fa-pull-left { | |
margin-right: .3em; | |
} | |
.edit_mode .modal_indicator:before.fa-pull-right { | |
margin-left: .3em; | |
} | |
.edit_mode .modal_indicator:before.pull-left { | |
margin-right: .3em; | |
} | |
.edit_mode .modal_indicator:before.pull-right { | |
margin-left: .3em; | |
} | |
.command_mode .modal_indicator:before { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
content: ' '; | |
} | |
.command_mode .modal_indicator:before.fa-pull-left { | |
margin-right: .3em; | |
} | |
.command_mode .modal_indicator:before.fa-pull-right { | |
margin-left: .3em; | |
} | |
.command_mode .modal_indicator:before.pull-left { | |
margin-right: .3em; | |
} | |
.command_mode .modal_indicator:before.pull-right { | |
margin-left: .3em; | |
} | |
.kernel_idle_icon:before { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
content: "\f10c"; | |
} | |
.kernel_idle_icon:before.fa-pull-left { | |
margin-right: .3em; | |
} | |
.kernel_idle_icon:before.fa-pull-right { | |
margin-left: .3em; | |
} | |
.kernel_idle_icon:before.pull-left { | |
margin-right: .3em; | |
} | |
.kernel_idle_icon:before.pull-right { | |
margin-left: .3em; | |
} | |
.kernel_busy_icon:before { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
content: "\f111"; | |
} | |
.kernel_busy_icon:before.fa-pull-left { | |
margin-right: .3em; | |
} | |
.kernel_busy_icon:before.fa-pull-right { | |
margin-left: .3em; | |
} | |
.kernel_busy_icon:before.pull-left { | |
margin-right: .3em; | |
} | |
.kernel_busy_icon:before.pull-right { | |
margin-left: .3em; | |
} | |
.kernel_dead_icon:before { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
content: "\f1e2"; | |
} | |
.kernel_dead_icon:before.fa-pull-left { | |
margin-right: .3em; | |
} | |
.kernel_dead_icon:before.fa-pull-right { | |
margin-left: .3em; | |
} | |
.kernel_dead_icon:before.pull-left { | |
margin-right: .3em; | |
} | |
.kernel_dead_icon:before.pull-right { | |
margin-left: .3em; | |
} | |
.kernel_disconnected_icon:before { | |
display: inline-block; | |
font: normal normal normal 14px/1 FontAwesome; | |
font-size: inherit; | |
text-rendering: auto; | |
-webkit-font-smoothing: antialiased; | |
-moz-osx-font-smoothing: grayscale; | |
content: "\f127"; | |
} | |
.kernel_disconnected_icon:before.fa-pull-left { | |
margin-right: .3em; | |
} | |
.kernel_disconnected_icon:before.fa-pull-right { | |
margin-left: .3em; | |
} | |
.kernel_disconnected_icon:before.pull-left { | |
margin-right: .3em; | |
} | |
.kernel_disconnected_icon:before.pull-right { | |
margin-left: .3em; | |
} | |
.notification_widget { | |
color: #777; | |
z-index: 10; | |
background: rgba(240, 240, 240, 0.5); | |
margin-right: 4px; | |
color: #333; | |
background-color: #fff; | |
border-color: #ccc; | |
} | |
.notification_widget:focus, | |
.notification_widget.focus { | |
color: #333; | |
background-color: #e6e6e6; | |
border-color: #8c8c8c; | |
} | |
.notification_widget:hover { | |
color: #333; | |
background-color: #e6e6e6; | |
border-color: #adadad; | |
} | |
.notification_widget:active, | |
.notification_widget.active, | |
.open > .dropdown-toggle.notification_widget { | |
color: #333; | |
background-color: #e6e6e6; | |
border-color: #adadad; | |
} | |
.notification_widget:active:hover, | |
.notification_widget.active:hover, | |
.open > .dropdown-toggle.notification_widget:hover, | |
.notification_widget:active:focus, | |
.notification_widget.active:focus, | |
.open > .dropdown-toggle.notification_widget:focus, | |
.notification_widget:active.focus, | |
.notification_widget.active.focus, | |
.open > .dropdown-toggle.notification_widget.focus { | |
color: #333; | |
background-color: #d4d4d4; | |
border-color: #8c8c8c; | |
} | |
.notification_widget:active, | |
.notification_widget.active, | |
.open > .dropdown-toggle.notification_widget { | |
background-image: none; | |
} | |
.notification_widget.disabled:hover, | |
.notification_widget[disabled]:hover, | |
fieldset[disabled] .notification_widget:hover, | |
.notification_widget.disabled:focus, | |
.notification_widget[disabled]:focus, | |
fieldset[disabled] .notification_widget:focus, | |
.notification_widget.disabled.focus, | |
.notification_widget[disabled].focus, | |
fieldset[disabled] .notification_widget.focus { | |
background-color: #fff; | |
border-color: #ccc; | |
} | |
.notification_widget .badge { | |
color: #fff; | |
background-color: #333; | |
} | |
.notification_widget.warning { | |
color: #fff; | |
background-color: #f0ad4e; | |
border-color: #eea236; | |
} | |
.notification_widget.warning:focus, | |
.notification_widget.warning.focus { | |
color: #fff; | |
background-color: #ec971f; | |
border-color: #985f0d; | |
} | |
.notification_widget.warning:hover { | |
color: #fff; | |
background-color: #ec971f; | |
border-color: #d58512; | |
} | |
.notification_widget.warning:active, | |
.notification_widget.warning.active, | |
.open > .dropdown-toggle.notification_widget.warning { | |
color: #fff; | |
background-color: #ec971f; | |
border-color: #d58512; | |
} | |
.notification_widget.warning:active:hover, | |
.notification_widget.warning.active:hover, | |
.open > .dropdown-toggle.notification_widget.warning:hover, | |
.notification_widget.warning:active:focus, | |
.notification_widget.warning.active:focus, | |
.open > .dropdown-toggle.notification_widget.warning:focus, | |
.notification_widget.warning:active.focus, | |
.notification_widget.warning.active.focus, | |
.open > .dropdown-toggle.notification_widget.warning.focus { | |
color: #fff; | |
background-color: #d58512; | |
border-color: #985f0d; | |
} | |
.notification_widget.warning:active, | |
.notification_widget.warning.active, | |
.open > .dropdown-toggle.notification_widget.warning { | |
background-image: none; | |
} | |
.notification_widget.warning.disabled:hover, | |
.notification_widget.warning[disabled]:hover, | |
fieldset[disabled] .notification_widget.warning:hover, | |
.notification_widget.warning.disabled:focus, | |
.notification_widget.warning[disabled]:focus, | |
fieldset[disabled] .notification_widget.warning:focus, | |
.notification_widget.warning.disabled.focus, | |
.notification_widget.warning[disabled].focus, | |
fieldset[disabled] .notification_widget.warning.focus { | |
background-color: #f0ad4e; | |
border-color: #eea236; | |
} | |
.notification_widget.warning .badge { | |
color: #f0ad4e; | |
background-color: #fff; | |
} | |
.notification_widget.success { | |
color: #fff; | |
background-color: #5cb85c; | |
border-color: #4cae4c; | |
} | |
.notification_widget.success:focus, | |
.notification_widget.success.focus { | |
color: #fff; | |
background-color: #449d44; | |
border-color: #255625; | |
} | |
.notification_widget.success:hover { | |
color: #fff; | |
background-color: #449d44; | |
border-color: #398439; | |
} | |
.notification_widget.success:active, | |
.notification_widget.success.active, | |
.open > .dropdown-toggle.notification_widget.success { | |
color: #fff; | |
background-color: #449d44; | |
border-color: #398439; | |
} | |
.notification_widget.success:active:hover, | |
.notification_widget.success.active:hover, | |
.open > .dropdown-toggle.notification_widget.success:hover, | |
.notification_widget.success:active:focus, | |
.notification_widget.success.active:focus, | |
.open > .dropdown-toggle.notification_widget.success:focus, | |
.notification_widget.success:active.focus, | |
.notification_widget.success.active.focus, | |
.open > .dropdown-toggle.notification_widget.success.focus { | |
color: #fff; | |
background-color: #398439; | |
border-color: #255625; | |
} | |
.notification_widget.success:active, | |
.notification_widget.success.active, | |
.open > .dropdown-toggle.notification_widget.success { | |
background-image: none; | |
} | |
.notification_widget.success.disabled:hover, | |
.notification_widget.success[disabled]:hover, | |
fieldset[disabled] .notification_widget.success:hover, | |
.notification_widget.success.disabled:focus, | |
.notification_widget.success[disabled]:focus, | |
fieldset[disabled] .notification_widget.success:focus, | |
.notification_widget.success.disabled.focus, | |
.notification_widget.success[disabled].focus, | |
fieldset[disabled] .notification_widget.success.focus { | |
background-color: #5cb85c; | |
border-color: #4cae4c; | |
} | |
.notification_widget.success .badge { | |
color: #5cb85c; | |
background-color: #fff; | |
} | |
.notification_widget.info { | |
color: #fff; | |
background-color: #5bc0de; | |
border-color: #46b8da; | |
} | |
.notification_widget.info:focus, | |
.notification_widget.info.focus { | |
color: #fff; | |
background-color: #31b0d5; | |
border-color: #1b6d85; | |
} | |
.notification_widget.info:hover { | |
color: #fff; | |
background-color: #31b0d5; | |
border-color: #269abc; | |
} | |
.notification_widget.info:active, | |
.notification_widget.info.active, | |
.open > .dropdown-toggle.notification_widget.info { | |
color: #fff; | |
background-color: #31b0d5; | |
border-color: #269abc; | |
} | |
.notification_widget.info:active:hover, | |
.notification_widget.info.active:hover, | |
.open > .dropdown-toggle.notification_widget.info:hover, | |
.notification_widget.info:active:focus, | |
.notification_widget.info.active:focus, | |
.open > .dropdown-toggle.notification_widget.info:focus, | |
.notification_widget.info:active.focus, | |
.notification_widget.info.active.focus, | |
.open > .dropdown-toggle.notification_widget.info.focus { | |
color: #fff; | |
background-color: #269abc; | |
border-color: #1b6d85; | |
} | |
.notification_widget.info:active, | |
.notification_widget.info.active, | |
.open > .dropdown-toggle.notification_widget.info { | |
background-image: none; | |
} | |
.notification_widget.info.disabled:hover, | |
.notification_widget.info[disabled]:hover, | |
fieldset[disabled] .notification_widget.info:hover, | |
.notification_widget.info.disabled:focus, | |
.notification_widget.info[disabled]:focus, | |
fieldset[disabled] .notification_widget.info:focus, | |
.notification_widget.info.disabled.focus, | |
.notification_widget.info[disabled].focus, | |
fieldset[disabled] .notification_widget.info.focus { | |
background-color: #5bc0de; | |
border-color: #46b8da; | |
} | |
.notification_widget.info .badge { | |
color: #5bc0de; | |
background-color: #fff; | |
} | |
.notification_widget.danger { | |
color: #fff; | |
background-color: #d9534f; | |
border-color: #d43f3a; | |
} | |
.notification_widget.danger:focus, | |
.notification_widget.danger.focus { | |
color: #fff; | |
background-color: #c9302c; | |
border-color: #761c19; | |
} | |
.notification_widget.danger:hover { | |
color: #fff; | |
background-color: #c9302c; | |
border-color: #ac2925; | |
} | |
.notification_widget.danger:active, | |
.notification_widget.danger.active, | |
.open > .dropdown-toggle.notification_widget.danger { | |
color: #fff; | |
background-color: #c9302c; | |
border-color: #ac2925; | |
} | |
.notification_widget.danger:active:hover, | |
.notification_widget.danger.active:hover, | |
.open > .dropdown-toggle.notification_widget.danger:hover, | |
.notification_widget.danger:active:focus, | |
.notification_widget.danger.active:focus, | |
.open > .dropdown-toggle.notification_widget.danger:focus, | |
.notification_widget.danger:active.focus, | |
.notification_widget.danger.active.focus, | |
.open > .dropdown-toggle.notification_widget.danger.focus { | |
color: #fff; | |
background-color: #ac2925; | |
border-color: #761c19; | |
} | |
.notification_widget.danger:active, | |
.notification_widget.danger.active, | |
.open > .dropdown-toggle.notification_widget.danger { | |
background-image: none; | |
} | |
.notification_widget.danger.disabled:hover, | |
.notification_widget.danger[disabled]:hover, | |
fieldset[disabled] .notification_widget.danger:hover, | |
.notification_widget.danger.disabled:focus, | |
.notification_widget.danger[disabled]:focus, | |
fieldset[disabled] .notification_widget.danger:focus, | |
.notification_widget.danger.disabled.focus, | |
.notification_widget.danger[disabled].focus, | |
fieldset[disabled] .notification_widget.danger.focus { | |
background-color: #d9534f; | |
border-color: #d43f3a; | |
} | |
.notification_widget.danger .badge { | |
color: #d9534f; | |
background-color: #fff; | |
} | |
div#pager { | |
background-color: #fff; | |
font-size: 14px; | |
line-height: 20px; | |
overflow: hidden; | |
display: none; | |
position: fixed; | |
bottom: 0px; | |
width: 100%; | |
max-height: 50%; | |
padding-top: 8px; | |
-webkit-box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2); | |
box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2); | |
/* Display over codemirror */ | |
z-index: 100; | |
/* Hack which prevents jquery ui resizable from changing top. */ | |
top: auto !important; | |
} | |
div#pager pre { | |
line-height: 1.21429em; | |
color: #000; | |
background-color: #f7f7f7; | |
padding: 0.4em; | |
} | |
div#pager #pager-button-area { | |
position: absolute; | |
top: 8px; | |
right: 20px; | |
} | |
div#pager #pager-contents { | |
position: relative; | |
overflow: auto; | |
width: 100%; | |
height: 100%; | |
} | |
div#pager #pager-contents #pager-container { | |
position: relative; | |
padding: 15px 0px; | |
box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
-webkit-box-sizing: border-box; | |
} | |
div#pager .ui-resizable-handle { | |
top: 0px; | |
height: 8px; | |
background: #f7f7f7; | |
border-top: 1px solid #cfcfcf; | |
border-bottom: 1px solid #cfcfcf; | |
/* This injects handle bars (a short, wide = symbol) for | |
the resize handle. */ | |
} | |
div#pager .ui-resizable-handle::after { | |
content: ''; | |
top: 2px; | |
left: 50%; | |
height: 3px; | |
width: 30px; | |
margin-left: -15px; | |
position: absolute; | |
border-top: 1px solid #cfcfcf; | |
} | |
.quickhelp { | |
/* Old browsers */ | |
display: -webkit-box; | |
-webkit-box-orient: horizontal; | |
-webkit-box-align: stretch; | |
display: -moz-box; | |
-moz-box-orient: horizontal; | |
-moz-box-align: stretch; | |
display: box; | |
box-orient: horizontal; | |
box-align: stretch; | |
/* Modern browsers */ | |
display: flex; | |
flex-direction: row; | |
align-items: stretch; | |
line-height: 1.8em; | |
} | |
.shortcut_key { | |
display: inline-block; | |
width: 21ex; | |
text-align: right; | |
font-family: monospace; | |
} | |
.shortcut_descr { | |
display: inline-block; | |
/* Old browsers */ | |
-webkit-box-flex: 1; | |
-moz-box-flex: 1; | |
box-flex: 1; | |
/* Modern browsers */ | |
flex: 1; | |
} | |
span.save_widget { | |
height: 30px; | |
margin-top: 4px; | |
display: flex; | |
justify-content: flex-start; | |
align-items: baseline; | |
width: 50%; | |
flex: 1; | |
} | |
span.save_widget span.filename { | |
height: 100%; | |
line-height: 1em; | |
margin-left: 16px; | |
border: none; | |
font-size: 146.5%; | |
text-overflow: ellipsis; | |
overflow: hidden; | |
white-space: nowrap; | |
border-radius: 2px; | |
} | |
span.save_widget span.filename:hover { | |
background-color: #e6e6e6; | |
} | |
[dir="rtl"] span.save_widget.pull-left { | |
float: right !important; | |
float: right; | |
} | |
[dir="rtl"] span.save_widget span.filename { | |
margin-left: 0; | |
margin-right: 16px; | |
} | |
span.checkpoint_status, | |
span.autosave_status { | |
font-size: small; | |
white-space: nowrap; | |
padding: 0 5px; | |
} | |
@media (max-width: 767px) { | |
span.save_widget { | |
font-size: small; | |
padding: 0 0 0 5px; | |
} | |
span.checkpoint_status, | |
span.autosave_status { | |
display: none; | |
} | |
} | |
@media (min-width: 768px) and (max-width: 991px) { | |
span.checkpoint_status { | |
display: none; | |
} | |
span.autosave_status { | |
font-size: x-small; | |
} | |
} | |
.toolbar { | |
padding: 0px; | |
margin-left: -5px; | |
margin-top: 2px; | |
margin-bottom: 5px; | |
box-sizing: border-box; | |
-moz-box-sizing: border-box; | |
-webkit-box-sizing: border-box; | |
} | |
.toolbar select, | |
.toolbar label { | |
width: auto; | |
vertical-align: middle; | |
margin-right: 2px; | |
margin-bottom: 0px; | |
display: inline; | |
font-size: 92%; | |
margin-left: 0.3em; | |
margin-right: 0.3em; | |
padding: 0px; | |
padding-top: 3px; | |
} | |
.toolbar .btn { | |
padding: 2px 8px; | |
} | |
.toolbar .btn-group { | |
margin-top: 0px; | |
margin-left: 5px; | |
} | |
.toolbar-btn-label { | |
margin-left: 6px; | |
} | |
#maintoolbar { | |
margin-bottom: -3px; | |
margin-top: -8px; | |
border: 0px; | |
min-height: 27px; | |
margin-left: 0px; | |
padding-top: 11px; | |
padding-bottom: 3px; | |
} | |
#maintoolbar .navbar-text { | |
float: none; | |
vertical-align: middle; | |
text-align: right; | |
margin-left: 5px; | |
margin-right: 0px; | |
margin-top: 0px; | |
} | |
.select-xs { | |
height: 24px; | |
} | |
[dir="rtl"] .btn-group > .btn, | |
.btn-group-vertical > .btn { | |
float: right; | |
} | |
.pulse, | |
.dropdown-menu > li > a.pulse, | |
li.pulse > a.dropdown-toggle, | |
li.pulse.open > a.dropdown-toggle { | |
background-color: #F37626; | |
color: white; | |
} | |
/** | |
* Primary styles | |
* | |
* Author: Jupyter Development Team | |
*/ | |
/** WARNING IF YOU ARE EDITTING THIS FILE, if this is a .css file, It has a lot | |
* of chance of beeing generated from the ../less/[samename].less file, you can | |
* try to get back the less file by reverting somme commit in history | |
**/ | |
/* | |
* We'll try to get something pretty, so we | |
* have some strange css to have the scroll bar on | |
* the left with fix button on the top right of the tooltip | |
*/ | |
@-moz-keyframes fadeOut { | |
from { | |
opacity: 1; | |
} | |
to { | |
opacity: 0; | |
} | |
} | |
@-webkit-keyframes fadeOut { | |
from { | |
opacity: 1; | |
} | |
to { | |
opacity: 0; | |
} | |
} | |
@-moz-keyframes fadeIn { | |
from { | |
opacity: 0; | |
} | |
to { | |
opacity: 1; | |
} | |
} | |
@-webkit-keyframes fadeIn { | |
from { | |
opacity: 0; | |
} | |
to { | |
opacity: 1; | |
} | |
} | |
/*properties of tooltip after "expand"*/ | |
.bigtooltip { | |
overflow: auto; | |
height: 200px; | |
-webkit-transition-property: height; | |
-webkit-transition-duration: 500ms; | |
-moz-transition-property: height; | |
-moz-transition-duration: 500ms; | |
transition-property: height; | |
transition-duration: 500ms; | |
} | |
/*properties of tooltip before "expand"*/ | |
.smalltooltip { | |
-webkit-transition-property: height; | |
-webkit-transition-duration: 500ms; | |
-moz-transition-property: height; | |
-moz-transition-duration: 500ms; | |
transition-property: height; | |
transition-duration: 500ms; | |
text-overflow: ellipsis; | |
overflow: hidden; | |
height: 80px; | |
} | |
.tooltipbuttons { | |
position: absolute; | |
padding-right: 15px; | |
top: 0px; | |
right: 0px; | |
} | |
.tooltiptext { | |
/*avoid the button to overlap on some docstring*/ | |
padding-right: 30px; | |
} | |
.ipython_tooltip { | |
max-width: 700px; | |
/*fade-in animation when inserted*/ | |
-webkit-animation: fadeOut 400ms; | |
-moz-animation: fadeOut 400ms; | |
animation: fadeOut 400ms; | |
-webkit-animation: fadeIn 400ms; | |
-moz-animation: fadeIn 400ms; | |
animation: fadeIn 400ms; | |
vertical-align: middle; | |
background-color: #f7f7f7; | |
overflow: visible; | |
border: #ababab 1px solid; | |
outline: none; | |
padding: 3px; | |
margin: 0px; | |
padding-left: 7px; | |
font-family: monospace; | |
min-height: 50px; | |
-moz-box-shadow: 0px 6px 10px -1px #adadad; | |
-webkit-box-shadow: 0px 6px 10px -1px #adadad; | |
box-shadow: 0px 6px 10px -1px #adadad; | |
border-radius: 2px; | |
position: absolute; | |
z-index: 1000; | |
} | |
.ipython_tooltip a { | |
float: right; | |
} | |
.ipython_tooltip .tooltiptext pre { | |
border: 0; | |
border-radius: 0; | |
font-size: 100%; | |
background-color: #f7f7f7; | |
} | |
.pretooltiparrow { | |
left: 0px; | |
margin: 0px; | |
top: -16px; | |
width: 40px; | |
height: 16px; | |
overflow: hidden; | |
position: absolute; | |
} | |
.pretooltiparrow:before { | |
background-color: #f7f7f7; | |
border: 1px #ababab solid; | |
z-index: 11; | |
content: ""; | |
position: absolute; | |
left: 15px; | |
top: 10px; | |
width: 25px; | |
height: 25px; | |
-webkit-transform: rotate(45deg); | |
-moz-transform: rotate(45deg); | |
-ms-transform: rotate(45deg); | |
-o-transform: rotate(45deg); | |
} | |
ul.typeahead-list i { | |
margin-left: -10px; | |
width: 18px; | |
} | |
[dir="rtl"] ul.typeahead-list i { | |
margin-left: 0; | |
margin-right: -10px; | |
} | |
ul.typeahead-list { | |
max-height: 80vh; | |
overflow: auto; | |
} | |
ul.typeahead-list > li > a { | |
/** Firefox bug **/ | |
/* see https://github.com/jupyter/notebook/issues/559 */ | |
white-space: normal; | |
} | |
ul.typeahead-list > li > a.pull-right { | |
float: left !important; | |
float: left; | |
} | |
[dir="rtl"] .typeahead-list { | |
text-align: right; | |
} | |
.cmd-palette .modal-body { | |
padding: 7px; | |
} | |
.cmd-palette form { | |
background: white; | |
} | |
.cmd-palette input { | |
outline: none; | |
} | |
.no-shortcut { | |
min-width: 20px; | |
color: transparent; | |
} | |
[dir="rtl"] .no-shortcut.pull-right { | |
float: left !important; | |
float: left; | |
} | |
[dir="rtl"] .command-shortcut.pull-right { | |
float: left !important; | |
float: left; | |
} | |
.command-shortcut:before { | |
content: "(command mode)"; | |
padding-right: 3px; | |
color: #777777; | |
} | |
.edit-shortcut:before { | |
content: "(edit)"; | |
padding-right: 3px; | |
color: #777777; | |
} | |
[dir="rtl"] .edit-shortcut.pull-right { | |
float: left !important; | |
float: left; | |
} | |
#find-and-replace #replace-preview .match, | |
#find-and-replace #replace-preview .insert { | |
background-color: #BBDEFB; | |
border-color: #90CAF9; | |
border-style: solid; | |
border-width: 1px; | |
border-radius: 0px; | |
} | |
[dir="ltr"] #find-and-replace .input-group-btn + .form-control { | |
border-left: none; | |
} | |
[dir="rtl"] #find-and-replace .input-group-btn + .form-control { | |
border-right: none; | |
} | |
#find-and-replace #replace-preview .replace .match { | |
background-color: #FFCDD2; | |
border-color: #EF9A9A; | |
border-radius: 0px; | |
} | |
#find-and-replace #replace-preview .replace .insert { | |
background-color: #C8E6C9; | |
border-color: #A5D6A7; | |
border-radius: 0px; | |
} | |
#find-and-replace #replace-preview { | |
max-height: 60vh; | |
overflow: auto; | |
} | |
#find-and-replace #replace-preview pre { | |
padding: 5px 10px; | |
} | |
.terminal-app { | |
background: #EEE; | |
} | |
.terminal-app #header { | |
background: #fff; | |
-webkit-box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2); | |
box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2); | |
} | |
.terminal-app .terminal { | |
width: 100%; | |
float: left; | |
font-family: monospace; | |
color: white; | |
background: black; | |
padding: 0.4em; | |
border-radius: 2px; | |
-webkit-box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.4); | |
box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.4); | |
} | |
.terminal-app .terminal, | |
.terminal-app .terminal dummy-screen { | |
line-height: 1em; | |
font-size: 14px; | |
} | |
.terminal-app .terminal .xterm-rows { | |
padding: 10px; | |
} | |
.terminal-app .terminal-cursor { | |
color: black; | |
background: white; | |
} | |
.terminal-app #terminado-container { | |
margin-top: 20px; | |
} | |
/*# sourceMappingURL=style.min.css.map */ | |
</style> | |
<style type="text/css"> | |
.highlight .hll { background-color: #ffffcc } | |
.highlight { background: #f8f8f8; } | |
.highlight .c { color: #408080; font-style: italic } /* Comment */ | |
.highlight .err { border: 1px solid #FF0000 } /* Error */ | |
.highlight .k { color: #008000; font-weight: bold } /* Keyword */ | |
.highlight .o { color: #666666 } /* Operator */ | |
.highlight .ch { color: #408080; font-style: italic } /* Comment.Hashbang */ | |
.highlight .cm { color: #408080; font-style: italic } /* Comment.Multiline */ | |
.highlight .cp { color: #BC7A00 } /* Comment.Preproc */ | |
.highlight .cpf { color: #408080; font-style: italic } /* Comment.PreprocFile */ | |
.highlight .c1 { color: #408080; font-style: italic } /* Comment.Single */ | |
.highlight .cs { color: #408080; font-style: italic } /* Comment.Special */ | |
.highlight .gd { color: #A00000 } /* Generic.Deleted */ | |
.highlight .ge { font-style: italic } /* Generic.Emph */ | |
.highlight .gr { color: #FF0000 } /* Generic.Error */ | |
.highlight .gh { color: #000080; font-weight: bold } /* Generic.Heading */ | |
.highlight .gi { color: #00A000 } /* Generic.Inserted */ | |
.highlight .go { color: #888888 } /* Generic.Output */ | |
.highlight .gp { color: #000080; font-weight: bold } /* Generic.Prompt */ | |
.highlight .gs { font-weight: bold } /* Generic.Strong */ | |
.highlight .gu { color: #800080; font-weight: bold } /* Generic.Subheading */ | |
.highlight .gt { color: #0044DD } /* Generic.Traceback */ | |
.highlight .kc { color: #008000; font-weight: bold } /* Keyword.Constant */ | |
.highlight .kd { color: #008000; font-weight: bold } /* Keyword.Declaration */ | |
.highlight .kn { color: #008000; font-weight: bold } /* Keyword.Namespace */ | |
.highlight .kp { color: #008000 } /* Keyword.Pseudo */ | |
.highlight .kr { color: #008000; font-weight: bold } /* Keyword.Reserved */ | |
.highlight .kt { color: #B00040 } /* Keyword.Type */ | |
.highlight .m { color: #666666 } /* Literal.Number */ | |
.highlight .s { color: #BA2121 } /* Literal.String */ | |
.highlight .na { color: #7D9029 } /* Name.Attribute */ | |
.highlight .nb { color: #008000 } /* Name.Builtin */ | |
.highlight .nc { color: #0000FF; font-weight: bold } /* Name.Class */ | |
.highlight .no { color: #880000 } /* Name.Constant */ | |
.highlight .nd { color: #AA22FF } /* Name.Decorator */ | |
.highlight .ni { color: #999999; font-weight: bold } /* Name.Entity */ | |
.highlight .ne { color: #D2413A; font-weight: bold } /* Name.Exception */ | |
.highlight .nf { color: #0000FF } /* Name.Function */ | |
.highlight .nl { color: #A0A000 } /* Name.Label */ | |
.highlight .nn { color: #0000FF; font-weight: bold } /* Name.Namespace */ | |
.highlight .nt { color: #008000; font-weight: bold } /* Name.Tag */ | |
.highlight .nv { color: #19177C } /* Name.Variable */ | |
.highlight .ow { color: #AA22FF; font-weight: bold } /* Operator.Word */ | |
.highlight .w { color: #bbbbbb } /* Text.Whitespace */ | |
.highlight .mb { color: #666666 } /* Literal.Number.Bin */ | |
.highlight .mf { color: #666666 } /* Literal.Number.Float */ | |
.highlight .mh { color: #666666 } /* Literal.Number.Hex */ | |
.highlight .mi { color: #666666 } /* Literal.Number.Integer */ | |
.highlight .mo { color: #666666 } /* Literal.Number.Oct */ | |
.highlight .sa { color: #BA2121 } /* Literal.String.Affix */ | |
.highlight .sb { color: #BA2121 } /* Literal.String.Backtick */ | |
.highlight .sc { color: #BA2121 } /* Literal.String.Char */ | |
.highlight .dl { color: #BA2121 } /* Literal.String.Delimiter */ | |
.highlight .sd { color: #BA2121; font-style: italic } /* Literal.String.Doc */ | |
.highlight .s2 { color: #BA2121 } /* Literal.String.Double */ | |
.highlight .se { color: #BB6622; font-weight: bold } /* Literal.String.Escape */ | |
.highlight .sh { color: #BA2121 } /* Literal.String.Heredoc */ | |
.highlight .si { color: #BB6688; font-weight: bold } /* Literal.String.Interpol */ | |
.highlight .sx { color: #008000 } /* Literal.String.Other */ | |
.highlight .sr { color: #BB6688 } /* Literal.String.Regex */ | |
.highlight .s1 { color: #BA2121 } /* Literal.String.Single */ | |
.highlight .ss { color: #19177C } /* Literal.String.Symbol */ | |
.highlight .bp { color: #008000 } /* Name.Builtin.Pseudo */ | |
.highlight .fm { color: #0000FF } /* Name.Function.Magic */ | |
.highlight .vc { color: #19177C } /* Name.Variable.Class */ | |
.highlight .vg { color: #19177C } /* Name.Variable.Global */ | |
.highlight .vi { color: #19177C } /* Name.Variable.Instance */ | |
.highlight .vm { color: #19177C } /* Name.Variable.Magic */ | |
.highlight .il { color: #666666 } /* Literal.Number.Integer.Long */ | |
</style> | |
<style type="text/css"> | |
/* Overrides of notebook CSS for static HTML export */ | |
body { | |
overflow: visible; | |
padding: 8px; | |
} | |
div#notebook { | |
overflow: visible; | |
border-top: none; | |
}@media print { | |
div.cell { | |
display: block; | |
page-break-inside: avoid; | |
} | |
div.output_wrapper { | |
display: block; | |
page-break-inside: avoid; | |
} | |
div.output { | |
display: block; | |
page-break-inside: avoid; | |
} | |
} | |
</style> | |
<!-- Custom stylesheet, it must be in the same directory as the html file --> | |
<link rel="stylesheet" href="custom.css"> | |
<!-- Loading mathjax macro --> | |
<!-- Load mathjax --> | |
<script src="https://cdnjs.cloudflare.com/ajax/libs/mathjax/2.7.5/latest.js?config=TeX-AMS_HTML"></script> | |
<!-- MathJax configuration --> | |
<script type="text/x-mathjax-config"> | |
MathJax.Hub.Config({ | |
tex2jax: { | |
inlineMath: [ ['$','$'], ["\\(","\\)"] ], | |
displayMath: [ ['$$','$$'], ["\\[","\\]"] ], | |
processEscapes: true, | |
processEnvironments: true | |
}, | |
// Center justify equations in code and markdown cells. Elsewhere | |
// we use CSS to left justify single line equations in code cells. | |
displayAlign: 'center', | |
"HTML-CSS": { | |
styles: {'.MathJax_Display': {"margin": 0}}, | |
linebreaks: { automatic: true } | |
} | |
}); | |
</script> | |
<!-- End of mathjax configuration --></head> | |
<body> | |
<div tabindex="-1" id="notebook" class="border-box-sizing"> | |
<div class="container" id="notebook-container"> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [1]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="kn">import</span> <span class="nn">rdkit</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [2]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">rdkit</span><span class="o">.</span><span class="n">__version__</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt output_prompt">Out[2]:</div> | |
<div class="output_text output_subarea output_execute_result"> | |
<pre>'2020.09.1dev1'</pre> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [3]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="kn">from</span> <span class="nn">rdkit</span> <span class="kn">import</span> <span class="n">Chem</span> | |
<span class="kn">from</span> <span class="nn">rdkit.Chem.Draw</span> <span class="kn">import</span> <span class="n">rdMolDraw2D</span> | |
<span class="kn">from</span> <span class="nn">IPython.display</span> <span class="kn">import</span> <span class="n">SVG</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [4]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="k">def</span> <span class="nf">draw</span><span class="p">(</span><span class="n">mol</span><span class="p">,</span> <span class="o">**</span><span class="n">kwargs</span><span class="p">):</span> | |
<span class="n">mol_draw</span> <span class="o">=</span> <span class="n">rdMolDraw2D</span><span class="o">.</span><span class="n">PrepareMolForDrawing</span><span class="p">(</span><span class="n">mol</span><span class="p">)</span> | |
<span class="n">draw_opt</span> <span class="o">=</span> <span class="n">rdMolDraw2D</span><span class="o">.</span><span class="n">MolDrawOptions</span><span class="p">()</span> | |
<span class="n">draw_opt</span><span class="o">.</span><span class="n">addAtomIndices</span> <span class="o">=</span> <span class="kc">True</span> | |
<span class="n">drawer</span> <span class="o">=</span> <span class="n">rdMolDraw2D</span><span class="o">.</span><span class="n">MolDraw2DSVG</span><span class="p">(</span><span class="mi">400</span><span class="p">,</span> <span class="mi">300</span><span class="p">)</span> | |
<span class="n">drawer</span><span class="o">.</span><span class="n">SetDrawOptions</span><span class="p">(</span><span class="n">draw_opt</span><span class="p">)</span> | |
<span class="n">drawer</span><span class="o">.</span><span class="n">DrawMolecule</span><span class="p">(</span><span class="n">mol_draw</span><span class="p">,</span> <span class="o">**</span><span class="n">kwargs</span><span class="p">)</span> | |
<span class="n">drawer</span><span class="o">.</span><span class="n">FinishDrawing</span><span class="p">()</span> | |
<span class="k">return</span> <span class="n">SVG</span><span class="p">(</span><span class="n">drawer</span><span class="o">.</span><span class="n">GetDrawingText</span><span class="p">())</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt"> | |
</div><div class="inner_cell"> | |
<div class="text_cell_render border-box-sizing rendered_html"> | |
<h2>Case 1</h2> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [5]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">m1</span> <span class="o">=</span> <span class="n">Chem</span><span class="o">.</span><span class="n">MolFromSmiles</span><span class="p">(</span><span class="s2">"C(C(C)C1)C12CN(C3)CCCCC23"</span><span class="p">)</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt"> | |
</div><div class="inner_cell"> | |
<div class="text_cell_render border-box-sizing rendered_html"> | |
<p>I believe this molecule has 3 stereocenters, i.e. 1 (a variant of the edge case shown by Ricardo with the cyclobutane bearing and exocyclic double bond), 6 (the N is not invertible) and 12</p> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [6]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">draw</span><span class="p">(</span><span class="n">m1</span><span class="p">,</span> <span class="n">highlightAtoms</span><span class="o">=</span><span class="p">[</span><span class="mi">1</span><span class="p">,</span> <span class="mi">6</span><span class="p">,</span> <span class="mi">12</span><span class="p">])</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt output_prompt">Out[6]:</div> | |
<div class="output_svg output_subarea output_execute_result"> | |
<svg baseProfile="full" height="300px" version="1.1" viewBox="0 0 400 300" width="400px" xml:space="preserve" xmlns="http://www.w3.org/2000/svg" xmlns:rdkit="http://www.rdkit.org/xml" xmlns:xlink="http://www.w3.org/1999/xlink"> | |
<!-- END OF HEADER --> | |
<rect height="300" style="opacity:1.0;fill:#FFFFFF;stroke:none" width="400" x="0" y="0"> </rect> | |
<ellipse cx="316.154" cy="146.364" rx="13.3262" ry="13.3262" style="fill:#FF7F7F;fill-rule:evenodd;stroke:#FF7F7F;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<ellipse cx="122.483" cy="223.587" rx="13.3262" ry="13.3431" style="fill:#FF7F7F;fill-rule:evenodd;stroke:#FF7F7F;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<ellipse cx="175.544" cy="115.883" rx="13.3262" ry="13.3262" style="fill:#FF7F7F;fill-rule:evenodd;stroke:#FF7F7F;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-0" d="M 261.725,107.93 L 316.154,146.364" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-3" d="M 261.725,107.93 L 223.291,162.359" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-1" d="M 316.154,146.364 L 381.818,135.054" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-2" d="M 316.154,146.364 L 277.719,200.793" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-12" d="M 277.719,200.793 L 223.291,162.359" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-4" d="M 223.291,162.359 L 193.844,222.13" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-13" d="M 223.291,162.359 L 175.544,115.883" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-5" d="M 193.844,222.13 L 162.634,222.767" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-5" d="M 162.634,222.767 L 131.424,223.404" style="fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-6" d="M 131.305,216.68 L 153.126,199.596" style="fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-6" d="M 153.126,199.596 L 174.947,182.511" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-7" d="M 113.661,221.49 L 85.6595,214.835" style="fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-7" d="M 85.6595,214.835 L 57.6579,208.179" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-14" d="M 174.947,182.511 L 175.544,115.883" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-8" d="M 57.6579,208.179 L 29.2866,147.89" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-9" d="M 29.2866,147.89 L 58.7333,88.1186" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-10" d="M 58.7333,88.1186 L 123.824,73.8741" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-11" d="M 123.824,73.8741 L 175.544,115.883" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="atom-6" d="M 118.312 214.152 L 124.495 224.147 Q 125.108 225.133, 126.095 226.919 Q 127.081 228.704, 127.134 228.811 L 127.134 214.152 L 129.639 214.152 L 129.639 233.022 L 127.054 233.022 L 120.418 222.094 Q 119.645 220.815, 118.818 219.349 Q 118.019 217.883, 117.779 217.43 L 117.779 233.022 L 115.327 233.022 L 115.327 214.152 L 118.312 214.152 " fill="#0000FF"/> | |
<path class="note" d="M 259.84 101.863 Q 258.108 101.863, 257.241 100.584 Q 256.389 99.3045, 256.389 97.0257 Q 256.389 94.7469, 257.241 93.4809 Q 258.094 92.2149, 259.84 92.2149 Q 261.586 92.2149, 262.439 93.4809 Q 263.291 94.7469, 263.291 97.0257 Q 263.291 99.3045, 262.425 100.584 Q 261.572 101.863, 259.84 101.863 M 259.84 100.797 Q 260.866 100.797, 261.412 99.8509 Q 261.959 98.8914, 261.959 97.0257 Q 261.959 95.1734, 261.412 94.2272 Q 260.866 93.281, 259.84 93.281 Q 258.827 93.281, 258.268 94.2272 Q 257.721 95.1734, 257.721 97.0257 Q 257.721 98.8914, 258.268 99.8509 Q 258.827 100.797, 259.84 100.797 " fill="#000000"/> | |
<path class="note" d="M 316.275 139.21 L 318.341 139.21 L 318.341 132.16 L 316.062 132.867 L 315.755 132.08 L 318.647 130.788 L 319.593 130.948 L 319.593 139.21 L 321.446 139.21 L 321.446 140.276 L 316.275 140.276 L 316.275 139.21 " fill="#000000"/> | |
<path class="note" d="M 376.782 121.232 Q 377.128 120.339, 377.954 119.846 Q 378.78 119.34, 379.927 119.34 Q 381.352 119.34, 382.152 120.112 Q 382.952 120.885, 382.952 122.258 Q 382.952 123.657, 381.912 124.963 Q 380.886 126.269, 378.754 127.815 L 383.112 127.815 L 383.112 128.881 L 376.755 128.881 L 376.755 127.988 Q 378.514 126.736, 379.553 125.803 Q 380.606 124.87, 381.113 124.03 Q 381.619 123.191, 381.619 122.325 Q 381.619 121.418, 381.166 120.912 Q 380.713 120.406, 379.927 120.406 Q 379.167 120.406, 378.661 120.712 Q 378.154 121.019, 377.794 121.698 L 376.782 121.232 " fill="#000000"/> | |
<path class="note" d="M 280.964 211.537 Q 281.883 211.804, 282.323 212.403 Q 282.776 212.99, 282.776 213.923 Q 282.776 214.722, 282.376 215.349 Q 281.976 215.962, 281.244 216.308 Q 280.511 216.641, 279.551 216.641 Q 278.538 216.641, 277.779 216.295 Q 277.032 215.935, 276.433 215.215 L 277.192 214.442 Q 277.779 215.082, 278.272 215.335 Q 278.765 215.575, 279.551 215.575 Q 280.404 215.575, 280.924 215.122 Q 281.443 214.656, 281.443 213.909 Q 281.443 212.95, 280.897 212.523 Q 280.364 212.084, 279.205 212.084 L 278.525 212.084 L 278.525 211.124 L 279.125 211.124 Q 280.151 211.111, 280.697 210.671 Q 281.244 210.218, 281.244 209.378 Q 281.244 208.765, 280.79 208.406 Q 280.337 208.032, 279.564 208.032 Q 278.778 208.032, 278.285 208.312 Q 277.805 208.592, 277.432 209.298 L 276.513 208.805 Q 276.846 208.019, 277.645 207.499 Q 278.445 206.966, 279.564 206.966 Q 280.95 206.966, 281.763 207.619 Q 282.576 208.272, 282.576 209.378 Q 282.576 210.138, 282.163 210.684 Q 281.75 211.231, 280.964 211.537 " fill="#000000"/> | |
<path class="note" d="M 247.998 164.12 L 249.131 164.12 L 249.131 165.186 L 247.998 165.186 L 247.998 167.358 L 246.745 167.358 L 246.745 165.186 L 241.868 165.186 L 241.868 164.346 L 245.999 157.923 L 247.998 157.923 L 247.998 164.12 M 243.414 164.12 L 246.745 164.12 L 246.745 158.776 L 243.414 164.12 " fill="#000000"/> | |
<path class="note" d="M 200.039 230.313 Q 200.865 230.313, 201.545 230.673 Q 202.225 231.019, 202.611 231.686 Q 202.998 232.339, 202.998 233.231 Q 202.998 234.204, 202.518 234.911 Q 202.051 235.603, 201.278 235.963 Q 200.506 236.323, 199.626 236.323 Q 198.76 236.323, 197.96 236.003 Q 197.161 235.683, 196.614 235.07 L 197.414 234.244 Q 197.854 234.724, 198.453 234.99 Q 199.053 235.244, 199.666 235.244 Q 200.506 235.244, 201.079 234.724 Q 201.665 234.204, 201.665 233.258 Q 201.665 232.259, 201.079 231.792 Q 200.506 231.312, 199.586 231.312 Q 198.76 231.312, 197.84 231.672 L 197.107 231.326 L 197.56 226.782 L 202.411 226.782 L 202.278 227.848 L 198.653 227.848 L 198.373 230.646 Q 199.213 230.313, 200.039 230.313 " fill="#000000"/> | |
<path class="note" d="M 126.907 200.621 Q 127.733 200.621, 128.386 200.981 Q 129.039 201.341, 129.399 201.994 Q 129.759 202.647, 129.759 203.473 Q 129.759 204.392, 129.346 205.112 Q 128.946 205.818, 128.226 206.218 Q 127.507 206.618, 126.587 206.618 Q 124.908 206.618, 124.055 205.485 Q 123.216 204.339, 123.216 202.074 Q 123.216 199.568, 124.255 198.276 Q 125.308 196.97, 127.32 196.97 Q 127.906 196.97, 128.399 197.103 Q 128.906 197.236, 129.386 197.516 L 128.866 198.409 Q 128.173 198.036, 127.333 198.036 Q 126.001 198.036, 125.321 198.902 Q 124.641 199.755, 124.562 201.527 Q 125.041 201.088, 125.641 200.861 Q 126.254 200.621, 126.907 200.621 M 126.6 205.525 Q 127.107 205.525, 127.52 205.259 Q 127.946 204.992, 128.186 204.526 Q 128.426 204.059, 128.426 203.486 Q 128.426 202.647, 127.96 202.167 Q 127.493 201.687, 126.667 201.687 Q 126.094 201.687, 125.521 201.927 Q 124.961 202.154, 124.562 202.553 Q 124.615 204.113, 125.108 204.819 Q 125.601 205.525, 126.6 205.525 " fill="#000000"/> | |
<path class="note" d="M 186.722 183.768 L 181.778 183.768 L 181.778 182.702 L 188.041 182.702 L 188.041 183.648 L 184.23 192.137 L 182.95 192.137 L 186.722 183.768 " fill="#000000"/> | |
<path class="note" d="M 52.1357 216.572 Q 53.0019 216.946, 53.4949 217.505 Q 53.988 218.052, 53.988 218.984 Q 53.988 219.784, 53.5749 220.41 Q 53.1618 221.023, 52.4155 221.37 Q 51.6826 221.703, 50.7098 221.703 Q 49.1373 221.703, 48.2311 220.983 Q 47.3249 220.25, 47.3249 218.984 Q 47.3249 218.212, 47.7247 217.639 Q 48.1245 217.052, 48.9507 216.612 Q 48.3377 216.266, 48.0045 215.76 Q 47.6714 215.24, 47.6714 214.44 Q 47.6714 213.334, 48.471 212.681 Q 49.2839 212.028, 50.6565 212.028 Q 52.0291 212.028, 52.8286 212.681 Q 53.6415 213.334, 53.6415 214.44 Q 53.6415 215.133, 53.2551 215.653 Q 52.8819 216.159, 52.1357 216.572 M 50.6565 213.028 Q 49.8702 213.028, 49.4304 213.401 Q 49.004 213.774, 49.004 214.44 Q 49.004 214.933, 49.2972 215.266 Q 49.5904 215.586, 50.0035 215.773 Q 50.4299 215.959, 51.2428 216.239 Q 51.8158 215.839, 52.0557 215.413 Q 52.3089 214.987, 52.3089 214.44 Q 52.3089 213.774, 51.8691 213.401 Q 51.4427 213.028, 50.6565 213.028 M 50.7098 220.704 Q 51.5893 220.704, 52.1223 220.237 Q 52.6554 219.757, 52.6554 218.971 Q 52.6554 218.465, 52.3755 218.145 Q 52.0957 217.825, 51.6693 217.639 Q 51.2561 217.452, 50.5099 217.212 L 49.9102 217.012 Q 49.2439 217.412, 48.9507 217.892 Q 48.6575 218.358, 48.6575 218.971 Q 48.6575 219.757, 49.2172 220.237 Q 49.7769 220.704, 50.7098 220.704 " fill="#000000"/> | |
<path class="note" d="M 18.0819 143.02 Q 19.761 143.02, 20.6005 144.166 Q 21.4534 145.298, 21.4534 147.564 Q 21.4534 150.069, 20.4006 151.375 Q 19.3612 152.668, 17.3489 152.668 Q 16.7626 152.668, 16.2562 152.535 Q 15.7631 152.401, 15.2834 152.121 L 15.8031 151.229 Q 16.496 151.602, 17.3356 151.602 Q 18.6682 151.602, 19.3479 150.749 Q 20.0275 149.883, 20.1075 148.11 Q 19.6277 148.55, 19.0147 148.79 Q 18.415 149.016, 17.762 149.016 Q 16.9358 149.016, 16.2828 148.657 Q 15.6298 148.297, 15.27 147.644 Q 14.9102 146.991, 14.9102 146.165 Q 14.9102 145.245, 15.31 144.539 Q 15.7231 143.819, 16.4427 143.419 Q 17.1624 143.02, 18.0819 143.02 M 16.2429 146.151 Q 16.2429 146.991, 16.7093 147.471 Q 17.1757 147.95, 18.0019 147.95 Q 18.5749 147.95, 19.1346 147.724 Q 19.7077 147.484, 20.1075 147.084 Q 20.0542 145.525, 19.5611 144.819 Q 19.068 144.112, 18.0685 144.112 Q 17.5621 144.112, 17.1357 144.379 Q 16.7226 144.645, 16.4827 145.112 Q 16.2429 145.578, 16.2429 146.151 " fill="#000000"/> | |
<path class="note" d="M 42.8588 83.0792 L 44.9244 83.0792 L 44.9244 76.0296 L 42.6456 76.7359 L 42.3391 75.9497 L 45.2309 74.657 L 46.177 74.8169 L 46.177 83.0792 L 48.0294 83.0792 L 48.0294 84.1453 L 42.8588 84.1453 L 42.8588 83.0792 " fill="#000000"/> | |
<path class="note" d="M 52.2938 84.2519 Q 50.5614 84.2519, 49.6952 82.9726 Q 48.8423 81.6933, 48.8423 79.4145 Q 48.8423 77.1357, 49.6952 75.8697 Q 50.548 74.6037, 52.2938 74.6037 Q 54.0395 74.6037, 54.8924 75.8697 Q 55.7453 77.1357, 55.7453 79.4145 Q 55.7453 81.6933, 54.8791 82.9726 Q 54.0262 84.2519, 52.2938 84.2519 M 52.2938 83.1858 Q 53.3199 83.1858, 53.8663 82.2396 Q 54.4126 81.2802, 54.4126 79.4145 Q 54.4126 77.5621, 53.8663 76.616 Q 53.3199 75.6698, 52.2938 75.6698 Q 51.281 75.6698, 50.7213 76.616 Q 50.1749 77.5621, 50.1749 79.4145 Q 50.1749 81.2802, 50.7213 82.2396 Q 51.281 83.1858, 52.2938 83.1858 " fill="#000000"/> | |
<path class="note" d="M 118.016 66.748 L 120.082 66.748 L 120.082 59.6984 L 117.803 60.4047 L 117.497 59.6184 L 120.389 58.3258 L 121.335 58.4857 L 121.335 66.748 L 123.187 66.748 L 123.187 67.8141 L 118.016 67.8141 L 118.016 66.748 " fill="#000000"/> | |
<path class="note" d="M 124.426 66.748 L 126.492 66.748 L 126.492 59.6984 L 124.213 60.4047 L 123.907 59.6184 L 126.798 58.3258 L 127.745 58.4857 L 127.745 66.748 L 129.597 66.748 L 129.597 67.8141 L 124.426 67.8141 L 124.426 66.748 " fill="#000000"/> | |
<path class="note" d="M 159.481 127.885 L 161.547 127.885 L 161.547 120.835 L 159.268 121.542 L 158.961 120.755 L 161.853 119.463 L 162.799 119.623 L 162.799 127.885 L 164.652 127.885 L 164.652 128.951 L 159.481 128.951 L 159.481 127.885 " fill="#000000"/> | |
<path class="note" d="M 165.345 121.302 Q 165.691 120.409, 166.517 119.916 Q 167.343 119.409, 168.49 119.409 Q 169.915 119.409, 170.715 120.182 Q 171.515 120.955, 171.515 122.328 Q 171.515 123.727, 170.475 125.033 Q 169.449 126.339, 167.317 127.885 L 171.675 127.885 L 171.675 128.951 L 165.318 128.951 L 165.318 128.058 Q 167.077 126.805, 168.116 125.873 Q 169.169 124.94, 169.676 124.1 Q 170.182 123.261, 170.182 122.394 Q 170.182 121.488, 169.729 120.982 Q 169.276 120.475, 168.49 120.475 Q 167.73 120.475, 167.224 120.782 Q 166.717 121.088, 166.357 121.768 L 165.345 121.302 " fill="#000000"/> | |
</svg> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [7]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">stereo</span> <span class="o">=</span> <span class="nb">tuple</span><span class="p">(</span><span class="n">Chem</span><span class="o">.</span><span class="n">FindPotentialStereo</span><span class="p">(</span><span class="n">m1</span><span class="p">,</span> <span class="n">cleanIt</span><span class="o">=</span><span class="kc">True</span><span class="p">))</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt"> | |
</div><div class="inner_cell"> | |
<div class="text_cell_render border-box-sizing rendered_html"> | |
<p><code>Chem.FindPotentialStereo()</code> returns only 12:</p> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [8]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="nb">len</span><span class="p">(</span><span class="n">stereo</span><span class="p">)</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt output_prompt">Out[8]:</div> | |
<div class="output_text output_subarea output_execute_result"> | |
<pre>1</pre> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [9]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="k">for</span> <span class="n">si</span> <span class="ow">in</span> <span class="n">stereo</span><span class="p">:</span> | |
<span class="nb">print</span><span class="p">(</span><span class="n">si</span><span class="o">.</span><span class="n">centeredOn</span><span class="p">,</span> <span class="n">si</span><span class="o">.</span><span class="n">descriptor</span><span class="p">,</span> <span class="n">si</span><span class="o">.</span><span class="n">specified</span><span class="p">,</span> <span class="n">si</span><span class="o">.</span><span class="n">type</span><span class="p">)</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt"></div> | |
<div class="output_subarea output_stream output_stdout output_text"> | |
<pre>12 NoValue Unspecified Atom_Tetrahedral | |
</pre> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt"> | |
</div><div class="inner_cell"> | |
<div class="text_cell_render border-box-sizing rendered_html"> | |
<h2>Case 1 (after canonicalization)</h2> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt"> | |
</div><div class="inner_cell"> | |
<div class="text_cell_render border-box-sizing rendered_html"> | |
<p>Oddly, the result is quite different if I canonicalize the SMILES first:</p> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [10]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">m1can</span> <span class="o">=</span> <span class="n">Chem</span><span class="o">.</span><span class="n">MolToSmiles</span><span class="p">(</span><span class="n">m1</span><span class="p">)</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [11]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">m1can</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt output_prompt">Out[11]:</div> | |
<div class="output_text output_subarea output_execute_result"> | |
<pre>'CC1CC2(C1)CN1CCCCC2C1'</pre> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt"> | |
</div><div class="inner_cell"> | |
<div class="text_cell_render border-box-sizing rendered_html"> | |
<p>Stereochemistry does not "stick" on atom 1, so I am unable to define its chirality from the SMILES string:</p> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [12]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">m1can</span> <span class="o">=</span> <span class="s2">"C[C@H]1CC2(C1)CN1CCCC[C@H]2C1"</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [13]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">m1can</span> <span class="o">=</span> <span class="n">Chem</span><span class="o">.</span><span class="n">MolFromSmiles</span><span class="p">(</span><span class="n">m1can</span><span class="p">)</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt"> | |
</div><div class="inner_cell"> | |
<div class="text_cell_render border-box-sizing rendered_html"> | |
<p>In this case I think chiral atoms should be 1, 6 and 11:</p> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [14]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">draw</span><span class="p">(</span><span class="n">m1can</span><span class="p">,</span> <span class="n">highlightAtoms</span><span class="o">=</span><span class="p">[</span><span class="mi">1</span><span class="p">,</span> <span class="mi">6</span><span class="p">,</span> <span class="mi">11</span><span class="p">],</span> <span class="n">highlightBonds</span><span class="o">=</span><span class="p">[])</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt output_prompt">Out[14]:</div> | |
<div class="output_svg output_subarea output_execute_result"> | |
<svg baseProfile="full" height="300px" version="1.1" viewBox="0 0 400 300" width="400px" xml:space="preserve" xmlns="http://www.w3.org/2000/svg" xmlns:rdkit="http://www.rdkit.org/xml" xmlns:xlink="http://www.w3.org/1999/xlink"> | |
<!-- END OF HEADER --> | |
<rect height="300" style="opacity:1.0;fill:#FFFFFF;stroke:none" width="400" x="0" y="0"> </rect> | |
<ellipse cx="315.868" cy="152.446" rx="13.3181" ry="13.3181" style="fill:#FF7F7F;fill-rule:evenodd;stroke:#FF7F7F;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<ellipse cx="119.963" cy="223.44" rx="13.3181" ry="13.335" style="fill:#FF7F7F;fill-rule:evenodd;stroke:#FF7F7F;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<ellipse cx="176.381" cy="117.538" rx="13.3181" ry="13.3181" style="fill:#FF7F7F;fill-rule:evenodd;stroke:#FF7F7F;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-0" d="M 381.818,143.231 L 315.868,152.446" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-1" d="M 315.868,152.446 L 275.75,205.595" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-12" d="M 315.868,152.446 L 262.719,112.328" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-2" d="M 275.75,205.595 L 222.601,165.477" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-3" d="M 222.601,165.477 L 262.719,112.328" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-4" d="M 222.601,165.477 L 191.291,224.248" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-14" d="M 222.601,165.477 L 176.381,117.538" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-5" d="M 191.291,224.248 L 160.095,223.895" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-5" d="M 160.095,223.895 L 128.898,223.541" style="fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-6" d="M 111.147,221.046 L 83.4226,213.52" style="fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-6" d="M 83.4226,213.52 L 55.6987,205.993" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-13" d="M 128.78,216.978 L 151.226,200.526" style="fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-13" d="M 151.226,200.526 L 173.672,184.074" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-7" d="M 55.6987,205.993 L 29.2711,144.871" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-8" d="M 29.2711,144.871 L 60.5809,86.0999" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-9" d="M 60.5809,86.0999 L 126.051,73.9359" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-10" d="M 126.051,73.9359 L 176.381,117.538" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-11" d="M 176.381,117.538 L 173.672,184.074" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-15" d="M 176.381,117.538 L 222.675,87.1912 L 217.823,80.8419 Z" style="fill:#000000;fill-rule:evenodd;fill-opacity:1;stroke:#000000;stroke-width:2px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;"/> | |
<path class="atom-6" d="M 115.795 214.011 L 121.974 223.999 Q 122.587 224.985, 123.572 226.769 Q 124.558 228.554, 124.611 228.661 L 124.611 214.011 L 127.115 214.011 L 127.115 232.869 L 124.531 232.869 L 117.899 221.948 Q 117.126 220.67, 116.301 219.205 Q 115.502 217.74, 115.262 217.287 L 115.262 232.869 L 112.811 232.869 L 112.811 214.011 L 115.795 214.011 " fill="#0000FF"/> | |
<path class="atom-13" d="M 221.914 67.677 L 224.471 67.677 L 224.471 75.6945 L 234.113 75.6945 L 234.113 67.677 L 236.671 67.677 L 236.671 86.5355 L 234.113 86.5355 L 234.113 77.8254 L 224.471 77.8254 L 224.471 86.5355 L 221.914 86.5355 L 221.914 67.677 " fill="#000000"/> | |
<path class="note" d="M 380.282 137.114 Q 378.551 137.114, 377.685 135.835 Q 376.833 134.557, 376.833 132.28 Q 376.833 130.002, 377.685 128.737 Q 378.538 127.472, 380.282 127.472 Q 382.027 127.472, 382.879 128.737 Q 383.732 130.002, 383.732 132.28 Q 383.732 134.557, 382.866 135.835 Q 382.014 137.114, 380.282 137.114 M 380.282 136.049 Q 381.308 136.049, 381.854 135.103 Q 382.4 134.144, 382.4 132.28 Q 382.4 130.428, 381.854 129.483 Q 381.308 128.537, 380.282 128.537 Q 379.27 128.537, 378.711 129.483 Q 378.165 130.428, 378.165 132.28 Q 378.165 134.144, 378.711 135.103 Q 379.27 136.049, 380.282 136.049 " fill="#000000"/> | |
<path class="note" d="M 319.169 165.689 L 321.234 165.689 L 321.234 158.644 L 318.956 159.349 L 318.65 158.564 L 321.54 157.272 L 322.485 157.432 L 322.485 165.689 L 324.337 165.689 L 324.337 166.754 L 319.169 166.754 L 319.169 165.689 " fill="#000000"/> | |
<path class="note" d="M 274.136 213.71 Q 274.482 212.818, 275.308 212.325 Q 276.134 211.819, 277.279 211.819 Q 278.704 211.819, 279.503 212.591 Q 280.302 213.364, 280.302 214.736 Q 280.302 216.134, 279.263 217.439 Q 278.238 218.744, 276.107 220.289 L 280.462 220.289 L 280.462 221.355 L 274.109 221.355 L 274.109 220.462 Q 275.867 219.21, 276.906 218.278 Q 277.958 217.346, 278.464 216.507 Q 278.97 215.668, 278.97 214.802 Q 278.97 213.897, 278.518 213.39 Q 278.065 212.884, 277.279 212.884 Q 276.52 212.884, 276.014 213.191 Q 275.508 213.497, 275.148 214.176 L 274.136 213.71 " fill="#000000"/> | |
<path class="note" d="M 212.967 166.813 Q 213.886 167.079, 214.326 167.679 Q 214.779 168.265, 214.779 169.197 Q 214.779 169.996, 214.379 170.622 Q 213.98 171.235, 213.247 171.581 Q 212.515 171.914, 211.556 171.914 Q 210.543 171.914, 209.784 171.568 Q 209.039 171.208, 208.439 170.489 L 209.198 169.716 Q 209.784 170.356, 210.277 170.609 Q 210.77 170.848, 211.556 170.848 Q 212.408 170.848, 212.927 170.396 Q 213.447 169.929, 213.447 169.184 Q 213.447 168.225, 212.901 167.799 Q 212.368 167.359, 211.209 167.359 L 210.53 167.359 L 210.53 166.4 L 211.129 166.4 Q 212.155 166.387, 212.701 165.947 Q 213.247 165.494, 213.247 164.655 Q 213.247 164.043, 212.794 163.683 Q 212.341 163.31, 211.569 163.31 Q 210.783 163.31, 210.29 163.59 Q 209.811 163.87, 209.438 164.576 L 208.519 164.083 Q 208.852 163.297, 209.651 162.778 Q 210.45 162.245, 211.569 162.245 Q 212.954 162.245, 213.766 162.897 Q 214.579 163.55, 214.579 164.655 Q 214.579 165.415, 214.166 165.961 Q 213.753 166.507, 212.967 166.813 " fill="#000000"/> | |
<path class="note" d="M 263.68 102.814 L 264.812 102.814 L 264.812 103.88 L 263.68 103.88 L 263.68 106.051 L 262.428 106.051 L 262.428 103.88 L 257.554 103.88 L 257.554 103.041 L 261.682 96.6213 L 263.68 96.6213 L 263.68 102.814 M 259.099 102.814 L 262.428 102.814 L 262.428 97.4737 L 259.099 102.814 " fill="#000000"/> | |
<path class="note" d="M 197.182 232.61 Q 198.008 232.61, 198.687 232.97 Q 199.366 233.316, 199.753 233.982 Q 200.139 234.635, 200.139 235.527 Q 200.139 236.499, 199.659 237.205 Q 199.193 237.898, 198.421 238.257 Q 197.648 238.617, 196.769 238.617 Q 195.904 238.617, 195.105 238.297 Q 194.305 237.978, 193.759 237.365 L 194.559 236.539 Q 194.998 237.019, 195.597 237.285 Q 196.197 237.538, 196.809 237.538 Q 197.648 237.538, 198.221 237.019 Q 198.807 236.499, 198.807 235.554 Q 198.807 234.555, 198.221 234.089 Q 197.648 233.609, 196.729 233.609 Q 195.904 233.609, 194.985 233.969 L 194.252 233.622 L 194.705 229.081 L 199.553 229.081 L 199.42 230.146 L 195.797 230.146 L 195.517 232.943 Q 196.356 232.61, 197.182 232.61 " fill="#000000"/> | |
<path class="note" d="M 123.441 200.336 Q 124.267 200.336, 124.919 200.696 Q 125.572 201.055, 125.931 201.708 Q 126.291 202.36, 126.291 203.186 Q 126.291 204.105, 125.878 204.824 Q 125.478 205.53, 124.759 205.93 Q 124.04 206.329, 123.121 206.329 Q 121.443 206.329, 120.591 205.197 Q 119.752 204.052, 119.752 201.788 Q 119.752 199.284, 120.79 197.992 Q 121.843 196.687, 123.854 196.687 Q 124.44 196.687, 124.932 196.82 Q 125.439 196.953, 125.918 197.233 L 125.399 198.125 Q 124.706 197.752, 123.867 197.752 Q 122.535 197.752, 121.856 198.618 Q 121.177 199.47, 121.097 201.242 Q 121.576 200.802, 122.176 200.576 Q 122.788 200.336, 123.441 200.336 M 123.134 205.237 Q 123.641 205.237, 124.053 204.971 Q 124.48 204.704, 124.719 204.238 Q 124.959 203.772, 124.959 203.199 Q 124.959 202.36, 124.493 201.881 Q 124.027 201.401, 123.201 201.401 Q 122.628 201.401, 122.056 201.641 Q 121.496 201.868, 121.097 202.267 Q 121.15 203.825, 121.643 204.531 Q 122.136 205.237, 123.134 205.237 " fill="#000000"/> | |
<path class="note" d="M 50.2428 210.732 L 45.3018 210.732 L 45.3018 209.667 L 51.5613 209.667 L 51.5613 210.612 L 47.7524 219.096 L 46.4738 219.096 L 50.2428 210.732 " fill="#000000"/> | |
<path class="note" d="M 19.6601 144.193 Q 20.5258 144.566, 21.0186 145.125 Q 21.5114 145.671, 21.5114 146.603 Q 21.5114 147.403, 21.0985 148.028 Q 20.6856 148.641, 19.9398 148.987 Q 19.2073 149.32, 18.2351 149.32 Q 16.6636 149.32, 15.7579 148.601 Q 14.8523 147.869, 14.8523 146.603 Q 14.8523 145.831, 15.2518 145.258 Q 15.6514 144.672, 16.4771 144.233 Q 15.8645 143.887, 15.5315 143.38 Q 15.1986 142.861, 15.1986 142.062 Q 15.1986 140.957, 15.9976 140.304 Q 16.81 139.651, 18.1818 139.651 Q 19.5536 139.651, 20.3527 140.304 Q 21.1651 140.957, 21.1651 142.062 Q 21.1651 142.754, 20.7789 143.274 Q 20.4059 143.78, 19.6601 144.193 M 18.1818 140.65 Q 17.396 140.65, 16.9565 141.023 Q 16.5304 141.396, 16.5304 142.062 Q 16.5304 142.555, 16.8234 142.888 Q 17.1164 143.207, 17.5292 143.394 Q 17.9554 143.58, 18.7678 143.86 Q 19.3405 143.46, 19.5802 143.034 Q 19.8333 142.608, 19.8333 142.062 Q 19.8333 141.396, 19.3938 141.023 Q 18.9676 140.65, 18.1818 140.65 M 18.2351 148.321 Q 19.1141 148.321, 19.6468 147.855 Q 20.1795 147.376, 20.1795 146.59 Q 20.1795 146.084, 19.8999 145.764 Q 19.6202 145.445, 19.194 145.258 Q 18.7811 145.072, 18.0353 144.832 L 17.436 144.632 Q 16.7701 145.032, 16.4771 145.511 Q 16.1841 145.977, 16.1841 146.59 Q 16.1841 147.376, 16.7435 147.855 Q 17.3028 148.321, 18.2351 148.321 " fill="#000000"/> | |
<path class="note" d="M 53.92 72.3806 Q 55.5981 72.3806, 56.4371 73.5259 Q 57.2895 74.658, 57.2895 76.9221 Q 57.2895 79.4259, 56.2374 80.731 Q 55.1985 82.0229, 53.1875 82.0229 Q 52.6015 82.0229, 52.0954 81.8897 Q 51.6026 81.7565, 51.1232 81.4769 L 51.6426 80.5845 Q 52.3351 80.9575, 53.1742 80.9575 Q 54.506 80.9575, 55.1852 80.1051 Q 55.8644 79.2394, 55.9444 77.4681 Q 55.4649 77.9076, 54.8523 78.1473 Q 54.253 78.3737, 53.6004 78.3737 Q 52.7746 78.3737, 52.122 78.0141 Q 51.4695 77.6546, 51.1099 77.002 Q 50.7503 76.3494, 50.7503 75.5237 Q 50.7503 74.6047, 51.1498 73.8988 Q 51.5627 73.1797, 52.2819 72.7801 Q 53.001 72.3806, 53.92 72.3806 M 52.0821 75.5103 Q 52.0821 76.3494, 52.5482 76.8288 Q 53.0144 77.3083, 53.8401 77.3083 Q 54.4128 77.3083, 54.9721 77.0819 Q 55.5448 76.8421, 55.9444 76.4426 Q 55.8911 74.8844, 55.3983 74.1785 Q 54.9055 73.4727, 53.9067 73.4727 Q 53.4006 73.4727, 52.9744 73.739 Q 52.5615 74.0054, 52.3218 74.4715 Q 52.0821 74.9377, 52.0821 75.5103 " fill="#000000"/> | |
<path class="note" d="M 119.936 66.9276 L 122 66.9276 L 122 59.8823 L 119.723 60.5881 L 119.417 59.8024 L 122.307 58.5105 L 123.252 58.6703 L 123.252 66.9276 L 125.103 66.9276 L 125.103 67.993 L 119.936 67.993 L 119.936 66.9276 " fill="#000000"/> | |
<path class="note" d="M 129.365 68.0996 Q 127.634 68.0996, 126.768 66.821 Q 125.916 65.5425, 125.916 63.2651 Q 125.916 60.9877, 126.768 59.7225 Q 127.621 58.4572, 129.365 58.4572 Q 131.11 58.4572, 131.962 59.7225 Q 132.815 60.9877, 132.815 63.2651 Q 132.815 65.5425, 131.949 66.821 Q 131.097 68.0996, 129.365 68.0996 M 129.365 67.0341 Q 130.391 67.0341, 130.937 66.0885 Q 131.483 65.1296, 131.483 63.2651 Q 131.483 61.4139, 130.937 60.4683 Q 130.391 59.5227, 129.365 59.5227 Q 128.353 59.5227, 127.794 60.4683 Q 127.248 61.4139, 127.248 63.2651 Q 127.248 65.1296, 127.794 66.0885 Q 128.353 67.0341, 129.365 67.0341 " fill="#000000"/> | |
<path class="note" d="M 157.824 125.619 L 159.888 125.619 L 159.888 118.574 L 157.611 119.279 L 157.305 118.494 L 160.195 117.202 L 161.14 117.362 L 161.14 125.619 L 162.991 125.619 L 162.991 126.684 L 157.824 126.684 L 157.824 125.619 " fill="#000000"/> | |
<path class="note" d="M 164.23 125.619 L 166.294 125.619 L 166.294 118.574 L 164.017 119.279 L 163.711 118.494 L 166.601 117.202 L 167.546 117.362 L 167.546 125.619 L 169.397 125.619 L 169.397 126.684 L 164.23 126.684 L 164.23 125.619 " fill="#000000"/> | |
<path class="note" d="M 159.122 178.36 L 161.186 178.36 L 161.186 171.314 L 158.908 172.02 L 158.602 171.234 L 161.492 169.943 L 162.438 170.102 L 162.438 178.36 L 164.289 178.36 L 164.289 179.425 L 159.122 179.425 L 159.122 178.36 " fill="#000000"/> | |
<path class="note" d="M 164.982 171.781 Q 165.328 170.888, 166.154 170.395 Q 166.979 169.889, 168.125 169.889 Q 169.55 169.889, 170.349 170.662 Q 171.148 171.434, 171.148 172.806 Q 171.148 174.204, 170.109 175.51 Q 169.084 176.815, 166.953 178.36 L 171.308 178.36 L 171.308 179.425 L 164.955 179.425 L 164.955 178.533 Q 166.713 177.281, 167.752 176.349 Q 168.804 175.416, 169.31 174.577 Q 169.816 173.738, 169.816 172.873 Q 169.816 171.967, 169.363 171.461 Q 168.91 170.955, 168.125 170.955 Q 167.365 170.955, 166.859 171.261 Q 166.353 171.567, 165.994 172.247 L 164.982 171.781 " fill="#000000"/> | |
<path class="note" d="M 238.312 67.3313 L 240.377 67.3313 L 240.377 60.286 L 238.099 60.9918 L 237.793 60.2061 L 240.683 58.9142 L 241.629 59.074 L 241.629 67.3313 L 243.48 67.3313 L 243.48 68.3967 L 238.312 68.3967 L 238.312 67.3313 " fill="#000000"/> | |
<path class="note" d="M 248.567 63.4291 Q 249.486 63.6954, 249.926 64.2947 Q 250.379 64.8807, 250.379 65.813 Q 250.379 66.6121, 249.979 67.2381 Q 249.58 67.8507, 248.847 68.197 Q 248.115 68.5299, 247.156 68.5299 Q 246.143 68.5299, 245.384 68.1836 Q 244.639 67.8241, 244.039 67.1049 L 244.798 66.3324 Q 245.384 66.9717, 245.877 67.2247 Q 246.37 67.4645, 247.156 67.4645 Q 248.008 67.4645, 248.527 67.0116 Q 249.047 66.5455, 249.047 65.7997 Q 249.047 64.8408, 248.501 64.4146 Q 247.968 63.9751, 246.809 63.9751 L 246.13 63.9751 L 246.13 63.0162 L 246.729 63.0162 Q 247.755 63.0029, 248.301 62.5634 Q 248.847 62.1106, 248.847 61.2715 Q 248.847 60.6589, 248.394 60.2993 Q 247.941 59.9264, 247.169 59.9264 Q 246.383 59.9264, 245.89 60.2061 Q 245.411 60.4858, 245.038 61.1916 L 244.119 60.6989 Q 244.452 59.9131, 245.251 59.3937 Q 246.05 58.8609, 247.169 58.8609 Q 248.554 58.8609, 249.366 59.5135 Q 250.179 60.1661, 250.179 61.2715 Q 250.179 62.0307, 249.766 62.5767 Q 249.353 63.1228, 248.567 63.4291 " fill="#000000"/> | |
</svg> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [15]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">stereo</span> <span class="o">=</span> <span class="nb">tuple</span><span class="p">(</span><span class="n">Chem</span><span class="o">.</span><span class="n">FindPotentialStereo</span><span class="p">(</span><span class="n">m1can</span><span class="p">,</span> <span class="n">cleanIt</span><span class="o">=</span><span class="kc">True</span><span class="p">,</span> <span class="n">flagPossible</span><span class="o">=</span><span class="kc">True</span><span class="p">))</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [16]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">Chem</span><span class="o">.</span><span class="n">FindMolChiralCenters</span><span class="p">(</span><span class="n">m1can</span><span class="p">,</span> <span class="n">includeUnassigned</span><span class="o">=</span><span class="kc">True</span><span class="p">,</span> <span class="n">useLegacyImplementation</span><span class="o">=</span><span class="kc">False</span><span class="p">)</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt output_prompt">Out[16]:</div> | |
<div class="output_text output_subarea output_execute_result"> | |
<pre>[(1, '?'), (3, '?'), (11, 'R')]</pre> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt"> | |
</div><div class="inner_cell"> | |
<div class="text_cell_render border-box-sizing rendered_html"> | |
<p>Now <code>Chem.FindPotentialStereo()</code> returns 1, 3 and 11, but I think it should rather return 1, 6 and 11:</p> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [17]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="nb">len</span><span class="p">(</span><span class="n">stereo</span><span class="p">)</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt output_prompt">Out[17]:</div> | |
<div class="output_text output_subarea output_execute_result"> | |
<pre>3</pre> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [18]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="k">for</span> <span class="n">si</span> <span class="ow">in</span> <span class="n">stereo</span><span class="p">:</span> | |
<span class="nb">print</span><span class="p">(</span><span class="n">si</span><span class="o">.</span><span class="n">centeredOn</span><span class="p">,</span> <span class="n">si</span><span class="o">.</span><span class="n">descriptor</span><span class="p">,</span> <span class="n">si</span><span class="o">.</span><span class="n">specified</span><span class="p">,</span> <span class="n">si</span><span class="o">.</span><span class="n">type</span><span class="p">)</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt"></div> | |
<div class="output_subarea output_stream output_stdout output_text"> | |
<pre>1 NoValue Unspecified Atom_Tetrahedral | |
3 NoValue Unspecified Atom_Tetrahedral | |
11 Tet_CW Specified Atom_Tetrahedral | |
</pre> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt"> | |
</div><div class="inner_cell"> | |
<div class="text_cell_render border-box-sizing rendered_html"> | |
<h2>Case 2</h2> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt"> | |
</div><div class="inner_cell"> | |
<div class="text_cell_render border-box-sizing rendered_html"> | |
<p>I believe this molecule has 3 stereocenters, i.e. 1, 6 and 7:</p> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [19]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">m2</span> <span class="o">=</span> <span class="n">Chem</span><span class="o">.</span><span class="n">MolFromSmiles</span><span class="p">(</span><span class="s2">"C[C@H]1COCC13[C@H]2[C@@H]3CCCC2"</span><span class="p">)</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [20]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">draw</span><span class="p">(</span><span class="n">m2</span><span class="p">,</span> <span class="n">highlightAtoms</span><span class="o">=</span><span class="p">[</span><span class="mi">1</span><span class="p">,</span> <span class="mi">6</span><span class="p">,</span> <span class="mi">7</span><span class="p">],</span> <span class="n">highlightBonds</span><span class="o">=</span><span class="p">[])</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt output_prompt">Out[20]:</div> | |
<div class="output_svg output_subarea output_execute_result"> | |
<svg baseProfile="full" height="300px" version="1.1" viewBox="0 0 400 300" width="400px" xml:space="preserve" xmlns="http://www.w3.org/2000/svg" xmlns:rdkit="http://www.rdkit.org/xml" xmlns:xlink="http://www.w3.org/1999/xlink"> | |
<!-- END OF HEADER --> | |
<rect height="300" style="opacity:1.0;fill:#FFFFFF;stroke:none" width="400" x="0" y="0"> </rect> | |
<ellipse cx="104.525" cy="95.0626" rx="16.0874" ry="16.0874" style="fill:#FF7F7F;fill-rule:evenodd;stroke:#FF7F7F;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<ellipse cx="223.291" cy="108.753" rx="16.0874" ry="16.0874" style="fill:#FF7F7F;fill-rule:evenodd;stroke:#FF7F7F;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<ellipse cx="230.895" cy="188.83" rx="16.0874" ry="16.0874" style="fill:#FF7F7F;fill-rule:evenodd;stroke:#FF7F7F;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-0" d="M 108.229,82.1531 L 106.658,81.8029" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-0" d="M 111.933,69.2437 L 108.792,68.5432" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-0" d="M 115.636,56.3343 L 110.926,55.2835" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-0" d="M 119.34,43.4249 L 113.06,42.0238" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-0" d="M 123.044,30.5154 L 115.194,28.7641" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-0" d="M 126.748,17.606 L 117.327,15.5044" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:1.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-1" d="M 104.525,95.0626 L 30.7169,127.04" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-11" d="M 104.525,95.0626 L 157.744,155.376" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-2" d="M 30.7169,127.04 L 33.8765,160.313" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-2" d="M 33.8765,160.313 L 37.0362,193.587" style="fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-3" d="M 50.7886,209.898 L 83.8084,217.264" style="fill:none;fill-rule:evenodd;stroke:#FF0000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-3" d="M 83.8084,217.264 L 116.828,224.63" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-4" d="M 116.828,224.63 L 157.744,155.376" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-5" d="M 157.744,155.376 L 223.291,108.753" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-13" d="M 157.744,155.376 L 230.895,188.83" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-6" d="M 223.291,108.753 L 230.895,188.83" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-12" d="M 223.291,108.753 L 288.837,62.1291" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-14" d="M 223.291,108.753 L 270.327,155.382 L 276.605,148.05 Z" style="fill:#000000;fill-rule:evenodd;fill-opacity:1;stroke:#000000;stroke-width:2px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;"/> | |
<path class="bond-7" d="M 230.895,188.83 L 304.045,222.283" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-15" d="M 230.895,188.83 L 199.181,246.572 L 207.959,250.586 Z" style="fill:#000000;fill-rule:evenodd;fill-opacity:1;stroke:#000000;stroke-width:2px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;"/> | |
<path class="bond-8" d="M 304.045,222.283 L 369.592,175.659" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-9" d="M 369.592,175.659 L 361.988,95.5822" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-10" d="M 361.988,95.5822 L 288.837,62.1291" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="atom-3" d="M 27.8641 207.181 Q 27.8641 201.711, 30.5668 198.654 Q 33.2695 195.598, 38.3209 195.598 Q 43.3724 195.598, 46.075 198.654 Q 48.7777 201.711, 48.7777 207.181 Q 48.7777 212.715, 46.0429 215.868 Q 43.308 218.989, 38.3209 218.989 Q 33.3016 218.989, 30.5668 215.868 Q 27.8641 212.747, 27.8641 207.181 M 38.3209 216.415 Q 41.7958 216.415, 43.6619 214.098 Q 45.5602 211.749, 45.5602 207.181 Q 45.5602 202.708, 43.6619 200.456 Q 41.7958 198.172, 38.3209 198.172 Q 34.846 198.172, 32.9477 200.424 Q 31.0816 202.676, 31.0816 207.181 Q 31.0816 211.782, 32.9477 214.098 Q 34.846 216.415, 38.3209 216.415 " fill="#FF0000"/> | |
<path class="atom-12" d="M 275.477 149.68 L 278.566 149.68 L 278.566 159.364 L 290.213 159.364 L 290.213 149.68 L 293.302 149.68 L 293.302 172.46 L 290.213 172.46 L 290.213 161.938 L 278.566 161.938 L 278.566 172.46 L 275.477 172.46 L 275.477 149.68 " fill="#000000"/> | |
<path class="atom-13" d="M 188.529 250.59 L 191.618 250.59 L 191.618 260.275 L 203.265 260.275 L 203.265 250.59 L 206.354 250.59 L 206.354 273.37 L 203.265 273.37 L 203.265 262.849 L 191.618 262.849 L 191.618 273.37 L 188.529 273.37 L 188.529 250.59 " fill="#000000"/> | |
<path class="note" d="M 108.953 19.5244 Q 106.862 19.5244, 105.816 17.98 Q 104.787 16.4356, 104.787 13.6846 Q 104.787 10.9337, 105.816 9.40538 Q 106.846 7.87707, 108.953 7.87707 Q 111.061 7.87707, 112.09 9.40538 Q 113.12 10.9337, 113.12 13.6846 Q 113.12 16.4356, 112.074 17.98 Q 111.045 19.5244, 108.953 19.5244 M 108.953 18.2374 Q 110.192 18.2374, 110.852 17.0952 Q 111.511 15.9369, 111.511 13.6846 Q 111.511 11.4485, 110.852 10.3063 Q 110.192 9.16407, 108.953 9.16407 Q 107.731 9.16407, 107.055 10.3063 Q 106.395 11.4485, 106.395 13.6846 Q 106.395 15.9369, 107.055 17.0952 Q 107.731 18.2374, 108.953 18.2374 " fill="#000000"/> | |
<path class="note" d="M 91.3841 90.9617 L 93.8776 90.9617 L 93.8776 82.4514 L 91.1267 83.3041 L 90.7567 82.3549 L 94.2476 80.7944 L 95.3898 80.9875 L 95.3898 90.9617 L 97.626 90.9617 L 97.626 92.2487 L 91.3841 92.2487 L 91.3841 90.9617 " fill="#000000"/> | |
<path class="note" d="M 15.37 116.745 Q 15.7883 115.667, 16.7857 115.072 Q 17.7831 114.461, 19.1666 114.461 Q 20.888 114.461, 21.8532 115.394 Q 22.8185 116.327, 22.8185 117.984 Q 22.8185 119.673, 21.5637 121.25 Q 20.3249 122.826, 17.751 124.692 L 23.0115 124.692 L 23.0115 125.979 L 15.3378 125.979 L 15.3378 124.902 Q 17.4614 123.389, 18.7162 122.263 Q 19.9871 121.137, 20.5984 120.124 Q 21.2097 119.11, 21.2097 118.064 Q 21.2097 116.971, 20.6628 116.359 Q 20.1158 115.748, 19.1666 115.748 Q 18.2497 115.748, 17.6383 116.118 Q 17.027 116.488, 16.5927 117.308 L 15.37 116.745 " fill="#000000"/> | |
<path class="note" d="M 19.8572 224.615 Q 20.9672 224.937, 21.4981 225.661 Q 22.0451 226.368, 22.0451 227.495 Q 22.0451 228.46, 21.5624 229.216 Q 21.0798 229.956, 20.195 230.374 Q 19.3102 230.776, 18.1519 230.776 Q 16.9293 230.776, 16.0123 230.358 Q 15.1114 229.924, 14.3875 229.055 L 15.3044 228.122 Q 16.0123 228.894, 16.6075 229.2 Q 17.2028 229.489, 18.1519 229.489 Q 19.1815 229.489, 19.8089 228.942 Q 20.4363 228.379, 20.4363 227.478 Q 20.4363 226.32, 19.7767 225.805 Q 19.1332 225.274, 17.7336 225.274 L 16.9132 225.274 L 16.9132 224.116 L 17.6371 224.116 Q 18.8758 224.1, 19.5354 223.569 Q 20.195 223.022, 20.195 222.009 Q 20.195 221.269, 19.648 220.834 Q 19.1011 220.384, 18.168 220.384 Q 17.2188 220.384, 16.6236 220.722 Q 16.0445 221.06, 15.594 221.912 L 14.484 221.317 Q 14.8862 220.368, 15.8514 219.74 Q 16.8167 219.097, 18.168 219.097 Q 19.8411 219.097, 20.8224 219.885 Q 21.8038 220.673, 21.8038 222.009 Q 21.8038 222.926, 21.305 223.585 Q 20.8063 224.245, 19.8572 224.615 " fill="#000000"/> | |
<path class="note" d="M 125.174 238.716 L 126.542 238.716 L 126.542 240.003 L 125.174 240.003 L 125.174 242.626 L 123.662 242.626 L 123.662 240.003 L 117.774 240.003 L 117.774 238.99 L 122.761 231.236 L 125.174 231.236 L 125.174 238.716 M 119.64 238.716 L 123.662 238.716 L 123.662 232.265 L 119.64 238.716 " fill="#000000"/> | |
<path class="note" d="M 162.04 166.736 Q 163.038 166.736, 163.858 167.17 Q 164.679 167.588, 165.145 168.393 Q 165.612 169.181, 165.612 170.259 Q 165.612 171.433, 165.033 172.286 Q 164.47 173.122, 163.536 173.557 Q 162.603 173.991, 161.542 173.991 Q 160.496 173.991, 159.531 173.605 Q 158.565 173.219, 157.906 172.479 L 158.871 171.481 Q 159.402 172.061, 160.126 172.382 Q 160.85 172.688, 161.59 172.688 Q 162.603 172.688, 163.295 172.061 Q 164.003 171.433, 164.003 170.291 Q 164.003 169.084, 163.295 168.521 Q 162.603 167.942, 161.493 167.942 Q 160.496 167.942, 159.386 168.377 L 158.501 167.958 L 159.048 162.473 L 164.904 162.473 L 164.743 163.76 L 160.367 163.76 L 160.029 167.138 Q 161.043 166.736, 162.04 166.736 " fill="#000000"/> | |
<path class="note" d="M 222.53 94.0553 Q 223.528 94.0553, 224.316 94.4897 Q 225.104 94.924, 225.539 95.7123 Q 225.973 96.5006, 225.973 97.498 Q 225.973 98.6081, 225.474 99.4768 Q 224.992 100.329, 224.123 100.812 Q 223.254 101.295, 222.144 101.295 Q 220.117 101.295, 219.088 99.9272 Q 218.074 98.5437, 218.074 95.8088 Q 218.074 92.7844, 219.329 91.2239 Q 220.6 89.6474, 223.029 89.6474 Q 223.737 89.6474, 224.332 89.8082 Q 224.943 89.9691, 225.523 90.307 L 224.895 91.3848 Q 224.059 90.9344, 223.045 90.9344 Q 221.436 90.9344, 220.616 91.98 Q 219.795 93.0096, 219.699 95.1493 Q 220.278 94.6184, 221.002 94.3449 Q 221.742 94.0553, 222.53 94.0553 M 222.16 99.9755 Q 222.772 99.9755, 223.27 99.6537 Q 223.785 99.332, 224.075 98.7689 Q 224.364 98.2059, 224.364 97.5141 Q 224.364 96.5006, 223.801 95.9215 Q 223.238 95.3423, 222.241 95.3423 Q 221.549 95.3423, 220.857 95.6319 Q 220.182 95.9054, 219.699 96.388 Q 219.763 98.2702, 220.358 99.1229 Q 220.954 99.9755, 222.16 99.9755 " fill="#000000"/> | |
<path class="note" d="M 244.007 176.651 L 238.039 176.651 L 238.039 175.364 L 245.6 175.364 L 245.6 176.506 L 240.999 186.754 L 239.454 186.754 L 244.007 176.651 " fill="#000000"/> | |
<path class="note" d="M 307.099 235.355 Q 308.144 235.806, 308.739 236.481 Q 309.335 237.141, 309.335 238.267 Q 309.335 239.232, 308.836 239.988 Q 308.337 240.728, 307.436 241.147 Q 306.552 241.549, 305.377 241.549 Q 303.479 241.549, 302.385 240.68 Q 301.291 239.795, 301.291 238.267 Q 301.291 237.334, 301.774 236.642 Q 302.256 235.934, 303.254 235.404 Q 302.514 234.985, 302.111 234.374 Q 301.709 233.747, 301.709 232.781 Q 301.709 231.446, 302.674 230.658 Q 303.656 229.869, 305.313 229.869 Q 306.97 229.869, 307.935 230.658 Q 308.916 231.446, 308.916 232.781 Q 308.916 233.618, 308.45 234.245 Q 307.999 234.857, 307.099 235.355 M 305.313 231.076 Q 304.364 231.076, 303.833 231.527 Q 303.318 231.977, 303.318 232.781 Q 303.318 233.377, 303.672 233.779 Q 304.026 234.165, 304.525 234.39 Q 305.039 234.615, 306.021 234.953 Q 306.712 234.47, 307.002 233.956 Q 307.308 233.441, 307.308 232.781 Q 307.308 231.977, 306.777 231.527 Q 306.262 231.076, 305.313 231.076 M 305.377 240.342 Q 306.439 240.342, 307.082 239.779 Q 307.726 239.2, 307.726 238.251 Q 307.726 237.64, 307.388 237.254 Q 307.05 236.868, 306.535 236.642 Q 306.037 236.417, 305.136 236.127 L 304.412 235.886 Q 303.608 236.369, 303.254 236.948 Q 302.9 237.511, 302.9 238.251 Q 302.9 239.2, 303.575 239.779 Q 304.251 240.342, 305.377 240.342 " fill="#000000"/> | |
<path class="note" d="M 381.663 175.475 Q 383.69 175.475, 384.704 176.859 Q 385.733 178.226, 385.733 180.961 Q 385.733 183.985, 384.462 185.562 Q 383.207 187.122, 380.778 187.122 Q 380.07 187.122, 379.459 186.962 Q 378.864 186.801, 378.285 186.463 L 378.912 185.385 Q 379.749 185.835, 380.762 185.835 Q 382.371 185.835, 383.191 184.806 Q 384.012 183.76, 384.108 181.621 Q 383.529 182.151, 382.789 182.441 Q 382.065 182.715, 381.277 182.715 Q 380.28 182.715, 379.491 182.28 Q 378.703 181.846, 378.269 181.058 Q 377.834 180.269, 377.834 179.272 Q 377.834 178.162, 378.317 177.309 Q 378.816 176.44, 379.684 175.958 Q 380.553 175.475, 381.663 175.475 M 379.443 179.256 Q 379.443 180.269, 380.006 180.848 Q 380.569 181.428, 381.567 181.428 Q 382.258 181.428, 382.934 181.154 Q 383.626 180.864, 384.108 180.382 Q 384.044 178.5, 383.449 177.647 Q 382.854 176.794, 381.647 176.794 Q 381.036 176.794, 380.521 177.116 Q 380.022 177.438, 379.733 178.001 Q 379.443 178.564, 379.443 179.256 " fill="#000000"/> | |
<path class="note" d="M 356.664 87.8627 L 359.158 87.8627 L 359.158 79.3525 L 356.407 80.2051 L 356.037 79.256 L 359.528 77.6955 L 360.67 77.8885 L 360.67 87.8627 L 362.906 87.8627 L 362.906 89.1497 L 356.664 89.1497 L 356.664 87.8627 " fill="#000000"/> | |
<path class="note" d="M 368.054 89.2784 Q 365.963 89.2784, 364.917 87.734 Q 363.887 86.1896, 363.887 83.4387 Q 363.887 80.6877, 364.917 79.1594 Q 365.947 77.6311, 368.054 77.6311 Q 370.162 77.6311, 371.191 79.1594 Q 372.221 80.6877, 372.221 83.4387 Q 372.221 86.1896, 371.175 87.734 Q 370.145 89.2784, 368.054 89.2784 M 368.054 87.9914 Q 369.293 87.9914, 369.952 86.8492 Q 370.612 85.6909, 370.612 83.4387 Q 370.612 81.2025, 369.952 80.0603 Q 369.293 78.9181, 368.054 78.9181 Q 366.831 78.9181, 366.156 80.0603 Q 365.496 81.2025, 365.496 83.4387 Q 365.496 85.6909, 366.156 86.8492 Q 366.831 87.9914, 368.054 87.9914 " fill="#000000"/> | |
<path class="note" d="M 277.459 53.2231 L 279.953 53.2231 L 279.953 44.7129 L 277.202 45.5655 L 276.832 44.6163 L 280.323 43.0559 L 281.465 43.2489 L 281.465 53.2231 L 283.701 53.2231 L 283.701 54.5101 L 277.459 54.5101 L 277.459 53.2231 " fill="#000000"/> | |
<path class="note" d="M 285.197 53.2231 L 287.691 53.2231 L 287.691 44.7129 L 284.94 45.5655 L 284.57 44.6163 L 288.061 43.0559 L 289.203 43.2489 L 289.203 53.2231 L 291.439 53.2231 L 291.439 54.5101 L 285.197 54.5101 L 285.197 53.2231 " fill="#000000"/> | |
<path class="note" d="M 294.275 182.981 L 296.768 182.981 L 296.768 174.471 L 294.017 175.323 L 293.647 174.374 L 297.138 172.814 L 298.281 173.007 L 298.281 182.981 L 300.517 182.981 L 300.517 184.268 L 294.275 184.268 L 294.275 182.981 " fill="#000000"/> | |
<path class="note" d="M 301.353 175.034 Q 301.772 173.956, 302.769 173.361 Q 303.766 172.749, 305.15 172.749 Q 306.871 172.749, 307.837 173.682 Q 308.802 174.616, 308.802 176.273 Q 308.802 177.962, 307.547 179.538 Q 306.308 181.115, 303.734 182.981 L 308.995 182.981 L 308.995 184.268 L 301.321 184.268 L 301.321 183.19 Q 303.445 181.678, 304.7 180.552 Q 305.97 179.426, 306.582 178.412 Q 307.193 177.399, 307.193 176.353 Q 307.193 175.259, 306.646 174.648 Q 306.099 174.036, 305.15 174.036 Q 304.233 174.036, 303.622 174.406 Q 303.01 174.776, 302.576 175.597 L 301.353 175.034 " fill="#000000"/> | |
<path class="note" d="M 175.882 290.836 L 178.376 290.836 L 178.376 282.326 L 175.625 283.178 L 175.255 282.229 L 178.746 280.669 L 179.888 280.862 L 179.888 290.836 L 182.124 290.836 L 182.124 292.123 L 175.882 292.123 L 175.882 290.836 " fill="#000000"/> | |
<path class="note" d="M 188.27 286.122 Q 189.38 286.444, 189.91 287.168 Q 190.457 287.876, 190.457 289.002 Q 190.457 289.967, 189.975 290.723 Q 189.492 291.463, 188.607 291.882 Q 187.723 292.284, 186.564 292.284 Q 185.342 292.284, 184.425 291.866 Q 183.524 291.431, 182.8 290.562 L 183.717 289.629 Q 184.425 290.402, 185.02 290.707 Q 185.615 290.997, 186.564 290.997 Q 187.594 290.997, 188.221 290.45 Q 188.849 289.887, 188.849 288.986 Q 188.849 287.828, 188.189 287.313 Q 187.546 286.782, 186.146 286.782 L 185.326 286.782 L 185.326 285.624 L 186.049 285.624 Q 187.288 285.608, 187.948 285.077 Q 188.607 284.53, 188.607 283.516 Q 188.607 282.776, 188.06 282.342 Q 187.513 281.891, 186.58 281.891 Q 185.631 281.891, 185.036 282.229 Q 184.457 282.567, 184.006 283.42 L 182.896 282.824 Q 183.299 281.875, 184.264 281.248 Q 185.229 280.604, 186.58 280.604 Q 188.253 280.604, 189.235 281.393 Q 190.216 282.181, 190.216 283.516 Q 190.216 284.433, 189.717 285.093 Q 189.219 285.752, 188.27 286.122 " fill="#000000"/> | |
</svg> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [21]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">stereo</span> <span class="o">=</span> <span class="nb">tuple</span><span class="p">(</span><span class="n">Chem</span><span class="o">.</span><span class="n">FindPotentialStereo</span><span class="p">(</span><span class="n">m2</span><span class="p">,</span> <span class="n">cleanIt</span><span class="o">=</span><span class="kc">True</span><span class="p">,</span> <span class="n">flagPossible</span><span class="o">=</span><span class="kc">True</span><span class="p">))</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt"> | |
</div><div class="inner_cell"> | |
<div class="text_cell_render border-box-sizing rendered_html"> | |
<p>Here I would have expected a lowercase <code>s</code> or <code>r</code> (or nothing at all, I am not quite clear about this) in position 5:</p> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [22]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">Chem</span><span class="o">.</span><span class="n">FindMolChiralCenters</span><span class="p">(</span><span class="n">m2</span><span class="p">,</span> <span class="n">includeUnassigned</span><span class="o">=</span><span class="kc">True</span><span class="p">,</span> <span class="n">useLegacyImplementation</span><span class="o">=</span><span class="kc">False</span><span class="p">)</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt output_prompt">Out[22]:</div> | |
<div class="output_text output_subarea output_execute_result"> | |
<pre>[(1, 'R'), (5, '?'), (6, 'R'), (7, 'S')]</pre> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [23]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="nb">len</span><span class="p">(</span><span class="n">stereo</span><span class="p">)</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt output_prompt">Out[23]:</div> | |
<div class="output_text output_subarea output_execute_result"> | |
<pre>4</pre> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt"> | |
</div><div class="inner_cell"> | |
<div class="text_cell_render border-box-sizing rendered_html"> | |
<p><code>FindPotentialStereo()</code> reports 4, but I think 5 should not be flagged as chiral as there is a plane of symmetry:</p> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [24]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="k">for</span> <span class="n">si</span> <span class="ow">in</span> <span class="n">stereo</span><span class="p">:</span> | |
<span class="nb">print</span><span class="p">(</span><span class="n">si</span><span class="o">.</span><span class="n">centeredOn</span><span class="p">,</span> <span class="n">si</span><span class="o">.</span><span class="n">descriptor</span><span class="p">,</span> <span class="n">si</span><span class="o">.</span><span class="n">specified</span><span class="p">,</span> <span class="n">si</span><span class="o">.</span><span class="n">type</span><span class="p">)</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt"></div> | |
<div class="output_subarea output_stream output_stdout output_text"> | |
<pre>1 Tet_CW Specified Atom_Tetrahedral | |
5 NoValue Unspecified Atom_Tetrahedral | |
6 Tet_CW Specified Atom_Tetrahedral | |
7 Tet_CCW Specified Atom_Tetrahedral | |
</pre> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt"> | |
</div><div class="inner_cell"> | |
<div class="text_cell_render border-box-sizing rendered_html"> | |
<h2>Case 3</h2> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt"> | |
</div><div class="inner_cell"> | |
<div class="text_cell_render border-box-sizing rendered_html"> | |
<p>I believe this molecule has 3 stereocenters, i.e. 1, 3 and 10:</p> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [25]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">m3</span> <span class="o">=</span> <span class="n">Chem</span><span class="o">.</span><span class="n">MolFromSmiles</span><span class="p">(</span><span class="s2">"CC2CN(CC1)CCCCN12"</span><span class="p">)</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [26]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">draw</span><span class="p">(</span><span class="n">m3</span><span class="p">,</span> <span class="n">highlightAtoms</span><span class="o">=</span><span class="p">[</span><span class="mi">1</span><span class="p">,</span> <span class="mi">3</span><span class="p">,</span> <span class="mi">10</span><span class="p">],</span> <span class="n">highlightBonds</span><span class="o">=</span><span class="p">[])</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt output_prompt">Out[26]:</div> | |
<div class="output_svg output_subarea output_execute_result"> | |
<svg baseProfile="full" height="300px" version="1.1" viewBox="0 0 400 300" width="400px" xml:space="preserve" xmlns="http://www.w3.org/2000/svg" xmlns:rdkit="http://www.rdkit.org/xml" xmlns:xlink="http://www.w3.org/1999/xlink"> | |
<!-- END OF HEADER --> | |
<rect height="300" style="opacity:1.0;fill:#FFFFFF;stroke:none" width="400" x="0" y="0"> </rect> | |
<ellipse cx="251.818" cy="159.964" rx="18.8749" ry="18.8749" style="fill:#FF7F7F;fill-rule:evenodd;stroke:#FF7F7F;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<ellipse cx="80.7872" cy="125.944" rx="18.8749" ry="18.8987" style="fill:#FF7F7F;fill-rule:evenodd;stroke:#FF7F7F;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<ellipse cx="270.229" cy="252.525" rx="18.8749" ry="18.8987" style="fill:#FF7F7F;fill-rule:evenodd;stroke:#FF7F7F;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-0" d="M 285.538,122.837 L 251.818,159.964" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-1" d="M 251.818,159.964 L 173.348,107.533" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-11" d="M 251.818,159.964 L 259.46,198.383" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-11" d="M 259.46,198.383 L 267.102,236.803" style="fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-2" d="M 173.348,107.533 L 133.315,115.496" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-2" d="M 133.315,115.496 L 93.2824,123.459" style="fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-3" d="M 83.9147,141.667 L 91.5567,180.086" style="fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-3" d="M 91.5567,180.086 L 99.1987,218.505" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-5" d="M 91.2929,110.221 L 112.256,78.848" style="fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-5" d="M 112.256,78.848 L 133.219,47.4747" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-4" d="M 99.1987,218.505 L 177.668,270.937" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-10" d="M 177.668,270.937 L 217.701,262.974" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-10" d="M 217.701,262.974 L 257.734,255.011" style="fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-6" d="M 133.219,47.4747 L 225.78,29.0632" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-7" d="M 225.78,29.0632 L 304.249,81.4949" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-8" d="M 304.249,81.4949 L 322.661,174.056" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-9" d="M 322.661,174.056 L 301.698,205.429" style="fill:none;fill-rule:evenodd;stroke:#000000;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="bond-9" d="M 301.698,205.429 L 280.735,236.803" style="fill:none;fill-rule:evenodd;stroke:#0000FF;stroke-width:2.0px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"/> | |
<path class="atom-3" d="M 74.8794 112.581 L 83.6373 126.737 Q 84.5056 128.134, 85.9023 130.663 Q 87.2991 133.192, 87.3746 133.343 L 87.3746 112.581 L 90.923 112.581 L 90.923 139.308 L 87.2613 139.308 L 77.8616 123.83 Q 76.7669 122.018, 75.5966 119.942 Q 74.4641 117.866, 74.1244 117.224 L 74.1244 139.308 L 70.6514 139.308 L 70.6514 112.581 L 74.8794 112.581 " fill="#0000FF"/> | |
<path class="atom-10" d="M 264.321 239.162 L 273.079 253.318 Q 273.948 254.715, 275.344 257.244 Q 276.741 259.773, 276.816 259.924 L 276.816 239.162 L 280.365 239.162 L 280.365 265.889 L 276.703 265.889 L 267.304 250.411 Q 266.209 248.599, 265.039 246.523 Q 263.906 244.447, 263.566 243.805 L 263.566 265.889 L 260.093 265.889 L 260.093 239.162 L 264.321 239.162 " fill="#0000FF"/> | |
<path class="note" d="M 273.894 119.17 Q 271.441 119.17, 270.214 117.358 Q 269.006 115.546, 269.006 112.319 Q 269.006 109.091, 270.214 107.298 Q 271.422 105.505, 273.894 105.505 Q 276.367 105.505, 277.575 107.298 Q 278.783 109.091, 278.783 112.319 Q 278.783 115.546, 277.556 117.358 Q 276.348 119.17, 273.894 119.17 M 273.894 117.66 Q 275.348 117.66, 276.122 116.32 Q 276.895 114.961, 276.895 112.319 Q 276.895 109.695, 276.122 108.355 Q 275.348 107.015, 273.894 107.015 Q 272.46 107.015, 271.667 108.355 Q 270.893 109.695, 270.893 112.319 Q 270.893 114.961, 271.667 116.32 Q 272.46 117.66, 273.894 117.66 " fill="#000000"/> | |
<path class="note" d="M 246.607 149.562 L 249.532 149.562 L 249.532 139.577 L 246.305 140.578 L 245.871 139.464 L 249.966 137.633 L 251.307 137.86 L 251.307 149.562 L 253.93 149.562 L 253.93 151.072 L 246.607 151.072 L 246.607 149.562 " fill="#000000"/> | |
<path class="note" d="M 171.953 88.0288 Q 172.444 86.7642, 173.614 86.0658 Q 174.784 85.3486, 176.407 85.3486 Q 178.427 85.3486, 179.56 86.4433 Q 180.692 87.5381, 180.692 89.4822 Q 180.692 91.464, 179.22 93.3138 Q 177.766 95.1635, 174.746 97.353 L 180.919 97.353 L 180.919 98.863 L 171.915 98.863 L 171.915 97.5984 Q 174.407 95.8241, 175.879 94.5029 Q 177.37 93.1817, 178.087 91.9925 Q 178.805 90.8034, 178.805 89.5765 Q 178.805 88.2931, 178.163 87.5758 Q 177.521 86.8586, 176.407 86.8586 Q 175.332 86.8586, 174.614 87.2927 Q 173.897 87.7268, 173.387 88.6894 L 171.953 88.0288 " fill="#000000"/> | |
<path class="note" d="M 108.869 143.138 Q 110.171 143.516, 110.794 144.365 Q 111.436 145.196, 111.436 146.517 Q 111.436 147.649, 110.87 148.536 Q 110.303 149.405, 109.265 149.895 Q 108.227 150.367, 106.868 150.367 Q 105.434 150.367, 104.358 149.877 Q 103.301 149.367, 102.451 148.348 L 103.527 147.253 Q 104.358 148.159, 105.056 148.518 Q 105.755 148.857, 106.868 148.857 Q 108.076 148.857, 108.812 148.216 Q 109.548 147.555, 109.548 146.498 Q 109.548 145.139, 108.775 144.535 Q 108.02 143.912, 106.377 143.912 L 105.415 143.912 L 105.415 142.553 L 106.264 142.553 Q 107.718 142.534, 108.491 141.911 Q 109.265 141.27, 109.265 140.08 Q 109.265 139.212, 108.624 138.703 Q 107.982 138.174, 106.887 138.174 Q 105.773 138.174, 105.075 138.57 Q 104.396 138.967, 103.867 139.967 L 102.565 139.269 Q 103.037 138.155, 104.169 137.419 Q 105.302 136.664, 106.887 136.664 Q 108.85 136.664, 110.001 137.589 Q 111.153 138.514, 111.153 140.08 Q 111.153 141.156, 110.568 141.93 Q 109.983 142.704, 108.869 143.138 " fill="#000000"/> | |
<path class="note" d="M 89.6595 229.339 L 91.2639 229.339 L 91.2639 230.849 L 89.6595 230.849 L 89.6595 233.925 L 87.8852 233.925 L 87.8852 230.849 L 80.977 230.849 L 80.977 229.66 L 86.8283 220.562 L 89.6595 220.562 L 89.6595 229.339 M 83.1665 229.339 L 87.8852 229.339 L 87.8852 221.77 L 83.1665 229.339 " fill="#000000"/> | |
<path class="note" d="M 174.93 284.684 Q 176.1 284.684, 177.063 285.193 Q 178.025 285.684, 178.573 286.628 Q 179.12 287.553, 179.12 288.817 Q 179.12 290.195, 178.441 291.196 Q 177.78 292.177, 176.685 292.687 Q 175.59 293.196, 174.345 293.196 Q 173.118 293.196, 171.985 292.743 Q 170.853 292.29, 170.079 291.422 L 171.211 290.252 Q 171.834 290.931, 172.684 291.309 Q 173.533 291.667, 174.401 291.667 Q 175.59 291.667, 176.402 290.931 Q 177.233 290.195, 177.233 288.855 Q 177.233 287.44, 176.402 286.779 Q 175.59 286.099, 174.288 286.099 Q 173.118 286.099, 171.815 286.609 L 170.777 286.118 L 171.419 279.682 L 178.29 279.682 L 178.101 281.192 L 172.967 281.192 L 172.57 285.156 Q 173.76 284.684, 174.93 284.684 " fill="#000000"/> | |
<path class="note" d="M 125.075 32.8109 Q 126.245 32.8109, 127.17 33.3206 Q 128.095 33.8302, 128.604 34.755 Q 129.114 35.6799, 129.114 36.8502 Q 129.114 38.1525, 128.529 39.1718 Q 127.963 40.1721, 126.943 40.7384 Q 125.924 41.3046, 124.622 41.3046 Q 122.244 41.3046, 121.036 39.7003 Q 119.847 38.077, 119.847 34.8683 Q 119.847 31.3198, 121.319 29.489 Q 122.81 27.6392, 125.66 27.6392 Q 126.49 27.6392, 127.189 27.828 Q 127.906 28.0167, 128.586 28.4131 L 127.849 29.6777 Q 126.868 29.1492, 125.679 29.1492 Q 123.791 29.1492, 122.829 30.3761 Q 121.866 31.5841, 121.753 34.0944 Q 122.432 33.4716, 123.282 33.1507 Q 124.15 32.8109, 125.075 32.8109 M 124.641 39.7569 Q 125.358 39.7569, 125.943 39.3794 Q 126.547 39.0019, 126.887 38.3413 Q 127.227 37.6807, 127.227 36.869 Q 127.227 35.6799, 126.566 35.0004 Q 125.905 34.3209, 124.735 34.3209 Q 123.923 34.3209, 123.112 34.6607 Q 122.319 34.9815, 121.753 35.5478 Q 121.828 37.7562, 122.527 38.7565 Q 123.225 39.7569, 124.641 39.7569 " fill="#000000"/> | |
<path class="note" d="M 231.416 8.46465 L 224.413 8.46465 L 224.413 6.95466 L 233.284 6.95466 L 233.284 8.29477 L 227.886 20.3181 L 226.074 20.3181 L 231.416 8.46465 " fill="#000000"/> | |
<path class="note" d="M 319.423 72.4354 Q 320.65 72.9639, 321.348 73.7566 Q 322.046 74.5305, 322.046 75.8518 Q 322.046 76.9842, 321.461 77.8714 Q 320.876 78.7396, 319.819 79.2304 Q 318.781 79.7022, 317.403 79.7022 Q 315.176 79.7022, 313.892 78.683 Q 312.609 77.6449, 312.609 75.8518 Q 312.609 74.757, 313.175 73.9454 Q 313.741 73.1149, 314.912 72.492 Q 314.043 72.0013, 313.571 71.284 Q 313.1 70.5479, 313.1 69.4154 Q 313.1 67.8488, 314.232 66.9239 Q 315.383 65.9991, 317.328 65.9991 Q 319.272 65.9991, 320.404 66.9239 Q 321.556 67.8488, 321.556 69.4154 Q 321.556 70.3969, 321.008 71.133 Q 320.48 71.8503, 319.423 72.4354 M 317.328 67.4147 Q 316.214 67.4147, 315.591 67.9432 Q 314.987 68.4717, 314.987 69.4154 Q 314.987 70.1138, 315.402 70.5857 Q 315.818 71.0387, 316.403 71.3029 Q 317.007 71.5672, 318.158 71.9635 Q 318.97 71.3973, 319.309 70.7933 Q 319.668 70.1893, 319.668 69.4154 Q 319.668 68.4717, 319.045 67.9432 Q 318.441 67.4147, 317.328 67.4147 M 317.403 78.2866 Q 318.649 78.2866, 319.404 77.626 Q 320.159 76.9465, 320.159 75.8329 Q 320.159 75.1156, 319.762 74.6626 Q 319.366 74.2096, 318.762 73.9454 Q 318.177 73.6811, 317.12 73.3414 L 316.271 73.0583 Q 315.327 73.6245, 314.912 74.304 Q 314.496 74.9646, 314.496 75.8329 Q 314.496 76.9465, 315.289 77.626 Q 316.082 78.2866, 317.403 78.2866 " fill="#000000"/> | |
<path class="note" d="M 337.946 170.367 Q 340.324 170.367, 341.513 171.991 Q 342.721 173.595, 342.721 176.804 Q 342.721 180.352, 341.23 182.202 Q 339.758 184.033, 336.908 184.033 Q 336.077 184.033, 335.36 183.844 Q 334.662 183.655, 333.982 183.259 L 334.718 181.994 Q 335.7 182.523, 336.889 182.523 Q 338.777 182.523, 339.739 181.315 Q 340.702 180.088, 340.815 177.578 Q 340.136 178.2, 339.267 178.54 Q 338.418 178.861, 337.493 178.861 Q 336.323 178.861, 335.398 178.351 Q 334.473 177.842, 333.963 176.917 Q 333.454 175.992, 333.454 174.822 Q 333.454 173.519, 334.02 172.519 Q 334.605 171.5, 335.624 170.934 Q 336.644 170.367, 337.946 170.367 M 335.341 174.803 Q 335.341 175.992, 336.002 176.672 Q 336.663 177.351, 337.833 177.351 Q 338.644 177.351, 339.437 177.03 Q 340.249 176.69, 340.815 176.124 Q 340.74 173.916, 340.041 172.915 Q 339.343 171.915, 337.927 171.915 Q 337.21 171.915, 336.606 172.293 Q 336.021 172.67, 335.681 173.331 Q 335.341 173.991, 335.341 174.803 " fill="#000000"/> | |
<path class="note" d="M 239.964 231.616 L 242.89 231.616 L 242.89 221.631 L 239.662 222.632 L 239.228 221.518 L 243.324 219.687 L 244.664 219.914 L 244.664 231.616 L 247.288 231.616 L 247.288 233.126 L 239.964 233.126 L 239.964 231.616 " fill="#000000"/> | |
<path class="note" d="M 253.328 233.277 Q 250.874 233.277, 249.647 231.465 Q 248.439 229.653, 248.439 226.425 Q 248.439 223.198, 249.647 221.405 Q 250.855 219.612, 253.328 219.612 Q 255.8 219.612, 257.008 221.405 Q 258.216 223.198, 258.216 226.425 Q 258.216 229.653, 256.989 231.465 Q 255.781 233.277, 253.328 233.277 M 253.328 231.767 Q 254.781 231.767, 255.555 230.427 Q 256.329 229.068, 256.329 226.425 Q 256.329 223.802, 255.555 222.462 Q 254.781 221.122, 253.328 221.122 Q 251.893 221.122, 251.1 222.462 Q 250.327 223.802, 250.327 226.425 Q 250.327 229.068, 251.1 230.427 Q 251.893 231.767, 253.328 231.767 " fill="#000000"/> | |
</svg> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [27]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="n">stereo</span> <span class="o">=</span> <span class="nb">tuple</span><span class="p">(</span><span class="n">Chem</span><span class="o">.</span><span class="n">FindPotentialStereo</span><span class="p">(</span><span class="n">m3</span><span class="p">,</span> <span class="n">cleanIt</span><span class="o">=</span><span class="kc">True</span><span class="p">,</span> <span class="n">flagPossible</span><span class="o">=</span><span class="kc">True</span><span class="p">))</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [28]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="nb">len</span><span class="p">(</span><span class="n">stereo</span><span class="p">)</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt output_prompt">Out[28]:</div> | |
<div class="output_text output_subarea output_execute_result"> | |
<pre>1</pre> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt"> | |
</div><div class="inner_cell"> | |
<div class="text_cell_render border-box-sizing rendered_html"> | |
<p><code>FindPotentialStereo()</code> does not flag the non-invertible nitrogens as chiral:</p> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [29]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="k">for</span> <span class="n">si</span> <span class="ow">in</span> <span class="n">stereo</span><span class="p">:</span> | |
<span class="nb">print</span><span class="p">(</span><span class="n">si</span><span class="o">.</span><span class="n">centeredOn</span><span class="p">,</span> <span class="n">si</span><span class="o">.</span><span class="n">descriptor</span><span class="p">,</span> <span class="n">si</span><span class="o">.</span><span class="n">specified</span><span class="p">,</span> <span class="n">si</span><span class="o">.</span><span class="n">type</span><span class="p">)</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt"></div> | |
<div class="output_subarea output_stream output_stdout output_text"> | |
<pre>1 NoValue Unspecified Atom_Tetrahedral | |
</pre> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [30]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span><span class="nb">type</span><span class="p">(</span><span class="n">Chem</span><span class="o">.</span><span class="n">StereoInfo</span><span class="o">.</span><span class="n">type</span><span class="p">)</span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
<div class="output_wrapper"> | |
<div class="output"> | |
<div class="output_area"> | |
<div class="prompt output_prompt">Out[30]:</div> | |
<div class="output_text output_subarea output_execute_result"> | |
<pre>property</pre> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
<div class="cell border-box-sizing code_cell rendered"> | |
<div class="input"> | |
<div class="prompt input_prompt">In [ ]:</div> | |
<div class="inner_cell"> | |
<div class="input_area"> | |
<div class=" highlight hl-ipython3"><pre><span></span> | |
</pre></div> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
</div> | |
</body> | |
</html> |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment