Created
April 20, 2015 19:19
-
-
Save vbullinger/d2ef5a64d1d9e620f820 to your computer and use it in GitHub Desktop.
This file has been truncated, but you can view the full file.
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| 82041 silly lockFile d40f3000-pm-cache-tryor-0-1-2-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\tryor\0.1.2\package.tgz | |
| 82042 silly resolved [ { name: 'amdefine', | |
| 82042 silly resolved description: 'Provide AMD\'s define() API for declaring modules in the AMD format', | |
| 82042 silly resolved version: '0.1.0', | |
| 82042 silly resolved homepage: 'http://github.com/jrburke/amdefine', | |
| 82042 silly resolved author: | |
| 82042 silly resolved { name: 'James Burke', | |
| 82042 silly resolved email: 'jrburke@gmail.com', | |
| 82042 silly resolved url: 'http://github.com/jrburke' }, | |
| 82042 silly resolved licenses: [ [Object], [Object] ], | |
| 82042 silly resolved repository: { type: 'git', url: 'https://github.com/jrburke/amdefine.git' }, | |
| 82042 silly resolved main: './amdefine.js', | |
| 82042 silly resolved engines: { node: '>=0.4.2' }, | |
| 82042 silly resolved readme: '# amdefine\n\nA module that can be used to implement AMD\'s define() in Node. This allows you\nto code to the AMD API and have the module work in node programs without\nrequiring those other programs to use AMD.\n\n## Usage\n\n**1)** Update your package.json to indicate amdefine as a dependency:\n\n```javascript\n "dependencies": {\n "amdefine": ">=0.1.0"\n }\n```\n\nThen run `npm install` to get amdefine into your project.\n\n**2)** At the top of each module that uses define(), place this code:\n\n```javascript\nif (typeof define !== \'function\') { var define = require(\'amdefine\')(module) }\n```\n\n**Only use these snippets** when loading amdefine. If you preserve the basic structure,\nwith the braces, it will be stripped out when using the [RequireJS optimizer](#optimizer).\n\nYou can add spaces, line breaks and even require amdefine with a local path, but\nkeep the rest of the structure to get the stripping behavior.\n\nAs you may know, because `if` statements in JavaScript don\'t have their own scope, the var\ndeclaration in the above snippet is made whether the `if` expression is truthy or not. If\nRequireJS is loaded then the declaration is superfluous because `define` is already already\ndeclared in the same scope in RequireJS. Fortunately JavaScript handles multiple `var`\ndeclarations of the same variable in the same scope gracefully.\n\nIf you want to deliver amdefine.js with your code rather than specifying it as a dependency\nwith npm, then just download the latest release and refer to it using a relative path:\n\n[Latest Version](https://github.com/jrburke/amdefine/raw/latest/amdefine.js)\n\n### amdefine/intercept\n\nConsider this very experimental.\n\nInstead of pasting the piece of text for the amdefine setup of a `define`\nvariable in each module you create or consume, you can use `amdefine/intercept`\ninstead. It will automatically insert the above snippet in each .js file loaded\nby Node.\n\n**Warning**: you should only use this if you are creating an application that\nis consuming AMD style defined()\'d modules that are distributed via npm and want\nto run that code in Node.\n\nFor library code where you are not sure if it will be used by others in Node or\nin the browser, then explicitly depending on amdefine and placing the code\nsnippet above is suggested path, instead of using `amdefine/intercept`. The\nintercept module affects all .js files loaded in the Node app, and it is\ninconsiderate to modify global state like that unless you are also controlling\nthe top level app.\n\n#### Why distribute AMD-style nodes via npm?\n\nnpm has a lot of weaknesses for front-end use (installed layout is not great,\nshould have better support for the `baseUrl + moduleID + \'.js\' style of loading,\nsingle file JS installs), but some people want a JS package manager and are\nwilling to live with those constraints. If that is you, but still want to author\nin AMD style modules to get dynamic require([]), better direct source usage and\npowerful loader plugin support in the browser, then this tool can help.\n\n#### amdefine/intercept usage\n\nJust require it in your top level app module (for example index.js, server.js):\n\n```javascript\nrequire(\'amdefine/intercept\');\n```\n\nThe module does not return a value, so no need to assign the result to a local\nvariable.\n\nThen just require() code as you normally would with Node\'s require(). Any .js\nloaded after the intercept require will have the amdefine check injected in\nthe .js source as it is loaded. It does not modify the source on disk, just\nprepends some content to the text of the module as it is loaded by Node.\n\n#### How amdefine/intercept works\n\nIt overrides the `Module._extensions[\'.js\']` in Node to automatically prepend\nthe amdefine snippet above. So, it will affect any .js file loaded by your\napp.\n\n## define() usage\n\nIt is best if you use the anonymous forms of define() in your module:\n\n```javascript\ndefine(function (require) {\n var dependency = require(\'dependency\');\n});\n```\n\nor\n\n```javascript\ndefine([\'dependency\'], function (dependency) {\n\n});\n```\n\n## RequireJS optimizer integration. <a name="optimizer"></name>\n\nVersion 1.0.3 of the [RequireJS optimizer](http://requirejs.org/docs/optimization.html)\nwill have support for stripping the `if (typeof define !== \'function\')` check\nmentioned above, so you can include this snippet for code that runs in the\nbrowser, but avoid taking the cost of the if() statement once the code is\noptimized for deployment.\n\n## Node 0.4 Support\n\nIf you want to support Node 0.4, then add `require` as the second parameter to amdefine:\n\n```javascript\n//Only if you want Node 0.4. If using 0.5 or later, use the above snippet.\nif (typeof define !== \'function\') { var define = require(\'amdefine\')(module, require) }\n```\n\n## Limitations\n\n### Synchronous vs Asynchronous\n\namdefine creates a define() function that is callable by your code. It will\nexecute and trace dependencies and call the factory function *synchronously*,\nto keep the behavior in line with Node\'s synchronous dependency tracing.\n\nThe exception: calling AMD\'s callback-style require() from inside a factory\nfunction. The require callback is called on process.nextTick():\n\n```javascript\ndefine(function (require) {\n require([\'a\'], function(a) {\n //\'a\' is loaded synchronously, but\n //this callback is called on process.nextTick().\n });\n});\n```\n\n### Loader Plugins\n\nLoader plugins are supported as long as they call their load() callbacks\nsynchronously. So ones that do network requests will not work. However plugins\nlike [text](http://requirejs.org/docs/api.html#text) can load text files locally.\n\nThe plugin API\'s `load.fromText()` is **not supported** in amdefine, so this means\ntranspiler plugins like the [CoffeeScript loader plugin](https://github.com/jrburke/require-cs)\nwill not work. This may be fixable, but it is a bit complex, and I do not have\nenough node-fu to figure it out yet. See the source for amdefine.js if you want\nto get an idea of the issues involved.\n\n## Tests\n\nTo run the tests, cd to **tests** and run:\n\n```\nnode all.js\nnode all-intercept.js\n```\n\n## License\n\nNew BSD and MIT. Check the LICENSE file for all the details.\n', | |
| 82042 silly resolved readmeFilename: 'README.md', | |
| 82042 silly resolved bugs: { url: 'https://github.com/jrburke/amdefine/issues' }, | |
| 82042 silly resolved _id: 'amdefine@0.1.0', | |
| 82042 silly resolved _from: 'amdefine@>=0.0.4', | |
| 82042 silly resolved scripts: {}, | |
| 82042 silly resolved dist: { shasum: '043a98168e8043c4295e7383e0e80bf31668075e' }, | |
| 82042 silly resolved _resolved: 'https://registry.npmjs.org/amdefine/-/amdefine-0.1.0.tgz' } ] | |
| 82043 info install amdefine@0.1.0 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\react\node_modules\envify\node_modules\jstransform\node_modules\source-map | |
| 82044 info installOne amdefine@0.1.0 | |
| 82045 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\react\node_modules\envify\node_modules\jstransform\node_modules\source-map\node_modules\amdefine unbuild | |
| 82046 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\amdefine\0.1.0\package.tgz | |
| 82047 silly lockFile b964d792-source-map-node-modules-amdefine tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\react\node_modules\envify\node_modules\jstransform\node_modules\source-map\node_modules\amdefine | |
| 82048 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\react\node_modules\envify\node_modules\jstransform\node_modules\source-map\node_modules\amdefine C:\Users\Vince\AppData\Roaming\npm-cache\b964d792-source-map-node-modules-amdefine.lock | |
| 82049 silly lockFile 05f8b4cb-cache-amdefine-0-1-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\amdefine\0.1.0\package.tgz | |
| 82050 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\amdefine\0.1.0\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\05f8b4cb-cache-amdefine-0-1-0-package-tgz.lock | |
| 82051 silly gunzTarPerm modes [ '755', '644' ] | |
| 82052 info preinstall tryor@0.1.2 | |
| 82053 verbose readDependencies using package.json deps | |
| 82054 verbose readDependencies using package.json deps | |
| 82055 silly resolved [] | |
| 82056 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\tryor | |
| 82057 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\tryor | |
| 82058 verbose linkStuff [ true, | |
| 82058 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 82058 verbose linkStuff false, | |
| 82058 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\defs\\node_modules' ] | |
| 82059 info linkStuff tryor@0.1.2 | |
| 82060 silly gunzTarPerm extractEntry package.json | |
| 82061 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 82062 silly gunzTarPerm extractEntry example/bool.js | |
| 82063 silly gunzTarPerm modified mode [ 'example/bool.js', 438, 420 ] | |
| 82064 silly gunzTarPerm extractEntry example/divide.js | |
| 82065 silly gunzTarPerm modified mode [ 'example/divide.js', 438, 420 ] | |
| 82066 verbose linkBins tryor@0.1.2 | |
| 82067 verbose linkMans tryor@0.1.2 | |
| 82068 verbose rebuildBundles tryor@0.1.2 | |
| 82069 silly lockFile 2daa1f05--modules-defs-node-modules-alter tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\alter | |
| 82070 silly lockFile 2daa1f05--modules-defs-node-modules-alter tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\alter | |
| 82071 info install tryor@0.1.2 | |
| 82072 silly lockFile 749687ce-les-defs-node-modules-simple-fmt tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\simple-fmt | |
| 82073 silly lockFile 749687ce-les-defs-node-modules-simple-fmt tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\simple-fmt | |
| 82074 silly lockFile 3d615fdf-ules-defs-node-modules-simple-is tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\simple-is | |
| 82075 silly lockFile 3d615fdf-ules-defs-node-modules-simple-is tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\simple-is | |
| 82076 silly lockFile 545e946d-pm-cache-alter-0-2-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\alter\0.2.0\package.tgz | |
| 82077 silly lockFile 545e946d-pm-cache-alter-0-2-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\alter\0.2.0\package.tgz | |
| 82078 silly gunzTarPerm extractEntry README.md | |
| 82079 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 82080 silly gunzTarPerm extractEntry LICENSE | |
| 82081 silly gunzTarPerm modified mode [ 'LICENSE', 438, 420 ] | |
| 82082 info postinstall tryor@0.1.2 | |
| 82083 silly lockFile 9bcc20ad-che-simple-fmt-0-1-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\simple-fmt\0.1.0\package.tgz | |
| 82084 silly lockFile 9bcc20ad-che-simple-fmt-0-1-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\simple-fmt\0.1.0\package.tgz | |
| 82085 silly lockFile e6a3e128-ache-simple-is-0-2-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\simple-is\0.2.0\package.tgz | |
| 82086 silly lockFile e6a3e128-ache-simple-is-0-2-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\simple-is\0.2.0\package.tgz | |
| 82087 info preinstall alter@0.2.0 | |
| 82088 info preinstall simple-fmt@0.1.0 | |
| 82089 silly lockFile 0ac62669-ules-defs-node-modules-stringset tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\stringset | |
| 82090 silly lockFile 0ac62669-ules-defs-node-modules-stringset tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\stringset | |
| 82091 info preinstall simple-is@0.2.0 | |
| 82092 silly gunzTarPerm extractEntry example/help.js | |
| 82093 silly gunzTarPerm modified mode [ 'example/help.js', 438, 420 ] | |
| 82094 silly gunzTarPerm extractEntry example/implies.js | |
| 82095 silly gunzTarPerm modified mode [ 'example/implies.js', 438, 420 ] | |
| 82096 silly lockFile d5e04869-ache-stringset-0-2-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\stringset\0.2.1\package.tgz | |
| 82097 silly lockFile d5e04869-ache-stringset-0-2-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\stringset\0.2.1\package.tgz | |
| 82098 verbose readDependencies using package.json deps | |
| 82099 verbose readDependencies using package.json deps | |
| 82100 silly gunzTarPerm extractEntry amdefine.js | |
| 82101 silly gunzTarPerm modified mode [ 'amdefine.js', 438, 420 ] | |
| 82102 silly gunzTarPerm extractEntry intercept.js | |
| 82103 silly gunzTarPerm modified mode [ 'intercept.js', 438, 420 ] | |
| 82104 verbose readDependencies using package.json deps | |
| 82105 verbose readDependencies using package.json deps | |
| 82106 verbose readDependencies using package.json deps | |
| 82107 silly resolved [] | |
| 82108 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\simple-fmt | |
| 82109 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\simple-fmt | |
| 82110 verbose linkStuff [ true, | |
| 82110 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 82110 verbose linkStuff false, | |
| 82110 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\defs\\node_modules' ] | |
| 82111 info linkStuff simple-fmt@0.1.0 | |
| 82112 verbose readDependencies using package.json deps | |
| 82113 silly resolved [] | |
| 82114 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\simple-is | |
| 82115 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\simple-is | |
| 82116 verbose linkStuff [ true, | |
| 82116 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 82116 verbose linkStuff false, | |
| 82116 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\defs\\node_modules' ] | |
| 82117 info linkStuff simple-is@0.2.0 | |
| 82118 verbose linkBins simple-fmt@0.1.0 | |
| 82119 verbose linkMans simple-fmt@0.1.0 | |
| 82120 verbose rebuildBundles simple-fmt@0.1.0 | |
| 82121 verbose cache add [ 'stable@~0.1.3', null ] | |
| 82122 verbose cache add name=undefined spec="stable@~0.1.3" args=["stable@~0.1.3",null] | |
| 82123 verbose parsed url { protocol: null, | |
| 82123 verbose parsed url slashes: null, | |
| 82123 verbose parsed url auth: null, | |
| 82123 verbose parsed url host: null, | |
| 82123 verbose parsed url port: null, | |
| 82123 verbose parsed url hostname: null, | |
| 82123 verbose parsed url hash: null, | |
| 82123 verbose parsed url search: null, | |
| 82123 verbose parsed url query: null, | |
| 82123 verbose parsed url pathname: 'stable@~0.1.3', | |
| 82123 verbose parsed url path: 'stable@~0.1.3', | |
| 82123 verbose parsed url href: 'stable@~0.1.3' } | |
| 82124 verbose cache add name="stable" spec="~0.1.3" args=["stable","~0.1.3"] | |
| 82125 verbose parsed url { protocol: null, | |
| 82125 verbose parsed url slashes: null, | |
| 82125 verbose parsed url auth: null, | |
| 82125 verbose parsed url host: null, | |
| 82125 verbose parsed url port: null, | |
| 82125 verbose parsed url hostname: null, | |
| 82125 verbose parsed url hash: null, | |
| 82125 verbose parsed url search: null, | |
| 82125 verbose parsed url query: null, | |
| 82125 verbose parsed url pathname: '~0.1.3', | |
| 82125 verbose parsed url path: '~0.1.3', | |
| 82125 verbose parsed url href: '~0.1.3' } | |
| 82126 verbose addNamed [ 'stable', '~0.1.3' ] | |
| 82127 verbose addNamed [ null, '>=0.1.3-0 <0.2.0-0' ] | |
| 82128 silly lockFile c1a2ae86-stable-0-1-3 stable@~0.1.3 | |
| 82129 verbose lock stable@~0.1.3 C:\Users\Vince\AppData\Roaming\npm-cache\c1a2ae86-stable-0-1-3.lock | |
| 82130 silly lockFile e8f714b4-ules-defs-node-modules-stringmap tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\stringmap | |
| 82131 silly lockFile e8f714b4-ules-defs-node-modules-stringmap tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\stringmap | |
| 82132 verbose linkBins simple-is@0.2.0 | |
| 82133 verbose linkMans simple-is@0.2.0 | |
| 82134 verbose rebuildBundles simple-is@0.2.0 | |
| 82135 info install simple-fmt@0.1.0 | |
| 82136 silly addNameRange { name: 'stable', range: '>=0.1.3-0 <0.2.0-0', hasData: false } | |
| 82137 info install simple-is@0.2.0 | |
| 82138 silly lockFile c7574e38-ache-stringmap-0-2-2-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\stringmap\0.2.2\package.tgz | |
| 82139 silly lockFile c7574e38-ache-stringmap-0-2-2-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\stringmap\0.2.2\package.tgz | |
| 82140 info preinstall stringset@0.2.1 | |
| 82141 info postinstall simple-fmt@0.1.0 | |
| 82142 info postinstall simple-is@0.2.0 | |
| 82143 verbose readDependencies using package.json deps | |
| 82144 silly lockFile e6c3ef68-s-defs-node-modules-ast-traverse tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\ast-traverse | |
| 82145 silly lockFile e6c3ef68-s-defs-node-modules-ast-traverse tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\ast-traverse | |
| 82146 verbose registry.get stable not expired, no request | |
| 82147 silly addNameRange number 2 { name: 'stable', range: '>=0.1.3-0 <0.2.0-0', hasData: true } | |
| 82148 silly addNameRange versions [ 'stable', | |
| 82148 silly addNameRange [ '0.1.0', '0.1.1', '0.1.2', '0.1.3', '0.1.4', '0.1.5' ] ] | |
| 82149 verbose addNamed [ 'stable', '0.1.5' ] | |
| 82150 verbose addNamed [ '0.1.5', '0.1.5' ] | |
| 82151 silly lockFile 2b1b203e-stable-0-1-5 stable@0.1.5 | |
| 82152 verbose lock stable@0.1.5 C:\Users\Vince\AppData\Roaming\npm-cache\2b1b203e-stable-0-1-5.lock | |
| 82153 verbose readDependencies using package.json deps | |
| 82154 silly resolved [] | |
| 82155 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\stringset | |
| 82156 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\stringset | |
| 82157 verbose linkStuff [ true, | |
| 82157 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 82157 verbose linkStuff false, | |
| 82157 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\defs\\node_modules' ] | |
| 82158 info linkStuff stringset@0.2.1 | |
| 82159 silly lockFile 70296c3f-e-ast-traverse-0-1-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\ast-traverse\0.1.1\package.tgz | |
| 82160 silly lockFile 70296c3f-e-ast-traverse-0-1-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\ast-traverse\0.1.1\package.tgz | |
| 82161 silly lockFile 2b1b203e-stable-0-1-5 stable@0.1.5 | |
| 82162 silly lockFile 2b1b203e-stable-0-1-5 stable@0.1.5 | |
| 82163 verbose linkBins stringset@0.2.1 | |
| 82164 verbose linkMans stringset@0.2.1 | |
| 82165 verbose rebuildBundles stringset@0.2.1 | |
| 82166 info install stringset@0.2.1 | |
| 82167 silly lockFile e0ce18af-ules-defs-node-modules-breakable tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\breakable | |
| 82168 silly lockFile e0ce18af-ules-defs-node-modules-breakable tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\breakable | |
| 82169 silly lockFile c1a2ae86-stable-0-1-3 stable@~0.1.3 | |
| 82170 silly lockFile c1a2ae86-stable-0-1-3 stable@~0.1.3 | |
| 82171 info postinstall stringset@0.2.1 | |
| 82172 info preinstall stringmap@0.2.2 | |
| 82173 silly lockFile 8c7fb1c8-ache-breakable-1-0-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\breakable\1.0.0\package.tgz | |
| 82174 silly lockFile 8c7fb1c8-ache-breakable-1-0-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\breakable\1.0.0\package.tgz | |
| 82175 silly resolved [ { name: 'stable', | |
| 82175 silly resolved version: '0.1.5', | |
| 82175 silly resolved keywords: [ 'stable', 'array', 'sort' ], | |
| 82175 silly resolved description: 'A stable array sort for JavaScript', | |
| 82175 silly resolved repository: { type: 'git', url: 'https://github.com/Two-Screen/stable.git' }, | |
| 82175 silly resolved main: './stable.js', | |
| 82175 silly resolved devDependencies: { tape: '2', 'uglify-js': '2' }, | |
| 82175 silly resolved scripts: | |
| 82175 silly resolved { test: 'node ./test.js', | |
| 82175 silly resolved minify: 'uglifyjs --comments \'/^!/\' -c -m -o ./stable.min.js ./stable.js' }, | |
| 82175 silly resolved testling: { files: './test.js', browsers: [Object] }, | |
| 82175 silly resolved author: { name: 'Angry Bytes', email: 'info@angrybytes.com' }, | |
| 82175 silly resolved contributors: [ [Object], [Object], [Object] ], | |
| 82175 silly resolved license: 'MIT', | |
| 82175 silly resolved readme: '## Stable\n\nA stable array sort, because `Array#sort()` is not guaranteed stable.\n\nMIT licensed.\n\n[](http://travis-ci.org/Two-Screen/stable)\n\n[](http://ci.testling.com/Two-Screen/stable)\n\n#### From the browser\n\nInclude [`stable.js`] or the minified version [`stable.min.js`]\nin your page, then call `stable()`.\n\n [`stable.js`]: https://raw.github.com/Two-Screen/stable/master/stable.js\n [`stable.min.js`]: https://raw.github.com/Two-Screen/stable/master/stable.min.js\n\n#### From Node.js\n\nInstall using NPM:\n\n npm install stable\n\nRequire in your code:\n\n var stable = require("stable");\n\n#### Usage\n\nThe default sort is, as with `Array#sort`, lexicographical:\n\n stable(["foo", "bar", "baz"]); // => ["bar", "baz", "foo"]\n stable([10, 1, 5]); // => [1, 10, 5]\n\nUnlike `Array#sort`, the default sort is **NOT** in-place. To do an in-place\nsort, use `stable.inplace`, which otherwise works the same:\n\n var arr = [10, 1, 5];\n stable(arr) === arr; // => false\n stable.inplace(arr) === arr; // => true\n\nA comparator function can be specified:\n\n // Regular sort() compatible comparator, that returns a number.\n // This demonstrates the default behavior.\n function lexCmp(a, b) {\n return String(a).localeCompare(b);\n }\n stable(["foo", "bar", "baz"], lexCmp); // => ["bar", "baz", "foo"]\n\n // Boolean comparator. Sorts `b` before `a` if true.\n // This demonstrates a simple way to sort numerically.\n function greaterThan(a, b) {\n return a > b;\n }\n stable([10, 1, 5], greaterThan); // -> [1, 5, 10]\n\n#### License\n\nCopyright (C) 2014 Angry Bytes and contributors.\n\nPermission is hereby granted, free of charge, to any person obtaining a copy of\nthis software and associated documentation files (the "Software"), to deal in\nthe Software without restriction, including without limitation the rights to\nuse, copy, modify, merge, publish, distribute, sublicense, and/or sell copies\nof the Software, and to permit persons to whom the Software is furnished to do\nso, subject to the following conditions:\n\nThe above copyright notice and this permission notice shall be included in all\ncopies or substantial portions of the Software.\n\nTHE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR\nIMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,\nFITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE\nAUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER\nLIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,\nOUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE\nSOFTWARE.\n', | |
| 82175 silly resolved readmeFilename: 'README.md', | |
| 82175 silly resolved bugs: { url: 'https://github.com/Two-Screen/stable/issues' }, | |
| 82175 silly resolved _id: 'stable@0.1.5', | |
| 82175 silly resolved _from: 'stable@~0.1.3' } ] | |
| 82176 info install stable@0.1.5 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\alter | |
| 82177 info installOne stable@0.1.5 | |
| 82178 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\alter\node_modules\stable unbuild | |
| 82179 verbose readDependencies using package.json deps | |
| 82180 verbose readDependencies using package.json deps | |
| 82181 silly resolved [] | |
| 82182 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\stringmap | |
| 82183 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\stringmap | |
| 82184 verbose linkStuff [ true, | |
| 82184 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 82184 verbose linkStuff false, | |
| 82184 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\defs\\node_modules' ] | |
| 82185 info linkStuff stringmap@0.2.2 | |
| 82186 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\stable\0.1.5\package.tgz | |
| 82187 silly lockFile fac7463f-odules-alter-node-modules-stable tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\alter\node_modules\stable | |
| 82188 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\alter\node_modules\stable C:\Users\Vince\AppData\Roaming\npm-cache\fac7463f-odules-alter-node-modules-stable.lock | |
| 82189 silly lockFile 3b0bfbb7-m-cache-stable-0-1-5-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\stable\0.1.5\package.tgz | |
| 82190 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\stable\0.1.5\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\3b0bfbb7-m-cache-stable-0-1-5-package-tgz.lock | |
| 82191 verbose linkBins stringmap@0.2.2 | |
| 82192 verbose linkMans stringmap@0.2.2 | |
| 82193 verbose rebuildBundles stringmap@0.2.2 | |
| 82194 info preinstall ast-traverse@0.1.1 | |
| 82195 info install stringmap@0.2.2 | |
| 82196 info preinstall breakable@1.0.0 | |
| 82197 info postinstall stringmap@0.2.2 | |
| 82198 silly gunzTarPerm modes [ '755', '644' ] | |
| 82199 verbose readDependencies using package.json deps | |
| 82200 verbose readDependencies using package.json deps | |
| 82201 silly resolved [] | |
| 82202 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\ast-traverse | |
| 82203 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\ast-traverse | |
| 82204 verbose linkStuff [ true, | |
| 82204 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 82204 verbose linkStuff false, | |
| 82204 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\defs\\node_modules' ] | |
| 82205 info linkStuff ast-traverse@0.1.1 | |
| 82206 verbose readDependencies using package.json deps | |
| 82207 verbose readDependencies using package.json deps | |
| 82208 silly resolved [] | |
| 82209 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\breakable | |
| 82210 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\breakable | |
| 82211 verbose linkStuff [ true, | |
| 82211 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 82211 verbose linkStuff false, | |
| 82211 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\defs\\node_modules' ] | |
| 82212 info linkStuff breakable@1.0.0 | |
| 82213 verbose linkBins ast-traverse@0.1.1 | |
| 82214 verbose linkMans ast-traverse@0.1.1 | |
| 82215 verbose rebuildBundles ast-traverse@0.1.1 | |
| 82216 info install ast-traverse@0.1.1 | |
| 82217 silly gunzTarPerm extractEntry package.json | |
| 82218 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 82219 verbose linkBins breakable@1.0.0 | |
| 82220 verbose linkMans breakable@1.0.0 | |
| 82221 verbose rebuildBundles breakable@1.0.0 | |
| 82222 info install breakable@1.0.0 | |
| 82223 info postinstall ast-traverse@0.1.1 | |
| 82224 info postinstall breakable@1.0.0 | |
| 82225 silly gunzTarPerm extractEntry .npmignore | |
| 82226 silly gunzTarPerm modified mode [ '.npmignore', 438, 420 ] | |
| 82227 silly gunzTarPerm extractEntry README.md | |
| 82228 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 82229 silly gunzTarPerm extractEntry stable.js | |
| 82230 silly gunzTarPerm modified mode [ 'stable.js', 438, 420 ] | |
| 82231 silly gunzTarPerm extractEntry test.js | |
| 82232 silly gunzTarPerm modified mode [ 'test.js', 438, 420 ] | |
| 82233 silly gunzTarPerm extractEntry example/demand_count.js | |
| 82234 silly gunzTarPerm modified mode [ 'example/demand_count.js', 438, 420 ] | |
| 82235 silly gunzTarPerm extractEntry example/line_count.js | |
| 82236 silly gunzTarPerm modified mode [ 'example/line_count.js', 438, 420 ] | |
| 82237 silly gunzTarPerm extractEntry shim.js | |
| 82238 silly gunzTarPerm modified mode [ 'shim.js', 438, 420 ] | |
| 82239 silly gunzTarPerm extractEntry fn/$for.js | |
| 82240 silly gunzTarPerm modified mode [ 'fn/$for.js', 438, 420 ] | |
| 82241 silly gunzTarPerm extractEntry .travis.yml | |
| 82242 silly gunzTarPerm modified mode [ '.travis.yml', 438, 420 ] | |
| 82243 silly gunzTarPerm extractEntry bower.json | |
| 82244 silly gunzTarPerm modified mode [ 'bower.json', 438, 420 ] | |
| 82245 silly gunzTarPerm extractEntry example/line_count_options.js | |
| 82246 silly gunzTarPerm modified mode [ 'example/line_count_options.js', 438, 420 ] | |
| 82247 silly gunzTarPerm extractEntry example/line_count_wrap.js | |
| 82248 silly gunzTarPerm modified mode [ 'example/line_count_wrap.js', 438, 420 ] | |
| 82249 silly gunzTarPerm extractEntry fn/dict.js | |
| 82250 silly gunzTarPerm modified mode [ 'fn/dict.js', 438, 420 ] | |
| 82251 silly gunzTarPerm extractEntry fn/weak-map.js | |
| 82252 silly gunzTarPerm modified mode [ 'fn/weak-map.js', 438, 420 ] | |
| 82253 silly gunzTarPerm extractEntry example/nonopt.js | |
| 82254 silly gunzTarPerm modified mode [ 'example/nonopt.js', 438, 420 ] | |
| 82255 silly gunzTarPerm extractEntry example/requires_arg.js | |
| 82256 silly gunzTarPerm modified mode [ 'example/requires_arg.js', 438, 420 ] | |
| 82257 silly lockFile cc106614-s-recast-node-modules-esprima-fb tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-loader\node_modules\babel-core\node_modules\regenerator\node_modules\recast\node_modules\esprima-fb | |
| 82258 silly lockFile cc106614-s-recast-node-modules-esprima-fb tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-loader\node_modules\babel-core\node_modules\regenerator\node_modules\recast\node_modules\esprima-fb | |
| 82259 silly lockFile 28ea949c-1-1-0-dev-harmony-fb-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\14001.1.0-dev-harmony-fb\package.tgz | |
| 82260 silly lockFile 28ea949c-1-1-0-dev-harmony-fb-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\14001.1.0-dev-harmony-fb\package.tgz | |
| 82261 silly gunzTarPerm extractEntry example/default_singles.js | |
| 82262 silly gunzTarPerm modified mode [ 'example/default_singles.js', 438, 420 ] | |
| 82263 silly gunzTarPerm extractEntry example/short.js | |
| 82264 silly gunzTarPerm modified mode [ 'example/short.js', 438, 420 ] | |
| 82265 silly gunzTarPerm extractEntry fn/get-iterator.js | |
| 82266 silly gunzTarPerm modified mode [ 'fn/get-iterator.js', 438, 420 ] | |
| 82267 silly gunzTarPerm extractEntry fn/global.js | |
| 82268 silly gunzTarPerm modified mode [ 'fn/global.js', 438, 420 ] | |
| 82269 info preinstall esprima-fb@14001.1.0-dev-harmony-fb | |
| 82270 verbose readDependencies using package.json deps | |
| 82271 verbose readDependencies using package.json deps | |
| 82272 silly resolved [] | |
| 82273 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-loader\node_modules\babel-core\node_modules\regenerator\node_modules\recast\node_modules\esprima-fb | |
| 82274 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-loader\node_modules\babel-core\node_modules\regenerator\node_modules\recast\node_modules\esprima-fb | |
| 82275 verbose linkStuff [ true, | |
| 82275 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 82275 verbose linkStuff false, | |
| 82275 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel-loader\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\recast\\node_modules' ] | |
| 82276 info linkStuff esprima-fb@14001.1.0-dev-harmony-fb | |
| 82277 silly lockFile b964d792-source-map-node-modules-amdefine tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\react\node_modules\envify\node_modules\jstransform\node_modules\source-map\node_modules\amdefine | |
| 82278 silly lockFile b964d792-source-map-node-modules-amdefine tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\react\node_modules\envify\node_modules\jstransform\node_modules\source-map\node_modules\amdefine | |
| 82279 verbose linkBins esprima-fb@14001.1.0-dev-harmony-fb | |
| 82280 verbose link bins [ { esparse: './bin/esparse.js', | |
| 82280 verbose link bins esvalidate: './bin/esvalidate.js' }, | |
| 82280 verbose link bins 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel-loader\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\recast\\node_modules\\.bin', | |
| 82280 verbose link bins false ] | |
| 82281 verbose linkMans esprima-fb@14001.1.0-dev-harmony-fb | |
| 82282 verbose rebuildBundles esprima-fb@14001.1.0-dev-harmony-fb | |
| 82283 silly gunzTarPerm extractEntry example/default_hash.js | |
| 82284 silly gunzTarPerm modified mode [ 'example/default_hash.js', 438, 420 ] | |
| 82285 silly gunzTarPerm extractEntry example/strict.js | |
| 82286 silly gunzTarPerm modified mode [ 'example/strict.js', 438, 420 ] | |
| 82287 silly lockFile 05f8b4cb-cache-amdefine-0-1-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\amdefine\0.1.0\package.tgz | |
| 82288 silly lockFile 05f8b4cb-cache-amdefine-0-1-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\amdefine\0.1.0\package.tgz | |
| 82289 silly gunzTarPerm extractEntry fn/delay.js | |
| 82290 silly gunzTarPerm modified mode [ 'fn/delay.js', 438, 420 ] | |
| 82291 silly gunzTarPerm extractEntry fn/log.js | |
| 82292 silly gunzTarPerm modified mode [ 'fn/log.js', 438, 420 ] | |
| 82293 info preinstall amdefine@0.1.0 | |
| 82294 silly gunzTarPerm extractEntry example/count.js | |
| 82295 silly gunzTarPerm modified mode [ 'example/count.js', 438, 420 ] | |
| 82296 silly gunzTarPerm extractEntry example/string.js | |
| 82297 silly gunzTarPerm modified mode [ 'example/string.js', 438, 420 ] | |
| 82298 verbose readDependencies using package.json deps | |
| 82299 verbose readDependencies using package.json deps | |
| 82300 silly resolved [] | |
| 82301 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\react\node_modules\envify\node_modules\jstransform\node_modules\source-map\node_modules\amdefine | |
| 82302 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\react\node_modules\envify\node_modules\jstransform\node_modules\source-map\node_modules\amdefine | |
| 82303 verbose linkStuff [ true, | |
| 82303 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 82303 verbose linkStuff false, | |
| 82303 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\react\\node_modules\\envify\\node_modules\\jstransform\\node_modules\\source-map\\node_modules' ] | |
| 82304 info linkStuff amdefine@0.1.0 | |
| 82305 verbose linkBins amdefine@0.1.0 | |
| 82306 verbose linkMans amdefine@0.1.0 | |
| 82307 verbose rebuildBundles amdefine@0.1.0 | |
| 82308 silly gunzTarPerm modes [ '755', '644' ] | |
| 82309 info install amdefine@0.1.0 | |
| 82310 silly lockFile 1f5c676e-86909-0-8921095754485577-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557086909-0.8921095754485577\package | |
| 82311 silly lockFile 1f5c676e-86909-0-8921095754485577-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557086909-0.8921095754485577\package | |
| 82312 info install esprima-fb@14001.1.0-dev-harmony-fb | |
| 82313 info postinstall amdefine@0.1.0 | |
| 82314 silly lockFile d9868246-86909-0-8921095754485577-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557086909-0.8921095754485577\tmp.tgz | |
| 82315 silly lockFile d9868246-86909-0-8921095754485577-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557086909-0.8921095754485577\tmp.tgz | |
| 82316 info postinstall esprima-fb@14001.1.0-dev-harmony-fb | |
| 82317 silly gunzTarPerm extractEntry example/boolean_single.js | |
| 82318 silly gunzTarPerm modified mode [ 'example/boolean_single.js', 438, 420 ] | |
| 82319 silly gunzTarPerm extractEntry example/usage-options.js | |
| 82320 silly gunzTarPerm modified mode [ 'example/usage-options.js', 438, 420 ] | |
| 82321 silly gunzTarPerm extractEntry fn/map.js | |
| 82322 silly gunzTarPerm modified mode [ 'fn/map.js', 438, 420 ] | |
| 82323 silly gunzTarPerm extractEntry fn/set.js | |
| 82324 silly gunzTarPerm modified mode [ 'fn/set.js', 438, 420 ] | |
| 82325 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\react\node_modules\envify\node_modules\jstransform\node_modules\source-map | |
| 82326 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\react\node_modules\envify\node_modules\jstransform\node_modules\source-map | |
| 82327 verbose linkStuff [ true, | |
| 82327 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 82327 verbose linkStuff false, | |
| 82327 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\react\\node_modules\\envify\\node_modules\\jstransform\\node_modules' ] | |
| 82328 info linkStuff source-map@0.1.31 | |
| 82329 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-loader\node_modules\babel-core\node_modules\regenerator\node_modules\recast | |
| 82330 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-loader\node_modules\babel-core\node_modules\regenerator\node_modules\recast | |
| 82331 verbose linkStuff [ true, | |
| 82331 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 82331 verbose linkStuff false, | |
| 82331 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel-loader\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules' ] | |
| 82332 info linkStuff recast@0.10.12 | |
| 82333 silly gunzTarPerm extractEntry package.json | |
| 82334 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 82335 verbose linkBins source-map@0.1.31 | |
| 82336 verbose linkMans source-map@0.1.31 | |
| 82337 verbose rebuildBundles source-map@0.1.31 | |
| 82338 verbose tar pack [ 'C:\\Users\\Vince\\AppData\\Roaming\\npm-cache\\ast-types\\0.6.16\\package.tgz', | |
| 82338 verbose tar pack 'C:\\Users\\Vince\\AppData\\Local\\Temp\\npm-11116\\1429557086909-0.8921095754485577\\package' ] | |
| 82339 verbose tarball C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.6.16\package.tgz | |
| 82340 verbose folder C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557086909-0.8921095754485577\package | |
| 82341 silly lockFile 1f5c676e-86909-0-8921095754485577-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557086909-0.8921095754485577\package | |
| 82342 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557086909-0.8921095754485577\package C:\Users\Vince\AppData\Roaming\npm-cache\1f5c676e-86909-0-8921095754485577-package.lock | |
| 82343 silly lockFile 09af4191-che-ast-types-0-6-16-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.6.16\package.tgz | |
| 82344 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.6.16\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\09af4191-che-ast-types-0-6-16-package-tgz.lock | |
| 82345 verbose linkBins recast@0.10.12 | |
| 82346 verbose linkMans recast@0.10.12 | |
| 82347 verbose rebuildBundles recast@0.10.12 | |
| 82348 verbose rebuildBundles [ 'amdefine' ] | |
| 82349 info install source-map@0.1.31 | |
| 82350 verbose rebuildBundles [ '.bin', 'esprima-fb' ] | |
| 82351 info install recast@0.10.12 | |
| 82352 info postinstall source-map@0.1.31 | |
| 82353 info postinstall recast@0.10.12 | |
| 82354 silly gunzTarPerm extractEntry README.md | |
| 82355 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 82356 silly gunzTarPerm extractEntry esprima.js | |
| 82357 silly gunzTarPerm modified mode [ 'esprima.js', 438, 420 ] | |
| 82358 silly gunzTarPerm extractEntry example/boolean_double.js | |
| 82359 silly gunzTarPerm modified mode [ 'example/boolean_double.js', 438, 420 ] | |
| 82360 silly gunzTarPerm extractEntry example/xup.js | |
| 82361 silly gunzTarPerm modified mode [ 'example/xup.js', 438, 420 ] | |
| 82362 silly gunzTarPerm extractEntry fn/set-timeout.js | |
| 82363 silly gunzTarPerm modified mode [ 'fn/set-timeout.js', 438, 420 ] | |
| 82364 silly gunzTarPerm extractEntry fn/set-interval.js | |
| 82365 silly gunzTarPerm modified mode [ 'fn/set-interval.js', 438, 420 ] | |
| 82366 silly lockFile fac7463f-odules-alter-node-modules-stable tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\alter\node_modules\stable | |
| 82367 silly lockFile fac7463f-odules-alter-node-modules-stable tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\alter\node_modules\stable | |
| 82368 silly lockFile 3b0bfbb7-m-cache-stable-0-1-5-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\stable\0.1.5\package.tgz | |
| 82369 silly lockFile 3b0bfbb7-m-cache-stable-0-1-5-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\stable\0.1.5\package.tgz | |
| 82370 silly gunzTarPerm extractEntry example/implies_hash.js | |
| 82371 silly gunzTarPerm modified mode [ 'example/implies_hash.js', 438, 420 ] | |
| 82372 silly gunzTarPerm extractEntry lib/minimist.js | |
| 82373 silly gunzTarPerm modified mode [ 'lib/minimist.js', 438, 420 ] | |
| 82374 silly gunzTarPerm extractEntry bin/esparse.js | |
| 82375 silly gunzTarPerm modified mode [ 'bin/esparse.js', 438, 420 ] | |
| 82376 info preinstall stable@0.1.5 | |
| 82377 silly gunzTarPerm extractEntry fn/weak-set.js | |
| 82378 silly gunzTarPerm modified mode [ 'fn/weak-set.js', 438, 420 ] | |
| 82379 silly gunzTarPerm extractEntry fn/promise.js | |
| 82380 silly gunzTarPerm modified mode [ 'fn/promise.js', 438, 420 ] | |
| 82381 verbose readDependencies using package.json deps | |
| 82382 verbose readDependencies using package.json deps | |
| 82383 silly resolved [] | |
| 82384 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\alter\node_modules\stable | |
| 82385 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\alter\node_modules\stable | |
| 82386 verbose linkStuff [ true, | |
| 82386 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 82386 verbose linkStuff false, | |
| 82386 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\defs\\node_modules\\alter\\node_modules' ] | |
| 82387 info linkStuff stable@0.1.5 | |
| 82388 silly gunzTarPerm extractEntry lib/wordwrap.js | |
| 82389 silly gunzTarPerm modified mode [ 'lib/wordwrap.js', 438, 420 ] | |
| 82390 silly gunzTarPerm extractEntry test/_.js | |
| 82391 silly gunzTarPerm modified mode [ 'test/_.js', 438, 420 ] | |
| 82392 verbose linkBins stable@0.1.5 | |
| 82393 verbose linkMans stable@0.1.5 | |
| 82394 verbose rebuildBundles stable@0.1.5 | |
| 82395 info install stable@0.1.5 | |
| 82396 info postinstall stable@0.1.5 | |
| 82397 silly gunzTarPerm extractEntry bin/esvalidate.js | |
| 82398 silly gunzTarPerm modified mode [ 'bin/esvalidate.js', 438, 420 ] | |
| 82399 silly gunzTarPerm extractEntry test/compat.js | |
| 82400 silly gunzTarPerm modified mode [ 'test/compat.js', 438, 420 ] | |
| 82401 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\alter | |
| 82402 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\alter | |
| 82403 verbose linkStuff [ true, | |
| 82403 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 82403 verbose linkStuff false, | |
| 82403 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\defs\\node_modules' ] | |
| 82404 info linkStuff alter@0.2.0 | |
| 82405 silly gunzTarPerm extractEntry fn/clear-immediate.js | |
| 82406 silly gunzTarPerm modified mode [ 'fn/clear-immediate.js', 438, 420 ] | |
| 82407 silly gunzTarPerm extractEntry fn/set-immediate.js | |
| 82408 silly gunzTarPerm modified mode [ 'fn/set-immediate.js', 438, 420 ] | |
| 82409 verbose linkBins alter@0.2.0 | |
| 82410 verbose linkMans alter@0.2.0 | |
| 82411 verbose rebuildBundles alter@0.2.0 | |
| 82412 verbose rebuildBundles [ 'stable' ] | |
| 82413 info install alter@0.2.0 | |
| 82414 silly gunzTarPerm extractEntry test/dash.js | |
| 82415 silly gunzTarPerm modified mode [ 'test/dash.js', 438, 420 ] | |
| 82416 silly gunzTarPerm extractEntry test/whitespace.js | |
| 82417 silly gunzTarPerm modified mode [ 'test/whitespace.js', 438, 420 ] | |
| 82418 info postinstall alter@0.2.0 | |
| 82419 silly gunzTarPerm extractEntry fn/is-iterable.js | |
| 82420 silly gunzTarPerm modified mode [ 'fn/is-iterable.js', 438, 420 ] | |
| 82421 silly gunzTarPerm extractEntry fn/_.js | |
| 82422 silly gunzTarPerm modified mode [ 'fn/_.js', 438, 420 ] | |
| 82423 silly gunzTarPerm extractEntry test/parse.js | |
| 82424 silly gunzTarPerm modified mode [ 'test/parse.js', 438, 420 ] | |
| 82425 silly gunzTarPerm extractEntry test/parse_camelCase.js | |
| 82426 silly gunzTarPerm modified mode [ 'test/parse_camelCase.js', 438, 420 ] | |
| 82427 silly gunzTarPerm extractEntry fn/regexp/escape.js | |
| 82428 silly gunzTarPerm modified mode [ 'fn/regexp/escape.js', 438, 420 ] | |
| 82429 silly gunzTarPerm extractEntry fn/regexp/index.js | |
| 82430 silly gunzTarPerm modified mode [ 'fn/regexp/index.js', 438, 420 ] | |
| 82431 silly gunzTarPerm extractEntry test/count.js | |
| 82432 silly gunzTarPerm modified mode [ 'test/count.js', 438, 420 ] | |
| 82433 silly gunzTarPerm extractEntry test/parse_modified.js | |
| 82434 silly gunzTarPerm modified mode [ 'test/parse_modified.js', 438, 420 ] | |
| 82435 silly gunzTarPerm extractEntry fn/reflect/apply.js | |
| 82436 silly gunzTarPerm modified mode [ 'fn/reflect/apply.js', 438, 420 ] | |
| 82437 silly gunzTarPerm extractEntry fn/reflect/enumerate.js | |
| 82438 silly gunzTarPerm modified mode [ 'fn/reflect/enumerate.js', 438, 420 ] | |
| 82439 silly gunzTarPerm extractEntry test/short.js | |
| 82440 silly gunzTarPerm modified mode [ 'test/short.js', 438, 420 ] | |
| 82441 silly gunzTarPerm extractEntry test/usage.js | |
| 82442 silly gunzTarPerm modified mode [ 'test/usage.js', 438, 420 ] | |
| 82443 silly gunzTarPerm extractEntry fn/reflect/get-own-property-descriptor.js | |
| 82444 silly gunzTarPerm modified mode [ 'fn/reflect/get-own-property-descriptor.js', 438, 420 ] | |
| 82445 silly gunzTarPerm extractEntry fn/reflect/get-prototype-of.js | |
| 82446 silly gunzTarPerm modified mode [ 'fn/reflect/get-prototype-of.js', 438, 420 ] | |
| 82447 silly gunzTarPerm extractEntry test/parse_defaults.js | |
| 82448 silly gunzTarPerm modified mode [ 'test/parse_defaults.js', 438, 420 ] | |
| 82449 silly gunzTarPerm extractEntry test/mocha.opts | |
| 82450 silly gunzTarPerm modified mode [ 'test/mocha.opts', 438, 420 ] | |
| 82451 silly gunzTarPerm extractEntry fn/reflect/delete-property.js | |
| 82452 silly gunzTarPerm modified mode [ 'fn/reflect/delete-property.js', 438, 420 ] | |
| 82453 silly gunzTarPerm extractEntry fn/reflect/has.js | |
| 82454 silly gunzTarPerm modified mode [ 'fn/reflect/has.js', 438, 420 ] | |
| 82455 silly gunzTarPerm extractEntry test/_/bin.js | |
| 82456 silly gunzTarPerm modified mode [ 'test/_/bin.js', 438, 420 ] | |
| 82457 silly gunzTarPerm extractEntry test/config.json | |
| 82458 silly gunzTarPerm modified mode [ 'test/config.json', 438, 420 ] | |
| 82459 silly gunzTarPerm extractEntry fn/reflect/index.js | |
| 82460 silly gunzTarPerm modified mode [ 'fn/reflect/index.js', 438, 420 ] | |
| 82461 silly gunzTarPerm extractEntry fn/reflect/is-extensible.js | |
| 82462 silly gunzTarPerm modified mode [ 'fn/reflect/is-extensible.js', 438, 420 ] | |
| 82463 silly gunzTarPerm extractEntry test/reflect.js | |
| 82464 silly gunzTarPerm extractEntry test/run.js | |
| 82465 silly gunzTarPerm extractEntry fn/reflect/own-keys.js | |
| 82466 silly gunzTarPerm modified mode [ 'fn/reflect/own-keys.js', 438, 420 ] | |
| 82467 silly gunzTarPerm extractEntry fn/reflect/prevent-extensions.js | |
| 82468 silly gunzTarPerm modified mode [ 'fn/reflect/prevent-extensions.js', 438, 420 ] | |
| 82469 silly lockFile 99fb6d6c-enerator-node-modules-esprima-fb tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\esprima-fb | |
| 82470 silly lockFile 99fb6d6c-enerator-node-modules-esprima-fb tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\esprima-fb | |
| 82471 silly lockFile 893c0675-1-1-0-dev-harmony-fb-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\13001.1.0-dev-harmony-fb\package.tgz | |
| 82472 silly lockFile 893c0675-1-1-0-dev-harmony-fb-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\13001.1.0-dev-harmony-fb\package.tgz | |
| 82473 info preinstall esprima-fb@13001.1.0-dev-harmony-fb | |
| 82474 silly gunzTarPerm extractEntry fn/reflect/define-property.js | |
| 82475 silly gunzTarPerm modified mode [ 'fn/reflect/define-property.js', 438, 420 ] | |
| 82476 silly gunzTarPerm extractEntry fn/reflect/set-prototype-of.js | |
| 82477 silly gunzTarPerm modified mode [ 'fn/reflect/set-prototype-of.js', 438, 420 ] | |
| 82478 verbose readDependencies using package.json deps | |
| 82479 verbose readDependencies using package.json deps | |
| 82480 silly resolved [] | |
| 82481 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\esprima-fb | |
| 82482 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\esprima-fb | |
| 82483 verbose linkStuff [ true, | |
| 82483 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 82483 verbose linkStuff false, | |
| 82483 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules' ] | |
| 82484 info linkStuff esprima-fb@13001.1.0-dev-harmony-fb | |
| 82485 silly gunzTarPerm extractEntry test/runner.js | |
| 82486 silly gunzTarPerm extractEntry test/test.js | |
| 82487 verbose linkBins esprima-fb@13001.1.0-dev-harmony-fb | |
| 82488 verbose link bins [ { esparse: './bin/esparse.js', | |
| 82488 verbose link bins esvalidate: './bin/esvalidate.js' }, | |
| 82488 verbose link bins 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\.bin', | |
| 82488 verbose link bins false ] | |
| 82489 verbose linkMans esprima-fb@13001.1.0-dev-harmony-fb | |
| 82490 verbose rebuildBundles esprima-fb@13001.1.0-dev-harmony-fb | |
| 82491 silly gunzTarPerm extractEntry fn/reflect/construct.js | |
| 82492 silly gunzTarPerm modified mode [ 'fn/reflect/construct.js', 438, 420 ] | |
| 82493 silly gunzTarPerm extractEntry fn/reflect/set.js | |
| 82494 silly gunzTarPerm modified mode [ 'fn/reflect/set.js', 438, 420 ] | |
| 82495 silly gunzTarPerm extractEntry fn/reflect/get.js | |
| 82496 silly gunzTarPerm modified mode [ 'fn/reflect/get.js', 438, 420 ] | |
| 82497 silly gunzTarPerm extractEntry fn/object/assign.js | |
| 82498 silly gunzTarPerm modified mode [ 'fn/object/assign.js', 438, 420 ] | |
| 82499 info install esprima-fb@13001.1.0-dev-harmony-fb | |
| 82500 info postinstall esprima-fb@13001.1.0-dev-harmony-fb | |
| 82501 silly gunzTarPerm extractEntry fn/object/get-own-property-names.js | |
| 82502 silly gunzTarPerm modified mode [ 'fn/object/get-own-property-names.js', 438, 420 ] | |
| 82503 silly gunzTarPerm extractEntry fn/object/get-own-property-symbols.js | |
| 82504 silly gunzTarPerm modified mode [ 'fn/object/get-own-property-symbols.js', 438, 420 ] | |
| 82505 silly gunzTarPerm extractEntry fn/object/get-prototype-of.js | |
| 82506 silly gunzTarPerm modified mode [ 'fn/object/get-prototype-of.js', 438, 420 ] | |
| 82507 silly gunzTarPerm extractEntry fn/object/index.js | |
| 82508 silly gunzTarPerm modified mode [ 'fn/object/index.js', 438, 420 ] | |
| 82509 silly gunzTarPerm extractEntry fn/object/get-own-property-descriptors.js | |
| 82510 silly gunzTarPerm modified mode [ 'fn/object/get-own-property-descriptors.js', 438, 420 ] | |
| 82511 silly gunzTarPerm extractEntry fn/object/is-frozen.js | |
| 82512 silly gunzTarPerm modified mode [ 'fn/object/is-frozen.js', 438, 420 ] | |
| 82513 silly gunzTarPerm extractEntry fn/object/is-object.js | |
| 82514 silly gunzTarPerm modified mode [ 'fn/object/is-object.js', 438, 420 ] | |
| 82515 silly gunzTarPerm extractEntry fn/object/is-sealed.js | |
| 82516 silly gunzTarPerm modified mode [ 'fn/object/is-sealed.js', 438, 420 ] | |
| 82517 silly lockFile 5be0246a-s-recast-node-modules-esprima-fb tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-loader\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\esprima-fb | |
| 82518 silly lockFile 5be0246a-s-recast-node-modules-esprima-fb tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-loader\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\esprima-fb | |
| 82519 silly lockFile e5ab5e09-1-1-0-dev-harmony-fb-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package.tgz | |
| 82520 silly lockFile e5ab5e09-1-1-0-dev-harmony-fb-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package.tgz | |
| 82521 silly gunzTarPerm extractEntry fn/object/is.js | |
| 82522 silly gunzTarPerm modified mode [ 'fn/object/is.js', 438, 420 ] | |
| 82523 silly gunzTarPerm extractEntry fn/object/keys.js | |
| 82524 silly gunzTarPerm modified mode [ 'fn/object/keys.js', 438, 420 ] | |
| 82525 info preinstall esprima-fb@10001.1.0-dev-harmony-fb | |
| 82526 silly gunzTarPerm extractEntry fn/object/get-own-property-descriptor.js | |
| 82527 silly gunzTarPerm modified mode [ 'fn/object/get-own-property-descriptor.js', 438, 420 ] | |
| 82528 silly gunzTarPerm extractEntry fn/object/make.js | |
| 82529 silly gunzTarPerm modified mode [ 'fn/object/make.js', 438, 420 ] | |
| 82530 verbose readDependencies using package.json deps | |
| 82531 verbose readDependencies using package.json deps | |
| 82532 silly resolved [] | |
| 82533 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-loader\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\esprima-fb | |
| 82534 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-loader\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\esprima-fb | |
| 82535 verbose linkStuff [ true, | |
| 82535 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 82535 verbose linkStuff false, | |
| 82535 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel-loader\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\commoner\\node_modules\\recast\\node_modules' ] | |
| 82536 info linkStuff esprima-fb@10001.1.0-dev-harmony-fb | |
| 82537 verbose linkBins esprima-fb@10001.1.0-dev-harmony-fb | |
| 82538 verbose link bins [ { esparse: './bin/esparse.js', | |
| 82538 verbose link bins esvalidate: './bin/esvalidate.js' }, | |
| 82538 verbose link bins 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel-loader\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\commoner\\node_modules\\recast\\node_modules\\.bin', | |
| 82538 verbose link bins false ] | |
| 82539 verbose linkMans esprima-fb@10001.1.0-dev-harmony-fb | |
| 82540 verbose rebuildBundles esprima-fb@10001.1.0-dev-harmony-fb | |
| 82541 silly gunzTarPerm extractEntry fn/object/freeze.js | |
| 82542 silly gunzTarPerm modified mode [ 'fn/object/freeze.js', 438, 420 ] | |
| 82543 silly gunzTarPerm extractEntry fn/object/prevent-extensions.js | |
| 82544 silly gunzTarPerm modified mode [ 'fn/object/prevent-extensions.js', 438, 420 ] | |
| 82545 info install esprima-fb@10001.1.0-dev-harmony-fb | |
| 82546 info postinstall esprima-fb@10001.1.0-dev-harmony-fb | |
| 82547 silly gunzTarPerm extractEntry fn/object/entries.js | |
| 82548 silly gunzTarPerm modified mode [ 'fn/object/entries.js', 438, 420 ] | |
| 82549 silly gunzTarPerm extractEntry fn/object/seal.js | |
| 82550 silly gunzTarPerm modified mode [ 'fn/object/seal.js', 438, 420 ] | |
| 82551 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-loader\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast | |
| 82552 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-loader\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast | |
| 82553 verbose linkStuff [ true, | |
| 82553 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 82553 verbose linkStuff false, | |
| 82553 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel-loader\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\commoner\\node_modules' ] | |
| 82554 info linkStuff recast@0.9.18 | |
| 82555 verbose linkBins recast@0.9.18 | |
| 82556 verbose linkMans recast@0.9.18 | |
| 82557 verbose rebuildBundles recast@0.9.18 | |
| 82558 verbose rebuildBundles [ '.bin', 'ast-types', 'esprima-fb', 'source-map' ] | |
| 82559 info install recast@0.9.18 | |
| 82560 info postinstall recast@0.9.18 | |
| 82561 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-loader\node_modules\babel-core\node_modules\regenerator\node_modules\commoner | |
| 82562 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-loader\node_modules\babel-core\node_modules\regenerator\node_modules\commoner | |
| 82563 verbose linkStuff [ true, | |
| 82563 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 82563 verbose linkStuff false, | |
| 82563 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel-loader\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules' ] | |
| 82564 info linkStuff commoner@0.10.1 | |
| 82565 verbose linkBins commoner@0.10.1 | |
| 82566 verbose link bins [ { commonize: './bin/commonize' }, | |
| 82566 verbose link bins 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel-loader\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\.bin', | |
| 82566 verbose link bins false ] | |
| 82567 verbose linkMans commoner@0.10.1 | |
| 82568 verbose rebuildBundles commoner@0.10.1 | |
| 82569 verbose rebuildBundles [ 'commander', | |
| 82569 verbose rebuildBundles 'glob', | |
| 82569 verbose rebuildBundles 'graceful-fs', | |
| 82569 verbose rebuildBundles 'iconv-lite', | |
| 82569 verbose rebuildBundles 'install', | |
| 82569 verbose rebuildBundles 'q', | |
| 82569 verbose rebuildBundles 'recast' ] | |
| 82570 silly gunzTarPerm extractEntry fn/object/define.js | |
| 82571 silly gunzTarPerm modified mode [ 'fn/object/define.js', 438, 420 ] | |
| 82572 silly gunzTarPerm extractEntry fn/object/set-prototype-of.js | |
| 82573 silly gunzTarPerm modified mode [ 'fn/object/set-prototype-of.js', 438, 420 ] | |
| 82574 silly gunzTarPerm extractEntry fn/object/classof.js | |
| 82575 silly gunzTarPerm modified mode [ 'fn/object/classof.js', 438, 420 ] | |
| 82576 silly gunzTarPerm extractEntry fn/object/values.js | |
| 82577 silly gunzTarPerm modified mode [ 'fn/object/values.js', 438, 420 ] | |
| 82578 info install commoner@0.10.1 | |
| 82579 info postinstall commoner@0.10.1 | |
| 82580 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-loader\node_modules\babel-core\node_modules\regenerator | |
| 82581 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-loader\node_modules\babel-core\node_modules\regenerator | |
| 82582 verbose linkStuff [ true, | |
| 82582 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 82582 verbose linkStuff false, | |
| 82582 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel-loader\\node_modules\\babel-core\\node_modules' ] | |
| 82583 info linkStuff regenerator@0.8.22 | |
| 82584 verbose linkBins regenerator@0.8.22 | |
| 82585 verbose link bins [ { regenerator: 'bin/regenerator' }, | |
| 82585 verbose link bins 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel-loader\\node_modules\\babel-core\\node_modules\\.bin', | |
| 82585 verbose link bins false ] | |
| 82586 verbose linkMans regenerator@0.8.22 | |
| 82587 verbose rebuildBundles regenerator@0.8.22 | |
| 82588 verbose rebuildBundles [ '.bin', 'commoner', 'defs', 'esprima-fb', 'recast', 'through' ] | |
| 82589 silly gunzTarPerm extractEntry fn/object/is-extensible.js | |
| 82590 silly gunzTarPerm modified mode [ 'fn/object/is-extensible.js', 438, 420 ] | |
| 82591 silly gunzTarPerm extractEntry fn/array/concat.js | |
| 82592 silly gunzTarPerm modified mode [ 'fn/array/concat.js', 438, 420 ] | |
| 82593 silly gunzTarPerm extractEntry fn/array/index.js | |
| 82594 silly gunzTarPerm modified mode [ 'fn/array/index.js', 438, 420 ] | |
| 82595 silly gunzTarPerm extractEntry fn/array/join.js | |
| 82596 silly gunzTarPerm modified mode [ 'fn/array/join.js', 438, 420 ] | |
| 82597 info install regenerator@0.8.22 | |
| 82598 info postinstall regenerator@0.8.22 | |
| 82599 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-loader\node_modules\babel-core | |
| 82600 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-loader\node_modules\babel-core | |
| 82601 verbose linkStuff [ true, | |
| 82601 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 82601 verbose linkStuff false, | |
| 82601 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel-loader\\node_modules' ] | |
| 82602 info linkStuff babel-core@5.1.11 | |
| 82603 verbose linkBins babel-core@5.1.11 | |
| 82604 verbose linkMans babel-core@5.1.11 | |
| 82605 verbose rebuildBundles babel-core@5.1.11 | |
| 82606 verbose rebuildBundles [ '.bin', | |
| 82606 verbose rebuildBundles 'ast-types', | |
| 82606 verbose rebuildBundles 'chalk', | |
| 82606 verbose rebuildBundles 'convert-source-map', | |
| 82606 verbose rebuildBundles 'core-js', | |
| 82606 verbose rebuildBundles 'debug', | |
| 82606 verbose rebuildBundles 'detect-indent', | |
| 82606 verbose rebuildBundles 'estraverse', | |
| 82606 verbose rebuildBundles 'esutils', | |
| 82606 verbose rebuildBundles 'fs-readdir-recursive', | |
| 82606 verbose rebuildBundles 'globals', | |
| 82606 verbose rebuildBundles 'is-integer', | |
| 82606 verbose rebuildBundles 'js-tokens', | |
| 82606 verbose rebuildBundles 'leven', | |
| 82606 verbose rebuildBundles 'line-numbers', | |
| 82606 verbose rebuildBundles 'lodash', | |
| 82606 verbose rebuildBundles 'minimatch', | |
| 82606 verbose rebuildBundles 'output-file-sync', | |
| 82606 verbose rebuildBundles 'path-is-absolute', | |
| 82606 verbose rebuildBundles 'private', | |
| 82606 verbose rebuildBundles 'regenerator', | |
| 82606 verbose rebuildBundles 'regexpu', | |
| 82606 verbose rebuildBundles 'repeating', | |
| 82606 verbose rebuildBundles 'shebang-regex', | |
| 82606 verbose rebuildBundles 'slash', | |
| 82606 verbose rebuildBundles 'source-map', | |
| 82606 verbose rebuildBundles 'source-map-support', | |
| 82606 verbose rebuildBundles 'strip-json-comments', | |
| 82606 verbose rebuildBundles 'to-fast-properties', | |
| 82606 verbose rebuildBundles 'trim-right', | |
| 82606 verbose rebuildBundles 'user-home' ] | |
| 82607 info install babel-core@5.1.11 | |
| 82608 silly gunzTarPerm extractEntry fn/array/keys.js | |
| 82609 silly gunzTarPerm modified mode [ 'fn/array/keys.js', 438, 420 ] | |
| 82610 silly gunzTarPerm extractEntry fn/array/index-of.js | |
| 82611 silly gunzTarPerm modified mode [ 'fn/array/index-of.js', 438, 420 ] | |
| 82612 info postinstall babel-core@5.1.11 | |
| 82613 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-loader | |
| 82614 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-loader | |
| 82615 verbose linkStuff [ true, | |
| 82615 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 82615 verbose linkStuff false, | |
| 82615 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules' ] | |
| 82616 info linkStuff babel-loader@5.0.0 | |
| 82617 verbose linkBins babel-loader@5.0.0 | |
| 82618 verbose linkMans babel-loader@5.0.0 | |
| 82619 verbose rebuildBundles babel-loader@5.0.0 | |
| 82620 verbose rebuildBundles [ 'babel-core', 'loader-utils' ] | |
| 82621 info install babel-loader@5.0.0 | |
| 82622 silly lockFile 1f5c676e-86909-0-8921095754485577-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557086909-0.8921095754485577\package | |
| 82623 silly lockFile 1f5c676e-86909-0-8921095754485577-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557086909-0.8921095754485577\package | |
| 82624 silly gunzTarPerm extractEntry test/reflect.js | |
| 82625 silly gunzTarPerm modified mode [ 'test/reflect.js', 438, 420 ] | |
| 82626 silly gunzTarPerm extractEntry test/run.js | |
| 82627 silly gunzTarPerm modified mode [ 'test/run.js', 438, 420 ] | |
| 82628 info postinstall babel-loader@5.0.0 | |
| 82629 silly lockFile 09af4191-che-ast-types-0-6-16-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.6.16\package.tgz | |
| 82630 silly lockFile 09af4191-che-ast-types-0-6-16-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.6.16\package.tgz | |
| 82631 silly gunzTarPerm extractEntry fn/array/map.js | |
| 82632 silly gunzTarPerm modified mode [ 'fn/array/map.js', 438, 420 ] | |
| 82633 silly gunzTarPerm extractEntry fn/array/of.js | |
| 82634 silly gunzTarPerm modified mode [ 'fn/array/of.js', 438, 420 ] | |
| 82635 verbose readDependencies using package.json deps | |
| 82636 silly lockFile d132ad89-m-cache-ast-types-0-6-16-package C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.6.16\package | |
| 82637 verbose lock C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.6.16\package C:\Users\Vince\AppData\Roaming\npm-cache\d132ad89-m-cache-ast-types-0-6-16-package.lock | |
| 82638 verbose cache add [ 'babel-core@*', null ] | |
| 82639 verbose cache add name=undefined spec="babel-core@*" args=["babel-core@*",null] | |
| 82640 verbose parsed url { protocol: null, | |
| 82640 verbose parsed url slashes: null, | |
| 82640 verbose parsed url auth: null, | |
| 82640 verbose parsed url host: null, | |
| 82640 verbose parsed url port: null, | |
| 82640 verbose parsed url hostname: null, | |
| 82640 verbose parsed url hash: null, | |
| 82640 verbose parsed url search: null, | |
| 82640 verbose parsed url query: null, | |
| 82640 verbose parsed url pathname: 'babel-core@*', | |
| 82640 verbose parsed url path: 'babel-core@*', | |
| 82640 verbose parsed url href: 'babel-core@*' } | |
| 82641 verbose cache add name="babel-core" spec="*" args=["babel-core","*"] | |
| 82642 verbose parsed url { protocol: null, | |
| 82642 verbose parsed url slashes: null, | |
| 82642 verbose parsed url auth: null, | |
| 82642 verbose parsed url host: null, | |
| 82642 verbose parsed url port: null, | |
| 82642 verbose parsed url hostname: null, | |
| 82642 verbose parsed url hash: null, | |
| 82642 verbose parsed url search: null, | |
| 82642 verbose parsed url query: null, | |
| 82642 verbose parsed url pathname: '*', | |
| 82642 verbose parsed url path: '*', | |
| 82642 verbose parsed url href: '*' } | |
| 82643 verbose addNamed [ 'babel-core', '*' ] | |
| 82644 verbose addNamed [ null, '*' ] | |
| 82645 silly lockFile 30f85588-babel-core babel-core@* | |
| 82646 verbose lock babel-core@* C:\Users\Vince\AppData\Roaming\npm-cache\30f85588-babel-core.lock | |
| 82647 silly addNameRange { name: 'babel-core', range: '*', hasData: false } | |
| 82648 silly gunzTarPerm extractEntry fn/array/pop.js | |
| 82649 silly gunzTarPerm modified mode [ 'fn/array/pop.js', 438, 420 ] | |
| 82650 silly gunzTarPerm extractEntry fn/array/push.js | |
| 82651 silly gunzTarPerm modified mode [ 'fn/array/push.js', 438, 420 ] | |
| 82652 verbose url raw babel-core | |
| 82653 verbose url resolving [ 'https://registry.npmjs.org/', './babel-core' ] | |
| 82654 verbose url resolved https://registry.npmjs.org/babel-core | |
| 82655 info trying registry request attempt 1 at 14:11:29 | |
| 82656 verbose etag "20H6JY8IC4E6TY9LMHTNKDELR" | |
| 82657 http GET https://registry.npmjs.org/babel-core | |
| 82658 silly lockFile d132ad89-m-cache-ast-types-0-6-16-package C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.6.16\package | |
| 82659 silly lockFile d132ad89-m-cache-ast-types-0-6-16-package C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.6.16\package | |
| 82660 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.6.16\package.tgz | |
| 82661 silly lockFile cfb64d3e-m-cache-ast-types-0-6-16-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.6.16\package | |
| 82662 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.6.16\package C:\Users\Vince\AppData\Roaming\npm-cache\cfb64d3e-m-cache-ast-types-0-6-16-package.lock | |
| 82663 silly lockFile 09af4191-che-ast-types-0-6-16-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.6.16\package.tgz | |
| 82664 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.6.16\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\09af4191-che-ast-types-0-6-16-package-tgz.lock | |
| 82665 silly gunzTarPerm extractEntry test/runner.js | |
| 82666 silly gunzTarPerm modified mode [ 'test/runner.js', 438, 420 ] | |
| 82667 silly gunzTarPerm extractEntry test/test.js | |
| 82668 silly gunzTarPerm modified mode [ 'test/test.js', 438, 420 ] | |
| 82669 silly gunzTarPerm modes [ '755', '644' ] | |
| 82670 silly gunzTarPerm extractEntry fn/array/reduce-right.js | |
| 82671 silly gunzTarPerm modified mode [ 'fn/array/reduce-right.js', 438, 420 ] | |
| 82672 silly gunzTarPerm extractEntry fn/array/includes.js | |
| 82673 silly gunzTarPerm modified mode [ 'fn/array/includes.js', 438, 420 ] | |
| 82674 silly gunzTarPerm extractEntry package.json | |
| 82675 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 82676 silly gunzTarPerm extractEntry fn/array/reduce.js | |
| 82677 silly gunzTarPerm modified mode [ 'fn/array/reduce.js', 438, 420 ] | |
| 82678 silly gunzTarPerm extractEntry fn/array/from.js | |
| 82679 silly gunzTarPerm modified mode [ 'fn/array/from.js', 438, 420 ] | |
| 82680 silly gunzTarPerm extractEntry .npmignore | |
| 82681 silly gunzTarPerm modified mode [ '.npmignore', 438, 420 ] | |
| 82682 silly gunzTarPerm extractEntry README.md | |
| 82683 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 82684 silly gunzTarPerm extractEntry fn/array/reverse.js | |
| 82685 silly gunzTarPerm modified mode [ 'fn/array/reverse.js', 438, 420 ] | |
| 82686 silly gunzTarPerm extractEntry fn/array/for-each.js | |
| 82687 silly gunzTarPerm modified mode [ 'fn/array/for-each.js', 438, 420 ] | |
| 82688 silly gunzTarPerm extractEntry LICENSE | |
| 82689 silly gunzTarPerm modified mode [ 'LICENSE', 438, 420 ] | |
| 82690 silly gunzTarPerm extractEntry fn/array/shift.js | |
| 82691 silly gunzTarPerm modified mode [ 'fn/array/shift.js', 438, 420 ] | |
| 82692 silly gunzTarPerm extractEntry fn/array/find.js | |
| 82693 silly gunzTarPerm modified mode [ 'fn/array/find.js', 438, 420 ] | |
| 82694 silly gunzTarPerm extractEntry main.js | |
| 82695 silly gunzTarPerm modified mode [ 'main.js', 438, 420 ] | |
| 82696 silly gunzTarPerm extractEntry .travis.yml | |
| 82697 silly gunzTarPerm modified mode [ '.travis.yml', 438, 420 ] | |
| 82698 silly gunzTarPerm extractEntry fn/array/slice.js | |
| 82699 silly gunzTarPerm modified mode [ 'fn/array/slice.js', 438, 420 ] | |
| 82700 silly gunzTarPerm extractEntry fn/array/find-index.js | |
| 82701 silly gunzTarPerm modified mode [ 'fn/array/find-index.js', 438, 420 ] | |
| 82702 silly gunzTarPerm extractEntry fn/array/some.js | |
| 82703 silly gunzTarPerm modified mode [ 'fn/array/some.js', 438, 420 ] | |
| 82704 silly gunzTarPerm extractEntry fn/array/filter.js | |
| 82705 silly gunzTarPerm modified mode [ 'fn/array/filter.js', 438, 420 ] | |
| 82706 silly gunzTarPerm extractEntry fn/array/sort.js | |
| 82707 silly gunzTarPerm modified mode [ 'fn/array/sort.js', 438, 420 ] | |
| 82708 silly gunzTarPerm extractEntry fn/array/fill.js | |
| 82709 silly gunzTarPerm modified mode [ 'fn/array/fill.js', 438, 420 ] | |
| 82710 silly gunzTarPerm extractEntry def/core.js | |
| 82711 silly gunzTarPerm modified mode [ 'def/core.js', 438, 420 ] | |
| 82712 silly gunzTarPerm extractEntry def/e4x.js | |
| 82713 silly gunzTarPerm modified mode [ 'def/e4x.js', 438, 420 ] | |
| 82714 silly gunzTarPerm extractEntry fn/array/splice.js | |
| 82715 silly gunzTarPerm modified mode [ 'fn/array/splice.js', 438, 420 ] | |
| 82716 silly gunzTarPerm extractEntry fn/array/every.js | |
| 82717 silly gunzTarPerm modified mode [ 'fn/array/every.js', 438, 420 ] | |
| 82718 silly gunzTarPerm extractEntry def/es6.js | |
| 82719 silly gunzTarPerm modified mode [ 'def/es6.js', 438, 420 ] | |
| 82720 silly gunzTarPerm extractEntry def/es7.js | |
| 82721 silly gunzTarPerm modified mode [ 'def/es7.js', 438, 420 ] | |
| 82722 silly gunzTarPerm extractEntry fn/array/turn.js | |
| 82723 silly gunzTarPerm modified mode [ 'fn/array/turn.js', 438, 420 ] | |
| 82724 silly gunzTarPerm extractEntry fn/array/entries.js | |
| 82725 silly gunzTarPerm modified mode [ 'fn/array/entries.js', 438, 420 ] | |
| 82726 silly gunzTarPerm extractEntry def/fb-harmony.js | |
| 82727 silly gunzTarPerm modified mode [ 'def/fb-harmony.js', 438, 420 ] | |
| 82728 silly gunzTarPerm extractEntry def/mozilla.js | |
| 82729 silly gunzTarPerm modified mode [ 'def/mozilla.js', 438, 420 ] | |
| 82730 silly gunzTarPerm extractEntry fn/array/unshift.js | |
| 82731 silly gunzTarPerm modified mode [ 'fn/array/unshift.js', 438, 420 ] | |
| 82732 silly gunzTarPerm extractEntry fn/array/copy-within.js | |
| 82733 silly gunzTarPerm modified mode [ 'fn/array/copy-within.js', 438, 420 ] | |
| 82734 silly lockFile 1a45b764--modules-defs-node-modules-yargs tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\yargs | |
| 82735 silly lockFile 1a45b764--modules-defs-node-modules-yargs tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\yargs | |
| 82736 silly lockFile f2caf1ff-pm-cache-yargs-1-3-3-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\yargs\1.3.3\package.tgz | |
| 82737 silly lockFile f2caf1ff-pm-cache-yargs-1-3-3-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\yargs\1.3.3\package.tgz | |
| 82738 silly gunzTarPerm extractEntry lib/equiv.js | |
| 82739 silly gunzTarPerm modified mode [ 'lib/equiv.js', 438, 420 ] | |
| 82740 silly gunzTarPerm extractEntry lib/node-path.js | |
| 82741 silly gunzTarPerm modified mode [ 'lib/node-path.js', 438, 420 ] | |
| 82742 silly gunzTarPerm extractEntry fn/array/values.js | |
| 82743 silly gunzTarPerm modified mode [ 'fn/array/values.js', 438, 420 ] | |
| 82744 silly gunzTarPerm extractEntry fn/array/last-index-of.js | |
| 82745 silly gunzTarPerm modified mode [ 'fn/array/last-index-of.js', 438, 420 ] | |
| 82746 info preinstall yargs@1.3.3 | |
| 82747 verbose readDependencies using package.json deps | |
| 82748 verbose readDependencies using package.json deps | |
| 82749 silly resolved [] | |
| 82750 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\yargs | |
| 82751 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\yargs | |
| 82752 verbose linkStuff [ true, | |
| 82752 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 82752 verbose linkStuff false, | |
| 82752 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\defs\\node_modules' ] | |
| 82753 info linkStuff yargs@1.3.3 | |
| 82754 verbose linkBins yargs@1.3.3 | |
| 82755 verbose linkMans yargs@1.3.3 | |
| 82756 verbose rebuildBundles yargs@1.3.3 | |
| 82757 info install yargs@1.3.3 | |
| 82758 info postinstall yargs@1.3.3 | |
| 82759 silly gunzTarPerm extractEntry fn/math/acosh.js | |
| 82760 silly gunzTarPerm modified mode [ 'fn/math/acosh.js', 438, 420 ] | |
| 82761 silly gunzTarPerm extractEntry fn/math/cosh.js | |
| 82762 silly gunzTarPerm modified mode [ 'fn/math/cosh.js', 438, 420 ] | |
| 82763 silly lockFile aace8a5f-loader-utils-node-modules-big-js tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\stylus-loader\node_modules\loader-utils\node_modules\big.js | |
| 82764 silly lockFile aace8a5f-loader-utils-node-modules-big-js tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\stylus-loader\node_modules\loader-utils\node_modules\big.js | |
| 82765 silly lockFile ad13883b-m-cache-big-js-2-5-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\big.js\2.5.1\package.tgz | |
| 82766 silly lockFile ad13883b-m-cache-big-js-2-5-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\big.js\2.5.1\package.tgz | |
| 82767 silly gunzTarPerm extractEntry fn/math/expm1.js | |
| 82768 silly gunzTarPerm modified mode [ 'fn/math/expm1.js', 438, 420 ] | |
| 82769 silly gunzTarPerm extractEntry fn/math/fround.js | |
| 82770 silly gunzTarPerm modified mode [ 'fn/math/fround.js', 438, 420 ] | |
| 82771 info preinstall big.js@2.5.1 | |
| 82772 silly gunzTarPerm modes [ '755', '644' ] | |
| 82773 verbose readDependencies using package.json deps | |
| 82774 silly gunzTarPerm extractEntry fn/math/hypot.js | |
| 82775 silly gunzTarPerm modified mode [ 'fn/math/hypot.js', 438, 420 ] | |
| 82776 silly gunzTarPerm extractEntry fn/math/clz32.js | |
| 82777 silly gunzTarPerm modified mode [ 'fn/math/clz32.js', 438, 420 ] | |
| 82778 verbose readDependencies using package.json deps | |
| 82779 silly resolved [] | |
| 82780 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\stylus-loader\node_modules\loader-utils\node_modules\big.js | |
| 82781 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\stylus-loader\node_modules\loader-utils\node_modules\big.js | |
| 82782 verbose linkStuff [ true, | |
| 82782 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 82782 verbose linkStuff false, | |
| 82782 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\stylus-loader\\node_modules\\loader-utils\\node_modules' ] | |
| 82783 info linkStuff big.js@2.5.1 | |
| 82784 verbose linkBins big.js@2.5.1 | |
| 82785 verbose linkMans big.js@2.5.1 | |
| 82786 verbose rebuildBundles big.js@2.5.1 | |
| 82787 info install big.js@2.5.1 | |
| 82788 silly gunzTarPerm extractEntry package.json | |
| 82789 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 82790 silly gunzTarPerm extractEntry lib/path-visitor.js | |
| 82791 silly gunzTarPerm modified mode [ 'lib/path-visitor.js', 438, 420 ] | |
| 82792 silly gunzTarPerm extractEntry lib/path.js | |
| 82793 silly gunzTarPerm modified mode [ 'lib/path.js', 438, 420 ] | |
| 82794 info postinstall big.js@2.5.1 | |
| 82795 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\stylus-loader\node_modules\loader-utils | |
| 82796 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\stylus-loader\node_modules\loader-utils | |
| 82797 silly gunzTarPerm extractEntry .npmignore | |
| 82798 silly gunzTarPerm modified mode [ '.npmignore', 438, 420 ] | |
| 82799 silly gunzTarPerm extractEntry README.md | |
| 82800 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 82801 silly gunzTarPerm extractEntry fn/math/index.js | |
| 82802 silly gunzTarPerm modified mode [ 'fn/math/index.js', 438, 420 ] | |
| 82803 silly gunzTarPerm extractEntry fn/math/log10.js | |
| 82804 silly gunzTarPerm modified mode [ 'fn/math/log10.js', 438, 420 ] | |
| 82805 verbose linkStuff [ true, | |
| 82805 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 82805 verbose linkStuff false, | |
| 82805 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\stylus-loader\\node_modules' ] | |
| 82806 info linkStuff loader-utils@0.2.7 | |
| 82807 silly gunzTarPerm extractEntry test/reflect.js | |
| 82808 silly gunzTarPerm modified mode [ 'test/reflect.js', 438, 420 ] | |
| 82809 silly gunzTarPerm extractEntry test/run.js | |
| 82810 silly gunzTarPerm modified mode [ 'test/run.js', 438, 420 ] | |
| 82811 verbose linkBins loader-utils@0.2.7 | |
| 82812 verbose linkMans loader-utils@0.2.7 | |
| 82813 verbose rebuildBundles loader-utils@0.2.7 | |
| 82814 verbose rebuildBundles [ '.bin', 'big.js', 'json5' ] | |
| 82815 info install loader-utils@0.2.7 | |
| 82816 silly gunzTarPerm extractEntry lib/scope.js | |
| 82817 silly gunzTarPerm modified mode [ 'lib/scope.js', 438, 420 ] | |
| 82818 silly gunzTarPerm extractEntry lib/shared.js | |
| 82819 silly gunzTarPerm modified mode [ 'lib/shared.js', 438, 420 ] | |
| 82820 info postinstall loader-utils@0.2.7 | |
| 82821 silly gunzTarPerm extractEntry LICENCE | |
| 82822 silly gunzTarPerm modified mode [ 'LICENCE', 438, 420 ] | |
| 82823 silly gunzTarPerm extractEntry big.js | |
| 82824 silly gunzTarPerm modified mode [ 'big.js', 438, 420 ] | |
| 82825 silly gunzTarPerm extractEntry fn/math/log1p.js | |
| 82826 silly gunzTarPerm modified mode [ 'fn/math/log1p.js', 438, 420 ] | |
| 82827 silly gunzTarPerm extractEntry fn/math/log2.js | |
| 82828 silly gunzTarPerm modified mode [ 'fn/math/log2.js', 438, 420 ] | |
| 82829 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\stylus-loader | |
| 82830 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\stylus-loader | |
| 82831 verbose linkStuff [ true, | |
| 82831 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 82831 verbose linkStuff false, | |
| 82831 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules' ] | |
| 82832 info linkStuff stylus-loader@1.1.0 | |
| 82833 verbose linkBins stylus-loader@1.1.0 | |
| 82834 verbose linkMans stylus-loader@1.1.0 | |
| 82835 verbose rebuildBundles stylus-loader@1.1.0 | |
| 82836 verbose rebuildBundles [ 'loader-utils', 'when' ] | |
| 82837 info install stylus-loader@1.1.0 | |
| 82838 info postinstall stylus-loader@1.1.0 | |
| 82839 silly gunzTarPerm extractEntry big.min.js | |
| 82840 silly gunzTarPerm modified mode [ 'big.min.js', 438, 420 ] | |
| 82841 silly gunzTarPerm extractEntry fn/math/sign.js | |
| 82842 silly gunzTarPerm modified mode [ 'fn/math/sign.js', 438, 420 ] | |
| 82843 silly gunzTarPerm extractEntry fn/math/cbrt.js | |
| 82844 silly gunzTarPerm modified mode [ 'fn/math/cbrt.js', 438, 420 ] | |
| 82845 silly gunzTarPerm extractEntry test/runner.js | |
| 82846 silly gunzTarPerm modified mode [ 'test/runner.js', 438, 420 ] | |
| 82847 silly gunzTarPerm extractEntry test/test.js | |
| 82848 silly gunzTarPerm modified mode [ 'test/test.js', 438, 420 ] | |
| 82849 silly gunzTarPerm extractEntry lib/types.js | |
| 82850 silly gunzTarPerm modified mode [ 'lib/types.js', 438, 420 ] | |
| 82851 silly gunzTarPerm extractEntry fn/math/sinh.js | |
| 82852 silly gunzTarPerm modified mode [ 'fn/math/sinh.js', 438, 420 ] | |
| 82853 silly gunzTarPerm extractEntry fn/math/atanh.js | |
| 82854 silly gunzTarPerm modified mode [ 'fn/math/atanh.js', 438, 420 ] | |
| 82855 silly gunzTarPerm extractEntry doc/bigAPI.html | |
| 82856 silly gunzTarPerm modified mode [ 'doc/bigAPI.html', 438, 420 ] | |
| 82857 silly gunzTarPerm extractEntry perf/bigtime.js | |
| 82858 silly gunzTarPerm modified mode [ 'perf/bigtime.js', 438, 420 ] | |
| 82859 silly gunzTarPerm extractEntry fn/math/tanh.js | |
| 82860 silly gunzTarPerm modified mode [ 'fn/math/tanh.js', 438, 420 ] | |
| 82861 silly gunzTarPerm extractEntry fn/math/asinh.js | |
| 82862 silly gunzTarPerm modified mode [ 'fn/math/asinh.js', 438, 420 ] | |
| 82863 silly gunzTarPerm extractEntry fn/math/trunc.js | |
| 82864 silly gunzTarPerm modified mode [ 'fn/math/trunc.js', 438, 420 ] | |
| 82865 silly gunzTarPerm extractEntry fn/math/imul.js | |
| 82866 silly gunzTarPerm modified mode [ 'fn/math/imul.js', 438, 420 ] | |
| 82867 silly gunzTarPerm extractEntry perf/big-vs-bigdecimal.html | |
| 82868 silly gunzTarPerm modified mode [ 'perf/big-vs-bigdecimal.html', 438, 420 ] | |
| 82869 silly gunzTarPerm extractEntry perf/lib/bigdecimal_GWT/bigdecimal.js | |
| 82870 silly gunzTarPerm modified mode [ 'perf/lib/bigdecimal_GWT/bigdecimal.js', 438, 420 ] | |
| 82871 silly gunzTarPerm extractEntry fn/string/at.js | |
| 82872 silly gunzTarPerm modified mode [ 'fn/string/at.js', 438, 420 ] | |
| 82873 silly gunzTarPerm extractEntry fn/string/ends-with.js | |
| 82874 silly gunzTarPerm modified mode [ 'fn/string/ends-with.js', 438, 420 ] | |
| 82875 silly gunzTarPerm extractEntry fn/string/escape-html.js | |
| 82876 silly gunzTarPerm modified mode [ 'fn/string/escape-html.js', 438, 420 ] | |
| 82877 silly gunzTarPerm extractEntry fn/string/from-code-point.js | |
| 82878 silly gunzTarPerm modified mode [ 'fn/string/from-code-point.js', 438, 420 ] | |
| 82879 silly gunzTarPerm extractEntry fn/string/code-point-at.js | |
| 82880 silly gunzTarPerm modified mode [ 'fn/string/code-point-at.js', 438, 420 ] | |
| 82881 silly gunzTarPerm extractEntry fn/string/index.js | |
| 82882 silly gunzTarPerm modified mode [ 'fn/string/index.js', 438, 420 ] | |
| 82883 silly gunzTarPerm extractEntry fn/string/raw.js | |
| 82884 silly gunzTarPerm modified mode [ 'fn/string/raw.js', 438, 420 ] | |
| 82885 silly gunzTarPerm extractEntry fn/string/repeat.js | |
| 82886 silly gunzTarPerm modified mode [ 'fn/string/repeat.js', 438, 420 ] | |
| 82887 silly gunzTarPerm extractEntry fn/string/starts-with.js | |
| 82888 silly gunzTarPerm modified mode [ 'fn/string/starts-with.js', 438, 420 ] | |
| 82889 silly gunzTarPerm extractEntry fn/string/unescape-html.js | |
| 82890 silly gunzTarPerm modified mode [ 'fn/string/unescape-html.js', 438, 420 ] | |
| 82891 silly gunzTarPerm extractEntry fn/string/includes.js | |
| 82892 silly gunzTarPerm modified mode [ 'fn/string/includes.js', 438, 420 ] | |
| 82893 silly gunzTarPerm extractEntry fn/symbol/for.js | |
| 82894 silly gunzTarPerm modified mode [ 'fn/symbol/for.js', 438, 420 ] | |
| 82895 silly gunzTarPerm extractEntry perf/lib/bigdecimal_GWT/bugs.js | |
| 82896 silly gunzTarPerm modified mode [ 'perf/lib/bigdecimal_GWT/bugs.js', 438, 420 ] | |
| 82897 silly gunzTarPerm extractEntry perf/lib/bigdecimal_GWT/BigDecTest.class | |
| 82898 silly gunzTarPerm modified mode [ 'perf/lib/bigdecimal_GWT/BigDecTest.class', 438, 420 ] | |
| 82899 silly gunzTarPerm extractEntry fn/symbol/is-concat-spreadable.js | |
| 82900 silly gunzTarPerm modified mode [ 'fn/symbol/is-concat-spreadable.js', 438, 420 ] | |
| 82901 silly gunzTarPerm extractEntry fn/symbol/iterator.js | |
| 82902 silly gunzTarPerm modified mode [ 'fn/symbol/iterator.js', 438, 420 ] | |
| 82903 silly gunzTarPerm extractEntry fn/symbol/key-for.js | |
| 82904 silly gunzTarPerm modified mode [ 'fn/symbol/key-for.js', 438, 420 ] | |
| 82905 silly gunzTarPerm extractEntry fn/symbol/match.js | |
| 82906 silly gunzTarPerm modified mode [ 'fn/symbol/match.js', 438, 420 ] | |
| 82907 silly gunzTarPerm extractEntry perf/lib/bigdecimal_GWT/BigDecTest.java | |
| 82908 silly gunzTarPerm modified mode [ 'perf/lib/bigdecimal_GWT/BigDecTest.java', 438, 420 ] | |
| 82909 silly gunzTarPerm extractEntry perf/lib/bigdecimal_GWT/LICENCE.txt | |
| 82910 silly gunzTarPerm modified mode [ 'perf/lib/bigdecimal_GWT/LICENCE.txt', 438, 420 ] | |
| 82911 silly gunzTarPerm extractEntry fn/symbol/index.js | |
| 82912 silly gunzTarPerm modified mode [ 'fn/symbol/index.js', 438, 420 ] | |
| 82913 silly gunzTarPerm extractEntry fn/symbol/search.js | |
| 82914 silly gunzTarPerm modified mode [ 'fn/symbol/search.js', 438, 420 ] | |
| 82915 silly gunzTarPerm extractEntry fn/symbol/species.js | |
| 82916 silly gunzTarPerm modified mode [ 'fn/symbol/species.js', 438, 420 ] | |
| 82917 silly gunzTarPerm extractEntry fn/symbol/split.js | |
| 82918 silly gunzTarPerm modified mode [ 'fn/symbol/split.js', 438, 420 ] | |
| 82919 http 304 https://registry.npmjs.org/babel-core | |
| 82920 silly registry.get cb [ 304, | |
| 82920 silly registry.get { date: 'Mon, 20 Apr 2015 19:11:56 GMT', | |
| 82920 silly registry.get server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 82920 silly registry.get etag: '"20H6JY8IC4E6TY9LMHTNKDELR"', | |
| 82920 silly registry.get 'cache-control': 'max-age=60', | |
| 82920 silly registry.get 'accept-ranges': 'bytes', | |
| 82920 silly registry.get via: '1.1 varnish', | |
| 82920 silly registry.get 'x-served-by': 'cache-dfw1823-DFW', | |
| 82920 silly registry.get 'x-cache': 'MISS', | |
| 82920 silly registry.get 'x-cache-hits': '0', | |
| 82920 silly registry.get 'x-timer': 'S1429557116.389902,VS0,VE258', | |
| 82920 silly registry.get 'content-length': '0', | |
| 82920 silly registry.get 'keep-alive': 'timeout=10, max=50', | |
| 82920 silly registry.get connection: 'Keep-Alive' } ] | |
| 82921 verbose etag babel-core from cache | |
| 82922 silly gunzTarPerm extractEntry fn/symbol/to-primitive.js | |
| 82923 silly gunzTarPerm modified mode [ 'fn/symbol/to-primitive.js', 438, 420 ] | |
| 82924 silly gunzTarPerm extractEntry fn/symbol/to-string-tag.js | |
| 82925 silly gunzTarPerm modified mode [ 'fn/symbol/to-string-tag.js', 438, 420 ] | |
| 82926 silly addNameRange number 2 { name: 'babel-core', range: '*', hasData: true } | |
| 82927 silly addNameRange versions [ 'babel-core', | |
| 82927 silly addNameRange [ '4.0.1', | |
| 82927 silly addNameRange '4.0.2', | |
| 82927 silly addNameRange '4.1.1', | |
| 82927 silly addNameRange '4.2.0', | |
| 82927 silly addNameRange '4.2.1', | |
| 82927 silly addNameRange '4.3.0', | |
| 82927 silly addNameRange '4.4.1', | |
| 82927 silly addNameRange '4.4.2', | |
| 82927 silly addNameRange '4.4.3', | |
| 82927 silly addNameRange '4.4.4', | |
| 82927 silly addNameRange '4.4.5', | |
| 82927 silly addNameRange '4.4.6', | |
| 82927 silly addNameRange '4.5.0', | |
| 82927 silly addNameRange '4.5.1', | |
| 82927 silly addNameRange '4.5.2', | |
| 82927 silly addNameRange '4.5.3', | |
| 82927 silly addNameRange '4.5.4', | |
| 82927 silly addNameRange '4.5.5', | |
| 82927 silly addNameRange '4.6.0', | |
| 82927 silly addNameRange '4.6.1', | |
| 82927 silly addNameRange '4.6.3', | |
| 82927 silly addNameRange '4.6.4', | |
| 82927 silly addNameRange '4.6.5', | |
| 82927 silly addNameRange '4.6.6', | |
| 82927 silly addNameRange '4.7.0', | |
| 82927 silly addNameRange '4.7.1', | |
| 82927 silly addNameRange '4.7.2', | |
| 82927 silly addNameRange '4.7.3', | |
| 82927 silly addNameRange '4.7.4', | |
| 82927 silly addNameRange '4.7.5', | |
| 82927 silly addNameRange '4.7.6', | |
| 82927 silly addNameRange '4.7.7', | |
| 82927 silly addNameRange '4.7.8', | |
| 82927 silly addNameRange '4.7.9', | |
| 82927 silly addNameRange '4.7.10', | |
| 82927 silly addNameRange '4.7.11', | |
| 82927 silly addNameRange '4.7.12', | |
| 82927 silly addNameRange '4.7.13', | |
| 82927 silly addNameRange '4.7.14', | |
| 82927 silly addNameRange '4.7.15', | |
| 82927 silly addNameRange '4.7.16', | |
| 82927 silly addNameRange '5.0.0-beta2', | |
| 82927 silly addNameRange '5.0.0-beta3', | |
| 82927 silly addNameRange '5.0.0-beta4', | |
| 82927 silly addNameRange '5.0.0', | |
| 82927 silly addNameRange '5.0.1', | |
| 82927 silly addNameRange '5.0.2', | |
| 82927 silly addNameRange '5.0.3', | |
| 82927 silly addNameRange '5.0.4', | |
| 82927 silly addNameRange '5.0.5', | |
| 82927 silly addNameRange '5.0.6', | |
| 82927 silly addNameRange '5.0.7', | |
| 82927 silly addNameRange '5.0.8', | |
| 82927 silly addNameRange '5.0.9', | |
| 82927 silly addNameRange '5.0.10', | |
| 82927 silly addNameRange '5.0.11', | |
| 82927 silly addNameRange '5.0.12', | |
| 82927 silly addNameRange '5.0.13', | |
| 82927 silly addNameRange '5.1.0', | |
| 82927 silly addNameRange '5.1.1', | |
| 82927 silly addNameRange '5.1.2', | |
| 82927 silly addNameRange '5.1.3', | |
| 82927 silly addNameRange '5.1.4', | |
| 82927 silly addNameRange '5.1.5', | |
| 82927 silly addNameRange '5.1.6', | |
| 82927 silly addNameRange '5.1.7', | |
| 82927 silly addNameRange '5.1.8', | |
| 82927 silly addNameRange '5.1.9', | |
| 82927 silly addNameRange '5.1.10', | |
| 82927 silly addNameRange '5.1.11' ] ] | |
| 82928 verbose addNamed [ 'babel-core', '5.1.11' ] | |
| 82929 verbose addNamed [ '5.1.11', '5.1.11' ] | |
| 82930 silly lockFile 23d830a7-babel-core-5-1-11 babel-core@5.1.11 | |
| 82931 verbose lock babel-core@5.1.11 C:\Users\Vince\AppData\Roaming\npm-cache\23d830a7-babel-core-5-1-11.lock | |
| 82932 silly lockFile 23d830a7-babel-core-5-1-11 babel-core@5.1.11 | |
| 82933 silly lockFile 23d830a7-babel-core-5-1-11 babel-core@5.1.11 | |
| 82934 silly lockFile 30f85588-babel-core babel-core@* | |
| 82935 silly lockFile 30f85588-babel-core babel-core@* | |
| 82936 silly resolved [ { name: 'babel-core', | |
| 82936 silly resolved description: 'Turn ES6 code into readable vanilla ES5 with source maps', | |
| 82936 silly resolved version: '5.1.11', | |
| 82936 silly resolved author: { name: 'Sebastian McKenzie', email: 'sebmck@gmail.com' }, | |
| 82936 silly resolved homepage: 'https://babeljs.io/', | |
| 82936 silly resolved repository: { type: 'git', url: 'babel/babel' }, | |
| 82936 silly resolved main: 'lib/babel/api/node.js', | |
| 82936 silly resolved browser: { './lib/babel/api/register/node.js': './lib/babel/api/register/browser.js' }, | |
| 82936 silly resolved keywords: | |
| 82936 silly resolved [ 'harmony', | |
| 82936 silly resolved 'classes', | |
| 82936 silly resolved 'modules', | |
| 82936 silly resolved 'let', | |
| 82936 silly resolved 'const', | |
| 82936 silly resolved 'var', | |
| 82936 silly resolved 'es6', | |
| 82936 silly resolved 'transpile', | |
| 82936 silly resolved 'transpiler', | |
| 82936 silly resolved '6to5', | |
| 82936 silly resolved 'babel' ], | |
| 82936 silly resolved scripts: { bench: 'make bench', test: 'make test' }, | |
| 82936 silly resolved dependencies: | |
| 82936 silly resolved { 'ast-types': '~0.7.0', | |
| 82936 silly resolved chalk: '^1.0.0', | |
| 82936 silly resolved 'convert-source-map': '^1.0.0', | |
| 82936 silly resolved 'core-js': '^0.8.3', | |
| 82936 silly resolved debug: '^2.1.1', | |
| 82936 silly resolved 'detect-indent': '^3.0.0', | |
| 82936 silly resolved estraverse: '^3.0.0', | |
| 82936 silly resolved esutils: '^2.0.0', | |
| 82936 silly resolved 'fs-readdir-recursive': '^0.1.0', | |
| 82936 silly resolved globals: '^6.4.0', | |
| 82936 silly resolved 'is-integer': '^1.0.4', | |
| 82936 silly resolved 'js-tokens': '1.0.0', | |
| 82936 silly resolved leven: '^1.0.1', | |
| 82936 silly resolved 'line-numbers': '0.2.0', | |
| 82936 silly resolved lodash: '^3.6.0', | |
| 82936 silly resolved minimatch: '^2.0.3', | |
| 82936 silly resolved 'output-file-sync': '^1.1.0', | |
| 82936 silly resolved 'path-is-absolute': '^1.0.0', | |
| 82936 silly resolved private: '^0.1.6', | |
| 82936 silly resolved regenerator: '^0.8.20', | |
| 82936 silly resolved regexpu: '^1.1.2', | |
| 82936 silly resolved repeating: '^1.1.2', | |
| 82936 silly resolved 'shebang-regex': '^1.0.0', | |
| 82936 silly resolved slash: '^1.0.0', | |
| 82936 silly resolved 'source-map': '^0.4.0', | |
| 82936 silly resolved 'source-map-support': '^0.2.10', | |
| 82936 silly resolved 'strip-json-comments': '^1.0.2', | |
| 82936 silly resolved 'to-fast-properties': '^1.0.0', | |
| 82936 silly resolved 'trim-right': '^1.0.0', | |
| 82936 silly resolved 'user-home': '^1.1.1' }, | |
| 82936 silly resolved devDependencies: | |
| 82936 silly resolved { babel: '4.7.13', | |
| 82936 silly resolved browserify: '^9.0.8', | |
| 82936 silly resolved chai: '^2.2.0', | |
| 82936 silly resolved eslint: '^0.18.0', | |
| 82936 silly resolved 'babel-eslint': '^2.0.0', | |
| 82936 silly resolved esvalid: '^1.1.0', | |
| 82936 silly resolved istanbul: '^0.3.5', | |
| 82936 silly resolved matcha: '^0.6.0', | |
| 82936 silly resolved mocha: '2.2.0', | |
| 82936 silly resolved rimraf: '^2.3.2', | |
| 82936 silly resolved 'uglify-js': '^2.4.16' }, | |
| 82936 silly resolved readme: '<p align="center">\n <a href="https://babeljs.io/">\n <img alt="babel" src="https://raw.githubusercontent.com/babel/logo/master/logo.png" width="546">\n </a>\n</p>\n\n<p align="center">\n <strong>Babel</strong> is a compiler for writing next generation JavaScript.\n</p>\n\n<p align="center">\n For questions and support please visit the <a href="https://gitter.im/babel/babel">gitter room</a> or <a href="http://stackoverflow.com/questions/tagged/babeljs">StackOverflow</a>. The Babel issue tracker is <strong>exclusively</strong> for bug reports and feature requests.\n</p>\n\n<p align="center">\n For documentation and website issues please visit the <a href="https://github.com/babel/babel.github.io">babel.github.io</a> repo.\n</p>\n', | |
| 82936 silly resolved readmeFilename: 'README.md', | |
| 82936 silly resolved _id: 'babel-core@5.1.11', | |
| 82936 silly resolved _from: 'babel-core@*' } ] | |
| 82937 info install babel-core@5.1.11 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack | |
| 82938 info installOne babel-core@5.1.11 | |
| 82939 silly gunzTarPerm extractEntry fn/symbol/has-instance.js | |
| 82940 silly gunzTarPerm modified mode [ 'fn/symbol/has-instance.js', 438, 420 ] | |
| 82941 silly gunzTarPerm extractEntry fn/symbol/unscopables.js | |
| 82942 silly gunzTarPerm modified mode [ 'fn/symbol/unscopables.js', 438, 420 ] | |
| 82943 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core unbuild | |
| 82944 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\babel-core\5.1.11\package.tgz | |
| 82945 silly lockFile eb9d16f1-app-pack-node-modules-babel-core tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 82946 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core C:\Users\Vince\AppData\Roaming\npm-cache\eb9d16f1-app-pack-node-modules-babel-core.lock | |
| 82947 silly lockFile 01903ca8-he-babel-core-5-1-11-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\babel-core\5.1.11\package.tgz | |
| 82948 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\babel-core\5.1.11\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\01903ca8-he-babel-core-5-1-11-package-tgz.lock | |
| 82949 silly gunzTarPerm modes [ '755', '644' ] | |
| 82950 silly gunzTarPerm extractEntry fn/symbol/replace.js | |
| 82951 silly gunzTarPerm modified mode [ 'fn/symbol/replace.js', 438, 420 ] | |
| 82952 silly gunzTarPerm extractEntry fn/function/index.js | |
| 82953 silly gunzTarPerm modified mode [ 'fn/function/index.js', 438, 420 ] | |
| 82954 silly gunzTarPerm extractEntry package.json | |
| 82955 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 82956 silly gunzTarPerm extractEntry README.md | |
| 82957 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 82958 silly gunzTarPerm extractEntry LICENSE | |
| 82959 silly gunzTarPerm modified mode [ 'LICENSE', 438, 420 ] | |
| 82960 silly gunzTarPerm extractEntry fn/function/only.js | |
| 82961 silly gunzTarPerm modified mode [ 'fn/function/only.js', 438, 420 ] | |
| 82962 silly gunzTarPerm extractEntry fn/function/part.js | |
| 82963 silly gunzTarPerm modified mode [ 'fn/function/part.js', 438, 420 ] | |
| 82964 silly gunzTarPerm extractEntry perf/lib/bigdecimal_ICU4J/BigDecimal-all-last.js | |
| 82965 silly gunzTarPerm modified mode [ 'perf/lib/bigdecimal_ICU4J/BigDecimal-all-last.js', 438, 420 ] | |
| 82966 silly gunzTarPerm extractEntry fn/date/add-locale.js | |
| 82967 silly gunzTarPerm modified mode [ 'fn/date/add-locale.js', 438, 420 ] | |
| 82968 silly gunzTarPerm extractEntry fn/date/format-utc.js | |
| 82969 silly gunzTarPerm modified mode [ 'fn/date/format-utc.js', 438, 420 ] | |
| 82970 silly gunzTarPerm extractEntry browser-polyfill.js | |
| 82971 silly gunzTarPerm modified mode [ 'browser-polyfill.js', 438, 420 ] | |
| 82972 silly gunzTarPerm extractEntry external-helpers.js | |
| 82973 silly gunzTarPerm modified mode [ 'external-helpers.js', 438, 420 ] | |
| 82974 silly gunzTarPerm extractEntry fn/date/format.js | |
| 82975 silly gunzTarPerm modified mode [ 'fn/date/format.js', 438, 420 ] | |
| 82976 silly gunzTarPerm extractEntry fn/date/index.js | |
| 82977 silly gunzTarPerm modified mode [ 'fn/date/index.js', 438, 420 ] | |
| 82978 silly gunzTarPerm extractEntry browser.js | |
| 82979 silly gunzTarPerm modified mode [ 'browser.js', 438, 420 ] | |
| 82980 silly gunzTarPerm extractEntry fn/number/epsilon.js | |
| 82981 silly gunzTarPerm modified mode [ 'fn/number/epsilon.js', 438, 420 ] | |
| 82982 silly gunzTarPerm extractEntry fn/number/is-finite.js | |
| 82983 silly gunzTarPerm modified mode [ 'fn/number/is-finite.js', 438, 420 ] | |
| 82984 silly gunzTarPerm extractEntry perf/lib/bigdecimal_ICU4J/BigDecimal-all-last.min.js | |
| 82985 silly gunzTarPerm modified mode [ 'perf/lib/bigdecimal_ICU4J/BigDecimal-all-last.min.js', | |
| 82985 silly gunzTarPerm 438, | |
| 82985 silly gunzTarPerm 420 ] | |
| 82986 silly gunzTarPerm extractEntry perf/lib/bigdecimal_ICU4J/LICENCE.txt | |
| 82987 silly gunzTarPerm modified mode [ 'perf/lib/bigdecimal_ICU4J/LICENCE.txt', 438, 420 ] | |
| 82988 silly gunzTarPerm extractEntry fn/number/is-integer.js | |
| 82989 silly gunzTarPerm modified mode [ 'fn/number/is-integer.js', 438, 420 ] | |
| 82990 silly gunzTarPerm extractEntry fn/number/is-nan.js | |
| 82991 silly gunzTarPerm modified mode [ 'fn/number/is-nan.js', 438, 420 ] | |
| 82992 silly gunzTarPerm extractEntry fn/number/index.js | |
| 82993 silly gunzTarPerm modified mode [ 'fn/number/index.js', 438, 420 ] | |
| 82994 silly gunzTarPerm extractEntry fn/number/max-safe-integer.js | |
| 82995 silly gunzTarPerm modified mode [ 'fn/number/max-safe-integer.js', 438, 420 ] | |
| 82996 silly gunzTarPerm extractEntry fn/number/min-safe-integer.js | |
| 82997 silly gunzTarPerm modified mode [ 'fn/number/min-safe-integer.js', 438, 420 ] | |
| 82998 silly gunzTarPerm extractEntry fn/number/parse-float.js | |
| 82999 silly gunzTarPerm modified mode [ 'fn/number/parse-float.js', 438, 420 ] | |
| 83000 silly lockFile cfb64d3e-m-cache-ast-types-0-6-16-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.6.16\package | |
| 83001 silly lockFile cfb64d3e-m-cache-ast-types-0-6-16-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.6.16\package | |
| 83002 silly lockFile 09af4191-che-ast-types-0-6-16-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.6.16\package.tgz | |
| 83003 silly lockFile 09af4191-che-ast-types-0-6-16-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.6.16\package.tgz | |
| 83004 silly gunzTarPerm extractEntry fn/number/parse-int.js | |
| 83005 silly gunzTarPerm modified mode [ 'fn/number/parse-int.js', 438, 420 ] | |
| 83006 silly gunzTarPerm extractEntry fn/number/random.js | |
| 83007 silly gunzTarPerm modified mode [ 'fn/number/random.js', 438, 420 ] | |
| 83008 silly gunzTarPerm extractEntry test/abs.js | |
| 83009 silly gunzTarPerm modified mode [ 'test/abs.js', 438, 420 ] | |
| 83010 silly gunzTarPerm extractEntry test/every-test.js | |
| 83011 silly gunzTarPerm modified mode [ 'test/every-test.js', 438, 420 ] | |
| 83012 verbose chmod C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.6.16\package.tgz 644 | |
| 83013 silly chown skipping for windows C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.6.16\package.tgz | |
| 83014 silly lockFile 1a39c6c0-g-ast-types-ast-types-0-6-16-tgz https://registry.npmjs.org/ast-types/-/ast-types-0.6.16.tgz | |
| 83015 silly lockFile 1a39c6c0-g-ast-types-ast-types-0-6-16-tgz https://registry.npmjs.org/ast-types/-/ast-types-0.6.16.tgz | |
| 83016 silly lockFile 708a3a2c-ast-types-0-6-16 ast-types@0.6.16 | |
| 83017 silly lockFile 708a3a2c-ast-types-0-6-16 ast-types@0.6.16 | |
| 83018 silly gunzTarPerm extractEntry fn/number/is-safe-integer.js | |
| 83019 silly gunzTarPerm modified mode [ 'fn/number/is-safe-integer.js', 438, 420 ] | |
| 83020 silly gunzTarPerm extractEntry es6/array.js | |
| 83021 silly gunzTarPerm modified mode [ 'es6/array.js', 438, 420 ] | |
| 83022 silly lockFile 5beb1a67-ast-types-0-6-1 ast-types@~0.6.1 | |
| 83023 silly lockFile 5beb1a67-ast-types-0-6-1 ast-types@~0.6.1 | |
| 83024 silly gunzTarPerm extractEntry polyfill.js | |
| 83025 silly gunzTarPerm modified mode [ 'polyfill.js', 438, 420 ] | |
| 83026 silly gunzTarPerm extractEntry es6/math.js | |
| 83027 silly gunzTarPerm modified mode [ 'es6/math.js', 438, 420 ] | |
| 83028 silly gunzTarPerm extractEntry es6/number.js | |
| 83029 silly gunzTarPerm modified mode [ 'es6/number.js', 438, 420 ] | |
| 83030 silly gunzTarPerm extractEntry es6/object.js | |
| 83031 silly gunzTarPerm modified mode [ 'es6/object.js', 438, 420 ] | |
| 83032 silly gunzTarPerm extractEntry es6/map.js | |
| 83033 silly gunzTarPerm modified mode [ 'es6/map.js', 438, 420 ] | |
| 83034 silly gunzTarPerm extractEntry es6/reflect.js | |
| 83035 silly gunzTarPerm modified mode [ 'es6/reflect.js', 438, 420 ] | |
| 83036 silly gunzTarPerm extractEntry es6/regexp.js | |
| 83037 silly gunzTarPerm modified mode [ 'es6/regexp.js', 438, 420 ] | |
| 83038 silly gunzTarPerm extractEntry es6/set.js | |
| 83039 silly gunzTarPerm modified mode [ 'es6/set.js', 438, 420 ] | |
| 83040 silly gunzTarPerm extractEntry es6/string.js | |
| 83041 silly gunzTarPerm modified mode [ 'es6/string.js', 438, 420 ] | |
| 83042 silly gunzTarPerm extractEntry es6/symbol.js | |
| 83043 silly gunzTarPerm modified mode [ 'es6/symbol.js', 438, 420 ] | |
| 83044 silly gunzTarPerm extractEntry es6/index.js | |
| 83045 silly gunzTarPerm modified mode [ 'es6/index.js', 438, 420 ] | |
| 83046 silly gunzTarPerm extractEntry register.js | |
| 83047 silly gunzTarPerm modified mode [ 'register.js', 438, 420 ] | |
| 83048 silly gunzTarPerm extractEntry CHANGELOG.md | |
| 83049 silly gunzTarPerm modified mode [ 'CHANGELOG.md', 438, 420 ] | |
| 83050 silly gunzTarPerm extractEntry es6/weak-map.js | |
| 83051 silly gunzTarPerm modified mode [ 'es6/weak-map.js', 438, 420 ] | |
| 83052 silly gunzTarPerm extractEntry es6/function.js | |
| 83053 silly gunzTarPerm modified mode [ 'es6/function.js', 438, 420 ] | |
| 83054 silly gunzTarPerm extractEntry es6/weak-set.js | |
| 83055 silly gunzTarPerm modified mode [ 'es6/weak-set.js', 438, 420 ] | |
| 83056 silly gunzTarPerm extractEntry es6/promise.js | |
| 83057 silly gunzTarPerm modified mode [ 'es6/promise.js', 438, 420 ] | |
| 83058 silly gunzTarPerm extractEntry es7/array.js | |
| 83059 silly gunzTarPerm modified mode [ 'es7/array.js', 438, 420 ] | |
| 83060 silly gunzTarPerm extractEntry es7/index.js | |
| 83061 silly gunzTarPerm modified mode [ 'es7/index.js', 438, 420 ] | |
| 83062 silly gunzTarPerm extractEntry CODE_OF_CONDUCT.md | |
| 83063 silly gunzTarPerm modified mode [ 'CODE_OF_CONDUCT.md', 438, 420 ] | |
| 83064 silly gunzTarPerm extractEntry es7/object.js | |
| 83065 silly gunzTarPerm modified mode [ 'es7/object.js', 438, 420 ] | |
| 83066 silly gunzTarPerm extractEntry es7/regexp.js | |
| 83067 silly gunzTarPerm modified mode [ 'es7/regexp.js', 438, 420 ] | |
| 83068 silly gunzTarPerm extractEntry es7/set.js | |
| 83069 silly gunzTarPerm modified mode [ 'es7/set.js', 438, 420 ] | |
| 83070 silly gunzTarPerm extractEntry es7/string.js | |
| 83071 silly gunzTarPerm modified mode [ 'es7/string.js', 438, 420 ] | |
| 83072 silly gunzTarPerm extractEntry .gitattributes | |
| 83073 silly gunzTarPerm modified mode [ '.gitattributes', 438, 420 ] | |
| 83074 silly gunzTarPerm extractEntry .eslintrc | |
| 83075 silly gunzTarPerm modified mode [ '.eslintrc', 438, 420 ] | |
| 83076 silly gunzTarPerm extractEntry bower.json | |
| 83077 silly gunzTarPerm modified mode [ 'bower.json', 438, 420 ] | |
| 83078 silly gunzTarPerm extractEntry js/array.js | |
| 83079 silly gunzTarPerm modified mode [ 'js/array.js', 438, 420 ] | |
| 83080 silly gunzTarPerm extractEntry js/index.js | |
| 83081 silly gunzTarPerm modified mode [ 'js/index.js', 438, 420 ] | |
| 83082 silly gunzTarPerm extractEntry library/index.js | |
| 83083 silly gunzTarPerm modified mode [ 'library/index.js', 438, 420 ] | |
| 83084 silly gunzTarPerm extractEntry library/shim.js | |
| 83085 silly gunzTarPerm modified mode [ 'library/shim.js', 438, 420 ] | |
| 83086 silly gunzTarPerm extractEntry library/core/$for.js | |
| 83087 silly gunzTarPerm modified mode [ 'library/core/$for.js', 438, 420 ] | |
| 83088 silly gunzTarPerm extractEntry test/minus.js | |
| 83089 silly gunzTarPerm modified mode [ 'test/minus.js', 438, 420 ] | |
| 83090 silly gunzTarPerm extractEntry library/core/delay.js | |
| 83091 silly gunzTarPerm modified mode [ 'library/core/delay.js', 438, 420 ] | |
| 83092 silly gunzTarPerm extractEntry library/core/dict.js | |
| 83093 silly gunzTarPerm modified mode [ 'library/core/dict.js', 438, 420 ] | |
| 83094 silly gunzTarPerm extractEntry test/mod.js | |
| 83095 silly gunzTarPerm modified mode [ 'test/mod.js', 438, 420 ] | |
| 83096 silly gunzTarPerm extractEntry library/core/function.js | |
| 83097 silly gunzTarPerm modified mode [ 'library/core/function.js', 438, 420 ] | |
| 83098 silly gunzTarPerm extractEntry library/core/date.js | |
| 83099 silly gunzTarPerm modified mode [ 'library/core/date.js', 438, 420 ] | |
| 83100 silly gunzTarPerm extractEntry test/div.js | |
| 83101 silly gunzTarPerm modified mode [ 'test/div.js', 438, 420 ] | |
| 83102 silly gunzTarPerm extractEntry library/core/index.js | |
| 83103 silly gunzTarPerm modified mode [ 'library/core/index.js', 438, 420 ] | |
| 83104 silly gunzTarPerm extractEntry library/core/log.js | |
| 83105 silly gunzTarPerm modified mode [ 'library/core/log.js', 438, 420 ] | |
| 83106 silly gunzTarPerm extractEntry library/core/number.js | |
| 83107 silly gunzTarPerm modified mode [ 'library/core/number.js', 438, 420 ] | |
| 83108 silly gunzTarPerm extractEntry library/core/object.js | |
| 83109 silly gunzTarPerm modified mode [ 'library/core/object.js', 438, 420 ] | |
| 83110 silly gunzTarPerm extractEntry library/core/string.js | |
| 83111 silly gunzTarPerm modified mode [ 'library/core/string.js', 438, 420 ] | |
| 83112 silly gunzTarPerm extractEntry library/core/array.js | |
| 83113 silly gunzTarPerm modified mode [ 'library/core/array.js', 438, 420 ] | |
| 83114 silly gunzTarPerm extractEntry library/core/_.js | |
| 83115 silly gunzTarPerm modified mode [ 'library/core/_.js', 438, 420 ] | |
| 83116 silly gunzTarPerm extractEntry library/core/global.js | |
| 83117 silly gunzTarPerm modified mode [ 'library/core/global.js', 438, 420 ] | |
| 83118 silly gunzTarPerm extractEntry test/toPrecision.js | |
| 83119 silly gunzTarPerm modified mode [ 'test/toPrecision.js', 438, 420 ] | |
| 83120 silly gunzTarPerm extractEntry library/es5/index.js | |
| 83121 silly gunzTarPerm modified mode [ 'library/es5/index.js', 438, 420 ] | |
| 83122 silly gunzTarPerm extractEntry library/es6/array.js | |
| 83123 silly gunzTarPerm modified mode [ 'library/es6/array.js', 438, 420 ] | |
| 83124 silly gunzTarPerm extractEntry library/es6/math.js | |
| 83125 silly gunzTarPerm modified mode [ 'library/es6/math.js', 438, 420 ] | |
| 83126 silly gunzTarPerm extractEntry library/es6/number.js | |
| 83127 silly gunzTarPerm modified mode [ 'library/es6/number.js', 438, 420 ] | |
| 83128 silly gunzTarPerm extractEntry library/es6/object.js | |
| 83129 silly gunzTarPerm modified mode [ 'library/es6/object.js', 438, 420 ] | |
| 83130 silly gunzTarPerm extractEntry library/es6/map.js | |
| 83131 silly gunzTarPerm modified mode [ 'library/es6/map.js', 438, 420 ] | |
| 83132 silly gunzTarPerm extractEntry library/es6/reflect.js | |
| 83133 silly gunzTarPerm modified mode [ 'library/es6/reflect.js', 438, 420 ] | |
| 83134 silly gunzTarPerm extractEntry library/es6/regexp.js | |
| 83135 silly gunzTarPerm modified mode [ 'library/es6/regexp.js', 438, 420 ] | |
| 83136 silly gunzTarPerm extractEntry library/es6/set.js | |
| 83137 silly gunzTarPerm modified mode [ 'library/es6/set.js', 438, 420 ] | |
| 83138 silly gunzTarPerm extractEntry library/es6/string.js | |
| 83139 silly gunzTarPerm modified mode [ 'library/es6/string.js', 438, 420 ] | |
| 83140 silly gunzTarPerm extractEntry library/es6/symbol.js | |
| 83141 silly gunzTarPerm modified mode [ 'library/es6/symbol.js', 438, 420 ] | |
| 83142 silly gunzTarPerm extractEntry library/es6/index.js | |
| 83143 silly gunzTarPerm modified mode [ 'library/es6/index.js', 438, 420 ] | |
| 83144 silly gunzTarPerm extractEntry library/es6/weak-map.js | |
| 83145 silly gunzTarPerm modified mode [ 'library/es6/weak-map.js', 438, 420 ] | |
| 83146 silly gunzTarPerm extractEntry library/es6/function.js | |
| 83147 silly gunzTarPerm modified mode [ 'library/es6/function.js', 438, 420 ] | |
| 83148 silly gunzTarPerm extractEntry library/es6/weak-set.js | |
| 83149 silly gunzTarPerm modified mode [ 'library/es6/weak-set.js', 438, 420 ] | |
| 83150 silly gunzTarPerm extractEntry library/es6/promise.js | |
| 83151 silly gunzTarPerm modified mode [ 'library/es6/promise.js', 438, 420 ] | |
| 83152 silly gunzTarPerm extractEntry library/es7/array.js | |
| 83153 silly gunzTarPerm modified mode [ 'library/es7/array.js', 438, 420 ] | |
| 83154 silly gunzTarPerm extractEntry library/es7/index.js | |
| 83155 silly gunzTarPerm modified mode [ 'library/es7/index.js', 438, 420 ] | |
| 83156 silly gunzTarPerm extractEntry library/es7/object.js | |
| 83157 silly gunzTarPerm modified mode [ 'library/es7/object.js', 438, 420 ] | |
| 83158 silly gunzTarPerm extractEntry library/es7/regexp.js | |
| 83159 silly gunzTarPerm modified mode [ 'library/es7/regexp.js', 438, 420 ] | |
| 83160 silly gunzTarPerm extractEntry library/es7/set.js | |
| 83161 silly gunzTarPerm modified mode [ 'library/es7/set.js', 438, 420 ] | |
| 83162 silly gunzTarPerm extractEntry library/es7/string.js | |
| 83163 silly gunzTarPerm modified mode [ 'library/es7/string.js', 438, 420 ] | |
| 83164 silly lockFile 3ea7e976-ransform-node-modules-esprima-fb tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\react\node_modules\envify\node_modules\jstransform\node_modules\esprima-fb | |
| 83165 silly lockFile 3ea7e976-ransform-node-modules-esprima-fb tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\react\node_modules\envify\node_modules\jstransform\node_modules\esprima-fb | |
| 83166 silly gunzTarPerm extractEntry library/fn/$for.js | |
| 83167 silly gunzTarPerm modified mode [ 'library/fn/$for.js', 438, 420 ] | |
| 83168 silly gunzTarPerm extractEntry library/fn/dict.js | |
| 83169 silly gunzTarPerm modified mode [ 'library/fn/dict.js', 438, 420 ] | |
| 83170 silly lockFile 753fdc6f-001-0-dev-harmony-fb-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\13001.1001.0-dev-harmony-fb\package.tgz | |
| 83171 silly lockFile 753fdc6f-001-0-dev-harmony-fb-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\13001.1001.0-dev-harmony-fb\package.tgz | |
| 83172 silly gunzTarPerm extractEntry library/fn/weak-map.js | |
| 83173 silly gunzTarPerm modified mode [ 'library/fn/weak-map.js', 438, 420 ] | |
| 83174 silly gunzTarPerm extractEntry library/fn/get-iterator.js | |
| 83175 silly gunzTarPerm modified mode [ 'library/fn/get-iterator.js', 438, 420 ] | |
| 83176 info preinstall esprima-fb@13001.1001.0-dev-harmony-fb | |
| 83177 verbose readDependencies using package.json deps | |
| 83178 verbose readDependencies using package.json deps | |
| 83179 silly resolved [] | |
| 83180 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\react\node_modules\envify\node_modules\jstransform\node_modules\esprima-fb | |
| 83181 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\react\node_modules\envify\node_modules\jstransform\node_modules\esprima-fb | |
| 83182 verbose linkStuff [ true, | |
| 83182 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 83182 verbose linkStuff false, | |
| 83182 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\react\\node_modules\\envify\\node_modules\\jstransform\\node_modules' ] | |
| 83183 info linkStuff esprima-fb@13001.1001.0-dev-harmony-fb | |
| 83184 verbose linkBins esprima-fb@13001.1001.0-dev-harmony-fb | |
| 83185 verbose link bins [ { esparse: './bin/esparse.js', | |
| 83185 verbose link bins esvalidate: './bin/esvalidate.js' }, | |
| 83185 verbose link bins 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\react\\node_modules\\envify\\node_modules\\jstransform\\node_modules\\.bin', | |
| 83185 verbose link bins false ] | |
| 83186 verbose linkMans esprima-fb@13001.1001.0-dev-harmony-fb | |
| 83187 verbose rebuildBundles esprima-fb@13001.1001.0-dev-harmony-fb | |
| 83188 silly gunzTarPerm extractEntry library/fn/global.js | |
| 83189 silly gunzTarPerm modified mode [ 'library/fn/global.js', 438, 420 ] | |
| 83190 silly gunzTarPerm extractEntry library/fn/delay.js | |
| 83191 silly gunzTarPerm modified mode [ 'library/fn/delay.js', 438, 420 ] | |
| 83192 silly gunzTarPerm extractEntry library/fn/log.js | |
| 83193 silly gunzTarPerm modified mode [ 'library/fn/log.js', 438, 420 ] | |
| 83194 silly gunzTarPerm extractEntry library/fn/map.js | |
| 83195 silly gunzTarPerm modified mode [ 'library/fn/map.js', 438, 420 ] | |
| 83196 info install esprima-fb@13001.1001.0-dev-harmony-fb | |
| 83197 info postinstall esprima-fb@13001.1001.0-dev-harmony-fb | |
| 83198 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\react\node_modules\envify\node_modules\jstransform | |
| 83199 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\react\node_modules\envify\node_modules\jstransform | |
| 83200 verbose linkStuff [ true, | |
| 83200 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 83200 verbose linkStuff false, | |
| 83200 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\react\\node_modules\\envify\\node_modules' ] | |
| 83201 info linkStuff jstransform@10.1.0 | |
| 83202 verbose linkBins jstransform@10.1.0 | |
| 83203 verbose linkMans jstransform@10.1.0 | |
| 83204 verbose rebuildBundles jstransform@10.1.0 | |
| 83205 verbose rebuildBundles [ '.bin', 'base62', 'esprima-fb', 'source-map' ] | |
| 83206 info install jstransform@10.1.0 | |
| 83207 info postinstall jstransform@10.1.0 | |
| 83208 silly gunzTarPerm extractEntry library/fn/set.js | |
| 83209 silly gunzTarPerm modified mode [ 'library/fn/set.js', 438, 420 ] | |
| 83210 silly gunzTarPerm extractEntry library/fn/set-timeout.js | |
| 83211 silly gunzTarPerm modified mode [ 'library/fn/set-timeout.js', 438, 420 ] | |
| 83212 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\react\node_modules\envify | |
| 83213 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\react\node_modules\envify | |
| 83214 verbose linkStuff [ true, | |
| 83214 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 83214 verbose linkStuff false, | |
| 83214 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\react\\node_modules' ] | |
| 83215 info linkStuff envify@3.4.0 | |
| 83216 verbose linkBins envify@3.4.0 | |
| 83217 verbose link bins [ { envify: 'bin/envify' }, | |
| 83217 verbose link bins 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\react\\node_modules\\.bin', | |
| 83217 verbose link bins false ] | |
| 83218 verbose linkMans envify@3.4.0 | |
| 83219 verbose rebuildBundles envify@3.4.0 | |
| 83220 verbose rebuildBundles [ 'jstransform', 'through' ] | |
| 83221 silly gunzTarPerm extractEntry library/fn/set-interval.js | |
| 83222 silly gunzTarPerm modified mode [ 'library/fn/set-interval.js', 438, 420 ] | |
| 83223 silly gunzTarPerm extractEntry library/fn/weak-set.js | |
| 83224 silly gunzTarPerm modified mode [ 'library/fn/weak-set.js', 438, 420 ] | |
| 83225 info install envify@3.4.0 | |
| 83226 info postinstall envify@3.4.0 | |
| 83227 silly gunzTarPerm extractEntry library/fn/promise.js | |
| 83228 silly gunzTarPerm modified mode [ 'library/fn/promise.js', 438, 420 ] | |
| 83229 silly gunzTarPerm extractEntry library/fn/clear-immediate.js | |
| 83230 silly gunzTarPerm modified mode [ 'library/fn/clear-immediate.js', 438, 420 ] | |
| 83231 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\react | |
| 83232 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\react | |
| 83233 verbose linkStuff [ true, | |
| 83233 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 83233 verbose linkStuff false, | |
| 83233 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules' ] | |
| 83234 info linkStuff react@0.13.2 | |
| 83235 verbose linkBins react@0.13.2 | |
| 83236 verbose linkMans react@0.13.2 | |
| 83237 verbose rebuildBundles react@0.13.2 | |
| 83238 verbose rebuildBundles [ '.bin', 'envify' ] | |
| 83239 info install react@0.13.2 | |
| 83240 info postinstall react@0.13.2 | |
| 83241 silly gunzTarPerm extractEntry library/fn/set-immediate.js | |
| 83242 silly gunzTarPerm modified mode [ 'library/fn/set-immediate.js', 438, 420 ] | |
| 83243 silly gunzTarPerm extractEntry library/fn/is-iterable.js | |
| 83244 silly gunzTarPerm modified mode [ 'library/fn/is-iterable.js', 438, 420 ] | |
| 83245 silly gunzTarPerm extractEntry library/fn/_.js | |
| 83246 silly gunzTarPerm modified mode [ 'library/fn/_.js', 438, 420 ] | |
| 83247 silly gunzTarPerm extractEntry library/fn/regexp/escape.js | |
| 83248 silly gunzTarPerm modified mode [ 'library/fn/regexp/escape.js', 438, 420 ] | |
| 83249 silly gunzTarPerm extractEntry library/fn/regexp/index.js | |
| 83250 silly gunzTarPerm modified mode [ 'library/fn/regexp/index.js', 438, 420 ] | |
| 83251 silly gunzTarPerm extractEntry library/fn/reflect/apply.js | |
| 83252 silly gunzTarPerm modified mode [ 'library/fn/reflect/apply.js', 438, 420 ] | |
| 83253 silly gunzTarPerm extractEntry test/round.js | |
| 83254 silly gunzTarPerm modified mode [ 'test/round.js', 438, 420 ] | |
| 83255 silly gunzTarPerm extractEntry library/fn/reflect/enumerate.js | |
| 83256 silly gunzTarPerm modified mode [ 'library/fn/reflect/enumerate.js', 438, 420 ] | |
| 83257 silly gunzTarPerm extractEntry library/fn/reflect/get-own-property-descriptor.js | |
| 83258 silly gunzTarPerm modified mode [ 'library/fn/reflect/get-own-property-descriptor.js', 438, 420 ] | |
| 83259 silly gunzTarPerm extractEntry library/fn/reflect/get-prototype-of.js | |
| 83260 silly gunzTarPerm modified mode [ 'library/fn/reflect/get-prototype-of.js', 438, 420 ] | |
| 83261 silly gunzTarPerm extractEntry library/fn/reflect/delete-property.js | |
| 83262 silly gunzTarPerm modified mode [ 'library/fn/reflect/delete-property.js', 438, 420 ] | |
| 83263 silly gunzTarPerm extractEntry library/fn/reflect/has.js | |
| 83264 silly gunzTarPerm modified mode [ 'library/fn/reflect/has.js', 438, 420 ] | |
| 83265 silly gunzTarPerm extractEntry library/fn/reflect/index.js | |
| 83266 silly gunzTarPerm modified mode [ 'library/fn/reflect/index.js', 438, 420 ] | |
| 83267 silly gunzTarPerm extractEntry library/fn/reflect/is-extensible.js | |
| 83268 silly gunzTarPerm modified mode [ 'library/fn/reflect/is-extensible.js', 438, 420 ] | |
| 83269 silly gunzTarPerm extractEntry library/fn/reflect/own-keys.js | |
| 83270 silly gunzTarPerm modified mode [ 'library/fn/reflect/own-keys.js', 438, 420 ] | |
| 83271 silly gunzTarPerm extractEntry test/sqrt.js | |
| 83272 silly gunzTarPerm modified mode [ 'test/sqrt.js', 438, 420 ] | |
| 83273 silly gunzTarPerm extractEntry library/fn/reflect/prevent-extensions.js | |
| 83274 silly gunzTarPerm modified mode [ 'library/fn/reflect/prevent-extensions.js', 438, 420 ] | |
| 83275 silly gunzTarPerm extractEntry library/fn/reflect/define-property.js | |
| 83276 silly gunzTarPerm modified mode [ 'library/fn/reflect/define-property.js', 438, 420 ] | |
| 83277 silly gunzTarPerm extractEntry test/times.js | |
| 83278 silly gunzTarPerm modified mode [ 'test/times.js', 438, 420 ] | |
| 83279 silly gunzTarPerm extractEntry library/fn/reflect/set-prototype-of.js | |
| 83280 silly gunzTarPerm modified mode [ 'library/fn/reflect/set-prototype-of.js', 438, 420 ] | |
| 83281 silly gunzTarPerm extractEntry library/fn/reflect/construct.js | |
| 83282 silly gunzTarPerm modified mode [ 'library/fn/reflect/construct.js', 438, 420 ] | |
| 83283 silly gunzTarPerm extractEntry library/fn/reflect/set.js | |
| 83284 silly gunzTarPerm modified mode [ 'library/fn/reflect/set.js', 438, 420 ] | |
| 83285 silly gunzTarPerm extractEntry library/fn/reflect/get.js | |
| 83286 silly gunzTarPerm modified mode [ 'library/fn/reflect/get.js', 438, 420 ] | |
| 83287 silly gunzTarPerm extractEntry test/toExponential.js | |
| 83288 silly gunzTarPerm modified mode [ 'test/toExponential.js', 438, 420 ] | |
| 83289 silly lockFile 1358337e-086913-0-132875056238845-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557086913-0.132875056238845\package | |
| 83290 silly lockFile 1358337e-086913-0-132875056238845-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557086913-0.132875056238845\package | |
| 83291 silly lockFile 575952a3-086913-0-132875056238845-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557086913-0.132875056238845\tmp.tgz | |
| 83292 silly lockFile 575952a3-086913-0-132875056238845-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557086913-0.132875056238845\tmp.tgz | |
| 83293 verbose tar pack [ 'C:\\Users\\Vince\\AppData\\Roaming\\npm-cache\\esprima-fb\\10001.1.0-dev-harmony-fb\\package.tgz', | |
| 83293 verbose tar pack 'C:\\Users\\Vince\\AppData\\Local\\Temp\\npm-11116\\1429557086913-0.132875056238845\\package' ] | |
| 83294 verbose tarball C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package.tgz | |
| 83295 verbose folder C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557086913-0.132875056238845\package | |
| 83296 silly lockFile 1358337e-086913-0-132875056238845-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557086913-0.132875056238845\package | |
| 83297 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557086913-0.132875056238845\package C:\Users\Vince\AppData\Roaming\npm-cache\1358337e-086913-0-132875056238845-package.lock | |
| 83298 silly lockFile e5ab5e09-1-1-0-dev-harmony-fb-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package.tgz | |
| 83299 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\e5ab5e09-1-1-0-dev-harmony-fb-package-tgz.lock | |
| 83300 silly gunzTarPerm extractEntry library/fn/object/assign.js | |
| 83301 silly gunzTarPerm modified mode [ 'library/fn/object/assign.js', 438, 420 ] | |
| 83302 silly gunzTarPerm extractEntry library/fn/object/get-own-property-names.js | |
| 83303 silly gunzTarPerm modified mode [ 'library/fn/object/get-own-property-names.js', 438, 420 ] | |
| 83304 silly gunzTarPerm extractEntry library/fn/object/get-own-property-symbols.js | |
| 83305 silly gunzTarPerm modified mode [ 'library/fn/object/get-own-property-symbols.js', 438, 420 ] | |
| 83306 silly gunzTarPerm extractEntry library/fn/object/get-prototype-of.js | |
| 83307 silly gunzTarPerm modified mode [ 'library/fn/object/get-prototype-of.js', 438, 420 ] | |
| 83308 silly gunzTarPerm extractEntry library/fn/object/index.js | |
| 83309 silly gunzTarPerm modified mode [ 'library/fn/object/index.js', 438, 420 ] | |
| 83310 silly gunzTarPerm extractEntry library/fn/object/get-own-property-descriptors.js | |
| 83311 silly gunzTarPerm modified mode [ 'library/fn/object/get-own-property-descriptors.js', 438, 420 ] | |
| 83312 silly gunzTarPerm extractEntry test/cmp.js | |
| 83313 silly gunzTarPerm modified mode [ 'test/cmp.js', 438, 420 ] | |
| 83314 silly gunzTarPerm extractEntry library/fn/object/is-frozen.js | |
| 83315 silly gunzTarPerm modified mode [ 'library/fn/object/is-frozen.js', 438, 420 ] | |
| 83316 silly gunzTarPerm extractEntry library/fn/object/is-object.js | |
| 83317 silly gunzTarPerm modified mode [ 'library/fn/object/is-object.js', 438, 420 ] | |
| 83318 silly gunzTarPerm extractEntry test/toFixed.js | |
| 83319 silly gunzTarPerm modified mode [ 'test/toFixed.js', 438, 420 ] | |
| 83320 silly gunzTarPerm extractEntry library/fn/object/is-sealed.js | |
| 83321 silly gunzTarPerm modified mode [ 'library/fn/object/is-sealed.js', 438, 420 ] | |
| 83322 silly gunzTarPerm extractEntry library/fn/object/is.js | |
| 83323 silly gunzTarPerm modified mode [ 'library/fn/object/is.js', 438, 420 ] | |
| 83324 silly lockFile 4137b13d-les-defs-node-modules-esprima-fb tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\esprima-fb | |
| 83325 silly lockFile 4137b13d-les-defs-node-modules-esprima-fb tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\esprima-fb | |
| 83326 silly lockFile 6aca11a9-001-0-dev-harmony-fb-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\8001.1001.0-dev-harmony-fb\package.tgz | |
| 83327 silly lockFile 6aca11a9-001-0-dev-harmony-fb-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\8001.1001.0-dev-harmony-fb\package.tgz | |
| 83328 silly gunzTarPerm extractEntry library/fn/object/keys.js | |
| 83329 silly gunzTarPerm modified mode [ 'library/fn/object/keys.js', 438, 420 ] | |
| 83330 silly gunzTarPerm extractEntry library/fn/object/get-own-property-descriptor.js | |
| 83331 silly gunzTarPerm modified mode [ 'library/fn/object/get-own-property-descriptor.js', 438, 420 ] | |
| 83332 info preinstall esprima-fb@8001.1001.0-dev-harmony-fb | |
| 83333 verbose readDependencies using package.json deps | |
| 83334 verbose readDependencies using package.json deps | |
| 83335 silly resolved [] | |
| 83336 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\esprima-fb | |
| 83337 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs\node_modules\esprima-fb | |
| 83338 verbose linkStuff [ true, | |
| 83338 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 83338 verbose linkStuff false, | |
| 83338 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\defs\\node_modules' ] | |
| 83339 info linkStuff esprima-fb@8001.1001.0-dev-harmony-fb | |
| 83340 verbose linkBins esprima-fb@8001.1001.0-dev-harmony-fb | |
| 83341 verbose link bins [ { esparse: './bin/esparse.js', | |
| 83341 verbose link bins esvalidate: './bin/esvalidate.js' }, | |
| 83341 verbose link bins 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\defs\\node_modules\\.bin', | |
| 83341 verbose link bins false ] | |
| 83342 verbose linkMans esprima-fb@8001.1001.0-dev-harmony-fb | |
| 83343 verbose rebuildBundles esprima-fb@8001.1001.0-dev-harmony-fb | |
| 83344 silly gunzTarPerm extractEntry library/fn/object/make.js | |
| 83345 silly gunzTarPerm modified mode [ 'library/fn/object/make.js', 438, 420 ] | |
| 83346 silly gunzTarPerm extractEntry library/fn/object/freeze.js | |
| 83347 silly gunzTarPerm modified mode [ 'library/fn/object/freeze.js', 438, 420 ] | |
| 83348 silly gunzTarPerm extractEntry library/fn/object/prevent-extensions.js | |
| 83349 silly gunzTarPerm modified mode [ 'library/fn/object/prevent-extensions.js', 438, 420 ] | |
| 83350 silly gunzTarPerm extractEntry library/fn/object/entries.js | |
| 83351 silly gunzTarPerm modified mode [ 'library/fn/object/entries.js', 438, 420 ] | |
| 83352 info install esprima-fb@8001.1001.0-dev-harmony-fb | |
| 83353 info postinstall esprima-fb@8001.1001.0-dev-harmony-fb | |
| 83354 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs | |
| 83355 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\defs | |
| 83356 verbose linkStuff [ true, | |
| 83356 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 83356 verbose linkStuff false, | |
| 83356 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules' ] | |
| 83357 info linkStuff defs@1.1.0 | |
| 83358 verbose linkBins defs@1.1.0 | |
| 83359 verbose link bins [ { defs: './build/es5/defs' }, | |
| 83359 verbose link bins 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\.bin', | |
| 83359 verbose link bins false ] | |
| 83360 verbose linkMans defs@1.1.0 | |
| 83361 verbose rebuildBundles defs@1.1.0 | |
| 83362 verbose rebuildBundles [ '.bin', | |
| 83362 verbose rebuildBundles 'alter', | |
| 83362 verbose rebuildBundles 'ast-traverse', | |
| 83362 verbose rebuildBundles 'breakable', | |
| 83362 verbose rebuildBundles 'esprima-fb', | |
| 83362 verbose rebuildBundles 'simple-fmt', | |
| 83362 verbose rebuildBundles 'simple-is', | |
| 83362 verbose rebuildBundles 'stringmap', | |
| 83362 verbose rebuildBundles 'stringset', | |
| 83362 verbose rebuildBundles 'tryor', | |
| 83362 verbose rebuildBundles 'yargs' ] | |
| 83363 silly gunzTarPerm extractEntry library/fn/object/seal.js | |
| 83364 silly gunzTarPerm modified mode [ 'library/fn/object/seal.js', 438, 420 ] | |
| 83365 silly gunzTarPerm extractEntry library/fn/object/define.js | |
| 83366 silly gunzTarPerm modified mode [ 'library/fn/object/define.js', 438, 420 ] | |
| 83367 silly gunzTarPerm extractEntry library/fn/object/set-prototype-of.js | |
| 83368 silly gunzTarPerm modified mode [ 'library/fn/object/set-prototype-of.js', 438, 420 ] | |
| 83369 silly gunzTarPerm extractEntry library/fn/object/classof.js | |
| 83370 silly gunzTarPerm modified mode [ 'library/fn/object/classof.js', 438, 420 ] | |
| 83371 info install defs@1.1.0 | |
| 83372 info postinstall defs@1.1.0 | |
| 83373 silly gunzTarPerm extractEntry library/fn/object/values.js | |
| 83374 silly gunzTarPerm modified mode [ 'library/fn/object/values.js', 438, 420 ] | |
| 83375 silly gunzTarPerm extractEntry library/fn/object/is-extensible.js | |
| 83376 silly gunzTarPerm modified mode [ 'library/fn/object/is-extensible.js', 438, 420 ] | |
| 83377 silly gunzTarPerm extractEntry library/fn/array/concat.js | |
| 83378 silly gunzTarPerm modified mode [ 'library/fn/array/concat.js', 438, 420 ] | |
| 83379 silly gunzTarPerm extractEntry library/fn/array/index.js | |
| 83380 silly gunzTarPerm modified mode [ 'library/fn/array/index.js', 438, 420 ] | |
| 83381 silly gunzTarPerm extractEntry library/fn/array/join.js | |
| 83382 silly gunzTarPerm modified mode [ 'library/fn/array/join.js', 438, 420 ] | |
| 83383 silly gunzTarPerm extractEntry library/fn/array/keys.js | |
| 83384 silly gunzTarPerm modified mode [ 'library/fn/array/keys.js', 438, 420 ] | |
| 83385 silly gunzTarPerm extractEntry library/fn/array/index-of.js | |
| 83386 silly gunzTarPerm modified mode [ 'library/fn/array/index-of.js', 438, 420 ] | |
| 83387 silly gunzTarPerm extractEntry library/fn/array/map.js | |
| 83388 silly gunzTarPerm modified mode [ 'library/fn/array/map.js', 438, 420 ] | |
| 83389 silly gunzTarPerm extractEntry library/fn/array/of.js | |
| 83390 silly gunzTarPerm modified mode [ 'library/fn/array/of.js', 438, 420 ] | |
| 83391 silly gunzTarPerm extractEntry library/fn/array/pop.js | |
| 83392 silly gunzTarPerm modified mode [ 'library/fn/array/pop.js', 438, 420 ] | |
| 83393 silly gunzTarPerm extractEntry library/fn/array/push.js | |
| 83394 silly gunzTarPerm modified mode [ 'library/fn/array/push.js', 438, 420 ] | |
| 83395 silly gunzTarPerm extractEntry library/fn/array/reduce-right.js | |
| 83396 silly gunzTarPerm modified mode [ 'library/fn/array/reduce-right.js', 438, 420 ] | |
| 83397 silly gunzTarPerm extractEntry library/fn/array/includes.js | |
| 83398 silly gunzTarPerm modified mode [ 'library/fn/array/includes.js', 438, 420 ] | |
| 83399 silly gunzTarPerm extractEntry library/fn/array/reduce.js | |
| 83400 silly gunzTarPerm modified mode [ 'library/fn/array/reduce.js', 438, 420 ] | |
| 83401 silly gunzTarPerm extractEntry library/fn/array/from.js | |
| 83402 silly gunzTarPerm modified mode [ 'library/fn/array/from.js', 438, 420 ] | |
| 83403 silly gunzTarPerm extractEntry library/fn/array/reverse.js | |
| 83404 silly gunzTarPerm modified mode [ 'library/fn/array/reverse.js', 438, 420 ] | |
| 83405 silly gunzTarPerm extractEntry library/fn/array/for-each.js | |
| 83406 silly gunzTarPerm modified mode [ 'library/fn/array/for-each.js', 438, 420 ] | |
| 83407 silly gunzTarPerm extractEntry library/fn/array/shift.js | |
| 83408 silly gunzTarPerm modified mode [ 'library/fn/array/shift.js', 438, 420 ] | |
| 83409 silly gunzTarPerm extractEntry library/fn/array/find.js | |
| 83410 silly gunzTarPerm modified mode [ 'library/fn/array/find.js', 438, 420 ] | |
| 83411 silly gunzTarPerm extractEntry library/fn/array/slice.js | |
| 83412 silly gunzTarPerm modified mode [ 'library/fn/array/slice.js', 438, 420 ] | |
| 83413 silly gunzTarPerm extractEntry library/fn/array/find-index.js | |
| 83414 silly gunzTarPerm modified mode [ 'library/fn/array/find-index.js', 438, 420 ] | |
| 83415 silly gunzTarPerm extractEntry library/fn/array/some.js | |
| 83416 silly gunzTarPerm modified mode [ 'library/fn/array/some.js', 438, 420 ] | |
| 83417 silly gunzTarPerm extractEntry library/fn/array/filter.js | |
| 83418 silly gunzTarPerm modified mode [ 'library/fn/array/filter.js', 438, 420 ] | |
| 83419 silly lockFile 574836ad-s-recast-node-modules-esprima-fb tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\recast\node_modules\esprima-fb | |
| 83420 silly lockFile 574836ad-s-recast-node-modules-esprima-fb tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\recast\node_modules\esprima-fb | |
| 83421 silly gunzTarPerm extractEntry library/fn/array/sort.js | |
| 83422 silly gunzTarPerm modified mode [ 'library/fn/array/sort.js', 438, 420 ] | |
| 83423 silly gunzTarPerm extractEntry library/fn/array/fill.js | |
| 83424 silly gunzTarPerm modified mode [ 'library/fn/array/fill.js', 438, 420 ] | |
| 83425 silly lockFile 28ea949c-1-1-0-dev-harmony-fb-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\14001.1.0-dev-harmony-fb\package.tgz | |
| 83426 silly lockFile 28ea949c-1-1-0-dev-harmony-fb-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\14001.1.0-dev-harmony-fb\package.tgz | |
| 83427 silly gunzTarPerm extractEntry library/fn/array/splice.js | |
| 83428 silly gunzTarPerm modified mode [ 'library/fn/array/splice.js', 438, 420 ] | |
| 83429 silly gunzTarPerm extractEntry library/fn/array/every.js | |
| 83430 silly gunzTarPerm modified mode [ 'library/fn/array/every.js', 438, 420 ] | |
| 83431 info preinstall esprima-fb@14001.1.0-dev-harmony-fb | |
| 83432 verbose readDependencies using package.json deps | |
| 83433 verbose readDependencies using package.json deps | |
| 83434 silly resolved [] | |
| 83435 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\recast\node_modules\esprima-fb | |
| 83436 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\recast\node_modules\esprima-fb | |
| 83437 verbose linkStuff [ true, | |
| 83437 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 83437 verbose linkStuff false, | |
| 83437 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\recast\\node_modules' ] | |
| 83438 info linkStuff esprima-fb@14001.1.0-dev-harmony-fb | |
| 83439 verbose linkBins esprima-fb@14001.1.0-dev-harmony-fb | |
| 83440 verbose link bins [ { esparse: './bin/esparse.js', | |
| 83440 verbose link bins esvalidate: './bin/esvalidate.js' }, | |
| 83440 verbose link bins 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\recast\\node_modules\\.bin', | |
| 83440 verbose link bins false ] | |
| 83441 verbose linkMans esprima-fb@14001.1.0-dev-harmony-fb | |
| 83442 verbose rebuildBundles esprima-fb@14001.1.0-dev-harmony-fb | |
| 83443 silly gunzTarPerm extractEntry library/fn/array/turn.js | |
| 83444 silly gunzTarPerm modified mode [ 'library/fn/array/turn.js', 438, 420 ] | |
| 83445 silly gunzTarPerm extractEntry library/fn/array/entries.js | |
| 83446 silly gunzTarPerm modified mode [ 'library/fn/array/entries.js', 438, 420 ] | |
| 83447 silly gunzTarPerm extractEntry library/fn/array/unshift.js | |
| 83448 silly gunzTarPerm modified mode [ 'library/fn/array/unshift.js', 438, 420 ] | |
| 83449 silly gunzTarPerm extractEntry library/fn/array/copy-within.js | |
| 83450 silly gunzTarPerm modified mode [ 'library/fn/array/copy-within.js', 438, 420 ] | |
| 83451 info install esprima-fb@14001.1.0-dev-harmony-fb | |
| 83452 info postinstall esprima-fb@14001.1.0-dev-harmony-fb | |
| 83453 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\recast | |
| 83454 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\recast | |
| 83455 verbose linkStuff [ true, | |
| 83455 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 83455 verbose linkStuff false, | |
| 83455 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules' ] | |
| 83456 info linkStuff recast@0.10.12 | |
| 83457 verbose linkBins recast@0.10.12 | |
| 83458 verbose linkMans recast@0.10.12 | |
| 83459 verbose rebuildBundles recast@0.10.12 | |
| 83460 verbose rebuildBundles [ '.bin', 'esprima-fb' ] | |
| 83461 info install recast@0.10.12 | |
| 83462 silly gunzTarPerm extractEntry library/fn/array/values.js | |
| 83463 silly gunzTarPerm modified mode [ 'library/fn/array/values.js', 438, 420 ] | |
| 83464 silly gunzTarPerm extractEntry library/fn/array/last-index-of.js | |
| 83465 silly gunzTarPerm modified mode [ 'library/fn/array/last-index-of.js', 438, 420 ] | |
| 83466 info postinstall recast@0.10.12 | |
| 83467 silly gunzTarPerm extractEntry library/fn/math/acosh.js | |
| 83468 silly gunzTarPerm modified mode [ 'library/fn/math/acosh.js', 438, 420 ] | |
| 83469 silly gunzTarPerm extractEntry library/fn/math/cosh.js | |
| 83470 silly gunzTarPerm modified mode [ 'library/fn/math/cosh.js', 438, 420 ] | |
| 83471 silly gunzTarPerm extractEntry library/fn/math/expm1.js | |
| 83472 silly gunzTarPerm modified mode [ 'library/fn/math/expm1.js', 438, 420 ] | |
| 83473 silly gunzTarPerm extractEntry library/fn/math/fround.js | |
| 83474 silly gunzTarPerm modified mode [ 'library/fn/math/fround.js', 438, 420 ] | |
| 83475 silly gunzTarPerm extractEntry library/fn/math/hypot.js | |
| 83476 silly gunzTarPerm modified mode [ 'library/fn/math/hypot.js', 438, 420 ] | |
| 83477 silly gunzTarPerm extractEntry library/fn/math/clz32.js | |
| 83478 silly gunzTarPerm modified mode [ 'library/fn/math/clz32.js', 438, 420 ] | |
| 83479 silly gunzTarPerm extractEntry test/plus.js | |
| 83480 silly gunzTarPerm modified mode [ 'test/plus.js', 438, 420 ] | |
| 83481 silly gunzTarPerm extractEntry library/fn/math/index.js | |
| 83482 silly gunzTarPerm modified mode [ 'library/fn/math/index.js', 438, 420 ] | |
| 83483 silly gunzTarPerm extractEntry library/fn/math/log10.js | |
| 83484 silly gunzTarPerm modified mode [ 'library/fn/math/log10.js', 438, 420 ] | |
| 83485 silly gunzTarPerm extractEntry library/fn/math/log1p.js | |
| 83486 silly gunzTarPerm modified mode [ 'library/fn/math/log1p.js', 438, 420 ] | |
| 83487 silly gunzTarPerm extractEntry library/fn/math/log2.js | |
| 83488 silly gunzTarPerm modified mode [ 'library/fn/math/log2.js', 438, 420 ] | |
| 83489 silly gunzTarPerm extractEntry library/fn/math/sign.js | |
| 83490 silly gunzTarPerm modified mode [ 'library/fn/math/sign.js', 438, 420 ] | |
| 83491 silly gunzTarPerm extractEntry library/fn/math/cbrt.js | |
| 83492 silly gunzTarPerm modified mode [ 'library/fn/math/cbrt.js', 438, 420 ] | |
| 83493 silly gunzTarPerm extractEntry library/fn/math/sinh.js | |
| 83494 silly gunzTarPerm modified mode [ 'library/fn/math/sinh.js', 438, 420 ] | |
| 83495 silly gunzTarPerm extractEntry library/fn/math/atanh.js | |
| 83496 silly gunzTarPerm modified mode [ 'library/fn/math/atanh.js', 438, 420 ] | |
| 83497 silly gunzTarPerm extractEntry library/fn/math/tanh.js | |
| 83498 silly gunzTarPerm modified mode [ 'library/fn/math/tanh.js', 438, 420 ] | |
| 83499 silly gunzTarPerm extractEntry library/fn/math/asinh.js | |
| 83500 silly gunzTarPerm modified mode [ 'library/fn/math/asinh.js', 438, 420 ] | |
| 83501 silly gunzTarPerm extractEntry library/fn/math/trunc.js | |
| 83502 silly gunzTarPerm modified mode [ 'library/fn/math/trunc.js', 438, 420 ] | |
| 83503 silly gunzTarPerm extractEntry library/fn/math/imul.js | |
| 83504 silly gunzTarPerm modified mode [ 'library/fn/math/imul.js', 438, 420 ] | |
| 83505 silly gunzTarPerm extractEntry library/fn/string/at.js | |
| 83506 silly gunzTarPerm modified mode [ 'library/fn/string/at.js', 438, 420 ] | |
| 83507 silly gunzTarPerm extractEntry library/fn/string/ends-with.js | |
| 83508 silly gunzTarPerm modified mode [ 'library/fn/string/ends-with.js', 438, 420 ] | |
| 83509 silly gunzTarPerm extractEntry library/fn/string/escape-html.js | |
| 83510 silly gunzTarPerm modified mode [ 'library/fn/string/escape-html.js', 438, 420 ] | |
| 83511 silly gunzTarPerm extractEntry library/fn/string/from-code-point.js | |
| 83512 silly gunzTarPerm modified mode [ 'library/fn/string/from-code-point.js', 438, 420 ] | |
| 83513 silly gunzTarPerm extractEntry library/fn/string/code-point-at.js | |
| 83514 silly gunzTarPerm modified mode [ 'library/fn/string/code-point-at.js', 438, 420 ] | |
| 83515 silly gunzTarPerm extractEntry library/fn/string/index.js | |
| 83516 silly gunzTarPerm modified mode [ 'library/fn/string/index.js', 438, 420 ] | |
| 83517 silly gunzTarPerm extractEntry library/fn/string/raw.js | |
| 83518 silly gunzTarPerm modified mode [ 'library/fn/string/raw.js', 438, 420 ] | |
| 83519 silly gunzTarPerm extractEntry library/fn/string/repeat.js | |
| 83520 silly gunzTarPerm modified mode [ 'library/fn/string/repeat.js', 438, 420 ] | |
| 83521 silly gunzTarPerm extractEntry library/fn/string/starts-with.js | |
| 83522 silly gunzTarPerm modified mode [ 'library/fn/string/starts-with.js', 438, 420 ] | |
| 83523 silly gunzTarPerm extractEntry library/fn/string/unescape-html.js | |
| 83524 silly gunzTarPerm modified mode [ 'library/fn/string/unescape-html.js', 438, 420 ] | |
| 83525 silly gunzTarPerm extractEntry library/fn/string/includes.js | |
| 83526 silly gunzTarPerm modified mode [ 'library/fn/string/includes.js', 438, 420 ] | |
| 83527 silly gunzTarPerm extractEntry library/fn/symbol/for.js | |
| 83528 silly gunzTarPerm modified mode [ 'library/fn/symbol/for.js', 438, 420 ] | |
| 83529 silly gunzTarPerm extractEntry library/fn/symbol/is-concat-spreadable.js | |
| 83530 silly gunzTarPerm modified mode [ 'library/fn/symbol/is-concat-spreadable.js', 438, 420 ] | |
| 83531 silly gunzTarPerm extractEntry library/fn/symbol/iterator.js | |
| 83532 silly gunzTarPerm modified mode [ 'library/fn/symbol/iterator.js', 438, 420 ] | |
| 83533 silly gunzTarPerm extractEntry library/fn/symbol/key-for.js | |
| 83534 silly gunzTarPerm modified mode [ 'library/fn/symbol/key-for.js', 438, 420 ] | |
| 83535 silly gunzTarPerm extractEntry library/fn/symbol/match.js | |
| 83536 silly gunzTarPerm modified mode [ 'library/fn/symbol/match.js', 438, 420 ] | |
| 83537 silly gunzTarPerm extractEntry library/fn/symbol/index.js | |
| 83538 silly gunzTarPerm modified mode [ 'library/fn/symbol/index.js', 438, 420 ] | |
| 83539 silly gunzTarPerm extractEntry library/fn/symbol/search.js | |
| 83540 silly gunzTarPerm modified mode [ 'library/fn/symbol/search.js', 438, 420 ] | |
| 83541 silly gunzTarPerm extractEntry library/fn/symbol/species.js | |
| 83542 silly gunzTarPerm modified mode [ 'library/fn/symbol/species.js', 438, 420 ] | |
| 83543 silly gunzTarPerm extractEntry library/fn/symbol/split.js | |
| 83544 silly gunzTarPerm modified mode [ 'library/fn/symbol/split.js', 438, 420 ] | |
| 83545 silly gunzTarPerm extractEntry library/fn/symbol/to-primitive.js | |
| 83546 silly gunzTarPerm modified mode [ 'library/fn/symbol/to-primitive.js', 438, 420 ] | |
| 83547 silly gunzTarPerm extractEntry library/fn/symbol/to-string-tag.js | |
| 83548 silly gunzTarPerm modified mode [ 'library/fn/symbol/to-string-tag.js', 438, 420 ] | |
| 83549 silly gunzTarPerm extractEntry library/fn/symbol/has-instance.js | |
| 83550 silly gunzTarPerm modified mode [ 'library/fn/symbol/has-instance.js', 438, 420 ] | |
| 83551 silly gunzTarPerm extractEntry library/fn/symbol/unscopables.js | |
| 83552 silly gunzTarPerm modified mode [ 'library/fn/symbol/unscopables.js', 438, 420 ] | |
| 83553 silly gunzTarPerm extractEntry library/fn/symbol/replace.js | |
| 83554 silly gunzTarPerm modified mode [ 'library/fn/symbol/replace.js', 438, 420 ] | |
| 83555 silly gunzTarPerm extractEntry library/fn/function/index.js | |
| 83556 silly gunzTarPerm modified mode [ 'library/fn/function/index.js', 438, 420 ] | |
| 83557 silly gunzTarPerm extractEntry library/fn/function/only.js | |
| 83558 silly gunzTarPerm modified mode [ 'library/fn/function/only.js', 438, 420 ] | |
| 83559 silly gunzTarPerm extractEntry library/fn/function/part.js | |
| 83560 silly gunzTarPerm modified mode [ 'library/fn/function/part.js', 438, 420 ] | |
| 83561 silly gunzTarPerm extractEntry library/fn/date/add-locale.js | |
| 83562 silly gunzTarPerm modified mode [ 'library/fn/date/add-locale.js', 438, 420 ] | |
| 83563 silly gunzTarPerm extractEntry library/fn/date/format-utc.js | |
| 83564 silly gunzTarPerm modified mode [ 'library/fn/date/format-utc.js', 438, 420 ] | |
| 83565 silly gunzTarPerm extractEntry library/fn/date/format.js | |
| 83566 silly gunzTarPerm modified mode [ 'library/fn/date/format.js', 438, 420 ] | |
| 83567 silly gunzTarPerm extractEntry library/fn/date/index.js | |
| 83568 silly gunzTarPerm modified mode [ 'library/fn/date/index.js', 438, 420 ] | |
| 83569 silly gunzTarPerm extractEntry library/fn/number/epsilon.js | |
| 83570 silly gunzTarPerm modified mode [ 'library/fn/number/epsilon.js', 438, 420 ] | |
| 83571 silly gunzTarPerm extractEntry library/fn/number/is-finite.js | |
| 83572 silly gunzTarPerm modified mode [ 'library/fn/number/is-finite.js', 438, 420 ] | |
| 83573 silly gunzTarPerm extractEntry test/toString.js | |
| 83574 silly gunzTarPerm modified mode [ 'test/toString.js', 438, 420 ] | |
| 83575 silly gunzTarPerm extractEntry library/fn/number/is-integer.js | |
| 83576 silly gunzTarPerm modified mode [ 'library/fn/number/is-integer.js', 438, 420 ] | |
| 83577 silly gunzTarPerm extractEntry library/fn/number/is-nan.js | |
| 83578 silly gunzTarPerm modified mode [ 'library/fn/number/is-nan.js', 438, 420 ] | |
| 83579 silly gunzTarPerm extractEntry library/fn/number/index.js | |
| 83580 silly gunzTarPerm modified mode [ 'library/fn/number/index.js', 438, 420 ] | |
| 83581 silly gunzTarPerm extractEntry library/fn/number/max-safe-integer.js | |
| 83582 silly gunzTarPerm modified mode [ 'library/fn/number/max-safe-integer.js', 438, 420 ] | |
| 83583 silly gunzTarPerm extractEntry library/fn/number/min-safe-integer.js | |
| 83584 silly gunzTarPerm modified mode [ 'library/fn/number/min-safe-integer.js', 438, 420 ] | |
| 83585 silly gunzTarPerm extractEntry library/fn/number/parse-float.js | |
| 83586 silly gunzTarPerm modified mode [ 'library/fn/number/parse-float.js', 438, 420 ] | |
| 83587 silly gunzTarPerm extractEntry library/fn/number/parse-int.js | |
| 83588 silly gunzTarPerm modified mode [ 'library/fn/number/parse-int.js', 438, 420 ] | |
| 83589 silly gunzTarPerm extractEntry library/fn/number/random.js | |
| 83590 silly gunzTarPerm modified mode [ 'library/fn/number/random.js', 438, 420 ] | |
| 83591 silly gunzTarPerm extractEntry library/fn/number/is-safe-integer.js | |
| 83592 silly gunzTarPerm modified mode [ 'library/fn/number/is-safe-integer.js', 438, 420 ] | |
| 83593 silly gunzTarPerm extractEntry library/js/array.js | |
| 83594 silly gunzTarPerm modified mode [ 'library/js/array.js', 438, 420 ] | |
| 83595 silly gunzTarPerm extractEntry library/js/index.js | |
| 83596 silly gunzTarPerm modified mode [ 'library/js/index.js', 438, 420 ] | |
| 83597 silly gunzTarPerm extractEntry library/modules/$.array-includes.js | |
| 83598 silly gunzTarPerm modified mode [ 'library/modules/$.array-includes.js', 438, 420 ] | |
| 83599 silly gunzTarPerm extractEntry library/modules/core.string.escape-html.js | |
| 83600 silly gunzTarPerm modified mode [ 'library/modules/core.string.escape-html.js', 438, 420 ] | |
| 83601 silly gunzTarPerm extractEntry library/modules/es5.js | |
| 83602 silly gunzTarPerm modified mode [ 'library/modules/es5.js', 438, 420 ] | |
| 83603 silly gunzTarPerm extractEntry library/modules/es6.array.copy-within.js | |
| 83604 silly gunzTarPerm modified mode [ 'library/modules/es6.array.copy-within.js', 438, 420 ] | |
| 83605 silly gunzTarPerm extractEntry library/modules/core.object.js | |
| 83606 silly gunzTarPerm modified mode [ 'library/modules/core.object.js', 438, 420 ] | |
| 83607 silly gunzTarPerm extractEntry library/modules/$.array-methods.js | |
| 83608 silly gunzTarPerm modified mode [ 'library/modules/$.array-methods.js', 438, 420 ] | |
| 83609 silly gunzTarPerm extractEntry library/modules/es6.array.find.js | |
| 83610 silly gunzTarPerm modified mode [ 'library/modules/es6.array.find.js', 438, 420 ] | |
| 83611 silly gunzTarPerm extractEntry library/modules/es6.array.from.js | |
| 83612 silly gunzTarPerm modified mode [ 'library/modules/es6.array.from.js', 438, 420 ] | |
| 83613 silly gunzTarPerm extractEntry library/modules/es6.array.iterator.js | |
| 83614 silly gunzTarPerm modified mode [ 'library/modules/es6.array.iterator.js', 438, 420 ] | |
| 83615 silly gunzTarPerm extractEntry library/modules/es6.array.of.js | |
| 83616 silly gunzTarPerm modified mode [ 'library/modules/es6.array.of.js', 438, 420 ] | |
| 83617 silly gunzTarPerm extractEntry library/modules/core.number.math.js | |
| 83618 silly gunzTarPerm modified mode [ 'library/modules/core.number.math.js', 438, 420 ] | |
| 83619 silly gunzTarPerm extractEntry library/modules/es6.array.species.js | |
| 83620 silly gunzTarPerm modified mode [ 'library/modules/es6.array.species.js', 438, 420 ] | |
| 83621 silly gunzTarPerm extractEntry library/modules/core.number.iterator.js | |
| 83622 silly gunzTarPerm modified mode [ 'library/modules/core.number.iterator.js', 438, 420 ] | |
| 83623 silly gunzTarPerm extractEntry library/modules/es6.function.name.js | |
| 83624 silly gunzTarPerm modified mode [ 'library/modules/es6.function.name.js', 438, 420 ] | |
| 83625 silly gunzTarPerm extractEntry library/modules/core.log.js | |
| 83626 silly gunzTarPerm modified mode [ 'library/modules/core.log.js', 438, 420 ] | |
| 83627 silly gunzTarPerm extractEntry library/modules/es6.map.js | |
| 83628 silly gunzTarPerm modified mode [ 'library/modules/es6.map.js', 438, 420 ] | |
| 83629 silly gunzTarPerm extractEntry library/modules/core.iter-helpers.js | |
| 83630 silly gunzTarPerm modified mode [ 'library/modules/core.iter-helpers.js', 438, 420 ] | |
| 83631 silly gunzTarPerm extractEntry library/modules/es6.math.js | |
| 83632 silly gunzTarPerm modified mode [ 'library/modules/es6.math.js', 438, 420 ] | |
| 83633 silly gunzTarPerm extractEntry library/modules/core.global.js | |
| 83634 silly gunzTarPerm modified mode [ 'library/modules/core.global.js', 438, 420 ] | |
| 83635 silly gunzTarPerm extractEntry library/modules/es6.number.constructor.js | |
| 83636 silly gunzTarPerm modified mode [ 'library/modules/es6.number.constructor.js', 438, 420 ] | |
| 83637 silly gunzTarPerm extractEntry library/modules/core.dict.js | |
| 83638 silly gunzTarPerm modified mode [ 'library/modules/core.dict.js', 438, 420 ] | |
| 83639 silly gunzTarPerm extractEntry library/modules/es6.number.statics.js | |
| 83640 silly gunzTarPerm modified mode [ 'library/modules/es6.number.statics.js', 438, 420 ] | |
| 83641 silly gunzTarPerm extractEntry library/modules/core.delay.js | |
| 83642 silly gunzTarPerm modified mode [ 'library/modules/core.delay.js', 438, 420 ] | |
| 83643 silly gunzTarPerm extractEntry library/modules/es6.object.assign.js | |
| 83644 silly gunzTarPerm modified mode [ 'library/modules/es6.object.assign.js', 438, 420 ] | |
| 83645 silly gunzTarPerm extractEntry library/modules/core.date.js | |
| 83646 silly gunzTarPerm modified mode [ 'library/modules/core.date.js', 438, 420 ] | |
| 83647 silly gunzTarPerm extractEntry library/modules/es6.object.is.js | |
| 83648 silly gunzTarPerm modified mode [ 'library/modules/es6.object.is.js', 438, 420 ] | |
| 83649 silly gunzTarPerm extractEntry library/modules/core.binding.js | |
| 83650 silly gunzTarPerm modified mode [ 'library/modules/core.binding.js', 438, 420 ] | |
| 83651 silly gunzTarPerm extractEntry library/modules/es6.object.set-prototype-of.js | |
| 83652 silly gunzTarPerm modified mode [ 'library/modules/es6.object.set-prototype-of.js', 438, 420 ] | |
| 83653 silly gunzTarPerm extractEntry library/modules/core.array.turn.js | |
| 83654 silly gunzTarPerm modified mode [ 'library/modules/core.array.turn.js', 438, 420 ] | |
| 83655 silly gunzTarPerm extractEntry library/modules/es6.object.statics-accept-primitives.js | |
| 83656 silly gunzTarPerm modified mode [ 'library/modules/es6.object.statics-accept-primitives.js', | |
| 83656 silly gunzTarPerm 438, | |
| 83656 silly gunzTarPerm 420 ] | |
| 83657 silly gunzTarPerm extractEntry library/modules/core.$for.js | |
| 83658 silly gunzTarPerm modified mode [ 'library/modules/core.$for.js', 438, 420 ] | |
| 83659 silly gunzTarPerm extractEntry library/modules/es6.object.to-string.js | |
| 83660 silly gunzTarPerm modified mode [ 'library/modules/es6.object.to-string.js', 438, 420 ] | |
| 83661 silly gunzTarPerm extractEntry library/modules/$.wks.js | |
| 83662 silly gunzTarPerm modified mode [ 'library/modules/$.wks.js', 438, 420 ] | |
| 83663 silly gunzTarPerm extractEntry library/modules/es6.promise.js | |
| 83664 silly gunzTarPerm modified mode [ 'library/modules/es6.promise.js', 438, 420 ] | |
| 83665 silly gunzTarPerm extractEntry library/modules/$.unscope.js | |
| 83666 silly gunzTarPerm modified mode [ 'library/modules/$.unscope.js', 438, 420 ] | |
| 83667 silly gunzTarPerm extractEntry library/modules/es6.reflect.js | |
| 83668 silly gunzTarPerm modified mode [ 'library/modules/es6.reflect.js', 438, 420 ] | |
| 83669 silly gunzTarPerm extractEntry library/modules/$.uid.js | |
| 83670 silly gunzTarPerm modified mode [ 'library/modules/$.uid.js', 438, 420 ] | |
| 83671 silly gunzTarPerm extractEntry library/modules/es6.regexp.js | |
| 83672 silly gunzTarPerm modified mode [ 'library/modules/es6.regexp.js', 438, 420 ] | |
| 83673 silly gunzTarPerm extractEntry library/modules/$.task.js | |
| 83674 silly gunzTarPerm modified mode [ 'library/modules/$.task.js', 438, 420 ] | |
| 83675 silly gunzTarPerm extractEntry library/modules/es6.set.js | |
| 83676 silly gunzTarPerm modified mode [ 'library/modules/es6.set.js', 438, 420 ] | |
| 83677 silly gunzTarPerm extractEntry library/modules/$.string-at.js | |
| 83678 silly gunzTarPerm modified mode [ 'library/modules/$.string-at.js', 438, 420 ] | |
| 83679 silly gunzTarPerm extractEntry library/modules/es6.string.code-point-at.js | |
| 83680 silly gunzTarPerm modified mode [ 'library/modules/es6.string.code-point-at.js', 438, 420 ] | |
| 83681 silly gunzTarPerm extractEntry library/modules/$.species.js | |
| 83682 silly gunzTarPerm modified mode [ 'library/modules/$.species.js', 438, 420 ] | |
| 83683 silly gunzTarPerm extractEntry library/modules/es6.string.ends-with.js | |
| 83684 silly gunzTarPerm modified mode [ 'library/modules/es6.string.ends-with.js', 438, 420 ] | |
| 83685 silly gunzTarPerm extractEntry library/modules/$.set-proto.js | |
| 83686 silly gunzTarPerm modified mode [ 'library/modules/$.set-proto.js', 438, 420 ] | |
| 83687 silly lockFile 1358337e-086913-0-132875056238845-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557086913-0.132875056238845\package | |
| 83688 silly lockFile 1358337e-086913-0-132875056238845-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557086913-0.132875056238845\package | |
| 83689 silly lockFile e5ab5e09-1-1-0-dev-harmony-fb-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package.tgz | |
| 83690 silly lockFile e5ab5e09-1-1-0-dev-harmony-fb-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package.tgz | |
| 83691 silly gunzTarPerm extractEntry library/modules/es6.string.from-code-point.js | |
| 83692 silly gunzTarPerm modified mode [ 'library/modules/es6.string.from-code-point.js', 438, 420 ] | |
| 83693 silly gunzTarPerm extractEntry library/modules/$.replacer.js | |
| 83694 silly gunzTarPerm modified mode [ 'library/modules/$.replacer.js', 438, 420 ] | |
| 83695 silly lockFile 0fa0c675-10001-1-0-dev-harmony-fb-package C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package | |
| 83696 verbose lock C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package C:\Users\Vince\AppData\Roaming\npm-cache\0fa0c675-10001-1-0-dev-harmony-fb-package.lock | |
| 83697 silly gunzTarPerm extractEntry library/modules/es6.string.includes.js | |
| 83698 silly gunzTarPerm modified mode [ 'library/modules/es6.string.includes.js', 438, 420 ] | |
| 83699 silly gunzTarPerm extractEntry library/modules/$.partial.js | |
| 83700 silly gunzTarPerm modified mode [ 'library/modules/$.partial.js', 438, 420 ] | |
| 83701 silly lockFile 0fa0c675-10001-1-0-dev-harmony-fb-package C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package | |
| 83702 silly lockFile 0fa0c675-10001-1-0-dev-harmony-fb-package C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package | |
| 83703 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package.tgz | |
| 83704 silly lockFile 8a8d4360-10001-1-0-dev-harmony-fb-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package | |
| 83705 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package C:\Users\Vince\AppData\Roaming\npm-cache\8a8d4360-10001-1-0-dev-harmony-fb-package.lock | |
| 83706 silly lockFile e5ab5e09-1-1-0-dev-harmony-fb-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package.tgz | |
| 83707 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\e5ab5e09-1-1-0-dev-harmony-fb-package-tgz.lock | |
| 83708 silly gunzTarPerm modes [ '755', '644' ] | |
| 83709 silly gunzTarPerm extractEntry library/modules/es6.string.iterator.js | |
| 83710 silly gunzTarPerm modified mode [ 'library/modules/es6.string.iterator.js', 438, 420 ] | |
| 83711 silly gunzTarPerm extractEntry library/modules/$.own-keys.js | |
| 83712 silly gunzTarPerm modified mode [ 'library/modules/$.own-keys.js', 438, 420 ] | |
| 83713 silly gunzTarPerm extractEntry package.json | |
| 83714 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 83715 silly gunzTarPerm extractEntry library/modules/es6.string.raw.js | |
| 83716 silly gunzTarPerm modified mode [ 'library/modules/es6.string.raw.js', 438, 420 ] | |
| 83717 silly gunzTarPerm extractEntry library/modules/$.keyof.js | |
| 83718 silly gunzTarPerm modified mode [ 'library/modules/$.keyof.js', 438, 420 ] | |
| 83719 silly gunzTarPerm extractEntry README.md | |
| 83720 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 83721 silly gunzTarPerm extractEntry esprima.js | |
| 83722 silly gunzTarPerm modified mode [ 'esprima.js', 438, 420 ] | |
| 83723 silly gunzTarPerm extractEntry library/modules/es6.string.repeat.js | |
| 83724 silly gunzTarPerm modified mode [ 'library/modules/es6.string.repeat.js', 438, 420 ] | |
| 83725 silly gunzTarPerm extractEntry library/modules/$.js | |
| 83726 silly gunzTarPerm modified mode [ 'library/modules/$.js', 438, 420 ] | |
| 83727 silly gunzTarPerm extractEntry bin/esparse.js | |
| 83728 silly gunzTarPerm modified mode [ 'bin/esparse.js', 438, 420 ] | |
| 83729 silly gunzTarPerm extractEntry library/modules/es6.string.starts-with.js | |
| 83730 silly gunzTarPerm modified mode [ 'library/modules/es6.string.starts-with.js', 438, 420 ] | |
| 83731 silly gunzTarPerm extractEntry library/modules/$.iter.js | |
| 83732 silly gunzTarPerm modified mode [ 'library/modules/$.iter.js', 438, 420 ] | |
| 83733 silly gunzTarPerm extractEntry bin/esvalidate.js | |
| 83734 silly gunzTarPerm modified mode [ 'bin/esvalidate.js', 438, 420 ] | |
| 83735 silly gunzTarPerm extractEntry test/compat.js | |
| 83736 silly gunzTarPerm modified mode [ 'test/compat.js', 438, 420 ] | |
| 83737 silly gunzTarPerm extractEntry library/modules/es6.symbol.js | |
| 83738 silly gunzTarPerm modified mode [ 'library/modules/es6.symbol.js', 438, 420 ] | |
| 83739 silly gunzTarPerm extractEntry library/modules/$.iter-detect.js | |
| 83740 silly gunzTarPerm modified mode [ 'library/modules/$.iter-detect.js', 438, 420 ] | |
| 83741 silly gunzTarPerm extractEntry library/modules/es6.weak-map.js | |
| 83742 silly gunzTarPerm modified mode [ 'library/modules/es6.weak-map.js', 438, 420 ] | |
| 83743 silly gunzTarPerm extractEntry library/modules/$.invoke.js | |
| 83744 silly gunzTarPerm modified mode [ 'library/modules/$.invoke.js', 438, 420 ] | |
| 83745 silly gunzTarPerm extractEntry library/modules/es6.weak-set.js | |
| 83746 silly gunzTarPerm modified mode [ 'library/modules/es6.weak-set.js', 438, 420 ] | |
| 83747 silly gunzTarPerm extractEntry library/modules/$.fw.js | |
| 83748 silly gunzTarPerm modified mode [ 'library/modules/$.fw.js', 438, 420 ] | |
| 83749 silly gunzTarPerm extractEntry library/modules/es7.array.includes.js | |
| 83750 silly gunzTarPerm modified mode [ 'library/modules/es7.array.includes.js', 438, 420 ] | |
| 83751 silly gunzTarPerm extractEntry library/modules/$.def.js | |
| 83752 silly gunzTarPerm modified mode [ 'library/modules/$.def.js', 438, 420 ] | |
| 83753 silly gunzTarPerm extractEntry library/modules/es7.object.get-own-property-descriptors.js | |
| 83754 silly gunzTarPerm modified mode [ 'library/modules/es7.object.get-own-property-descriptors.js', | |
| 83754 silly gunzTarPerm 438, | |
| 83754 silly gunzTarPerm 420 ] | |
| 83755 silly gunzTarPerm extractEntry library/modules/$.ctx.js | |
| 83756 silly gunzTarPerm modified mode [ 'library/modules/$.ctx.js', 438, 420 ] | |
| 83757 silly gunzTarPerm extractEntry library/modules/es7.object.to-array.js | |
| 83758 silly gunzTarPerm modified mode [ 'library/modules/es7.object.to-array.js', 438, 420 ] | |
| 83759 silly gunzTarPerm extractEntry library/modules/$.collection.js | |
| 83760 silly gunzTarPerm modified mode [ 'library/modules/$.collection.js', 438, 420 ] | |
| 83761 silly gunzTarPerm extractEntry library/modules/es7.regexp.escape.js | |
| 83762 silly gunzTarPerm modified mode [ 'library/modules/es7.regexp.escape.js', 438, 420 ] | |
| 83763 silly gunzTarPerm extractEntry library/modules/$.collection-weak.js | |
| 83764 silly gunzTarPerm modified mode [ 'library/modules/$.collection-weak.js', 438, 420 ] | |
| 83765 silly gunzTarPerm extractEntry library/modules/es7.set.to-json.js | |
| 83766 silly gunzTarPerm modified mode [ 'library/modules/es7.set.to-json.js', 438, 420 ] | |
| 83767 silly gunzTarPerm extractEntry library/modules/$.collection-strong.js | |
| 83768 silly gunzTarPerm modified mode [ 'library/modules/$.collection-strong.js', 438, 420 ] | |
| 83769 silly gunzTarPerm extractEntry library/modules/es7.string.at.js | |
| 83770 silly gunzTarPerm modified mode [ 'library/modules/es7.string.at.js', 438, 420 ] | |
| 83771 silly gunzTarPerm extractEntry library/modules/$.cof.js | |
| 83772 silly gunzTarPerm modified mode [ 'library/modules/$.cof.js', 438, 420 ] | |
| 83773 silly gunzTarPerm extractEntry library/modules/js.array.statics.js | |
| 83774 silly gunzTarPerm modified mode [ 'library/modules/js.array.statics.js', 438, 420 ] | |
| 83775 silly gunzTarPerm extractEntry library/modules/$.assign.js | |
| 83776 silly gunzTarPerm modified mode [ 'library/modules/$.assign.js', 438, 420 ] | |
| 83777 silly gunzTarPerm extractEntry library/modules/web.immediate.js | |
| 83778 silly gunzTarPerm modified mode [ 'library/modules/web.immediate.js', 438, 420 ] | |
| 83779 silly gunzTarPerm extractEntry library/modules/$.assert.js | |
| 83780 silly gunzTarPerm modified mode [ 'library/modules/$.assert.js', 438, 420 ] | |
| 83781 silly gunzTarPerm extractEntry library/modules/web.dom.iterable.js | |
| 83782 silly gunzTarPerm modified mode [ 'library/modules/web.dom.iterable.js', 438, 420 ] | |
| 83783 silly gunzTarPerm extractEntry library/modules/es6.array.fill.js | |
| 83784 silly gunzTarPerm modified mode [ 'library/modules/es6.array.fill.js', 438, 420 ] | |
| 83785 silly gunzTarPerm extractEntry library/modules/web.timers.js | |
| 83786 silly gunzTarPerm modified mode [ 'library/modules/web.timers.js', 438, 420 ] | |
| 83787 silly gunzTarPerm extractEntry library/modules/es6.array.find-index.js | |
| 83788 silly gunzTarPerm modified mode [ 'library/modules/es6.array.find-index.js', 438, 420 ] | |
| 83789 silly gunzTarPerm extractEntry library/modules/library/modules/$.def.js | |
| 83790 silly gunzTarPerm modified mode [ 'library/modules/library/modules/$.def.js', 438, 420 ] | |
| 83791 silly gunzTarPerm extractEntry library/modules/library/modules/$.fw.js | |
| 83792 silly gunzTarPerm modified mode [ 'library/modules/library/modules/$.fw.js', 438, 420 ] | |
| 83793 silly gunzTarPerm extractEntry library/web/dom.js | |
| 83794 silly gunzTarPerm modified mode [ 'library/web/dom.js', 438, 420 ] | |
| 83795 silly gunzTarPerm extractEntry library/web/immediate.js | |
| 83796 silly gunzTarPerm modified mode [ 'library/web/immediate.js', 438, 420 ] | |
| 83797 silly gunzTarPerm extractEntry library/web/index.js | |
| 83798 silly gunzTarPerm modified mode [ 'library/web/index.js', 438, 420 ] | |
| 83799 silly gunzTarPerm extractEntry library/web/timers.js | |
| 83800 silly gunzTarPerm modified mode [ 'library/web/timers.js', 438, 420 ] | |
| 83801 silly gunzTarPerm extractEntry build/build.ls | |
| 83802 silly gunzTarPerm modified mode [ 'build/build.ls', 438, 420 ] | |
| 83803 silly gunzTarPerm extractEntry build/config.ls | |
| 83804 silly gunzTarPerm modified mode [ 'build/config.ls', 438, 420 ] | |
| 83805 silly gunzTarPerm extractEntry test/reflect.js | |
| 83806 silly gunzTarPerm modified mode [ 'test/reflect.js', 438, 420 ] | |
| 83807 silly gunzTarPerm extractEntry test/run.js | |
| 83808 silly gunzTarPerm modified mode [ 'test/run.js', 438, 420 ] | |
| 83809 silly gunzTarPerm extractEntry build/Gruntfile.ls | |
| 83810 silly gunzTarPerm modified mode [ 'build/Gruntfile.ls', 438, 420 ] | |
| 83811 silly gunzTarPerm extractEntry modules/$.array-includes.js | |
| 83812 silly gunzTarPerm modified mode [ 'modules/$.array-includes.js', 438, 420 ] | |
| 83813 silly gunzTarPerm extractEntry test/runner.js | |
| 83814 silly gunzTarPerm modified mode [ 'test/runner.js', 438, 420 ] | |
| 83815 silly gunzTarPerm extractEntry test/test.js | |
| 83816 silly gunzTarPerm modified mode [ 'test/test.js', 438, 420 ] | |
| 83817 silly gunzTarPerm extractEntry modules/core.string.escape-html.js | |
| 83818 silly gunzTarPerm modified mode [ 'modules/core.string.escape-html.js', 438, 420 ] | |
| 83819 silly gunzTarPerm extractEntry modules/es5.js | |
| 83820 silly gunzTarPerm modified mode [ 'modules/es5.js', 438, 420 ] | |
| 83821 silly gunzTarPerm extractEntry modules/es6.array.copy-within.js | |
| 83822 silly gunzTarPerm modified mode [ 'modules/es6.array.copy-within.js', 438, 420 ] | |
| 83823 silly gunzTarPerm extractEntry modules/core.object.js | |
| 83824 silly gunzTarPerm modified mode [ 'modules/core.object.js', 438, 420 ] | |
| 83825 silly gunzTarPerm extractEntry modules/$.array-methods.js | |
| 83826 silly gunzTarPerm modified mode [ 'modules/$.array-methods.js', 438, 420 ] | |
| 83827 silly gunzTarPerm extractEntry modules/es6.array.find.js | |
| 83828 silly gunzTarPerm modified mode [ 'modules/es6.array.find.js', 438, 420 ] | |
| 83829 silly gunzTarPerm extractEntry modules/es6.array.from.js | |
| 83830 silly gunzTarPerm modified mode [ 'modules/es6.array.from.js', 438, 420 ] | |
| 83831 silly gunzTarPerm extractEntry modules/es6.array.iterator.js | |
| 83832 silly gunzTarPerm modified mode [ 'modules/es6.array.iterator.js', 438, 420 ] | |
| 83833 silly gunzTarPerm extractEntry modules/es6.array.of.js | |
| 83834 silly gunzTarPerm modified mode [ 'modules/es6.array.of.js', 438, 420 ] | |
| 83835 silly gunzTarPerm extractEntry modules/core.number.math.js | |
| 83836 silly gunzTarPerm modified mode [ 'modules/core.number.math.js', 438, 420 ] | |
| 83837 silly gunzTarPerm extractEntry modules/es6.array.species.js | |
| 83838 silly gunzTarPerm modified mode [ 'modules/es6.array.species.js', 438, 420 ] | |
| 83839 silly gunzTarPerm extractEntry modules/core.number.iterator.js | |
| 83840 silly gunzTarPerm modified mode [ 'modules/core.number.iterator.js', 438, 420 ] | |
| 83841 silly gunzTarPerm extractEntry modules/es6.function.name.js | |
| 83842 silly gunzTarPerm modified mode [ 'modules/es6.function.name.js', 438, 420 ] | |
| 83843 silly gunzTarPerm extractEntry modules/core.log.js | |
| 83844 silly gunzTarPerm modified mode [ 'modules/core.log.js', 438, 420 ] | |
| 83845 silly gunzTarPerm extractEntry modules/es6.map.js | |
| 83846 silly gunzTarPerm modified mode [ 'modules/es6.map.js', 438, 420 ] | |
| 83847 silly gunzTarPerm extractEntry modules/core.iter-helpers.js | |
| 83848 silly gunzTarPerm modified mode [ 'modules/core.iter-helpers.js', 438, 420 ] | |
| 83849 silly gunzTarPerm extractEntry modules/es6.math.js | |
| 83850 silly gunzTarPerm modified mode [ 'modules/es6.math.js', 438, 420 ] | |
| 83851 silly gunzTarPerm extractEntry modules/core.global.js | |
| 83852 silly gunzTarPerm modified mode [ 'modules/core.global.js', 438, 420 ] | |
| 83853 silly gunzTarPerm extractEntry modules/es6.number.constructor.js | |
| 83854 silly gunzTarPerm modified mode [ 'modules/es6.number.constructor.js', 438, 420 ] | |
| 83855 silly gunzTarPerm extractEntry modules/core.dict.js | |
| 83856 silly gunzTarPerm modified mode [ 'modules/core.dict.js', 438, 420 ] | |
| 83857 silly gunzTarPerm extractEntry modules/es6.number.statics.js | |
| 83858 silly gunzTarPerm modified mode [ 'modules/es6.number.statics.js', 438, 420 ] | |
| 83859 silly gunzTarPerm extractEntry modules/core.delay.js | |
| 83860 silly gunzTarPerm modified mode [ 'modules/core.delay.js', 438, 420 ] | |
| 83861 silly gunzTarPerm extractEntry modules/es6.object.assign.js | |
| 83862 silly gunzTarPerm modified mode [ 'modules/es6.object.assign.js', 438, 420 ] | |
| 83863 silly gunzTarPerm extractEntry modules/core.date.js | |
| 83864 silly gunzTarPerm modified mode [ 'modules/core.date.js', 438, 420 ] | |
| 83865 silly gunzTarPerm extractEntry CONTRIBUTING.md | |
| 83866 silly gunzTarPerm modified mode [ 'CONTRIBUTING.md', 438, 420 ] | |
| 83867 silly gunzTarPerm extractEntry tools/build-tests | |
| 83868 silly gunzTarPerm modified mode [ 'tools/build-tests', 438, 420 ] | |
| 83869 silly gunzTarPerm extractEntry modules/es6.object.is.js | |
| 83870 silly gunzTarPerm modified mode [ 'modules/es6.object.is.js', 438, 420 ] | |
| 83871 silly gunzTarPerm extractEntry modules/core.binding.js | |
| 83872 silly gunzTarPerm modified mode [ 'modules/core.binding.js', 438, 420 ] | |
| 83873 silly gunzTarPerm extractEntry tools/cache-templates | |
| 83874 silly gunzTarPerm modified mode [ 'tools/cache-templates', 438, 420 ] | |
| 83875 silly gunzTarPerm extractEntry CHANGELOG-6to5.md | |
| 83876 silly gunzTarPerm modified mode [ 'CHANGELOG-6to5.md', 438, 420 ] | |
| 83877 silly gunzTarPerm extractEntry test/pow.js | |
| 83878 silly gunzTarPerm modified mode [ 'test/pow.js', 438, 420 ] | |
| 83879 silly gunzTarPerm extractEntry modules/es6.object.set-prototype-of.js | |
| 83880 silly gunzTarPerm modified mode [ 'modules/es6.object.set-prototype-of.js', 438, 420 ] | |
| 83881 silly gunzTarPerm extractEntry modules/core.array.turn.js | |
| 83882 silly gunzTarPerm modified mode [ 'modules/core.array.turn.js', 438, 420 ] | |
| 83883 silly gunzTarPerm extractEntry templates.json | |
| 83884 silly gunzTarPerm modified mode [ 'templates.json', 438, 420 ] | |
| 83885 silly gunzTarPerm extractEntry lib/acorn/package.json | |
| 83886 silly gunzTarPerm modified mode [ 'lib/acorn/package.json', 438, 420 ] | |
| 83887 silly gunzTarPerm extractEntry modules/es6.object.statics-accept-primitives.js | |
| 83888 silly gunzTarPerm modified mode [ 'modules/es6.object.statics-accept-primitives.js', 438, 420 ] | |
| 83889 silly gunzTarPerm extractEntry modules/core.$for.js | |
| 83890 silly gunzTarPerm modified mode [ 'modules/core.$for.js', 438, 420 ] | |
| 83891 silly gunzTarPerm extractEntry modules/es6.object.to-string.js | |
| 83892 silly gunzTarPerm modified mode [ 'modules/es6.object.to-string.js', 438, 420 ] | |
| 83893 silly gunzTarPerm extractEntry modules/$.wks.js | |
| 83894 silly gunzTarPerm modified mode [ 'modules/$.wks.js', 438, 420 ] | |
| 83895 silly gunzTarPerm extractEntry modules/es6.promise.js | |
| 83896 silly gunzTarPerm modified mode [ 'modules/es6.promise.js', 438, 420 ] | |
| 83897 silly gunzTarPerm extractEntry modules/$.unscope.js | |
| 83898 silly gunzTarPerm modified mode [ 'modules/$.unscope.js', 438, 420 ] | |
| 83899 silly gunzTarPerm extractEntry modules/es6.reflect.js | |
| 83900 silly gunzTarPerm modified mode [ 'modules/es6.reflect.js', 438, 420 ] | |
| 83901 silly gunzTarPerm extractEntry modules/$.uid.js | |
| 83902 silly gunzTarPerm modified mode [ 'modules/$.uid.js', 438, 420 ] | |
| 83903 silly gunzTarPerm extractEntry lib/acorn/LICENSE | |
| 83904 silly gunzTarPerm modified mode [ 'lib/acorn/LICENSE', 438, 420 ] | |
| 83905 silly gunzTarPerm extractEntry lib/acorn/AUTHORS | |
| 83906 silly gunzTarPerm modified mode [ 'lib/acorn/AUTHORS', 438, 420 ] | |
| 83907 silly gunzTarPerm extractEntry test/browser/big-vs-number.html | |
| 83908 silly gunzTarPerm modified mode [ 'test/browser/big-vs-number.html', 438, 420 ] | |
| 83909 silly gunzTarPerm extractEntry test/browser/every-test.html | |
| 83910 silly gunzTarPerm modified mode [ 'test/browser/every-test.html', 438, 420 ] | |
| 83911 silly gunzTarPerm extractEntry modules/es6.regexp.js | |
| 83912 silly gunzTarPerm modified mode [ 'modules/es6.regexp.js', 438, 420 ] | |
| 83913 silly gunzTarPerm extractEntry modules/$.task.js | |
| 83914 silly gunzTarPerm modified mode [ 'modules/$.task.js', 438, 420 ] | |
| 83915 silly gunzTarPerm extractEntry lib/acorn/plugins/flow.js | |
| 83916 silly gunzTarPerm modified mode [ 'lib/acorn/plugins/flow.js', 438, 420 ] | |
| 83917 silly gunzTarPerm extractEntry lib/acorn/plugins/jsx.js | |
| 83918 silly gunzTarPerm modified mode [ 'lib/acorn/plugins/jsx.js', 438, 420 ] | |
| 83919 silly gunzTarPerm extractEntry modules/es6.set.js | |
| 83920 silly gunzTarPerm modified mode [ 'modules/es6.set.js', 438, 420 ] | |
| 83921 silly gunzTarPerm extractEntry modules/$.string-at.js | |
| 83922 silly gunzTarPerm modified mode [ 'modules/$.string-at.js', 438, 420 ] | |
| 83923 silly gunzTarPerm extractEntry modules/es6.string.code-point-at.js | |
| 83924 silly gunzTarPerm modified mode [ 'modules/es6.string.code-point-at.js', 438, 420 ] | |
| 83925 silly gunzTarPerm extractEntry modules/$.species.js | |
| 83926 silly gunzTarPerm modified mode [ 'modules/$.species.js', 438, 420 ] | |
| 83927 silly gunzTarPerm extractEntry lib/acorn/src/expression.js | |
| 83928 silly gunzTarPerm modified mode [ 'lib/acorn/src/expression.js', 438, 420 ] | |
| 83929 silly gunzTarPerm extractEntry lib/acorn/src/lookahead.js | |
| 83930 silly gunzTarPerm modified mode [ 'lib/acorn/src/lookahead.js', 438, 420 ] | |
| 83931 silly gunzTarPerm extractEntry modules/es6.string.ends-with.js | |
| 83932 silly gunzTarPerm modified mode [ 'modules/es6.string.ends-with.js', 438, 420 ] | |
| 83933 silly gunzTarPerm extractEntry modules/$.set-proto.js | |
| 83934 silly gunzTarPerm modified mode [ 'modules/$.set-proto.js', 438, 420 ] | |
| 83935 silly gunzTarPerm extractEntry lib/acorn/src/lval.js | |
| 83936 silly gunzTarPerm modified mode [ 'lib/acorn/src/lval.js', 438, 420 ] | |
| 83937 silly gunzTarPerm extractEntry lib/acorn/src/node.js | |
| 83938 silly gunzTarPerm modified mode [ 'lib/acorn/src/node.js', 438, 420 ] | |
| 83939 silly gunzTarPerm extractEntry modules/es6.string.from-code-point.js | |
| 83940 silly gunzTarPerm modified mode [ 'modules/es6.string.from-code-point.js', 438, 420 ] | |
| 83941 silly gunzTarPerm extractEntry modules/$.replacer.js | |
| 83942 silly gunzTarPerm modified mode [ 'modules/$.replacer.js', 438, 420 ] | |
| 83943 silly gunzTarPerm extractEntry modules/es6.string.includes.js | |
| 83944 silly gunzTarPerm modified mode [ 'modules/es6.string.includes.js', 438, 420 ] | |
| 83945 silly gunzTarPerm extractEntry modules/$.partial.js | |
| 83946 silly gunzTarPerm modified mode [ 'modules/$.partial.js', 438, 420 ] | |
| 83947 silly gunzTarPerm extractEntry lib/acorn/src/options.js | |
| 83948 silly gunzTarPerm modified mode [ 'lib/acorn/src/options.js', 438, 420 ] | |
| 83949 silly gunzTarPerm extractEntry lib/acorn/src/location.js | |
| 83950 silly gunzTarPerm modified mode [ 'lib/acorn/src/location.js', 438, 420 ] | |
| 83951 silly gunzTarPerm extractEntry modules/es6.string.iterator.js | |
| 83952 silly gunzTarPerm modified mode [ 'modules/es6.string.iterator.js', 438, 420 ] | |
| 83953 silly gunzTarPerm extractEntry modules/$.own-keys.js | |
| 83954 silly gunzTarPerm modified mode [ 'modules/$.own-keys.js', 438, 420 ] | |
| 83955 silly gunzTarPerm extractEntry modules/es6.string.raw.js | |
| 83956 silly gunzTarPerm modified mode [ 'modules/es6.string.raw.js', 438, 420 ] | |
| 83957 silly gunzTarPerm extractEntry modules/$.keyof.js | |
| 83958 silly gunzTarPerm modified mode [ 'modules/$.keyof.js', 438, 420 ] | |
| 83959 silly gunzTarPerm extractEntry modules/es6.string.repeat.js | |
| 83960 silly gunzTarPerm modified mode [ 'modules/es6.string.repeat.js', 438, 420 ] | |
| 83961 silly gunzTarPerm extractEntry modules/$.js | |
| 83962 silly gunzTarPerm modified mode [ 'modules/$.js', 438, 420 ] | |
| 83963 silly gunzTarPerm extractEntry lib/acorn/src/state.js | |
| 83964 silly gunzTarPerm modified mode [ 'lib/acorn/src/state.js', 438, 420 ] | |
| 83965 silly gunzTarPerm extractEntry lib/acorn/src/statement.js | |
| 83966 silly gunzTarPerm modified mode [ 'lib/acorn/src/statement.js', 438, 420 ] | |
| 83967 silly gunzTarPerm extractEntry modules/es6.string.starts-with.js | |
| 83968 silly gunzTarPerm modified mode [ 'modules/es6.string.starts-with.js', 438, 420 ] | |
| 83969 silly gunzTarPerm extractEntry modules/$.iter.js | |
| 83970 silly gunzTarPerm modified mode [ 'modules/$.iter.js', 438, 420 ] | |
| 83971 silly gunzTarPerm extractEntry modules/es6.symbol.js | |
| 83972 silly gunzTarPerm modified mode [ 'modules/es6.symbol.js', 438, 420 ] | |
| 83973 silly gunzTarPerm extractEntry modules/$.iter-detect.js | |
| 83974 silly gunzTarPerm modified mode [ 'modules/$.iter-detect.js', 438, 420 ] | |
| 83975 silly gunzTarPerm extractEntry modules/es6.weak-map.js | |
| 83976 silly gunzTarPerm modified mode [ 'modules/es6.weak-map.js', 438, 420 ] | |
| 83977 silly gunzTarPerm extractEntry modules/$.invoke.js | |
| 83978 silly gunzTarPerm modified mode [ 'modules/$.invoke.js', 438, 420 ] | |
| 83979 silly gunzTarPerm extractEntry modules/es6.weak-set.js | |
| 83980 silly gunzTarPerm modified mode [ 'modules/es6.weak-set.js', 438, 420 ] | |
| 83981 silly gunzTarPerm extractEntry modules/$.fw.js | |
| 83982 silly gunzTarPerm modified mode [ 'modules/$.fw.js', 438, 420 ] | |
| 83983 silly gunzTarPerm extractEntry modules/es7.array.includes.js | |
| 83984 silly gunzTarPerm modified mode [ 'modules/es7.array.includes.js', 438, 420 ] | |
| 83985 silly gunzTarPerm extractEntry modules/$.def.js | |
| 83986 silly gunzTarPerm modified mode [ 'modules/$.def.js', 438, 420 ] | |
| 83987 silly gunzTarPerm extractEntry modules/es7.object.get-own-property-descriptors.js | |
| 83988 silly gunzTarPerm modified mode [ 'modules/es7.object.get-own-property-descriptors.js', | |
| 83988 silly gunzTarPerm 438, | |
| 83988 silly gunzTarPerm 420 ] | |
| 83989 silly gunzTarPerm extractEntry modules/$.ctx.js | |
| 83990 silly gunzTarPerm modified mode [ 'modules/$.ctx.js', 438, 420 ] | |
| 83991 silly gunzTarPerm extractEntry modules/es7.object.to-array.js | |
| 83992 silly gunzTarPerm modified mode [ 'modules/es7.object.to-array.js', 438, 420 ] | |
| 83993 silly gunzTarPerm extractEntry modules/$.collection.js | |
| 83994 silly gunzTarPerm modified mode [ 'modules/$.collection.js', 438, 420 ] | |
| 83995 silly gunzTarPerm extractEntry modules/es7.regexp.escape.js | |
| 83996 silly gunzTarPerm modified mode [ 'modules/es7.regexp.escape.js', 438, 420 ] | |
| 83997 silly gunzTarPerm extractEntry modules/$.collection-weak.js | |
| 83998 silly gunzTarPerm modified mode [ 'modules/$.collection-weak.js', 438, 420 ] | |
| 83999 silly gunzTarPerm extractEntry modules/es7.set.to-json.js | |
| 84000 silly gunzTarPerm modified mode [ 'modules/es7.set.to-json.js', 438, 420 ] | |
| 84001 silly gunzTarPerm extractEntry modules/$.collection-strong.js | |
| 84002 silly gunzTarPerm modified mode [ 'modules/$.collection-strong.js', 438, 420 ] | |
| 84003 silly gunzTarPerm extractEntry modules/es7.string.at.js | |
| 84004 silly gunzTarPerm modified mode [ 'modules/es7.string.at.js', 438, 420 ] | |
| 84005 silly gunzTarPerm extractEntry modules/$.cof.js | |
| 84006 silly gunzTarPerm modified mode [ 'modules/$.cof.js', 438, 420 ] | |
| 84007 silly gunzTarPerm extractEntry modules/js.array.statics.js | |
| 84008 silly gunzTarPerm modified mode [ 'modules/js.array.statics.js', 438, 420 ] | |
| 84009 silly gunzTarPerm extractEntry modules/$.assign.js | |
| 84010 silly gunzTarPerm modified mode [ 'modules/$.assign.js', 438, 420 ] | |
| 84011 silly gunzTarPerm extractEntry modules/web.immediate.js | |
| 84012 silly gunzTarPerm modified mode [ 'modules/web.immediate.js', 438, 420 ] | |
| 84013 silly gunzTarPerm extractEntry modules/$.assert.js | |
| 84014 silly gunzTarPerm modified mode [ 'modules/$.assert.js', 438, 420 ] | |
| 84015 silly gunzTarPerm extractEntry modules/web.dom.iterable.js | |
| 84016 silly gunzTarPerm modified mode [ 'modules/web.dom.iterable.js', 438, 420 ] | |
| 84017 silly gunzTarPerm extractEntry modules/es6.array.fill.js | |
| 84018 silly gunzTarPerm modified mode [ 'modules/es6.array.fill.js', 438, 420 ] | |
| 84019 silly gunzTarPerm extractEntry modules/web.timers.js | |
| 84020 silly gunzTarPerm modified mode [ 'modules/web.timers.js', 438, 420 ] | |
| 84021 silly gunzTarPerm extractEntry modules/es6.array.find-index.js | |
| 84022 silly gunzTarPerm modified mode [ 'modules/es6.array.find-index.js', 438, 420 ] | |
| 84023 silly gunzTarPerm extractEntry modules/library/modules/$.def.js | |
| 84024 silly gunzTarPerm modified mode [ 'modules/library/modules/$.def.js', 438, 420 ] | |
| 84025 silly gunzTarPerm extractEntry modules/library/modules/$.fw.js | |
| 84026 silly gunzTarPerm modified mode [ 'modules/library/modules/$.fw.js', 438, 420 ] | |
| 84027 silly gunzTarPerm extractEntry client/core.js | |
| 84028 silly gunzTarPerm modified mode [ 'client/core.js', 438, 420 ] | |
| 84029 silly gunzTarPerm extractEntry client/core.min.js | |
| 84030 silly gunzTarPerm modified mode [ 'client/core.min.js', 438, 420 ] | |
| 84031 silly gunzTarPerm extractEntry client/library.js | |
| 84032 silly gunzTarPerm modified mode [ 'client/library.js', 438, 420 ] | |
| 84033 silly gunzTarPerm extractEntry client/library.min.js | |
| 84034 silly gunzTarPerm modified mode [ 'client/library.min.js', 438, 420 ] | |
| 84035 silly gunzTarPerm extractEntry client/shim.js | |
| 84036 silly gunzTarPerm modified mode [ 'client/shim.js', 438, 420 ] | |
| 84037 silly gunzTarPerm extractEntry client/shim.min.js | |
| 84038 silly gunzTarPerm modified mode [ 'client/shim.min.js', 438, 420 ] | |
| 84039 silly gunzTarPerm extractEntry client/core.min.js.map | |
| 84040 silly gunzTarPerm modified mode [ 'client/core.min.js.map', 438, 420 ] | |
| 84041 silly gunzTarPerm extractEntry client/library.min.js.map | |
| 84042 silly gunzTarPerm modified mode [ 'client/library.min.js.map', 438, 420 ] | |
| 84043 silly gunzTarPerm extractEntry client/shim.min.js.map | |
| 84044 silly gunzTarPerm modified mode [ 'client/shim.min.js.map', 438, 420 ] | |
| 84045 silly gunzTarPerm extractEntry lib/acorn/src/tokencontext.js | |
| 84046 silly gunzTarPerm modified mode [ 'lib/acorn/src/tokencontext.js', 438, 420 ] | |
| 84047 silly gunzTarPerm extractEntry core/$for.js | |
| 84048 silly gunzTarPerm modified mode [ 'core/$for.js', 438, 420 ] | |
| 84049 silly gunzTarPerm extractEntry core/delay.js | |
| 84050 silly gunzTarPerm modified mode [ 'core/delay.js', 438, 420 ] | |
| 84051 silly gunzTarPerm extractEntry core/dict.js | |
| 84052 silly gunzTarPerm modified mode [ 'core/dict.js', 438, 420 ] | |
| 84053 silly gunzTarPerm extractEntry lib/acorn/src/tokenize.js | |
| 84054 silly gunzTarPerm modified mode [ 'lib/acorn/src/tokenize.js', 438, 420 ] | |
| 84055 silly gunzTarPerm extractEntry lib/acorn/src/tokentype.js | |
| 84056 silly gunzTarPerm modified mode [ 'lib/acorn/src/tokentype.js', 438, 420 ] | |
| 84057 silly gunzTarPerm extractEntry core/function.js | |
| 84058 silly gunzTarPerm modified mode [ 'core/function.js', 438, 420 ] | |
| 84059 silly gunzTarPerm extractEntry core/date.js | |
| 84060 silly gunzTarPerm modified mode [ 'core/date.js', 438, 420 ] | |
| 84061 silly gunzTarPerm extractEntry lib/acorn/src/index.js | |
| 84062 silly gunzTarPerm modified mode [ 'lib/acorn/src/index.js', 438, 420 ] | |
| 84063 silly gunzTarPerm extractEntry lib/acorn/src/util.js | |
| 84064 silly gunzTarPerm modified mode [ 'lib/acorn/src/util.js', 438, 420 ] | |
| 84065 silly gunzTarPerm extractEntry core/index.js | |
| 84066 silly gunzTarPerm modified mode [ 'core/index.js', 438, 420 ] | |
| 84067 silly gunzTarPerm extractEntry core/log.js | |
| 84068 silly gunzTarPerm modified mode [ 'core/log.js', 438, 420 ] | |
| 84069 silly gunzTarPerm extractEntry core/number.js | |
| 84070 silly gunzTarPerm modified mode [ 'core/number.js', 438, 420 ] | |
| 84071 silly gunzTarPerm extractEntry core/object.js | |
| 84072 silly gunzTarPerm modified mode [ 'core/object.js', 438, 420 ] | |
| 84073 silly gunzTarPerm extractEntry lib/acorn/src/identifier.js | |
| 84074 silly gunzTarPerm modified mode [ 'lib/acorn/src/identifier.js', 438, 420 ] | |
| 84075 silly gunzTarPerm extractEntry lib/acorn/src/whitespace.js | |
| 84076 silly gunzTarPerm modified mode [ 'lib/acorn/src/whitespace.js', 438, 420 ] | |
| 84077 silly gunzTarPerm extractEntry core/string.js | |
| 84078 silly gunzTarPerm modified mode [ 'core/string.js', 438, 420 ] | |
| 84079 silly gunzTarPerm extractEntry core/array.js | |
| 84080 silly gunzTarPerm modified mode [ 'core/array.js', 438, 420 ] | |
| 84081 silly gunzTarPerm extractEntry core/_.js | |
| 84082 silly gunzTarPerm modified mode [ 'core/_.js', 438, 420 ] | |
| 84083 silly gunzTarPerm extractEntry core/global.js | |
| 84084 silly gunzTarPerm modified mode [ 'core/global.js', 438, 420 ] | |
| 84085 silly gunzTarPerm extractEntry test/browser/single-test.html | |
| 84086 silly gunzTarPerm modified mode [ 'test/browser/single-test.html', 438, 420 ] | |
| 84087 silly gunzTarPerm extractEntry es5/index.js | |
| 84088 silly gunzTarPerm modified mode [ 'es5/index.js', 438, 420 ] | |
| 84089 silly gunzTarPerm extractEntry web/dom.js | |
| 84090 silly gunzTarPerm modified mode [ 'web/dom.js', 438, 420 ] | |
| 84091 silly gunzTarPerm extractEntry web/immediate.js | |
| 84092 silly gunzTarPerm modified mode [ 'web/immediate.js', 438, 420 ] | |
| 84093 silly gunzTarPerm extractEntry web/index.js | |
| 84094 silly gunzTarPerm modified mode [ 'web/index.js', 438, 420 ] | |
| 84095 silly gunzTarPerm extractEntry web/timers.js | |
| 84096 silly gunzTarPerm modified mode [ 'web/timers.js', 438, 420 ] | |
| 84097 silly gunzTarPerm extractEntry lib/acorn/src/parseutil.js | |
| 84098 silly gunzTarPerm modified mode [ 'lib/acorn/src/parseutil.js', 438, 420 ] | |
| 84099 silly gunzTarPerm extractEntry lib/babel/util.js | |
| 84100 silly gunzTarPerm modified mode [ 'lib/babel/util.js', 438, 420 ] | |
| 84101 silly gunzTarPerm extractEntry lib/babel/patch.js | |
| 84102 silly gunzTarPerm modified mode [ 'lib/babel/patch.js', 438, 420 ] | |
| 84103 silly gunzTarPerm extractEntry lib/babel/messages.js | |
| 84104 silly gunzTarPerm modified mode [ 'lib/babel/messages.js', 438, 420 ] | |
| 84105 silly gunzTarPerm extractEntry lib/babel/polyfill.js | |
| 84106 silly gunzTarPerm modified mode [ 'lib/babel/polyfill.js', 438, 420 ] | |
| 84107 silly gunzTarPerm extractEntry lib/babel/helpers/code-frame.js | |
| 84108 silly gunzTarPerm modified mode [ 'lib/babel/helpers/code-frame.js', 438, 420 ] | |
| 84109 silly gunzTarPerm extractEntry lib/babel/helpers/normalize-ast.js | |
| 84110 silly gunzTarPerm modified mode [ 'lib/babel/helpers/normalize-ast.js', 438, 420 ] | |
| 84111 silly gunzTarPerm extractEntry lib/babel/helpers/object.js | |
| 84112 silly gunzTarPerm modified mode [ 'lib/babel/helpers/object.js', 438, 420 ] | |
| 84113 silly gunzTarPerm extractEntry lib/babel/helpers/parse.js | |
| 84114 silly gunzTarPerm modified mode [ 'lib/babel/helpers/parse.js', 438, 420 ] | |
| 84115 silly gunzTarPerm extractEntry lib/babel/generation/buffer.js | |
| 84116 silly gunzTarPerm modified mode [ 'lib/babel/generation/buffer.js', 438, 420 ] | |
| 84117 silly gunzTarPerm extractEntry lib/babel/generation/index.js | |
| 84118 silly gunzTarPerm modified mode [ 'lib/babel/generation/index.js', 438, 420 ] | |
| 84119 silly gunzTarPerm extractEntry lib/babel/generation/position.js | |
| 84120 silly gunzTarPerm modified mode [ 'lib/babel/generation/position.js', 438, 420 ] | |
| 84121 silly gunzTarPerm extractEntry lib/babel/generation/source-map.js | |
| 84122 silly gunzTarPerm modified mode [ 'lib/babel/generation/source-map.js', 438, 420 ] | |
| 84123 silly gunzTarPerm extractEntry lib/babel/generation/whitespace.js | |
| 84124 silly gunzTarPerm modified mode [ 'lib/babel/generation/whitespace.js', 438, 420 ] | |
| 84125 silly gunzTarPerm extractEntry lib/babel/generation/generators/base.js | |
| 84126 silly gunzTarPerm modified mode [ 'lib/babel/generation/generators/base.js', 438, 420 ] | |
| 84127 silly gunzTarPerm extractEntry lib/babel/generation/generators/comprehensions.js | |
| 84128 silly gunzTarPerm modified mode [ 'lib/babel/generation/generators/comprehensions.js', 438, 420 ] | |
| 84129 silly gunzTarPerm extractEntry lib/babel/generation/generators/expressions.js | |
| 84130 silly gunzTarPerm modified mode [ 'lib/babel/generation/generators/expressions.js', 438, 420 ] | |
| 84131 silly gunzTarPerm extractEntry lib/babel/generation/generators/flow.js | |
| 84132 silly gunzTarPerm modified mode [ 'lib/babel/generation/generators/flow.js', 438, 420 ] | |
| 84133 silly lockFile 8a8d4360-10001-1-0-dev-harmony-fb-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package | |
| 84134 silly lockFile 8a8d4360-10001-1-0-dev-harmony-fb-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package | |
| 84135 silly gunzTarPerm extractEntry lib/babel/generation/generators/classes.js | |
| 84136 silly gunzTarPerm modified mode [ 'lib/babel/generation/generators/classes.js', 438, 420 ] | |
| 84137 silly gunzTarPerm extractEntry lib/babel/generation/generators/methods.js | |
| 84138 silly gunzTarPerm modified mode [ 'lib/babel/generation/generators/methods.js', 438, 420 ] | |
| 84139 silly lockFile e5ab5e09-1-1-0-dev-harmony-fb-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package.tgz | |
| 84140 silly lockFile e5ab5e09-1-1-0-dev-harmony-fb-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package.tgz | |
| 84141 verbose chmod C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package.tgz 644 | |
| 84142 silly chown skipping for windows C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package.tgz | |
| 84143 silly lockFile 333800f5--fb-10001-1-0-dev-harmony-fb-tgz https://registry.npmjs.org/esprima-fb/-/esprima-fb-10001.1.0-dev-harmony-fb.tgz | |
| 84144 silly lockFile 333800f5--fb-10001-1-0-dev-harmony-fb-tgz https://registry.npmjs.org/esprima-fb/-/esprima-fb-10001.1.0-dev-harmony-fb.tgz | |
| 84145 silly lockFile bad5010c-rima-fb-10001-1-0-dev-harmony-fb esprima-fb@10001.1.0-dev-harmony-fb | |
| 84146 silly lockFile bad5010c-rima-fb-10001-1-0-dev-harmony-fb esprima-fb@10001.1.0-dev-harmony-fb | |
| 84147 silly lockFile 5b6e7fe8-rima-fb-10001-1-0-dev-harmony-fb esprima-fb@~10001.1.0-dev-harmony-fb | |
| 84148 silly lockFile 5b6e7fe8-rima-fb-10001-1-0-dev-harmony-fb esprima-fb@~10001.1.0-dev-harmony-fb | |
| 84149 silly resolved [ { name: 'source-map', | |
| 84149 silly resolved description: 'Generates and consumes source maps', | |
| 84149 silly resolved version: '0.1.43', | |
| 84149 silly resolved homepage: 'https://github.com/mozilla/source-map', | |
| 84149 silly resolved author: { name: 'Nick Fitzgerald', email: 'nfitzgerald@mozilla.com' }, | |
| 84149 silly resolved contributors: | |
| 84149 silly resolved [ [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object], | |
| 84149 silly resolved [Object] ], | |
| 84149 silly resolved repository: { type: 'git', url: 'http://github.com/mozilla/source-map.git' }, | |
| 84149 silly resolved directories: { lib: './lib' }, | |
| 84149 silly resolved main: './lib/source-map.js', | |
| 84149 silly resolved engines: { node: '>=0.8.0' }, | |
| 84149 silly resolved licenses: [ [Object] ], | |
| 84149 silly resolved dependencies: { amdefine: '>=0.0.4' }, | |
| 84149 silly resolved devDependencies: { dryice: '>=0.4.8' }, | |
| 84149 silly resolved scripts: | |
| 84149 silly resolved { test: 'node test/run-tests.js', | |
| 84149 silly resolved build: 'node Makefile.dryice.js' }, | |
| 84149 silly resolved readme: '# Source Map\n\nThis is a library to generate and consume the source map format\n[described here][format].\n\nThis library is written in the Asynchronous Module Definition format, and works\nin the following environments:\n\n* Modern Browsers supporting ECMAScript 5 (either after the build, or with an\n AMD loader such as RequireJS)\n\n* Inside Firefox (as a JSM file, after the build)\n\n* With NodeJS versions 0.8.X and higher\n\n## Node\n\n $ npm install source-map\n\n## Building from Source (for everywhere else)\n\nInstall Node and then run\n\n $ git clone https://fitzgen@github.com/mozilla/source-map.git\n $ cd source-map\n $ npm link .\n\nNext, run\n\n $ node Makefile.dryice.js\n\nThis should spew a bunch of stuff to stdout, and create the following files:\n\n* `dist/source-map.js` - The unminified browser version.\n\n* `dist/source-map.min.js` - The minified browser version.\n\n* `dist/SourceMap.jsm` - The JavaScript Module for inclusion in Firefox source.\n\n## Examples\n\n### Consuming a source map\n\n var rawSourceMap = {\n version: 3,\n file: \'min.js\',\n names: [\'bar\', \'baz\', \'n\'],\n sources: [\'one.js\', \'two.js\'],\n sourceRoot: \'http://example.com/www/js/\',\n mappings: \'CAAC,IAAI,IAAM,SAAUA,GAClB,OAAOC,IAAID;CCDb,IAAI,IAAM,SAAUE,GAClB,OAAOA\'\n };\n\n var smc = new SourceMapConsumer(rawSourceMap);\n\n console.log(smc.sources);\n // [ \'http://example.com/www/js/one.js\',\n // \'http://example.com/www/js/two.js\' ]\n\n console.log(smc.originalPositionFor({\n line: 2,\n column: 28\n }));\n // { source: \'http://example.com/www/js/two.js\',\n // line: 2,\n // column: 10,\n // name: \'n\' }\n\n console.log(smc.generatedPositionFor({\n source: \'http://example.com/www/js/two.js\',\n line: 2,\n column: 10\n }));\n // { line: 2, column: 28 }\n\n smc.eachMapping(function (m) {\n // ...\n });\n\n### Generating a source map\n\nIn depth guide:\n[**Compiling to JavaScript, and Debugging with Source Maps**](https://hacks.mozilla.org/2013/05/compiling-to-javascript-and-debugging-with-source-maps/)\n\n#### With SourceNode (high level API)\n\n function compile(ast) {\n switch (ast.type) {\n case \'BinaryExpression\':\n return new SourceNode(\n ast.location.line,\n ast.location.column,\n ast.location.source,\n [compile(ast.left), " + ", compile(ast.right)]\n );\n case \'Literal\':\n return new SourceNode(\n ast.location.line,\n ast.location.column,\n ast.location.source,\n String(ast.value)\n );\n // ...\n default:\n throw new Error("Bad AST");\n }\n }\n\n var ast = parse("40 + 2", "add.js");\n console.log(compile(ast).toStringWithSourceMap({\n file: \'add.js\'\n }));\n // { code: \'40 + 2\',\n // map: [object SourceMapGenerator] }\n\n#### With SourceMapGenerator (low level API)\n\n var map = new SourceMapGenerator({\n file: "source-mapped.js"\n });\n\n map.addMapping({\n generated: {\n line: 10,\n column: 35\n },\n source: "foo.js",\n original: {\n line: 33,\n column: 2\n },\n name: "christopher"\n });\n\n console.log(map.toString());\n // \'{"version":3,"file":"source-mapped.js","sources":["foo.js"],"names":["christopher"],"mappings":";;;;;;;;;mCAgCEA"}\'\n\n## API\n\nGet a reference to the module:\n\n // NodeJS\n var sourceMap = require(\'source-map\');\n\n // Browser builds\n var sourceMap = window.sourceMap;\n\n // Inside Firefox\n let sourceMap = {};\n Components.utils.import(\'resource:///modules/devtools/SourceMap.jsm\', sourceMap);\n\n### SourceMapConsumer\n\nA SourceMapConsumer instance represents a parsed source map which we can query\nfor information about the original file positions by giving it a file position\nin the generated source.\n\n#### new SourceMapConsumer(rawSourceMap)\n\nThe only parameter is the raw source map (either as a string which can be\n`JSON.parse`\'d, or an object). According to the spec, source maps have the\nfollowing attributes:\n\n* `version`: Which version of the source map spec this map is following.\n\n* `sources`: An array of URLs to the original source files.\n\n* `names`: An array of identifiers which can be referrenced by individual\n mappings.\n\n* `sourceRoot`: Optional. The URL root from which all sources are relative.\n\n* `sourcesContent`: Optional. An array of contents of the original source files.\n\n* `mappings`: A string of base64 VLQs which contain the actual mappings.\n\n* `file`: Optional. The generated filename this source map is associated with.\n\n#### SourceMapConsumer.prototype.computeColumnSpans()\n\nCompute the last column for each generated mapping. The last column is\ninclusive.\n\n#### SourceMapConsumer.prototype.originalPositionFor(generatedPosition)\n\nReturns the original source, line, and column information for the generated\nsource\'s line and column positions provided. The only argument is an object with\nthe following properties:\n\n* `line`: The line number in the generated source.\n\n* `column`: The column number in the generated source.\n\nand an object is returned with the following properties:\n\n* `source`: The original source file, or null if this information is not\n available.\n\n* `line`: The line number in the original source, or null if this information is\n not available.\n\n* `column`: The column number in the original source, or null or null if this\n information is not available.\n\n* `name`: The original identifier, or null if this information is not available.\n\n#### SourceMapConsumer.prototype.generatedPositionFor(originalPosition)\n\nReturns the generated line and column information for the original source,\nline, and column positions provided. The only argument is an object with\nthe following properties:\n\n* `source`: The filename of the original source.\n\n* `line`: The line number in the original source.\n\n* `column`: The column number in the original source.\n\nand an object is returned with the following properties:\n\n* `line`: The line number in the generated source, or null.\n\n* `column`: The column number in the generated source, or null.\n\n#### SourceMapConsumer.prototype.allGeneratedPositionsFor(originalPosition)\n\nReturns all generated line and column information for the original source\nand line provided. The only argument is an object with the following\nproperties:\n\n* `source`: The filename of the original source.\n\n* `line`: The line number in the original source.\n\nand an array of objects is returned, each with the following properties:\n\n* `line`: The line number in the generated source, or null.\n\n* `column`: The column number in the generated source, or null.\n\n#### SourceMapConsumer.prototype.sourceContentFor(source)\n\nReturns the original source content for the source provided. The only\nargument is the URL of the original source file.\n\n#### SourceMapConsumer.prototype.eachMapping(callback, context, order)\n\nIterate over each mapping between an original source/line/column and a\ngenerated line/column in this source map.\n\n* `callback`: The function that is called with each mapping. Mappings have the\n form `{ source, generatedLine, generatedColumn, originalLine, originalColumn,\n name }`\n\n* `context`: Optional. If specified, this object will be the value of `this`\n every time that `callback` is called.\n\n* `order`: Either `SourceMapConsumer.GENERATED_ORDER` or\n `SourceMapConsumer.ORIGINAL_ORDER`. Specifies whether you want to iterate over\n the mappings sorted by the generated file\'s line/column order or the\n original\'s source/line/column order, respectively. Defaults to\n `SourceMapConsumer.GENERATED_ORDER`.\n\n### SourceMapGenerator\n\nAn instance of the SourceMapGenerator represents a source map which is being\nbuilt incrementally.\n\n#### new SourceMapGenerator([startOfSourceMap])\n\nYou may pass an object with the following properties:\n\n* `file`: The filename of the generated source that this source map is\n associated with.\n\n* `sourceRoot`: A root for all relative URLs in this source map.\n\n* `skipValidation`: Optional. When `true`, disables validation of mappings as\n they are added. This can improve performance but should be used with\n discretion, as a last resort. Even then, one should avoid using this flag when\n running tests, if possible.\n\n#### SourceMapGenerator.fromSourceMap(sourceMapConsumer)\n\nCreates a new SourceMapGenerator based on a SourceMapConsumer\n\n* `sourceMapConsumer` The SourceMap.\n\n#### SourceMapGenerator.prototype.addMapping(mapping)\n\nAdd a single mapping from original source line and column to the generated\nsource\'s line and column for this source map being created. The mapping object\nshould have the following properties:\n\n* `generated`: An object with the generated line and column positions.\n\n* `original`: An object with the original line and column positions.\n\n* `source`: The original source file (relative to the sourceRoot).\n\n* `name`: An optional original token name for this mapping.\n\n#### SourceMapGenerator.prototype.setSourceContent(sourceFile, sourceContent)\n\nSet the source content for an original source file.\n\n* `sourceFile` the URL of the original source file.\n\n* `sourceContent` the content of the source file.\n\n#### SourceMapGenerator.prototype.applySourceMap(sourceMapConsumer[, sourceFile[, sourceMapPath]])\n\nApplies a SourceMap for a source file to the SourceMap.\nEach mapping to the supplied source file is rewritten using the\nsupplied SourceMap. Note: The resolution for the resulting mappings\nis the minimium of this map and the supplied map.\n\n* `sourceMapConsumer`: The SourceMap to be applied.\n\n* `sourceFile`: Optional. The filename of the source file.\n If omitted, sourceMapConsumer.file will be used, if it exists.\n Otherwise an error will be thrown.\n\n* `sourceMapPath`: Optional. The dirname of the path to the SourceMap\n to be applied. If relative, it is relative to the SourceMap.\n\n This parameter is needed when the two SourceMaps aren\'t in the same\n directory, and the SourceMap to be applied contains relative source\n paths. If so, those relative source paths need to be rewritten\n relative to the SourceMap.\n\n If omitted, it is assumed that both SourceMaps are in the same directory,\n thus not needing any rewriting. (Supplying `\'.\'` has the same effect.)\n\n#### SourceMapGenerator.prototype.toString()\n\nRenders the source map being generated to a string.\n\n### SourceNode\n\nSourceNodes provide a way to abstract over interpolating and/or concatenating\nsnippets of generated JavaScript source code, while maintaining the line and\ncolumn information associated between those snippets and the original source\ncode. This is useful as the final intermediate representation a compiler might\nuse before outputting the generated JS and source map.\n\n#### new SourceNode([line, column, source[, chunk[, name]]])\n\n* `line`: The original line number associated with this source node, or null if\n it isn\'t associated with an original line.\n\n* `column`: The original column number associated with this source node, or null\n if it isn\'t associated with an original column.\n\n* `source`: The original source\'s filename; null if no filename is provided.\n\n* `chunk`: Optional. Is immediately passed to `SourceNode.prototype.add`, see\n below.\n\n* `name`: Optional. The original identifier.\n\n#### SourceNode.fromStringWithSourceMap(code, sourceMapConsumer[, relativePath])\n\nCreates a SourceNode from generated code and a SourceMapConsumer.\n\n* `code`: The generated code\n\n* `sourceMapConsumer` The SourceMap for the generated code\n\n* `relativePath` The optional path that relative sources in `sourceMapConsumer`\n should be relative to.\n\n#### SourceNode.prototype.add(chunk)\n\nAdd a chunk of generated JS to this source node.\n\n* `chunk`: A string snippet of generated JS code, another instance of\n `SourceNode`, or an array where each member is one of those things.\n\n#### SourceNode.prototype.prepend(chunk)\n\nPrepend a chunk of generated JS to this source node.\n\n* `chunk`: A string snippet of generated JS code, another instance of\n `SourceNode`, or an array where each member is one of those things.\n\n#### SourceNode.prototype.setSourceContent(sourceFile, sourceContent)\n\nSet the source content for a source file. This will be added to the\n`SourceMap` in the `sourcesContent` field.\n\n* `sourceFile`: The filename of the source file\n\n* `sourceContent`: The content of the source file\n\n#### SourceNode.prototype.walk(fn)\n\nWalk over the tree of JS snippets in this node and its children. The walking\nfunction is called once for each snippet of JS and is passed that snippet and\nthe its original associated source\'s line/column location.\n\n* `fn`: The traversal function.\n\n#### SourceNode.prototype.walkSourceContents(fn)\n\nWalk over the tree of SourceNodes. The walking function is called for each\nsource file content and is passed the filename and source content.\n\n* `fn`: The traversal function.\n\n#### SourceNode.prototype.join(sep)\n\nLike `Array.prototype.join` except for SourceNodes. Inserts the separator\nbetween each of this source node\'s children.\n\n* `sep`: The separator.\n\n#### SourceNode.prototype.replaceRight(pattern, replacement)\n\nCall `String.prototype.replace` on the very right-most source snippet. Useful\nfor trimming whitespace from the end of a source node, etc.\n\n* `pattern`: The pattern to replace.\n\n* `replacement`: The thing to replace the pattern with.\n\n#### SourceNode.prototype.toString()\n\nReturn the string representation of this source node. Walks over the tree and\nconcatenates all the various snippets together to one string.\n\n#### SourceNode.prototype.toStringWithSourceMap([startOfSourceMap])\n\nReturns the string representation of this tree of source nodes, plus a\nSourceMapGenerator which contains all the mappings between the generated and\noriginal sources.\n\nThe arguments are the same as those to `new SourceMapGenerator`.\n\n## Tests\n\n[](https://travis-ci.org/mozilla/source-map)\n\nInstall NodeJS version 0.8.0 or greater, then run `node test/run-tests.js`.\n\nTo add new tests, create a new file named `test/test-<your new test name>.js`\nand export your test functions with names that start with "test", for example\n\n exports["test doing the foo bar"] = function (assert, util) {\n ...\n };\n\nThe new test will be located automatically when you run the suite.\n\nThe `util` argument is the test utility module located at `test/source-map/util`.\n\nThe `assert` argument is a cut down version of node\'s assert module. You have\naccess to the following assertion functions:\n\n* `doesNotThrow`\n\n* `equal`\n\n* `ok`\n\n* `strictEqual`\n\n* `throws`\n\n(The reason for the restricted set of test functions is because we need the\ntests to run inside Firefox\'s test suite as well and so the assert module is\nshimmed in that environment. See `build/assert-shim.js`.)\n\n[format]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit\n[feature]: https://wiki.mozilla.org/DevTools/Features/SourceMap\n[Dryice]: https://github.com/mozilla/dryice\n', | |
| 84149 silly resolved readmeFilename: 'README.md', | |
| 84149 silly resolved bugs: { url: 'https://github.com/mozilla/source-map/issues' }, | |
| 84149 silly resolved _id: 'source-map@0.1.43', | |
| 84149 silly resolved _from: 'source-map@~0.1.40' }, | |
| 84149 silly resolved { author: { name: 'Ben Newman', email: 'bn@cs.stanford.edu' }, | |
| 84149 silly resolved name: 'ast-types', | |
| 84149 silly resolved description: 'Esprima-compatible implementation of the Mozilla JS Parser API', | |
| 84149 silly resolved keywords: | |
| 84149 silly resolved [ 'ast', | |
| 84149 silly resolved 'abstract syntax tree', | |
| 84149 silly resolved 'hierarchy', | |
| 84149 silly resolved 'mozilla', | |
| 84149 silly resolved 'spidermonkey', | |
| 84149 silly resolved 'parser api', | |
| 84149 silly resolved 'esprima', | |
| 84149 silly resolved 'types', | |
| 84149 silly resolved 'type system', | |
| 84149 silly resolved 'type checking', | |
| 84149 silly resolved 'dynamic types', | |
| 84149 silly resolved 'parsing', | |
| 84149 silly resolved 'transformation', | |
| 84149 silly resolved 'syntax' ], | |
| 84149 silly resolved version: '0.6.16', | |
| 84149 silly resolved homepage: 'http://github.com/benjamn/ast-types', | |
| 84149 silly resolved repository: { type: 'git', url: 'git://github.com/benjamn/ast-types.git' }, | |
| 84149 silly resolved license: 'MIT', | |
| 84149 silly resolved main: 'main.js', | |
| 84149 silly resolved scripts: { test: 'mocha --reporter spec test/run.js' }, | |
| 84149 silly resolved dependencies: {}, | |
| 84149 silly resolved devDependencies: | |
| 84149 silly resolved { esprima: '~1.2.2', | |
| 84149 silly resolved 'esprima-fb': '~7001.1.0-dev-harmony-fb', | |
| 84149 silly resolved mocha: '~1.20.1' }, | |
| 84149 silly resolved engines: { node: '>= 0.6' }, | |
| 84149 silly resolved readme: 'AST Types\n===\n\nThis module provides an efficient, modular,\n[Esprima](https://github.com/ariya/esprima)-compatible implementation of\nthe [abstract syntax\ntree](http://en.wikipedia.org/wiki/Abstract_syntax_tree) type hierarchy\npioneered by the [Mozilla Parser\nAPI](https://developer.mozilla.org/en-US/docs/SpiderMonkey/Parser_API).\n\n[](https://travis-ci.org/benjamn/ast-types)\n\nInstallation\n---\n\nFrom NPM:\n\n npm install ast-types\n\nFrom GitHub:\n\n cd path/to/node_modules\n git clone git://github.com/benjamn/ast-types.git\n cd ast-types\n npm install .\n\nBasic Usage\n---\n```js\nvar assert = require("assert");\nvar n = require("ast-types").namedTypes;\nvar b = require("ast-types").builders;\n\nvar fooId = b.identifier("foo");\nvar ifFoo = b.ifStatement(fooId, b.blockStatement([\n b.expressionStatement(b.callExpression(fooId, []))\n]));\n\nassert.ok(n.IfStatement.check(ifFoo));\nassert.ok(n.Statement.check(ifFoo));\nassert.ok(n.Node.check(ifFoo));\n\nassert.ok(n.BlockStatement.check(ifFoo.consequent));\nassert.strictEqual(\n ifFoo.consequent.body[0].expression.arguments.length,\n 0);\n\nassert.strictEqual(ifFoo.test, fooId);\nassert.ok(n.Expression.check(ifFoo.test));\nassert.ok(n.Identifier.check(ifFoo.test));\nassert.ok(!n.Statement.check(ifFoo.test));\n```\n\nAST Traversal\n---\n\nBecause it understands the AST type system so thoroughly, this library\nis able to provide excellent node iteration and traversal mechanisms.\n\nIf you want complete control over the traversal, and all you need is a way\nof enumerating the known fields of your AST nodes and getting their\nvalues, you may be interested in the primitives `getFieldNames` and\n`getFieldValue`:\n```js\nvar types = require("ast-types");\nvar partialFunExpr = { type: "FunctionExpression" };\n\n// Even though partialFunExpr doesn\'t actually contain all the fields that\n// are expected for a FunctionExpression, types.getFieldNames knows:\nconsole.log(types.getFieldNames(partialFunExpr));\n// [ \'type\', \'id\', \'params\', \'body\', \'generator\', \'expression\',\n// \'defaults\', \'rest\', \'async\' ]\n\n// For fields that have default values, types.getFieldValue will return\n// the default if the field is not actually defined.\nconsole.log(types.getFieldValue(partialFunExpr, "generator"));\n// false\n```\n\nTwo more low-level helper functions, `eachField` and `someField`, are\ndefined in terms of `getFieldNames` and `getFieldValue`:\n```js\n// Iterate over all defined fields of an object, including those missing\n// or undefined, passing each field name and effective value (as returned\n// by getFieldValue) to the callback. If the object has no corresponding\n// Def, the callback will never be called.\nexports.eachField = function(object, callback, context) {\n getFieldNames(object).forEach(function(name) {\n callback.call(this, name, getFieldValue(object, name));\n }, context);\n};\n\n// Similar to eachField, except that iteration stops as soon as the\n// callback returns a truthy value. Like Array.prototype.some, the final\n// result is either true or false to indicates whether the callback\n// returned true for any element or not.\nexports.someField = function(object, callback, context) {\n return getFieldNames(object).some(function(name) {\n return callback.call(this, name, getFieldValue(object, name));\n }, context);\n};\n```\n\nSo here\'s how you might make a copy of an AST node:\n```js\nvar copy = {};\nrequire("ast-types").eachField(node, function(name, value) {\n // Note that undefined fields will be visited too, according to\n // the rules associated with node.type, and default field values\n // will be substituted if appropriate.\n copy[name] = value;\n})\n```\n\nBut that\'s not all! You can also easily visit entire syntax trees using\nthe powerful `types.visit` abstraction.\n\nHere\'s a trivial example of how you might assert that `arguments.callee`\nis never used in `ast`:\n```js\nvar assert = require("assert");\nvar types = require("ast-types");\nvar n = types.namedTypes;\n\ntypes.visit(ast, {\n // This method will be called for any node with .type "MemberExpression":\n visitMemberExpression: function(path) {\n // Visitor methods receive a single argument, a NodePath object\n // wrapping the node of interest.\n var node = path.node;\n\n if (n.Identifier.check(node.object) &&\n node.object.name === "arguments" &&\n n.Identifier.check(node.property)) {\n assert.notStrictEqual(node.property.name, "callee");\n }\n\n // It\'s your responsibility to call this.traverse with some\n // NodePath object (usually the one passed into the visitor\n // method) before the visitor method returns, or return false to\n // indicate that the traversal need not continue any further down\n // this subtree.\n this.traverse(path);\n }\n});\n```\n\nHere\'s a slightly more involved example of transforming `...rest`\nparameters into browser-runnable ES5 JavaScript:\n\n```js\nvar b = types.builders;\n\n// Reuse the same AST structure for Array.prototype.slice.call.\nvar sliceExpr = b.memberExpression(\n b.memberExpression(\n b.memberExpression(\n b.identifier("Array"),\n b.identifier("prototype"),\n false\n ),\n b.identifier("slice"),\n false\n ),\n b.identifier("call"),\n false\n);\n\ntypes.visit(ast, {\n // This method will be called for any node whose type is a subtype of\n // Function (e.g., FunctionDeclaration, FunctionExpression, and\n // ArrowFunctionExpression). Note that types.visit precomputes a\n // lookup table from every known type to the appropriate visitor\n // method to call for nodes of that type, so the dispatch takes\n // constant time.\n visitFunction: function(path) {\n // Visitor methods receive a single argument, a NodePath object\n // wrapping the node of interest.\n var node = path.node;\n\n // It\'s your responsibility to call this.traverse with some\n // NodePath object (usually the one passed into the visitor\n // method) before the visitor method returns, or return false to\n // indicate that the traversal need not continue any further down\n // this subtree. An assertion will fail if you forget, which is\n // awesome, because it means you will never again make the\n // disastrous mistake of forgetting to traverse a subtree. Also\n // cool: because you can call this method at any point in the\n // visitor method, it\'s up to you whether your traversal is\n // pre-order, post-order, or both!\n this.traverse(path);\n\n // This traversal is only concerned with Function nodes that have\n // rest parameters.\n if (!node.rest) {\n return;\n }\n\n // For the purposes of this example, we won\'t worry about functions\n // with Expression bodies.\n n.BlockStatement.assert(node.body);\n\n // Use types.builders to build a variable declaration of the form\n //\n // var rest = Array.prototype.slice.call(arguments, n);\n //\n // where `rest` is the name of the rest parameter, and `n` is a\n // numeric literal specifying the number of named parameters the\n // function takes.\n var restVarDecl = b.variableDeclaration("var", [\n b.variableDeclarator(\n node.rest,\n b.callExpression(sliceExpr, [\n b.identifier("arguments"),\n b.literal(node.params.length)\n ])\n )\n ]);\n\n // Similar to doing node.body.body.unshift(restVarDecl), except\n // that the other NodePath objects wrapping body statements will\n // have their indexes updated to accommodate the new statement.\n path.get("body", "body").unshift(restVarDecl);\n\n // Nullify node.rest now that we have simulated the behavior of\n // the rest parameter using ordinary JavaScript.\n path.get("rest").replace(null);\n\n // There\'s nothing wrong with doing node.rest = null, but I wanted\n // to point out that the above statement has the same effect.\n assert.strictEqual(node.rest, null);\n }\n});\n```\n\nHere\'s how you might use `types.visit` to implement a function that\ndetermines if a given function node refers to `this`:\n\n```js\nfunction usesThis(funcNode) {\n n.Function.assert(funcNode);\n var result = false;\n\n types.visit(funcNode, {\n visitThisExpression: function(path) {\n result = true;\n\n // The quickest way to terminate the traversal is to call\n // this.abort(), which throws a special exception (instanceof\n // this.AbortRequest) that will be caught in the top-level\n // types.visit method, so you don\'t have to worry about\n // catching the exception yourself.\n this.abort();\n },\n\n visitFunction: function(path) {\n // ThisExpression nodes in nested scopes don\'t count as `this`\n // references for the original function node, so we can safely\n // avoid traversing this subtree.\n return false;\n },\n\n visitCallExpression: function(path) {\n var node = path.node;\n\n // If the function contains CallExpression nodes involving\n // super, those expressions will implicitly depend on the\n // value of `this`, even though they do not explicitly contain\n // any ThisExpression nodes.\n if (this.isSuperCallExpression(node)) {\n result = true;\n this.abort(); // Throws AbortRequest exception.\n }\n\n this.traverse(path);\n },\n\n // Yes, you can define arbitrary helper methods.\n isSuperCallExpression: function(callExpr) {\n n.CallExpression.assert(callExpr);\n return this.isSuperIdentifier(callExpr.callee)\n || this.isSuperMemberExpression(callExpr.callee);\n },\n\n // And even helper helper methods!\n isSuperIdentifier: function(node) {\n return n.Identifier.check(node.callee)\n && node.callee.name === "super";\n },\n\n isSuperMemberExpression: function(node) {\n return n.MemberExpression.check(node.callee)\n && n.Identifier.check(node.callee.object)\n && node.callee.object.name === "super";\n }\n });\n\n return result;\n}\n```\n\nAs you might guess, when an `AbortRequest` is thrown from a subtree, the\nexception will propagate from the corresponding calls to `this.traverse`\nin the ancestor visitor methods. If you decide you want to cancel the\nrequest, simply catch the exception and call its `.cancel()` method. The\nrest of the subtree beneath the `try`-`catch` block will be abandoned, but\nthe remaining siblings of the ancestor node will still be visited.\n\nNodePath\n---\n\nThe `NodePath` object passed to visitor methods is a wrapper around an AST\nnode, and it serves to provide access to the chain of ancestor objects\n(all the way back to the root of the AST) and scope information.\n\nIn general, `path.node` refers to the wrapped node, `path.parent.node`\nrefers to the nearest `Node` ancestor, `path.parent.parent.node` to the\ngrandparent, and so on.\n\nNote that `path.node` may not be a direct property value of\n`path.parent.node`; for instance, it might be the case that `path.node` is\nan element of an array that is a direct child of the parent node:\n```js\npath.node === path.parent.node.elements[3]\n```\nin which case you should know that `path.parentPath` provides\nfiner-grained access to the complete path of objects (not just the `Node`\nones) from the root of the AST:\n```js\n// In reality, path.parent is the grandparent of path:\npath.parentPath.parentPath === path.parent\n\n// The path.parentPath object wraps the elements array (note that we use\n// .value because the elements array is not a Node):\npath.parentPath.value === path.parent.node.elements\n\n// The path.node object is the fourth element in that array:\npath.parentPath.value[3] === path.node\n\n// Unlike path.node and path.value, which are synonyms because path.node\n// is a Node object, path.parentPath.node is distinct from\n// path.parentPath.value, because the elements array is not a\n// Node. Instead, path.parentPath.node refers to the closest ancestor\n// Node, which happens to be the same as path.parent.node:\npath.parentPath.node === path.parent.node\n\n// The path is named for its index in the elements array:\npath.name === 3\n\n// Likewise, path.parentPath is named for the property by which\n// path.parent.node refers to it:\npath.parentPath.name === "elements"\n\n// Putting it all together, we can follow the chain of object references\n// from path.parent.node all the way to path.node by accessing each\n// property by name:\npath.parent.node[path.parentPath.name][path.name] === path.node\n```\n\nThese `NodePath` objects are created during the traversal without\nmodifying the AST nodes themselves, so it\'s not a problem if the same node\nappears more than once in the AST (like `Array.prototype.slice.call` in\nthe example above), because it will be visited with a distict `NodePath`\neach time it appears.\n\nChild `NodePath` objects are created lazily, by calling the `.get` method\nof a parent `NodePath` object:\n```js\n// If a NodePath object for the elements array has never been created\n// before, it will be created here and cached in the future:\npath.get("elements").get(3).value === path.value.elements[3]\n\n// Alternatively, you can pass multiple property names to .get instead of\n// chaining multiple .get calls:\npath.get("elements", 0).value === path.value.elements[0]\n```\n\n`NodePath` objects support a number of useful methods:\n```js\n// Replace one node with another node:\nvar fifth = path.get("elements", 4);\nfifth.replace(newNode);\n\n// Now do some stuff that might rearrange the list, and this replacement\n// remains safe:\nfifth.replace(newerNode);\n\n// Replace the third element in an array with two new nodes:\npath.get("elements", 2).replace(\n b.identifier("foo"),\n b.thisExpression()\n);\n\n// Remove a node and its parent if it would leave a redundant AST node:\n//e.g. var t = 1, y =2; removing the `t` and `y` declarators results in `var undefined`.\npath.prune(); //returns the closest parent `NodePath`.\n\n// Remove a node from a list of nodes:\npath.get("elements", 3).replace();\n\n// Add three new nodes to the beginning of a list of nodes:\npath.get("elements").unshift(a, b, c);\n\n// Remove and return the first node in a list of nodes:\npath.get("elements").shift();\n\n// Push two new nodes onto the end of a list of nodes:\npath.get("elements").push(d, e);\n\n// Remove and return the last node in a list of nodes:\npath.get("elements").pop();\n\n// Insert a new node before/after the seventh node in a list of nodes:\nvar seventh = path.get("elements", 6);\nseventh.insertBefore(newNode);\nseventh.insertAfter(newNode);\n\n// Insert a new element at index 5 in a list of nodes:\npath.get("elements").insertAt(5, newNode);\n```\n\nScope\n---\n\nThe object exposed as `path.scope` during AST traversals provides\ninformation about variable and function declarations in the scope that\ncontains `path.node`. See [scope.js](lib/scope.js) for its public\ninterface, which currently includes `.isGlobal`, `.getGlobalScope()`,\n`.depth`, `.declares(name)`, `.lookup(name)`, and `.getBindings()`.\n\nCustom AST Node Types\n---\n\nThe `ast-types` module was designed to be extended. To that end, it\nprovides a readable, declarative syntax for specifying new AST node types,\nbased primarily upon the `require("ast-types").Type.def` function:\n```js\nvar types = require("ast-types");\nvar def = types.Type.def;\nvar string = types.builtInTypes.string;\nvar b = types.builders;\n\n// Suppose you need a named File type to wrap your Programs.\ndef("File")\n .bases("Node")\n .build("name", "program")\n .field("name", string)\n .field("program", def("Program"));\n\n// Prevent further modifications to the File type (and any other\n// types newly introduced by def(...)).\ntypes.finalize();\n\n// The b.file builder function is now available. It expects two\n// arguments, as named by .build("name", "program") above.\nvar main = b.file("main.js", b.program([\n // Pointless program contents included for extra color.\n b.functionDeclaration(b.identifier("succ"), [\n b.identifier("x")\n ], b.blockStatement([\n b.returnStatement(\n b.binaryExpression(\n "+", b.identifier("x"), b.literal(1)\n )\n )\n ]))\n]));\n\nassert.strictEqual(main.name, "main.js");\nassert.strictEqual(main.program.body[0].params[0].name, "x");\n// etc.\n\n// If you pass the wrong type of arguments, or fail to pass enough\n// arguments, an AssertionError will be thrown.\n\nb.file(b.blockStatement([]));\n// ==> AssertionError: {"body":[],"type":"BlockStatement","loc":null} does not match type string\n\nb.file("lib/types.js", b.thisExpression());\n// ==> AssertionError: {"type":"ThisExpression","loc":null} does not match type Program\n```\nThe `def` syntax is used to define all the default AST node types found in\n[core.js](def/core.js),\n[es6.js](def/es6.js),\n[mozilla.js](def/mozilla.js),\n[e4x.js](def/e4x.js), and\n[fb-harmony.js](def/fb-harmony.js), so you have\nno shortage of examples to learn from.\n', | |
| 84149 silly resolved readmeFilename: 'README.md', | |
| 84149 silly resolved bugs: { url: 'https://github.com/benjamn/ast-types/issues' }, | |
| 84149 silly resolved _id: 'ast-types@0.6.16', | |
| 84149 silly resolved _from: 'ast-types@~0.6.1', | |
| 84149 silly resolved dist: { shasum: '45d47745732bfbfed419d18f653006192ada41b1' }, | |
| 84149 silly resolved _resolved: 'https://registry.npmjs.org/ast-types/-/ast-types-0.6.16.tgz' }, | |
| 84149 silly resolved { name: 'esprima-fb', | |
| 84149 silly resolved description: 'Facebook-specific fork of the esprima project', | |
| 84149 silly resolved homepage: 'https://github.com/facebook/esprima/tree/fb-harmony', | |
| 84149 silly resolved main: 'esprima.js', | |
| 84149 silly resolved bin: | |
| 84149 silly resolved { esparse: './bin/esparse.js', | |
| 84149 silly resolved esvalidate: './bin/esvalidate.js' }, | |
| 84149 silly resolved version: '10001.1.0-dev-harmony-fb', | |
| 84149 silly resolved files: | |
| 84149 silly resolved [ 'bin', | |
| 84149 silly resolved 'test/run.js', | |
| 84149 silly resolved 'test/runner.js', | |
| 84149 silly resolved 'test/test.js', | |
| 84149 silly resolved 'test/compat.js', | |
| 84149 silly resolved 'test/reflect.js', | |
| 84149 silly resolved 'esprima.js' ], | |
| 84149 silly resolved engines: { node: '>=0.4.0' }, | |
| 84149 silly resolved author: { name: 'Ariya Hidayat', email: 'ariya.hidayat@gmail.com' }, | |
| 84149 silly resolved maintainers: [ [Object] ], | |
| 84149 silly resolved repository: { type: 'git', url: 'http://github.com/facebook/esprima.git' }, | |
| 84149 silly resolved bugs: { url: 'http://issues.esprima.org' }, | |
| 84149 silly resolved licenses: [ [Object] ], | |
| 84149 silly resolved devDependencies: | |
| 84149 silly resolved { jslint: '~0.1.9', | |
| 84149 silly resolved eslint: '~0.1.0', | |
| 84149 silly resolved istanbul: '~0.2.6', | |
| 84149 silly resolved 'complexity-report': '~0.6.1', | |
| 84149 silly resolved regenerate: '~0.5.4', | |
| 84149 silly resolved 'unicode-6.3.0': '~0.1.0', | |
| 84149 silly resolved 'json-diff': '~0.3.1', | |
| 84149 silly resolved commander: '~2.5.0' }, | |
| 84149 silly resolved scripts: | |
| 84149 silly resolved { test: 'npm run-script lint && node test/run.js && npm run-script coverage && npm run-script complexity', | |
| 84149 silly resolved lint: 'node tools/check-version.js && node node_modules/eslint/bin/eslint.js esprima.js && node node_modules/jslint/bin/jslint.js esprima.js', | |
| 84149 silly resolved coverage: 'npm run-script analyze-coverage && npm run-script check-coverage', | |
| 84149 silly resolved 'analyze-coverage': 'node node_modules/istanbul/lib/cli.js cover test/runner.js', | |
| 84149 silly resolved 'check-coverage': 'node node_modules/istanbul/lib/cli.js check-coverage --statement 100 --branch 100 --function 100', | |
| 84149 silly resolved complexity: 'npm run-script analyze-complexity && npm run-script check-complexity', | |
| 84149 silly resolved 'analyze-complexity': 'node tools/list-complexity.js', | |
| 84149 silly resolved 'check-complexity': 'node node_modules/complexity-report/src/cli.js --maxcc 31 --silent -l -w esprima.js', | |
| 84149 silly resolved benchmark: 'node test/benchmarks.js', | |
| 84149 silly resolved 'benchmark-quick': 'node test/benchmarks.js quick' }, | |
| 84149 silly resolved readme: '**Esprima** ([esprima.org](http://esprima.org), BSD license) is a high performance,\nstandard-compliant [ECMAScript](http://www.ecma-international.org/publications/standards/Ecma-262.htm)\nparser written in ECMAScript (also popularly known as\n[JavaScript](http://en.wikipedia.org/wiki/JavaScript>JavaScript)).\nEsprima is created and maintained by [Ariya Hidayat](http://twitter.com/ariyahidayat),\nwith the help of [many contributors](https://github.com/ariya/esprima/contributors).\n\n**Esprima-FB** is a fork of the [Harmony branch](https://github.com/ariya/esprima/tree/harmony) of Esprima that implements [JSX specification](https://github.com/facebook/jsx) on top of ECMAScript syntax.\n\n### Features\n\n- Full support for ECMAScript 5.1 ([ECMA-262](http://www.ecma-international.org/publications/standards/Ecma-262.htm))\n- Experimental support for ES6/Harmony (module, class, destructuring, ...)\n- Full support for [JSX syntax extensions](https://github.com/facebook/jsx).\n- Sensible [syntax tree format](https://github.com/facebook/jsx/blob/master/AST.md) compatible with Mozilla\n[Parser AST](https://developer.mozilla.org/en/SpiderMonkey/Parser_API)\n- Optional tracking of syntax node location (index-based and line-column)\n- Heavily tested (> 650 [unit tests](http://esprima.org/test/) with [full code coverage](http://esprima.org/test/coverage.html))\n- Ongoing support for ES6/Harmony (module, class, destructuring, ...)\n\n### Versioning rules\n\nIn order to follow semver rules and keep reference to original Esprima versions at the same time, we left 3 digits of each version part to refer to upstream harmony branch. We then take the most significant digit.\n\n**Example:** 4001.3001.0000-dev-harmony-fb aligns with 1.1.0-dev-harmony (aka 001.001.000-dev-harmony) in upstream, with our own changes on top.\n\nEsprima-FB serves as a **building block** for JSX language tools and transpiler implementations (such as [React](https://github.com/facebook/react) or [JSXDOM](https://github.com/vjeux/jsxdom)).\n\nEsprima-FB runs on many popular web browsers, as well as other ECMAScript platforms such as\n[Rhino](http://www.mozilla.org/rhino) and [Node.js](https://npmjs.org/package/esprima).\n\nFor more information on original Esprima, check the web site [esprima.org](http://esprima.org).\n', | |
| 84149 silly resolved readmeFilename: 'README.md', | |
| 84149 silly resolved _id: 'esprima-fb@10001.1.0-dev-harmony-fb', | |
| 84149 silly resolved _from: 'esprima-fb@~10001.1.0-dev-harmony-fb', | |
| 84149 silly resolved dist: { shasum: 'f0eb2362ab2c5277df89d6bc6720a11511e5307a' }, | |
| 84149 silly resolved _resolved: 'https://registry.npmjs.org/esprima-fb/-/esprima-fb-10001.1.0-dev-harmony-fb.tgz' } ] | |
| 84150 info install source-map@0.1.43 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast | |
| 84151 info install ast-types@0.6.16 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast | |
| 84152 info install esprima-fb@10001.1.0-dev-harmony-fb into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast | |
| 84153 info installOne source-map@0.1.43 | |
| 84154 info installOne ast-types@0.6.16 | |
| 84155 info installOne esprima-fb@10001.1.0-dev-harmony-fb | |
| 84156 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\source-map unbuild | |
| 84157 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\ast-types unbuild | |
| 84158 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\esprima-fb unbuild | |
| 84159 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.1.43\package.tgz | |
| 84160 silly lockFile 7356bf3e-s-recast-node-modules-source-map tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\source-map | |
| 84161 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\source-map C:\Users\Vince\AppData\Roaming\npm-cache\7356bf3e-s-recast-node-modules-source-map.lock | |
| 84162 silly lockFile b1c5b5bb-he-source-map-0-1-43-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.1.43\package.tgz | |
| 84163 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.1.43\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\b1c5b5bb-he-source-map-0-1-43-package-tgz.lock | |
| 84164 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.6.16\package.tgz | |
| 84165 silly lockFile 4b55f14e-es-recast-node-modules-ast-types tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\ast-types | |
| 84166 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\ast-types C:\Users\Vince\AppData\Roaming\npm-cache\4b55f14e-es-recast-node-modules-ast-types.lock | |
| 84167 silly lockFile 09af4191-che-ast-types-0-6-16-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.6.16\package.tgz | |
| 84168 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.6.16\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\09af4191-che-ast-types-0-6-16-package-tgz.lock | |
| 84169 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package.tgz | |
| 84170 silly lockFile 9e31dec1-s-recast-node-modules-esprima-fb tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\esprima-fb | |
| 84171 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\esprima-fb C:\Users\Vince\AppData\Roaming\npm-cache\9e31dec1-s-recast-node-modules-esprima-fb.lock | |
| 84172 silly lockFile e5ab5e09-1-1-0-dev-harmony-fb-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package.tgz | |
| 84173 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\e5ab5e09-1-1-0-dev-harmony-fb-package-tgz.lock | |
| 84174 silly gunzTarPerm modes [ '755', '644' ] | |
| 84175 silly gunzTarPerm modes [ '755', '644' ] | |
| 84176 silly gunzTarPerm extractEntry lib/babel/generation/generators/modules.js | |
| 84177 silly gunzTarPerm modified mode [ 'lib/babel/generation/generators/modules.js', 438, 420 ] | |
| 84178 silly gunzTarPerm extractEntry lib/babel/generation/generators/statements.js | |
| 84179 silly gunzTarPerm modified mode [ 'lib/babel/generation/generators/statements.js', 438, 420 ] | |
| 84180 silly gunzTarPerm modes [ '755', '644' ] | |
| 84181 silly gunzTarPerm extractEntry package.json | |
| 84182 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 84183 silly gunzTarPerm extractEntry package.json | |
| 84184 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 84185 silly gunzTarPerm extractEntry package.json | |
| 84186 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 84187 silly gunzTarPerm extractEntry .npmignore | |
| 84188 silly gunzTarPerm modified mode [ '.npmignore', 438, 420 ] | |
| 84189 silly gunzTarPerm extractEntry README.md | |
| 84190 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 84191 silly gunzTarPerm extractEntry .npmignore | |
| 84192 silly gunzTarPerm modified mode [ '.npmignore', 438, 420 ] | |
| 84193 silly gunzTarPerm extractEntry README.md | |
| 84194 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 84195 silly gunzTarPerm extractEntry README.md | |
| 84196 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 84197 silly gunzTarPerm extractEntry esprima.js | |
| 84198 silly gunzTarPerm modified mode [ 'esprima.js', 438, 420 ] | |
| 84199 silly gunzTarPerm extractEntry LICENSE | |
| 84200 silly gunzTarPerm modified mode [ 'LICENSE', 438, 420 ] | |
| 84201 silly gunzTarPerm extractEntry LICENSE | |
| 84202 silly gunzTarPerm modified mode [ 'LICENSE', 438, 420 ] | |
| 84203 silly gunzTarPerm extractEntry bin/esparse.js | |
| 84204 silly gunzTarPerm modified mode [ 'bin/esparse.js', 438, 420 ] | |
| 84205 silly gunzTarPerm extractEntry main.js | |
| 84206 silly gunzTarPerm modified mode [ 'main.js', 438, 420 ] | |
| 84207 silly gunzTarPerm extractEntry .travis.yml | |
| 84208 silly gunzTarPerm modified mode [ '.travis.yml', 438, 420 ] | |
| 84209 silly gunzTarPerm extractEntry Makefile.dryice.js | |
| 84210 silly gunzTarPerm modified mode [ 'Makefile.dryice.js', 438, 420 ] | |
| 84211 silly gunzTarPerm extractEntry .travis.yml | |
| 84212 silly gunzTarPerm modified mode [ '.travis.yml', 438, 420 ] | |
| 84213 silly gunzTarPerm extractEntry bin/esvalidate.js | |
| 84214 silly gunzTarPerm modified mode [ 'bin/esvalidate.js', 438, 420 ] | |
| 84215 silly gunzTarPerm extractEntry test/compat.js | |
| 84216 silly gunzTarPerm modified mode [ 'test/compat.js', 438, 420 ] | |
| 84217 silly gunzTarPerm extractEntry lib/babel/generation/generators/template-literals.js | |
| 84218 silly gunzTarPerm modified mode [ 'lib/babel/generation/generators/template-literals.js', | |
| 84218 silly gunzTarPerm 438, | |
| 84218 silly gunzTarPerm 420 ] | |
| 84219 silly gunzTarPerm extractEntry lib/babel/generation/generators/types.js | |
| 84220 silly gunzTarPerm modified mode [ 'lib/babel/generation/generators/types.js', 438, 420 ] | |
| 84221 silly gunzTarPerm extractEntry build/assert-shim.js | |
| 84222 silly gunzTarPerm modified mode [ 'build/assert-shim.js', 438, 420 ] | |
| 84223 silly gunzTarPerm extractEntry build/mini-require.js | |
| 84224 silly gunzTarPerm modified mode [ 'build/mini-require.js', 438, 420 ] | |
| 84225 silly gunzTarPerm extractEntry def/core.js | |
| 84226 silly gunzTarPerm modified mode [ 'def/core.js', 438, 420 ] | |
| 84227 silly gunzTarPerm extractEntry def/e4x.js | |
| 84228 silly gunzTarPerm modified mode [ 'def/e4x.js', 438, 420 ] | |
| 84229 silly gunzTarPerm extractEntry def/es6.js | |
| 84230 silly gunzTarPerm modified mode [ 'def/es6.js', 438, 420 ] | |
| 84231 silly gunzTarPerm extractEntry def/es7.js | |
| 84232 silly gunzTarPerm modified mode [ 'def/es7.js', 438, 420 ] | |
| 84233 silly gunzTarPerm extractEntry build/suffix-browser.js | |
| 84234 silly gunzTarPerm modified mode [ 'build/suffix-browser.js', 438, 420 ] | |
| 84235 silly gunzTarPerm extractEntry build/test-prefix.js | |
| 84236 silly gunzTarPerm modified mode [ 'build/test-prefix.js', 438, 420 ] | |
| 84237 silly gunzTarPerm extractEntry lib/babel/generation/generators/jsx.js | |
| 84238 silly gunzTarPerm modified mode [ 'lib/babel/generation/generators/jsx.js', 438, 420 ] | |
| 84239 silly gunzTarPerm extractEntry lib/babel/generation/node/index.js | |
| 84240 silly gunzTarPerm modified mode [ 'lib/babel/generation/node/index.js', 438, 420 ] | |
| 84241 silly gunzTarPerm extractEntry def/fb-harmony.js | |
| 84242 silly gunzTarPerm modified mode [ 'def/fb-harmony.js', 438, 420 ] | |
| 84243 silly gunzTarPerm extractEntry def/mozilla.js | |
| 84244 silly gunzTarPerm modified mode [ 'def/mozilla.js', 438, 420 ] | |
| 84245 silly gunzTarPerm extractEntry lib/babel/generation/node/parentheses.js | |
| 84246 silly gunzTarPerm modified mode [ 'lib/babel/generation/node/parentheses.js', 438, 420 ] | |
| 84247 silly gunzTarPerm extractEntry lib/babel/generation/node/whitespace.js | |
| 84248 silly gunzTarPerm modified mode [ 'lib/babel/generation/node/whitespace.js', 438, 420 ] | |
| 84249 silly gunzTarPerm extractEntry lib/equiv.js | |
| 84250 silly gunzTarPerm modified mode [ 'lib/equiv.js', 438, 420 ] | |
| 84251 silly gunzTarPerm extractEntry lib/node-path.js | |
| 84252 silly gunzTarPerm modified mode [ 'lib/node-path.js', 438, 420 ] | |
| 84253 silly gunzTarPerm extractEntry build/test-suffix.js | |
| 84254 silly gunzTarPerm modified mode [ 'build/test-suffix.js', 438, 420 ] | |
| 84255 silly gunzTarPerm extractEntry build/prefix-source-map.jsm | |
| 84256 silly gunzTarPerm modified mode [ 'build/prefix-source-map.jsm', 438, 420 ] | |
| 84257 silly gunzTarPerm extractEntry lib/babel/tools/build-external-helpers.js | |
| 84258 silly gunzTarPerm modified mode [ 'lib/babel/tools/build-external-helpers.js', 438, 420 ] | |
| 84259 silly gunzTarPerm extractEntry lib/babel/tools/resolve-rc.js | |
| 84260 silly gunzTarPerm modified mode [ 'lib/babel/tools/resolve-rc.js', 438, 420 ] | |
| 84261 silly gunzTarPerm extractEntry build/prefix-utils.jsm | |
| 84262 silly gunzTarPerm modified mode [ 'build/prefix-utils.jsm', 438, 420 ] | |
| 84263 silly gunzTarPerm extractEntry build/suffix-source-map.jsm | |
| 84264 silly gunzTarPerm modified mode [ 'build/suffix-source-map.jsm', 438, 420 ] | |
| 84265 silly gunzTarPerm extractEntry lib/babel/transformation/index.js | |
| 84266 silly gunzTarPerm modified mode [ 'lib/babel/transformation/index.js', 438, 420 ] | |
| 84267 silly gunzTarPerm extractEntry lib/babel/transformation/transformer-pass.js | |
| 84268 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformer-pass.js', 438, 420 ] | |
| 84269 silly gunzTarPerm extractEntry lib/path-visitor.js | |
| 84270 silly gunzTarPerm modified mode [ 'lib/path-visitor.js', 438, 420 ] | |
| 84271 silly gunzTarPerm extractEntry lib/path.js | |
| 84272 silly gunzTarPerm modified mode [ 'lib/path.js', 438, 420 ] | |
| 84273 silly gunzTarPerm extractEntry build/suffix-utils.jsm | |
| 84274 silly gunzTarPerm modified mode [ 'build/suffix-utils.jsm', 438, 420 ] | |
| 84275 silly gunzTarPerm extractEntry CHANGELOG.md | |
| 84276 silly gunzTarPerm modified mode [ 'CHANGELOG.md', 438, 420 ] | |
| 84277 silly gunzTarPerm extractEntry lib/scope.js | |
| 84278 silly gunzTarPerm modified mode [ 'lib/scope.js', 438, 420 ] | |
| 84279 silly gunzTarPerm extractEntry lib/shared.js | |
| 84280 silly gunzTarPerm modified mode [ 'lib/shared.js', 438, 420 ] | |
| 84281 silly gunzTarPerm extractEntry lib/babel/transformation/transformer.js | |
| 84282 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformer.js', 438, 420 ] | |
| 84283 silly gunzTarPerm extractEntry lib/babel/transformation/file/index.js | |
| 84284 silly gunzTarPerm modified mode [ 'lib/babel/transformation/file/index.js', 438, 420 ] | |
| 84285 silly gunzTarPerm extractEntry lib/babel/transformation/file/logger.js | |
| 84286 silly gunzTarPerm modified mode [ 'lib/babel/transformation/file/logger.js', 438, 420 ] | |
| 84287 silly gunzTarPerm extractEntry lib/babel/transformation/file/option-parsers.js | |
| 84288 silly gunzTarPerm modified mode [ 'lib/babel/transformation/file/option-parsers.js', 438, 420 ] | |
| 84289 silly gunzTarPerm extractEntry lib/source-map.js | |
| 84290 silly gunzTarPerm modified mode [ 'lib/source-map.js', 438, 420 ] | |
| 84291 silly gunzTarPerm extractEntry lib/source-map/array-set.js | |
| 84292 silly gunzTarPerm modified mode [ 'lib/source-map/array-set.js', 438, 420 ] | |
| 84293 silly gunzTarPerm extractEntry lib/types.js | |
| 84294 silly gunzTarPerm modified mode [ 'lib/types.js', 438, 420 ] | |
| 84295 silly gunzTarPerm extractEntry lib/source-map/base64-vlq.js | |
| 84296 silly gunzTarPerm modified mode [ 'lib/source-map/base64-vlq.js', 438, 420 ] | |
| 84297 silly gunzTarPerm extractEntry lib/source-map/base64.js | |
| 84298 silly gunzTarPerm modified mode [ 'lib/source-map/base64.js', 438, 420 ] | |
| 84299 silly gunzTarPerm extractEntry lib/source-map/binary-search.js | |
| 84300 silly gunzTarPerm modified mode [ 'lib/source-map/binary-search.js', 438, 420 ] | |
| 84301 silly gunzTarPerm extractEntry lib/source-map/mapping-list.js | |
| 84302 silly gunzTarPerm modified mode [ 'lib/source-map/mapping-list.js', 438, 420 ] | |
| 84303 silly gunzTarPerm extractEntry lib/babel/transformation/file/options.json | |
| 84304 silly gunzTarPerm modified mode [ 'lib/babel/transformation/file/options.json', 438, 420 ] | |
| 84305 silly gunzTarPerm extractEntry lib/babel/transformation/helpers/build-binary-assignment-operator-transformer.js | |
| 84306 silly gunzTarPerm modified mode [ 'lib/babel/transformation/helpers/build-binary-assignment-operator-transformer.js', | |
| 84306 silly gunzTarPerm 438, | |
| 84306 silly gunzTarPerm 420 ] | |
| 84307 silly gunzTarPerm extractEntry lib/source-map/source-map-consumer.js | |
| 84308 silly gunzTarPerm modified mode [ 'lib/source-map/source-map-consumer.js', 438, 420 ] | |
| 84309 silly gunzTarPerm extractEntry lib/source-map/source-map-generator.js | |
| 84310 silly gunzTarPerm modified mode [ 'lib/source-map/source-map-generator.js', 438, 420 ] | |
| 84311 silly gunzTarPerm extractEntry lib/babel/transformation/helpers/call-delegate.js | |
| 84312 silly gunzTarPerm modified mode [ 'lib/babel/transformation/helpers/call-delegate.js', 438, 420 ] | |
| 84313 silly gunzTarPerm extractEntry lib/babel/transformation/helpers/define-map.js | |
| 84314 silly gunzTarPerm modified mode [ 'lib/babel/transformation/helpers/define-map.js', 438, 420 ] | |
| 84315 silly gunzTarPerm extractEntry lib/source-map/source-node.js | |
| 84316 silly gunzTarPerm modified mode [ 'lib/source-map/source-node.js', 438, 420 ] | |
| 84317 silly gunzTarPerm extractEntry lib/source-map/util.js | |
| 84318 silly gunzTarPerm modified mode [ 'lib/source-map/util.js', 438, 420 ] | |
| 84319 silly gunzTarPerm extractEntry lib/babel/transformation/helpers/explode-assignable-expression.js | |
| 84320 silly gunzTarPerm modified mode [ 'lib/babel/transformation/helpers/explode-assignable-expression.js', | |
| 84320 silly gunzTarPerm 438, | |
| 84320 silly gunzTarPerm 420 ] | |
| 84321 silly gunzTarPerm extractEntry lib/babel/transformation/helpers/build-react-transformer.js | |
| 84322 silly gunzTarPerm modified mode [ 'lib/babel/transformation/helpers/build-react-transformer.js', | |
| 84322 silly gunzTarPerm 438, | |
| 84322 silly gunzTarPerm 420 ] | |
| 84323 silly gunzTarPerm extractEntry test/run-tests.js | |
| 84324 silly gunzTarPerm modified mode [ 'test/run-tests.js', 438, 420 ] | |
| 84325 silly gunzTarPerm extractEntry test/source-map/test-api.js | |
| 84326 silly gunzTarPerm modified mode [ 'test/source-map/test-api.js', 438, 420 ] | |
| 84327 silly gunzTarPerm extractEntry lib/babel/transformation/helpers/memoise-decorators.js | |
| 84328 silly gunzTarPerm modified mode [ 'lib/babel/transformation/helpers/memoise-decorators.js', | |
| 84328 silly gunzTarPerm 438, | |
| 84328 silly gunzTarPerm 420 ] | |
| 84329 silly gunzTarPerm extractEntry lib/babel/transformation/helpers/name-method.js | |
| 84330 silly gunzTarPerm modified mode [ 'lib/babel/transformation/helpers/name-method.js', 438, 420 ] | |
| 84331 silly gunzTarPerm extractEntry test/source-map/test-base64-vlq.js | |
| 84332 silly gunzTarPerm modified mode [ 'test/source-map/test-base64-vlq.js', 438, 420 ] | |
| 84333 silly gunzTarPerm extractEntry test/source-map/test-base64.js | |
| 84334 silly gunzTarPerm modified mode [ 'test/source-map/test-base64.js', 438, 420 ] | |
| 84335 silly gunzTarPerm extractEntry test/source-map/test-binary-search.js | |
| 84336 silly gunzTarPerm modified mode [ 'test/source-map/test-binary-search.js', 438, 420 ] | |
| 84337 silly gunzTarPerm extractEntry test/source-map/test-array-set.js | |
| 84338 silly gunzTarPerm modified mode [ 'test/source-map/test-array-set.js', 438, 420 ] | |
| 84339 silly gunzTarPerm extractEntry lib/babel/transformation/helpers/react.js | |
| 84340 silly gunzTarPerm modified mode [ 'lib/babel/transformation/helpers/react.js', 438, 420 ] | |
| 84341 silly gunzTarPerm extractEntry lib/babel/transformation/helpers/regex.js | |
| 84342 silly gunzTarPerm modified mode [ 'lib/babel/transformation/helpers/regex.js', 438, 420 ] | |
| 84343 silly gunzTarPerm extractEntry lib/babel/transformation/helpers/remap-async-to-generator.js | |
| 84344 silly gunzTarPerm modified mode [ 'lib/babel/transformation/helpers/remap-async-to-generator.js', | |
| 84344 silly gunzTarPerm 438, | |
| 84344 silly gunzTarPerm 420 ] | |
| 84345 silly gunzTarPerm extractEntry lib/babel/transformation/helpers/build-conditional-assignment-operator-transformer.js | |
| 84346 silly gunzTarPerm modified mode [ 'lib/babel/transformation/helpers/build-conditional-assignment-operator-transformer.js', | |
| 84346 silly gunzTarPerm 438, | |
| 84346 silly gunzTarPerm 420 ] | |
| 84347 silly gunzTarPerm extractEntry test/source-map/test-source-map-consumer.js | |
| 84348 silly gunzTarPerm modified mode [ 'test/source-map/test-source-map-consumer.js', 438, 420 ] | |
| 84349 silly gunzTarPerm extractEntry test/source-map/test-source-map-generator.js | |
| 84350 silly gunzTarPerm modified mode [ 'test/source-map/test-source-map-generator.js', 438, 420 ] | |
| 84351 silly gunzTarPerm extractEntry test/source-map/test-source-node.js | |
| 84352 silly gunzTarPerm modified mode [ 'test/source-map/test-source-node.js', 438, 420 ] | |
| 84353 silly gunzTarPerm extractEntry test/source-map/test-util.js | |
| 84354 silly gunzTarPerm modified mode [ 'test/source-map/test-util.js', 438, 420 ] | |
| 84355 silly gunzTarPerm extractEntry lib/babel/transformation/helpers/replace-supers.js | |
| 84356 silly gunzTarPerm modified mode [ 'lib/babel/transformation/helpers/replace-supers.js', | |
| 84356 silly gunzTarPerm 438, | |
| 84356 silly gunzTarPerm 420 ] | |
| 84357 silly gunzTarPerm extractEntry lib/babel/transformation/helpers/build-comprehension.js | |
| 84358 silly gunzTarPerm modified mode [ 'lib/babel/transformation/helpers/build-comprehension.js', | |
| 84358 silly gunzTarPerm 438, | |
| 84358 silly gunzTarPerm 420 ] | |
| 84359 silly gunzTarPerm extractEntry lib/babel/transformation/helpers/strict.js | |
| 84360 silly gunzTarPerm modified mode [ 'lib/babel/transformation/helpers/strict.js', 438, 420 ] | |
| 84361 silly gunzTarPerm extractEntry lib/babel/transformation/helpers/get-function-arity.js | |
| 84362 silly gunzTarPerm modified mode [ 'lib/babel/transformation/helpers/get-function-arity.js', | |
| 84362 silly gunzTarPerm 438, | |
| 84362 silly gunzTarPerm 420 ] | |
| 84363 silly gunzTarPerm extractEntry test/source-map/util.js | |
| 84364 silly gunzTarPerm modified mode [ 'test/source-map/util.js', 438, 420 ] | |
| 84365 silly gunzTarPerm extractEntry test/source-map/test-dog-fooding.js | |
| 84366 silly gunzTarPerm modified mode [ 'test/source-map/test-dog-fooding.js', 438, 420 ] | |
| 84367 silly gunzTarPerm extractEntry lib/babel/transformation/modules/amd-strict.js | |
| 84368 silly gunzTarPerm modified mode [ 'lib/babel/transformation/modules/amd-strict.js', 438, 420 ] | |
| 84369 silly gunzTarPerm extractEntry lib/babel/transformation/modules/common-strict.js | |
| 84370 silly gunzTarPerm modified mode [ 'lib/babel/transformation/modules/common-strict.js', 438, 420 ] | |
| 84371 silly gunzTarPerm extractEntry lib/babel/transformation/modules/common.js | |
| 84372 silly gunzTarPerm modified mode [ 'lib/babel/transformation/modules/common.js', 438, 420 ] | |
| 84373 silly gunzTarPerm extractEntry lib/babel/transformation/modules/ignore.js | |
| 84374 silly gunzTarPerm modified mode [ 'lib/babel/transformation/modules/ignore.js', 438, 420 ] | |
| 84375 silly gunzTarPerm extractEntry lib/babel/transformation/modules/amd.js | |
| 84376 silly gunzTarPerm modified mode [ 'lib/babel/transformation/modules/amd.js', 438, 420 ] | |
| 84377 silly gunzTarPerm extractEntry lib/babel/transformation/modules/system.js | |
| 84378 silly gunzTarPerm modified mode [ 'lib/babel/transformation/modules/system.js', 438, 420 ] | |
| 84379 silly gunzTarPerm extractEntry lib/babel/transformation/modules/umd-strict.js | |
| 84380 silly gunzTarPerm modified mode [ 'lib/babel/transformation/modules/umd-strict.js', 438, 420 ] | |
| 84381 silly gunzTarPerm extractEntry lib/babel/transformation/modules/umd.js | |
| 84382 silly gunzTarPerm modified mode [ 'lib/babel/transformation/modules/umd.js', 438, 420 ] | |
| 84383 silly gunzTarPerm extractEntry test/reflect.js | |
| 84384 silly gunzTarPerm modified mode [ 'test/reflect.js', 438, 420 ] | |
| 84385 silly gunzTarPerm extractEntry test/run.js | |
| 84386 silly gunzTarPerm modified mode [ 'test/run.js', 438, 420 ] | |
| 84387 silly gunzTarPerm extractEntry lib/babel/transformation/modules/_default.js | |
| 84388 silly gunzTarPerm modified mode [ 'lib/babel/transformation/modules/_default.js', 438, 420 ] | |
| 84389 silly gunzTarPerm extractEntry lib/babel/transformation/modules/_strict.js | |
| 84390 silly gunzTarPerm modified mode [ 'lib/babel/transformation/modules/_strict.js', 438, 420 ] | |
| 84391 silly gunzTarPerm extractEntry test/runner.js | |
| 84392 silly gunzTarPerm modified mode [ 'test/runner.js', 438, 420 ] | |
| 84393 silly gunzTarPerm extractEntry test/test.js | |
| 84394 silly gunzTarPerm modified mode [ 'test/test.js', 438, 420 ] | |
| 84395 silly gunzTarPerm extractEntry lib/babel/transformation/modules/index.js | |
| 84396 silly gunzTarPerm modified mode [ 'lib/babel/transformation/modules/index.js', 438, 420 ] | |
| 84397 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/index.js | |
| 84398 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/index.js', 438, 420 ] | |
| 84399 silly lockFile 4b55f14e-es-recast-node-modules-ast-types tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\ast-types | |
| 84400 silly lockFile 4b55f14e-es-recast-node-modules-ast-types tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\ast-types | |
| 84401 silly lockFile 09af4191-che-ast-types-0-6-16-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.6.16\package.tgz | |
| 84402 silly lockFile 09af4191-che-ast-types-0-6-16-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.6.16\package.tgz | |
| 84403 info preinstall ast-types@0.6.16 | |
| 84404 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/aliases.json | |
| 84405 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/aliases.json', | |
| 84405 silly gunzTarPerm 438, | |
| 84405 silly gunzTarPerm 420 ] | |
| 84406 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es3/member-expression-literals.js | |
| 84407 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es3/member-expression-literals.js', | |
| 84407 silly gunzTarPerm 438, | |
| 84407 silly gunzTarPerm 420 ] | |
| 84408 verbose readDependencies using package.json deps | |
| 84409 verbose readDependencies using package.json deps | |
| 84410 silly resolved [] | |
| 84411 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\ast-types | |
| 84412 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\ast-types | |
| 84413 verbose linkStuff [ true, | |
| 84413 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 84413 verbose linkStuff false, | |
| 84413 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\commoner\\node_modules\\recast\\node_modules' ] | |
| 84414 info linkStuff ast-types@0.6.16 | |
| 84415 verbose linkBins ast-types@0.6.16 | |
| 84416 verbose linkMans ast-types@0.6.16 | |
| 84417 verbose rebuildBundles ast-types@0.6.16 | |
| 84418 info install ast-types@0.6.16 | |
| 84419 info postinstall ast-types@0.6.16 | |
| 84420 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es3/property-literals.js | |
| 84421 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es3/property-literals.js', | |
| 84421 silly gunzTarPerm 438, | |
| 84421 silly gunzTarPerm 420 ] | |
| 84422 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es5/properties.mutators.js | |
| 84423 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es5/properties.mutators.js', | |
| 84423 silly gunzTarPerm 438, | |
| 84423 silly gunzTarPerm 420 ] | |
| 84424 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es6/arrow-functions.js | |
| 84425 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es6/arrow-functions.js', | |
| 84425 silly gunzTarPerm 438, | |
| 84425 silly gunzTarPerm 420 ] | |
| 84426 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es6/modules.js | |
| 84427 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es6/modules.js', | |
| 84427 silly gunzTarPerm 438, | |
| 84427 silly gunzTarPerm 420 ] | |
| 84428 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es6/object-super.js | |
| 84429 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es6/object-super.js', | |
| 84429 silly gunzTarPerm 438, | |
| 84429 silly gunzTarPerm 420 ] | |
| 84430 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es6/parameters.default.js | |
| 84431 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es6/parameters.default.js', | |
| 84431 silly gunzTarPerm 438, | |
| 84431 silly gunzTarPerm 420 ] | |
| 84432 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es6/parameters.rest.js | |
| 84433 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es6/parameters.rest.js', | |
| 84433 silly gunzTarPerm 438, | |
| 84433 silly gunzTarPerm 420 ] | |
| 84434 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es6/for-of.js | |
| 84435 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es6/for-of.js', | |
| 84435 silly gunzTarPerm 438, | |
| 84435 silly gunzTarPerm 420 ] | |
| 84436 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es6/properties.shorthand.js | |
| 84437 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es6/properties.shorthand.js', | |
| 84437 silly gunzTarPerm 438, | |
| 84437 silly gunzTarPerm 420 ] | |
| 84438 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es6/regex.sticky.js | |
| 84439 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es6/regex.sticky.js', | |
| 84439 silly gunzTarPerm 438, | |
| 84439 silly gunzTarPerm 420 ] | |
| 84440 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es6/regex.unicode.js | |
| 84441 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es6/regex.unicode.js', | |
| 84441 silly gunzTarPerm 438, | |
| 84441 silly gunzTarPerm 420 ] | |
| 84442 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es6/spec.block-scoping.js | |
| 84443 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es6/spec.block-scoping.js', | |
| 84443 silly gunzTarPerm 438, | |
| 84443 silly gunzTarPerm 420 ] | |
| 84444 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es6/spec.symbols.js | |
| 84445 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es6/spec.symbols.js', | |
| 84445 silly gunzTarPerm 438, | |
| 84445 silly gunzTarPerm 420 ] | |
| 84446 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es6/destructuring.js | |
| 84447 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es6/destructuring.js', | |
| 84447 silly gunzTarPerm 438, | |
| 84447 silly gunzTarPerm 420 ] | |
| 84448 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es6/spec.template-literals.js | |
| 84449 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es6/spec.template-literals.js', | |
| 84449 silly gunzTarPerm 438, | |
| 84449 silly gunzTarPerm 420 ] | |
| 84450 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es6/constants.js | |
| 84451 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es6/constants.js', | |
| 84451 silly gunzTarPerm 438, | |
| 84451 silly gunzTarPerm 420 ] | |
| 84452 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es6/spread.js | |
| 84453 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es6/spread.js', | |
| 84453 silly gunzTarPerm 438, | |
| 84453 silly gunzTarPerm 420 ] | |
| 84454 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es6/classes.js | |
| 84455 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es6/classes.js', | |
| 84455 silly gunzTarPerm 438, | |
| 84455 silly gunzTarPerm 420 ] | |
| 84456 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es6/tail-call.js | |
| 84457 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es6/tail-call.js', | |
| 84457 silly gunzTarPerm 438, | |
| 84457 silly gunzTarPerm 420 ] | |
| 84458 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es6/block-scoping.js | |
| 84459 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es6/block-scoping.js', | |
| 84459 silly gunzTarPerm 438, | |
| 84459 silly gunzTarPerm 420 ] | |
| 84460 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es6/template-literals.js | |
| 84461 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es6/template-literals.js', | |
| 84461 silly gunzTarPerm 438, | |
| 84461 silly gunzTarPerm 420 ] | |
| 84462 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es6/properties.computed.js | |
| 84463 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es6/properties.computed.js', | |
| 84463 silly gunzTarPerm 438, | |
| 84463 silly gunzTarPerm 420 ] | |
| 84464 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es7/async-functions.js | |
| 84465 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es7/async-functions.js', | |
| 84465 silly gunzTarPerm 438, | |
| 84465 silly gunzTarPerm 420 ] | |
| 84466 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es7/class-properties.js | |
| 84467 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es7/class-properties.js', | |
| 84467 silly gunzTarPerm 438, | |
| 84467 silly gunzTarPerm 420 ] | |
| 84468 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es7/comprehensions.js | |
| 84469 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es7/comprehensions.js', | |
| 84469 silly gunzTarPerm 438, | |
| 84469 silly gunzTarPerm 420 ] | |
| 84470 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es7/decorators.js | |
| 84471 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es7/decorators.js', | |
| 84471 silly gunzTarPerm 438, | |
| 84471 silly gunzTarPerm 420 ] | |
| 84472 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es7/do-expressions.js | |
| 84473 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es7/do-expressions.js', | |
| 84473 silly gunzTarPerm 438, | |
| 84473 silly gunzTarPerm 420 ] | |
| 84474 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es7/exponentiation-operator.js | |
| 84475 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es7/exponentiation-operator.js', | |
| 84475 silly gunzTarPerm 438, | |
| 84475 silly gunzTarPerm 420 ] | |
| 84476 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es7/export-extensions.js | |
| 84477 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es7/export-extensions.js', | |
| 84477 silly gunzTarPerm 438, | |
| 84477 silly gunzTarPerm 420 ] | |
| 84478 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es7/object-rest-spread.js | |
| 84479 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es7/object-rest-spread.js', | |
| 84479 silly gunzTarPerm 438, | |
| 84479 silly gunzTarPerm 420 ] | |
| 84480 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/es7/trailing-function-commas.js | |
| 84481 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/es7/trailing-function-commas.js', | |
| 84481 silly gunzTarPerm 438, | |
| 84481 silly gunzTarPerm 420 ] | |
| 84482 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/deprecated.json | |
| 84483 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/deprecated.json', | |
| 84483 silly gunzTarPerm 438, | |
| 84483 silly gunzTarPerm 420 ] | |
| 84484 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/internal/block-hoist.js | |
| 84485 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/internal/block-hoist.js', | |
| 84485 silly gunzTarPerm 438, | |
| 84485 silly gunzTarPerm 420 ] | |
| 84486 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/internal/cleanup.js | |
| 84487 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/internal/cleanup.js', | |
| 84487 silly gunzTarPerm 438, | |
| 84487 silly gunzTarPerm 420 ] | |
| 84488 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/internal/declarations.js | |
| 84489 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/internal/declarations.js', | |
| 84489 silly gunzTarPerm 438, | |
| 84489 silly gunzTarPerm 420 ] | |
| 84490 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/internal/module-formatter.js | |
| 84491 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/internal/module-formatter.js', | |
| 84491 silly gunzTarPerm 438, | |
| 84491 silly gunzTarPerm 420 ] | |
| 84492 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/internal/modules.js | |
| 84493 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/internal/modules.js', | |
| 84493 silly gunzTarPerm 438, | |
| 84493 silly gunzTarPerm 420 ] | |
| 84494 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/internal/shadow-functions.js | |
| 84495 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/internal/shadow-functions.js', | |
| 84495 silly gunzTarPerm 438, | |
| 84495 silly gunzTarPerm 420 ] | |
| 84496 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/internal/strict.js | |
| 84497 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/internal/strict.js', | |
| 84497 silly gunzTarPerm 438, | |
| 84497 silly gunzTarPerm 420 ] | |
| 84498 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/internal/validation.js | |
| 84499 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/internal/validation.js', | |
| 84499 silly gunzTarPerm 438, | |
| 84499 silly gunzTarPerm 420 ] | |
| 84500 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/optimisation/flow.for-of.js | |
| 84501 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/optimisation/flow.for-of.js', | |
| 84501 silly gunzTarPerm 438, | |
| 84501 silly gunzTarPerm 420 ] | |
| 84502 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/optimisation/react.constant-elements.js | |
| 84503 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/optimisation/react.constant-elements.js', | |
| 84503 silly gunzTarPerm 438, | |
| 84503 silly gunzTarPerm 420 ] | |
| 84504 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/optimisation/react.inline-elements.js | |
| 84505 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/optimisation/react.inline-elements.js', | |
| 84505 silly gunzTarPerm 438, | |
| 84505 silly gunzTarPerm 420 ] | |
| 84506 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/other/async-to-generator.js | |
| 84507 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/other/async-to-generator.js', | |
| 84507 silly gunzTarPerm 438, | |
| 84507 silly gunzTarPerm 420 ] | |
| 84508 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/other/bluebird-coroutines.js | |
| 84509 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/other/bluebird-coroutines.js', | |
| 84509 silly gunzTarPerm 438, | |
| 84509 silly gunzTarPerm 420 ] | |
| 84510 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/other/flow.js | |
| 84511 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/other/flow.js', | |
| 84511 silly gunzTarPerm 438, | |
| 84511 silly gunzTarPerm 420 ] | |
| 84512 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/other/ludicrous.js | |
| 84513 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/other/ludicrous.js', | |
| 84513 silly gunzTarPerm 438, | |
| 84513 silly gunzTarPerm 420 ] | |
| 84514 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/other/react-compat.js | |
| 84515 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/other/react-compat.js', | |
| 84515 silly gunzTarPerm 438, | |
| 84515 silly gunzTarPerm 420 ] | |
| 84516 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/other/react.js | |
| 84517 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/other/react.js', | |
| 84517 silly gunzTarPerm 438, | |
| 84517 silly gunzTarPerm 420 ] | |
| 84518 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/other/regenerator.js | |
| 84519 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/other/regenerator.js', | |
| 84519 silly gunzTarPerm 438, | |
| 84519 silly gunzTarPerm 420 ] | |
| 84520 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/other/strict.js | |
| 84521 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/other/strict.js', | |
| 84521 silly gunzTarPerm 438, | |
| 84521 silly gunzTarPerm 420 ] | |
| 84522 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/other/runtime/index.js | |
| 84523 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/other/runtime/index.js', | |
| 84523 silly gunzTarPerm 438, | |
| 84523 silly gunzTarPerm 420 ] | |
| 84524 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/other/runtime/definitions.json | |
| 84525 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/other/runtime/definitions.json', | |
| 84525 silly gunzTarPerm 438, | |
| 84525 silly gunzTarPerm 420 ] | |
| 84526 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/spec/block-scoped-functions.js | |
| 84527 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/spec/block-scoped-functions.js', | |
| 84527 silly gunzTarPerm 438, | |
| 84527 silly gunzTarPerm 420 ] | |
| 84528 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/spec/function-name.js | |
| 84529 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/spec/function-name.js', | |
| 84529 silly gunzTarPerm 438, | |
| 84529 silly gunzTarPerm 420 ] | |
| 84530 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/spec/proto-to-assign.js | |
| 84531 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/spec/proto-to-assign.js', | |
| 84531 silly gunzTarPerm 438, | |
| 84531 silly gunzTarPerm 420 ] | |
| 84532 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/spec/undefined-to-void.js | |
| 84533 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/spec/undefined-to-void.js', | |
| 84533 silly gunzTarPerm 438, | |
| 84533 silly gunzTarPerm 420 ] | |
| 84534 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/utility/dead-code-elimination.js | |
| 84535 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/utility/dead-code-elimination.js', | |
| 84535 silly gunzTarPerm 438, | |
| 84535 silly gunzTarPerm 420 ] | |
| 84536 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/utility/inline-environment-variables.js | |
| 84537 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/utility/inline-environment-variables.js', | |
| 84537 silly gunzTarPerm 438, | |
| 84537 silly gunzTarPerm 420 ] | |
| 84538 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/utility/inline-expressions.js | |
| 84539 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/utility/inline-expressions.js', | |
| 84539 silly gunzTarPerm 438, | |
| 84539 silly gunzTarPerm 420 ] | |
| 84540 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/utility/remove-console.js | |
| 84541 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/utility/remove-console.js', | |
| 84541 silly gunzTarPerm 438, | |
| 84541 silly gunzTarPerm 420 ] | |
| 84542 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/utility/remove-debugger.js | |
| 84543 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/utility/remove-debugger.js', | |
| 84543 silly gunzTarPerm 438, | |
| 84543 silly gunzTarPerm 420 ] | |
| 84544 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/validation/react.js | |
| 84545 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/validation/react.js', | |
| 84545 silly gunzTarPerm 438, | |
| 84545 silly gunzTarPerm 420 ] | |
| 84546 silly gunzTarPerm extractEntry lib/babel/transformation/transformers/validation/undeclared-variable-check.js | |
| 84547 silly gunzTarPerm modified mode [ 'lib/babel/transformation/transformers/validation/undeclared-variable-check.js', | |
| 84547 silly gunzTarPerm 438, | |
| 84547 silly gunzTarPerm 420 ] | |
| 84548 silly gunzTarPerm extractEntry lib/babel/traversal/binding.js | |
| 84549 silly gunzTarPerm modified mode [ 'lib/babel/traversal/binding.js', 438, 420 ] | |
| 84550 silly gunzTarPerm extractEntry lib/babel/traversal/context.js | |
| 84551 silly gunzTarPerm modified mode [ 'lib/babel/traversal/context.js', 438, 420 ] | |
| 84552 silly gunzTarPerm extractEntry lib/babel/traversal/index.js | |
| 84553 silly gunzTarPerm modified mode [ 'lib/babel/traversal/index.js', 438, 420 ] | |
| 84554 silly gunzTarPerm extractEntry lib/babel/traversal/scope.js | |
| 84555 silly gunzTarPerm modified mode [ 'lib/babel/traversal/scope.js', 438, 420 ] | |
| 84556 silly gunzTarPerm extractEntry lib/babel/traversal/path/conversion.js | |
| 84557 silly gunzTarPerm modified mode [ 'lib/babel/traversal/path/conversion.js', 438, 420 ] | |
| 84558 silly gunzTarPerm extractEntry lib/babel/traversal/path/evaluation.js | |
| 84559 silly gunzTarPerm modified mode [ 'lib/babel/traversal/path/evaluation.js', 438, 420 ] | |
| 84560 silly gunzTarPerm extractEntry lib/babel/traversal/path/hoister.js | |
| 84561 silly gunzTarPerm modified mode [ 'lib/babel/traversal/path/hoister.js', 438, 420 ] | |
| 84562 silly gunzTarPerm extractEntry lib/babel/traversal/path/index.js | |
| 84563 silly gunzTarPerm modified mode [ 'lib/babel/traversal/path/index.js', 438, 420 ] | |
| 84564 silly gunzTarPerm extractEntry lib/babel/types/converters.js | |
| 84565 silly gunzTarPerm modified mode [ 'lib/babel/types/converters.js', 438, 420 ] | |
| 84566 silly gunzTarPerm extractEntry lib/babel/types/index.js | |
| 84567 silly gunzTarPerm modified mode [ 'lib/babel/types/index.js', 438, 420 ] | |
| 84568 silly gunzTarPerm extractEntry lib/babel/types/retrievers.js | |
| 84569 silly gunzTarPerm modified mode [ 'lib/babel/types/retrievers.js', 438, 420 ] | |
| 84570 silly gunzTarPerm extractEntry lib/babel/types/validators.js | |
| 84571 silly gunzTarPerm modified mode [ 'lib/babel/types/validators.js', 438, 420 ] | |
| 84572 silly gunzTarPerm extractEntry lib/babel/types/alias-keys.json | |
| 84573 silly gunzTarPerm modified mode [ 'lib/babel/types/alias-keys.json', 438, 420 ] | |
| 84574 silly gunzTarPerm extractEntry lib/babel/types/builder-keys.json | |
| 84575 silly gunzTarPerm modified mode [ 'lib/babel/types/builder-keys.json', 438, 420 ] | |
| 84576 silly gunzTarPerm extractEntry lib/babel/types/visitor-keys.json | |
| 84577 silly gunzTarPerm modified mode [ 'lib/babel/types/visitor-keys.json', 438, 420 ] | |
| 84578 silly gunzTarPerm extractEntry lib/babel/api/browser.js | |
| 84579 silly gunzTarPerm modified mode [ 'lib/babel/api/browser.js', 438, 420 ] | |
| 84580 silly gunzTarPerm extractEntry lib/babel/api/node.js | |
| 84581 silly gunzTarPerm modified mode [ 'lib/babel/api/node.js', 438, 420 ] | |
| 84582 silly gunzTarPerm extractEntry lib/babel/api/register/browser.js | |
| 84583 silly gunzTarPerm modified mode [ 'lib/babel/api/register/browser.js', 438, 420 ] | |
| 84584 silly gunzTarPerm extractEntry lib/babel/api/register/cache.js | |
| 84585 silly gunzTarPerm modified mode [ 'lib/babel/api/register/cache.js', 438, 420 ] | |
| 84586 silly gunzTarPerm extractEntry lib/babel/api/register/node.js | |
| 84587 silly gunzTarPerm modified mode [ 'lib/babel/api/register/node.js', 438, 420 ] | |
| 84588 silly gunzTarPerm extractEntry lib/react/index.js | |
| 84589 silly gunzTarPerm modified mode [ 'lib/react/index.js', 438, 420 ] | |
| 84590 silly gunzTarPerm extractEntry lib/react/generation/flow.js | |
| 84591 silly gunzTarPerm modified mode [ 'lib/react/generation/flow.js', 438, 420 ] | |
| 84592 silly gunzTarPerm extractEntry lib/react/generation/jsx.js | |
| 84593 silly gunzTarPerm modified mode [ 'lib/react/generation/jsx.js', 438, 420 ] | |
| 84594 silly lockFile 7356bf3e-s-recast-node-modules-source-map tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\source-map | |
| 84595 silly lockFile 7356bf3e-s-recast-node-modules-source-map tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\source-map | |
| 84596 silly lockFile b1c5b5bb-he-source-map-0-1-43-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.1.43\package.tgz | |
| 84597 silly lockFile b1c5b5bb-he-source-map-0-1-43-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.1.43\package.tgz | |
| 84598 info preinstall source-map@0.1.43 | |
| 84599 verbose readDependencies using package.json deps | |
| 84600 verbose readDependencies using package.json deps | |
| 84601 verbose cache add [ 'amdefine@>=0.0.4', null ] | |
| 84602 verbose cache add name=undefined spec="amdefine@>=0.0.4" args=["amdefine@>=0.0.4",null] | |
| 84603 verbose parsed url { protocol: null, | |
| 84603 verbose parsed url slashes: null, | |
| 84603 verbose parsed url auth: null, | |
| 84603 verbose parsed url host: null, | |
| 84603 verbose parsed url port: null, | |
| 84603 verbose parsed url hostname: null, | |
| 84603 verbose parsed url hash: null, | |
| 84603 verbose parsed url search: null, | |
| 84603 verbose parsed url query: null, | |
| 84603 verbose parsed url pathname: 'amdefine@%3E=0.0.4', | |
| 84603 verbose parsed url path: 'amdefine@%3E=0.0.4', | |
| 84603 verbose parsed url href: 'amdefine@%3E=0.0.4' } | |
| 84604 verbose cache add name="amdefine" spec=">=0.0.4" args=["amdefine",">=0.0.4"] | |
| 84605 verbose parsed url { protocol: null, | |
| 84605 verbose parsed url slashes: null, | |
| 84605 verbose parsed url auth: null, | |
| 84605 verbose parsed url host: null, | |
| 84605 verbose parsed url port: null, | |
| 84605 verbose parsed url hostname: null, | |
| 84605 verbose parsed url hash: null, | |
| 84605 verbose parsed url search: null, | |
| 84605 verbose parsed url query: null, | |
| 84605 verbose parsed url pathname: '%3E=0.0.4', | |
| 84605 verbose parsed url path: '%3E=0.0.4', | |
| 84605 verbose parsed url href: '%3E=0.0.4' } | |
| 84606 verbose addNamed [ 'amdefine', '>=0.0.4' ] | |
| 84607 verbose addNamed [ null, '>=0.0.4' ] | |
| 84608 silly lockFile 165d2d7b-amdefine-0-0-4 amdefine@>=0.0.4 | |
| 84609 verbose lock amdefine@>=0.0.4 C:\Users\Vince\AppData\Roaming\npm-cache\165d2d7b-amdefine-0-0-4.lock | |
| 84610 silly addNameRange { name: 'amdefine', range: '>=0.0.4', hasData: false } | |
| 84611 verbose registry.get amdefine not expired, no request | |
| 84612 silly addNameRange number 2 { name: 'amdefine', range: '>=0.0.4', hasData: true } | |
| 84613 silly addNameRange versions [ 'amdefine', | |
| 84613 silly addNameRange [ '0.0.1', | |
| 84613 silly addNameRange '0.0.2', | |
| 84613 silly addNameRange '0.0.3', | |
| 84613 silly addNameRange '0.0.4', | |
| 84613 silly addNameRange '0.0.5', | |
| 84613 silly addNameRange '0.0.6', | |
| 84613 silly addNameRange '0.0.7', | |
| 84613 silly addNameRange '0.0.8', | |
| 84613 silly addNameRange '0.1.0' ] ] | |
| 84614 verbose addNamed [ 'amdefine', '0.1.0' ] | |
| 84615 verbose addNamed [ '0.1.0', '0.1.0' ] | |
| 84616 silly lockFile 3c57e17c-amdefine-0-1-0 amdefine@0.1.0 | |
| 84617 verbose lock amdefine@0.1.0 C:\Users\Vince\AppData\Roaming\npm-cache\3c57e17c-amdefine-0-1-0.lock | |
| 84618 silly lockFile 3c57e17c-amdefine-0-1-0 amdefine@0.1.0 | |
| 84619 silly lockFile 3c57e17c-amdefine-0-1-0 amdefine@0.1.0 | |
| 84620 silly lockFile 165d2d7b-amdefine-0-0-4 amdefine@>=0.0.4 | |
| 84621 silly lockFile 165d2d7b-amdefine-0-0-4 amdefine@>=0.0.4 | |
| 84622 silly resolved [ { name: 'amdefine', | |
| 84622 silly resolved description: 'Provide AMD\'s define() API for declaring modules in the AMD format', | |
| 84622 silly resolved version: '0.1.0', | |
| 84622 silly resolved homepage: 'http://github.com/jrburke/amdefine', | |
| 84622 silly resolved author: | |
| 84622 silly resolved { name: 'James Burke', | |
| 84622 silly resolved email: 'jrburke@gmail.com', | |
| 84622 silly resolved url: 'http://github.com/jrburke' }, | |
| 84622 silly resolved licenses: [ [Object], [Object] ], | |
| 84622 silly resolved repository: { type: 'git', url: 'https://github.com/jrburke/amdefine.git' }, | |
| 84622 silly resolved main: './amdefine.js', | |
| 84622 silly resolved engines: { node: '>=0.4.2' }, | |
| 84622 silly resolved readme: '# amdefine\n\nA module that can be used to implement AMD\'s define() in Node. This allows you\nto code to the AMD API and have the module work in node programs without\nrequiring those other programs to use AMD.\n\n## Usage\n\n**1)** Update your package.json to indicate amdefine as a dependency:\n\n```javascript\n "dependencies": {\n "amdefine": ">=0.1.0"\n }\n```\n\nThen run `npm install` to get amdefine into your project.\n\n**2)** At the top of each module that uses define(), place this code:\n\n```javascript\nif (typeof define !== \'function\') { var define = require(\'amdefine\')(module) }\n```\n\n**Only use these snippets** when loading amdefine. If you preserve the basic structure,\nwith the braces, it will be stripped out when using the [RequireJS optimizer](#optimizer).\n\nYou can add spaces, line breaks and even require amdefine with a local path, but\nkeep the rest of the structure to get the stripping behavior.\n\nAs you may know, because `if` statements in JavaScript don\'t have their own scope, the var\ndeclaration in the above snippet is made whether the `if` expression is truthy or not. If\nRequireJS is loaded then the declaration is superfluous because `define` is already already\ndeclared in the same scope in RequireJS. Fortunately JavaScript handles multiple `var`\ndeclarations of the same variable in the same scope gracefully.\n\nIf you want to deliver amdefine.js with your code rather than specifying it as a dependency\nwith npm, then just download the latest release and refer to it using a relative path:\n\n[Latest Version](https://github.com/jrburke/amdefine/raw/latest/amdefine.js)\n\n### amdefine/intercept\n\nConsider this very experimental.\n\nInstead of pasting the piece of text for the amdefine setup of a `define`\nvariable in each module you create or consume, you can use `amdefine/intercept`\ninstead. It will automatically insert the above snippet in each .js file loaded\nby Node.\n\n**Warning**: you should only use this if you are creating an application that\nis consuming AMD style defined()\'d modules that are distributed via npm and want\nto run that code in Node.\n\nFor library code where you are not sure if it will be used by others in Node or\nin the browser, then explicitly depending on amdefine and placing the code\nsnippet above is suggested path, instead of using `amdefine/intercept`. The\nintercept module affects all .js files loaded in the Node app, and it is\ninconsiderate to modify global state like that unless you are also controlling\nthe top level app.\n\n#### Why distribute AMD-style nodes via npm?\n\nnpm has a lot of weaknesses for front-end use (installed layout is not great,\nshould have better support for the `baseUrl + moduleID + \'.js\' style of loading,\nsingle file JS installs), but some people want a JS package manager and are\nwilling to live with those constraints. If that is you, but still want to author\nin AMD style modules to get dynamic require([]), better direct source usage and\npowerful loader plugin support in the browser, then this tool can help.\n\n#### amdefine/intercept usage\n\nJust require it in your top level app module (for example index.js, server.js):\n\n```javascript\nrequire(\'amdefine/intercept\');\n```\n\nThe module does not return a value, so no need to assign the result to a local\nvariable.\n\nThen just require() code as you normally would with Node\'s require(). Any .js\nloaded after the intercept require will have the amdefine check injected in\nthe .js source as it is loaded. It does not modify the source on disk, just\nprepends some content to the text of the module as it is loaded by Node.\n\n#### How amdefine/intercept works\n\nIt overrides the `Module._extensions[\'.js\']` in Node to automatically prepend\nthe amdefine snippet above. So, it will affect any .js file loaded by your\napp.\n\n## define() usage\n\nIt is best if you use the anonymous forms of define() in your module:\n\n```javascript\ndefine(function (require) {\n var dependency = require(\'dependency\');\n});\n```\n\nor\n\n```javascript\ndefine([\'dependency\'], function (dependency) {\n\n});\n```\n\n## RequireJS optimizer integration. <a name="optimizer"></name>\n\nVersion 1.0.3 of the [RequireJS optimizer](http://requirejs.org/docs/optimization.html)\nwill have support for stripping the `if (typeof define !== \'function\')` check\nmentioned above, so you can include this snippet for code that runs in the\nbrowser, but avoid taking the cost of the if() statement once the code is\noptimized for deployment.\n\n## Node 0.4 Support\n\nIf you want to support Node 0.4, then add `require` as the second parameter to amdefine:\n\n```javascript\n//Only if you want Node 0.4. If using 0.5 or later, use the above snippet.\nif (typeof define !== \'function\') { var define = require(\'amdefine\')(module, require) }\n```\n\n## Limitations\n\n### Synchronous vs Asynchronous\n\namdefine creates a define() function that is callable by your code. It will\nexecute and trace dependencies and call the factory function *synchronously*,\nto keep the behavior in line with Node\'s synchronous dependency tracing.\n\nThe exception: calling AMD\'s callback-style require() from inside a factory\nfunction. The require callback is called on process.nextTick():\n\n```javascript\ndefine(function (require) {\n require([\'a\'], function(a) {\n //\'a\' is loaded synchronously, but\n //this callback is called on process.nextTick().\n });\n});\n```\n\n### Loader Plugins\n\nLoader plugins are supported as long as they call their load() callbacks\nsynchronously. So ones that do network requests will not work. However plugins\nlike [text](http://requirejs.org/docs/api.html#text) can load text files locally.\n\nThe plugin API\'s `load.fromText()` is **not supported** in amdefine, so this means\ntranspiler plugins like the [CoffeeScript loader plugin](https://github.com/jrburke/require-cs)\nwill not work. This may be fixable, but it is a bit complex, and I do not have\nenough node-fu to figure it out yet. See the source for amdefine.js if you want\nto get an idea of the issues involved.\n\n## Tests\n\nTo run the tests, cd to **tests** and run:\n\n```\nnode all.js\nnode all-intercept.js\n```\n\n## License\n\nNew BSD and MIT. Check the LICENSE file for all the details.\n', | |
| 84622 silly resolved readmeFilename: 'README.md', | |
| 84622 silly resolved bugs: { url: 'https://github.com/jrburke/amdefine/issues' }, | |
| 84622 silly resolved _id: 'amdefine@0.1.0', | |
| 84622 silly resolved _from: 'amdefine@>=0.0.4', | |
| 84622 silly resolved scripts: {}, | |
| 84622 silly resolved dist: { shasum: '043a98168e8043c4295e7383e0e80bf31668075e' }, | |
| 84622 silly resolved _resolved: 'https://registry.npmjs.org/amdefine/-/amdefine-0.1.0.tgz' } ] | |
| 84623 info install amdefine@0.1.0 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\source-map | |
| 84624 info installOne amdefine@0.1.0 | |
| 84625 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\source-map\node_modules\amdefine unbuild | |
| 84626 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\amdefine\0.1.0\package.tgz | |
| 84627 silly lockFile 07b19f05-source-map-node-modules-amdefine tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\source-map\node_modules\amdefine | |
| 84628 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\source-map\node_modules\amdefine C:\Users\Vince\AppData\Roaming\npm-cache\07b19f05-source-map-node-modules-amdefine.lock | |
| 84629 silly lockFile 05f8b4cb-cache-amdefine-0-1-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\amdefine\0.1.0\package.tgz | |
| 84630 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\amdefine\0.1.0\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\05f8b4cb-cache-amdefine-0-1-0-package-tgz.lock | |
| 84631 silly gunzTarPerm modes [ '755', '644' ] | |
| 84632 silly gunzTarPerm extractEntry package.json | |
| 84633 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 84634 silly gunzTarPerm extractEntry README.md | |
| 84635 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 84636 silly gunzTarPerm extractEntry LICENSE | |
| 84637 silly gunzTarPerm modified mode [ 'LICENSE', 438, 420 ] | |
| 84638 silly gunzTarPerm extractEntry amdefine.js | |
| 84639 silly gunzTarPerm modified mode [ 'amdefine.js', 438, 420 ] | |
| 84640 silly gunzTarPerm extractEntry intercept.js | |
| 84641 silly gunzTarPerm modified mode [ 'intercept.js', 438, 420 ] | |
| 84642 silly lockFile 07b19f05-source-map-node-modules-amdefine tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\source-map\node_modules\amdefine | |
| 84643 silly lockFile 07b19f05-source-map-node-modules-amdefine tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\source-map\node_modules\amdefine | |
| 84644 silly lockFile 05f8b4cb-cache-amdefine-0-1-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\amdefine\0.1.0\package.tgz | |
| 84645 silly lockFile 05f8b4cb-cache-amdefine-0-1-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\amdefine\0.1.0\package.tgz | |
| 84646 info preinstall amdefine@0.1.0 | |
| 84647 verbose readDependencies using package.json deps | |
| 84648 verbose readDependencies using package.json deps | |
| 84649 silly resolved [] | |
| 84650 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\source-map\node_modules\amdefine | |
| 84651 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\source-map\node_modules\amdefine | |
| 84652 verbose linkStuff [ true, | |
| 84652 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 84652 verbose linkStuff false, | |
| 84652 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\commoner\\node_modules\\recast\\node_modules\\source-map\\node_modules' ] | |
| 84653 info linkStuff amdefine@0.1.0 | |
| 84654 verbose linkBins amdefine@0.1.0 | |
| 84655 verbose linkMans amdefine@0.1.0 | |
| 84656 verbose rebuildBundles amdefine@0.1.0 | |
| 84657 info install amdefine@0.1.0 | |
| 84658 info postinstall amdefine@0.1.0 | |
| 84659 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\source-map | |
| 84660 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\source-map | |
| 84661 verbose linkStuff [ true, | |
| 84661 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 84661 verbose linkStuff false, | |
| 84661 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\commoner\\node_modules\\recast\\node_modules' ] | |
| 84662 info linkStuff source-map@0.1.43 | |
| 84663 verbose linkBins source-map@0.1.43 | |
| 84664 verbose linkMans source-map@0.1.43 | |
| 84665 verbose rebuildBundles source-map@0.1.43 | |
| 84666 verbose rebuildBundles [ 'amdefine' ] | |
| 84667 info install source-map@0.1.43 | |
| 84668 info postinstall source-map@0.1.43 | |
| 84669 silly lockFile 9e31dec1-s-recast-node-modules-esprima-fb tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\esprima-fb | |
| 84670 silly lockFile 9e31dec1-s-recast-node-modules-esprima-fb tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\esprima-fb | |
| 84671 silly lockFile e5ab5e09-1-1-0-dev-harmony-fb-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package.tgz | |
| 84672 silly lockFile e5ab5e09-1-1-0-dev-harmony-fb-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\esprima-fb\10001.1.0-dev-harmony-fb\package.tgz | |
| 84673 info preinstall esprima-fb@10001.1.0-dev-harmony-fb | |
| 84674 verbose readDependencies using package.json deps | |
| 84675 verbose readDependencies using package.json deps | |
| 84676 silly resolved [] | |
| 84677 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\esprima-fb | |
| 84678 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast\node_modules\esprima-fb | |
| 84679 verbose linkStuff [ true, | |
| 84679 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 84679 verbose linkStuff false, | |
| 84679 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\commoner\\node_modules\\recast\\node_modules' ] | |
| 84680 info linkStuff esprima-fb@10001.1.0-dev-harmony-fb | |
| 84681 verbose linkBins esprima-fb@10001.1.0-dev-harmony-fb | |
| 84682 verbose link bins [ { esparse: './bin/esparse.js', | |
| 84682 verbose link bins esvalidate: './bin/esvalidate.js' }, | |
| 84682 verbose link bins 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\commoner\\node_modules\\recast\\node_modules\\.bin', | |
| 84682 verbose link bins false ] | |
| 84683 verbose linkMans esprima-fb@10001.1.0-dev-harmony-fb | |
| 84684 verbose rebuildBundles esprima-fb@10001.1.0-dev-harmony-fb | |
| 84685 info install esprima-fb@10001.1.0-dev-harmony-fb | |
| 84686 info postinstall esprima-fb@10001.1.0-dev-harmony-fb | |
| 84687 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast | |
| 84688 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner\node_modules\recast | |
| 84689 verbose linkStuff [ true, | |
| 84689 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 84689 verbose linkStuff false, | |
| 84689 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\commoner\\node_modules' ] | |
| 84690 info linkStuff recast@0.9.18 | |
| 84691 verbose linkBins recast@0.9.18 | |
| 84692 verbose linkMans recast@0.9.18 | |
| 84693 verbose rebuildBundles recast@0.9.18 | |
| 84694 verbose rebuildBundles [ '.bin', 'ast-types', 'esprima-fb', 'source-map' ] | |
| 84695 info install recast@0.9.18 | |
| 84696 info postinstall recast@0.9.18 | |
| 84697 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner | |
| 84698 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator\node_modules\commoner | |
| 84699 verbose linkStuff [ true, | |
| 84699 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 84699 verbose linkStuff false, | |
| 84699 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules' ] | |
| 84700 info linkStuff commoner@0.10.1 | |
| 84701 verbose linkBins commoner@0.10.1 | |
| 84702 verbose link bins [ { commonize: './bin/commonize' }, | |
| 84702 verbose link bins 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\regenerator\\node_modules\\.bin', | |
| 84702 verbose link bins false ] | |
| 84703 verbose linkMans commoner@0.10.1 | |
| 84704 verbose rebuildBundles commoner@0.10.1 | |
| 84705 verbose rebuildBundles [ 'commander', | |
| 84705 verbose rebuildBundles 'glob', | |
| 84705 verbose rebuildBundles 'graceful-fs', | |
| 84705 verbose rebuildBundles 'iconv-lite', | |
| 84705 verbose rebuildBundles 'install', | |
| 84705 verbose rebuildBundles 'q', | |
| 84705 verbose rebuildBundles 'recast' ] | |
| 84706 info install commoner@0.10.1 | |
| 84707 info postinstall commoner@0.10.1 | |
| 84708 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator | |
| 84709 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\regenerator | |
| 84710 verbose linkStuff [ true, | |
| 84710 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 84710 verbose linkStuff false, | |
| 84710 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules' ] | |
| 84711 info linkStuff regenerator@0.8.22 | |
| 84712 verbose linkBins regenerator@0.8.22 | |
| 84713 verbose link bins [ { regenerator: 'bin/regenerator' }, | |
| 84713 verbose link bins 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules\\.bin', | |
| 84713 verbose link bins false ] | |
| 84714 verbose linkMans regenerator@0.8.22 | |
| 84715 verbose rebuildBundles regenerator@0.8.22 | |
| 84716 verbose rebuildBundles [ '.bin', 'commoner', 'defs', 'esprima-fb', 'recast', 'through' ] | |
| 84717 info install regenerator@0.8.22 | |
| 84718 info postinstall regenerator@0.8.22 | |
| 84719 silly lockFile 32813439-loader-utils-node-modules-big-js tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\html-loader\node_modules\loader-utils\node_modules\big.js | |
| 84720 silly lockFile 32813439-loader-utils-node-modules-big-js tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\html-loader\node_modules\loader-utils\node_modules\big.js | |
| 84721 silly lockFile ad13883b-m-cache-big-js-2-5-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\big.js\2.5.1\package.tgz | |
| 84722 silly lockFile ad13883b-m-cache-big-js-2-5-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\big.js\2.5.1\package.tgz | |
| 84723 silly gunzTarPerm modes [ '755', '644' ] | |
| 84724 info preinstall big.js@2.5.1 | |
| 84725 verbose readDependencies using package.json deps | |
| 84726 verbose readDependencies using package.json deps | |
| 84727 silly resolved [] | |
| 84728 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\html-loader\node_modules\loader-utils\node_modules\big.js | |
| 84729 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\html-loader\node_modules\loader-utils\node_modules\big.js | |
| 84730 verbose linkStuff [ true, | |
| 84730 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 84730 verbose linkStuff false, | |
| 84730 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\html-loader\\node_modules\\loader-utils\\node_modules' ] | |
| 84731 info linkStuff big.js@2.5.1 | |
| 84732 verbose linkBins big.js@2.5.1 | |
| 84733 verbose linkMans big.js@2.5.1 | |
| 84734 verbose rebuildBundles big.js@2.5.1 | |
| 84735 silly gunzTarPerm extractEntry package.json | |
| 84736 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 84737 info install big.js@2.5.1 | |
| 84738 info postinstall big.js@2.5.1 | |
| 84739 silly gunzTarPerm extractEntry .npmignore | |
| 84740 silly gunzTarPerm modified mode [ '.npmignore', 438, 420 ] | |
| 84741 silly gunzTarPerm extractEntry README.md | |
| 84742 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 84743 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\html-loader\node_modules\loader-utils | |
| 84744 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\html-loader\node_modules\loader-utils | |
| 84745 verbose linkStuff [ true, | |
| 84745 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 84745 verbose linkStuff false, | |
| 84745 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\html-loader\\node_modules' ] | |
| 84746 info linkStuff loader-utils@0.2.7 | |
| 84747 verbose linkBins loader-utils@0.2.7 | |
| 84748 verbose linkMans loader-utils@0.2.7 | |
| 84749 verbose rebuildBundles loader-utils@0.2.7 | |
| 84750 verbose rebuildBundles [ '.bin', 'big.js', 'json5' ] | |
| 84751 info install loader-utils@0.2.7 | |
| 84752 info postinstall loader-utils@0.2.7 | |
| 84753 silly gunzTarPerm extractEntry LICENCE | |
| 84754 silly gunzTarPerm modified mode [ 'LICENCE', 438, 420 ] | |
| 84755 silly gunzTarPerm extractEntry big.js | |
| 84756 silly gunzTarPerm modified mode [ 'big.js', 438, 420 ] | |
| 84757 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\html-loader | |
| 84758 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\html-loader | |
| 84759 verbose linkStuff [ true, | |
| 84759 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 84759 verbose linkStuff false, | |
| 84759 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules' ] | |
| 84760 info linkStuff html-loader@0.2.3 | |
| 84761 verbose linkBins html-loader@0.2.3 | |
| 84762 verbose linkMans html-loader@0.2.3 | |
| 84763 verbose rebuildBundles html-loader@0.2.3 | |
| 84764 verbose rebuildBundles [ 'fastparse', 'html-minifier', 'loader-utils', 'source-map' ] | |
| 84765 info install html-loader@0.2.3 | |
| 84766 info postinstall html-loader@0.2.3 | |
| 84767 silly gunzTarPerm extractEntry big.min.js | |
| 84768 silly gunzTarPerm modified mode [ 'big.min.js', 438, 420 ] | |
| 84769 silly gunzTarPerm extractEntry doc/bigAPI.html | |
| 84770 silly gunzTarPerm modified mode [ 'doc/bigAPI.html', 438, 420 ] | |
| 84771 silly gunzTarPerm extractEntry perf/bigtime.js | |
| 84772 silly gunzTarPerm modified mode [ 'perf/bigtime.js', 438, 420 ] | |
| 84773 silly gunzTarPerm extractEntry perf/big-vs-bigdecimal.html | |
| 84774 silly gunzTarPerm modified mode [ 'perf/big-vs-bigdecimal.html', 438, 420 ] | |
| 84775 silly gunzTarPerm extractEntry perf/lib/bigdecimal_GWT/bigdecimal.js | |
| 84776 silly gunzTarPerm modified mode [ 'perf/lib/bigdecimal_GWT/bigdecimal.js', 438, 420 ] | |
| 84777 silly gunzTarPerm extractEntry perf/lib/bigdecimal_GWT/bugs.js | |
| 84778 silly gunzTarPerm modified mode [ 'perf/lib/bigdecimal_GWT/bugs.js', 438, 420 ] | |
| 84779 silly gunzTarPerm extractEntry perf/lib/bigdecimal_GWT/BigDecTest.class | |
| 84780 silly gunzTarPerm modified mode [ 'perf/lib/bigdecimal_GWT/BigDecTest.class', 438, 420 ] | |
| 84781 silly gunzTarPerm extractEntry perf/lib/bigdecimal_GWT/BigDecTest.java | |
| 84782 silly gunzTarPerm modified mode [ 'perf/lib/bigdecimal_GWT/BigDecTest.java', 438, 420 ] | |
| 84783 silly gunzTarPerm extractEntry perf/lib/bigdecimal_GWT/LICENCE.txt | |
| 84784 silly gunzTarPerm modified mode [ 'perf/lib/bigdecimal_GWT/LICENCE.txt', 438, 420 ] | |
| 84785 silly gunzTarPerm extractEntry perf/lib/bigdecimal_ICU4J/BigDecimal-all-last.js | |
| 84786 silly gunzTarPerm modified mode [ 'perf/lib/bigdecimal_ICU4J/BigDecimal-all-last.js', 438, 420 ] | |
| 84787 silly gunzTarPerm extractEntry perf/lib/bigdecimal_ICU4J/BigDecimal-all-last.min.js | |
| 84788 silly gunzTarPerm modified mode [ 'perf/lib/bigdecimal_ICU4J/BigDecimal-all-last.min.js', | |
| 84788 silly gunzTarPerm 438, | |
| 84788 silly gunzTarPerm 420 ] | |
| 84789 silly gunzTarPerm extractEntry perf/lib/bigdecimal_ICU4J/LICENCE.txt | |
| 84790 silly gunzTarPerm modified mode [ 'perf/lib/bigdecimal_ICU4J/LICENCE.txt', 438, 420 ] | |
| 84791 silly gunzTarPerm extractEntry test/abs.js | |
| 84792 silly gunzTarPerm modified mode [ 'test/abs.js', 438, 420 ] | |
| 84793 silly gunzTarPerm extractEntry test/every-test.js | |
| 84794 silly gunzTarPerm modified mode [ 'test/every-test.js', 438, 420 ] | |
| 84795 silly gunzTarPerm extractEntry test/minus.js | |
| 84796 silly gunzTarPerm modified mode [ 'test/minus.js', 438, 420 ] | |
| 84797 silly gunzTarPerm extractEntry test/mod.js | |
| 84798 silly gunzTarPerm modified mode [ 'test/mod.js', 438, 420 ] | |
| 84799 silly gunzTarPerm extractEntry test/div.js | |
| 84800 silly gunzTarPerm modified mode [ 'test/div.js', 438, 420 ] | |
| 84801 silly gunzTarPerm extractEntry test/toPrecision.js | |
| 84802 silly gunzTarPerm modified mode [ 'test/toPrecision.js', 438, 420 ] | |
| 84803 silly gunzTarPerm extractEntry test/round.js | |
| 84804 silly gunzTarPerm modified mode [ 'test/round.js', 438, 420 ] | |
| 84805 silly gunzTarPerm extractEntry test/sqrt.js | |
| 84806 silly gunzTarPerm modified mode [ 'test/sqrt.js', 438, 420 ] | |
| 84807 silly gunzTarPerm extractEntry test/times.js | |
| 84808 silly gunzTarPerm modified mode [ 'test/times.js', 438, 420 ] | |
| 84809 silly gunzTarPerm extractEntry test/toExponential.js | |
| 84810 silly gunzTarPerm modified mode [ 'test/toExponential.js', 438, 420 ] | |
| 84811 silly gunzTarPerm extractEntry test/cmp.js | |
| 84812 silly gunzTarPerm modified mode [ 'test/cmp.js', 438, 420 ] | |
| 84813 silly gunzTarPerm extractEntry test/toFixed.js | |
| 84814 silly gunzTarPerm modified mode [ 'test/toFixed.js', 438, 420 ] | |
| 84815 silly gunzTarPerm extractEntry test/plus.js | |
| 84816 silly gunzTarPerm modified mode [ 'test/plus.js', 438, 420 ] | |
| 84817 silly gunzTarPerm extractEntry test/toString.js | |
| 84818 silly gunzTarPerm modified mode [ 'test/toString.js', 438, 420 ] | |
| 84819 silly gunzTarPerm extractEntry test/pow.js | |
| 84820 silly gunzTarPerm modified mode [ 'test/pow.js', 438, 420 ] | |
| 84821 silly lockFile eb9d16f1-app-pack-node-modules-babel-core tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 84822 silly lockFile eb9d16f1-app-pack-node-modules-babel-core tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 84823 silly lockFile 01903ca8-he-babel-core-5-1-11-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\babel-core\5.1.11\package.tgz | |
| 84824 silly lockFile 01903ca8-he-babel-core-5-1-11-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\babel-core\5.1.11\package.tgz | |
| 84825 info preinstall babel-core@5.1.11 | |
| 84826 verbose readDependencies using package.json deps | |
| 84827 verbose readDependencies using package.json deps | |
| 84828 verbose cache add [ 'ast-types@~0.7.0', null ] | |
| 84829 verbose cache add name=undefined spec="ast-types@~0.7.0" args=["ast-types@~0.7.0",null] | |
| 84830 verbose parsed url { protocol: null, | |
| 84830 verbose parsed url slashes: null, | |
| 84830 verbose parsed url auth: null, | |
| 84830 verbose parsed url host: null, | |
| 84830 verbose parsed url port: null, | |
| 84830 verbose parsed url hostname: null, | |
| 84830 verbose parsed url hash: null, | |
| 84830 verbose parsed url search: null, | |
| 84830 verbose parsed url query: null, | |
| 84830 verbose parsed url pathname: 'ast-types@~0.7.0', | |
| 84830 verbose parsed url path: 'ast-types@~0.7.0', | |
| 84830 verbose parsed url href: 'ast-types@~0.7.0' } | |
| 84831 verbose cache add name="ast-types" spec="~0.7.0" args=["ast-types","~0.7.0"] | |
| 84832 verbose parsed url { protocol: null, | |
| 84832 verbose parsed url slashes: null, | |
| 84832 verbose parsed url auth: null, | |
| 84832 verbose parsed url host: null, | |
| 84832 verbose parsed url port: null, | |
| 84832 verbose parsed url hostname: null, | |
| 84832 verbose parsed url hash: null, | |
| 84832 verbose parsed url search: null, | |
| 84832 verbose parsed url query: null, | |
| 84832 verbose parsed url pathname: '~0.7.0', | |
| 84832 verbose parsed url path: '~0.7.0', | |
| 84832 verbose parsed url href: '~0.7.0' } | |
| 84833 verbose addNamed [ 'ast-types', '~0.7.0' ] | |
| 84834 verbose addNamed [ null, '>=0.7.0-0 <0.8.0-0' ] | |
| 84835 silly lockFile bc92d377-ast-types-0-7-0 ast-types@~0.7.0 | |
| 84836 verbose lock ast-types@~0.7.0 C:\Users\Vince\AppData\Roaming\npm-cache\bc92d377-ast-types-0-7-0.lock | |
| 84837 verbose cache add [ 'chalk@^1.0.0', null ] | |
| 84838 verbose cache add name=undefined spec="chalk@^1.0.0" args=["chalk@^1.0.0",null] | |
| 84839 verbose parsed url { protocol: null, | |
| 84839 verbose parsed url slashes: null, | |
| 84839 verbose parsed url auth: null, | |
| 84839 verbose parsed url host: null, | |
| 84839 verbose parsed url port: null, | |
| 84839 verbose parsed url hostname: null, | |
| 84839 verbose parsed url hash: null, | |
| 84839 verbose parsed url search: null, | |
| 84839 verbose parsed url query: null, | |
| 84839 verbose parsed url pathname: 'chalk@^1.0.0', | |
| 84839 verbose parsed url path: 'chalk@^1.0.0', | |
| 84839 verbose parsed url href: 'chalk@^1.0.0' } | |
| 84840 verbose cache add name="chalk" spec="^1.0.0" args=["chalk","^1.0.0"] | |
| 84841 verbose parsed url { protocol: null, | |
| 84841 verbose parsed url slashes: null, | |
| 84841 verbose parsed url auth: null, | |
| 84841 verbose parsed url host: null, | |
| 84841 verbose parsed url port: null, | |
| 84841 verbose parsed url hostname: null, | |
| 84841 verbose parsed url hash: null, | |
| 84841 verbose parsed url search: null, | |
| 84841 verbose parsed url query: null, | |
| 84841 verbose parsed url pathname: '^1.0.0', | |
| 84841 verbose parsed url path: '^1.0.0', | |
| 84841 verbose parsed url href: '^1.0.0' } | |
| 84842 verbose addNamed [ 'chalk', '^1.0.0' ] | |
| 84843 verbose addNamed [ null, null ] | |
| 84844 silly lockFile 2b6848f7-chalk-1-0-0 chalk@^1.0.0 | |
| 84845 verbose lock chalk@^1.0.0 C:\Users\Vince\AppData\Roaming\npm-cache\2b6848f7-chalk-1-0-0.lock | |
| 84846 verbose cache add [ 'convert-source-map@^1.0.0', null ] | |
| 84847 verbose cache add name=undefined spec="convert-source-map@^1.0.0" args=["convert-source-map@^1.0.0",null] | |
| 84848 verbose parsed url { protocol: null, | |
| 84848 verbose parsed url slashes: null, | |
| 84848 verbose parsed url auth: null, | |
| 84848 verbose parsed url host: null, | |
| 84848 verbose parsed url port: null, | |
| 84848 verbose parsed url hostname: null, | |
| 84848 verbose parsed url hash: null, | |
| 84848 verbose parsed url search: null, | |
| 84848 verbose parsed url query: null, | |
| 84848 verbose parsed url pathname: 'convert-source-map@^1.0.0', | |
| 84848 verbose parsed url path: 'convert-source-map@^1.0.0', | |
| 84848 verbose parsed url href: 'convert-source-map@^1.0.0' } | |
| 84849 verbose cache add name="convert-source-map" spec="^1.0.0" args=["convert-source-map","^1.0.0"] | |
| 84850 verbose parsed url { protocol: null, | |
| 84850 verbose parsed url slashes: null, | |
| 84850 verbose parsed url auth: null, | |
| 84850 verbose parsed url host: null, | |
| 84850 verbose parsed url port: null, | |
| 84850 verbose parsed url hostname: null, | |
| 84850 verbose parsed url hash: null, | |
| 84850 verbose parsed url search: null, | |
| 84850 verbose parsed url query: null, | |
| 84850 verbose parsed url pathname: '^1.0.0', | |
| 84850 verbose parsed url path: '^1.0.0', | |
| 84850 verbose parsed url href: '^1.0.0' } | |
| 84851 verbose addNamed [ 'convert-source-map', '^1.0.0' ] | |
| 84852 verbose addNamed [ null, null ] | |
| 84853 silly lockFile 6a737811-convert-source-map-1-0-0 convert-source-map@^1.0.0 | |
| 84854 verbose lock convert-source-map@^1.0.0 C:\Users\Vince\AppData\Roaming\npm-cache\6a737811-convert-source-map-1-0-0.lock | |
| 84855 verbose cache add [ 'core-js@^0.8.3', null ] | |
| 84856 verbose cache add name=undefined spec="core-js@^0.8.3" args=["core-js@^0.8.3",null] | |
| 84857 verbose parsed url { protocol: null, | |
| 84857 verbose parsed url slashes: null, | |
| 84857 verbose parsed url auth: null, | |
| 84857 verbose parsed url host: null, | |
| 84857 verbose parsed url port: null, | |
| 84857 verbose parsed url hostname: null, | |
| 84857 verbose parsed url hash: null, | |
| 84857 verbose parsed url search: null, | |
| 84857 verbose parsed url query: null, | |
| 84857 verbose parsed url pathname: 'core-js@^0.8.3', | |
| 84857 verbose parsed url path: 'core-js@^0.8.3', | |
| 84857 verbose parsed url href: 'core-js@^0.8.3' } | |
| 84858 verbose cache add name="core-js" spec="^0.8.3" args=["core-js","^0.8.3"] | |
| 84859 verbose parsed url { protocol: null, | |
| 84859 verbose parsed url slashes: null, | |
| 84859 verbose parsed url auth: null, | |
| 84859 verbose parsed url host: null, | |
| 84859 verbose parsed url port: null, | |
| 84859 verbose parsed url hostname: null, | |
| 84859 verbose parsed url hash: null, | |
| 84859 verbose parsed url search: null, | |
| 84859 verbose parsed url query: null, | |
| 84859 verbose parsed url pathname: '^0.8.3', | |
| 84859 verbose parsed url path: '^0.8.3', | |
| 84859 verbose parsed url href: '^0.8.3' } | |
| 84860 verbose addNamed [ 'core-js', '^0.8.3' ] | |
| 84861 verbose addNamed [ null, null ] | |
| 84862 silly lockFile ede6f407-core-js-0-8-3 core-js@^0.8.3 | |
| 84863 verbose lock core-js@^0.8.3 C:\Users\Vince\AppData\Roaming\npm-cache\ede6f407-core-js-0-8-3.lock | |
| 84864 verbose cache add [ 'debug@^2.1.1', null ] | |
| 84865 verbose cache add name=undefined spec="debug@^2.1.1" args=["debug@^2.1.1",null] | |
| 84866 verbose parsed url { protocol: null, | |
| 84866 verbose parsed url slashes: null, | |
| 84866 verbose parsed url auth: null, | |
| 84866 verbose parsed url host: null, | |
| 84866 verbose parsed url port: null, | |
| 84866 verbose parsed url hostname: null, | |
| 84866 verbose parsed url hash: null, | |
| 84866 verbose parsed url search: null, | |
| 84866 verbose parsed url query: null, | |
| 84866 verbose parsed url pathname: 'debug@^2.1.1', | |
| 84866 verbose parsed url path: 'debug@^2.1.1', | |
| 84866 verbose parsed url href: 'debug@^2.1.1' } | |
| 84867 verbose cache add name="debug" spec="^2.1.1" args=["debug","^2.1.1"] | |
| 84868 verbose parsed url { protocol: null, | |
| 84868 verbose parsed url slashes: null, | |
| 84868 verbose parsed url auth: null, | |
| 84868 verbose parsed url host: null, | |
| 84868 verbose parsed url port: null, | |
| 84868 verbose parsed url hostname: null, | |
| 84868 verbose parsed url hash: null, | |
| 84868 verbose parsed url search: null, | |
| 84868 verbose parsed url query: null, | |
| 84868 verbose parsed url pathname: '^2.1.1', | |
| 84868 verbose parsed url path: '^2.1.1', | |
| 84868 verbose parsed url href: '^2.1.1' } | |
| 84869 verbose addNamed [ 'debug', '^2.1.1' ] | |
| 84870 verbose addNamed [ null, null ] | |
| 84871 silly lockFile 0dc79bd7-debug-2-1-1 debug@^2.1.1 | |
| 84872 verbose lock debug@^2.1.1 C:\Users\Vince\AppData\Roaming\npm-cache\0dc79bd7-debug-2-1-1.lock | |
| 84873 verbose cache add [ 'detect-indent@^3.0.0', null ] | |
| 84874 verbose cache add name=undefined spec="detect-indent@^3.0.0" args=["detect-indent@^3.0.0",null] | |
| 84875 verbose parsed url { protocol: null, | |
| 84875 verbose parsed url slashes: null, | |
| 84875 verbose parsed url auth: null, | |
| 84875 verbose parsed url host: null, | |
| 84875 verbose parsed url port: null, | |
| 84875 verbose parsed url hostname: null, | |
| 84875 verbose parsed url hash: null, | |
| 84875 verbose parsed url search: null, | |
| 84875 verbose parsed url query: null, | |
| 84875 verbose parsed url pathname: 'detect-indent@^3.0.0', | |
| 84875 verbose parsed url path: 'detect-indent@^3.0.0', | |
| 84875 verbose parsed url href: 'detect-indent@^3.0.0' } | |
| 84876 verbose cache add name="detect-indent" spec="^3.0.0" args=["detect-indent","^3.0.0"] | |
| 84877 verbose parsed url { protocol: null, | |
| 84877 verbose parsed url slashes: null, | |
| 84877 verbose parsed url auth: null, | |
| 84877 verbose parsed url host: null, | |
| 84877 verbose parsed url port: null, | |
| 84877 verbose parsed url hostname: null, | |
| 84877 verbose parsed url hash: null, | |
| 84877 verbose parsed url search: null, | |
| 84877 verbose parsed url query: null, | |
| 84877 verbose parsed url pathname: '^3.0.0', | |
| 84877 verbose parsed url path: '^3.0.0', | |
| 84877 verbose parsed url href: '^3.0.0' } | |
| 84878 verbose addNamed [ 'detect-indent', '^3.0.0' ] | |
| 84879 verbose addNamed [ null, null ] | |
| 84880 silly lockFile cfe08b67-detect-indent-3-0-0 detect-indent@^3.0.0 | |
| 84881 verbose lock detect-indent@^3.0.0 C:\Users\Vince\AppData\Roaming\npm-cache\cfe08b67-detect-indent-3-0-0.lock | |
| 84882 verbose cache add [ 'estraverse@^3.0.0', null ] | |
| 84883 verbose cache add name=undefined spec="estraverse@^3.0.0" args=["estraverse@^3.0.0",null] | |
| 84884 verbose parsed url { protocol: null, | |
| 84884 verbose parsed url slashes: null, | |
| 84884 verbose parsed url auth: null, | |
| 84884 verbose parsed url host: null, | |
| 84884 verbose parsed url port: null, | |
| 84884 verbose parsed url hostname: null, | |
| 84884 verbose parsed url hash: null, | |
| 84884 verbose parsed url search: null, | |
| 84884 verbose parsed url query: null, | |
| 84884 verbose parsed url pathname: 'estraverse@^3.0.0', | |
| 84884 verbose parsed url path: 'estraverse@^3.0.0', | |
| 84884 verbose parsed url href: 'estraverse@^3.0.0' } | |
| 84885 verbose cache add name="estraverse" spec="^3.0.0" args=["estraverse","^3.0.0"] | |
| 84886 verbose parsed url { protocol: null, | |
| 84886 verbose parsed url slashes: null, | |
| 84886 verbose parsed url auth: null, | |
| 84886 verbose parsed url host: null, | |
| 84886 verbose parsed url port: null, | |
| 84886 verbose parsed url hostname: null, | |
| 84886 verbose parsed url hash: null, | |
| 84886 verbose parsed url search: null, | |
| 84886 verbose parsed url query: null, | |
| 84886 verbose parsed url pathname: '^3.0.0', | |
| 84886 verbose parsed url path: '^3.0.0', | |
| 84886 verbose parsed url href: '^3.0.0' } | |
| 84887 verbose addNamed [ 'estraverse', '^3.0.0' ] | |
| 84888 verbose addNamed [ null, null ] | |
| 84889 silly lockFile 5fa3d4f2-estraverse-3-0-0 estraverse@^3.0.0 | |
| 84890 verbose lock estraverse@^3.0.0 C:\Users\Vince\AppData\Roaming\npm-cache\5fa3d4f2-estraverse-3-0-0.lock | |
| 84891 verbose cache add [ 'esutils@^2.0.0', null ] | |
| 84892 verbose cache add name=undefined spec="esutils@^2.0.0" args=["esutils@^2.0.0",null] | |
| 84893 verbose parsed url { protocol: null, | |
| 84893 verbose parsed url slashes: null, | |
| 84893 verbose parsed url auth: null, | |
| 84893 verbose parsed url host: null, | |
| 84893 verbose parsed url port: null, | |
| 84893 verbose parsed url hostname: null, | |
| 84893 verbose parsed url hash: null, | |
| 84893 verbose parsed url search: null, | |
| 84893 verbose parsed url query: null, | |
| 84893 verbose parsed url pathname: 'esutils@^2.0.0', | |
| 84893 verbose parsed url path: 'esutils@^2.0.0', | |
| 84893 verbose parsed url href: 'esutils@^2.0.0' } | |
| 84894 verbose cache add name="esutils" spec="^2.0.0" args=["esutils","^2.0.0"] | |
| 84895 verbose parsed url { protocol: null, | |
| 84895 verbose parsed url slashes: null, | |
| 84895 verbose parsed url auth: null, | |
| 84895 verbose parsed url host: null, | |
| 84895 verbose parsed url port: null, | |
| 84895 verbose parsed url hostname: null, | |
| 84895 verbose parsed url hash: null, | |
| 84895 verbose parsed url search: null, | |
| 84895 verbose parsed url query: null, | |
| 84895 verbose parsed url pathname: '^2.0.0', | |
| 84895 verbose parsed url path: '^2.0.0', | |
| 84895 verbose parsed url href: '^2.0.0' } | |
| 84896 verbose addNamed [ 'esutils', '^2.0.0' ] | |
| 84897 verbose addNamed [ null, null ] | |
| 84898 silly lockFile 0a46a63a-esutils-2-0-0 esutils@^2.0.0 | |
| 84899 verbose lock esutils@^2.0.0 C:\Users\Vince\AppData\Roaming\npm-cache\0a46a63a-esutils-2-0-0.lock | |
| 84900 verbose cache add [ 'fs-readdir-recursive@^0.1.0', null ] | |
| 84901 verbose cache add name=undefined spec="fs-readdir-recursive@^0.1.0" args=["fs-readdir-recursive@^0.1.0",null] | |
| 84902 verbose parsed url { protocol: null, | |
| 84902 verbose parsed url slashes: null, | |
| 84902 verbose parsed url auth: null, | |
| 84902 verbose parsed url host: null, | |
| 84902 verbose parsed url port: null, | |
| 84902 verbose parsed url hostname: null, | |
| 84902 verbose parsed url hash: null, | |
| 84902 verbose parsed url search: null, | |
| 84902 verbose parsed url query: null, | |
| 84902 verbose parsed url pathname: 'fs-readdir-recursive@^0.1.0', | |
| 84902 verbose parsed url path: 'fs-readdir-recursive@^0.1.0', | |
| 84902 verbose parsed url href: 'fs-readdir-recursive@^0.1.0' } | |
| 84903 verbose cache add name="fs-readdir-recursive" spec="^0.1.0" args=["fs-readdir-recursive","^0.1.0"] | |
| 84904 verbose parsed url { protocol: null, | |
| 84904 verbose parsed url slashes: null, | |
| 84904 verbose parsed url auth: null, | |
| 84904 verbose parsed url host: null, | |
| 84904 verbose parsed url port: null, | |
| 84904 verbose parsed url hostname: null, | |
| 84904 verbose parsed url hash: null, | |
| 84904 verbose parsed url search: null, | |
| 84904 verbose parsed url query: null, | |
| 84904 verbose parsed url pathname: '^0.1.0', | |
| 84904 verbose parsed url path: '^0.1.0', | |
| 84904 verbose parsed url href: '^0.1.0' } | |
| 84905 verbose addNamed [ 'fs-readdir-recursive', '^0.1.0' ] | |
| 84906 verbose addNamed [ null, null ] | |
| 84907 silly lockFile d0326061-fs-readdir-recursive-0-1-0 fs-readdir-recursive@^0.1.0 | |
| 84908 verbose lock fs-readdir-recursive@^0.1.0 C:\Users\Vince\AppData\Roaming\npm-cache\d0326061-fs-readdir-recursive-0-1-0.lock | |
| 84909 verbose cache add [ 'globals@^6.4.0', null ] | |
| 84910 verbose cache add name=undefined spec="globals@^6.4.0" args=["globals@^6.4.0",null] | |
| 84911 verbose parsed url { protocol: null, | |
| 84911 verbose parsed url slashes: null, | |
| 84911 verbose parsed url auth: null, | |
| 84911 verbose parsed url host: null, | |
| 84911 verbose parsed url port: null, | |
| 84911 verbose parsed url hostname: null, | |
| 84911 verbose parsed url hash: null, | |
| 84911 verbose parsed url search: null, | |
| 84911 verbose parsed url query: null, | |
| 84911 verbose parsed url pathname: 'globals@^6.4.0', | |
| 84911 verbose parsed url path: 'globals@^6.4.0', | |
| 84911 verbose parsed url href: 'globals@^6.4.0' } | |
| 84912 verbose cache add name="globals" spec="^6.4.0" args=["globals","^6.4.0"] | |
| 84913 verbose parsed url { protocol: null, | |
| 84913 verbose parsed url slashes: null, | |
| 84913 verbose parsed url auth: null, | |
| 84913 verbose parsed url host: null, | |
| 84913 verbose parsed url port: null, | |
| 84913 verbose parsed url hostname: null, | |
| 84913 verbose parsed url hash: null, | |
| 84913 verbose parsed url search: null, | |
| 84913 verbose parsed url query: null, | |
| 84913 verbose parsed url pathname: '^6.4.0', | |
| 84913 verbose parsed url path: '^6.4.0', | |
| 84913 verbose parsed url href: '^6.4.0' } | |
| 84914 verbose addNamed [ 'globals', '^6.4.0' ] | |
| 84915 verbose addNamed [ null, null ] | |
| 84916 silly lockFile 13e5252f-globals-6-4-0 globals@^6.4.0 | |
| 84917 verbose lock globals@^6.4.0 C:\Users\Vince\AppData\Roaming\npm-cache\13e5252f-globals-6-4-0.lock | |
| 84918 verbose cache add [ 'is-integer@^1.0.4', null ] | |
| 84919 verbose cache add name=undefined spec="is-integer@^1.0.4" args=["is-integer@^1.0.4",null] | |
| 84920 verbose parsed url { protocol: null, | |
| 84920 verbose parsed url slashes: null, | |
| 84920 verbose parsed url auth: null, | |
| 84920 verbose parsed url host: null, | |
| 84920 verbose parsed url port: null, | |
| 84920 verbose parsed url hostname: null, | |
| 84920 verbose parsed url hash: null, | |
| 84920 verbose parsed url search: null, | |
| 84920 verbose parsed url query: null, | |
| 84920 verbose parsed url pathname: 'is-integer@^1.0.4', | |
| 84920 verbose parsed url path: 'is-integer@^1.0.4', | |
| 84920 verbose parsed url href: 'is-integer@^1.0.4' } | |
| 84921 verbose cache add name="is-integer" spec="^1.0.4" args=["is-integer","^1.0.4"] | |
| 84922 verbose parsed url { protocol: null, | |
| 84922 verbose parsed url slashes: null, | |
| 84922 verbose parsed url auth: null, | |
| 84922 verbose parsed url host: null, | |
| 84922 verbose parsed url port: null, | |
| 84922 verbose parsed url hostname: null, | |
| 84922 verbose parsed url hash: null, | |
| 84922 verbose parsed url search: null, | |
| 84922 verbose parsed url query: null, | |
| 84922 verbose parsed url pathname: '^1.0.4', | |
| 84922 verbose parsed url path: '^1.0.4', | |
| 84922 verbose parsed url href: '^1.0.4' } | |
| 84923 verbose addNamed [ 'is-integer', '^1.0.4' ] | |
| 84924 verbose addNamed [ null, null ] | |
| 84925 silly lockFile e7d6cb5f-is-integer-1-0-4 is-integer@^1.0.4 | |
| 84926 verbose lock is-integer@^1.0.4 C:\Users\Vince\AppData\Roaming\npm-cache\e7d6cb5f-is-integer-1-0-4.lock | |
| 84927 verbose cache add [ 'js-tokens@1.0.0', null ] | |
| 84928 verbose cache add name=undefined spec="js-tokens@1.0.0" args=["js-tokens@1.0.0",null] | |
| 84929 verbose parsed url { protocol: null, | |
| 84929 verbose parsed url slashes: null, | |
| 84929 verbose parsed url auth: null, | |
| 84929 verbose parsed url host: null, | |
| 84929 verbose parsed url port: null, | |
| 84929 verbose parsed url hostname: null, | |
| 84929 verbose parsed url hash: null, | |
| 84929 verbose parsed url search: null, | |
| 84929 verbose parsed url query: null, | |
| 84929 verbose parsed url pathname: 'js-tokens@1.0.0', | |
| 84929 verbose parsed url path: 'js-tokens@1.0.0', | |
| 84929 verbose parsed url href: 'js-tokens@1.0.0' } | |
| 84930 verbose cache add name="js-tokens" spec="1.0.0" args=["js-tokens","1.0.0"] | |
| 84931 verbose parsed url { protocol: null, | |
| 84931 verbose parsed url slashes: null, | |
| 84931 verbose parsed url auth: null, | |
| 84931 verbose parsed url host: null, | |
| 84931 verbose parsed url port: null, | |
| 84931 verbose parsed url hostname: null, | |
| 84931 verbose parsed url hash: null, | |
| 84931 verbose parsed url search: null, | |
| 84931 verbose parsed url query: null, | |
| 84931 verbose parsed url pathname: '1.0.0', | |
| 84931 verbose parsed url path: '1.0.0', | |
| 84931 verbose parsed url href: '1.0.0' } | |
| 84932 verbose addNamed [ 'js-tokens', '1.0.0' ] | |
| 84933 verbose addNamed [ '1.0.0', '1.0.0' ] | |
| 84934 silly lockFile 56dac76c-js-tokens-1-0-0 js-tokens@1.0.0 | |
| 84935 verbose lock js-tokens@1.0.0 C:\Users\Vince\AppData\Roaming\npm-cache\56dac76c-js-tokens-1-0-0.lock | |
| 84936 verbose cache add [ 'leven@^1.0.1', null ] | |
| 84937 verbose cache add name=undefined spec="leven@^1.0.1" args=["leven@^1.0.1",null] | |
| 84938 verbose parsed url { protocol: null, | |
| 84938 verbose parsed url slashes: null, | |
| 84938 verbose parsed url auth: null, | |
| 84938 verbose parsed url host: null, | |
| 84938 verbose parsed url port: null, | |
| 84938 verbose parsed url hostname: null, | |
| 84938 verbose parsed url hash: null, | |
| 84938 verbose parsed url search: null, | |
| 84938 verbose parsed url query: null, | |
| 84938 verbose parsed url pathname: 'leven@^1.0.1', | |
| 84938 verbose parsed url path: 'leven@^1.0.1', | |
| 84938 verbose parsed url href: 'leven@^1.0.1' } | |
| 84939 verbose cache add name="leven" spec="^1.0.1" args=["leven","^1.0.1"] | |
| 84940 verbose parsed url { protocol: null, | |
| 84940 verbose parsed url slashes: null, | |
| 84940 verbose parsed url auth: null, | |
| 84940 verbose parsed url host: null, | |
| 84940 verbose parsed url port: null, | |
| 84940 verbose parsed url hostname: null, | |
| 84940 verbose parsed url hash: null, | |
| 84940 verbose parsed url search: null, | |
| 84940 verbose parsed url query: null, | |
| 84940 verbose parsed url pathname: '^1.0.1', | |
| 84940 verbose parsed url path: '^1.0.1', | |
| 84940 verbose parsed url href: '^1.0.1' } | |
| 84941 verbose addNamed [ 'leven', '^1.0.1' ] | |
| 84942 verbose addNamed [ null, null ] | |
| 84943 silly lockFile 871e565c-leven-1-0-1 leven@^1.0.1 | |
| 84944 verbose lock leven@^1.0.1 C:\Users\Vince\AppData\Roaming\npm-cache\871e565c-leven-1-0-1.lock | |
| 84945 verbose cache add [ 'line-numbers@0.2.0', null ] | |
| 84946 verbose cache add name=undefined spec="line-numbers@0.2.0" args=["line-numbers@0.2.0",null] | |
| 84947 verbose parsed url { protocol: null, | |
| 84947 verbose parsed url slashes: null, | |
| 84947 verbose parsed url auth: null, | |
| 84947 verbose parsed url host: null, | |
| 84947 verbose parsed url port: null, | |
| 84947 verbose parsed url hostname: null, | |
| 84947 verbose parsed url hash: null, | |
| 84947 verbose parsed url search: null, | |
| 84947 verbose parsed url query: null, | |
| 84947 verbose parsed url pathname: 'line-numbers@0.2.0', | |
| 84947 verbose parsed url path: 'line-numbers@0.2.0', | |
| 84947 verbose parsed url href: 'line-numbers@0.2.0' } | |
| 84948 verbose cache add name="line-numbers" spec="0.2.0" args=["line-numbers","0.2.0"] | |
| 84949 verbose parsed url { protocol: null, | |
| 84949 verbose parsed url slashes: null, | |
| 84949 verbose parsed url auth: null, | |
| 84949 verbose parsed url host: null, | |
| 84949 verbose parsed url port: null, | |
| 84949 verbose parsed url hostname: null, | |
| 84949 verbose parsed url hash: null, | |
| 84949 verbose parsed url search: null, | |
| 84949 verbose parsed url query: null, | |
| 84949 verbose parsed url pathname: '0.2.0', | |
| 84949 verbose parsed url path: '0.2.0', | |
| 84949 verbose parsed url href: '0.2.0' } | |
| 84950 verbose addNamed [ 'line-numbers', '0.2.0' ] | |
| 84951 verbose addNamed [ '0.2.0', '0.2.0' ] | |
| 84952 silly lockFile f4758902-line-numbers-0-2-0 line-numbers@0.2.0 | |
| 84953 verbose lock line-numbers@0.2.0 C:\Users\Vince\AppData\Roaming\npm-cache\f4758902-line-numbers-0-2-0.lock | |
| 84954 verbose cache add [ 'lodash@^3.6.0', null ] | |
| 84955 verbose cache add name=undefined spec="lodash@^3.6.0" args=["lodash@^3.6.0",null] | |
| 84956 verbose parsed url { protocol: null, | |
| 84956 verbose parsed url slashes: null, | |
| 84956 verbose parsed url auth: null, | |
| 84956 verbose parsed url host: null, | |
| 84956 verbose parsed url port: null, | |
| 84956 verbose parsed url hostname: null, | |
| 84956 verbose parsed url hash: null, | |
| 84956 verbose parsed url search: null, | |
| 84956 verbose parsed url query: null, | |
| 84956 verbose parsed url pathname: 'lodash@^3.6.0', | |
| 84956 verbose parsed url path: 'lodash@^3.6.0', | |
| 84956 verbose parsed url href: 'lodash@^3.6.0' } | |
| 84957 verbose cache add name="lodash" spec="^3.6.0" args=["lodash","^3.6.0"] | |
| 84958 verbose parsed url { protocol: null, | |
| 84958 verbose parsed url slashes: null, | |
| 84958 verbose parsed url auth: null, | |
| 84958 verbose parsed url host: null, | |
| 84958 verbose parsed url port: null, | |
| 84958 verbose parsed url hostname: null, | |
| 84958 verbose parsed url hash: null, | |
| 84958 verbose parsed url search: null, | |
| 84958 verbose parsed url query: null, | |
| 84958 verbose parsed url pathname: '^3.6.0', | |
| 84958 verbose parsed url path: '^3.6.0', | |
| 84958 verbose parsed url href: '^3.6.0' } | |
| 84959 verbose addNamed [ 'lodash', '^3.6.0' ] | |
| 84960 verbose addNamed [ null, null ] | |
| 84961 silly lockFile 02802cad-lodash-3-6-0 lodash@^3.6.0 | |
| 84962 verbose lock lodash@^3.6.0 C:\Users\Vince\AppData\Roaming\npm-cache\02802cad-lodash-3-6-0.lock | |
| 84963 verbose cache add [ 'minimatch@^2.0.3', null ] | |
| 84964 verbose cache add name=undefined spec="minimatch@^2.0.3" args=["minimatch@^2.0.3",null] | |
| 84965 verbose parsed url { protocol: null, | |
| 84965 verbose parsed url slashes: null, | |
| 84965 verbose parsed url auth: null, | |
| 84965 verbose parsed url host: null, | |
| 84965 verbose parsed url port: null, | |
| 84965 verbose parsed url hostname: null, | |
| 84965 verbose parsed url hash: null, | |
| 84965 verbose parsed url search: null, | |
| 84965 verbose parsed url query: null, | |
| 84965 verbose parsed url pathname: 'minimatch@^2.0.3', | |
| 84965 verbose parsed url path: 'minimatch@^2.0.3', | |
| 84965 verbose parsed url href: 'minimatch@^2.0.3' } | |
| 84966 verbose cache add name="minimatch" spec="^2.0.3" args=["minimatch","^2.0.3"] | |
| 84967 verbose parsed url { protocol: null, | |
| 84967 verbose parsed url slashes: null, | |
| 84967 verbose parsed url auth: null, | |
| 84967 verbose parsed url host: null, | |
| 84967 verbose parsed url port: null, | |
| 84967 verbose parsed url hostname: null, | |
| 84967 verbose parsed url hash: null, | |
| 84967 verbose parsed url search: null, | |
| 84967 verbose parsed url query: null, | |
| 84967 verbose parsed url pathname: '^2.0.3', | |
| 84967 verbose parsed url path: '^2.0.3', | |
| 84967 verbose parsed url href: '^2.0.3' } | |
| 84968 verbose addNamed [ 'minimatch', '^2.0.3' ] | |
| 84969 verbose addNamed [ null, null ] | |
| 84970 silly lockFile 5504e165-minimatch-2-0-3 minimatch@^2.0.3 | |
| 84971 verbose lock minimatch@^2.0.3 C:\Users\Vince\AppData\Roaming\npm-cache\5504e165-minimatch-2-0-3.lock | |
| 84972 verbose cache add [ 'output-file-sync@^1.1.0', null ] | |
| 84973 verbose cache add name=undefined spec="output-file-sync@^1.1.0" args=["output-file-sync@^1.1.0",null] | |
| 84974 verbose parsed url { protocol: null, | |
| 84974 verbose parsed url slashes: null, | |
| 84974 verbose parsed url auth: null, | |
| 84974 verbose parsed url host: null, | |
| 84974 verbose parsed url port: null, | |
| 84974 verbose parsed url hostname: null, | |
| 84974 verbose parsed url hash: null, | |
| 84974 verbose parsed url search: null, | |
| 84974 verbose parsed url query: null, | |
| 84974 verbose parsed url pathname: 'output-file-sync@^1.1.0', | |
| 84974 verbose parsed url path: 'output-file-sync@^1.1.0', | |
| 84974 verbose parsed url href: 'output-file-sync@^1.1.0' } | |
| 84975 verbose cache add name="output-file-sync" spec="^1.1.0" args=["output-file-sync","^1.1.0"] | |
| 84976 verbose parsed url { protocol: null, | |
| 84976 verbose parsed url slashes: null, | |
| 84976 verbose parsed url auth: null, | |
| 84976 verbose parsed url host: null, | |
| 84976 verbose parsed url port: null, | |
| 84976 verbose parsed url hostname: null, | |
| 84976 verbose parsed url hash: null, | |
| 84976 verbose parsed url search: null, | |
| 84976 verbose parsed url query: null, | |
| 84976 verbose parsed url pathname: '^1.1.0', | |
| 84976 verbose parsed url path: '^1.1.0', | |
| 84976 verbose parsed url href: '^1.1.0' } | |
| 84977 verbose addNamed [ 'output-file-sync', '^1.1.0' ] | |
| 84978 verbose addNamed [ null, null ] | |
| 84979 silly lockFile 5b112237-output-file-sync-1-1-0 output-file-sync@^1.1.0 | |
| 84980 verbose lock output-file-sync@^1.1.0 C:\Users\Vince\AppData\Roaming\npm-cache\5b112237-output-file-sync-1-1-0.lock | |
| 84981 verbose cache add [ 'path-is-absolute@^1.0.0', null ] | |
| 84982 verbose cache add name=undefined spec="path-is-absolute@^1.0.0" args=["path-is-absolute@^1.0.0",null] | |
| 84983 verbose parsed url { protocol: null, | |
| 84983 verbose parsed url slashes: null, | |
| 84983 verbose parsed url auth: null, | |
| 84983 verbose parsed url host: null, | |
| 84983 verbose parsed url port: null, | |
| 84983 verbose parsed url hostname: null, | |
| 84983 verbose parsed url hash: null, | |
| 84983 verbose parsed url search: null, | |
| 84983 verbose parsed url query: null, | |
| 84983 verbose parsed url pathname: 'path-is-absolute@^1.0.0', | |
| 84983 verbose parsed url path: 'path-is-absolute@^1.0.0', | |
| 84983 verbose parsed url href: 'path-is-absolute@^1.0.0' } | |
| 84984 verbose cache add name="path-is-absolute" spec="^1.0.0" args=["path-is-absolute","^1.0.0"] | |
| 84985 verbose parsed url { protocol: null, | |
| 84985 verbose parsed url slashes: null, | |
| 84985 verbose parsed url auth: null, | |
| 84985 verbose parsed url host: null, | |
| 84985 verbose parsed url port: null, | |
| 84985 verbose parsed url hostname: null, | |
| 84985 verbose parsed url hash: null, | |
| 84985 verbose parsed url search: null, | |
| 84985 verbose parsed url query: null, | |
| 84985 verbose parsed url pathname: '^1.0.0', | |
| 84985 verbose parsed url path: '^1.0.0', | |
| 84985 verbose parsed url href: '^1.0.0' } | |
| 84986 verbose addNamed [ 'path-is-absolute', '^1.0.0' ] | |
| 84987 verbose addNamed [ null, null ] | |
| 84988 silly lockFile 0add5472-path-is-absolute-1-0-0 path-is-absolute@^1.0.0 | |
| 84989 verbose lock path-is-absolute@^1.0.0 C:\Users\Vince\AppData\Roaming\npm-cache\0add5472-path-is-absolute-1-0-0.lock | |
| 84990 verbose cache add [ 'private@^0.1.6', null ] | |
| 84991 verbose cache add name=undefined spec="private@^0.1.6" args=["private@^0.1.6",null] | |
| 84992 verbose parsed url { protocol: null, | |
| 84992 verbose parsed url slashes: null, | |
| 84992 verbose parsed url auth: null, | |
| 84992 verbose parsed url host: null, | |
| 84992 verbose parsed url port: null, | |
| 84992 verbose parsed url hostname: null, | |
| 84992 verbose parsed url hash: null, | |
| 84992 verbose parsed url search: null, | |
| 84992 verbose parsed url query: null, | |
| 84992 verbose parsed url pathname: 'private@^0.1.6', | |
| 84992 verbose parsed url path: 'private@^0.1.6', | |
| 84992 verbose parsed url href: 'private@^0.1.6' } | |
| 84993 verbose cache add name="private" spec="^0.1.6" args=["private","^0.1.6"] | |
| 84994 verbose parsed url { protocol: null, | |
| 84994 verbose parsed url slashes: null, | |
| 84994 verbose parsed url auth: null, | |
| 84994 verbose parsed url host: null, | |
| 84994 verbose parsed url port: null, | |
| 84994 verbose parsed url hostname: null, | |
| 84994 verbose parsed url hash: null, | |
| 84994 verbose parsed url search: null, | |
| 84994 verbose parsed url query: null, | |
| 84994 verbose parsed url pathname: '^0.1.6', | |
| 84994 verbose parsed url path: '^0.1.6', | |
| 84994 verbose parsed url href: '^0.1.6' } | |
| 84995 verbose addNamed [ 'private', '^0.1.6' ] | |
| 84996 verbose addNamed [ null, null ] | |
| 84997 silly lockFile 29e2ee19-private-0-1-6 private@^0.1.6 | |
| 84998 verbose lock private@^0.1.6 C:\Users\Vince\AppData\Roaming\npm-cache\29e2ee19-private-0-1-6.lock | |
| 84999 verbose cache add [ 'regenerator@^0.8.20', null ] | |
| 85000 verbose cache add name=undefined spec="regenerator@^0.8.20" args=["regenerator@^0.8.20",null] | |
| 85001 verbose parsed url { protocol: null, | |
| 85001 verbose parsed url slashes: null, | |
| 85001 verbose parsed url auth: null, | |
| 85001 verbose parsed url host: null, | |
| 85001 verbose parsed url port: null, | |
| 85001 verbose parsed url hostname: null, | |
| 85001 verbose parsed url hash: null, | |
| 85001 verbose parsed url search: null, | |
| 85001 verbose parsed url query: null, | |
| 85001 verbose parsed url pathname: 'regenerator@^0.8.20', | |
| 85001 verbose parsed url path: 'regenerator@^0.8.20', | |
| 85001 verbose parsed url href: 'regenerator@^0.8.20' } | |
| 85002 verbose cache add name="regenerator" spec="^0.8.20" args=["regenerator","^0.8.20"] | |
| 85003 verbose parsed url { protocol: null, | |
| 85003 verbose parsed url slashes: null, | |
| 85003 verbose parsed url auth: null, | |
| 85003 verbose parsed url host: null, | |
| 85003 verbose parsed url port: null, | |
| 85003 verbose parsed url hostname: null, | |
| 85003 verbose parsed url hash: null, | |
| 85003 verbose parsed url search: null, | |
| 85003 verbose parsed url query: null, | |
| 85003 verbose parsed url pathname: '^0.8.20', | |
| 85003 verbose parsed url path: '^0.8.20', | |
| 85003 verbose parsed url href: '^0.8.20' } | |
| 85004 verbose addNamed [ 'regenerator', '^0.8.20' ] | |
| 85005 verbose addNamed [ null, null ] | |
| 85006 silly lockFile 42e5322c-regenerator-0-8-20 regenerator@^0.8.20 | |
| 85007 verbose lock regenerator@^0.8.20 C:\Users\Vince\AppData\Roaming\npm-cache\42e5322c-regenerator-0-8-20.lock | |
| 85008 verbose cache add [ 'regexpu@^1.1.2', null ] | |
| 85009 verbose cache add name=undefined spec="regexpu@^1.1.2" args=["regexpu@^1.1.2",null] | |
| 85010 verbose parsed url { protocol: null, | |
| 85010 verbose parsed url slashes: null, | |
| 85010 verbose parsed url auth: null, | |
| 85010 verbose parsed url host: null, | |
| 85010 verbose parsed url port: null, | |
| 85010 verbose parsed url hostname: null, | |
| 85010 verbose parsed url hash: null, | |
| 85010 verbose parsed url search: null, | |
| 85010 verbose parsed url query: null, | |
| 85010 verbose parsed url pathname: 'regexpu@^1.1.2', | |
| 85010 verbose parsed url path: 'regexpu@^1.1.2', | |
| 85010 verbose parsed url href: 'regexpu@^1.1.2' } | |
| 85011 verbose cache add name="regexpu" spec="^1.1.2" args=["regexpu","^1.1.2"] | |
| 85012 verbose parsed url { protocol: null, | |
| 85012 verbose parsed url slashes: null, | |
| 85012 verbose parsed url auth: null, | |
| 85012 verbose parsed url host: null, | |
| 85012 verbose parsed url port: null, | |
| 85012 verbose parsed url hostname: null, | |
| 85012 verbose parsed url hash: null, | |
| 85012 verbose parsed url search: null, | |
| 85012 verbose parsed url query: null, | |
| 85012 verbose parsed url pathname: '^1.1.2', | |
| 85012 verbose parsed url path: '^1.1.2', | |
| 85012 verbose parsed url href: '^1.1.2' } | |
| 85013 verbose addNamed [ 'regexpu', '^1.1.2' ] | |
| 85014 verbose addNamed [ null, null ] | |
| 85015 silly lockFile a0ab6506-regexpu-1-1-2 regexpu@^1.1.2 | |
| 85016 verbose lock regexpu@^1.1.2 C:\Users\Vince\AppData\Roaming\npm-cache\a0ab6506-regexpu-1-1-2.lock | |
| 85017 verbose cache add [ 'repeating@^1.1.2', null ] | |
| 85018 verbose cache add name=undefined spec="repeating@^1.1.2" args=["repeating@^1.1.2",null] | |
| 85019 verbose parsed url { protocol: null, | |
| 85019 verbose parsed url slashes: null, | |
| 85019 verbose parsed url auth: null, | |
| 85019 verbose parsed url host: null, | |
| 85019 verbose parsed url port: null, | |
| 85019 verbose parsed url hostname: null, | |
| 85019 verbose parsed url hash: null, | |
| 85019 verbose parsed url search: null, | |
| 85019 verbose parsed url query: null, | |
| 85019 verbose parsed url pathname: 'repeating@^1.1.2', | |
| 85019 verbose parsed url path: 'repeating@^1.1.2', | |
| 85019 verbose parsed url href: 'repeating@^1.1.2' } | |
| 85020 verbose cache add name="repeating" spec="^1.1.2" args=["repeating","^1.1.2"] | |
| 85021 verbose parsed url { protocol: null, | |
| 85021 verbose parsed url slashes: null, | |
| 85021 verbose parsed url auth: null, | |
| 85021 verbose parsed url host: null, | |
| 85021 verbose parsed url port: null, | |
| 85021 verbose parsed url hostname: null, | |
| 85021 verbose parsed url hash: null, | |
| 85021 verbose parsed url search: null, | |
| 85021 verbose parsed url query: null, | |
| 85021 verbose parsed url pathname: '^1.1.2', | |
| 85021 verbose parsed url path: '^1.1.2', | |
| 85021 verbose parsed url href: '^1.1.2' } | |
| 85022 verbose addNamed [ 'repeating', '^1.1.2' ] | |
| 85023 verbose addNamed [ null, null ] | |
| 85024 silly lockFile 0fe0a906-repeating-1-1-2 repeating@^1.1.2 | |
| 85025 verbose lock repeating@^1.1.2 C:\Users\Vince\AppData\Roaming\npm-cache\0fe0a906-repeating-1-1-2.lock | |
| 85026 verbose cache add [ 'shebang-regex@^1.0.0', null ] | |
| 85027 verbose cache add name=undefined spec="shebang-regex@^1.0.0" args=["shebang-regex@^1.0.0",null] | |
| 85028 verbose parsed url { protocol: null, | |
| 85028 verbose parsed url slashes: null, | |
| 85028 verbose parsed url auth: null, | |
| 85028 verbose parsed url host: null, | |
| 85028 verbose parsed url port: null, | |
| 85028 verbose parsed url hostname: null, | |
| 85028 verbose parsed url hash: null, | |
| 85028 verbose parsed url search: null, | |
| 85028 verbose parsed url query: null, | |
| 85028 verbose parsed url pathname: 'shebang-regex@^1.0.0', | |
| 85028 verbose parsed url path: 'shebang-regex@^1.0.0', | |
| 85028 verbose parsed url href: 'shebang-regex@^1.0.0' } | |
| 85029 verbose cache add name="shebang-regex" spec="^1.0.0" args=["shebang-regex","^1.0.0"] | |
| 85030 verbose parsed url { protocol: null, | |
| 85030 verbose parsed url slashes: null, | |
| 85030 verbose parsed url auth: null, | |
| 85030 verbose parsed url host: null, | |
| 85030 verbose parsed url port: null, | |
| 85030 verbose parsed url hostname: null, | |
| 85030 verbose parsed url hash: null, | |
| 85030 verbose parsed url search: null, | |
| 85030 verbose parsed url query: null, | |
| 85030 verbose parsed url pathname: '^1.0.0', | |
| 85030 verbose parsed url path: '^1.0.0', | |
| 85030 verbose parsed url href: '^1.0.0' } | |
| 85031 verbose addNamed [ 'shebang-regex', '^1.0.0' ] | |
| 85032 verbose addNamed [ null, null ] | |
| 85033 silly lockFile 5d9164e3-shebang-regex-1-0-0 shebang-regex@^1.0.0 | |
| 85034 verbose lock shebang-regex@^1.0.0 C:\Users\Vince\AppData\Roaming\npm-cache\5d9164e3-shebang-regex-1-0-0.lock | |
| 85035 verbose cache add [ 'slash@^1.0.0', null ] | |
| 85036 verbose cache add name=undefined spec="slash@^1.0.0" args=["slash@^1.0.0",null] | |
| 85037 verbose parsed url { protocol: null, | |
| 85037 verbose parsed url slashes: null, | |
| 85037 verbose parsed url auth: null, | |
| 85037 verbose parsed url host: null, | |
| 85037 verbose parsed url port: null, | |
| 85037 verbose parsed url hostname: null, | |
| 85037 verbose parsed url hash: null, | |
| 85037 verbose parsed url search: null, | |
| 85037 verbose parsed url query: null, | |
| 85037 verbose parsed url pathname: 'slash@^1.0.0', | |
| 85037 verbose parsed url path: 'slash@^1.0.0', | |
| 85037 verbose parsed url href: 'slash@^1.0.0' } | |
| 85038 verbose cache add name="slash" spec="^1.0.0" args=["slash","^1.0.0"] | |
| 85039 verbose parsed url { protocol: null, | |
| 85039 verbose parsed url slashes: null, | |
| 85039 verbose parsed url auth: null, | |
| 85039 verbose parsed url host: null, | |
| 85039 verbose parsed url port: null, | |
| 85039 verbose parsed url hostname: null, | |
| 85039 verbose parsed url hash: null, | |
| 85039 verbose parsed url search: null, | |
| 85039 verbose parsed url query: null, | |
| 85039 verbose parsed url pathname: '^1.0.0', | |
| 85039 verbose parsed url path: '^1.0.0', | |
| 85039 verbose parsed url href: '^1.0.0' } | |
| 85040 verbose addNamed [ 'slash', '^1.0.0' ] | |
| 85041 verbose addNamed [ null, null ] | |
| 85042 silly lockFile 5e01e0f1-slash-1-0-0 slash@^1.0.0 | |
| 85043 verbose lock slash@^1.0.0 C:\Users\Vince\AppData\Roaming\npm-cache\5e01e0f1-slash-1-0-0.lock | |
| 85044 verbose cache add [ 'source-map@^0.4.0', null ] | |
| 85045 verbose cache add name=undefined spec="source-map@^0.4.0" args=["source-map@^0.4.0",null] | |
| 85046 verbose parsed url { protocol: null, | |
| 85046 verbose parsed url slashes: null, | |
| 85046 verbose parsed url auth: null, | |
| 85046 verbose parsed url host: null, | |
| 85046 verbose parsed url port: null, | |
| 85046 verbose parsed url hostname: null, | |
| 85046 verbose parsed url hash: null, | |
| 85046 verbose parsed url search: null, | |
| 85046 verbose parsed url query: null, | |
| 85046 verbose parsed url pathname: 'source-map@^0.4.0', | |
| 85046 verbose parsed url path: 'source-map@^0.4.0', | |
| 85046 verbose parsed url href: 'source-map@^0.4.0' } | |
| 85047 verbose cache add name="source-map" spec="^0.4.0" args=["source-map","^0.4.0"] | |
| 85048 verbose parsed url { protocol: null, | |
| 85048 verbose parsed url slashes: null, | |
| 85048 verbose parsed url auth: null, | |
| 85048 verbose parsed url host: null, | |
| 85048 verbose parsed url port: null, | |
| 85048 verbose parsed url hostname: null, | |
| 85048 verbose parsed url hash: null, | |
| 85048 verbose parsed url search: null, | |
| 85048 verbose parsed url query: null, | |
| 85048 verbose parsed url pathname: '^0.4.0', | |
| 85048 verbose parsed url path: '^0.4.0', | |
| 85048 verbose parsed url href: '^0.4.0' } | |
| 85049 verbose addNamed [ 'source-map', '^0.4.0' ] | |
| 85050 verbose addNamed [ null, null ] | |
| 85051 silly lockFile 75dc20b0-source-map-0-4-0 source-map@^0.4.0 | |
| 85052 verbose lock source-map@^0.4.0 C:\Users\Vince\AppData\Roaming\npm-cache\75dc20b0-source-map-0-4-0.lock | |
| 85053 verbose cache add [ 'source-map-support@^0.2.10', null ] | |
| 85054 verbose cache add name=undefined spec="source-map-support@^0.2.10" args=["source-map-support@^0.2.10",null] | |
| 85055 verbose parsed url { protocol: null, | |
| 85055 verbose parsed url slashes: null, | |
| 85055 verbose parsed url auth: null, | |
| 85055 verbose parsed url host: null, | |
| 85055 verbose parsed url port: null, | |
| 85055 verbose parsed url hostname: null, | |
| 85055 verbose parsed url hash: null, | |
| 85055 verbose parsed url search: null, | |
| 85055 verbose parsed url query: null, | |
| 85055 verbose parsed url pathname: 'source-map-support@^0.2.10', | |
| 85055 verbose parsed url path: 'source-map-support@^0.2.10', | |
| 85055 verbose parsed url href: 'source-map-support@^0.2.10' } | |
| 85056 verbose cache add name="source-map-support" spec="^0.2.10" args=["source-map-support","^0.2.10"] | |
| 85057 verbose parsed url { protocol: null, | |
| 85057 verbose parsed url slashes: null, | |
| 85057 verbose parsed url auth: null, | |
| 85057 verbose parsed url host: null, | |
| 85057 verbose parsed url port: null, | |
| 85057 verbose parsed url hostname: null, | |
| 85057 verbose parsed url hash: null, | |
| 85057 verbose parsed url search: null, | |
| 85057 verbose parsed url query: null, | |
| 85057 verbose parsed url pathname: '^0.2.10', | |
| 85057 verbose parsed url path: '^0.2.10', | |
| 85057 verbose parsed url href: '^0.2.10' } | |
| 85058 verbose addNamed [ 'source-map-support', '^0.2.10' ] | |
| 85059 verbose addNamed [ null, null ] | |
| 85060 silly lockFile 46603d62-source-map-support-0-2-10 source-map-support@^0.2.10 | |
| 85061 verbose lock source-map-support@^0.2.10 C:\Users\Vince\AppData\Roaming\npm-cache\46603d62-source-map-support-0-2-10.lock | |
| 85062 verbose cache add [ 'strip-json-comments@^1.0.2', null ] | |
| 85063 verbose cache add name=undefined spec="strip-json-comments@^1.0.2" args=["strip-json-comments@^1.0.2",null] | |
| 85064 verbose parsed url { protocol: null, | |
| 85064 verbose parsed url slashes: null, | |
| 85064 verbose parsed url auth: null, | |
| 85064 verbose parsed url host: null, | |
| 85064 verbose parsed url port: null, | |
| 85064 verbose parsed url hostname: null, | |
| 85064 verbose parsed url hash: null, | |
| 85064 verbose parsed url search: null, | |
| 85064 verbose parsed url query: null, | |
| 85064 verbose parsed url pathname: 'strip-json-comments@^1.0.2', | |
| 85064 verbose parsed url path: 'strip-json-comments@^1.0.2', | |
| 85064 verbose parsed url href: 'strip-json-comments@^1.0.2' } | |
| 85065 verbose cache add name="strip-json-comments" spec="^1.0.2" args=["strip-json-comments","^1.0.2"] | |
| 85066 verbose parsed url { protocol: null, | |
| 85066 verbose parsed url slashes: null, | |
| 85066 verbose parsed url auth: null, | |
| 85066 verbose parsed url host: null, | |
| 85066 verbose parsed url port: null, | |
| 85066 verbose parsed url hostname: null, | |
| 85066 verbose parsed url hash: null, | |
| 85066 verbose parsed url search: null, | |
| 85066 verbose parsed url query: null, | |
| 85066 verbose parsed url pathname: '^1.0.2', | |
| 85066 verbose parsed url path: '^1.0.2', | |
| 85066 verbose parsed url href: '^1.0.2' } | |
| 85067 verbose addNamed [ 'strip-json-comments', '^1.0.2' ] | |
| 85068 verbose addNamed [ null, null ] | |
| 85069 silly lockFile 18fbc7be-strip-json-comments-1-0-2 strip-json-comments@^1.0.2 | |
| 85070 verbose lock strip-json-comments@^1.0.2 C:\Users\Vince\AppData\Roaming\npm-cache\18fbc7be-strip-json-comments-1-0-2.lock | |
| 85071 verbose cache add [ 'to-fast-properties@^1.0.0', null ] | |
| 85072 verbose cache add name=undefined spec="to-fast-properties@^1.0.0" args=["to-fast-properties@^1.0.0",null] | |
| 85073 verbose parsed url { protocol: null, | |
| 85073 verbose parsed url slashes: null, | |
| 85073 verbose parsed url auth: null, | |
| 85073 verbose parsed url host: null, | |
| 85073 verbose parsed url port: null, | |
| 85073 verbose parsed url hostname: null, | |
| 85073 verbose parsed url hash: null, | |
| 85073 verbose parsed url search: null, | |
| 85073 verbose parsed url query: null, | |
| 85073 verbose parsed url pathname: 'to-fast-properties@^1.0.0', | |
| 85073 verbose parsed url path: 'to-fast-properties@^1.0.0', | |
| 85073 verbose parsed url href: 'to-fast-properties@^1.0.0' } | |
| 85074 verbose cache add name="to-fast-properties" spec="^1.0.0" args=["to-fast-properties","^1.0.0"] | |
| 85075 verbose parsed url { protocol: null, | |
| 85075 verbose parsed url slashes: null, | |
| 85075 verbose parsed url auth: null, | |
| 85075 verbose parsed url host: null, | |
| 85075 verbose parsed url port: null, | |
| 85075 verbose parsed url hostname: null, | |
| 85075 verbose parsed url hash: null, | |
| 85075 verbose parsed url search: null, | |
| 85075 verbose parsed url query: null, | |
| 85075 verbose parsed url pathname: '^1.0.0', | |
| 85075 verbose parsed url path: '^1.0.0', | |
| 85075 verbose parsed url href: '^1.0.0' } | |
| 85076 verbose addNamed [ 'to-fast-properties', '^1.0.0' ] | |
| 85077 verbose addNamed [ null, null ] | |
| 85078 silly lockFile 2e352511-to-fast-properties-1-0-0 to-fast-properties@^1.0.0 | |
| 85079 verbose lock to-fast-properties@^1.0.0 C:\Users\Vince\AppData\Roaming\npm-cache\2e352511-to-fast-properties-1-0-0.lock | |
| 85080 verbose cache add [ 'trim-right@^1.0.0', null ] | |
| 85081 verbose cache add name=undefined spec="trim-right@^1.0.0" args=["trim-right@^1.0.0",null] | |
| 85082 verbose parsed url { protocol: null, | |
| 85082 verbose parsed url slashes: null, | |
| 85082 verbose parsed url auth: null, | |
| 85082 verbose parsed url host: null, | |
| 85082 verbose parsed url port: null, | |
| 85082 verbose parsed url hostname: null, | |
| 85082 verbose parsed url hash: null, | |
| 85082 verbose parsed url search: null, | |
| 85082 verbose parsed url query: null, | |
| 85082 verbose parsed url pathname: 'trim-right@^1.0.0', | |
| 85082 verbose parsed url path: 'trim-right@^1.0.0', | |
| 85082 verbose parsed url href: 'trim-right@^1.0.0' } | |
| 85083 verbose cache add name="trim-right" spec="^1.0.0" args=["trim-right","^1.0.0"] | |
| 85084 verbose parsed url { protocol: null, | |
| 85084 verbose parsed url slashes: null, | |
| 85084 verbose parsed url auth: null, | |
| 85084 verbose parsed url host: null, | |
| 85084 verbose parsed url port: null, | |
| 85084 verbose parsed url hostname: null, | |
| 85084 verbose parsed url hash: null, | |
| 85084 verbose parsed url search: null, | |
| 85084 verbose parsed url query: null, | |
| 85084 verbose parsed url pathname: '^1.0.0', | |
| 85084 verbose parsed url path: '^1.0.0', | |
| 85084 verbose parsed url href: '^1.0.0' } | |
| 85085 verbose addNamed [ 'trim-right', '^1.0.0' ] | |
| 85086 verbose addNamed [ null, null ] | |
| 85087 silly lockFile 8a1ace6d-trim-right-1-0-0 trim-right@^1.0.0 | |
| 85088 verbose lock trim-right@^1.0.0 C:\Users\Vince\AppData\Roaming\npm-cache\8a1ace6d-trim-right-1-0-0.lock | |
| 85089 verbose cache add [ 'user-home@^1.1.1', null ] | |
| 85090 verbose cache add name=undefined spec="user-home@^1.1.1" args=["user-home@^1.1.1",null] | |
| 85091 verbose parsed url { protocol: null, | |
| 85091 verbose parsed url slashes: null, | |
| 85091 verbose parsed url auth: null, | |
| 85091 verbose parsed url host: null, | |
| 85091 verbose parsed url port: null, | |
| 85091 verbose parsed url hostname: null, | |
| 85091 verbose parsed url hash: null, | |
| 85091 verbose parsed url search: null, | |
| 85091 verbose parsed url query: null, | |
| 85091 verbose parsed url pathname: 'user-home@^1.1.1', | |
| 85091 verbose parsed url path: 'user-home@^1.1.1', | |
| 85091 verbose parsed url href: 'user-home@^1.1.1' } | |
| 85092 verbose cache add name="user-home" spec="^1.1.1" args=["user-home","^1.1.1"] | |
| 85093 verbose parsed url { protocol: null, | |
| 85093 verbose parsed url slashes: null, | |
| 85093 verbose parsed url auth: null, | |
| 85093 verbose parsed url host: null, | |
| 85093 verbose parsed url port: null, | |
| 85093 verbose parsed url hostname: null, | |
| 85093 verbose parsed url hash: null, | |
| 85093 verbose parsed url search: null, | |
| 85093 verbose parsed url query: null, | |
| 85093 verbose parsed url pathname: '^1.1.1', | |
| 85093 verbose parsed url path: '^1.1.1', | |
| 85093 verbose parsed url href: '^1.1.1' } | |
| 85094 verbose addNamed [ 'user-home', '^1.1.1' ] | |
| 85095 verbose addNamed [ null, null ] | |
| 85096 silly lockFile d8d27d25-user-home-1-1-1 user-home@^1.1.1 | |
| 85097 verbose lock user-home@^1.1.1 C:\Users\Vince\AppData\Roaming\npm-cache\d8d27d25-user-home-1-1-1.lock | |
| 85098 silly addNameRange { name: 'ast-types', | |
| 85098 silly addNameRange range: '>=0.7.0-0 <0.8.0-0', | |
| 85098 silly addNameRange hasData: false } | |
| 85099 silly addNameRange { name: 'chalk', range: '*', hasData: false } | |
| 85100 silly addNameRange { name: 'convert-source-map', range: '*', hasData: false } | |
| 85101 silly addNameRange { name: 'core-js', range: '*', hasData: false } | |
| 85102 silly addNameRange { name: 'debug', range: '*', hasData: false } | |
| 85103 silly addNameRange { name: 'detect-indent', range: '*', hasData: false } | |
| 85104 silly addNameRange { name: 'estraverse', range: '*', hasData: false } | |
| 85105 silly addNameRange { name: 'esutils', range: '*', hasData: false } | |
| 85106 silly addNameRange { name: 'fs-readdir-recursive', range: '*', hasData: false } | |
| 85107 silly addNameRange { name: 'globals', range: '*', hasData: false } | |
| 85108 silly addNameRange { name: 'is-integer', range: '*', hasData: false } | |
| 85109 silly addNameRange { name: 'leven', range: '*', hasData: false } | |
| 85110 silly addNameRange { name: 'lodash', range: '*', hasData: false } | |
| 85111 silly addNameRange { name: 'minimatch', range: '*', hasData: false } | |
| 85112 silly addNameRange { name: 'output-file-sync', range: '*', hasData: false } | |
| 85113 silly addNameRange { name: 'path-is-absolute', range: '*', hasData: false } | |
| 85114 silly addNameRange { name: 'private', range: '*', hasData: false } | |
| 85115 silly addNameRange { name: 'regenerator', range: '*', hasData: false } | |
| 85116 silly addNameRange { name: 'regexpu', range: '*', hasData: false } | |
| 85117 silly addNameRange { name: 'repeating', range: '*', hasData: false } | |
| 85118 silly addNameRange { name: 'shebang-regex', range: '*', hasData: false } | |
| 85119 silly addNameRange { name: 'slash', range: '*', hasData: false } | |
| 85120 silly addNameRange { name: 'source-map', range: '*', hasData: false } | |
| 85121 silly addNameRange { name: 'source-map-support', range: '*', hasData: false } | |
| 85122 silly addNameRange { name: 'strip-json-comments', range: '*', hasData: false } | |
| 85123 silly addNameRange { name: 'to-fast-properties', range: '*', hasData: false } | |
| 85124 silly addNameRange { name: 'trim-right', range: '*', hasData: false } | |
| 85125 silly addNameRange { name: 'user-home', range: '*', hasData: false } | |
| 85126 verbose url raw convert-source-map | |
| 85127 verbose url resolving [ 'https://registry.npmjs.org/', './convert-source-map' ] | |
| 85128 verbose url resolved https://registry.npmjs.org/convert-source-map | |
| 85129 info trying registry request attempt 1 at 14:11:36 | |
| 85130 verbose etag "E6HG68O20DI72JQ4ZNE0JYSND" | |
| 85131 http GET https://registry.npmjs.org/convert-source-map | |
| 85132 verbose url raw debug | |
| 85133 verbose url resolving [ 'https://registry.npmjs.org/', './debug' ] | |
| 85134 verbose url resolved https://registry.npmjs.org/debug | |
| 85135 info trying registry request attempt 1 at 14:11:36 | |
| 85136 verbose etag "ALFJOECWHISLZ4DH7SXTAXEIG" | |
| 85137 http GET https://registry.npmjs.org/debug | |
| 85138 verbose url raw chalk | |
| 85139 verbose url resolving [ 'https://registry.npmjs.org/', './chalk' ] | |
| 85140 verbose url resolved https://registry.npmjs.org/chalk | |
| 85141 info trying registry request attempt 1 at 14:11:36 | |
| 85142 verbose etag "ESFACXBKHRMYG53XP0PKJEAGJ" | |
| 85143 http GET https://registry.npmjs.org/chalk | |
| 85144 verbose url raw detect-indent | |
| 85145 verbose url resolving [ 'https://registry.npmjs.org/', './detect-indent' ] | |
| 85146 verbose url resolved https://registry.npmjs.org/detect-indent | |
| 85147 info trying registry request attempt 1 at 14:11:36 | |
| 85148 verbose etag "65AHAWKOAS49G3W23GDKU0K1N" | |
| 85149 http GET https://registry.npmjs.org/detect-indent | |
| 85150 verbose url raw core-js | |
| 85151 verbose url resolving [ 'https://registry.npmjs.org/', './core-js' ] | |
| 85152 verbose url resolved https://registry.npmjs.org/core-js | |
| 85153 info trying registry request attempt 1 at 14:11:36 | |
| 85154 verbose etag "17IF7KCZSURFLAUPA965GGB6K" | |
| 85155 http GET https://registry.npmjs.org/core-js | |
| 85156 verbose url raw estraverse | |
| 85157 verbose url resolving [ 'https://registry.npmjs.org/', './estraverse' ] | |
| 85158 verbose url resolved https://registry.npmjs.org/estraverse | |
| 85159 info trying registry request attempt 1 at 14:11:36 | |
| 85160 verbose etag "4U2608228MZ08O797OO21DF5G" | |
| 85161 http GET https://registry.npmjs.org/estraverse | |
| 85162 verbose url raw esutils | |
| 85163 verbose url resolving [ 'https://registry.npmjs.org/', './esutils' ] | |
| 85164 verbose url resolved https://registry.npmjs.org/esutils | |
| 85165 info trying registry request attempt 1 at 14:11:36 | |
| 85166 verbose etag "7VMH27EN8T99V4NDNMXTFFUJD" | |
| 85167 http GET https://registry.npmjs.org/esutils | |
| 85168 verbose url raw globals | |
| 85169 verbose url resolving [ 'https://registry.npmjs.org/', './globals' ] | |
| 85170 verbose url resolved https://registry.npmjs.org/globals | |
| 85171 info trying registry request attempt 1 at 14:11:36 | |
| 85172 verbose etag "30TY2FMQ7ARPQ8QB8VRM4SKXV" | |
| 85173 http GET https://registry.npmjs.org/globals | |
| 85174 verbose url raw fs-readdir-recursive | |
| 85175 verbose url resolving [ 'https://registry.npmjs.org/', './fs-readdir-recursive' ] | |
| 85176 verbose url resolved https://registry.npmjs.org/fs-readdir-recursive | |
| 85177 info trying registry request attempt 1 at 14:11:36 | |
| 85178 verbose etag "40KGL4KVVXOSTP3O5PO1V23BE" | |
| 85179 http GET https://registry.npmjs.org/fs-readdir-recursive | |
| 85180 verbose url raw is-integer | |
| 85181 verbose url resolving [ 'https://registry.npmjs.org/', './is-integer' ] | |
| 85182 verbose url resolved https://registry.npmjs.org/is-integer | |
| 85183 info trying registry request attempt 1 at 14:11:36 | |
| 85184 verbose etag "AHKPFYMKZL2CW53HLJJWK37TN" | |
| 85185 http GET https://registry.npmjs.org/is-integer | |
| 85186 verbose url raw leven | |
| 85187 verbose url resolving [ 'https://registry.npmjs.org/', './leven' ] | |
| 85188 verbose url resolved https://registry.npmjs.org/leven | |
| 85189 info trying registry request attempt 1 at 14:11:36 | |
| 85190 verbose etag "8P64AED8Y4NXZOFA4JZ5HR8RD" | |
| 85191 http GET https://registry.npmjs.org/leven | |
| 85192 verbose url raw js-tokens/1.0.0 | |
| 85193 verbose url resolving [ 'https://registry.npmjs.org/', './js-tokens/1.0.0' ] | |
| 85194 verbose url resolved https://registry.npmjs.org/js-tokens/1.0.0 | |
| 85195 info trying registry request attempt 1 at 14:11:36 | |
| 85196 verbose etag "8CQIZ6ZUQHCHI7M32BV36YRD" | |
| 85197 http GET https://registry.npmjs.org/js-tokens/1.0.0 | |
| 85198 verbose url raw line-numbers/0.2.0 | |
| 85199 verbose url resolving [ 'https://registry.npmjs.org/', './line-numbers/0.2.0' ] | |
| 85200 verbose url resolved https://registry.npmjs.org/line-numbers/0.2.0 | |
| 85201 info trying registry request attempt 1 at 14:11:36 | |
| 85202 verbose etag "1MSV70PLCAKEEJRBQYEL2473M" | |
| 85203 http GET https://registry.npmjs.org/line-numbers/0.2.0 | |
| 85204 verbose url raw lodash | |
| 85205 verbose url resolving [ 'https://registry.npmjs.org/', './lodash' ] | |
| 85206 verbose url resolved https://registry.npmjs.org/lodash | |
| 85207 info trying registry request attempt 1 at 14:11:36 | |
| 85208 verbose etag "6BK5V4583BQPCHUJJTIMSBFAP" | |
| 85209 http GET https://registry.npmjs.org/lodash | |
| 85210 verbose url raw ast-types | |
| 85211 verbose url resolving [ 'https://registry.npmjs.org/', './ast-types' ] | |
| 85212 verbose url resolved https://registry.npmjs.org/ast-types | |
| 85213 info trying registry request attempt 1 at 14:11:36 | |
| 85214 verbose etag "897DBCVE7I2H5MFBAVQLNQ4TG" | |
| 85215 http GET https://registry.npmjs.org/ast-types | |
| 85216 verbose url raw output-file-sync | |
| 85217 verbose url resolving [ 'https://registry.npmjs.org/', './output-file-sync' ] | |
| 85218 verbose url resolved https://registry.npmjs.org/output-file-sync | |
| 85219 info trying registry request attempt 1 at 14:11:36 | |
| 85220 verbose etag "DHDR0X5T6BX4A4QOIPLW0ZY5T" | |
| 85221 http GET https://registry.npmjs.org/output-file-sync | |
| 85222 verbose url raw path-is-absolute | |
| 85223 verbose url resolving [ 'https://registry.npmjs.org/', './path-is-absolute' ] | |
| 85224 verbose url resolved https://registry.npmjs.org/path-is-absolute | |
| 85225 info trying registry request attempt 1 at 14:11:36 | |
| 85226 verbose etag "YJPG84UQ0LP8C3JMZV74XL03" | |
| 85227 http GET https://registry.npmjs.org/path-is-absolute | |
| 85228 verbose url raw minimatch | |
| 85229 verbose url resolving [ 'https://registry.npmjs.org/', './minimatch' ] | |
| 85230 verbose url resolved https://registry.npmjs.org/minimatch | |
| 85231 info trying registry request attempt 1 at 14:11:36 | |
| 85232 verbose etag "7E6LX8BUVQYO67FCINACMFASW" | |
| 85233 http GET https://registry.npmjs.org/minimatch | |
| 85234 verbose url raw private | |
| 85235 verbose url resolving [ 'https://registry.npmjs.org/', './private' ] | |
| 85236 verbose url resolved https://registry.npmjs.org/private | |
| 85237 info trying registry request attempt 1 at 14:11:36 | |
| 85238 verbose etag "CYCL3LS37GT66Q0X11ELDMVPR" | |
| 85239 http GET https://registry.npmjs.org/private | |
| 85240 verbose url raw regexpu | |
| 85241 verbose url resolving [ 'https://registry.npmjs.org/', './regexpu' ] | |
| 85242 verbose url resolved https://registry.npmjs.org/regexpu | |
| 85243 info trying registry request attempt 1 at 14:11:36 | |
| 85244 verbose etag "DSDFHVGBR31ROZJSLJJ2VU5SC" | |
| 85245 http GET https://registry.npmjs.org/regexpu | |
| 85246 verbose url raw regenerator | |
| 85247 verbose url resolving [ 'https://registry.npmjs.org/', './regenerator' ] | |
| 85248 verbose url resolved https://registry.npmjs.org/regenerator | |
| 85249 info trying registry request attempt 1 at 14:11:36 | |
| 85250 verbose etag "7EYM5BZH9XUPH62L8B94MKAUR" | |
| 85251 http GET https://registry.npmjs.org/regenerator | |
| 85252 verbose url raw repeating | |
| 85253 verbose url resolving [ 'https://registry.npmjs.org/', './repeating' ] | |
| 85254 verbose url resolved https://registry.npmjs.org/repeating | |
| 85255 info trying registry request attempt 1 at 14:11:36 | |
| 85256 verbose etag "6XZ95R0691DR4O28A6SZBSH9A" | |
| 85257 http GET https://registry.npmjs.org/repeating | |
| 85258 verbose url raw shebang-regex | |
| 85259 verbose url resolving [ 'https://registry.npmjs.org/', './shebang-regex' ] | |
| 85260 verbose url resolved https://registry.npmjs.org/shebang-regex | |
| 85261 info trying registry request attempt 1 at 14:11:36 | |
| 85262 verbose etag "CS363YQ9Y3G537WLFL71OHWW1" | |
| 85263 http GET https://registry.npmjs.org/shebang-regex | |
| 85264 verbose url raw slash | |
| 85265 verbose url resolving [ 'https://registry.npmjs.org/', './slash' ] | |
| 85266 verbose url resolved https://registry.npmjs.org/slash | |
| 85267 info trying registry request attempt 1 at 14:11:36 | |
| 85268 verbose etag "EW6IQDLAMOH6DMVJEB79Z0MKO" | |
| 85269 http GET https://registry.npmjs.org/slash | |
| 85270 verbose url raw source-map | |
| 85271 verbose url resolving [ 'https://registry.npmjs.org/', './source-map' ] | |
| 85272 verbose url resolved https://registry.npmjs.org/source-map | |
| 85273 info trying registry request attempt 1 at 14:11:36 | |
| 85274 verbose etag "6X6700A4ARF6BEP1WI9Y86P6" | |
| 85275 http GET https://registry.npmjs.org/source-map | |
| 85276 verbose url raw source-map-support | |
| 85277 verbose url resolving [ 'https://registry.npmjs.org/', './source-map-support' ] | |
| 85278 verbose url resolved https://registry.npmjs.org/source-map-support | |
| 85279 info trying registry request attempt 1 at 14:11:36 | |
| 85280 verbose etag "9YLBO9N0L0XSMPKS9UWMCS7HG" | |
| 85281 http GET https://registry.npmjs.org/source-map-support | |
| 85282 verbose url raw strip-json-comments | |
| 85283 verbose url resolving [ 'https://registry.npmjs.org/', './strip-json-comments' ] | |
| 85284 verbose url resolved https://registry.npmjs.org/strip-json-comments | |
| 85285 info trying registry request attempt 1 at 14:11:36 | |
| 85286 verbose etag "18AM02OC56FGV63KROIALAXYJ" | |
| 85287 http GET https://registry.npmjs.org/strip-json-comments | |
| 85288 verbose url raw to-fast-properties | |
| 85289 verbose url resolving [ 'https://registry.npmjs.org/', './to-fast-properties' ] | |
| 85290 verbose url resolved https://registry.npmjs.org/to-fast-properties | |
| 85291 info trying registry request attempt 1 at 14:11:36 | |
| 85292 verbose etag "6J8XPNZL52VKJVT5TNPRQ7CRU" | |
| 85293 http GET https://registry.npmjs.org/to-fast-properties | |
| 85294 verbose url raw trim-right | |
| 85295 verbose url resolving [ 'https://registry.npmjs.org/', './trim-right' ] | |
| 85296 verbose url resolved https://registry.npmjs.org/trim-right | |
| 85297 info trying registry request attempt 1 at 14:11:36 | |
| 85298 verbose etag "75I3VPLCM2BLD9BM5J6OIB7VV" | |
| 85299 http GET https://registry.npmjs.org/trim-right | |
| 85300 verbose url raw user-home | |
| 85301 verbose url resolving [ 'https://registry.npmjs.org/', './user-home' ] | |
| 85302 verbose url resolved https://registry.npmjs.org/user-home | |
| 85303 info trying registry request attempt 1 at 14:11:36 | |
| 85304 verbose etag "A2O9GA2AL0HW3K925MP10O2OB" | |
| 85305 http GET https://registry.npmjs.org/user-home | |
| 85306 silly lockFile acecb2ad--babel-core-node-modules-core-js tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\core-js | |
| 85307 silly lockFile acecb2ad--babel-core-node-modules-core-js tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\core-js | |
| 85308 silly lockFile f6d97a4e--cache-core-js-0-8-4-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\core-js\0.8.4\package.tgz | |
| 85309 silly lockFile f6d97a4e--cache-core-js-0-8-4-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\core-js\0.8.4\package.tgz | |
| 85310 silly gunzTarPerm extractEntry test/browser/big-vs-number.html | |
| 85311 silly gunzTarPerm modified mode [ 'test/browser/big-vs-number.html', 438, 420 ] | |
| 85312 silly gunzTarPerm extractEntry test/browser/every-test.html | |
| 85313 silly gunzTarPerm modified mode [ 'test/browser/every-test.html', 438, 420 ] | |
| 85314 info preinstall core-js@0.8.4 | |
| 85315 verbose readDependencies using package.json deps | |
| 85316 verbose readDependencies using package.json deps | |
| 85317 silly resolved [] | |
| 85318 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\core-js | |
| 85319 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core\node_modules\core-js | |
| 85320 verbose linkStuff [ true, | |
| 85320 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 85320 verbose linkStuff false, | |
| 85320 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules\\babel-core\\node_modules' ] | |
| 85321 info linkStuff core-js@0.8.4 | |
| 85322 verbose linkBins core-js@0.8.4 | |
| 85323 verbose linkMans core-js@0.8.4 | |
| 85324 verbose rebuildBundles core-js@0.8.4 | |
| 85325 info install core-js@0.8.4 | |
| 85326 info postinstall core-js@0.8.4 | |
| 85327 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core | |
| 85328 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel\node_modules\babel-core | |
| 85329 verbose linkStuff [ true, | |
| 85329 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 85329 verbose linkStuff false, | |
| 85329 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel\\node_modules' ] | |
| 85330 info linkStuff babel-core@5.1.11 | |
| 85331 verbose linkBins babel-core@5.1.11 | |
| 85332 verbose linkMans babel-core@5.1.11 | |
| 85333 verbose rebuildBundles babel-core@5.1.11 | |
| 85334 verbose rebuildBundles [ '.bin', | |
| 85334 verbose rebuildBundles 'ast-types', | |
| 85334 verbose rebuildBundles 'chalk', | |
| 85334 verbose rebuildBundles 'core-js', | |
| 85334 verbose rebuildBundles 'debug', | |
| 85334 verbose rebuildBundles 'detect-indent', | |
| 85334 verbose rebuildBundles 'estraverse', | |
| 85334 verbose rebuildBundles 'esutils', | |
| 85334 verbose rebuildBundles 'globals', | |
| 85334 verbose rebuildBundles 'is-integer', | |
| 85334 verbose rebuildBundles 'js-tokens', | |
| 85334 verbose rebuildBundles 'leven', | |
| 85334 verbose rebuildBundles 'line-numbers', | |
| 85334 verbose rebuildBundles 'minimatch', | |
| 85334 verbose rebuildBundles 'private', | |
| 85334 verbose rebuildBundles 'regenerator', | |
| 85334 verbose rebuildBundles 'regexpu', | |
| 85334 verbose rebuildBundles 'repeating', | |
| 85334 verbose rebuildBundles 'shebang-regex', | |
| 85334 verbose rebuildBundles 'slash', | |
| 85334 verbose rebuildBundles 'source-map-support', | |
| 85334 verbose rebuildBundles 'strip-json-comments', | |
| 85334 verbose rebuildBundles 'to-fast-properties', | |
| 85334 verbose rebuildBundles 'trim-right', | |
| 85334 verbose rebuildBundles 'user-home' ] | |
| 85335 info install babel-core@5.1.11 | |
| 85336 http 304 https://registry.npmjs.org/convert-source-map | |
| 85337 silly registry.get cb [ 304, | |
| 85337 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85337 silly registry.get etag: '"E6HG68O20DI72JQ4ZNE0JYSND"', | |
| 85337 silly registry.get 'cache-control': 'max-age=60', | |
| 85337 silly registry.get 'accept-ranges': 'bytes', | |
| 85337 silly registry.get date: 'Mon, 20 Apr 2015 19:12:02 GMT', | |
| 85337 silly registry.get via: '1.1 varnish', | |
| 85337 silly registry.get connection: 'keep-alive', | |
| 85337 silly registry.get 'x-served-by': 'cache-ord1721-ORD', | |
| 85337 silly registry.get 'x-cache': 'MISS', | |
| 85337 silly registry.get 'x-cache-hits': '0', | |
| 85337 silly registry.get 'x-timer': 'S1429557122.909177,VS0,VE39' } ] | |
| 85338 verbose etag convert-source-map from cache | |
| 85339 http 304 https://registry.npmjs.org/detect-indent | |
| 85340 silly registry.get cb [ 304, | |
| 85340 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85340 silly registry.get etag: '"65AHAWKOAS49G3W23GDKU0K1N"', | |
| 85340 silly registry.get 'cache-control': 'max-age=60', | |
| 85340 silly registry.get 'accept-ranges': 'bytes', | |
| 85340 silly registry.get date: 'Mon, 20 Apr 2015 19:12:02 GMT', | |
| 85340 silly registry.get via: '1.1 varnish', | |
| 85340 silly registry.get connection: 'keep-alive', | |
| 85340 silly registry.get 'x-served-by': 'cache-ord1727-ORD', | |
| 85340 silly registry.get 'x-cache': 'MISS', | |
| 85340 silly registry.get 'x-cache-hits': '0', | |
| 85340 silly registry.get 'x-timer': 'S1429557122.928097,VS0,VE39' } ] | |
| 85341 verbose etag detect-indent from cache | |
| 85342 info postinstall babel-core@5.1.11 | |
| 85343 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel | |
| 85344 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel | |
| 85345 verbose linkStuff [ true, | |
| 85345 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 85345 verbose linkStuff false, | |
| 85345 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules' ] | |
| 85346 info linkStuff babel@5.1.11 | |
| 85347 verbose linkBins babel@5.1.11 | |
| 85348 verbose link bins [ { babel: './bin/babel/index.js', | |
| 85348 verbose link bins 'babel-node': './bin/babel-node', | |
| 85348 verbose link bins 'babel-external-helpers': './bin/babel-external-helpers' }, | |
| 85348 verbose link bins 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\.bin', | |
| 85348 verbose link bins false ] | |
| 85349 verbose linkMans babel@5.1.11 | |
| 85350 verbose rebuildBundles babel@5.1.11 | |
| 85351 verbose rebuildBundles [ 'babel-core', | |
| 85351 verbose rebuildBundles 'chokidar', | |
| 85351 verbose rebuildBundles 'convert-source-map', | |
| 85351 verbose rebuildBundles 'fs-readdir-recursive', | |
| 85351 verbose rebuildBundles 'lodash', | |
| 85351 verbose rebuildBundles 'output-file-sync', | |
| 85351 verbose rebuildBundles 'path-is-absolute', | |
| 85351 verbose rebuildBundles 'source-map' ] | |
| 85352 http 304 https://registry.npmjs.org/chalk | |
| 85353 silly registry.get cb [ 304, | |
| 85353 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85353 silly registry.get etag: '"ESFACXBKHRMYG53XP0PKJEAGJ"', | |
| 85353 silly registry.get 'cache-control': 'max-age=60', | |
| 85353 silly registry.get 'accept-ranges': 'bytes', | |
| 85353 silly registry.get date: 'Mon, 20 Apr 2015 19:12:02 GMT', | |
| 85353 silly registry.get via: '1.1 varnish', | |
| 85353 silly registry.get connection: 'keep-alive', | |
| 85353 silly registry.get 'x-served-by': 'cache-ord1735-ORD', | |
| 85353 silly registry.get 'x-cache': 'MISS', | |
| 85353 silly registry.get 'x-cache-hits': '0', | |
| 85353 silly registry.get 'x-timer': 'S1429557122.923359,VS0,VE65' } ] | |
| 85354 verbose etag chalk from cache | |
| 85355 silly gunzTarPerm extractEntry test/browser/single-test.html | |
| 85356 silly gunzTarPerm modified mode [ 'test/browser/single-test.html', 438, 420 ] | |
| 85357 silly addNameRange number 2 { name: 'detect-indent', range: '*', hasData: true } | |
| 85358 silly addNameRange versions [ 'detect-indent', | |
| 85358 silly addNameRange [ '0.1.0', | |
| 85358 silly addNameRange '0.1.1', | |
| 85358 silly addNameRange '0.1.2', | |
| 85358 silly addNameRange '0.1.3', | |
| 85358 silly addNameRange '0.1.4', | |
| 85358 silly addNameRange '0.2.0', | |
| 85358 silly addNameRange '1.0.0', | |
| 85358 silly addNameRange '1.0.1', | |
| 85358 silly addNameRange '2.0.0', | |
| 85358 silly addNameRange '3.0.0', | |
| 85358 silly addNameRange '3.0.1' ] ] | |
| 85359 verbose addNamed [ 'detect-indent', '3.0.1' ] | |
| 85360 verbose addNamed [ '3.0.1', '3.0.1' ] | |
| 85361 silly lockFile 4db7d457-detect-indent-3-0-1 detect-indent@3.0.1 | |
| 85362 verbose lock detect-indent@3.0.1 C:\Users\Vince\AppData\Roaming\npm-cache\4db7d457-detect-indent-3-0-1.lock | |
| 85363 silly addNameRange number 2 { name: 'convert-source-map', range: '*', hasData: true } | |
| 85364 silly addNameRange versions [ 'convert-source-map', | |
| 85364 silly addNameRange [ '0.1.0', | |
| 85364 silly addNameRange '0.2.0', | |
| 85364 silly addNameRange '0.2.1', | |
| 85364 silly addNameRange '0.2.2', | |
| 85364 silly addNameRange '0.2.3', | |
| 85364 silly addNameRange '0.2.4', | |
| 85364 silly addNameRange '0.2.5', | |
| 85364 silly addNameRange '0.2.6', | |
| 85364 silly addNameRange '0.3.0', | |
| 85364 silly addNameRange '0.3.1', | |
| 85364 silly addNameRange '0.3.2', | |
| 85364 silly addNameRange '0.3.3', | |
| 85364 silly addNameRange '0.3.4', | |
| 85364 silly addNameRange '0.3.5', | |
| 85364 silly addNameRange '0.4.0', | |
| 85364 silly addNameRange '0.4.1', | |
| 85364 silly addNameRange '0.5.0', | |
| 85364 silly addNameRange '0.5.1', | |
| 85364 silly addNameRange '0.6.0', | |
| 85364 silly addNameRange '0.7.0', | |
| 85364 silly addNameRange '0.7.1', | |
| 85364 silly addNameRange '1.0.0' ] ] | |
| 85365 verbose addNamed [ 'convert-source-map', '1.0.0' ] | |
| 85366 verbose addNamed [ '1.0.0', '1.0.0' ] | |
| 85367 silly lockFile 4760a6f5-convert-source-map-1-0-0 convert-source-map@1.0.0 | |
| 85368 verbose lock convert-source-map@1.0.0 C:\Users\Vince\AppData\Roaming\npm-cache\4760a6f5-convert-source-map-1-0-0.lock | |
| 85369 silly lockFile 4760a6f5-convert-source-map-1-0-0 convert-source-map@1.0.0 | |
| 85370 silly lockFile 4760a6f5-convert-source-map-1-0-0 convert-source-map@1.0.0 | |
| 85371 silly lockFile cd0e6bea-t-indent-detect-indent-3-0-1-tgz https://registry.npmjs.org/detect-indent/-/detect-indent-3.0.1.tgz | |
| 85372 verbose lock https://registry.npmjs.org/detect-indent/-/detect-indent-3.0.1.tgz C:\Users\Vince\AppData\Roaming\npm-cache\cd0e6bea-t-indent-detect-indent-3-0-1-tgz.lock | |
| 85373 silly lockFile 6a737811-convert-source-map-1-0-0 convert-source-map@^1.0.0 | |
| 85374 silly lockFile 6a737811-convert-source-map-1-0-0 convert-source-map@^1.0.0 | |
| 85375 verbose addRemoteTarball [ 'https://registry.npmjs.org/detect-indent/-/detect-indent-3.0.1.tgz', | |
| 85375 verbose addRemoteTarball '9dc5e5ddbceef8325764b9451b02bc6d54084f75' ] | |
| 85376 info retry fetch attempt 1 at 14:11:36 | |
| 85377 verbose fetch to= C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557096673-0.6629795944318175\tmp.tgz | |
| 85378 http GET https://registry.npmjs.org/detect-indent/-/detect-indent-3.0.1.tgz | |
| 85379 silly addNameRange number 2 { name: 'chalk', range: '*', hasData: true } | |
| 85380 silly addNameRange versions [ 'chalk', | |
| 85380 silly addNameRange [ '0.1.0', | |
| 85380 silly addNameRange '0.1.1', | |
| 85380 silly addNameRange '0.2.0', | |
| 85380 silly addNameRange '0.2.1', | |
| 85380 silly addNameRange '0.3.0', | |
| 85380 silly addNameRange '0.4.0', | |
| 85380 silly addNameRange '0.5.0', | |
| 85380 silly addNameRange '0.5.1', | |
| 85380 silly addNameRange '1.0.0' ] ] | |
| 85381 verbose addNamed [ 'chalk', '1.0.0' ] | |
| 85382 verbose addNamed [ '1.0.0', '1.0.0' ] | |
| 85383 silly lockFile 3c08535b-chalk-1-0-0 chalk@1.0.0 | |
| 85384 verbose lock chalk@1.0.0 C:\Users\Vince\AppData\Roaming\npm-cache\3c08535b-chalk-1-0-0.lock | |
| 85385 silly lockFile 3c08535b-chalk-1-0-0 chalk@1.0.0 | |
| 85386 silly lockFile 3c08535b-chalk-1-0-0 chalk@1.0.0 | |
| 85387 info install babel@5.1.11 | |
| 85388 silly lockFile 2b6848f7-chalk-1-0-0 chalk@^1.0.0 | |
| 85389 silly lockFile 2b6848f7-chalk-1-0-0 chalk@^1.0.0 | |
| 85390 info postinstall babel@5.1.11 | |
| 85391 http 304 https://registry.npmjs.org/esutils | |
| 85392 silly registry.get cb [ 304, | |
| 85392 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85392 silly registry.get etag: '"7VMH27EN8T99V4NDNMXTFFUJD"', | |
| 85392 silly registry.get 'cache-control': 'max-age=60', | |
| 85392 silly registry.get 'accept-ranges': 'bytes', | |
| 85392 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85392 silly registry.get via: '1.1 varnish', | |
| 85392 silly registry.get connection: 'keep-alive', | |
| 85392 silly registry.get 'x-served-by': 'cache-ord1727-ORD', | |
| 85392 silly registry.get 'x-cache': 'MISS', | |
| 85392 silly registry.get 'x-cache-hits': '0', | |
| 85392 silly registry.get 'x-timer': 'S1429557123.027579,VS0,VE40' } ] | |
| 85393 verbose etag esutils from cache | |
| 85394 silly addNameRange number 2 { name: 'esutils', range: '*', hasData: true } | |
| 85395 silly addNameRange versions [ 'esutils', | |
| 85395 silly addNameRange [ '1.0.0', | |
| 85395 silly addNameRange '1.1.0', | |
| 85395 silly addNameRange '1.1.1', | |
| 85395 silly addNameRange '1.1.2', | |
| 85395 silly addNameRange '1.1.3', | |
| 85395 silly addNameRange '1.1.4', | |
| 85395 silly addNameRange '1.1.5-dev', | |
| 85395 silly addNameRange '1.1.5', | |
| 85395 silly addNameRange '1.1.6', | |
| 85395 silly addNameRange '2.0.0', | |
| 85395 silly addNameRange '2.0.1', | |
| 85395 silly addNameRange '2.0.2' ] ] | |
| 85396 verbose addNamed [ 'esutils', '2.0.2' ] | |
| 85397 verbose addNamed [ '2.0.2', '2.0.2' ] | |
| 85398 silly lockFile e948ece4-esutils-2-0-2 esutils@2.0.2 | |
| 85399 verbose lock esutils@2.0.2 C:\Users\Vince\AppData\Roaming\npm-cache\e948ece4-esutils-2-0-2.lock | |
| 85400 silly lockFile e948ece4-esutils-2-0-2 esutils@2.0.2 | |
| 85401 silly lockFile e948ece4-esutils-2-0-2 esutils@2.0.2 | |
| 85402 silly lockFile 0a46a63a-esutils-2-0-0 esutils@^2.0.0 | |
| 85403 silly lockFile 0a46a63a-esutils-2-0-0 esutils@^2.0.0 | |
| 85404 http 304 https://registry.npmjs.org/globals | |
| 85405 silly registry.get cb [ 304, | |
| 85405 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85405 silly registry.get etag: '"30TY2FMQ7ARPQ8QB8VRM4SKXV"', | |
| 85405 silly registry.get 'cache-control': 'max-age=60', | |
| 85405 silly registry.get 'accept-ranges': 'bytes', | |
| 85405 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85405 silly registry.get via: '1.1 varnish', | |
| 85405 silly registry.get connection: 'keep-alive', | |
| 85405 silly registry.get 'x-served-by': 'cache-ord1735-ORD', | |
| 85405 silly registry.get 'x-cache': 'MISS', | |
| 85405 silly registry.get 'x-cache-hits': '0', | |
| 85405 silly registry.get 'x-timer': 'S1429557123.041754,VS0,VE65' } ] | |
| 85406 verbose etag globals from cache | |
| 85407 silly addNameRange number 2 { name: 'globals', range: '*', hasData: true } | |
| 85408 silly addNameRange versions [ 'globals', | |
| 85408 silly addNameRange [ '0.1.0', | |
| 85408 silly addNameRange '0.1.1', | |
| 85408 silly addNameRange '1.0.0', | |
| 85408 silly addNameRange '2.0.0', | |
| 85408 silly addNameRange '3.0.0', | |
| 85408 silly addNameRange '4.0.0', | |
| 85408 silly addNameRange '5.0.0', | |
| 85408 silly addNameRange '5.1.0', | |
| 85408 silly addNameRange '6.0.0', | |
| 85408 silly addNameRange '6.1.0', | |
| 85408 silly addNameRange '6.2.0', | |
| 85408 silly addNameRange '6.3.0', | |
| 85408 silly addNameRange '6.4.0', | |
| 85408 silly addNameRange '6.4.1' ] ] | |
| 85409 verbose addNamed [ 'globals', '6.4.1' ] | |
| 85410 verbose addNamed [ '6.4.1', '6.4.1' ] | |
| 85411 silly lockFile 6584f740-globals-6-4-1 globals@6.4.1 | |
| 85412 verbose lock globals@6.4.1 C:\Users\Vince\AppData\Roaming\npm-cache\6584f740-globals-6-4-1.lock | |
| 85413 silly lockFile 6584f740-globals-6-4-1 globals@6.4.1 | |
| 85414 silly lockFile 6584f740-globals-6-4-1 globals@6.4.1 | |
| 85415 silly lockFile 13e5252f-globals-6-4-0 globals@^6.4.0 | |
| 85416 silly lockFile 13e5252f-globals-6-4-0 globals@^6.4.0 | |
| 85417 http 304 https://registry.npmjs.org/debug | |
| 85418 silly registry.get cb [ 304, | |
| 85418 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85418 silly registry.get etag: '"ALFJOECWHISLZ4DH7SXTAXEIG"', | |
| 85418 silly registry.get 'cache-control': 'max-age=60', | |
| 85418 silly registry.get 'accept-ranges': 'bytes', | |
| 85418 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85418 silly registry.get via: '1.1 varnish', | |
| 85418 silly registry.get connection: 'keep-alive', | |
| 85418 silly registry.get 'x-served-by': 'cache-ord1732-ORD', | |
| 85418 silly registry.get 'x-cache': 'MISS', | |
| 85418 silly registry.get 'x-cache-hits': '0', | |
| 85418 silly registry.get 'x-timer': 'S1429557122.914963,VS0,VE269' } ] | |
| 85419 verbose etag debug from cache | |
| 85420 silly addNameRange number 2 { name: 'debug', range: '*', hasData: true } | |
| 85421 silly addNameRange versions [ 'debug', | |
| 85421 silly addNameRange [ '0.0.1', | |
| 85421 silly addNameRange '0.1.0', | |
| 85421 silly addNameRange '0.2.0', | |
| 85421 silly addNameRange '0.3.0', | |
| 85421 silly addNameRange '0.4.0', | |
| 85421 silly addNameRange '0.4.1', | |
| 85421 silly addNameRange '0.5.0', | |
| 85421 silly addNameRange '0.6.0', | |
| 85421 silly addNameRange '0.7.0', | |
| 85421 silly addNameRange '0.7.1', | |
| 85421 silly addNameRange '0.7.2', | |
| 85421 silly addNameRange '0.7.3', | |
| 85421 silly addNameRange '0.7.4', | |
| 85421 silly addNameRange '0.8.0', | |
| 85421 silly addNameRange '0.8.1', | |
| 85421 silly addNameRange '1.0.0', | |
| 85421 silly addNameRange '1.0.1', | |
| 85421 silly addNameRange '1.0.2', | |
| 85421 silly addNameRange '1.0.3', | |
| 85421 silly addNameRange '1.0.4', | |
| 85421 silly addNameRange '2.0.0', | |
| 85421 silly addNameRange '2.1.0', | |
| 85421 silly addNameRange '2.1.1', | |
| 85421 silly addNameRange '2.1.2', | |
| 85421 silly addNameRange '2.1.3' ] ] | |
| 85422 verbose addNamed [ 'debug', '2.1.3' ] | |
| 85423 verbose addNamed [ '2.1.3', '2.1.3' ] | |
| 85424 silly lockFile aef7a5b5-debug-2-1-3 debug@2.1.3 | |
| 85425 verbose lock debug@2.1.3 C:\Users\Vince\AppData\Roaming\npm-cache\aef7a5b5-debug-2-1-3.lock | |
| 85426 silly lockFile aef7a5b5-debug-2-1-3 debug@2.1.3 | |
| 85427 silly lockFile aef7a5b5-debug-2-1-3 debug@2.1.3 | |
| 85428 silly lockFile 0dc79bd7-debug-2-1-1 debug@^2.1.1 | |
| 85429 silly lockFile 0dc79bd7-debug-2-1-1 debug@^2.1.1 | |
| 85430 http 304 https://registry.npmjs.org/is-integer | |
| 85431 silly registry.get cb [ 304, | |
| 85431 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85431 silly registry.get etag: '"AHKPFYMKZL2CW53HLJJWK37TN"', | |
| 85431 silly registry.get 'cache-control': 'max-age=60', | |
| 85431 silly registry.get 'accept-ranges': 'bytes', | |
| 85431 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85431 silly registry.get via: '1.1 varnish', | |
| 85431 silly registry.get connection: 'keep-alive', | |
| 85431 silly registry.get 'x-served-by': 'cache-ord1735-ORD', | |
| 85431 silly registry.get 'x-cache': 'MISS', | |
| 85431 silly registry.get 'x-cache-hits': '0', | |
| 85431 silly registry.get 'x-timer': 'S1429557123.157270,VS0,VE64' } ] | |
| 85432 verbose etag is-integer from cache | |
| 85433 http 304 https://registry.npmjs.org/core-js | |
| 85434 silly registry.get cb [ 304, | |
| 85434 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85434 silly registry.get etag: '"17IF7KCZSURFLAUPA965GGB6K"', | |
| 85434 silly registry.get 'cache-control': 'max-age=60', | |
| 85434 silly registry.get 'accept-ranges': 'bytes', | |
| 85434 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85434 silly registry.get via: '1.1 varnish', | |
| 85434 silly registry.get connection: 'keep-alive', | |
| 85434 silly registry.get 'x-served-by': 'cache-ord1730-ORD', | |
| 85434 silly registry.get 'x-cache': 'MISS', | |
| 85434 silly registry.get 'x-cache-hits': '0', | |
| 85434 silly registry.get 'x-timer': 'S1429557122.956123,VS0,VE268' } ] | |
| 85435 verbose etag core-js from cache | |
| 85436 silly addNameRange number 2 { name: 'is-integer', range: '*', hasData: true } | |
| 85437 silly addNameRange versions [ 'is-integer', | |
| 85437 silly addNameRange [ '1.0.0', '1.0.1', '1.0.2', '1.0.3', '1.0.4' ] ] | |
| 85438 verbose addNamed [ 'is-integer', '1.0.4' ] | |
| 85439 verbose addNamed [ '1.0.4', '1.0.4' ] | |
| 85440 silly lockFile fff68caa-is-integer-1-0-4 is-integer@1.0.4 | |
| 85441 verbose lock is-integer@1.0.4 C:\Users\Vince\AppData\Roaming\npm-cache\fff68caa-is-integer-1-0-4.lock | |
| 85442 silly lockFile fff68caa-is-integer-1-0-4 is-integer@1.0.4 | |
| 85443 silly lockFile fff68caa-is-integer-1-0-4 is-integer@1.0.4 | |
| 85444 silly addNameRange number 2 { name: 'core-js', range: '*', hasData: true } | |
| 85445 silly addNameRange versions [ 'core-js', | |
| 85445 silly addNameRange [ '0.0.3', | |
| 85445 silly addNameRange '0.0.4', | |
| 85445 silly addNameRange '0.0.5', | |
| 85445 silly addNameRange '0.0.7', | |
| 85445 silly addNameRange '0.0.8', | |
| 85445 silly addNameRange '0.0.9', | |
| 85445 silly addNameRange '0.1.1', | |
| 85445 silly addNameRange '0.1.2', | |
| 85445 silly addNameRange '0.1.3', | |
| 85445 silly addNameRange '0.1.4', | |
| 85445 silly addNameRange '0.1.5', | |
| 85445 silly addNameRange '0.2.0', | |
| 85445 silly addNameRange '0.2.1', | |
| 85445 silly addNameRange '0.2.2', | |
| 85445 silly addNameRange '0.2.3', | |
| 85445 silly addNameRange '0.2.4', | |
| 85445 silly addNameRange '0.2.5', | |
| 85445 silly addNameRange '0.3.0', | |
| 85445 silly addNameRange '0.3.1', | |
| 85445 silly addNameRange '0.3.2', | |
| 85445 silly addNameRange '0.3.3', | |
| 85445 silly addNameRange '0.4.0', | |
| 85445 silly addNameRange '0.4.1', | |
| 85445 silly addNameRange '0.4.2', | |
| 85445 silly addNameRange '0.4.3', | |
| 85445 silly addNameRange '0.4.4', | |
| 85445 silly addNameRange '0.4.5', | |
| 85445 silly addNameRange '0.4.6', | |
| 85445 silly addNameRange '0.4.7', | |
| 85445 silly addNameRange '0.4.8', | |
| 85445 silly addNameRange '0.4.9', | |
| 85445 silly addNameRange '0.4.10', | |
| 85445 silly addNameRange '0.5.0', | |
| 85445 silly addNameRange '0.5.1', | |
| 85445 silly addNameRange '0.5.2', | |
| 85445 silly addNameRange '0.5.3', | |
| 85445 silly addNameRange '0.5.4', | |
| 85445 silly addNameRange '0.6.0', | |
| 85445 silly addNameRange '0.6.1', | |
| 85445 silly addNameRange '0.7.0', | |
| 85445 silly addNameRange '0.7.1', | |
| 85445 silly addNameRange '0.7.2', | |
| 85445 silly addNameRange '0.8.0', | |
| 85445 silly addNameRange '0.8.1', | |
| 85445 silly addNameRange '0.8.2', | |
| 85445 silly addNameRange '0.8.3', | |
| 85445 silly addNameRange '0.8.4' ] ] | |
| 85446 verbose addNamed [ 'core-js', '0.8.4' ] | |
| 85447 verbose addNamed [ '0.8.4', '0.8.4' ] | |
| 85448 silly lockFile 1eeb8e65-core-js-0-8-4 core-js@0.8.4 | |
| 85449 verbose lock core-js@0.8.4 C:\Users\Vince\AppData\Roaming\npm-cache\1eeb8e65-core-js-0-8-4.lock | |
| 85450 silly lockFile e7d6cb5f-is-integer-1-0-4 is-integer@^1.0.4 | |
| 85451 silly lockFile e7d6cb5f-is-integer-1-0-4 is-integer@^1.0.4 | |
| 85452 silly lockFile 1eeb8e65-core-js-0-8-4 core-js@0.8.4 | |
| 85453 silly lockFile 1eeb8e65-core-js-0-8-4 core-js@0.8.4 | |
| 85454 silly lockFile ede6f407-core-js-0-8-3 core-js@^0.8.3 | |
| 85455 silly lockFile ede6f407-core-js-0-8-3 core-js@^0.8.3 | |
| 85456 http 304 https://registry.npmjs.org/estraverse | |
| 85457 silly registry.get cb [ 304, | |
| 85457 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85457 silly registry.get etag: '"4U2608228MZ08O797OO21DF5G"', | |
| 85457 silly registry.get 'cache-control': 'max-age=60', | |
| 85457 silly registry.get 'accept-ranges': 'bytes', | |
| 85457 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85457 silly registry.get via: '1.1 varnish', | |
| 85457 silly registry.get connection: 'keep-alive', | |
| 85457 silly registry.get 'x-served-by': 'cache-ord1721-ORD', | |
| 85457 silly registry.get 'x-cache': 'MISS', | |
| 85457 silly registry.get 'x-cache-hits': '0', | |
| 85457 silly registry.get 'x-timer': 'S1429557123.022085,VS0,VE270' } ] | |
| 85458 verbose etag estraverse from cache | |
| 85459 http 200 https://registry.npmjs.org/detect-indent/-/detect-indent-3.0.1.tgz | |
| 85460 http 304 https://registry.npmjs.org/leven | |
| 85461 silly registry.get cb [ 304, | |
| 85461 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85461 silly registry.get etag: '"8P64AED8Y4NXZOFA4JZ5HR8RD"', | |
| 85461 silly registry.get 'cache-control': 'max-age=60', | |
| 85461 silly registry.get 'accept-ranges': 'bytes', | |
| 85461 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85461 silly registry.get via: '1.1 varnish', | |
| 85461 silly registry.get connection: 'keep-alive', | |
| 85461 silly registry.get 'x-served-by': 'cache-ord1732-ORD', | |
| 85461 silly registry.get 'x-cache': 'MISS', | |
| 85461 silly registry.get 'x-cache-hits': '0', | |
| 85461 silly registry.get 'x-timer': 'S1429557123.247987,VS0,VE64' } ] | |
| 85462 verbose etag leven from cache | |
| 85463 http 304 https://registry.npmjs.org/js-tokens/1.0.0 | |
| 85464 silly registry.get cb [ 304, | |
| 85464 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85464 silly registry.get etag: '"8CQIZ6ZUQHCHI7M32BV36YRD"', | |
| 85464 silly registry.get 'cache-control': 'max-age=60', | |
| 85464 silly registry.get 'accept-ranges': 'bytes', | |
| 85464 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85464 silly registry.get via: '1.1 varnish', | |
| 85464 silly registry.get connection: 'keep-alive', | |
| 85464 silly registry.get 'x-served-by': 'cache-ord1735-ORD', | |
| 85464 silly registry.get 'x-cache': 'MISS', | |
| 85464 silly registry.get 'x-cache-hits': '0', | |
| 85464 silly registry.get 'x-timer': 'S1429557123.273615,VS0,VE45' } ] | |
| 85465 verbose etag js-tokens/1.0.0 from cache | |
| 85466 verbose tar unpack C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557096673-0.6629795944318175\tmp.tgz | |
| 85467 silly lockFile 8de6fd28-96673-0-6629795944318175-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557096673-0.6629795944318175\package | |
| 85468 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557096673-0.6629795944318175\package C:\Users\Vince\AppData\Roaming\npm-cache\8de6fd28-96673-0-6629795944318175-package.lock | |
| 85469 silly lockFile ec4a85c9-96673-0-6629795944318175-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557096673-0.6629795944318175\tmp.tgz | |
| 85470 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557096673-0.6629795944318175\tmp.tgz C:\Users\Vince\AppData\Roaming\npm-cache\ec4a85c9-96673-0-6629795944318175-tmp-tgz.lock | |
| 85471 silly gunzTarPerm modes [ '755', '644' ] | |
| 85472 silly addNameRange number 2 { name: 'estraverse', range: '*', hasData: true } | |
| 85473 silly addNameRange versions [ 'estraverse', | |
| 85473 silly addNameRange [ '0.0.1', | |
| 85473 silly addNameRange '0.0.2', | |
| 85473 silly addNameRange '0.0.3', | |
| 85473 silly addNameRange '0.0.4', | |
| 85473 silly addNameRange '1.0.0', | |
| 85473 silly addNameRange '1.1.0', | |
| 85473 silly addNameRange '1.1.1', | |
| 85473 silly addNameRange '1.1.2-1', | |
| 85473 silly addNameRange '1.2.0', | |
| 85473 silly addNameRange '1.3.0', | |
| 85473 silly addNameRange '1.3.1', | |
| 85473 silly addNameRange '1.3.2', | |
| 85473 silly addNameRange '1.4.0', | |
| 85473 silly addNameRange '1.5.0', | |
| 85473 silly addNameRange '1.5.1', | |
| 85473 silly addNameRange '1.6.0', | |
| 85473 silly addNameRange '1.7.0', | |
| 85473 silly addNameRange '1.7.1', | |
| 85473 silly addNameRange '1.8.0', | |
| 85473 silly addNameRange '1.9.0', | |
| 85473 silly addNameRange '1.9.1', | |
| 85473 silly addNameRange '1.9.3', | |
| 85473 silly addNameRange '2.0.0', | |
| 85473 silly addNameRange '3.0.0', | |
| 85473 silly addNameRange '3.1.0' ] ] | |
| 85474 verbose addNamed [ 'estraverse', '3.1.0' ] | |
| 85475 verbose addNamed [ '3.1.0', '3.1.0' ] | |
| 85476 silly lockFile fc8187bc-estraverse-3-1-0 estraverse@3.1.0 | |
| 85477 verbose lock estraverse@3.1.0 C:\Users\Vince\AppData\Roaming\npm-cache\fc8187bc-estraverse-3-1-0.lock | |
| 85478 silly addNameRange number 2 { name: 'leven', range: '*', hasData: true } | |
| 85479 silly addNameRange versions [ 'leven', [ '1.0.0', '1.0.1' ] ] | |
| 85480 verbose addNamed [ 'leven', '1.0.1' ] | |
| 85481 verbose addNamed [ '1.0.1', '1.0.1' ] | |
| 85482 silly lockFile 4469d3e1-leven-1-0-1 leven@1.0.1 | |
| 85483 verbose lock leven@1.0.1 C:\Users\Vince\AppData\Roaming\npm-cache\4469d3e1-leven-1-0-1.lock | |
| 85484 silly lockFile e24484a9-rg-js-tokens-js-tokens-1-0-0-tgz https://registry.npmjs.org/js-tokens/-/js-tokens-1.0.0.tgz | |
| 85485 verbose lock https://registry.npmjs.org/js-tokens/-/js-tokens-1.0.0.tgz C:\Users\Vince\AppData\Roaming\npm-cache\e24484a9-rg-js-tokens-js-tokens-1-0-0-tgz.lock | |
| 85486 silly lockFile 4469d3e1-leven-1-0-1 leven@1.0.1 | |
| 85487 silly lockFile 4469d3e1-leven-1-0-1 leven@1.0.1 | |
| 85488 silly gunzTarPerm extractEntry package.json | |
| 85489 verbose addRemoteTarball [ 'https://registry.npmjs.org/js-tokens/-/js-tokens-1.0.0.tgz', | |
| 85489 verbose addRemoteTarball '278b2e6b68dfa4c8416af11370a55ea401bf4cde' ] | |
| 85490 silly lockFile cf495a71--estraverse-estraverse-3-1-0-tgz https://registry.npmjs.org/estraverse/-/estraverse-3.1.0.tgz | |
| 85491 verbose lock https://registry.npmjs.org/estraverse/-/estraverse-3.1.0.tgz C:\Users\Vince\AppData\Roaming\npm-cache\cf495a71--estraverse-estraverse-3-1-0-tgz.lock | |
| 85492 silly lockFile 871e565c-leven-1-0-1 leven@^1.0.1 | |
| 85493 silly lockFile 871e565c-leven-1-0-1 leven@^1.0.1 | |
| 85494 info retry fetch attempt 1 at 14:11:37 | |
| 85495 verbose fetch to= C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097009-0.08639553817920387\tmp.tgz | |
| 85496 verbose addRemoteTarball [ 'https://registry.npmjs.org/estraverse/-/estraverse-3.1.0.tgz', | |
| 85496 verbose addRemoteTarball '15e28a446b8b82bc700ccc8b96c78af4da0d6cba' ] | |
| 85497 http GET https://registry.npmjs.org/js-tokens/-/js-tokens-1.0.0.tgz | |
| 85498 info retry fetch attempt 1 at 14:11:37 | |
| 85499 verbose fetch to= C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097013-0.11878230073489249\tmp.tgz | |
| 85500 silly gunzTarPerm extractEntry index.js | |
| 85501 silly gunzTarPerm extractEntry cli.js | |
| 85502 http GET https://registry.npmjs.org/estraverse/-/estraverse-3.1.0.tgz | |
| 85503 silly gunzTarPerm extractEntry license | |
| 85504 silly gunzTarPerm extractEntry readme.md | |
| 85505 http 304 https://registry.npmjs.org/fs-readdir-recursive | |
| 85506 silly registry.get cb [ 304, | |
| 85506 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85506 silly registry.get etag: '"40KGL4KVVXOSTP3O5PO1V23BE"', | |
| 85506 silly registry.get 'cache-control': 'max-age=60', | |
| 85506 silly registry.get 'accept-ranges': 'bytes', | |
| 85506 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85506 silly registry.get via: '1.1 varnish', | |
| 85506 silly registry.get connection: 'keep-alive', | |
| 85506 silly registry.get 'x-served-by': 'cache-ord1727-ORD', | |
| 85506 silly registry.get 'x-cache': 'MISS', | |
| 85506 silly registry.get 'x-cache-hits': '0', | |
| 85506 silly registry.get 'x-timer': 'S1429557123.133039,VS0,VE267' } ] | |
| 85507 verbose etag fs-readdir-recursive from cache | |
| 85508 silly addNameRange number 2 { name: 'fs-readdir-recursive', range: '*', hasData: true } | |
| 85509 silly addNameRange versions [ 'fs-readdir-recursive', | |
| 85509 silly addNameRange [ '0.0.1', '0.0.2', '0.1.0', '0.1.1' ] ] | |
| 85510 verbose addNamed [ 'fs-readdir-recursive', '0.1.1' ] | |
| 85511 verbose addNamed [ '0.1.1', '0.1.1' ] | |
| 85512 silly lockFile 04337c4d-fs-readdir-recursive-0-1-1 fs-readdir-recursive@0.1.1 | |
| 85513 verbose lock fs-readdir-recursive@0.1.1 C:\Users\Vince\AppData\Roaming\npm-cache\04337c4d-fs-readdir-recursive-0-1-1.lock | |
| 85514 silly lockFile 04337c4d-fs-readdir-recursive-0-1-1 fs-readdir-recursive@0.1.1 | |
| 85515 silly lockFile 04337c4d-fs-readdir-recursive-0-1-1 fs-readdir-recursive@0.1.1 | |
| 85516 silly lockFile d0326061-fs-readdir-recursive-0-1-0 fs-readdir-recursive@^0.1.0 | |
| 85517 silly lockFile d0326061-fs-readdir-recursive-0-1-0 fs-readdir-recursive@^0.1.0 | |
| 85518 http 304 https://registry.npmjs.org/ast-types | |
| 85519 silly registry.get cb [ 304, | |
| 85519 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85519 silly registry.get etag: '"897DBCVE7I2H5MFBAVQLNQ4TG"', | |
| 85519 silly registry.get 'cache-control': 'max-age=60', | |
| 85519 silly registry.get 'accept-ranges': 'bytes', | |
| 85519 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85519 silly registry.get via: '1.1 varnish', | |
| 85519 silly registry.get connection: 'keep-alive', | |
| 85519 silly registry.get 'x-served-by': 'cache-ord1732-ORD', | |
| 85519 silly registry.get 'x-cache': 'MISS', | |
| 85519 silly registry.get 'x-cache-hits': '0', | |
| 85519 silly registry.get 'x-timer': 'S1429557123.366233,VS0,VE65' } ] | |
| 85520 verbose etag ast-types from cache | |
| 85521 http 304 https://registry.npmjs.org/line-numbers/0.2.0 | |
| 85522 silly registry.get cb [ 304, | |
| 85522 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85522 silly registry.get etag: '"1MSV70PLCAKEEJRBQYEL2473M"', | |
| 85522 silly registry.get 'cache-control': 'max-age=60', | |
| 85522 silly registry.get 'accept-ranges': 'bytes', | |
| 85522 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85522 silly registry.get via: '1.1 varnish', | |
| 85522 silly registry.get connection: 'keep-alive', | |
| 85522 silly registry.get 'x-served-by': 'cache-ord1730-ORD', | |
| 85522 silly registry.get 'x-cache': 'MISS', | |
| 85522 silly registry.get 'x-cache-hits': '0', | |
| 85522 silly registry.get 'x-timer': 'S1429557123.279698,VS0,VE161' } ] | |
| 85523 verbose etag line-numbers/0.2.0 from cache | |
| 85524 silly lockFile 8de6fd28-96673-0-6629795944318175-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557096673-0.6629795944318175\package | |
| 85525 silly lockFile 8de6fd28-96673-0-6629795944318175-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557096673-0.6629795944318175\package | |
| 85526 silly addNameRange number 2 { name: 'ast-types', range: '>=0.7.0-0 <0.8.0-0', hasData: true } | |
| 85527 silly addNameRange versions [ 'ast-types', | |
| 85527 silly addNameRange [ '0.1.1', | |
| 85527 silly addNameRange '0.1.2', | |
| 85527 silly addNameRange '0.1.3', | |
| 85527 silly addNameRange '0.1.4', | |
| 85527 silly addNameRange '0.2.0', | |
| 85527 silly addNameRange '0.2.2', | |
| 85527 silly addNameRange '0.2.3', | |
| 85527 silly addNameRange '0.2.4', | |
| 85527 silly addNameRange '0.2.6', | |
| 85527 silly addNameRange '0.2.7', | |
| 85527 silly addNameRange '0.2.8', | |
| 85527 silly addNameRange '0.2.9', | |
| 85527 silly addNameRange '0.2.10', | |
| 85527 silly addNameRange '0.2.11', | |
| 85527 silly addNameRange '0.2.12', | |
| 85527 silly addNameRange '0.2.13', | |
| 85527 silly addNameRange '0.2.14', | |
| 85527 silly addNameRange '0.2.15', | |
| 85527 silly addNameRange '0.2.16', | |
| 85527 silly addNameRange '0.2.17', | |
| 85527 silly addNameRange '0.2.18', | |
| 85527 silly addNameRange '0.2.19', | |
| 85527 silly addNameRange '0.2.20', | |
| 85527 silly addNameRange '0.2.21', | |
| 85527 silly addNameRange '0.2.22', | |
| 85527 silly addNameRange '0.2.23', | |
| 85527 silly addNameRange '0.2.24', | |
| 85527 silly addNameRange '0.2.25', | |
| 85527 silly addNameRange '0.3.0', | |
| 85527 silly addNameRange '0.3.1', | |
| 85527 silly addNameRange '0.3.2', | |
| 85527 silly addNameRange '0.3.3', | |
| 85527 silly addNameRange '0.3.4', | |
| 85527 silly addNameRange '0.3.5', | |
| 85527 silly addNameRange '0.3.7', | |
| 85527 silly addNameRange '0.3.8', | |
| 85527 silly addNameRange '0.3.9', | |
| 85527 silly addNameRange '0.3.10', | |
| 85527 silly addNameRange '0.3.11', | |
| 85527 silly addNameRange '0.3.12', | |
| 85527 silly addNameRange '0.3.13', | |
| 85527 silly addNameRange '0.3.14', | |
| 85527 silly addNameRange '0.3.15', | |
| 85527 silly addNameRange '0.3.16', | |
| 85527 silly addNameRange '0.3.17', | |
| 85527 silly addNameRange '0.3.18', | |
| 85527 silly addNameRange '0.3.20', | |
| 85527 silly addNameRange '0.3.21', | |
| 85527 silly addNameRange '0.3.22', | |
| 85527 silly addNameRange '0.3.23', | |
| 85527 silly addNameRange '0.3.24', | |
| 85527 silly addNameRange '0.3.25', | |
| 85527 silly addNameRange '0.3.26', | |
| 85527 silly addNameRange '0.3.27', | |
| 85527 silly addNameRange '0.3.28', | |
| 85527 silly addNameRange '0.3.29', | |
| 85527 silly addNameRange '0.3.30', | |
| 85527 silly addNameRange '0.3.31', | |
| 85527 silly addNameRange '0.3.32', | |
| 85527 silly addNameRange '0.3.33', | |
| 85527 silly addNameRange '0.3.34', | |
| 85527 silly addNameRange '0.3.35', | |
| 85527 silly addNameRange '0.3.36', | |
| 85527 silly addNameRange '0.3.37', | |
| 85527 silly addNameRange '0.3.38', | |
| 85527 silly addNameRange '0.4.0', | |
| 85527 silly addNameRange '0.4.1', | |
| 85527 silly addNameRange '0.4.2', | |
| 85527 silly addNameRange '0.4.3', | |
| 85527 silly addNameRange '0.4.4', | |
| 85527 silly addNameRange '0.4.5', | |
| 85527 silly addNameRange '0.4.7', | |
| 85527 silly addNameRange '0.4.8', | |
| 85527 silly addNameRange '0.4.9', | |
| 85527 silly addNameRange '0.4.10', | |
| 85527 silly addNameRange '0.4.11', | |
| 85527 silly addNameRange '0.4.12', | |
| 85527 silly addNameRange '0.4.13', | |
| 85527 silly addNameRange '0.5.0', | |
| 85527 silly addNameRange '0.5.2', | |
| 85527 silly addNameRange '0.5.3', | |
| 85527 silly addNameRange '0.5.4', | |
| 85527 silly addNameRange '0.5.5', | |
| 85527 silly addNameRange '0.5.6', | |
| 85527 silly addNameRange '0.5.7', | |
| 85527 silly addNameRange '0.6.0', | |
| 85527 silly addNameRange '0.6.1', | |
| 85527 silly addNameRange '0.6.2', | |
| 85527 silly addNameRange '0.6.3', | |
| 85527 silly addNameRange '0.6.4', | |
| 85527 silly addNameRange '0.6.5', | |
| 85527 silly addNameRange '0.6.6', | |
| 85527 silly addNameRange '0.6.7', | |
| 85527 silly addNameRange '0.6.8', | |
| 85527 silly addNameRange '0.6.9', | |
| 85527 silly addNameRange '0.6.10', | |
| 85527 silly addNameRange '0.6.11', | |
| 85527 silly addNameRange '0.6.12', | |
| 85527 silly addNameRange '0.6.13', | |
| 85527 silly addNameRange '0.6.14', | |
| 85527 silly addNameRange '0.6.15', | |
| 85527 silly addNameRange '0.6.16', | |
| 85527 silly addNameRange '0.7.0', | |
| 85527 silly addNameRange '0.7.1', | |
| 85527 silly addNameRange '0.7.2', | |
| 85527 silly addNameRange '0.7.3', | |
| 85527 silly addNameRange '0.7.4', | |
| 85527 silly addNameRange '0.7.5', | |
| 85527 silly addNameRange '0.7.6' ] ] | |
| 85528 verbose addNamed [ 'ast-types', '0.7.6' ] | |
| 85529 verbose addNamed [ '0.7.6', '0.7.6' ] | |
| 85530 silly lockFile 66a99fa4-ast-types-0-7-6 ast-types@0.7.6 | |
| 85531 verbose lock ast-types@0.7.6 C:\Users\Vince\AppData\Roaming\npm-cache\66a99fa4-ast-types-0-7-6.lock | |
| 85532 silly lockFile ec4a85c9-96673-0-6629795944318175-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557096673-0.6629795944318175\tmp.tgz | |
| 85533 silly lockFile ec4a85c9-96673-0-6629795944318175-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557096673-0.6629795944318175\tmp.tgz | |
| 85534 silly lockFile 66a99fa4-ast-types-0-7-6 ast-types@0.7.6 | |
| 85535 silly lockFile 66a99fa4-ast-types-0-7-6 ast-types@0.7.6 | |
| 85536 http 304 https://registry.npmjs.org/path-is-absolute | |
| 85537 silly registry.get cb [ 304, | |
| 85537 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85537 silly registry.get etag: '"YJPG84UQ0LP8C3JMZV74XL03"', | |
| 85537 silly registry.get 'cache-control': 'max-age=60', | |
| 85537 silly registry.get 'accept-ranges': 'bytes', | |
| 85537 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85537 silly registry.get via: '1.1 varnish', | |
| 85537 silly registry.get connection: 'keep-alive', | |
| 85537 silly registry.get 'x-served-by': 'cache-ord1727-ORD', | |
| 85537 silly registry.get 'x-cache': 'MISS', | |
| 85537 silly registry.get 'x-cache-hits': '0', | |
| 85537 silly registry.get 'x-timer': 'S1429557123.453997,VS0,VE39' } ] | |
| 85538 verbose etag path-is-absolute from cache | |
| 85539 silly lockFile bc92d377-ast-types-0-7-0 ast-types@~0.7.0 | |
| 85540 silly lockFile bc92d377-ast-types-0-7-0 ast-types@~0.7.0 | |
| 85541 verbose tar pack [ 'C:\\Users\\Vince\\AppData\\Roaming\\npm-cache\\detect-indent\\3.0.1\\package.tgz', | |
| 85541 verbose tar pack 'C:\\Users\\Vince\\AppData\\Local\\Temp\\npm-11116\\1429557096673-0.6629795944318175\\package' ] | |
| 85542 verbose tarball C:\Users\Vince\AppData\Roaming\npm-cache\detect-indent\3.0.1\package.tgz | |
| 85543 verbose folder C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557096673-0.6629795944318175\package | |
| 85544 silly lockFile 8de6fd28-96673-0-6629795944318175-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557096673-0.6629795944318175\package | |
| 85545 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557096673-0.6629795944318175\package C:\Users\Vince\AppData\Roaming\npm-cache\8de6fd28-96673-0-6629795944318175-package.lock | |
| 85546 silly lockFile 94040487--detect-indent-3-0-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\detect-indent\3.0.1\package.tgz | |
| 85547 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\detect-indent\3.0.1\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\94040487--detect-indent-3-0-1-package-tgz.lock | |
| 85548 http 304 https://registry.npmjs.org/lodash | |
| 85549 silly registry.get cb [ 304, | |
| 85549 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85549 silly registry.get etag: '"6BK5V4583BQPCHUJJTIMSBFAP"', | |
| 85549 silly registry.get 'cache-control': 'max-age=60', | |
| 85549 silly registry.get 'accept-ranges': 'bytes', | |
| 85549 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85549 silly registry.get via: '1.1 varnish', | |
| 85549 silly registry.get connection: 'keep-alive', | |
| 85549 silly registry.get 'x-served-by': 'cache-ord1721-ORD', | |
| 85549 silly registry.get 'x-cache': 'MISS', | |
| 85549 silly registry.get 'x-cache-hits': '0', | |
| 85549 silly registry.get 'x-timer': 'S1429557123.356328,VS0,VE163' } ] | |
| 85550 verbose etag lodash from cache | |
| 85551 silly lockFile 8a4350ee-e-numbers-line-numbers-0-2-0-tgz https://registry.npmjs.org/line-numbers/-/line-numbers-0.2.0.tgz | |
| 85552 verbose lock https://registry.npmjs.org/line-numbers/-/line-numbers-0.2.0.tgz C:\Users\Vince\AppData\Roaming\npm-cache\8a4350ee-e-numbers-line-numbers-0-2-0-tgz.lock | |
| 85553 http 304 https://registry.npmjs.org/private | |
| 85554 silly registry.get cb [ 304, | |
| 85554 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85554 silly registry.get etag: '"CYCL3LS37GT66Q0X11ELDMVPR"', | |
| 85554 silly registry.get 'cache-control': 'max-age=60', | |
| 85554 silly registry.get 'accept-ranges': 'bytes', | |
| 85554 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85554 silly registry.get via: '1.1 varnish', | |
| 85554 silly registry.get connection: 'keep-alive', | |
| 85554 silly registry.get 'x-served-by': 'cache-ord1730-ORD', | |
| 85554 silly registry.get 'x-cache': 'MISS', | |
| 85554 silly registry.get 'x-cache-hits': '0', | |
| 85554 silly registry.get 'x-timer': 'S1429557123.505300,VS0,VE39' } ] | |
| 85555 verbose etag private from cache | |
| 85556 verbose addRemoteTarball [ 'https://registry.npmjs.org/line-numbers/-/line-numbers-0.2.0.tgz', | |
| 85556 verbose addRemoteTarball '6bc028149440e570d495ab509692aa08bd779c6e' ] | |
| 85557 http 304 https://registry.npmjs.org/minimatch | |
| 85558 silly registry.get cb [ 304, | |
| 85558 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85558 silly registry.get etag: '"7E6LX8BUVQYO67FCINACMFASW"', | |
| 85558 silly registry.get 'cache-control': 'max-age=60', | |
| 85558 silly registry.get 'accept-ranges': 'bytes', | |
| 85558 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85558 silly registry.get via: '1.1 varnish', | |
| 85558 silly registry.get connection: 'keep-alive', | |
| 85558 silly registry.get 'x-served-by': 'cache-ord1732-ORD', | |
| 85558 silly registry.get 'x-cache': 'MISS', | |
| 85558 silly registry.get 'x-cache-hits': '0', | |
| 85558 silly registry.get 'x-timer': 'S1429557123.482146,VS0,VE66' } ] | |
| 85559 verbose etag minimatch from cache | |
| 85560 info retry fetch attempt 1 at 14:11:37 | |
| 85561 verbose fetch to= C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097213-0.42129150265827775\tmp.tgz | |
| 85562 silly addNameRange number 2 { name: 'path-is-absolute', range: '*', hasData: true } | |
| 85563 silly addNameRange versions [ 'path-is-absolute', [ '1.0.0' ] ] | |
| 85564 verbose addNamed [ 'path-is-absolute', '1.0.0' ] | |
| 85565 verbose addNamed [ '1.0.0', '1.0.0' ] | |
| 85566 silly lockFile b525007d-path-is-absolute-1-0-0 path-is-absolute@1.0.0 | |
| 85567 verbose lock path-is-absolute@1.0.0 C:\Users\Vince\AppData\Roaming\npm-cache\b525007d-path-is-absolute-1-0-0.lock | |
| 85568 http GET https://registry.npmjs.org/line-numbers/-/line-numbers-0.2.0.tgz | |
| 85569 silly addNameRange number 2 { name: 'lodash', range: '*', hasData: true } | |
| 85570 silly addNameRange versions [ 'lodash', | |
| 85570 silly addNameRange [ '0.1.0', | |
| 85570 silly addNameRange '0.2.0', | |
| 85570 silly addNameRange '0.2.1', | |
| 85570 silly addNameRange '0.2.2', | |
| 85570 silly addNameRange '0.3.0', | |
| 85570 silly addNameRange '0.3.1', | |
| 85570 silly addNameRange '0.3.2', | |
| 85570 silly addNameRange '0.4.0', | |
| 85570 silly addNameRange '0.4.1', | |
| 85570 silly addNameRange '0.4.2', | |
| 85570 silly addNameRange '0.5.0-rc.1', | |
| 85570 silly addNameRange '0.5.0', | |
| 85570 silly addNameRange '0.5.1', | |
| 85570 silly addNameRange '0.5.2', | |
| 85570 silly addNameRange '0.6.0', | |
| 85570 silly addNameRange '0.6.1', | |
| 85570 silly addNameRange '0.7.0', | |
| 85570 silly addNameRange '0.8.0', | |
| 85570 silly addNameRange '0.8.1', | |
| 85570 silly addNameRange '0.8.2', | |
| 85570 silly addNameRange '0.9.0', | |
| 85570 silly addNameRange '0.9.1', | |
| 85570 silly addNameRange '0.9.2', | |
| 85570 silly addNameRange '0.10.0', | |
| 85570 silly addNameRange '1.0.0-rc.1', | |
| 85570 silly addNameRange '1.0.0-rc.2', | |
| 85570 silly addNameRange '1.0.0-rc.3', | |
| 85570 silly addNameRange '1.0.0', | |
| 85570 silly addNameRange '1.0.1', | |
| 85570 silly addNameRange '1.1.0', | |
| 85570 silly addNameRange '1.1.1', | |
| 85570 silly addNameRange '1.2.0', | |
| 85570 silly addNameRange '1.2.1', | |
| 85570 silly addNameRange '1.3.0', | |
| 85570 silly addNameRange '1.3.1', | |
| 85570 silly addNameRange '2.0.0', | |
| 85570 silly addNameRange '2.1.0', | |
| 85570 silly addNameRange '2.2.0', | |
| 85570 silly addNameRange '2.2.1', | |
| 85570 silly addNameRange '2.3.0', | |
| 85570 silly addNameRange '2.4.0', | |
| 85570 silly addNameRange '2.4.1', | |
| 85570 silly addNameRange '3.0.0', | |
| 85570 silly addNameRange '3.0.1', | |
| 85570 silly addNameRange '3.1.0', | |
| 85570 silly addNameRange '3.2.0', | |
| 85570 silly addNameRange '3.3.0', | |
| 85570 silly addNameRange '3.3.1', | |
| 85570 silly addNameRange '3.4.0', | |
| 85570 silly addNameRange '3.5.0', | |
| 85570 silly addNameRange '3.6.0', | |
| 85570 silly addNameRange '1.0.2', | |
| 85570 silly addNameRange '3.7.0' ] ] | |
| 85571 verbose addNamed [ 'lodash', '3.7.0' ] | |
| 85572 verbose addNamed [ '3.7.0', '3.7.0' ] | |
| 85573 silly lockFile d734a2d5-lodash-3-7-0 lodash@3.7.0 | |
| 85574 verbose lock lodash@3.7.0 C:\Users\Vince\AppData\Roaming\npm-cache\d734a2d5-lodash-3-7-0.lock | |
| 85575 silly lockFile b525007d-path-is-absolute-1-0-0 path-is-absolute@1.0.0 | |
| 85576 silly lockFile b525007d-path-is-absolute-1-0-0 path-is-absolute@1.0.0 | |
| 85577 http 304 https://registry.npmjs.org/regexpu | |
| 85578 silly registry.get cb [ 304, | |
| 85578 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85578 silly registry.get etag: '"DSDFHVGBR31ROZJSLJJ2VU5SC"', | |
| 85578 silly registry.get 'cache-control': 'max-age=60', | |
| 85578 silly registry.get 'accept-ranges': 'bytes', | |
| 85578 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85578 silly registry.get via: '1.1 varnish', | |
| 85578 silly registry.get connection: 'keep-alive', | |
| 85578 silly registry.get 'x-served-by': 'cache-ord1727-ORD', | |
| 85578 silly registry.get 'x-cache': 'MISS', | |
| 85578 silly registry.get 'x-cache-hits': '0', | |
| 85578 silly registry.get 'x-timer': 'S1429557123.560532,VS0,VE65' } ] | |
| 85579 verbose etag regexpu from cache | |
| 85580 http 304 https://registry.npmjs.org/output-file-sync | |
| 85581 silly registry.get cb [ 304, | |
| 85581 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85581 silly registry.get etag: '"DHDR0X5T6BX4A4QOIPLW0ZY5T"', | |
| 85581 silly registry.get 'cache-control': 'max-age=60', | |
| 85581 silly registry.get 'accept-ranges': 'bytes', | |
| 85581 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85581 silly registry.get via: '1.1 varnish', | |
| 85581 silly registry.get connection: 'keep-alive', | |
| 85581 silly registry.get 'x-served-by': 'cache-ord1735-ORD', | |
| 85581 silly registry.get 'x-cache': 'MISS', | |
| 85581 silly registry.get 'x-cache-hits': '0', | |
| 85581 silly registry.get 'x-timer': 'S1429557123.374052,VS0,VE268' } ] | |
| 85582 verbose etag output-file-sync from cache | |
| 85583 http 304 https://registry.npmjs.org/regenerator | |
| 85584 silly registry.get cb [ 304, | |
| 85584 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85584 silly registry.get etag: '"7EYM5BZH9XUPH62L8B94MKAUR"', | |
| 85584 silly registry.get 'cache-control': 'max-age=60', | |
| 85584 silly registry.get 'accept-ranges': 'bytes', | |
| 85584 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85584 silly registry.get via: '1.1 varnish', | |
| 85584 silly registry.get connection: 'keep-alive', | |
| 85584 silly registry.get 'x-served-by': 'cache-ord1721-ORD', | |
| 85584 silly registry.get 'x-cache': 'MISS', | |
| 85584 silly registry.get 'x-cache-hits': '0', | |
| 85584 silly registry.get 'x-timer': 'S1429557123.579335,VS0,VE66' } ] | |
| 85585 verbose etag regenerator from cache | |
| 85586 http 304 https://registry.npmjs.org/repeating | |
| 85587 silly registry.get cb [ 304, | |
| 85587 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85587 silly registry.get etag: '"6XZ95R0691DR4O28A6SZBSH9A"', | |
| 85587 silly registry.get 'cache-control': 'max-age=60', | |
| 85587 silly registry.get 'accept-ranges': 'bytes', | |
| 85587 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85587 silly registry.get via: '1.1 varnish', | |
| 85587 silly registry.get connection: 'keep-alive', | |
| 85587 silly registry.get 'x-served-by': 'cache-ord1730-ORD', | |
| 85587 silly registry.get 'x-cache': 'MISS', | |
| 85587 silly registry.get 'x-cache-hits': '0', | |
| 85587 silly registry.get 'x-timer': 'S1429557123.596862,VS0,VE65' } ] | |
| 85588 verbose etag repeating from cache | |
| 85589 silly lockFile 0add5472-path-is-absolute-1-0-0 path-is-absolute@^1.0.0 | |
| 85590 silly lockFile 0add5472-path-is-absolute-1-0-0 path-is-absolute@^1.0.0 | |
| 85591 silly addNameRange number 2 { name: 'private', range: '*', hasData: true } | |
| 85592 silly addNameRange versions [ 'private', | |
| 85592 silly addNameRange [ '0.0.1', | |
| 85592 silly addNameRange '0.0.2', | |
| 85592 silly addNameRange '0.0.3', | |
| 85592 silly addNameRange '0.0.4', | |
| 85592 silly addNameRange '0.0.5', | |
| 85592 silly addNameRange '0.1.0', | |
| 85592 silly addNameRange '0.1.1', | |
| 85592 silly addNameRange '0.1.2', | |
| 85592 silly addNameRange '0.1.3', | |
| 85592 silly addNameRange '0.1.4', | |
| 85592 silly addNameRange '0.1.5', | |
| 85592 silly addNameRange '0.1.6' ] ] | |
| 85593 verbose addNamed [ 'private', '0.1.6' ] | |
| 85594 verbose addNamed [ '0.1.6', '0.1.6' ] | |
| 85595 silly lockFile 2ec3a1af-private-0-1-6 private@0.1.6 | |
| 85596 verbose lock private@0.1.6 C:\Users\Vince\AppData\Roaming\npm-cache\2ec3a1af-private-0-1-6.lock | |
| 85597 silly lockFile d734a2d5-lodash-3-7-0 lodash@3.7.0 | |
| 85598 silly lockFile d734a2d5-lodash-3-7-0 lodash@3.7.0 | |
| 85599 silly addNameRange number 2 { name: 'regenerator', range: '*', hasData: true } | |
| 85600 silly addNameRange versions [ 'regenerator', | |
| 85600 silly addNameRange [ '0.1.0', | |
| 85600 silly addNameRange '0.1.1', | |
| 85600 silly addNameRange '0.1.2', | |
| 85600 silly addNameRange '0.1.3', | |
| 85600 silly addNameRange '0.1.4', | |
| 85600 silly addNameRange '0.1.5', | |
| 85600 silly addNameRange '0.1.6', | |
| 85600 silly addNameRange '0.1.7', | |
| 85600 silly addNameRange '0.2.0', | |
| 85600 silly addNameRange '0.2.1', | |
| 85600 silly addNameRange '0.2.2', | |
| 85600 silly addNameRange '0.2.3', | |
| 85600 silly addNameRange '0.2.4', | |
| 85600 silly addNameRange '0.2.5', | |
| 85600 silly addNameRange '0.2.6', | |
| 85600 silly addNameRange '0.2.7', | |
| 85600 silly addNameRange '0.2.8', | |
| 85600 silly addNameRange '0.2.9', | |
| 85600 silly addNameRange '0.2.10', | |
| 85600 silly addNameRange '0.2.11', | |
| 85600 silly addNameRange '0.3.0', | |
| 85600 silly addNameRange '0.3.1', | |
| 85600 silly addNameRange '0.3.2', | |
| 85600 silly addNameRange '0.3.3', | |
| 85600 silly addNameRange '0.3.4', | |
| 85600 silly addNameRange '0.3.5', | |
| 85600 silly addNameRange '0.3.6', | |
| 85600 silly addNameRange '0.3.7', | |
| 85600 silly addNameRange '0.3.8', | |
| 85600 silly addNameRange '0.3.9', | |
| 85600 silly addNameRange '0.4.0', | |
| 85600 silly addNameRange '0.4.1', | |
| 85600 silly addNameRange '0.4.2', | |
| 85600 silly addNameRange '0.4.3', | |
| 85600 silly addNameRange '0.4.4', | |
| 85600 silly addNameRange '0.4.5', | |
| 85600 silly addNameRange '0.4.6', | |
| 85600 silly addNameRange '0.4.7', | |
| 85600 silly addNameRange '0.4.8', | |
| 85600 silly addNameRange '0.4.9', | |
| 85600 silly addNameRange '0.4.10', | |
| 85600 silly addNameRange '0.4.11', | |
| 85600 silly addNameRange '0.4.12', | |
| 85600 silly addNameRange '0.5.0', | |
| 85600 silly addNameRange '0.5.3', | |
| 85600 silly addNameRange '0.5.2', | |
| 85600 silly addNameRange '0.5.1', | |
| 85600 silly addNameRange '0.6.0', | |
| 85600 silly addNameRange '0.6.1', | |
| 85600 silly addNameRange '0.6.2', | |
| 85600 silly addNameRange '0.6.3', | |
| 85600 silly addNameRange '0.6.4', | |
| 85600 silly addNameRange '0.6.5', | |
| 85600 silly addNameRange '0.6.6', | |
| 85600 silly addNameRange '0.6.7', | |
| 85600 silly addNameRange '0.6.8', | |
| 85600 silly addNameRange '0.6.9', | |
| 85600 silly addNameRange '0.6.10', | |
| 85600 silly addNameRange '0.7.0', | |
| 85600 silly addNameRange '0.7.1', | |
| 85600 silly addNameRange '0.7.2', | |
| 85600 silly addNameRange '0.7.3', | |
| 85600 silly addNameRange '0.7.4', | |
| 85600 silly addNameRange '0.7.5', | |
| 85600 silly addNameRange '0.7.6', | |
| 85600 silly addNameRange '0.7.7', | |
| 85600 silly addNameRange '0.7.8', | |
| 85600 silly addNameRange '0.8.0', | |
| 85600 silly addNameRange '0.8.1', | |
| 85600 silly addNameRange '0.8.2', | |
| 85600 silly addNameRange '0.8.3', | |
| 85600 silly addNameRange '0.8.4', | |
| 85600 silly addNameRange '0.8.5', | |
| 85600 silly addNameRange '0.8.6', | |
| 85600 silly addNameRange '0.8.7', | |
| 85600 silly addNameRange '0.8.8', | |
| 85600 silly addNameRange '0.8.9', | |
| 85600 silly addNameRange '0.8.10', | |
| 85600 silly addNameRange '0.8.11', | |
| 85600 silly addNameRange '0.8.12', | |
| 85600 silly addNameRange '0.8.13', | |
| 85600 silly addNameRange '0.8.14', | |
| 85600 silly addNameRange '0.8.15', | |
| 85600 silly addNameRange '0.8.16', | |
| 85600 silly addNameRange '0.8.17', | |
| 85600 silly addNameRange '0.8.18', | |
| 85600 silly addNameRange '0.8.19', | |
| 85600 silly addNameRange '0.8.20', | |
| 85600 silly addNameRange '0.8.21', | |
| 85600 silly addNameRange '0.8.22' ] ] | |
| 85601 verbose addNamed [ 'regenerator', '0.8.22' ] | |
| 85602 verbose addNamed [ '0.8.22', '0.8.22' ] | |
| 85603 silly lockFile 0e0fbd9c-regenerator-0-8-22 regenerator@0.8.22 | |
| 85604 verbose lock regenerator@0.8.22 C:\Users\Vince\AppData\Roaming\npm-cache\0e0fbd9c-regenerator-0-8-22.lock | |
| 85605 silly lockFile 02802cad-lodash-3-6-0 lodash@^3.6.0 | |
| 85606 silly lockFile 02802cad-lodash-3-6-0 lodash@^3.6.0 | |
| 85607 silly addNameRange number 2 { name: 'repeating', range: '*', hasData: true } | |
| 85608 silly addNameRange versions [ 'repeating', [ '1.0.0', '1.0.1', '1.1.0', '1.1.1', '1.1.2' ] ] | |
| 85609 verbose addNamed [ 'repeating', '1.1.2' ] | |
| 85610 verbose addNamed [ '1.1.2', '1.1.2' ] | |
| 85611 silly lockFile 8cff280a-repeating-1-1-2 repeating@1.1.2 | |
| 85612 verbose lock repeating@1.1.2 C:\Users\Vince\AppData\Roaming\npm-cache\8cff280a-repeating-1-1-2.lock | |
| 85613 silly lockFile 8cff280a-repeating-1-1-2 repeating@1.1.2 | |
| 85614 silly lockFile 8cff280a-repeating-1-1-2 repeating@1.1.2 | |
| 85615 silly addNameRange number 2 { name: 'regexpu', range: '*', hasData: true } | |
| 85616 silly addNameRange versions [ 'regexpu', | |
| 85616 silly addNameRange [ '0.1.0', | |
| 85616 silly addNameRange '0.1.1', | |
| 85616 silly addNameRange '0.2.1', | |
| 85616 silly addNameRange '0.2.2', | |
| 85616 silly addNameRange '0.2.3', | |
| 85616 silly addNameRange '0.3.0', | |
| 85616 silly addNameRange '0.3.1', | |
| 85616 silly addNameRange '1.0.0', | |
| 85616 silly addNameRange '1.1.0', | |
| 85616 silly addNameRange '1.1.1', | |
| 85616 silly addNameRange '1.1.2' ] ] | |
| 85617 verbose addNamed [ 'regexpu', '1.1.2' ] | |
| 85618 verbose addNamed [ '1.1.2', '1.1.2' ] | |
| 85619 silly lockFile 7c21e241-regexpu-1-1-2 regexpu@1.1.2 | |
| 85620 verbose lock regexpu@1.1.2 C:\Users\Vince\AppData\Roaming\npm-cache\7c21e241-regexpu-1-1-2.lock | |
| 85621 silly addNameRange number 2 { name: 'output-file-sync', range: '*', hasData: true } | |
| 85622 silly addNameRange versions [ 'output-file-sync', [ '1.0.0', '1.1.0' ] ] | |
| 85623 verbose addNamed [ 'output-file-sync', '1.1.0' ] | |
| 85624 verbose addNamed [ '1.1.0', '1.1.0' ] | |
| 85625 silly lockFile 2d3564f0-output-file-sync-1-1-0 output-file-sync@1.1.0 | |
| 85626 verbose lock output-file-sync@1.1.0 C:\Users\Vince\AppData\Roaming\npm-cache\2d3564f0-output-file-sync-1-1-0.lock | |
| 85627 silly lockFile 8de6fd28-96673-0-6629795944318175-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557096673-0.6629795944318175\package | |
| 85628 silly lockFile 8de6fd28-96673-0-6629795944318175-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557096673-0.6629795944318175\package | |
| 85629 silly lockFile 9ec40baa-js-org-private-private-0-1-6-tgz https://registry.npmjs.org/private/-/private-0.1.6.tgz | |
| 85630 verbose lock https://registry.npmjs.org/private/-/private-0.1.6.tgz C:\Users\Vince\AppData\Roaming\npm-cache\9ec40baa-js-org-private-private-0-1-6-tgz.lock | |
| 85631 silly lockFile 0fe0a906-repeating-1-1-2 repeating@^1.1.2 | |
| 85632 silly lockFile 0fe0a906-repeating-1-1-2 repeating@^1.1.2 | |
| 85633 silly lockFile 2d3564f0-output-file-sync-1-1-0 output-file-sync@1.1.0 | |
| 85634 silly lockFile 2d3564f0-output-file-sync-1-1-0 output-file-sync@1.1.0 | |
| 85635 verbose addRemoteTarball [ 'https://registry.npmjs.org/private/-/private-0.1.6.tgz', | |
| 85635 verbose addRemoteTarball '55c6a976d0f9bafb9924851350fe47b9b5fbb7c1' ] | |
| 85636 silly addNameRange number 2 { name: 'minimatch', range: '*', hasData: true } | |
| 85637 silly addNameRange versions [ 'minimatch', | |
| 85637 silly addNameRange [ '0.0.1', | |
| 85637 silly addNameRange '0.0.2', | |
| 85637 silly addNameRange '0.0.4', | |
| 85637 silly addNameRange '0.0.5', | |
| 85637 silly addNameRange '0.1.1', | |
| 85637 silly addNameRange '0.1.2', | |
| 85637 silly addNameRange '0.1.3', | |
| 85637 silly addNameRange '0.1.4', | |
| 85637 silly addNameRange '0.1.5', | |
| 85637 silly addNameRange '0.2.0', | |
| 85637 silly addNameRange '0.2.2', | |
| 85637 silly addNameRange '0.2.3', | |
| 85637 silly addNameRange '0.2.4', | |
| 85637 silly addNameRange '0.2.5', | |
| 85637 silly addNameRange '0.2.6', | |
| 85637 silly addNameRange '0.2.7', | |
| 85637 silly addNameRange '0.2.8', | |
| 85637 silly addNameRange '0.2.9', | |
| 85637 silly addNameRange '0.2.10', | |
| 85637 silly addNameRange '0.2.11', | |
| 85637 silly addNameRange '0.2.12', | |
| 85637 silly addNameRange '0.2.13', | |
| 85637 silly addNameRange '0.2.14', | |
| 85637 silly addNameRange '0.3.0', | |
| 85637 silly addNameRange '0.4.0', | |
| 85637 silly addNameRange '1.0.0', | |
| 85637 silly addNameRange '2.0.0', | |
| 85637 silly addNameRange '2.0.1', | |
| 85637 silly addNameRange '2.0.2', | |
| 85637 silly addNameRange '2.0.3', | |
| 85637 silly addNameRange '2.0.4' ] ] | |
| 85638 verbose addNamed [ 'minimatch', '2.0.4' ] | |
| 85639 verbose addNamed [ '2.0.4', '2.0.4' ] | |
| 85640 silly lockFile 5757e70b-minimatch-2-0-4 minimatch@2.0.4 | |
| 85641 verbose lock minimatch@2.0.4 C:\Users\Vince\AppData\Roaming\npm-cache\5757e70b-minimatch-2-0-4.lock | |
| 85642 silly lockFile 94040487--detect-indent-3-0-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\detect-indent\3.0.1\package.tgz | |
| 85643 silly lockFile 94040487--detect-indent-3-0-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\detect-indent\3.0.1\package.tgz | |
| 85644 silly lockFile 7de00f14-generator-regenerator-0-8-22-tgz https://registry.npmjs.org/regenerator/-/regenerator-0.8.22.tgz | |
| 85645 verbose lock https://registry.npmjs.org/regenerator/-/regenerator-0.8.22.tgz C:\Users\Vince\AppData\Roaming\npm-cache\7de00f14-generator-regenerator-0-8-22-tgz.lock | |
| 85646 info retry fetch attempt 1 at 14:11:37 | |
| 85647 verbose fetch to= C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097361-0.5838439704384655\tmp.tgz | |
| 85648 silly lockFile f0fc0ab4-js-org-regexpu-regexpu-1-1-2-tgz https://registry.npmjs.org/regexpu/-/regexpu-1.1.2.tgz | |
| 85649 verbose lock https://registry.npmjs.org/regexpu/-/regexpu-1.1.2.tgz C:\Users\Vince\AppData\Roaming\npm-cache\f0fc0ab4-js-org-regexpu-regexpu-1-1-2-tgz.lock | |
| 85650 silly lockFile 5b112237-output-file-sync-1-1-0 output-file-sync@^1.1.0 | |
| 85651 silly lockFile 5b112237-output-file-sync-1-1-0 output-file-sync@^1.1.0 | |
| 85652 verbose addRemoteTarball [ 'https://registry.npmjs.org/regenerator/-/regenerator-0.8.22.tgz', | |
| 85652 verbose addRemoteTarball '6706f6f3abb9268c161f9f25a0520d0cdec250fc' ] | |
| 85653 silly lockFile 5757e70b-minimatch-2-0-4 minimatch@2.0.4 | |
| 85654 silly lockFile 5757e70b-minimatch-2-0-4 minimatch@2.0.4 | |
| 85655 http GET https://registry.npmjs.org/private/-/private-0.1.6.tgz | |
| 85656 verbose addRemoteTarball [ 'https://registry.npmjs.org/regexpu/-/regexpu-1.1.2.tgz', | |
| 85656 verbose addRemoteTarball '472fedd80ebfac9f07513b4aa17e40fdaf5c8605' ] | |
| 85657 info retry fetch attempt 1 at 14:11:37 | |
| 85658 verbose fetch to= C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.696940659545362\tmp.tgz | |
| 85659 info retry fetch attempt 1 at 14:11:37 | |
| 85660 verbose fetch to= C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.6178647016640753\tmp.tgz | |
| 85661 silly lockFile 9725e165-ache-detect-indent-3-0-1-package C:\Users\Vince\AppData\Roaming\npm-cache\detect-indent\3.0.1\package | |
| 85662 verbose lock C:\Users\Vince\AppData\Roaming\npm-cache\detect-indent\3.0.1\package C:\Users\Vince\AppData\Roaming\npm-cache\9725e165-ache-detect-indent-3-0-1-package.lock | |
| 85663 silly lockFile 5504e165-minimatch-2-0-3 minimatch@^2.0.3 | |
| 85664 silly lockFile 5504e165-minimatch-2-0-3 minimatch@^2.0.3 | |
| 85665 http GET https://registry.npmjs.org/regenerator/-/regenerator-0.8.22.tgz | |
| 85666 http GET https://registry.npmjs.org/regexpu/-/regexpu-1.1.2.tgz | |
| 85667 silly lockFile 9725e165-ache-detect-indent-3-0-1-package C:\Users\Vince\AppData\Roaming\npm-cache\detect-indent\3.0.1\package | |
| 85668 silly lockFile 9725e165-ache-detect-indent-3-0-1-package C:\Users\Vince\AppData\Roaming\npm-cache\detect-indent\3.0.1\package | |
| 85669 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\detect-indent\3.0.1\package.tgz | |
| 85670 silly lockFile b2b6163c-ache-detect-indent-3-0-1-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\detect-indent\3.0.1\package | |
| 85671 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\detect-indent\3.0.1\package C:\Users\Vince\AppData\Roaming\npm-cache\b2b6163c-ache-detect-indent-3-0-1-package.lock | |
| 85672 silly lockFile 94040487--detect-indent-3-0-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\detect-indent\3.0.1\package.tgz | |
| 85673 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\detect-indent\3.0.1\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\94040487--detect-indent-3-0-1-package-tgz.lock | |
| 85674 silly gunzTarPerm modes [ '755', '644' ] | |
| 85675 silly gunzTarPerm extractEntry package.json | |
| 85676 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 85677 http 304 https://registry.npmjs.org/source-map | |
| 85678 silly registry.get cb [ 304, | |
| 85678 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85678 silly registry.get etag: '"6X6700A4ARF6BEP1WI9Y86P6"', | |
| 85678 silly registry.get 'cache-control': 'max-age=60', | |
| 85678 silly registry.get 'accept-ranges': 'bytes', | |
| 85678 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85678 silly registry.get via: '1.1 varnish', | |
| 85678 silly registry.get connection: 'keep-alive', | |
| 85678 silly registry.get 'x-served-by': 'cache-ord1735-ORD', | |
| 85678 silly registry.get 'x-cache': 'MISS', | |
| 85678 silly registry.get 'x-cache-hits': '0', | |
| 85678 silly registry.get 'x-timer': 'S1429557123.697332,VS0,VE39' } ] | |
| 85679 verbose etag source-map from cache | |
| 85680 http 304 https://registry.npmjs.org/slash | |
| 85681 silly registry.get cb [ 304, | |
| 85681 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85681 silly registry.get etag: '"EW6IQDLAMOH6DMVJEB79Z0MKO"', | |
| 85681 silly registry.get 'cache-control': 'max-age=60', | |
| 85681 silly registry.get 'accept-ranges': 'bytes', | |
| 85681 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85681 silly registry.get via: '1.1 varnish', | |
| 85681 silly registry.get connection: 'keep-alive', | |
| 85681 silly registry.get 'x-served-by': 'cache-ord1727-ORD', | |
| 85681 silly registry.get 'x-cache': 'MISS', | |
| 85681 silly registry.get 'x-cache-hits': '0', | |
| 85681 silly registry.get 'x-timer': 'S1429557123.686585,VS0,VE65' } ] | |
| 85682 verbose etag slash from cache | |
| 85683 http 304 https://registry.npmjs.org/shebang-regex | |
| 85684 silly registry.get cb [ 304, | |
| 85684 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85684 silly registry.get etag: '"CS363YQ9Y3G537WLFL71OHWW1"', | |
| 85684 silly registry.get 'cache-control': 'max-age=60', | |
| 85684 silly registry.get 'accept-ranges': 'bytes', | |
| 85684 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85684 silly registry.get via: '1.1 varnish', | |
| 85684 silly registry.get connection: 'keep-alive', | |
| 85684 silly registry.get 'x-served-by': 'cache-ord1732-ORD', | |
| 85684 silly registry.get 'x-cache': 'MISS', | |
| 85684 silly registry.get 'x-cache-hits': '0', | |
| 85684 silly registry.get 'x-timer': 'S1429557123.605315,VS0,VE161' } ] | |
| 85685 verbose etag shebang-regex from cache | |
| 85686 http 304 https://registry.npmjs.org/source-map-support | |
| 85687 silly registry.get cb [ 304, | |
| 85687 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85687 silly registry.get etag: '"9YLBO9N0L0XSMPKS9UWMCS7HG"', | |
| 85687 silly registry.get 'cache-control': 'max-age=60', | |
| 85687 silly registry.get 'accept-ranges': 'bytes', | |
| 85687 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85687 silly registry.get via: '1.1 varnish', | |
| 85687 silly registry.get connection: 'keep-alive', | |
| 85687 silly registry.get 'x-served-by': 'cache-ord1721-ORD', | |
| 85687 silly registry.get 'x-cache': 'MISS', | |
| 85687 silly registry.get 'x-cache-hits': '0', | |
| 85687 silly registry.get 'x-timer': 'S1429557123.702735,VS0,VE66' } ] | |
| 85688 verbose etag source-map-support from cache | |
| 85689 silly gunzTarPerm extractEntry cli.js | |
| 85690 silly gunzTarPerm modified mode [ 'cli.js', 438, 420 ] | |
| 85691 silly gunzTarPerm extractEntry index.js | |
| 85692 silly gunzTarPerm modified mode [ 'index.js', 438, 420 ] | |
| 85693 http 304 https://registry.npmjs.org/strip-json-comments | |
| 85694 silly registry.get cb [ 304, | |
| 85694 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85694 silly registry.get etag: '"18AM02OC56FGV63KROIALAXYJ"', | |
| 85694 silly registry.get 'cache-control': 'max-age=60', | |
| 85694 silly registry.get 'accept-ranges': 'bytes', | |
| 85694 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85694 silly registry.get via: '1.1 varnish', | |
| 85694 silly registry.get connection: 'keep-alive', | |
| 85694 silly registry.get 'x-served-by': 'cache-ord1730-ORD', | |
| 85694 silly registry.get 'x-cache': 'MISS', | |
| 85694 silly registry.get 'x-cache-hits': '0', | |
| 85694 silly registry.get 'x-timer': 'S1429557123.716941,VS0,VE66' } ] | |
| 85695 verbose etag strip-json-comments from cache | |
| 85696 silly addNameRange number 2 { name: 'source-map', range: '*', hasData: true } | |
| 85697 silly addNameRange versions [ 'source-map', | |
| 85697 silly addNameRange [ '0.0.0', | |
| 85697 silly addNameRange '0.1.0', | |
| 85697 silly addNameRange '0.1.1', | |
| 85697 silly addNameRange '0.1.2', | |
| 85697 silly addNameRange '0.1.3', | |
| 85697 silly addNameRange '0.1.4', | |
| 85697 silly addNameRange '0.1.5', | |
| 85697 silly addNameRange '0.1.6', | |
| 85697 silly addNameRange '0.1.7', | |
| 85697 silly addNameRange '0.1.8', | |
| 85697 silly addNameRange '0.1.9', | |
| 85697 silly addNameRange '0.1.10', | |
| 85697 silly addNameRange '0.1.11', | |
| 85697 silly addNameRange '0.1.12', | |
| 85697 silly addNameRange '0.1.13', | |
| 85697 silly addNameRange '0.1.14', | |
| 85697 silly addNameRange '0.1.15', | |
| 85697 silly addNameRange '0.1.16', | |
| 85697 silly addNameRange '0.1.17', | |
| 85697 silly addNameRange '0.1.18', | |
| 85697 silly addNameRange '0.1.19', | |
| 85697 silly addNameRange '0.1.20', | |
| 85697 silly addNameRange '0.1.21', | |
| 85697 silly addNameRange '0.1.22', | |
| 85697 silly addNameRange '0.1.23', | |
| 85697 silly addNameRange '0.1.24', | |
| 85697 silly addNameRange '0.1.25', | |
| 85697 silly addNameRange '0.1.26', | |
| 85697 silly addNameRange '0.1.27', | |
| 85697 silly addNameRange '0.1.28', | |
| 85697 silly addNameRange '0.1.29', | |
| 85697 silly addNameRange '0.1.30', | |
| 85697 silly addNameRange '0.1.31', | |
| 85697 silly addNameRange '0.1.32', | |
| 85697 silly addNameRange '0.1.33', | |
| 85697 silly addNameRange '0.1.34', | |
| 85697 silly addNameRange '0.1.35', | |
| 85697 silly addNameRange '0.1.36', | |
| 85697 silly addNameRange '0.1.37', | |
| 85697 silly addNameRange '0.1.38', | |
| 85697 silly addNameRange '0.1.39', | |
| 85697 silly addNameRange '0.1.40', | |
| 85697 silly addNameRange '0.1.41', | |
| 85697 silly addNameRange '0.1.42', | |
| 85697 silly addNameRange '0.1.43', | |
| 85697 silly addNameRange '0.2.0', | |
| 85697 silly addNameRange '0.3.0', | |
| 85697 silly addNameRange '0.4.0', | |
| 85697 silly addNameRange '0.4.1', | |
| 85697 silly addNameRange '0.4.2' ] ] | |
| 85698 verbose addNamed [ 'source-map', '0.4.2' ] | |
| 85699 verbose addNamed [ '0.4.2', '0.4.2' ] | |
| 85700 silly lockFile 0677abf1-source-map-0-4-2 source-map@0.4.2 | |
| 85701 verbose lock source-map@0.4.2 C:\Users\Vince\AppData\Roaming\npm-cache\0677abf1-source-map-0-4-2.lock | |
| 85702 silly addNameRange number 2 { name: 'shebang-regex', range: '*', hasData: true } | |
| 85703 silly addNameRange versions [ 'shebang-regex', [ '1.0.0' ] ] | |
| 85704 verbose addNamed [ 'shebang-regex', '1.0.0' ] | |
| 85705 verbose addNamed [ '1.0.0', '1.0.0' ] | |
| 85706 silly lockFile a2eaecc8-shebang-regex-1-0-0 shebang-regex@1.0.0 | |
| 85707 verbose lock shebang-regex@1.0.0 C:\Users\Vince\AppData\Roaming\npm-cache\a2eaecc8-shebang-regex-1-0-0.lock | |
| 85708 silly addNameRange number 2 { name: 'slash', range: '*', hasData: true } | |
| 85709 silly addNameRange versions [ 'slash', [ '0.1.0', '0.1.1', '0.1.3', '1.0.0' ] ] | |
| 85710 verbose addNamed [ 'slash', '1.0.0' ] | |
| 85711 verbose addNamed [ '1.0.0', '1.0.0' ] | |
| 85712 silly lockFile 7f414145-slash-1-0-0 slash@1.0.0 | |
| 85713 verbose lock slash@1.0.0 C:\Users\Vince\AppData\Roaming\npm-cache\7f414145-slash-1-0-0.lock | |
| 85714 silly lockFile a2eaecc8-shebang-regex-1-0-0 shebang-regex@1.0.0 | |
| 85715 silly lockFile a2eaecc8-shebang-regex-1-0-0 shebang-regex@1.0.0 | |
| 85716 silly addNameRange number 2 { name: 'source-map-support', range: '*', hasData: true } | |
| 85717 silly addNameRange versions [ 'source-map-support', | |
| 85717 silly addNameRange [ '0.1.0', | |
| 85717 silly addNameRange '0.1.1', | |
| 85717 silly addNameRange '0.1.2', | |
| 85717 silly addNameRange '0.1.3', | |
| 85717 silly addNameRange '0.1.4', | |
| 85717 silly addNameRange '0.1.5', | |
| 85717 silly addNameRange '0.1.6', | |
| 85717 silly addNameRange '0.1.7', | |
| 85717 silly addNameRange '0.1.8', | |
| 85717 silly addNameRange '0.1.9', | |
| 85717 silly addNameRange '0.2.0', | |
| 85717 silly addNameRange '0.2.1', | |
| 85717 silly addNameRange '0.2.2', | |
| 85717 silly addNameRange '0.2.3', | |
| 85717 silly addNameRange '0.2.4', | |
| 85717 silly addNameRange '0.2.5', | |
| 85717 silly addNameRange '0.2.6', | |
| 85717 silly addNameRange '0.2.7', | |
| 85717 silly addNameRange '0.2.8', | |
| 85717 silly addNameRange '0.2.9', | |
| 85717 silly addNameRange '0.2.10' ] ] | |
| 85718 verbose addNamed [ 'source-map-support', '0.2.10' ] | |
| 85719 verbose addNamed [ '0.2.10', '0.2.10' ] | |
| 85720 silly lockFile fe1fd7d3-source-map-support-0-2-10 source-map-support@0.2.10 | |
| 85721 verbose lock source-map-support@0.2.10 C:\Users\Vince\AppData\Roaming\npm-cache\fe1fd7d3-source-map-support-0-2-10.lock | |
| 85722 silly lockFile 7f414145-slash-1-0-0 slash@1.0.0 | |
| 85723 silly lockFile 7f414145-slash-1-0-0 slash@1.0.0 | |
| 85724 silly gunzTarPerm extractEntry readme.md | |
| 85725 silly gunzTarPerm modified mode [ 'readme.md', 438, 420 ] | |
| 85726 silly addNameRange number 2 { name: 'strip-json-comments', range: '*', hasData: true } | |
| 85727 silly addNameRange versions [ 'strip-json-comments', | |
| 85727 silly addNameRange [ '0.1.0', '0.1.1', '0.1.2', '0.1.3', '1.0.0', '1.0.1', '1.0.2' ] ] | |
| 85728 verbose addNamed [ 'strip-json-comments', '1.0.2' ] | |
| 85729 verbose addNamed [ '1.0.2', '1.0.2' ] | |
| 85730 silly lockFile 006f1065-strip-json-comments-1-0-2 strip-json-comments@1.0.2 | |
| 85731 verbose lock strip-json-comments@1.0.2 C:\Users\Vince\AppData\Roaming\npm-cache\006f1065-strip-json-comments-1-0-2.lock | |
| 85732 http 200 https://registry.npmjs.org/js-tokens/-/js-tokens-1.0.0.tgz | |
| 85733 silly lockFile 6b03ed00--source-map-source-map-0-4-2-tgz https://registry.npmjs.org/source-map/-/source-map-0.4.2.tgz | |
| 85734 verbose lock https://registry.npmjs.org/source-map/-/source-map-0.4.2.tgz C:\Users\Vince\AppData\Roaming\npm-cache\6b03ed00--source-map-source-map-0-4-2-tgz.lock | |
| 85735 silly lockFile 5e01e0f1-slash-1-0-0 slash@^1.0.0 | |
| 85736 silly lockFile 5e01e0f1-slash-1-0-0 slash@^1.0.0 | |
| 85737 silly lockFile 5d9164e3-shebang-regex-1-0-0 shebang-regex@^1.0.0 | |
| 85738 silly lockFile 5d9164e3-shebang-regex-1-0-0 shebang-regex@^1.0.0 | |
| 85739 verbose addRemoteTarball [ 'https://registry.npmjs.org/source-map/-/source-map-0.4.2.tgz', | |
| 85739 verbose addRemoteTarball 'dc9f3114394ab7c1f9782972f3d11820fff06f1f' ] | |
| 85740 silly lockFile 006f1065-strip-json-comments-1-0-2 strip-json-comments@1.0.2 | |
| 85741 silly lockFile 006f1065-strip-json-comments-1-0-2 strip-json-comments@1.0.2 | |
| 85742 info retry fetch attempt 1 at 14:11:37 | |
| 85743 verbose fetch to= C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097509-0.2024305632803589\tmp.tgz | |
| 85744 silly lockFile a506c62b-rt-source-map-support-0-2-10-tgz https://registry.npmjs.org/source-map-support/-/source-map-support-0.2.10.tgz | |
| 85745 verbose lock https://registry.npmjs.org/source-map-support/-/source-map-support-0.2.10.tgz C:\Users\Vince\AppData\Roaming\npm-cache\a506c62b-rt-source-map-support-0-2-10-tgz.lock | |
| 85746 http 304 https://registry.npmjs.org/to-fast-properties | |
| 85747 silly registry.get cb [ 304, | |
| 85747 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85747 silly registry.get etag: '"6J8XPNZL52VKJVT5TNPRQ7CRU"', | |
| 85747 silly registry.get 'cache-control': 'max-age=60', | |
| 85747 silly registry.get 'accept-ranges': 'bytes', | |
| 85747 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85747 silly registry.get via: '1.1 varnish', | |
| 85747 silly registry.get connection: 'keep-alive', | |
| 85747 silly registry.get 'x-served-by': 'cache-ord1735-ORD', | |
| 85747 silly registry.get 'x-cache': 'MISS', | |
| 85747 silly registry.get 'x-cache-hits': '0', | |
| 85747 silly registry.get 'x-timer': 'S1429557123.813015,VS0,VE44' } ] | |
| 85748 verbose etag to-fast-properties from cache | |
| 85749 http 304 https://registry.npmjs.org/trim-right | |
| 85750 silly registry.get cb [ 304, | |
| 85750 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85750 silly registry.get etag: '"75I3VPLCM2BLD9BM5J6OIB7VV"', | |
| 85750 silly registry.get 'cache-control': 'max-age=60', | |
| 85750 silly registry.get 'accept-ranges': 'bytes', | |
| 85750 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85750 silly registry.get via: '1.1 varnish', | |
| 85750 silly registry.get connection: 'keep-alive', | |
| 85750 silly registry.get 'x-served-by': 'cache-ord1727-ORD', | |
| 85750 silly registry.get 'x-cache': 'MISS', | |
| 85750 silly registry.get 'x-cache-hits': '0', | |
| 85750 silly registry.get 'x-timer': 'S1429557123.818078,VS0,VE39' } ] | |
| 85751 verbose etag trim-right from cache | |
| 85752 verbose addRemoteTarball [ 'https://registry.npmjs.org/source-map-support/-/source-map-support-0.2.10.tgz', | |
| 85752 verbose addRemoteTarball 'ea5a3900a1c1cb25096a0ae8cc5c2b4b10ded3dc' ] | |
| 85753 silly lockFile 18fbc7be-strip-json-comments-1-0-2 strip-json-comments@^1.0.2 | |
| 85754 silly lockFile 18fbc7be-strip-json-comments-1-0-2 strip-json-comments@^1.0.2 | |
| 85755 http GET https://registry.npmjs.org/source-map/-/source-map-0.4.2.tgz | |
| 85756 http 304 https://registry.npmjs.org/user-home | |
| 85757 silly registry.get cb [ 304, | |
| 85757 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 85757 silly registry.get etag: '"A2O9GA2AL0HW3K925MP10O2OB"', | |
| 85757 silly registry.get 'cache-control': 'max-age=60', | |
| 85757 silly registry.get 'accept-ranges': 'bytes', | |
| 85757 silly registry.get date: 'Mon, 20 Apr 2015 19:12:03 GMT', | |
| 85757 silly registry.get via: '1.1 varnish', | |
| 85757 silly registry.get connection: 'keep-alive', | |
| 85757 silly registry.get 'x-served-by': 'cache-ord1732-ORD', | |
| 85757 silly registry.get 'x-cache': 'MISS', | |
| 85757 silly registry.get 'x-cache-hits': '0', | |
| 85757 silly registry.get 'x-timer': 'S1429557123.828417,VS0,VE39' } ] | |
| 85758 verbose etag user-home from cache | |
| 85759 info retry fetch attempt 1 at 14:11:37 | |
| 85760 verbose fetch to= C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097529-0.28276859945617616\tmp.tgz | |
| 85761 http 200 https://registry.npmjs.org/estraverse/-/estraverse-3.1.0.tgz | |
| 85762 http GET https://registry.npmjs.org/source-map-support/-/source-map-support-0.2.10.tgz | |
| 85763 verbose tar unpack C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097009-0.08639553817920387\tmp.tgz | |
| 85764 silly lockFile e431376d-7009-0-08639553817920387-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097009-0.08639553817920387\package | |
| 85765 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097009-0.08639553817920387\package C:\Users\Vince\AppData\Roaming\npm-cache\e431376d-7009-0-08639553817920387-package.lock | |
| 85766 silly lockFile eefcfe2e-7009-0-08639553817920387-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097009-0.08639553817920387\tmp.tgz | |
| 85767 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097009-0.08639553817920387\tmp.tgz C:\Users\Vince\AppData\Roaming\npm-cache\eefcfe2e-7009-0-08639553817920387-tmp-tgz.lock | |
| 85768 silly addNameRange number 2 { name: 'to-fast-properties', range: '*', hasData: true } | |
| 85769 silly addNameRange versions [ 'to-fast-properties', [ '1.0.0', '1.0.1' ] ] | |
| 85770 verbose addNamed [ 'to-fast-properties', '1.0.1' ] | |
| 85771 verbose addNamed [ '1.0.1', '1.0.1' ] | |
| 85772 silly lockFile e77e0341-to-fast-properties-1-0-1 to-fast-properties@1.0.1 | |
| 85773 verbose lock to-fast-properties@1.0.1 C:\Users\Vince\AppData\Roaming\npm-cache\e77e0341-to-fast-properties-1-0-1.lock | |
| 85774 verbose tar unpack C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097013-0.11878230073489249\tmp.tgz | |
| 85775 silly lockFile ad64ea8b-7013-0-11878230073489249-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097013-0.11878230073489249\package | |
| 85776 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097013-0.11878230073489249\package C:\Users\Vince\AppData\Roaming\npm-cache\ad64ea8b-7013-0-11878230073489249-package.lock | |
| 85777 silly lockFile abeeeb27-7013-0-11878230073489249-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097013-0.11878230073489249\tmp.tgz | |
| 85778 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097013-0.11878230073489249\tmp.tgz C:\Users\Vince\AppData\Roaming\npm-cache\abeeeb27-7013-0-11878230073489249-tmp-tgz.lock | |
| 85779 silly addNameRange number 2 { name: 'trim-right', range: '*', hasData: true } | |
| 85780 silly addNameRange versions [ 'trim-right', [ '1.0.0' ] ] | |
| 85781 verbose addNamed [ 'trim-right', '1.0.0' ] | |
| 85782 verbose addNamed [ '1.0.0', '1.0.0' ] | |
| 85783 silly lockFile 19e4293a-trim-right-1-0-0 trim-right@1.0.0 | |
| 85784 verbose lock trim-right@1.0.0 C:\Users\Vince\AppData\Roaming\npm-cache\19e4293a-trim-right-1-0-0.lock | |
| 85785 silly gunzTarPerm modes [ '755', '644' ] | |
| 85786 silly addNameRange number 2 { name: 'user-home', range: '*', hasData: true } | |
| 85787 silly addNameRange versions [ 'user-home', [ '1.0.0', '1.1.0', '1.1.1' ] ] | |
| 85788 verbose addNamed [ 'user-home', '1.1.1' ] | |
| 85789 verbose addNamed [ '1.1.1', '1.1.1' ] | |
| 85790 silly lockFile 8f7ecde5-user-home-1-1-1 user-home@1.1.1 | |
| 85791 verbose lock user-home@1.1.1 C:\Users\Vince\AppData\Roaming\npm-cache\8f7ecde5-user-home-1-1-1.lock | |
| 85792 silly gunzTarPerm modes [ '755', '644' ] | |
| 85793 silly lockFile 19e4293a-trim-right-1-0-0 trim-right@1.0.0 | |
| 85794 silly lockFile 19e4293a-trim-right-1-0-0 trim-right@1.0.0 | |
| 85795 silly lockFile 67cf9c71-ies-to-fast-properties-1-0-1-tgz https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-1.0.1.tgz | |
| 85796 verbose lock https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-1.0.1.tgz C:\Users\Vince\AppData\Roaming\npm-cache\67cf9c71-ies-to-fast-properties-1-0-1-tgz.lock | |
| 85797 silly lockFile 8f7ecde5-user-home-1-1-1 user-home@1.1.1 | |
| 85798 silly lockFile 8f7ecde5-user-home-1-1-1 user-home@1.1.1 | |
| 85799 silly lockFile 8a1ace6d-trim-right-1-0-0 trim-right@^1.0.0 | |
| 85800 silly lockFile 8a1ace6d-trim-right-1-0-0 trim-right@^1.0.0 | |
| 85801 verbose addRemoteTarball [ 'https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-1.0.1.tgz', | |
| 85801 verbose addRemoteTarball '4a41554d2b2f4bbe2d794060dc47396b10bb48a8' ] | |
| 85802 silly lockFile d8d27d25-user-home-1-1-1 user-home@^1.1.1 | |
| 85803 silly lockFile d8d27d25-user-home-1-1-1 user-home@^1.1.1 | |
| 85804 info retry fetch attempt 1 at 14:11:37 | |
| 85805 verbose fetch to= C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097613-0.06393451918847859\tmp.tgz | |
| 85806 silly gunzTarPerm extractEntry package.json | |
| 85807 silly gunzTarPerm modified mode [ 'package.json', 436, 420 ] | |
| 85808 silly gunzTarPerm extractEntry package.json | |
| 85809 http GET https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-1.0.1.tgz | |
| 85810 silly gunzTarPerm extractEntry .npmignore | |
| 85811 silly gunzTarPerm modified mode [ '.npmignore', 384, 420 ] | |
| 85812 silly gunzTarPerm extractEntry LICENSE | |
| 85813 silly gunzTarPerm modified mode [ 'LICENSE', 436, 420 ] | |
| 85814 silly gunzTarPerm extractEntry README.md | |
| 85815 silly gunzTarPerm extractEntry estraverse.js | |
| 85816 silly lockFile b2b6163c-ache-detect-indent-3-0-1-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\detect-indent\3.0.1\package | |
| 85817 silly lockFile b2b6163c-ache-detect-indent-3-0-1-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\detect-indent\3.0.1\package | |
| 85818 silly lockFile 94040487--detect-indent-3-0-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\detect-indent\3.0.1\package.tgz | |
| 85819 silly lockFile 94040487--detect-indent-3-0-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\detect-indent\3.0.1\package.tgz | |
| 85820 silly gunzTarPerm extractEntry generate-index.js | |
| 85821 silly gunzTarPerm modified mode [ 'generate-index.js', 436, 420 ] | |
| 85822 silly gunzTarPerm extractEntry index.js | |
| 85823 silly gunzTarPerm modified mode [ 'index.js', 436, 420 ] | |
| 85824 verbose chmod C:\Users\Vince\AppData\Roaming\npm-cache\detect-indent\3.0.1\package.tgz 644 | |
| 85825 silly chown skipping for windows C:\Users\Vince\AppData\Roaming\npm-cache\detect-indent\3.0.1\package.tgz | |
| 85826 silly lockFile cd0e6bea-t-indent-detect-indent-3-0-1-tgz https://registry.npmjs.org/detect-indent/-/detect-indent-3.0.1.tgz | |
| 85827 silly lockFile cd0e6bea-t-indent-detect-indent-3-0-1-tgz https://registry.npmjs.org/detect-indent/-/detect-indent-3.0.1.tgz | |
| 85828 silly gunzTarPerm extractEntry gulpfile.js | |
| 85829 silly lockFile 4db7d457-detect-indent-3-0-1 detect-indent@3.0.1 | |
| 85830 silly lockFile 4db7d457-detect-indent-3-0-1 detect-indent@3.0.1 | |
| 85831 silly lockFile cfe08b67-detect-indent-3-0-0 detect-indent@^3.0.0 | |
| 85832 silly lockFile cfe08b67-detect-indent-3-0-0 detect-indent@^3.0.0 | |
| 85833 silly gunzTarPerm extractEntry .travis.yml | |
| 85834 silly gunzTarPerm modified mode [ '.travis.yml', 384, 420 ] | |
| 85835 silly gunzTarPerm extractEntry changelog.md | |
| 85836 silly gunzTarPerm modified mode [ 'changelog.md', 436, 420 ] | |
| 85837 silly gunzTarPerm extractEntry readme.md | |
| 85838 silly gunzTarPerm modified mode [ 'readme.md', 436, 420 ] | |
| 85839 silly gunzTarPerm extractEntry regex.coffee | |
| 85840 silly gunzTarPerm modified mode [ 'regex.coffee', 436, 420 ] | |
| 85841 silly gunzTarPerm extractEntry test/index.js | |
| 85842 silly gunzTarPerm modified mode [ 'test/index.js', 436, 420 ] | |
| 85843 silly gunzTarPerm extractEntry test/fixtures/base64.js | |
| 85844 silly gunzTarPerm modified mode [ 'test/fixtures/base64.js', 436, 420 ] | |
| 85845 silly gunzTarPerm extractEntry test/fixtures/division.js | |
| 85846 silly gunzTarPerm modified mode [ 'test/fixtures/division.js', 436, 420 ] | |
| 85847 silly gunzTarPerm extractEntry test/fixtures/errors.js | |
| 85848 silly gunzTarPerm modified mode [ 'test/fixtures/errors.js', 436, 420 ] | |
| 85849 silly gunzTarPerm extractEntry test/fixtures/regex.js | |
| 85850 silly gunzTarPerm modified mode [ 'test/fixtures/regex.js', 436, 420 ] | |
| 85851 silly gunzTarPerm extractEntry test/fixtures/base64.json | |
| 85852 silly gunzTarPerm modified mode [ 'test/fixtures/base64.json', 436, 420 ] | |
| 85853 silly gunzTarPerm extractEntry test/fixtures/division.json | |
| 85854 silly gunzTarPerm modified mode [ 'test/fixtures/division.json', 436, 420 ] | |
| 85855 silly gunzTarPerm extractEntry test/fixtures/errors.json | |
| 85856 silly gunzTarPerm modified mode [ 'test/fixtures/errors.json', 436, 420 ] | |
| 85857 silly gunzTarPerm extractEntry test/fixtures/regex.json | |
| 85858 silly gunzTarPerm modified mode [ 'test/fixtures/regex.json', 436, 420 ] | |
| 85859 silly gunzTarPerm extractEntry .jshintrc | |
| 85860 silly gunzTarPerm extractEntry LICENSE.BSD | |
| 85861 http 200 https://registry.npmjs.org/regexpu/-/regexpu-1.1.2.tgz | |
| 85862 http 200 https://registry.npmjs.org/private/-/private-0.1.6.tgz | |
| 85863 verbose tar unpack C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097361-0.5838439704384655\tmp.tgz | |
| 85864 silly lockFile 340faf5a-97361-0-5838439704384655-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097361-0.5838439704384655\package | |
| 85865 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097361-0.5838439704384655\package C:\Users\Vince\AppData\Roaming\npm-cache\340faf5a-97361-0-5838439704384655-package.lock | |
| 85866 silly lockFile 04f1536e-97361-0-5838439704384655-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097361-0.5838439704384655\tmp.tgz | |
| 85867 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097361-0.5838439704384655\tmp.tgz C:\Users\Vince\AppData\Roaming\npm-cache\04f1536e-97361-0-5838439704384655-tmp-tgz.lock | |
| 85868 silly gunzTarPerm modes [ '755', '644' ] | |
| 85869 silly gunzTarPerm extractEntry package.json | |
| 85870 silly gunzTarPerm extractEntry README.md | |
| 85871 silly gunzTarPerm extractEntry LICENSE | |
| 85872 http 200 https://registry.npmjs.org/line-numbers/-/line-numbers-0.2.0.tgz | |
| 85873 http 200 https://registry.npmjs.org/source-map/-/source-map-0.4.2.tgz | |
| 85874 verbose tar unpack C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.6178647016640753\tmp.tgz | |
| 85875 silly lockFile f4c1718a-97376-0-6178647016640753-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.6178647016640753\package | |
| 85876 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.6178647016640753\package C:\Users\Vince\AppData\Roaming\npm-cache\f4c1718a-97376-0-6178647016640753-package.lock | |
| 85877 silly lockFile a8db10ab-97376-0-6178647016640753-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.6178647016640753\tmp.tgz | |
| 85878 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.6178647016640753\tmp.tgz C:\Users\Vince\AppData\Roaming\npm-cache\a8db10ab-97376-0-6178647016640753-tmp-tgz.lock | |
| 85879 silly gunzTarPerm modes [ '755', '644' ] | |
| 85880 verbose tar unpack C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097213-0.42129150265827775\tmp.tgz | |
| 85881 silly lockFile 42d9cc94-7213-0-42129150265827775-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097213-0.42129150265827775\package | |
| 85882 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097213-0.42129150265827775\package C:\Users\Vince\AppData\Roaming\npm-cache\42d9cc94-7213-0-42129150265827775-package.lock | |
| 85883 silly lockFile 702a12d8-7213-0-42129150265827775-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097213-0.42129150265827775\tmp.tgz | |
| 85884 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097213-0.42129150265827775\tmp.tgz C:\Users\Vince\AppData\Roaming\npm-cache\702a12d8-7213-0-42129150265827775-tmp-tgz.lock | |
| 85885 silly gunzTarPerm extractEntry private.js | |
| 85886 silly gunzTarPerm extractEntry .travis.yml | |
| 85887 silly gunzTarPerm extractEntry test/run.js | |
| 85888 silly gunzTarPerm modes [ '755', '644' ] | |
| 85889 silly lockFile ad64ea8b-7013-0-11878230073489249-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097013-0.11878230073489249\package | |
| 85890 silly lockFile ad64ea8b-7013-0-11878230073489249-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097013-0.11878230073489249\package | |
| 85891 silly gunzTarPerm extractEntry package.json | |
| 85892 silly lockFile abeeeb27-7013-0-11878230073489249-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097013-0.11878230073489249\tmp.tgz | |
| 85893 silly lockFile abeeeb27-7013-0-11878230073489249-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097013-0.11878230073489249\tmp.tgz | |
| 85894 silly gunzTarPerm extractEntry package.json | |
| 85895 silly gunzTarPerm modified mode [ 'package.json', 436, 420 ] | |
| 85896 silly gunzTarPerm extractEntry README.md | |
| 85897 silly gunzTarPerm extractEntry transpile-code.js | |
| 85898 verbose tar pack [ 'C:\\Users\\Vince\\AppData\\Roaming\\npm-cache\\estraverse\\3.1.0\\package.tgz', | |
| 85898 verbose tar pack 'C:\\Users\\Vince\\AppData\\Local\\Temp\\npm-11116\\1429557097013-0.11878230073489249\\package' ] | |
| 85899 verbose tarball C:\Users\Vince\AppData\Roaming\npm-cache\estraverse\3.1.0\package.tgz | |
| 85900 verbose folder C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097013-0.11878230073489249\package | |
| 85901 silly lockFile ad64ea8b-7013-0-11878230073489249-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097013-0.11878230073489249\package | |
| 85902 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097013-0.11878230073489249\package C:\Users\Vince\AppData\Roaming\npm-cache\ad64ea8b-7013-0-11878230073489249-package.lock | |
| 85903 silly lockFile 97ff7ad1-che-estraverse-3-1-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\estraverse\3.1.0\package.tgz | |
| 85904 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\estraverse\3.1.0\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\97ff7ad1-che-estraverse-3-1-0-package-tgz.lock | |
| 85905 silly gunzTarPerm extractEntry .npmignore | |
| 85906 silly gunzTarPerm modified mode [ '.npmignore', 384, 420 ] | |
| 85907 silly gunzTarPerm extractEntry LICENSE | |
| 85908 silly gunzTarPerm modified mode [ 'LICENSE', 436, 420 ] | |
| 85909 silly gunzTarPerm extractEntry index.js | |
| 85910 silly gunzTarPerm modified mode [ 'index.js', 436, 420 ] | |
| 85911 silly gunzTarPerm extractEntry changelog.md | |
| 85912 silly gunzTarPerm modified mode [ 'changelog.md', 436, 420 ] | |
| 85913 silly gunzTarPerm extractEntry regexpu.js | |
| 85914 silly gunzTarPerm extractEntry .travis.yml | |
| 85915 silly gunzTarPerm modified mode [ '.travis.yml', 384, 420 ] | |
| 85916 silly gunzTarPerm extractEntry readme.md | |
| 85917 silly gunzTarPerm modified mode [ 'readme.md', 436, 420 ] | |
| 85918 silly gunzTarPerm extractEntry test/index.js | |
| 85919 silly gunzTarPerm modified mode [ 'test/index.js', 436, 420 ] | |
| 85920 http 200 https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-1.0.1.tgz | |
| 85921 silly gunzTarPerm extractEntry rewrite-pattern.js | |
| 85922 silly gunzTarPerm extractEntry transform-tree.js | |
| 85923 http 200 https://registry.npmjs.org/regenerator/-/regenerator-0.8.22.tgz | |
| 85924 verbose tar unpack C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097613-0.06393451918847859\tmp.tgz | |
| 85925 silly lockFile 67a6329e-7613-0-06393451918847859-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097613-0.06393451918847859\package | |
| 85926 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097613-0.06393451918847859\package C:\Users\Vince\AppData\Roaming\npm-cache\67a6329e-7613-0-06393451918847859-package.lock | |
| 85927 silly lockFile bc5c62ee-7613-0-06393451918847859-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097613-0.06393451918847859\tmp.tgz | |
| 85928 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097613-0.06393451918847859\tmp.tgz C:\Users\Vince\AppData\Roaming\npm-cache\bc5c62ee-7613-0-06393451918847859-tmp-tgz.lock | |
| 85929 silly gunzTarPerm modes [ '755', '644' ] | |
| 85930 silly gunzTarPerm extractEntry data/character-class-escape-sets.js | |
| 85931 silly gunzTarPerm extractEntry data/iu-mappings.json | |
| 85932 silly gunzTarPerm extractEntry package.json | |
| 85933 http 200 https://registry.npmjs.org/source-map-support/-/source-map-support-0.2.10.tgz | |
| 85934 silly gunzTarPerm extractEntry index.js | |
| 85935 silly gunzTarPerm extractEntry license | |
| 85936 silly gunzTarPerm extractEntry LICENSE-MIT.txt | |
| 85937 silly gunzTarPerm extractEntry bin/regexpu | |
| 85938 silly gunzTarPerm extractEntry readme.md | |
| 85939 silly gunzTarPerm extractEntry man/regexpu.1 | |
| 85940 silly lockFile 340faf5a-97361-0-5838439704384655-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097361-0.5838439704384655\package | |
| 85941 silly lockFile 340faf5a-97361-0-5838439704384655-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097361-0.5838439704384655\package | |
| 85942 silly lockFile 04f1536e-97361-0-5838439704384655-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097361-0.5838439704384655\tmp.tgz | |
| 85943 silly lockFile 04f1536e-97361-0-5838439704384655-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097361-0.5838439704384655\tmp.tgz | |
| 85944 verbose tar pack [ 'C:\\Users\\Vince\\AppData\\Roaming\\npm-cache\\private\\0.1.6\\package.tgz', | |
| 85944 verbose tar pack 'C:\\Users\\Vince\\AppData\\Local\\Temp\\npm-11116\\1429557097361-0.5838439704384655\\package' ] | |
| 85945 verbose tarball C:\Users\Vince\AppData\Roaming\npm-cache\private\0.1.6\package.tgz | |
| 85946 verbose folder C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097361-0.5838439704384655\package | |
| 85947 silly lockFile 340faf5a-97361-0-5838439704384655-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097361-0.5838439704384655\package | |
| 85948 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097361-0.5838439704384655\package C:\Users\Vince\AppData\Roaming\npm-cache\340faf5a-97361-0-5838439704384655-package.lock | |
| 85949 silly lockFile ecd3127e--cache-private-0-1-6-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\private\0.1.6\package.tgz | |
| 85950 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\private\0.1.6\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\ecd3127e--cache-private-0-1-6-package-tgz.lock | |
| 85951 silly lockFile ad64ea8b-7013-0-11878230073489249-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097013-0.11878230073489249\package | |
| 85952 silly lockFile ad64ea8b-7013-0-11878230073489249-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097013-0.11878230073489249\package | |
| 85953 silly lockFile 97ff7ad1-che-estraverse-3-1-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\estraverse\3.1.0\package.tgz | |
| 85954 silly lockFile 97ff7ad1-che-estraverse-3-1-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\estraverse\3.1.0\package.tgz | |
| 85955 silly lockFile 7feabd47-m-cache-estraverse-3-1-0-package C:\Users\Vince\AppData\Roaming\npm-cache\estraverse\3.1.0\package | |
| 85956 verbose lock C:\Users\Vince\AppData\Roaming\npm-cache\estraverse\3.1.0\package C:\Users\Vince\AppData\Roaming\npm-cache\7feabd47-m-cache-estraverse-3-1-0-package.lock | |
| 85957 silly lockFile 42d9cc94-7213-0-42129150265827775-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097213-0.42129150265827775\package | |
| 85958 silly lockFile 42d9cc94-7213-0-42129150265827775-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097213-0.42129150265827775\package | |
| 85959 silly lockFile 702a12d8-7213-0-42129150265827775-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097213-0.42129150265827775\tmp.tgz | |
| 85960 silly lockFile 702a12d8-7213-0-42129150265827775-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097213-0.42129150265827775\tmp.tgz | |
| 85961 silly lockFile 7feabd47-m-cache-estraverse-3-1-0-package C:\Users\Vince\AppData\Roaming\npm-cache\estraverse\3.1.0\package | |
| 85962 silly lockFile 7feabd47-m-cache-estraverse-3-1-0-package C:\Users\Vince\AppData\Roaming\npm-cache\estraverse\3.1.0\package | |
| 85963 verbose tar pack [ 'C:\\Users\\Vince\\AppData\\Roaming\\npm-cache\\line-numbers\\0.2.0\\package.tgz', | |
| 85963 verbose tar pack 'C:\\Users\\Vince\\AppData\\Local\\Temp\\npm-11116\\1429557097213-0.42129150265827775\\package' ] | |
| 85964 verbose tarball C:\Users\Vince\AppData\Roaming\npm-cache\line-numbers\0.2.0\package.tgz | |
| 85965 verbose folder C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097213-0.42129150265827775\package | |
| 85966 silly lockFile 42d9cc94-7213-0-42129150265827775-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097213-0.42129150265827775\package | |
| 85967 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097213-0.42129150265827775\package C:\Users\Vince\AppData\Roaming\npm-cache\42d9cc94-7213-0-42129150265827775-package.lock | |
| 85968 silly lockFile 93892149-e-line-numbers-0-2-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\line-numbers\0.2.0\package.tgz | |
| 85969 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\line-numbers\0.2.0\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\93892149-e-line-numbers-0-2-0-package-tgz.lock | |
| 85970 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\estraverse\3.1.0\package.tgz | |
| 85971 silly lockFile 15ec83f5-m-cache-estraverse-3-1-0-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\estraverse\3.1.0\package | |
| 85972 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\estraverse\3.1.0\package C:\Users\Vince\AppData\Roaming\npm-cache\15ec83f5-m-cache-estraverse-3-1-0-package.lock | |
| 85973 silly lockFile 97ff7ad1-che-estraverse-3-1-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\estraverse\3.1.0\package.tgz | |
| 85974 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\estraverse\3.1.0\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\97ff7ad1-che-estraverse-3-1-0-package-tgz.lock | |
| 85975 silly lockFile 67a6329e-7613-0-06393451918847859-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097613-0.06393451918847859\package | |
| 85976 silly lockFile 67a6329e-7613-0-06393451918847859-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097613-0.06393451918847859\package | |
| 85977 silly gunzTarPerm modes [ '755', '644' ] | |
| 85978 silly lockFile bc5c62ee-7613-0-06393451918847859-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097613-0.06393451918847859\tmp.tgz | |
| 85979 silly lockFile bc5c62ee-7613-0-06393451918847859-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097613-0.06393451918847859\tmp.tgz | |
| 85980 verbose tar pack [ 'C:\\Users\\Vince\\AppData\\Roaming\\npm-cache\\to-fast-properties\\1.0.1\\package.tgz', | |
| 85980 verbose tar pack 'C:\\Users\\Vince\\AppData\\Local\\Temp\\npm-11116\\1429557097613-0.06393451918847859\\package' ] | |
| 85981 verbose tarball C:\Users\Vince\AppData\Roaming\npm-cache\to-fast-properties\1.0.1\package.tgz | |
| 85982 verbose folder C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097613-0.06393451918847859\package | |
| 85983 silly lockFile 67a6329e-7613-0-06393451918847859-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097613-0.06393451918847859\package | |
| 85984 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097613-0.06393451918847859\package C:\Users\Vince\AppData\Roaming\npm-cache\67a6329e-7613-0-06393451918847859-package.lock | |
| 85985 silly lockFile 8de6028c-ast-properties-1-0-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\to-fast-properties\1.0.1\package.tgz | |
| 85986 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\to-fast-properties\1.0.1\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\8de6028c-ast-properties-1-0-1-package-tgz.lock | |
| 85987 silly gunzTarPerm extractEntry package.json | |
| 85988 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 85989 verbose tar unpack C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.696940659545362\tmp.tgz | |
| 85990 silly lockFile 91a9a374-097376-0-696940659545362-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.696940659545362\package | |
| 85991 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.696940659545362\package C:\Users\Vince\AppData\Roaming\npm-cache\91a9a374-097376-0-696940659545362-package.lock | |
| 85992 silly lockFile d2b6598d-097376-0-696940659545362-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.696940659545362\tmp.tgz | |
| 85993 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.696940659545362\tmp.tgz C:\Users\Vince\AppData\Roaming\npm-cache\d2b6598d-097376-0-696940659545362-tmp-tgz.lock | |
| 85994 silly gunzTarPerm modes [ '755', '644' ] | |
| 85995 silly gunzTarPerm extractEntry README.md | |
| 85996 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 85997 silly gunzTarPerm extractEntry estraverse.js | |
| 85998 silly gunzTarPerm modified mode [ 'estraverse.js', 438, 420 ] | |
| 85999 silly gunzTarPerm extractEntry package.json | |
| 86000 verbose tar unpack C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097509-0.2024305632803589\tmp.tgz | |
| 86001 silly lockFile f1bab7f3-97509-0-2024305632803589-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097509-0.2024305632803589\package | |
| 86002 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097509-0.2024305632803589\package C:\Users\Vince\AppData\Roaming\npm-cache\f1bab7f3-97509-0-2024305632803589-package.lock | |
| 86003 silly lockFile 95b0dd1f-97509-0-2024305632803589-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097509-0.2024305632803589\tmp.tgz | |
| 86004 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097509-0.2024305632803589\tmp.tgz C:\Users\Vince\AppData\Roaming\npm-cache\95b0dd1f-97509-0-2024305632803589-tmp-tgz.lock | |
| 86005 silly gunzTarPerm extractEntry .npmignore | |
| 86006 silly gunzTarPerm extractEntry README.md | |
| 86007 silly gunzTarPerm extractEntry gulpfile.js | |
| 86008 silly gunzTarPerm modified mode [ 'gulpfile.js', 438, 420 ] | |
| 86009 silly gunzTarPerm modes [ '755', '644' ] | |
| 86010 verbose tar unpack C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097529-0.28276859945617616\tmp.tgz | |
| 86011 silly lockFile d4951282-7529-0-28276859945617616-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097529-0.28276859945617616\package | |
| 86012 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097529-0.28276859945617616\package C:\Users\Vince\AppData\Roaming\npm-cache\d4951282-7529-0-28276859945617616-package.lock | |
| 86013 silly lockFile 606cd54d-7529-0-28276859945617616-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097529-0.28276859945617616\tmp.tgz | |
| 86014 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097529-0.28276859945617616\tmp.tgz C:\Users\Vince\AppData\Roaming\npm-cache\606cd54d-7529-0-28276859945617616-tmp-tgz.lock | |
| 86015 silly gunzTarPerm modes [ '755', '644' ] | |
| 86016 silly gunzTarPerm extractEntry package.json | |
| 86017 silly gunzTarPerm extractEntry LICENSE | |
| 86018 silly gunzTarPerm extractEntry runtime-module.js | |
| 86019 silly gunzTarPerm extractEntry package.json | |
| 86020 silly gunzTarPerm extractEntry .npmignore | |
| 86021 silly gunzTarPerm extractEntry README.md | |
| 86022 silly lockFile 340faf5a-97361-0-5838439704384655-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097361-0.5838439704384655\package | |
| 86023 silly lockFile 340faf5a-97361-0-5838439704384655-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097361-0.5838439704384655\package | |
| 86024 silly gunzTarPerm extractEntry .npmignore | |
| 86025 silly gunzTarPerm extractEntry README.md | |
| 86026 silly lockFile 67a6329e-7613-0-06393451918847859-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097613-0.06393451918847859\package | |
| 86027 silly lockFile 67a6329e-7613-0-06393451918847859-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097613-0.06393451918847859\package | |
| 86028 silly gunzTarPerm extractEntry .jshintrc | |
| 86029 silly gunzTarPerm modified mode [ '.jshintrc', 438, 420 ] | |
| 86030 silly gunzTarPerm extractEntry LICENSE.BSD | |
| 86031 silly gunzTarPerm modified mode [ 'LICENSE.BSD', 438, 420 ] | |
| 86032 silly lockFile ecd3127e--cache-private-0-1-6-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\private\0.1.6\package.tgz | |
| 86033 silly lockFile ecd3127e--cache-private-0-1-6-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\private\0.1.6\package.tgz | |
| 86034 silly lockFile 8de6028c-ast-properties-1-0-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\to-fast-properties\1.0.1\package.tgz | |
| 86035 silly lockFile 8de6028c-ast-properties-1-0-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\to-fast-properties\1.0.1\package.tgz | |
| 86036 silly gunzTarPerm extractEntry main.js | |
| 86037 silly gunzTarPerm extractEntry runtime.js | |
| 86038 silly lockFile 6901896b--npm-cache-private-0-1-6-package C:\Users\Vince\AppData\Roaming\npm-cache\private\0.1.6\package | |
| 86039 verbose lock C:\Users\Vince\AppData\Roaming\npm-cache\private\0.1.6\package C:\Users\Vince\AppData\Roaming\npm-cache\6901896b--npm-cache-private-0-1-6-package.lock | |
| 86040 silly lockFile e431376d-7009-0-08639553817920387-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097009-0.08639553817920387\package | |
| 86041 silly lockFile e431376d-7009-0-08639553817920387-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097009-0.08639553817920387\package | |
| 86042 silly lockFile d77a3f9f-to-fast-properties-1-0-1-package C:\Users\Vince\AppData\Roaming\npm-cache\to-fast-properties\1.0.1\package | |
| 86043 verbose lock C:\Users\Vince\AppData\Roaming\npm-cache\to-fast-properties\1.0.1\package C:\Users\Vince\AppData\Roaming\npm-cache\d77a3f9f-to-fast-properties-1-0-1-package.lock | |
| 86044 silly lockFile eefcfe2e-7009-0-08639553817920387-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097009-0.08639553817920387\tmp.tgz | |
| 86045 silly lockFile eefcfe2e-7009-0-08639553817920387-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097009-0.08639553817920387\tmp.tgz | |
| 86046 silly gunzTarPerm extractEntry LICENSE | |
| 86047 silly gunzTarPerm extractEntry test.js | |
| 86048 silly gunzTarPerm extractEntry browser-source-map-support.js | |
| 86049 silly gunzTarPerm extractEntry build.js | |
| 86050 silly gunzTarPerm extractEntry source-map-support.js | |
| 86051 silly gunzTarPerm extractEntry amd-test/browser-source-map-support.js | |
| 86052 silly gunzTarPerm extractEntry amd-test/require.js | |
| 86053 silly gunzTarPerm extractEntry amd-test/script.js | |
| 86054 silly gunzTarPerm extractEntry amd-test/index.html | |
| 86055 silly gunzTarPerm extractEntry amd-test/script.coffee | |
| 86056 silly gunzTarPerm extractEntry amd-test/script.map | |
| 86057 silly gunzTarPerm extractEntry header-test/script.js | |
| 86058 silly gunzTarPerm extractEntry header-test/server.js | |
| 86059 silly gunzTarPerm extractEntry header-test/index.html | |
| 86060 silly gunzTarPerm extractEntry header-test/script.coffee | |
| 86061 silly gunzTarPerm extractEntry header-test/script.map | |
| 86062 silly gunzTarPerm extractEntry LICENSE.md | |
| 86063 silly gunzTarPerm extractEntry browser-test/script.js | |
| 86064 silly gunzTarPerm extractEntry browser-test/index.html | |
| 86065 silly gunzTarPerm extractEntry browser-test/script.coffee | |
| 86066 silly gunzTarPerm extractEntry browser-test/script.map | |
| 86067 verbose tar pack [ 'C:\\Users\\Vince\\AppData\\Roaming\\npm-cache\\js-tokens\\1.0.0\\package.tgz', | |
| 86067 verbose tar pack 'C:\\Users\\Vince\\AppData\\Local\\Temp\\npm-11116\\1429557097009-0.08639553817920387\\package' ] | |
| 86068 verbose tarball C:\Users\Vince\AppData\Roaming\npm-cache\js-tokens\1.0.0\package.tgz | |
| 86069 verbose folder C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097009-0.08639553817920387\package | |
| 86070 silly lockFile e431376d-7009-0-08639553817920387-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097009-0.08639553817920387\package | |
| 86071 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097009-0.08639553817920387\package C:\Users\Vince\AppData\Roaming\npm-cache\e431376d-7009-0-08639553817920387-package.lock | |
| 86072 silly lockFile 8cdaa6a5-ache-js-tokens-1-0-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\js-tokens\1.0.0\package.tgz | |
| 86073 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\js-tokens\1.0.0\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\8cdaa6a5-ache-js-tokens-1-0-0-package-tgz.lock | |
| 86074 silly lockFile d77a3f9f-to-fast-properties-1-0-1-package C:\Users\Vince\AppData\Roaming\npm-cache\to-fast-properties\1.0.1\package | |
| 86075 silly lockFile d77a3f9f-to-fast-properties-1-0-1-package C:\Users\Vince\AppData\Roaming\npm-cache\to-fast-properties\1.0.1\package | |
| 86076 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\to-fast-properties\1.0.1\package.tgz | |
| 86077 silly lockFile 90d12438-to-fast-properties-1-0-1-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\to-fast-properties\1.0.1\package | |
| 86078 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\to-fast-properties\1.0.1\package C:\Users\Vince\AppData\Roaming\npm-cache\90d12438-to-fast-properties-1-0-1-package.lock | |
| 86079 silly lockFile 8de6028c-ast-properties-1-0-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\to-fast-properties\1.0.1\package.tgz | |
| 86080 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\to-fast-properties\1.0.1\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\8de6028c-ast-properties-1-0-1-package-tgz.lock | |
| 86081 silly lockFile 6901896b--npm-cache-private-0-1-6-package C:\Users\Vince\AppData\Roaming\npm-cache\private\0.1.6\package | |
| 86082 silly lockFile 6901896b--npm-cache-private-0-1-6-package C:\Users\Vince\AppData\Roaming\npm-cache\private\0.1.6\package | |
| 86083 silly gunzTarPerm modes [ '755', '644' ] | |
| 86084 silly gunzTarPerm extractEntry Makefile.dryice.js | |
| 86085 silly gunzTarPerm extractEntry CHANGELOG.md | |
| 86086 silly gunzTarPerm extractEntry lib/emit.js | |
| 86087 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\private\0.1.6\package.tgz | |
| 86088 silly lockFile 01027dba--npm-cache-private-0-1-6-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\private\0.1.6\package | |
| 86089 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\private\0.1.6\package C:\Users\Vince\AppData\Roaming\npm-cache\01027dba--npm-cache-private-0-1-6-package.lock | |
| 86090 silly lockFile ecd3127e--cache-private-0-1-6-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\private\0.1.6\package.tgz | |
| 86091 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\private\0.1.6\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\ecd3127e--cache-private-0-1-6-package-tgz.lock | |
| 86092 silly gunzTarPerm modes [ '755', '644' ] | |
| 86093 silly gunzTarPerm extractEntry package.json | |
| 86094 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 86095 silly lockFile f4c1718a-97376-0-6178647016640753-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.6178647016640753\package | |
| 86096 silly lockFile f4c1718a-97376-0-6178647016640753-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.6178647016640753\package | |
| 86097 silly lockFile a8db10ab-97376-0-6178647016640753-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.6178647016640753\tmp.tgz | |
| 86098 silly lockFile a8db10ab-97376-0-6178647016640753-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.6178647016640753\tmp.tgz | |
| 86099 silly gunzTarPerm extractEntry index.js | |
| 86100 silly gunzTarPerm modified mode [ 'index.js', 438, 420 ] | |
| 86101 silly gunzTarPerm extractEntry readme.md | |
| 86102 silly gunzTarPerm modified mode [ 'readme.md', 438, 420 ] | |
| 86103 silly gunzTarPerm extractEntry package.json | |
| 86104 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 86105 silly lockFile 42d9cc94-7213-0-42129150265827775-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097213-0.42129150265827775\package | |
| 86106 silly lockFile 42d9cc94-7213-0-42129150265827775-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097213-0.42129150265827775\package | |
| 86107 verbose tar pack [ 'C:\\Users\\Vince\\AppData\\Roaming\\npm-cache\\regexpu\\1.1.2\\package.tgz', | |
| 86107 verbose tar pack 'C:\\Users\\Vince\\AppData\\Local\\Temp\\npm-11116\\1429557097376-0.6178647016640753\\package' ] | |
| 86108 verbose tarball C:\Users\Vince\AppData\Roaming\npm-cache\regexpu\1.1.2\package.tgz | |
| 86109 verbose folder C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.6178647016640753\package | |
| 86110 silly lockFile f4c1718a-97376-0-6178647016640753-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.6178647016640753\package | |
| 86111 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.6178647016640753\package C:\Users\Vince\AppData\Roaming\npm-cache\f4c1718a-97376-0-6178647016640753-package.lock | |
| 86112 silly lockFile 4e025d0c--cache-regexpu-1-1-2-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\regexpu\1.1.2\package.tgz | |
| 86113 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\regexpu\1.1.2\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\4e025d0c--cache-regexpu-1-1-2-package-tgz.lock | |
| 86114 silly gunzTarPerm extractEntry lib/hoist.js | |
| 86115 silly gunzTarPerm extractEntry lib/leap.js | |
| 86116 silly lockFile 93892149-e-line-numbers-0-2-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\line-numbers\0.2.0\package.tgz | |
| 86117 silly lockFile 93892149-e-line-numbers-0-2-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\line-numbers\0.2.0\package.tgz | |
| 86118 silly gunzTarPerm extractEntry README.md | |
| 86119 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 86120 silly gunzTarPerm extractEntry LICENSE | |
| 86121 silly gunzTarPerm modified mode [ 'LICENSE', 438, 420 ] | |
| 86122 silly lockFile b275c8fd-cache-line-numbers-0-2-0-package C:\Users\Vince\AppData\Roaming\npm-cache\line-numbers\0.2.0\package | |
| 86123 verbose lock C:\Users\Vince\AppData\Roaming\npm-cache\line-numbers\0.2.0\package C:\Users\Vince\AppData\Roaming\npm-cache\b275c8fd-cache-line-numbers-0-2-0-package.lock | |
| 86124 silly gunzTarPerm extractEntry lib/meta.js | |
| 86125 silly gunzTarPerm extractEntry lib/util.js | |
| 86126 silly gunzTarPerm extractEntry private.js | |
| 86127 silly gunzTarPerm modified mode [ 'private.js', 438, 420 ] | |
| 86128 silly gunzTarPerm extractEntry .travis.yml | |
| 86129 silly gunzTarPerm modified mode [ '.travis.yml', 438, 420 ] | |
| 86130 silly gunzTarPerm extractEntry test/run.js | |
| 86131 silly gunzTarPerm modified mode [ 'test/run.js', 438, 420 ] | |
| 86132 silly lockFile b275c8fd-cache-line-numbers-0-2-0-package C:\Users\Vince\AppData\Roaming\npm-cache\line-numbers\0.2.0\package | |
| 86133 silly lockFile b275c8fd-cache-line-numbers-0-2-0-package C:\Users\Vince\AppData\Roaming\npm-cache\line-numbers\0.2.0\package | |
| 86134 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\line-numbers\0.2.0\package.tgz | |
| 86135 silly lockFile 31cee817-cache-line-numbers-0-2-0-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\line-numbers\0.2.0\package | |
| 86136 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\line-numbers\0.2.0\package C:\Users\Vince\AppData\Roaming\npm-cache\31cee817-cache-line-numbers-0-2-0-package.lock | |
| 86137 silly lockFile 93892149-e-line-numbers-0-2-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\line-numbers\0.2.0\package.tgz | |
| 86138 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\line-numbers\0.2.0\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\93892149-e-line-numbers-0-2-0-package-tgz.lock | |
| 86139 silly gunzTarPerm modes [ '755', '644' ] | |
| 86140 silly lockFile 90d12438-to-fast-properties-1-0-1-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\to-fast-properties\1.0.1\package | |
| 86141 silly lockFile 90d12438-to-fast-properties-1-0-1-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\to-fast-properties\1.0.1\package | |
| 86142 silly lockFile 8de6028c-ast-properties-1-0-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\to-fast-properties\1.0.1\package.tgz | |
| 86143 silly lockFile 8de6028c-ast-properties-1-0-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\to-fast-properties\1.0.1\package.tgz | |
| 86144 silly gunzTarPerm extractEntry lib/visit.js | |
| 86145 silly gunzTarPerm extractEntry .travis.yml | |
| 86146 silly gunzTarPerm extractEntry package.json | |
| 86147 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 86148 silly gunzTarPerm extractEntry .gitattributes | |
| 86149 silly gunzTarPerm extractEntry build/assert-shim.js | |
| 86150 verbose chmod C:\Users\Vince\AppData\Roaming\npm-cache\to-fast-properties\1.0.1\package.tgz 644 | |
| 86151 silly chown skipping for windows C:\Users\Vince\AppData\Roaming\npm-cache\to-fast-properties\1.0.1\package.tgz | |
| 86152 silly gunzTarPerm extractEntry .npmignore | |
| 86153 silly gunzTarPerm modified mode [ '.npmignore', 438, 420 ] | |
| 86154 silly gunzTarPerm extractEntry LICENSE | |
| 86155 silly gunzTarPerm modified mode [ 'LICENSE', 438, 420 ] | |
| 86156 silly lockFile 67cf9c71-ies-to-fast-properties-1-0-1-tgz https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-1.0.1.tgz | |
| 86157 silly lockFile 67cf9c71-ies-to-fast-properties-1-0-1-tgz https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-1.0.1.tgz | |
| 86158 silly lockFile e77e0341-to-fast-properties-1-0-1 to-fast-properties@1.0.1 | |
| 86159 silly lockFile e77e0341-to-fast-properties-1-0-1 to-fast-properties@1.0.1 | |
| 86160 silly lockFile 2e352511-to-fast-properties-1-0-0 to-fast-properties@^1.0.0 | |
| 86161 silly lockFile 2e352511-to-fast-properties-1-0-0 to-fast-properties@^1.0.0 | |
| 86162 silly gunzTarPerm extractEntry index.js | |
| 86163 silly gunzTarPerm modified mode [ 'index.js', 438, 420 ] | |
| 86164 silly gunzTarPerm extractEntry .travis.yml | |
| 86165 silly gunzTarPerm modified mode [ '.travis.yml', 438, 420 ] | |
| 86166 silly gunzTarPerm extractEntry build/mini-require.js | |
| 86167 silly gunzTarPerm extractEntry build/suffix-browser.js | |
| 86168 silly gunzTarPerm extractEntry changelog.md | |
| 86169 silly gunzTarPerm modified mode [ 'changelog.md', 438, 420 ] | |
| 86170 silly gunzTarPerm extractEntry readme.md | |
| 86171 silly gunzTarPerm modified mode [ 'readme.md', 438, 420 ] | |
| 86172 silly gunzTarPerm extractEntry build/test-prefix.js | |
| 86173 silly gunzTarPerm extractEntry build/test-suffix.js | |
| 86174 silly gunzTarPerm extractEntry test/index.js | |
| 86175 silly gunzTarPerm modified mode [ 'test/index.js', 438, 420 ] | |
| 86176 silly lockFile 15ec83f5-m-cache-estraverse-3-1-0-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\estraverse\3.1.0\package | |
| 86177 silly lockFile 15ec83f5-m-cache-estraverse-3-1-0-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\estraverse\3.1.0\package | |
| 86178 silly lockFile 97ff7ad1-che-estraverse-3-1-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\estraverse\3.1.0\package.tgz | |
| 86179 silly lockFile 97ff7ad1-che-estraverse-3-1-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\estraverse\3.1.0\package.tgz | |
| 86180 verbose chmod C:\Users\Vince\AppData\Roaming\npm-cache\estraverse\3.1.0\package.tgz 644 | |
| 86181 silly chown skipping for windows C:\Users\Vince\AppData\Roaming\npm-cache\estraverse\3.1.0\package.tgz | |
| 86182 silly gunzTarPerm extractEntry PATENTS | |
| 86183 silly gunzTarPerm extractEntry CONTRIBUTING.md | |
| 86184 silly lockFile cf495a71--estraverse-estraverse-3-1-0-tgz https://registry.npmjs.org/estraverse/-/estraverse-3.1.0.tgz | |
| 86185 silly lockFile cf495a71--estraverse-estraverse-3-1-0-tgz https://registry.npmjs.org/estraverse/-/estraverse-3.1.0.tgz | |
| 86186 silly gunzTarPerm extractEntry build/prefix-source-map.jsm | |
| 86187 silly gunzTarPerm extractEntry build/prefix-utils.jsm | |
| 86188 silly lockFile fc8187bc-estraverse-3-1-0 estraverse@3.1.0 | |
| 86189 silly lockFile fc8187bc-estraverse-3-1-0 estraverse@3.1.0 | |
| 86190 silly lockFile 5fa3d4f2-estraverse-3-0-0 estraverse@^3.0.0 | |
| 86191 silly lockFile 5fa3d4f2-estraverse-3-0-0 estraverse@^3.0.0 | |
| 86192 silly gunzTarPerm extractEntry build/suffix-source-map.jsm | |
| 86193 silly gunzTarPerm extractEntry build/suffix-utils.jsm | |
| 86194 silly lockFile f4c1718a-97376-0-6178647016640753-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.6178647016640753\package | |
| 86195 silly lockFile f4c1718a-97376-0-6178647016640753-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.6178647016640753\package | |
| 86196 silly lockFile 01027dba--npm-cache-private-0-1-6-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\private\0.1.6\package | |
| 86197 silly lockFile 01027dba--npm-cache-private-0-1-6-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\private\0.1.6\package | |
| 86198 silly lockFile 4e025d0c--cache-regexpu-1-1-2-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\regexpu\1.1.2\package.tgz | |
| 86199 silly lockFile 4e025d0c--cache-regexpu-1-1-2-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\regexpu\1.1.2\package.tgz | |
| 86200 silly lockFile ecd3127e--cache-private-0-1-6-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\private\0.1.6\package.tgz | |
| 86201 silly lockFile ecd3127e--cache-private-0-1-6-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\private\0.1.6\package.tgz | |
| 86202 silly lockFile 7375c07f--npm-cache-regexpu-1-1-2-package C:\Users\Vince\AppData\Roaming\npm-cache\regexpu\1.1.2\package | |
| 86203 verbose lock C:\Users\Vince\AppData\Roaming\npm-cache\regexpu\1.1.2\package C:\Users\Vince\AppData\Roaming\npm-cache\7375c07f--npm-cache-regexpu-1-1-2-package.lock | |
| 86204 verbose chmod C:\Users\Vince\AppData\Roaming\npm-cache\private\0.1.6\package.tgz 644 | |
| 86205 silly chown skipping for windows C:\Users\Vince\AppData\Roaming\npm-cache\private\0.1.6\package.tgz | |
| 86206 silly lockFile 9ec40baa-js-org-private-private-0-1-6-tgz https://registry.npmjs.org/private/-/private-0.1.6.tgz | |
| 86207 silly lockFile 9ec40baa-js-org-private-private-0-1-6-tgz https://registry.npmjs.org/private/-/private-0.1.6.tgz | |
| 86208 silly lockFile 2ec3a1af-private-0-1-6 private@0.1.6 | |
| 86209 silly lockFile 2ec3a1af-private-0-1-6 private@0.1.6 | |
| 86210 silly gunzTarPerm extractEntry dist/source-map.js | |
| 86211 silly gunzTarPerm extractEntry dist/source-map.min.js | |
| 86212 silly lockFile 29e2ee19-private-0-1-6 private@^0.1.6 | |
| 86213 silly lockFile 29e2ee19-private-0-1-6 private@^0.1.6 | |
| 86214 silly lockFile 7375c07f--npm-cache-regexpu-1-1-2-package C:\Users\Vince\AppData\Roaming\npm-cache\regexpu\1.1.2\package | |
| 86215 silly lockFile 7375c07f--npm-cache-regexpu-1-1-2-package C:\Users\Vince\AppData\Roaming\npm-cache\regexpu\1.1.2\package | |
| 86216 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\regexpu\1.1.2\package.tgz | |
| 86217 silly lockFile 4a95dd82--npm-cache-regexpu-1-1-2-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\regexpu\1.1.2\package | |
| 86218 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\regexpu\1.1.2\package C:\Users\Vince\AppData\Roaming\npm-cache\4a95dd82--npm-cache-regexpu-1-1-2-package.lock | |
| 86219 silly lockFile 4e025d0c--cache-regexpu-1-1-2-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\regexpu\1.1.2\package.tgz | |
| 86220 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\regexpu\1.1.2\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\4e025d0c--cache-regexpu-1-1-2-package-tgz.lock | |
| 86221 silly lockFile 31cee817-cache-line-numbers-0-2-0-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\line-numbers\0.2.0\package | |
| 86222 silly lockFile 31cee817-cache-line-numbers-0-2-0-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\line-numbers\0.2.0\package | |
| 86223 silly gunzTarPerm modes [ '755', '644' ] | |
| 86224 silly lockFile 93892149-e-line-numbers-0-2-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\line-numbers\0.2.0\package.tgz | |
| 86225 silly lockFile 93892149-e-line-numbers-0-2-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\line-numbers\0.2.0\package.tgz | |
| 86226 silly gunzTarPerm extractEntry dist/SourceMap.jsm | |
| 86227 silly gunzTarPerm extractEntry dist/test/test_util.js | |
| 86228 verbose chmod C:\Users\Vince\AppData\Roaming\npm-cache\line-numbers\0.2.0\package.tgz 644 | |
| 86229 silly chown skipping for windows C:\Users\Vince\AppData\Roaming\npm-cache\line-numbers\0.2.0\package.tgz | |
| 86230 silly lockFile 8a4350ee-e-numbers-line-numbers-0-2-0-tgz https://registry.npmjs.org/line-numbers/-/line-numbers-0.2.0.tgz | |
| 86231 silly lockFile 8a4350ee-e-numbers-line-numbers-0-2-0-tgz https://registry.npmjs.org/line-numbers/-/line-numbers-0.2.0.tgz | |
| 86232 silly gunzTarPerm extractEntry package.json | |
| 86233 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 86234 silly lockFile f4758902-line-numbers-0-2-0 line-numbers@0.2.0 | |
| 86235 silly lockFile f4758902-line-numbers-0-2-0 line-numbers@0.2.0 | |
| 86236 silly gunzTarPerm extractEntry README.md | |
| 86237 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 86238 silly gunzTarPerm extractEntry regexpu.js | |
| 86239 silly gunzTarPerm modified mode [ 'regexpu.js', 438, 420 ] | |
| 86240 silly gunzTarPerm extractEntry dist/test/test_array_set.js | |
| 86241 silly gunzTarPerm extractEntry dist/test/test_base64.js | |
| 86242 silly gunzTarPerm extractEntry dist/test/test_base64_vlq.js | |
| 86243 silly gunzTarPerm extractEntry dist/test/test_api.js | |
| 86244 silly lockFile e431376d-7009-0-08639553817920387-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097009-0.08639553817920387\package | |
| 86245 silly lockFile e431376d-7009-0-08639553817920387-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097009-0.08639553817920387\package | |
| 86246 silly gunzTarPerm extractEntry rewrite-pattern.js | |
| 86247 silly gunzTarPerm modified mode [ 'rewrite-pattern.js', 438, 420 ] | |
| 86248 silly gunzTarPerm extractEntry transform-tree.js | |
| 86249 silly gunzTarPerm modified mode [ 'transform-tree.js', 438, 420 ] | |
| 86250 silly gunzTarPerm extractEntry transpile-code.js | |
| 86251 silly gunzTarPerm modified mode [ 'transpile-code.js', 438, 420 ] | |
| 86252 silly gunzTarPerm extractEntry bin/regexpu | |
| 86253 silly gunzTarPerm modified mode [ 'bin/regexpu', 438, 420 ] | |
| 86254 silly gunzTarPerm extractEntry data/character-class-escape-sets.js | |
| 86255 silly gunzTarPerm modified mode [ 'data/character-class-escape-sets.js', 438, 420 ] | |
| 86256 silly gunzTarPerm extractEntry data/iu-mappings.json | |
| 86257 silly gunzTarPerm modified mode [ 'data/iu-mappings.json', 438, 420 ] | |
| 86258 silly gunzTarPerm extractEntry LICENSE-MIT.txt | |
| 86259 silly gunzTarPerm modified mode [ 'LICENSE-MIT.txt', 438, 420 ] | |
| 86260 silly gunzTarPerm extractEntry man/regexpu.1 | |
| 86261 silly gunzTarPerm modified mode [ 'man/regexpu.1', 438, 420 ] | |
| 86262 silly lockFile 8cdaa6a5-ache-js-tokens-1-0-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\js-tokens\1.0.0\package.tgz | |
| 86263 silly lockFile 8cdaa6a5-ache-js-tokens-1-0-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\js-tokens\1.0.0\package.tgz | |
| 86264 silly lockFile 48c5cb5b-pm-cache-js-tokens-1-0-0-package C:\Users\Vince\AppData\Roaming\npm-cache\js-tokens\1.0.0\package | |
| 86265 verbose lock C:\Users\Vince\AppData\Roaming\npm-cache\js-tokens\1.0.0\package C:\Users\Vince\AppData\Roaming\npm-cache\48c5cb5b-pm-cache-js-tokens-1-0-0-package.lock | |
| 86266 silly gunzTarPerm extractEntry dist/test/test_dog_fooding.js | |
| 86267 silly gunzTarPerm extractEntry dist/test/test_source_map_consumer.js | |
| 86268 silly gunzTarPerm extractEntry bin/regenerator | |
| 86269 silly lockFile 48c5cb5b-pm-cache-js-tokens-1-0-0-package C:\Users\Vince\AppData\Roaming\npm-cache\js-tokens\1.0.0\package | |
| 86270 silly lockFile 48c5cb5b-pm-cache-js-tokens-1-0-0-package C:\Users\Vince\AppData\Roaming\npm-cache\js-tokens\1.0.0\package | |
| 86271 silly gunzTarPerm extractEntry dist/test/test_source_map_generator.js | |
| 86272 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\js-tokens\1.0.0\package.tgz | |
| 86273 silly lockFile 480fcc70-pm-cache-js-tokens-1-0-0-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\js-tokens\1.0.0\package | |
| 86274 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\js-tokens\1.0.0\package C:\Users\Vince\AppData\Roaming\npm-cache\480fcc70-pm-cache-js-tokens-1-0-0-package.lock | |
| 86275 silly lockFile 8cdaa6a5-ache-js-tokens-1-0-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\js-tokens\1.0.0\package.tgz | |
| 86276 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\js-tokens\1.0.0\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\8cdaa6a5-ache-js-tokens-1-0-0-package-tgz.lock | |
| 86277 silly gunzTarPerm modes [ '755', '644' ] | |
| 86278 silly gunzTarPerm extractEntry dist/test/test_source_node.js | |
| 86279 silly gunzTarPerm extractEntry dist/test/test_binary_search.js | |
| 86280 silly gunzTarPerm extractEntry package.json | |
| 86281 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 86282 silly gunzTarPerm extractEntry .npmignore | |
| 86283 silly gunzTarPerm modified mode [ '.npmignore', 438, 420 ] | |
| 86284 silly gunzTarPerm extractEntry LICENSE | |
| 86285 silly gunzTarPerm modified mode [ 'LICENSE', 438, 420 ] | |
| 86286 silly gunzTarPerm extractEntry dist/test/Utils.jsm | |
| 86287 silly gunzTarPerm extractEntry lib/source-map.js | |
| 86288 silly gunzTarPerm extractEntry generate-index.js | |
| 86289 silly gunzTarPerm modified mode [ 'generate-index.js', 438, 420 ] | |
| 86290 silly gunzTarPerm extractEntry index.js | |
| 86291 silly gunzTarPerm modified mode [ 'index.js', 438, 420 ] | |
| 86292 silly gunzTarPerm extractEntry lib/source-map/array-set.js | |
| 86293 silly gunzTarPerm extractEntry lib/source-map/base64-vlq.js | |
| 86294 silly gunzTarPerm extractEntry .travis.yml | |
| 86295 silly gunzTarPerm modified mode [ '.travis.yml', 438, 420 ] | |
| 86296 silly gunzTarPerm extractEntry changelog.md | |
| 86297 silly gunzTarPerm modified mode [ 'changelog.md', 438, 420 ] | |
| 86298 silly gunzTarPerm extractEntry readme.md | |
| 86299 silly gunzTarPerm modified mode [ 'readme.md', 438, 420 ] | |
| 86300 silly gunzTarPerm extractEntry regex.coffee | |
| 86301 silly gunzTarPerm modified mode [ 'regex.coffee', 438, 420 ] | |
| 86302 silly gunzTarPerm extractEntry test/index.js | |
| 86303 silly gunzTarPerm modified mode [ 'test/index.js', 438, 420 ] | |
| 86304 silly gunzTarPerm extractEntry test/fixtures/base64.js | |
| 86305 silly gunzTarPerm modified mode [ 'test/fixtures/base64.js', 438, 420 ] | |
| 86306 silly gunzTarPerm extractEntry test/fixtures/division.js | |
| 86307 silly gunzTarPerm modified mode [ 'test/fixtures/division.js', 438, 420 ] | |
| 86308 silly gunzTarPerm extractEntry test/fixtures/errors.js | |
| 86309 silly gunzTarPerm modified mode [ 'test/fixtures/errors.js', 438, 420 ] | |
| 86310 silly gunzTarPerm extractEntry test/fixtures/regex.js | |
| 86311 silly gunzTarPerm modified mode [ 'test/fixtures/regex.js', 438, 420 ] | |
| 86312 silly gunzTarPerm extractEntry test/fixtures/base64.json | |
| 86313 silly gunzTarPerm modified mode [ 'test/fixtures/base64.json', 438, 420 ] | |
| 86314 silly gunzTarPerm extractEntry test/fixtures/division.json | |
| 86315 silly gunzTarPerm modified mode [ 'test/fixtures/division.json', 438, 420 ] | |
| 86316 silly gunzTarPerm extractEntry test/fixtures/errors.json | |
| 86317 silly gunzTarPerm modified mode [ 'test/fixtures/errors.json', 438, 420 ] | |
| 86318 silly gunzTarPerm extractEntry test/fixtures/regex.json | |
| 86319 silly gunzTarPerm modified mode [ 'test/fixtures/regex.json', 438, 420 ] | |
| 86320 silly lockFile 4a95dd82--npm-cache-regexpu-1-1-2-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\regexpu\1.1.2\package | |
| 86321 silly lockFile 4a95dd82--npm-cache-regexpu-1-1-2-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\regexpu\1.1.2\package | |
| 86322 silly lockFile 4e025d0c--cache-regexpu-1-1-2-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\regexpu\1.1.2\package.tgz | |
| 86323 silly lockFile 4e025d0c--cache-regexpu-1-1-2-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\regexpu\1.1.2\package.tgz | |
| 86324 verbose chmod C:\Users\Vince\AppData\Roaming\npm-cache\regexpu\1.1.2\package.tgz 644 | |
| 86325 silly chown skipping for windows C:\Users\Vince\AppData\Roaming\npm-cache\regexpu\1.1.2\package.tgz | |
| 86326 silly lockFile f0fc0ab4-js-org-regexpu-regexpu-1-1-2-tgz https://registry.npmjs.org/regexpu/-/regexpu-1.1.2.tgz | |
| 86327 silly lockFile f0fc0ab4-js-org-regexpu-regexpu-1-1-2-tgz https://registry.npmjs.org/regexpu/-/regexpu-1.1.2.tgz | |
| 86328 silly lockFile 7c21e241-regexpu-1-1-2 regexpu@1.1.2 | |
| 86329 silly lockFile 7c21e241-regexpu-1-1-2 regexpu@1.1.2 | |
| 86330 silly lockFile a0ab6506-regexpu-1-1-2 regexpu@^1.1.2 | |
| 86331 silly lockFile a0ab6506-regexpu-1-1-2 regexpu@^1.1.2 | |
| 86332 silly gunzTarPerm extractEntry lib/source-map/base64.js | |
| 86333 silly gunzTarPerm extractEntry lib/source-map/binary-search.js | |
| 86334 silly lockFile 91a9a374-097376-0-696940659545362-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.696940659545362\package | |
| 86335 silly lockFile 91a9a374-097376-0-696940659545362-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.696940659545362\package | |
| 86336 silly lockFile d2b6598d-097376-0-696940659545362-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.696940659545362\tmp.tgz | |
| 86337 silly lockFile d2b6598d-097376-0-696940659545362-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.696940659545362\tmp.tgz | |
| 86338 verbose tar pack [ 'C:\\Users\\Vince\\AppData\\Roaming\\npm-cache\\regenerator\\0.8.22\\package.tgz', | |
| 86338 verbose tar pack 'C:\\Users\\Vince\\AppData\\Local\\Temp\\npm-11116\\1429557097376-0.696940659545362\\package' ] | |
| 86339 verbose tarball C:\Users\Vince\AppData\Roaming\npm-cache\regenerator\0.8.22\package.tgz | |
| 86340 verbose folder C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.696940659545362\package | |
| 86341 silly lockFile 91a9a374-097376-0-696940659545362-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.696940659545362\package | |
| 86342 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.696940659545362\package C:\Users\Vince\AppData\Roaming\npm-cache\91a9a374-097376-0-696940659545362-package.lock | |
| 86343 silly lockFile 467d96b6-e-regenerator-0-8-22-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\regenerator\0.8.22\package.tgz | |
| 86344 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\regenerator\0.8.22\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\467d96b6-e-regenerator-0-8-22-package-tgz.lock | |
| 86345 silly gunzTarPerm extractEntry lib/source-map/mapping-list.js | |
| 86346 silly gunzTarPerm extractEntry lib/source-map/source-map-consumer.js | |
| 86347 silly lockFile 480fcc70-pm-cache-js-tokens-1-0-0-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\js-tokens\1.0.0\package | |
| 86348 silly lockFile 480fcc70-pm-cache-js-tokens-1-0-0-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\js-tokens\1.0.0\package | |
| 86349 silly lockFile 8cdaa6a5-ache-js-tokens-1-0-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\js-tokens\1.0.0\package.tgz | |
| 86350 silly lockFile 8cdaa6a5-ache-js-tokens-1-0-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\js-tokens\1.0.0\package.tgz | |
| 86351 verbose chmod C:\Users\Vince\AppData\Roaming\npm-cache\js-tokens\1.0.0\package.tgz 644 | |
| 86352 silly chown skipping for windows C:\Users\Vince\AppData\Roaming\npm-cache\js-tokens\1.0.0\package.tgz | |
| 86353 silly lockFile e24484a9-rg-js-tokens-js-tokens-1-0-0-tgz https://registry.npmjs.org/js-tokens/-/js-tokens-1.0.0.tgz | |
| 86354 silly lockFile e24484a9-rg-js-tokens-js-tokens-1-0-0-tgz https://registry.npmjs.org/js-tokens/-/js-tokens-1.0.0.tgz | |
| 86355 silly lockFile 56dac76c-js-tokens-1-0-0 js-tokens@1.0.0 | |
| 86356 silly lockFile 56dac76c-js-tokens-1-0-0 js-tokens@1.0.0 | |
| 86357 silly lockFile 91a9a374-097376-0-696940659545362-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.696940659545362\package | |
| 86358 silly lockFile 91a9a374-097376-0-696940659545362-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097376-0.696940659545362\package | |
| 86359 silly lockFile 467d96b6-e-regenerator-0-8-22-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\regenerator\0.8.22\package.tgz | |
| 86360 silly lockFile 467d96b6-e-regenerator-0-8-22-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\regenerator\0.8.22\package.tgz | |
| 86361 silly lockFile 211cb73d-cache-regenerator-0-8-22-package C:\Users\Vince\AppData\Roaming\npm-cache\regenerator\0.8.22\package | |
| 86362 verbose lock C:\Users\Vince\AppData\Roaming\npm-cache\regenerator\0.8.22\package C:\Users\Vince\AppData\Roaming\npm-cache\211cb73d-cache-regenerator-0-8-22-package.lock | |
| 86363 silly lockFile 211cb73d-cache-regenerator-0-8-22-package C:\Users\Vince\AppData\Roaming\npm-cache\regenerator\0.8.22\package | |
| 86364 silly lockFile 211cb73d-cache-regenerator-0-8-22-package C:\Users\Vince\AppData\Roaming\npm-cache\regenerator\0.8.22\package | |
| 86365 silly lockFile d4951282-7529-0-28276859945617616-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097529-0.28276859945617616\package | |
| 86366 silly lockFile d4951282-7529-0-28276859945617616-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097529-0.28276859945617616\package | |
| 86367 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\regenerator\0.8.22\package.tgz | |
| 86368 silly lockFile d83e6f8a-cache-regenerator-0-8-22-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\regenerator\0.8.22\package | |
| 86369 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\regenerator\0.8.22\package C:\Users\Vince\AppData\Roaming\npm-cache\d83e6f8a-cache-regenerator-0-8-22-package.lock | |
| 86370 silly lockFile 467d96b6-e-regenerator-0-8-22-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\regenerator\0.8.22\package.tgz | |
| 86371 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\regenerator\0.8.22\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\467d96b6-e-regenerator-0-8-22-package-tgz.lock | |
| 86372 silly gunzTarPerm extractEntry lib/source-map/source-map-generator.js | |
| 86373 silly gunzTarPerm extractEntry lib/source-map/source-node.js | |
| 86374 silly lockFile 606cd54d-7529-0-28276859945617616-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097529-0.28276859945617616\tmp.tgz | |
| 86375 silly lockFile 606cd54d-7529-0-28276859945617616-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097529-0.28276859945617616\tmp.tgz | |
| 86376 silly gunzTarPerm modes [ '755', '644' ] | |
| 86377 verbose tar pack [ 'C:\\Users\\Vince\\AppData\\Roaming\\npm-cache\\source-map-support\\0.2.10\\package.tgz', | |
| 86377 verbose tar pack 'C:\\Users\\Vince\\AppData\\Local\\Temp\\npm-11116\\1429557097529-0.28276859945617616\\package' ] | |
| 86378 verbose tarball C:\Users\Vince\AppData\Roaming\npm-cache\source-map-support\0.2.10\package.tgz | |
| 86379 verbose folder C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097529-0.28276859945617616\package | |
| 86380 silly lockFile d4951282-7529-0-28276859945617616-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097529-0.28276859945617616\package | |
| 86381 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097529-0.28276859945617616\package C:\Users\Vince\AppData\Roaming\npm-cache\d4951282-7529-0-28276859945617616-package.lock | |
| 86382 silly lockFile c89f0a3c-e-map-support-0-2-10-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map-support\0.2.10\package.tgz | |
| 86383 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map-support\0.2.10\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\c89f0a3c-e-map-support-0-2-10-package-tgz.lock | |
| 86384 silly gunzTarPerm extractEntry package.json | |
| 86385 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 86386 silly gunzTarPerm extractEntry .npmignore | |
| 86387 silly gunzTarPerm modified mode [ '.npmignore', 438, 420 ] | |
| 86388 silly gunzTarPerm extractEntry README.md | |
| 86389 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 86390 silly gunzTarPerm extractEntry LICENSE | |
| 86391 silly gunzTarPerm modified mode [ 'LICENSE', 438, 420 ] | |
| 86392 silly gunzTarPerm extractEntry runtime-module.js | |
| 86393 silly gunzTarPerm modified mode [ 'runtime-module.js', 438, 420 ] | |
| 86394 silly gunzTarPerm extractEntry lib/source-map/util.js | |
| 86395 silly gunzTarPerm extractEntry .travis.yml | |
| 86396 silly gunzTarPerm extractEntry runtime.js | |
| 86397 silly gunzTarPerm modified mode [ 'runtime.js', 438, 420 ] | |
| 86398 silly gunzTarPerm extractEntry main.js | |
| 86399 silly gunzTarPerm modified mode [ 'main.js', 438, 420 ] | |
| 86400 silly gunzTarPerm extractEntry .travis.yml | |
| 86401 silly gunzTarPerm modified mode [ '.travis.yml', 438, 420 ] | |
| 86402 silly gunzTarPerm extractEntry lib/emit.js | |
| 86403 silly gunzTarPerm modified mode [ 'lib/emit.js', 438, 420 ] | |
| 86404 silly gunzTarPerm extractEntry lib/hoist.js | |
| 86405 silly gunzTarPerm modified mode [ 'lib/hoist.js', 438, 420 ] | |
| 86406 silly gunzTarPerm extractEntry lib/leap.js | |
| 86407 silly gunzTarPerm modified mode [ 'lib/leap.js', 438, 420 ] | |
| 86408 silly gunzTarPerm extractEntry lib/meta.js | |
| 86409 silly gunzTarPerm modified mode [ 'lib/meta.js', 438, 420 ] | |
| 86410 silly gunzTarPerm extractEntry lib/util.js | |
| 86411 silly gunzTarPerm modified mode [ 'lib/util.js', 438, 420 ] | |
| 86412 silly gunzTarPerm extractEntry lib/visit.js | |
| 86413 silly gunzTarPerm modified mode [ 'lib/visit.js', 438, 420 ] | |
| 86414 silly gunzTarPerm extractEntry PATENTS | |
| 86415 silly gunzTarPerm modified mode [ 'PATENTS', 438, 420 ] | |
| 86416 silly gunzTarPerm extractEntry CONTRIBUTING.md | |
| 86417 silly gunzTarPerm modified mode [ 'CONTRIBUTING.md', 438, 420 ] | |
| 86418 silly gunzTarPerm extractEntry bin/regenerator | |
| 86419 silly gunzTarPerm modified mode [ 'bin/regenerator', 438, 420 ] | |
| 86420 silly lockFile d4951282-7529-0-28276859945617616-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097529-0.28276859945617616\package | |
| 86421 silly lockFile d4951282-7529-0-28276859945617616-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097529-0.28276859945617616\package | |
| 86422 silly lockFile c89f0a3c-e-map-support-0-2-10-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map-support\0.2.10\package.tgz | |
| 86423 silly lockFile c89f0a3c-e-map-support-0-2-10-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map-support\0.2.10\package.tgz | |
| 86424 silly lockFile 646465fb-ource-map-support-0-2-10-package C:\Users\Vince\AppData\Roaming\npm-cache\source-map-support\0.2.10\package | |
| 86425 verbose lock C:\Users\Vince\AppData\Roaming\npm-cache\source-map-support\0.2.10\package C:\Users\Vince\AppData\Roaming\npm-cache\646465fb-ource-map-support-0-2-10-package.lock | |
| 86426 silly lockFile 646465fb-ource-map-support-0-2-10-package C:\Users\Vince\AppData\Roaming\npm-cache\source-map-support\0.2.10\package | |
| 86427 silly lockFile 646465fb-ource-map-support-0-2-10-package C:\Users\Vince\AppData\Roaming\npm-cache\source-map-support\0.2.10\package | |
| 86428 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\source-map-support\0.2.10\package.tgz | |
| 86429 silly lockFile da21c412-ource-map-support-0-2-10-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map-support\0.2.10\package | |
| 86430 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map-support\0.2.10\package C:\Users\Vince\AppData\Roaming\npm-cache\da21c412-ource-map-support-0-2-10-package.lock | |
| 86431 silly lockFile c89f0a3c-e-map-support-0-2-10-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map-support\0.2.10\package.tgz | |
| 86432 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map-support\0.2.10\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\c89f0a3c-e-map-support-0-2-10-package-tgz.lock | |
| 86433 silly gunzTarPerm modes [ '755', '644' ] | |
| 86434 silly lockFile d83e6f8a-cache-regenerator-0-8-22-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\regenerator\0.8.22\package | |
| 86435 silly lockFile d83e6f8a-cache-regenerator-0-8-22-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\regenerator\0.8.22\package | |
| 86436 silly lockFile 467d96b6-e-regenerator-0-8-22-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\regenerator\0.8.22\package.tgz | |
| 86437 silly lockFile 467d96b6-e-regenerator-0-8-22-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\regenerator\0.8.22\package.tgz | |
| 86438 silly gunzTarPerm extractEntry package.json | |
| 86439 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 86440 verbose chmod C:\Users\Vince\AppData\Roaming\npm-cache\regenerator\0.8.22\package.tgz 644 | |
| 86441 silly chown skipping for windows C:\Users\Vince\AppData\Roaming\npm-cache\regenerator\0.8.22\package.tgz | |
| 86442 silly lockFile 7de00f14-generator-regenerator-0-8-22-tgz https://registry.npmjs.org/regenerator/-/regenerator-0.8.22.tgz | |
| 86443 silly lockFile 7de00f14-generator-regenerator-0-8-22-tgz https://registry.npmjs.org/regenerator/-/regenerator-0.8.22.tgz | |
| 86444 silly gunzTarPerm extractEntry .npmignore | |
| 86445 silly gunzTarPerm modified mode [ '.npmignore', 438, 420 ] | |
| 86446 silly gunzTarPerm extractEntry README.md | |
| 86447 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 86448 silly lockFile 0e0fbd9c-regenerator-0-8-22 regenerator@0.8.22 | |
| 86449 silly lockFile 0e0fbd9c-regenerator-0-8-22 regenerator@0.8.22 | |
| 86450 silly lockFile 42e5322c-regenerator-0-8-20 regenerator@^0.8.20 | |
| 86451 silly lockFile 42e5322c-regenerator-0-8-20 regenerator@^0.8.20 | |
| 86452 silly gunzTarPerm extractEntry browser-source-map-support.js | |
| 86453 silly gunzTarPerm modified mode [ 'browser-source-map-support.js', 438, 420 ] | |
| 86454 silly gunzTarPerm extractEntry source-map-support.js | |
| 86455 silly gunzTarPerm modified mode [ 'source-map-support.js', 438, 420 ] | |
| 86456 silly gunzTarPerm extractEntry build.js | |
| 86457 silly gunzTarPerm modified mode [ 'build.js', 438, 420 ] | |
| 86458 silly gunzTarPerm extractEntry test.js | |
| 86459 silly gunzTarPerm modified mode [ 'test.js', 438, 420 ] | |
| 86460 silly gunzTarPerm extractEntry LICENSE.md | |
| 86461 silly gunzTarPerm modified mode [ 'LICENSE.md', 438, 420 ] | |
| 86462 silly gunzTarPerm extractEntry amd-test/browser-source-map-support.js | |
| 86463 silly gunzTarPerm modified mode [ 'amd-test/browser-source-map-support.js', 438, 420 ] | |
| 86464 silly gunzTarPerm extractEntry amd-test/require.js | |
| 86465 silly gunzTarPerm modified mode [ 'amd-test/require.js', 438, 420 ] | |
| 86466 silly gunzTarPerm extractEntry amd-test/script.js | |
| 86467 silly gunzTarPerm modified mode [ 'amd-test/script.js', 438, 420 ] | |
| 86468 silly gunzTarPerm extractEntry amd-test/index.html | |
| 86469 silly gunzTarPerm modified mode [ 'amd-test/index.html', 438, 420 ] | |
| 86470 silly gunzTarPerm extractEntry amd-test/script.coffee | |
| 86471 silly gunzTarPerm modified mode [ 'amd-test/script.coffee', 438, 420 ] | |
| 86472 silly gunzTarPerm extractEntry amd-test/script.map | |
| 86473 silly gunzTarPerm modified mode [ 'amd-test/script.map', 438, 420 ] | |
| 86474 silly gunzTarPerm extractEntry browser-test/script.js | |
| 86475 silly gunzTarPerm modified mode [ 'browser-test/script.js', 438, 420 ] | |
| 86476 silly gunzTarPerm extractEntry browser-test/index.html | |
| 86477 silly gunzTarPerm modified mode [ 'browser-test/index.html', 438, 420 ] | |
| 86478 silly gunzTarPerm extractEntry browser-test/script.coffee | |
| 86479 silly gunzTarPerm modified mode [ 'browser-test/script.coffee', 438, 420 ] | |
| 86480 silly gunzTarPerm extractEntry browser-test/script.map | |
| 86481 silly gunzTarPerm modified mode [ 'browser-test/script.map', 438, 420 ] | |
| 86482 silly gunzTarPerm extractEntry header-test/script.js | |
| 86483 silly gunzTarPerm modified mode [ 'header-test/script.js', 438, 420 ] | |
| 86484 silly gunzTarPerm extractEntry header-test/server.js | |
| 86485 silly gunzTarPerm modified mode [ 'header-test/server.js', 438, 420 ] | |
| 86486 silly gunzTarPerm extractEntry header-test/index.html | |
| 86487 silly gunzTarPerm modified mode [ 'header-test/index.html', 438, 420 ] | |
| 86488 silly gunzTarPerm extractEntry header-test/script.coffee | |
| 86489 silly gunzTarPerm modified mode [ 'header-test/script.coffee', 438, 420 ] | |
| 86490 silly gunzTarPerm extractEntry header-test/script.map | |
| 86491 silly gunzTarPerm modified mode [ 'header-test/script.map', 438, 420 ] | |
| 86492 silly lockFile f1bab7f3-97509-0-2024305632803589-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097509-0.2024305632803589\package | |
| 86493 silly lockFile f1bab7f3-97509-0-2024305632803589-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097509-0.2024305632803589\package | |
| 86494 silly lockFile 95b0dd1f-97509-0-2024305632803589-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097509-0.2024305632803589\tmp.tgz | |
| 86495 silly lockFile 95b0dd1f-97509-0-2024305632803589-tmp-tgz tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097509-0.2024305632803589\tmp.tgz | |
| 86496 verbose tar pack [ 'C:\\Users\\Vince\\AppData\\Roaming\\npm-cache\\source-map\\0.4.2\\package.tgz', | |
| 86496 verbose tar pack 'C:\\Users\\Vince\\AppData\\Local\\Temp\\npm-11116\\1429557097509-0.2024305632803589\\package' ] | |
| 86497 verbose tarball C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.4.2\package.tgz | |
| 86498 verbose folder C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097509-0.2024305632803589\package | |
| 86499 silly lockFile f1bab7f3-97509-0-2024305632803589-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097509-0.2024305632803589\package | |
| 86500 verbose lock tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097509-0.2024305632803589\package C:\Users\Vince\AppData\Roaming\npm-cache\f1bab7f3-97509-0-2024305632803589-package.lock | |
| 86501 silly lockFile fa6b540d-che-source-map-0-4-2-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.4.2\package.tgz | |
| 86502 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.4.2\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\fa6b540d-che-source-map-0-4-2-package-tgz.lock | |
| 86503 silly lockFile da21c412-ource-map-support-0-2-10-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map-support\0.2.10\package | |
| 86504 silly lockFile da21c412-ource-map-support-0-2-10-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map-support\0.2.10\package | |
| 86505 silly lockFile c89f0a3c-e-map-support-0-2-10-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map-support\0.2.10\package.tgz | |
| 86506 silly lockFile c89f0a3c-e-map-support-0-2-10-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map-support\0.2.10\package.tgz | |
| 86507 verbose chmod C:\Users\Vince\AppData\Roaming\npm-cache\source-map-support\0.2.10\package.tgz 644 | |
| 86508 silly chown skipping for windows C:\Users\Vince\AppData\Roaming\npm-cache\source-map-support\0.2.10\package.tgz | |
| 86509 silly lockFile a506c62b-rt-source-map-support-0-2-10-tgz https://registry.npmjs.org/source-map-support/-/source-map-support-0.2.10.tgz | |
| 86510 silly lockFile a506c62b-rt-source-map-support-0-2-10-tgz https://registry.npmjs.org/source-map-support/-/source-map-support-0.2.10.tgz | |
| 86511 silly lockFile fe1fd7d3-source-map-support-0-2-10 source-map-support@0.2.10 | |
| 86512 silly lockFile fe1fd7d3-source-map-support-0-2-10 source-map-support@0.2.10 | |
| 86513 silly lockFile 46603d62-source-map-support-0-2-10 source-map-support@^0.2.10 | |
| 86514 silly lockFile 46603d62-source-map-support-0-2-10 source-map-support@^0.2.10 | |
| 86515 silly lockFile 7353b913-loader-utils-node-modules-big-js tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\file-loader\node_modules\loader-utils\node_modules\big.js | |
| 86516 silly lockFile 7353b913-loader-utils-node-modules-big-js tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\file-loader\node_modules\loader-utils\node_modules\big.js | |
| 86517 silly lockFile ad13883b-m-cache-big-js-2-5-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\big.js\2.5.1\package.tgz | |
| 86518 silly lockFile ad13883b-m-cache-big-js-2-5-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\big.js\2.5.1\package.tgz | |
| 86519 info preinstall big.js@2.5.1 | |
| 86520 verbose readDependencies using package.json deps | |
| 86521 verbose readDependencies using package.json deps | |
| 86522 silly resolved [] | |
| 86523 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\file-loader\node_modules\loader-utils\node_modules\big.js | |
| 86524 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\file-loader\node_modules\loader-utils\node_modules\big.js | |
| 86525 verbose linkStuff [ true, | |
| 86525 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 86525 verbose linkStuff false, | |
| 86525 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\file-loader\\node_modules\\loader-utils\\node_modules' ] | |
| 86526 info linkStuff big.js@2.5.1 | |
| 86527 verbose linkBins big.js@2.5.1 | |
| 86528 verbose linkMans big.js@2.5.1 | |
| 86529 verbose rebuildBundles big.js@2.5.1 | |
| 86530 info install big.js@2.5.1 | |
| 86531 info postinstall big.js@2.5.1 | |
| 86532 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\file-loader\node_modules\loader-utils | |
| 86533 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\file-loader\node_modules\loader-utils | |
| 86534 silly gunzTarPerm modes [ '755', '644' ] | |
| 86535 verbose linkStuff [ true, | |
| 86535 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 86535 verbose linkStuff false, | |
| 86535 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\file-loader\\node_modules' ] | |
| 86536 info linkStuff loader-utils@0.2.7 | |
| 86537 verbose linkBins loader-utils@0.2.7 | |
| 86538 verbose linkMans loader-utils@0.2.7 | |
| 86539 verbose rebuildBundles loader-utils@0.2.7 | |
| 86540 silly gunzTarPerm extractEntry package.json | |
| 86541 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 86542 verbose rebuildBundles [ '.bin', 'big.js', 'json5' ] | |
| 86543 info install loader-utils@0.2.7 | |
| 86544 info postinstall loader-utils@0.2.7 | |
| 86545 silly gunzTarPerm extractEntry .npmignore | |
| 86546 silly gunzTarPerm modified mode [ '.npmignore', 438, 420 ] | |
| 86547 silly gunzTarPerm extractEntry README.md | |
| 86548 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 86549 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\file-loader | |
| 86550 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\file-loader | |
| 86551 verbose linkStuff [ true, | |
| 86551 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 86551 verbose linkStuff false, | |
| 86551 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules' ] | |
| 86552 info linkStuff file-loader@0.8.1 | |
| 86553 verbose linkBins file-loader@0.8.1 | |
| 86554 verbose linkMans file-loader@0.8.1 | |
| 86555 verbose rebuildBundles file-loader@0.8.1 | |
| 86556 verbose rebuildBundles [ 'loader-utils' ] | |
| 86557 info install file-loader@0.8.1 | |
| 86558 info postinstall file-loader@0.8.1 | |
| 86559 silly gunzTarPerm extractEntry LICENCE | |
| 86560 silly gunzTarPerm modified mode [ 'LICENCE', 438, 420 ] | |
| 86561 silly gunzTarPerm extractEntry big.js | |
| 86562 silly gunzTarPerm modified mode [ 'big.js', 438, 420 ] | |
| 86563 silly gunzTarPerm extractEntry big.min.js | |
| 86564 silly gunzTarPerm modified mode [ 'big.min.js', 438, 420 ] | |
| 86565 silly gunzTarPerm extractEntry doc/bigAPI.html | |
| 86566 silly gunzTarPerm modified mode [ 'doc/bigAPI.html', 438, 420 ] | |
| 86567 silly gunzTarPerm extractEntry perf/bigtime.js | |
| 86568 silly gunzTarPerm modified mode [ 'perf/bigtime.js', 438, 420 ] | |
| 86569 silly gunzTarPerm extractEntry perf/big-vs-bigdecimal.html | |
| 86570 silly gunzTarPerm modified mode [ 'perf/big-vs-bigdecimal.html', 438, 420 ] | |
| 86571 silly gunzTarPerm extractEntry perf/lib/bigdecimal_GWT/bigdecimal.js | |
| 86572 silly gunzTarPerm modified mode [ 'perf/lib/bigdecimal_GWT/bigdecimal.js', 438, 420 ] | |
| 86573 silly gunzTarPerm extractEntry perf/lib/bigdecimal_GWT/bugs.js | |
| 86574 silly gunzTarPerm modified mode [ 'perf/lib/bigdecimal_GWT/bugs.js', 438, 420 ] | |
| 86575 silly gunzTarPerm extractEntry perf/lib/bigdecimal_GWT/BigDecTest.class | |
| 86576 silly gunzTarPerm modified mode [ 'perf/lib/bigdecimal_GWT/BigDecTest.class', 438, 420 ] | |
| 86577 silly gunzTarPerm extractEntry perf/lib/bigdecimal_GWT/BigDecTest.java | |
| 86578 silly gunzTarPerm modified mode [ 'perf/lib/bigdecimal_GWT/BigDecTest.java', 438, 420 ] | |
| 86579 silly gunzTarPerm extractEntry perf/lib/bigdecimal_GWT/LICENCE.txt | |
| 86580 silly gunzTarPerm modified mode [ 'perf/lib/bigdecimal_GWT/LICENCE.txt', 438, 420 ] | |
| 86581 silly gunzTarPerm extractEntry perf/lib/bigdecimal_ICU4J/BigDecimal-all-last.js | |
| 86582 silly gunzTarPerm modified mode [ 'perf/lib/bigdecimal_ICU4J/BigDecimal-all-last.js', 438, 420 ] | |
| 86583 silly gunzTarPerm extractEntry perf/lib/bigdecimal_ICU4J/BigDecimal-all-last.min.js | |
| 86584 silly gunzTarPerm modified mode [ 'perf/lib/bigdecimal_ICU4J/BigDecimal-all-last.min.js', | |
| 86584 silly gunzTarPerm 438, | |
| 86584 silly gunzTarPerm 420 ] | |
| 86585 silly gunzTarPerm extractEntry perf/lib/bigdecimal_ICU4J/LICENCE.txt | |
| 86586 silly gunzTarPerm modified mode [ 'perf/lib/bigdecimal_ICU4J/LICENCE.txt', 438, 420 ] | |
| 86587 silly gunzTarPerm extractEntry test/abs.js | |
| 86588 silly gunzTarPerm modified mode [ 'test/abs.js', 438, 420 ] | |
| 86589 silly gunzTarPerm extractEntry test/every-test.js | |
| 86590 silly gunzTarPerm modified mode [ 'test/every-test.js', 438, 420 ] | |
| 86591 silly lockFile f1bab7f3-97509-0-2024305632803589-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097509-0.2024305632803589\package | |
| 86592 silly lockFile f1bab7f3-97509-0-2024305632803589-package tar://C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557097509-0.2024305632803589\package | |
| 86593 silly lockFile fa6b540d-che-source-map-0-4-2-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.4.2\package.tgz | |
| 86594 silly lockFile fa6b540d-che-source-map-0-4-2-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.4.2\package.tgz | |
| 86595 silly lockFile 8db31e66-m-cache-source-map-0-4-2-package C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.4.2\package | |
| 86596 verbose lock C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.4.2\package C:\Users\Vince\AppData\Roaming\npm-cache\8db31e66-m-cache-source-map-0-4-2-package.lock | |
| 86597 silly lockFile 8db31e66-m-cache-source-map-0-4-2-package C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.4.2\package | |
| 86598 silly lockFile 8db31e66-m-cache-source-map-0-4-2-package C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.4.2\package | |
| 86599 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.4.2\package.tgz | |
| 86600 silly lockFile d0749782-m-cache-source-map-0-4-2-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.4.2\package | |
| 86601 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.4.2\package C:\Users\Vince\AppData\Roaming\npm-cache\d0749782-m-cache-source-map-0-4-2-package.lock | |
| 86602 silly lockFile fa6b540d-che-source-map-0-4-2-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.4.2\package.tgz | |
| 86603 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.4.2\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\fa6b540d-che-source-map-0-4-2-package-tgz.lock | |
| 86604 silly gunzTarPerm modes [ '755', '644' ] | |
| 86605 silly gunzTarPerm extractEntry package.json | |
| 86606 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 86607 silly gunzTarPerm extractEntry .npmignore | |
| 86608 silly gunzTarPerm modified mode [ '.npmignore', 438, 420 ] | |
| 86609 silly gunzTarPerm extractEntry README.md | |
| 86610 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 86611 silly gunzTarPerm extractEntry LICENSE | |
| 86612 silly gunzTarPerm modified mode [ 'LICENSE', 438, 420 ] | |
| 86613 silly gunzTarPerm extractEntry Makefile.dryice.js | |
| 86614 silly gunzTarPerm modified mode [ 'Makefile.dryice.js', 438, 420 ] | |
| 86615 silly gunzTarPerm extractEntry .gitattributes | |
| 86616 silly gunzTarPerm modified mode [ '.gitattributes', 438, 420 ] | |
| 86617 silly gunzTarPerm extractEntry lib/source-map.js | |
| 86618 silly gunzTarPerm modified mode [ 'lib/source-map.js', 438, 420 ] | |
| 86619 silly gunzTarPerm extractEntry lib/source-map/array-set.js | |
| 86620 silly gunzTarPerm modified mode [ 'lib/source-map/array-set.js', 438, 420 ] | |
| 86621 silly gunzTarPerm extractEntry lib/source-map/base64-vlq.js | |
| 86622 silly gunzTarPerm modified mode [ 'lib/source-map/base64-vlq.js', 438, 420 ] | |
| 86623 silly gunzTarPerm extractEntry lib/source-map/base64.js | |
| 86624 silly gunzTarPerm modified mode [ 'lib/source-map/base64.js', 438, 420 ] | |
| 86625 silly gunzTarPerm extractEntry lib/source-map/binary-search.js | |
| 86626 silly gunzTarPerm modified mode [ 'lib/source-map/binary-search.js', 438, 420 ] | |
| 86627 silly gunzTarPerm extractEntry lib/source-map/mapping-list.js | |
| 86628 silly gunzTarPerm modified mode [ 'lib/source-map/mapping-list.js', 438, 420 ] | |
| 86629 silly gunzTarPerm extractEntry lib/source-map/source-map-consumer.js | |
| 86630 silly gunzTarPerm modified mode [ 'lib/source-map/source-map-consumer.js', 438, 420 ] | |
| 86631 silly gunzTarPerm extractEntry lib/source-map/source-map-generator.js | |
| 86632 silly gunzTarPerm modified mode [ 'lib/source-map/source-map-generator.js', 438, 420 ] | |
| 86633 silly gunzTarPerm extractEntry lib/source-map/source-node.js | |
| 86634 silly gunzTarPerm modified mode [ 'lib/source-map/source-node.js', 438, 420 ] | |
| 86635 silly gunzTarPerm extractEntry lib/source-map/util.js | |
| 86636 silly gunzTarPerm modified mode [ 'lib/source-map/util.js', 438, 420 ] | |
| 86637 silly gunzTarPerm extractEntry .travis.yml | |
| 86638 silly gunzTarPerm modified mode [ '.travis.yml', 438, 420 ] | |
| 86639 silly gunzTarPerm extractEntry build/assert-shim.js | |
| 86640 silly gunzTarPerm modified mode [ 'build/assert-shim.js', 438, 420 ] | |
| 86641 silly gunzTarPerm extractEntry build/mini-require.js | |
| 86642 silly gunzTarPerm modified mode [ 'build/mini-require.js', 438, 420 ] | |
| 86643 silly gunzTarPerm extractEntry build/suffix-browser.js | |
| 86644 silly gunzTarPerm modified mode [ 'build/suffix-browser.js', 438, 420 ] | |
| 86645 silly gunzTarPerm extractEntry test/minus.js | |
| 86646 silly gunzTarPerm modified mode [ 'test/minus.js', 438, 420 ] | |
| 86647 silly gunzTarPerm extractEntry test/mod.js | |
| 86648 silly gunzTarPerm modified mode [ 'test/mod.js', 438, 420 ] | |
| 86649 silly gunzTarPerm extractEntry build/test-prefix.js | |
| 86650 silly gunzTarPerm modified mode [ 'build/test-prefix.js', 438, 420 ] | |
| 86651 silly gunzTarPerm extractEntry build/test-suffix.js | |
| 86652 silly gunzTarPerm modified mode [ 'build/test-suffix.js', 438, 420 ] | |
| 86653 silly gunzTarPerm extractEntry build/prefix-source-map.jsm | |
| 86654 silly gunzTarPerm modified mode [ 'build/prefix-source-map.jsm', 438, 420 ] | |
| 86655 silly gunzTarPerm extractEntry build/prefix-utils.jsm | |
| 86656 silly gunzTarPerm modified mode [ 'build/prefix-utils.jsm', 438, 420 ] | |
| 86657 silly gunzTarPerm extractEntry test/div.js | |
| 86658 silly gunzTarPerm modified mode [ 'test/div.js', 438, 420 ] | |
| 86659 silly gunzTarPerm extractEntry build/suffix-source-map.jsm | |
| 86660 silly gunzTarPerm modified mode [ 'build/suffix-source-map.jsm', 438, 420 ] | |
| 86661 silly gunzTarPerm extractEntry build/suffix-utils.jsm | |
| 86662 silly gunzTarPerm modified mode [ 'build/suffix-utils.jsm', 438, 420 ] | |
| 86663 silly gunzTarPerm extractEntry CHANGELOG.md | |
| 86664 silly gunzTarPerm modified mode [ 'CHANGELOG.md', 438, 420 ] | |
| 86665 silly gunzTarPerm extractEntry dist/source-map.js | |
| 86666 silly gunzTarPerm modified mode [ 'dist/source-map.js', 438, 420 ] | |
| 86667 silly gunzTarPerm extractEntry test/toPrecision.js | |
| 86668 silly gunzTarPerm modified mode [ 'test/toPrecision.js', 438, 420 ] | |
| 86669 silly gunzTarPerm extractEntry dist/source-map.min.js | |
| 86670 silly gunzTarPerm modified mode [ 'dist/source-map.min.js', 438, 420 ] | |
| 86671 silly gunzTarPerm extractEntry dist/SourceMap.jsm | |
| 86672 silly gunzTarPerm modified mode [ 'dist/SourceMap.jsm', 438, 420 ] | |
| 86673 silly gunzTarPerm extractEntry dist/test/test_api.js | |
| 86674 silly gunzTarPerm modified mode [ 'dist/test/test_api.js', 438, 420 ] | |
| 86675 silly gunzTarPerm extractEntry dist/test/test_base64.js | |
| 86676 silly gunzTarPerm modified mode [ 'dist/test/test_base64.js', 438, 420 ] | |
| 86677 silly gunzTarPerm extractEntry dist/test/test_base64_vlq.js | |
| 86678 silly gunzTarPerm modified mode [ 'dist/test/test_base64_vlq.js', 438, 420 ] | |
| 86679 silly gunzTarPerm extractEntry dist/test/test_binary_search.js | |
| 86680 silly gunzTarPerm modified mode [ 'dist/test/test_binary_search.js', 438, 420 ] | |
| 86681 silly gunzTarPerm extractEntry dist/test/test_array_set.js | |
| 86682 silly gunzTarPerm modified mode [ 'dist/test/test_array_set.js', 438, 420 ] | |
| 86683 silly gunzTarPerm extractEntry dist/test/test_source_map_consumer.js | |
| 86684 silly gunzTarPerm modified mode [ 'dist/test/test_source_map_consumer.js', 438, 420 ] | |
| 86685 silly gunzTarPerm extractEntry dist/test/test_source_map_generator.js | |
| 86686 silly gunzTarPerm modified mode [ 'dist/test/test_source_map_generator.js', 438, 420 ] | |
| 86687 silly gunzTarPerm extractEntry dist/test/test_source_node.js | |
| 86688 silly gunzTarPerm modified mode [ 'dist/test/test_source_node.js', 438, 420 ] | |
| 86689 silly gunzTarPerm extractEntry dist/test/test_util.js | |
| 86690 silly gunzTarPerm modified mode [ 'dist/test/test_util.js', 438, 420 ] | |
| 86691 silly gunzTarPerm extractEntry dist/test/test_dog_fooding.js | |
| 86692 silly gunzTarPerm modified mode [ 'dist/test/test_dog_fooding.js', 438, 420 ] | |
| 86693 silly gunzTarPerm extractEntry dist/test/Utils.jsm | |
| 86694 silly gunzTarPerm modified mode [ 'dist/test/Utils.jsm', 438, 420 ] | |
| 86695 silly gunzTarPerm extractEntry test/round.js | |
| 86696 silly gunzTarPerm modified mode [ 'test/round.js', 438, 420 ] | |
| 86697 silly gunzTarPerm extractEntry test/sqrt.js | |
| 86698 silly gunzTarPerm modified mode [ 'test/sqrt.js', 438, 420 ] | |
| 86699 silly gunzTarPerm extractEntry test/times.js | |
| 86700 silly gunzTarPerm modified mode [ 'test/times.js', 438, 420 ] | |
| 86701 silly gunzTarPerm extractEntry test/toExponential.js | |
| 86702 silly gunzTarPerm modified mode [ 'test/toExponential.js', 438, 420 ] | |
| 86703 silly gunzTarPerm extractEntry test/cmp.js | |
| 86704 silly gunzTarPerm modified mode [ 'test/cmp.js', 438, 420 ] | |
| 86705 silly gunzTarPerm extractEntry test/toFixed.js | |
| 86706 silly gunzTarPerm modified mode [ 'test/toFixed.js', 438, 420 ] | |
| 86707 silly gunzTarPerm extractEntry test/plus.js | |
| 86708 silly gunzTarPerm modified mode [ 'test/plus.js', 438, 420 ] | |
| 86709 silly gunzTarPerm extractEntry test/toString.js | |
| 86710 silly gunzTarPerm modified mode [ 'test/toString.js', 438, 420 ] | |
| 86711 silly lockFile d0749782-m-cache-source-map-0-4-2-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.4.2\package | |
| 86712 silly lockFile d0749782-m-cache-source-map-0-4-2-package tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.4.2\package | |
| 86713 silly lockFile fa6b540d-che-source-map-0-4-2-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.4.2\package.tgz | |
| 86714 silly lockFile fa6b540d-che-source-map-0-4-2-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.4.2\package.tgz | |
| 86715 verbose chmod C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.4.2\package.tgz 644 | |
| 86716 silly chown skipping for windows C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.4.2\package.tgz | |
| 86717 silly lockFile 6b03ed00--source-map-source-map-0-4-2-tgz https://registry.npmjs.org/source-map/-/source-map-0.4.2.tgz | |
| 86718 silly lockFile 6b03ed00--source-map-source-map-0-4-2-tgz https://registry.npmjs.org/source-map/-/source-map-0.4.2.tgz | |
| 86719 silly lockFile 0677abf1-source-map-0-4-2 source-map@0.4.2 | |
| 86720 silly lockFile 0677abf1-source-map-0-4-2 source-map@0.4.2 | |
| 86721 silly lockFile 75dc20b0-source-map-0-4-0 source-map@^0.4.0 | |
| 86722 silly lockFile 75dc20b0-source-map-0-4-0 source-map@^0.4.0 | |
| 86723 silly resolved [ { name: 'convert-source-map', | |
| 86723 silly resolved version: '1.0.0', | |
| 86723 silly resolved description: 'Converts a source-map from/to different formats and allows adding/changing properties.', | |
| 86723 silly resolved main: 'index.js', | |
| 86723 silly resolved scripts: { test: 'tap test/*.js' }, | |
| 86723 silly resolved repository: | |
| 86723 silly resolved { type: 'git', | |
| 86723 silly resolved url: 'git://github.com/thlorenz/convert-source-map.git' }, | |
| 86723 silly resolved homepage: 'https://github.com/thlorenz/convert-source-map', | |
| 86723 silly resolved dependencies: {}, | |
| 86723 silly resolved devDependencies: { 'inline-source-map': '~0.3.1', tap: '~0.4.13' }, | |
| 86723 silly resolved keywords: [ 'convert', 'sourcemap', 'source', 'map', 'browser', 'debug' ], | |
| 86723 silly resolved author: | |
| 86723 silly resolved { name: 'Thorsten Lorenz', | |
| 86723 silly resolved email: 'thlorenz@gmx.de', | |
| 86723 silly resolved url: 'http://thlorenz.com' }, | |
| 86723 silly resolved license: 'MIT', | |
| 86723 silly resolved engine: { node: '>=0.6' }, | |
| 86723 silly resolved readme: '# convert-source-map [](http://travis-ci.org/thlorenz/convert-source-map)\n\n[](https://nodei.co/npm/convert-source-map/)\n\nConverts a source-map from/to different formats and allows adding/changing properties.\n\n```js\nvar convert = require(\'convert-source-map\');\n\nvar json = convert\n .fromComment(\'//# sourceMappingURL=data:application/json;base64,eyJ2ZXJzaW9uIjozLCJmaWxlIjoiZm9vLmpzIiwic291cmNlcyI6WyJjb25zb2xlLmxvZyhcImhpXCIpOyJdLCJuYW1lcyI6W10sIm1hcHBpbmdzIjoiQUFBQSIsInNvdXJjZVJvb3QiOiIvIn0=\')\n .toJSON();\n\nvar modified = convert\n .fromComment(\'//# sourceMappingURL=data:application/json;base64,eyJ2ZXJzaW9uIjozLCJmaWxlIjoiZm9vLmpzIiwic291cmNlcyI6WyJjb25zb2xlLmxvZyhcImhpXCIpOyJdLCJuYW1lcyI6W10sIm1hcHBpbmdzIjoiQUFBQSIsInNvdXJjZVJvb3QiOiIvIn0=\')\n .setProperty(\'sources\', [ \'CONSOLE.LOG("HI");\' ])\n .toJSON();\n\nconsole.log(json);\nconsole.log(modified);\n```\n\n```json\n{"version":3,"file":"foo.js","sources":["console.log(\\"hi\\");"],"names":[],"mappings":"AAAA","sourceRoot":"/"}\n{"version":3,"file":"foo.js","sources":["CONSOLE.LOG(\\"HI\\");"],"names":[],"mappings":"AAAA","sourceRoot":"/"}\n```\n\n## API\n\n### fromObject(obj)\n\nReturns source map converter from given object.\n\n### fromJSON(json)\n\nReturns source map converter from given json string.\n\n### fromBase64(base64)\n\nReturns source map converter from given base64 encoded json string.\n\n### fromComment(comment)\n\nReturns source map converter from given base64 encoded json string prefixed with `//# sourceMappingURL=...`.\n\n### fromMapFileComment(comment, mapFileDir)\n\nReturns source map converter from given `filename` by parsing `//# sourceMappingURL=filename`.\n\n`filename` must point to a file that is found inside the `mapFileDir`. Most tools store this file right next to the\ngenerated file, i.e. the one containing the source map.\n\n### fromSource(source[, largeSource])\n\nFinds last sourcemap comment in file and returns source map converter or returns null if no source map comment was found.\n\nIf `largeSource` is set to `true`, an algorithm that does not use regex is applied to find the source map. This is faster and especially useful if you\'re running into "call stack size exceeded" errors with the default algorithm.\n\nHowever, it is less accurate and may match content that isn\'t a source map comment.\n\n### fromMapFileSource(source, mapFileDir)\n\nFinds last sourcemap comment in file and returns source map converter or returns null if no source map comment was\nfound.\n\nThe sourcemap will be read from the map file found by parsing `# sourceMappingURL=file` comment. For more info see\nfromMapFileComment.\n\n### toObject()\n\nReturns a copy of the underlying source map.\n\n### toJSON([space])\n\nConverts source map to json string. If `space` is given (optional), this will be passed to\n[JSON.stringify](https://developer.mozilla.org/en-US/docs/JavaScript/Reference/Global_Objects/JSON/stringify) when the\nJSON string is generated.\n\n### toBase64()\n\nConverts source map to base64 encoded json string.\n\n### toComment([options])\n\nConverts source map to an inline comment that can be appended to the source-file.\n\nBy default, the comment is formatted like: `//# sourceMappingURL=...`, which you would\nnormally see in a JS source file.\n\nWhen `options.multiline == true`, the comment is formatted like: `/*# sourceMappingURL=... */`, which you would find in a CSS source file.\n\n### addProperty(key, value)\n\nAdds given property to the source map. Throws an error if property already exists.\n\n### setProperty(key, value)\n\nSets given property to the source map. If property doesn\'t exist it is added, otherwise its value is updated.\n\n### getProperty(key)\n\nGets given property of the source map.\n\n### removeComments(src)\n\nReturns `src` with all source map comments removed\n\n### removeMapFileComments(src)\n\nReturns `src` with all source map comments pointing to map files removed.\n\n### commentRegex\n\nReturns the regex used to find source map comments.\n\n### mapFileCommentRegex\n\nReturns the regex used to find source map comments pointing to map files.\n\n\n[](https://bitdeli.com/free "Bitdeli Badge")\n', | |
| 86723 silly resolved readmeFilename: 'README.md', | |
| 86723 silly resolved bugs: { url: 'https://github.com/thlorenz/convert-source-map/issues' }, | |
| 86723 silly resolved _id: 'convert-source-map@1.0.0', | |
| 86723 silly resolved _from: 'convert-source-map@^1.0.0', | |
| 86723 silly resolved dist: { shasum: 'b2e8aedf41ab00e6a7d869cfb6aee93bdb10a2d1' }, | |
| 86723 silly resolved _resolved: 'https://registry.npmjs.org/convert-source-map/-/convert-source-map-1.0.0.tgz' }, | |
| 86723 silly resolved { name: 'chalk', | |
| 86723 silly resolved version: '1.0.0', | |
| 86723 silly resolved description: 'Terminal string styling done right. Much color.', | |
| 86723 silly resolved license: 'MIT', | |
| 86723 silly resolved repository: { type: 'git', url: 'sindresorhus/chalk' }, | |
| 86723 silly resolved maintainers: [ [Object], [Object] ], | |
| 86723 silly resolved engines: { node: '>=0.10.0' }, | |
| 86723 silly resolved scripts: { test: 'mocha', bench: 'matcha benchmark.js' }, | |
| 86723 silly resolved files: [ 'index.js' ], | |
| 86723 silly resolved keywords: | |
| 86723 silly resolved [ 'color', | |
| 86723 silly resolved 'colour', | |
| 86723 silly resolved 'colors', | |
| 86723 silly resolved 'terminal', | |
| 86723 silly resolved 'console', | |
| 86723 silly resolved 'cli', | |
| 86723 silly resolved 'string', | |
| 86723 silly resolved 'ansi', | |
| 86723 silly resolved 'styles', | |
| 86723 silly resolved 'tty', | |
| 86723 silly resolved 'formatting', | |
| 86723 silly resolved 'rgb', | |
| 86723 silly resolved '256', | |
| 86723 silly resolved 'shell', | |
| 86723 silly resolved 'xterm', | |
| 86723 silly resolved 'log', | |
| 86723 silly resolved 'logging', | |
| 86723 silly resolved 'command-line', | |
| 86723 silly resolved 'text' ], | |
| 86723 silly resolved dependencies: | |
| 86723 silly resolved { 'ansi-styles': '^2.0.1', | |
| 86723 silly resolved 'escape-string-regexp': '^1.0.2', | |
| 86723 silly resolved 'has-ansi': '^1.0.3', | |
| 86723 silly resolved 'strip-ansi': '^2.0.1', | |
| 86723 silly resolved 'supports-color': '^1.3.0' }, | |
| 86723 silly resolved devDependencies: { matcha: '^0.6.0', mocha: '*' }, | |
| 86723 silly resolved readme: '<h1 align="center">\n\t<br>\n\t<img width="360" src="https://cdn.rawgit.com/sindresorhus/chalk/19935d6484811c5e468817f846b7b3d417d7bf4a/logo.svg" alt="chalk">\n\t<br>\n\t<br>\n</h1>\n\n> Terminal string styling done right\n\n[](https://travis-ci.org/sindresorhus/chalk) [](https://www.youtube.com/watch?v=Sm368W0OsHo)\n\n[colors.js](https://github.com/Marak/colors.js) used to be the most popular string styling module, but it has serious deficiencies like extending `String.prototype` which causes all kinds of [problems](https://github.com/yeoman/yo/issues/68). Although there are other ones, they either do too much or not enough.\n\n**Chalk is a clean and focused alternative.**\n\n\n\n\n## Why\n\n- Highly performant\n- Doesn\'t extend `String.prototype`\n- Expressive API\n- Ability to nest styles\n- Clean and focused\n- Auto-detects color support\n- Actively maintained\n- [Used by ~3000 modules](https://www.npmjs.com/browse/depended/chalk)\n\n\n## Install\n\n```\n$ npm install --save chalk\n```\n\n\n## Usage\n\nChalk comes with an easy to use composable API where you just chain and nest the styles you want.\n\n```js\nvar chalk = require(\'chalk\');\n\n// style a string\nchalk.blue(\'Hello world!\');\n\n// combine styled and normal strings\nchalk.blue(\'Hello\') + \'World\' + chalk.red(\'!\');\n\n// compose multiple styles using the chainable API\nchalk.blue.bgRed.bold(\'Hello world!\');\n\n// pass in multiple arguments\nchalk.blue(\'Hello\', \'World!\', \'Foo\', \'bar\', \'biz\', \'baz\');\n\n// nest styles\nchalk.red(\'Hello\', chalk.underline.bgBlue(\'world\') + \'!\');\n\n// nest styles of the same type even (color, underline, background)\nchalk.green(\n\t\'I am a green line \' +\n\tchalk.blue.underline.bold(\'with a blue substring\') +\n\t\' that becomes green again!\'\n);\n```\n\nEasily define your own themes.\n\n```js\nvar chalk = require(\'chalk\');\nvar error = chalk.bold.red;\nconsole.log(error(\'Error!\'));\n```\n\nTake advantage of console.log [string substitution](http://nodejs.org/docs/latest/api/console.html#console_console_log_data).\n\n```js\nvar name = \'Sindre\';\nconsole.log(chalk.green(\'Hello %s\'), name);\n//=> Hello Sindre\n```\n\n\n## API\n\n### chalk.`<style>[.<style>...](string, [string...])`\n\nExample: `chalk.red.bold.underline(\'Hello\', \'world\');`\n\nChain [styles](#styles) and call the last one as a method with a string argument. Order doesn\'t matter, and later styles take precedent in case of a conflict. This simply means that `Chalk.red.yellow.green` is equivalent to `Chalk.green`.\n\nMultiple arguments will be separated by space.\n\n### chalk.enabled\n\nColor support is automatically detected, but you can override it by setting the `enabled` property. You should however only do this in your own code as it applies globally to all chalk consumers.\n\nIf you need to change this in a reusable module create a new instance:\n\n```js\nvar ctx = new chalk.constructor({enabled: false});\n```\n\n### chalk.supportsColor\n\nDetect whether the terminal [supports color](https://github.com/sindresorhus/supports-color). Used internally and handled for you, but exposed for convenience.\n\nCan be overridden by the user with the flags `--color` and `--no-color`. For situations where using `--color` is not possible, add an environment variable `FORCE_COLOR` with any value to force color. Trumps `--no-color`.\n\n### chalk.styles\n\nExposes the styles as [ANSI escape codes](https://github.com/sindresorhus/ansi-styles).\n\nGenerally not useful, but you might need just the `.open` or `.close` escape code if you\'re mixing externally styled strings with your own.\n\n```js\nvar chalk = require(\'chalk\');\n\nconsole.log(chalk.styles.red);\n//=> {open: \'\\u001b[31m\', close: \'\\u001b[39m\'}\n\nconsole.log(chalk.styles.red.open + \'Hello\' + chalk.styles.red.close);\n```\n\n### chalk.hasColor(string)\n\nCheck whether a string [has color](https://github.com/sindresorhus/has-ansi).\n\n### chalk.stripColor(string)\n\n[Strip color](https://github.com/sindresorhus/strip-ansi) from a string.\n\nCan be useful in combination with `.supportsColor` to strip color on externally styled text when it\'s not supported.\n\nExample:\n\n```js\nvar chalk = require(\'chalk\');\nvar styledString = getText();\n\nif (!chalk.supportsColor) {\n\tstyledString = chalk.stripColor(styledString);\n}\n```\n\n\n## Styles\n\n### Modifiers\n\n- `reset`\n- `bold`\n- `dim`\n- `italic` *(not widely supported)*\n- `underline`\n- `inverse`\n- `hidden`\n- `strikethrough` *(not widely supported)*\n\n### Colors\n\n- `black`\n- `red`\n- `green`\n- `yellow`\n- `blue` *(on Windows the bright version is used as normal blue is illegible)*\n- `magenta`\n- `cyan`\n- `white`\n- `gray`\n\n### Background colors\n\n- `bgBlack`\n- `bgRed`\n- `bgGreen`\n- `bgYellow`\n- `bgBlue`\n- `bgMagenta`\n- `bgCyan`\n- `bgWhite`\n\n\n## 256-colors\n\nChalk does not support support anything other than the base eight colors, which guarantees it will work on all terminals and systems. Some terminals, specifically `xterm` compliant ones, will support the full range of 8-bit colors. For this the lower level [ansi-256-colors](https://github.com/jbnicolai/ansi-256-colors) package can be used.\n\n\n## Windows\n\nIf you\'re on Windows, do yourself a favor and use [`cmder`](http://bliker.github.io/cmder/) instead of `cmd.exe`.\n\n\n## License\n\nMIT © [Sindre Sorhus](http://sindresorhus.com)\n', | |
| 86723 silly resolved readmeFilename: 'readme.md', | |
| 86723 silly resolved _id: 'chalk@1.0.0', | |
| 86723 silly resolved _from: 'chalk@^1.0.0' }, | |
| 86723 silly resolved { name: 'esutils', | |
| 86723 silly resolved description: 'utility box for ECMAScript language tools', | |
| 86723 silly resolved homepage: 'https://github.com/estools/esutils', | |
| 86723 silly resolved main: 'lib/utils.js', | |
| 86723 silly resolved version: '2.0.2', | |
| 86723 silly resolved engines: { node: '>=0.10.0' }, | |
| 86723 silly resolved directories: { lib: './lib' }, | |
| 86723 silly resolved files: [ 'LICENSE.BSD', 'README.md', 'lib' ], | |
| 86723 silly resolved maintainers: [ [Object] ], | |
| 86723 silly resolved repository: { type: 'git', url: 'http://github.com/estools/esutils.git' }, | |
| 86723 silly resolved devDependencies: | |
| 86723 silly resolved { chai: '~1.7.2', | |
| 86723 silly resolved 'coffee-script': '~1.6.3', | |
| 86723 silly resolved jshint: '2.6.3', | |
| 86723 silly resolved mocha: '~2.2.1', | |
| 86723 silly resolved regenerate: '~1.2.1', | |
| 86723 silly resolved 'unicode-7.0.0': '^0.1.5' }, | |
| 86723 silly resolved licenses: [ [Object] ], | |
| 86723 silly resolved scripts: | |
| 86723 silly resolved { test: 'npm run-script lint && npm run-script unit-test', | |
| 86723 silly resolved lint: 'jshint lib/*.js', | |
| 86723 silly resolved 'unit-test': 'mocha --compilers coffee:coffee-script -R spec', | |
| 86723 silly resolved 'generate-regex': 'node tools/generate-identifier-regex.js' }, | |
| 86723 silly resolved readme: '### esutils [](http://travis-ci.org/estools/esutils)\nesutils ([esutils](http://github.com/estools/esutils)) is\nutility box for ECMAScript language tools.\n\n### API\n\n### ast\n\n#### ast.isExpression(node)\n\nReturns true if `node` is an Expression as defined in ECMA262 edition 5.1 section\n[11](https://es5.github.io/#x11).\n\n#### ast.isStatement(node)\n\nReturns true if `node` is a Statement as defined in ECMA262 edition 5.1 section\n[12](https://es5.github.io/#x12).\n\n#### ast.isIterationStatement(node)\n\nReturns true if `node` is an IterationStatement as defined in ECMA262 edition\n5.1 section [12.6](https://es5.github.io/#x12.6).\n\n#### ast.isSourceElement(node)\n\nReturns true if `node` is a SourceElement as defined in ECMA262 edition 5.1\nsection [14](https://es5.github.io/#x14).\n\n#### ast.trailingStatement(node)\n\nReturns `Statement?` if `node` has trailing `Statement`.\n```js\nif (cond)\n consequent;\n```\nWhen taking this `IfStatement`, returns `consequent;` statement.\n\n#### ast.isProblematicIfStatement(node)\n\nReturns true if `node` is a problematic IfStatement. If `node` is a problematic `IfStatement`, `node` cannot be represented as an one on one JavaScript code.\n```js\n{\n type: \'IfStatement\',\n consequent: {\n type: \'WithStatement\',\n body: {\n type: \'IfStatement\',\n consequent: {type: \'EmptyStatement\'}\n }\n },\n alternate: {type: \'EmptyStatement\'}\n}\n```\nThe above node cannot be represented as a JavaScript code, since the top level `else` alternate belongs to an inner `IfStatement`.\n\n\n### code\n\n#### code.isDecimalDigit(code)\n\nReturn true if provided code is decimal digit.\n\n#### code.isHexDigit(code)\n\nReturn true if provided code is hexadecimal digit.\n\n#### code.isOctalDigit(code)\n\nReturn true if provided code is octal digit.\n\n#### code.isWhiteSpace(code)\n\nReturn true if provided code is white space. White space characters are formally defined in ECMA262.\n\n#### code.isLineTerminator(code)\n\nReturn true if provided code is line terminator. Line terminator characters are formally defined in ECMA262.\n\n#### code.isIdentifierStart(code)\n\nReturn true if provided code can be the first character of ECMA262 Identifier. They are formally defined in ECMA262.\n\n#### code.isIdentifierPart(code)\n\nReturn true if provided code can be the trailing character of ECMA262 Identifier. They are formally defined in ECMA262.\n\n### keyword\n\n#### keyword.isKeywordES5(id, strict)\n\nReturns `true` if provided identifier string is a Keyword or Future Reserved Word\nin ECMA262 edition 5.1. They are formally defined in ECMA262 sections\n[7.6.1.1](http://es5.github.io/#x7.6.1.1) and [7.6.1.2](http://es5.github.io/#x7.6.1.2),\nrespectively. If the `strict` flag is truthy, this function additionally checks whether\n`id` is a Keyword or Future Reserved Word under strict mode.\n\n#### keyword.isKeywordES6(id, strict)\n\nReturns `true` if provided identifier string is a Keyword or Future Reserved Word\nin ECMA262 edition 6. They are formally defined in ECMA262 sections\n[11.6.2.1](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-keywords) and\n[11.6.2.2](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-future-reserved-words),\nrespectively. If the `strict` flag is truthy, this function additionally checks whether\n`id` is a Keyword or Future Reserved Word under strict mode.\n\n#### keyword.isReservedWordES5(id, strict)\n\nReturns `true` if provided identifier string is a Reserved Word in ECMA262 edition 5.1.\nThey are formally defined in ECMA262 section [7.6.1](http://es5.github.io/#x7.6.1).\nIf the `strict` flag is truthy, this function additionally checks whether `id`\nis a Reserved Word under strict mode.\n\n#### keyword.isReservedWordES6(id, strict)\n\nReturns `true` if provided identifier string is a Reserved Word in ECMA262 edition 6.\nThey are formally defined in ECMA262 section [11.6.2](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-reserved-words).\nIf the `strict` flag is truthy, this function additionally checks whether `id`\nis a Reserved Word under strict mode.\n\n#### keyword.isRestrictedWord(id)\n\nReturns `true` if provided identifier string is one of `eval` or `arguments`.\nThey are restricted in strict mode code throughout ECMA262 edition 5.1 and\nin ECMA262 edition 6 section [12.1.1](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-identifiers-static-semantics-early-errors).\n\n#### keyword.isIdentifierName(id)\n\nReturn true if provided identifier string is an IdentifierName as specified in\nECMA262 edition 5.1 section [7.6](https://es5.github.io/#x7.6).\n\n#### keyword.isIdentifierES5(id, strict)\n\nReturn true if provided identifier string is an Identifier as specified in\nECMA262 edition 5.1 section [7.6](https://es5.github.io/#x7.6). If the `strict`\nflag is truthy, this function additionally checks whether `id` is an Identifier\nunder strict mode.\n\n#### keyword.isIdentifierES6(id, strict)\n\nReturn true if provided identifier string is an Identifier as specified in\nECMA262 edition 6 section [12.1](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-identifiers).\nIf the `strict` flag is truthy, this function additionally checks whether `id`\nis an Identifier under strict mode.\n\n### License\n\nCopyright (C) 2013 [Yusuke Suzuki](http://github.com/Constellation)\n (twitter: [@Constellation](http://twitter.com/Constellation)) and other contributors.\n\nRedistribution and use in source and binary forms, with or without\nmodification, are permitted provided that the following conditions are met:\n\n * Redistributions of source code must retain the above copyright\n notice, this list of conditions and the following disclaimer.\n\n * Redistributions in binary form must reproduce the above copyright\n notice, this list of conditions and the following disclaimer in the\n documentation and/or other materials provided with the distribution.\n\nTHIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"\nAND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE\nIMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE\nARE DISCLAIMED. IN NO EVENT SHALL <COPYRIGHT HOLDER> BE LIABLE FOR ANY\nDIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES\n(INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;\nLOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND\nON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT\n(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF\nTHIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.\n', | |
| 86723 silly resolved readmeFilename: 'README.md', | |
| 86723 silly resolved bugs: { url: 'https://github.com/estools/esutils/issues' }, | |
| 86723 silly resolved _id: 'esutils@2.0.2', | |
| 86723 silly resolved _from: 'esutils@^2.0.0' }, | |
| 86723 silly resolved { name: 'globals', | |
| 86723 silly resolved version: '6.4.1', | |
| 86723 silly resolved description: 'Global identifiers from different JavaScript environments', | |
| 86723 silly resolved license: 'MIT', | |
| 86723 silly resolved repository: { type: 'git', url: 'sindresorhus/globals' }, | |
| 86723 silly resolved author: | |
| 86723 silly resolved { name: 'Sindre Sorhus', | |
| 86723 silly resolved email: 'sindresorhus@gmail.com', | |
| 86723 silly resolved url: 'http://sindresorhus.com' }, | |
| 86723 silly resolved engines: { node: '>=0.10.0' }, | |
| 86723 silly resolved scripts: { test: 'mocha' }, | |
| 86723 silly resolved files: [ 'index.js', 'globals.json' ], | |
| 86723 silly resolved keywords: | |
| 86723 silly resolved [ 'globals', | |
| 86723 silly resolved 'global', | |
| 86723 silly resolved 'identifiers', | |
| 86723 silly resolved 'variables', | |
| 86723 silly resolved 'vars', | |
| 86723 silly resolved 'jshint', | |
| 86723 silly resolved 'eslint', | |
| 86723 silly resolved 'environments' ], | |
| 86723 silly resolved devDependencies: { mocha: '*' }, | |
| 86723 silly resolved readme: '# globals [](https://travis-ci.org/sindresorhus/globals)\n\n> Global identifiers from different JavaScript environments\n\nExtracted from [JSHint](https://github.com/jshint/jshint/blob/master/src/vars.js) and [ESLint](https://github.com/nzakas/eslint/blob/master/conf/environments.json) and merged.\n\nIt\'s just a [JSON file](globals.json), so use it in whatever environment you like.\n\n\n## Install\n\n```\n$ npm install --save globals\n```\n\n\n## Usage\n\n```js\nvar globals = require(\'globals\');\n\nconsole.log(globals.browser);\n/*\n{\n\taddEventListener: false,\n\tapplicationCache: false,\n\tArrayBuffer: false,\n\tatob: false,\n\t...\n}\n*/\n```\n\nEach global is given a value of `true` or `false`. A value of `true` indicates that the variable may be overwritten. A value of `false` indicates that the variable should be considered read-only. This information is used by static analysis tools to flag incorrect behavior. We assume all variables should be `false` unless we hear otherwise.\n\n\n## License\n\nMIT © [Sindre Sorhus](http://sindresorhus.com)\n', | |
| 86723 silly resolved readmeFilename: 'readme.md', | |
| 86723 silly resolved _id: 'globals@6.4.1', | |
| 86723 silly resolved dist: { shasum: 'fef884c6f26611f18d77c308904c66aa4d95b67c' }, | |
| 86723 silly resolved _from: 'globals@^6.4.0', | |
| 86723 silly resolved _resolved: 'https://registry.npmjs.org/globals/-/globals-6.4.1.tgz' }, | |
| 86723 silly resolved { name: 'debug', | |
| 86723 silly resolved version: '2.1.3', | |
| 86723 silly resolved repository: { type: 'git', url: 'git://github.com/visionmedia/debug.git' }, | |
| 86723 silly resolved description: 'small debugging utility', | |
| 86723 silly resolved keywords: [ 'debug', 'log', 'debugger' ], | |
| 86723 silly resolved author: { name: 'TJ Holowaychuk', email: 'tj@vision-media.ca' }, | |
| 86723 silly resolved contributors: [ [Object] ], | |
| 86723 silly resolved license: 'MIT', | |
| 86723 silly resolved dependencies: { ms: '0.7.0' }, | |
| 86723 silly resolved devDependencies: { browserify: '9.0.3', mocha: '*' }, | |
| 86723 silly resolved main: './node.js', | |
| 86723 silly resolved browser: './browser.js', | |
| 86723 silly resolved component: { scripts: [Object] }, | |
| 86723 silly resolved readme: '# debug\n\n tiny node.js debugging utility modelled after node core\'s debugging technique.\n\n## Installation\n\n```bash\n$ npm install debug\n```\n\n## Usage\n\n With `debug` you simply invoke the exported function to generate your debug function, passing it a name which will determine if a noop function is returned, or a decorated `console.error`, so all of the `console` format string goodies you\'re used to work fine. A unique color is selected per-function for visibility.\n\nExample _app.js_:\n\n```js\nvar debug = require(\'debug\')(\'http\')\n , http = require(\'http\')\n , name = \'My App\';\n\n// fake app\n\ndebug(\'booting %s\', name);\n\nhttp.createServer(function(req, res){\n debug(req.method + \' \' + req.url);\n res.end(\'hello\\n\');\n}).listen(3000, function(){\n debug(\'listening\');\n});\n\n// fake worker of some kind\n\nrequire(\'./worker\');\n```\n\nExample _worker.js_:\n\n```js\nvar debug = require(\'debug\')(\'worker\');\n\nsetInterval(function(){\n debug(\'doing some work\');\n}, 1000);\n```\n\n The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:\n\n \n\n \n\n#### Windows note\n\n On Windows the environment variable is set using the `set` command. \n \n ```cmd\n set DEBUG=*,-not_this\n ```\n\nThen, run the program to be debugged as usual.\n\n## Millisecond diff\n\n When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.\n\n \n\n When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:\n\n \n\n## Conventions\n\n If you\'re using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".\n\n## Wildcards\n\n The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect.compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.\n\n You can also exclude specific debuggers by prefixing them with a "-" character. For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".\n\n## Browser support\n\n Debug works in the browser as well, currently persisted by `localStorage`. Consider the situation shown below where you have `worker:a` and `worker:b`, and wish to debug both. Somewhere in the code on your page, include:\n\n```js\nwindow.myDebug = require("debug");\n```\n\n ("debug" is a global object in the browser so we give this object a different name.) When your page is open in the browser, type the following in the console:\n\n```js\nmyDebug.enable("worker:*")\n```\n\n Refresh the page. Debug output will continue to be sent to the console until it is disabled by typing `myDebug.disable()` in the console.\n\n```js\na = debug(\'worker:a\');\nb = debug(\'worker:b\');\n\nsetInterval(function(){\n a(\'doing some work\');\n}, 1000);\n\nsetInterval(function(){\n b(\'doing some work\');\n}, 1200);\n```\n\n#### Web Inspector Colors\n\n Colors are also enabled on "Web Inspectors" that understand the `%c` formatting\n option. These are WebKit web inspectors, Firefox ([since version\n 31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))\n and the Firebug plugin for Firefox (any version).\n\n Colored output looks something like:\n\n \n\n### stderr vs stdout\n\nYou can set an alternative logging method per-namespace by overriding the `log` method on a per-namespace or globally:\n\nExample _stdout.js_:\n\n```js\nvar debug = require(\'debug\');\nvar error = debug(\'app:error\');\n\n// by default stderr is used\nerror(\'goes to stderr!\');\n\nvar log = debug(\'app:log\');\n// set this namespace to log via console.log\nlog.log = console.log.bind(console); // don\'t forget to bind to console!\nlog(\'goes to stdout\');\nerror(\'still goes to stderr!\');\n\n// set all output to go via console.info\n// overrides all per-namespace log settings\ndebug.log = console.info.bind(console);\nerror(\'now goes to stdout via console.info\');\nlog(\'still goes to stdout, but via console.info now\');\n```\n\n## Authors\n\n - TJ Holowaychuk\n - Nathan Rajlich\n\n## License\n\n(The MIT License)\n\nCopyright (c) 2014 TJ Holowaychuk <tj@vision-media.ca>\n\nPermission is hereby granted, free of charge, to any person obtaining\na copy of this software and associated documentation files (the\n\'Software\'), to deal in the Software without restriction, including\nwithout limitation the rights to use, copy, modify, merge, publish,\ndistribute, sublicense, and/or sell copies of the Software, and to\npermit persons to whom the Software is furnished to do so, subject to\nthe following conditions:\n\nThe above copyright notice and this permission notice shall be\nincluded in all copies or substantial portions of the Software.\n\nTHE SOFTWARE IS PROVIDED \'AS IS\', WITHOUT WARRANTY OF ANY KIND,\nEXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF\nMERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.\nIN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY\nCLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,\nTORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE\nSOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.\n', | |
| 86723 silly resolved readmeFilename: 'Readme.md', | |
| 86723 silly resolved bugs: { url: 'https://github.com/visionmedia/debug/issues' }, | |
| 86723 silly resolved _id: 'debug@2.1.3', | |
| 86723 silly resolved _from: 'debug@^2.1.1', | |
| 86723 silly resolved scripts: {}, | |
| 86723 silly resolved dist: { shasum: 'a0fbca01d1f1a750b1d037d6c4f8cb6ac968f1dd' }, | |
| 86723 silly resolved _resolved: 'https://registry.npmjs.org/debug/-/debug-2.1.3.tgz' }, | |
| 86723 silly resolved { name: 'is-integer', | |
| 86723 silly resolved version: '1.0.4', | |
| 86723 silly resolved description: 'Polyfill for ES6 Number.isInteger', | |
| 86723 silly resolved main: 'index.js', | |
| 86723 silly resolved scripts: { test: 'node test.js' }, | |
| 86723 silly resolved repository: { type: 'git', url: 'git@github.com:parshap/js-is-integer' }, | |
| 86723 silly resolved keywords: [ 'es6', 'is', 'safe', 'integer', 'isInteger', 'isSafeInteger' ], | |
| 86723 silly resolved author: { name: 'Parsha Pourkhomami' }, | |
| 86723 silly resolved license: 'MIT', | |
| 86723 silly resolved devDependencies: { tape: '^3.5.0' }, | |
| 86723 silly resolved dependencies: { 'is-finite': '^1.0.0', 'is-nan': '^1.0.1' }, | |
| 86723 silly resolved readme: '# is-integer\n\nPolyfill for [ES6 `Number.isInteger`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Number/isInteger).\n\n# Example\n```js\nvar isInteger = require("is-integer");\nisInteger("hello") // -> false\nisInteger(4) // -> true\nisInteger(4.0) // -> true\nisInteger(4.1) // -> false\n```\n\n# Installation\n```\nnpm install is-integer\n```\n', | |
| 86723 silly resolved readmeFilename: 'README.md', | |
| 86723 silly resolved bugs: { url: 'https://github.com/parshap/js-is-integer/issues' }, | |
| 86723 silly resolved _id: 'is-integer@1.0.4', | |
| 86723 silly resolved _from: 'is-integer@^1.0.4', | |
| 86723 silly resolved dist: { shasum: '75accbe24d1003e94038d8cf7caccfe79b920924' }, | |
| 86723 silly resolved _resolved: 'https://registry.npmjs.org/is-integer/-/is-integer-1.0.4.tgz' }, | |
| 86723 silly resolved { name: 'core-js', | |
| 86723 silly resolved description: 'Standard library', | |
| 86723 silly resolved version: '0.8.4', | |
| 86723 silly resolved repository: { type: 'git', url: 'https://github.com/zloirock/core-js.git' }, | |
| 86723 silly resolved main: 'index.js', | |
| 86723 silly resolved devDependencies: | |
| 86723 silly resolved { webpack: '1.8.x', | |
| 86723 silly resolved LiveScript: '1.3.x', | |
| 86723 silly resolved grunt: '0.4.x', | |
| 86723 silly resolved 'grunt-livescript': '0.5.x', | |
| 86723 silly resolved 'grunt-contrib-uglify': '0.9.x', | |
| 86723 silly resolved 'grunt-contrib-watch': '0.6.x', | |
| 86723 silly resolved 'grunt-contrib-clean': '0.6.x', | |
| 86723 silly resolved 'grunt-contrib-copy': '0.8.x', | |
| 86723 silly resolved karma: '0.12.x', | |
| 86723 silly resolved 'karma-qunit': '0.1.x', | |
| 86723 silly resolved 'karma-chrome-launcher': '0.1.x', | |
| 86723 silly resolved 'karma-ie-launcher': '0.1.x', | |
| 86723 silly resolved 'karma-firefox-launcher': '0.1.x', | |
| 86723 silly resolved 'karma-opera-launcher': '0.1.x', | |
| 86723 silly resolved 'promises-aplus-tests': '2.1.x', | |
| 86723 silly resolved eslint: '0.19.x' }, | |
| 86723 silly resolved scripts: | |
| 86723 silly resolved { lint: 'eslint es5 es6 es7 js web core fn modules', | |
| 86723 silly resolved 'promises-tests': 'promises-aplus-tests tests/promises_tests_adapter' }, | |
| 86723 silly resolved license: 'MIT', | |
| 86723 silly resolved keywords: | |
| 86723 silly resolved [ 'ES5', | |
| 86723 silly resolved 'ECMAScript 5', | |
| 86723 silly resolved 'ES6', | |
| 86723 silly resolved 'ECMAScript 6', | |
| 86723 silly resolved 'ES7', | |
| 86723 silly resolved 'ECMAScript 7', | |
| 86723 silly resolved 'Harmony', | |
| 86723 silly resolved 'Strawman', | |
| 86723 silly resolved 'Map', | |
| 86723 silly resolved 'Set', | |
| 86723 silly resolved 'WeakMap', | |
| 86723 silly resolved 'WeakSet', | |
| 86723 silly resolved 'Dict', | |
| 86723 silly resolved 'Promise', | |
| 86723 silly resolved 'Symbol', | |
| 86723 silly resolved 'Array generics', | |
| 86723 silly resolved 'setImmediate', | |
| 86723 silly resolved 'partial application', | |
| 86723 silly resolved 'Date formatting' ], | |
| 86723 silly resolved readme: '# core-js\r\n\r\n[](https://gitter.im/zloirock/core-js?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)\r\n\r\nModular compact standard library for JavaScript. Includes polyfills for [ECMAScript 5](#ecmascript-5), [ECMAScript 6](#ecmascript-6): [symbols](#ecmascript-6-symbols), [collections](#ecmascript-6-collections), [iterators](#ecmascript-6-iterators), [promises](#ecmascript-6-promises), [ECMAScript 7 proposals](#ecmascript-7); [setImmediate](#setimmediate), [array generics](#mozilla-javascript-array-generics). Some additional features such as [dictionaries](#dict), [extended partial application](#partial-application), [console cap](#console), [date formatting](#date-formatting). You can require only standardized features polyfills, use features without global namespace pollution or create a custom build.\r\n\r\n[Example](http://goo.gl/mfHYm2):\r\n```javascript\r\nArray.from(new Set([1, 2, 3, 2, 1])); // => [1, 2, 3]\r\n\'*\'.repeat(10); // => \'**********\'\r\nPromise.resolve(32).then(log); // => 32\r\nsetImmediate(log, 42); // => 42\r\n```\r\n\r\n[Without global namespace pollution](http://goo.gl/WBhs43):\r\n```javascript\r\nvar core = require(\'core-js/library\'); // With a modular system, otherwise use global `core`\r\ncore.Array.from(new core.Set([1, 2, 3, 2, 1])); // => [1, 2, 3]\r\ncore.String.repeat(\'*\', 10); // => \'**********\'\r\ncore.Promise.resolve(32).then(core.log); // => 32\r\ncore.setImmediate(core.log, 42); // => 42\r\n```\r\n\r\n[](https://www.npmjs.org/package/core-js/)\r\n\r\n- [Usage](#usage)\r\n - [Basic](#basic)\r\n - [CommonJS](#commonjs)\r\n - [Custom build](#custom-build)\r\n- [API](#api)\r\n - [ECMAScript 5](#ecmascript-5)\r\n - [ECMAScript 6](#ecmascript-6)\r\n - [ECMAScript 6: Symbols](#ecmascript-6-symbols)\r\n - [ECMAScript 6: Collections](#ecmascript-6-collections)\r\n - [ECMAScript 6: Iterators](#ecmascript-6-iterators)\r\n - [ECMAScript 6: Promises](#ecmascript-6-promises)\r\n - [ECMAScript 6: Reflect](#ecmascript-6-reflect)\r\n - [ECMAScript 7](#ecmascript-7)\r\n - [Mozilla JavaScript: Array generics](#mozilla-javascript-array-generics)\r\n - [setTimeout / setInterval](#settimeout--setinterval)\r\n - [setImmediate](#setimmediate)\r\n - [console](#console)\r\n - [Object](#object)\r\n - [Dict](#dict)\r\n - [Partial application](#partial-application)\r\n - [Date formatting](#date-formatting)\r\n - [Array](#array)\r\n - [Number](#number)\r\n - [Escaping characters](#escaping-characters)\r\n - [delay](#delay)\r\n- [Changelog](#changelog)\r\n\r\n## Usage\r\n### Basic\r\n```\r\nnpm i core-js\r\nbower install core.js\r\n```\r\n\r\n```javascript\r\n// Default\r\nrequire(\'core-js\');\r\n// Without global namespace pollution\r\nvar core = require(\'core-js/library\');\r\n// Shim only\r\nrequire(\'core-js/shim\');\r\n```\r\nIf you need complete build for browser, use builds from `core-js/client` path: [default](https://raw.githack.com/zloirock/core-js/master/client/core.min.js), [without global namespace pollution](https://raw.githack.com/zloirock/core-js/master/client/core.min.js), [shim only](https://raw.githack.com/zloirock/core-js/master/client/shim.min.js).\r\n\r\nCaveat: if you uses `core-js` with extension of native objects, require all needed `core-js` modules at the beginning of entry point of your application, otherwise possible conflicts.\r\n### CommonJS\r\nYou can require only needed modules.\r\n\r\n```js\r\nrequire(\'core-js/es5\'); // if you need support IE8-\r\nrequire(\'core-js/fn/set\');\r\nrequire(\'core-js/fn/array/from\');\r\nArray.from(new Set([1, 2, 3, 2, 1])); // => [1, 2, 3]\r\n\r\n// or, w/o global namespace pollution:\r\n\r\nvar core = require(\'core-js/library/es5\'); // if you need support IE8-\r\nvar Set = require(\'core-js/library/fn/set\');\r\nvar from = require(\'core-js/library/fn/array/from\');\r\nfrom(new Set([1, 2, 3, 2, 1])); // => [1, 2, 3]\r\n```\r\nAvailable entry points for methods / constructors, as above, excluding features from [`es5`](#ecmascript-5) module (this module requires fully in ES3 environment before all other modules).\r\n\r\nAvailable namespaces: for example, `core-js/es6/array` (`core-js/library/es6/array`) contains all [ES6 `Array` features](#ecmascript-6-array), `core-js/es6` (`core-js/library/es6`) contains all ES6 features.\r\n\r\nAvailable inclusion by module name, for example, `es6.array.prototype` - `core-js/modules/es6.array.prototype` or `core-js/library/modules/es6.array.prototype`.\r\n### Custom build\r\n```\r\nnpm i -g grunt-cli\r\nnpm i core-js\r\ncd node_modules/core-js && npm i\r\ngrunt build:core.dict,es6 --blacklist=es6.promise,es6.math --library=on --path=custom uglify\r\n```\r\nWhere `core.dict` and `es6` are modules (namespaces) names, which will be added to the build, `es6.promise` and `es6.math` are modules (namespaces) names, which will be excluded from the build, `--library=on` is flag for build without global namespace pollution and `custom` is target file name.\r\n\r\nAvailable namespaces: for example, `es6.array` contains [ES6 `Array` features](#ecmascript-6-array), `es6` contains all modules whose names start with `es6`.\r\n## API:\r\n### ECMAScript 5\r\nModule `es5`, nothing new - without examples.\r\n```javascript\r\nObject\r\n .create(proto | null, descriptors?) -> object\r\n .getPrototypeOf(object) -> proto | null\r\n .defineProperty(target, key, desc) -> target, cap for ie8-\r\n .defineProperties(target, descriptors) -> target, cap for ie8-\r\n .getOwnPropertyDescriptor(object, key) -> desc\r\n .getOwnPropertyNames(object) -> array\r\n .seal(object) -> object, cap for ie8-\r\n .freeze(object) -> object, cap for ie8-\r\n .preventExtensions(object) -> object, cap for ie8-\r\n .isSealed(object) -> bool, cap for ie8-\r\n .isFrozen(object) -> bool, cap for ie8-\r\n .isExtensible(object) -> bool, cap for ie8-\r\n .keys(object) -> array\r\nArray\r\n .isArray(var) -> bool\r\n #slice(start?, end?) -> array, fix for ie7-\r\n #join(string = \',\') -> string, fix for ie7-\r\n #indexOf(var, from?) -> int\r\n #lastIndexOf(var, from?) -> int\r\n #every(fn(val, index, @), that) -> bool\r\n #some(fn(val, index, @), that) -> bool\r\n #forEach(fn(val, index, @), that) -> void\r\n #map(fn(val, index, @), that) -> array\r\n #filter(fn(val, index, @), that) -> array\r\n #reduce(fn(memo, val, index, @), memo?) -> var\r\n #reduceRight(fn(memo, val, index, @), memo?) -> var\r\nFunction\r\n #bind(object, ...args) -> boundFn(...args)\r\nString\r\n #trim() -> str\r\nDate\r\n .now() -> int\r\n #toISOString() -> string\r\n```\r\n\r\n### ECMAScript 6\r\n#### ECMAScript 6: Object & Function\r\nModules `es6.object.assign`, `es6.object.is`, `es6.object.set-prototype-of`, `es6.object.to-string` and `es6.function.name`.\r\n```javascript\r\nObject\r\n .assign(target, ...src) -> target\r\n .is(a, b) -> bool\r\n .setPrototypeOf(target, proto | null) -> target, sham (required __proto__)\r\n #toString() -> string, ES6 fix: @@toStringTag support\r\nFunction\r\n #name -> string (IE9+)\r\n```\r\n[Example](http://goo.gl/UN5ZDT):\r\n```javascript\r\nvar foo = {q: 1, w: 2}\r\n , bar = {e: 3, r: 4}\r\n , baz = {t: 5, y: 6};\r\nObject.assign(foo, bar, baz); // => foo = {q: 1, w: 2, e: 3, r: 4, t: 5, y: 6}\r\n\r\nObject.is(NaN, NaN); // => true\r\nObject.is(0, -0); // => false\r\nObject.is(42, 42); // => true\r\nObject.is(42, \'42\'); // => false\r\n\r\nfunction Parent(){}\r\nfunction Child(){}\r\nObject.setPrototypeOf(Child.prototype, Parent.prototype);\r\nnew Child instanceof Child; // => true\r\nnew Child instanceof Parent; // => true\r\n\r\nvar O = {};\r\nO[Symbol.toStringTag] = \'Foo\';\r\n\'\' + O; // => \'[object Foo]\'\r\n\r\n(function foo(){}).name // => \'foo\'\r\n```\r\nModule `es6.object.statics-accept-primitives`. In ES6 most `Object` static methods should work with primitives. [Example](http://goo.gl/35lPSi):\r\n```javascript\r\nObject.keys(\'qwe\'); // => [\'0\', \'1\', \'2\']\r\nObject.getPrototypeOf(\'qwe\') === String.prototype; // => true\r\n```\r\n#### ECMAScript 6: Array\r\nModules `es6.array.from`, `es6.array.of`, `es6.array.copy-within`, `es6.array.fill`, `es6.array.find` and `es6.array.find-index`.\r\n```javascript\r\nArray\r\n .from(iterable | array-like, mapFn(val, index)?, that) -> array\r\n .of(...args) -> array\r\n #copyWithin(target = 0, start = 0, end = @length) -> @\r\n #fill(val, start = 0, end = @length) -> @\r\n #find(fn(val, index, @), that) -> val\r\n #findIndex(fn(val, index, @), that) -> index\r\n #@@unscopables -> object (cap)\r\n```\r\n[Example](http://goo.gl/nxmJTe):\r\n```javascript\r\nArray.from(new Set([1, 2, 3, 2, 1])); // => [1, 2, 3]\r\nArray.from({0: 1, 1: 2, 2: 3, length: 3}); // => [1, 2, 3]\r\nArray.from(\'123\', Number); // => [1, 2, 3]\r\nArray.from(\'123\', function(it){\r\n return it * it;\r\n}); // => [1, 4, 9]\r\n\r\nArray.of(1); // => [1]\r\nArray.of(1, 2, 3); // => [1, 2, 3]\r\n\r\nfunction isOdd(val){\r\n return val % 2;\r\n}\r\n[4, 8, 15, 16, 23, 42].find(isOdd); // => 15\r\n[4, 8, 15, 16, 23, 42].findIndex(isOdd); // => 2\r\n[4, 8, 15, 16, 23, 42].find(isNaN); // => undefined\r\n[4, 8, 15, 16, 23, 42].findIndex(isNaN); // => -1\r\n\r\nArray(5).fill(42); // => [42, 42, 42, 42, 42]\r\n\r\n[1, 2, 3, 4, 5].copyWithin(0, 3); // => [4, 5, 3, 4, 5]\r\n```\r\n#### ECMAScript 6: String & RegExp\r\nModules `es6.string.from-code-point`, `es6.string.raw`, `es6.string.code-point-at`, `es6.string.ends-with`, `es6.string.includes`, `es6.string.repeat`, `es6.string.starts-with` and `es6.regexp`.\r\n```javascript\r\nString\r\n .fromCodePoint(...codePoints) -> str\r\n .raw({raw}, ...substitutions) -> str\r\n #includes(str, from?) -> bool\r\n #startsWith(str, from?) -> bool\r\n #endsWith(str, from?) -> bool\r\n #repeat(num) -> str\r\n #codePointAt(pos) -> uint\r\n[new] RegExp(pattern, flags?) -> regexp, ES6 fix: can alter flags (IE9+)\r\n #flags -> str (IE9+)\r\n```\r\n[Example](http://goo.gl/sdNGeJ):\r\n```javascript\r\n\'foobarbaz\'.includes(\'bar\'); // => true\r\n\'foobarbaz\'.includes(\'bar\', 4); // => false\r\n\'foobarbaz\'.startsWith(\'foo\'); // => true\r\n\'foobarbaz\'.startsWith(\'bar\', 3); // => true\r\n\'foobarbaz\'.endsWith(\'baz\'); // => true\r\n\'foobarbaz\'.endsWith(\'bar\', 6); // => true\r\n\r\n\'string\'.repeat(3); // => \'stringstringstring\'\r\n\r\n\'𠮷\'.codePointAt(0); // => 134071\r\nString.fromCodePoint(97, 134071, 98); // => \'a𠮷b\'\r\n\r\nvar name = \'Bob\';\r\nString.raw`Hi\\n${name}!`; // => \'Hi\\\\nBob!\' (ES6 template string syntax)\r\nString.raw({raw: \'test\'}, 0, 1, 2); // => \'t0e1s2t\'\r\n\r\nRegExp(/./g, \'m\'); // => /./m\r\n\r\n/foo/.flags; // => \'\'\r\n/foo/gim.flags; // => \'gim\'\r\n```\r\n#### ECMAScript 6: Number & Math\r\nModule `es6.number.constructor`. `Number` constructor support binary and octal literals, [example](http://goo.gl/jRd6b3):\r\n```javascript\r\nNumber(\'0b1010101\'); // => 85\r\nNumber(\'0o7654321\'); // => 2054353\r\n```\r\nModules `es6.number.statics` and `es6.math`.\r\n```javascript\r\nNumber\r\n .EPSILON -> num\r\n .isFinite(num) -> bool\r\n .isInteger(num) -> bool\r\n .isNaN(num) -> bool\r\n .isSafeInteger(num) -> bool\r\n .MAX_SAFE_INTEGER -> int\r\n .MIN_SAFE_INTEGER -> int\r\n .parseFloat(str) -> num\r\n .parseInt(str) -> int\r\nMath\r\n .acosh(num) -> num\r\n .asinh(num) -> num\r\n .atanh(num) -> num\r\n .cbrt(num) -> num\r\n .clz32(num) -> uint\r\n .cosh(num) -> num\r\n .expm1(num) -> num\r\n .fround(num) -> num\r\n .hypot(...args) -> num\r\n .imul(num, num) -> int\r\n .log1p(num) -> num\r\n .log10(num) -> num\r\n .log2(num) -> num\r\n .sign(num) -> 1 | -1 | 0 | -0 | NaN\r\n .sinh(num) -> num\r\n .tanh(num) -> num\r\n .trunc(num) -> num\r\n```\r\n\r\n### ECMAScript 6: Symbols\r\nModule `es6.symbol`.\r\n```javascript\r\nSymbol(description?) -> symbol\r\n .hasInstance -> @@hasInstance\r\n .isConcatSpreadable -> @@isConcatSpreadable\r\n .iterator -> @@iterator\r\n .match -> @@match\r\n .replace -> @@replace\r\n .search -> @@search\r\n .species -> @@species\r\n .split -> @@split\r\n .toPrimitive -> @@toPrimitive\r\n .toStringTag -> @@toStringTag\r\n .unscopables -> @@unscopables\r\n .for(key) -> symbol\r\n .keyFor(symbol) -> key\r\n .useSimple() -> void\r\n .useSetter() -> void\r\n .pure(description?) -> symbol || string\r\n .set(object, key, val) -> object\r\nObject\r\n .getOwnPropertySymbols(object) -> array\r\n```\r\n[Basic example](http://goo.gl/BbvWFc):\r\n```javascript\r\nvar Person = (function(){\r\n var NAME = Symbol(\'name\');\r\n function Person(name){\r\n this[NAME] = name;\r\n }\r\n Person.prototype.getName = function(){\r\n return this[NAME];\r\n };\r\n return Person;\r\n})();\r\n\r\nvar person = new Person(\'Vasya\');\r\nlog(person.getName()); // => \'Vasya\'\r\nlog(person[\'name\']); // => undefined\r\nlog(person[Symbol(\'name\')]); // => undefined, symbols are uniq\r\nfor(var key in person)log(key); // => only \'getName\', symbols are not enumerable\r\n```\r\n`Symbol.for` & `Symbol.keyFor` [example](http://goo.gl/0pdJjX):\r\n```javascript\r\nvar symbol = Symbol.for(\'key\');\r\nsymbol === Symbol.for(\'key\'); // true\r\nSymbol.keyFor(symbol); // \'key\'\r\n```\r\n[Example](http://goo.gl/mKVOQJ) with methods for getting own object keys:\r\n```javascript\r\nvar O = {a: 1};\r\nObject.defineProperty(O, \'b\', {value: 2});\r\nO[Symbol(\'c\')] = 3;\r\nObject.keys(O); // => [\'a\']\r\nObject.getOwnPropertyNames(O); // => [\'a\', \'b\']\r\nObject.getOwnPropertySymbols(O); // => [Symbol(c)]\r\nReflect.ownKeys(O); // => [\'a\', \'b\', Symbol(c)]\r\n```\r\n#### Caveats when using `Symbol` polyfill:\r\n\r\n* We can\'t add new primitive type, `Symbol` returns object.\r\n* By default, to hide the keys, `Symbol` polyfill defines setter in `Object.prototype`. For this reason, the `in` operator is not working correctly with `Symbol` polyfill: `Symbol() in {} // => true`.\r\n\r\nYou can disable defining setter in `Object.prototype`. [Example](http://goo.gl/N5UD7J):\r\n```javascript\r\nSymbol.useSimple();\r\nvar s1 = Symbol(\'s1\')\r\n , o1 = {};\r\no1[s1] = true;\r\nfor(var key in o1)log(key); // => \'Symbol(s1)_t.qamkg9f3q\', w/o native Symbol\r\n\r\nSymbol.useSetter();\r\nvar s2 = Symbol(\'s2\')\r\n , o2 = {};\r\no2[s2] = true;\r\nfor(var key in o2)log(key); // nothing\r\n```\r\n### ECMAScript 6: Collections\r\n`core-js` uses native collections in most case, just fixes methods / constructor, if it\'s required, and in old environment uses fast polyfill (O(1) lookup).\r\n#### Map\r\nModule `es6.map`. About iterators from this module [here](#ecmascript-6-iterators).\r\n```javascript\r\nnew Map(iterable (entries) ?) -> map\r\n #clear() -> void\r\n #delete(key) -> bool\r\n #forEach(fn(val, key, @), that) -> void\r\n #get(key) -> val\r\n #has(key) -> bool\r\n #set(key, val) -> @\r\n #size -> uint\r\n```\r\n[Example](http://goo.gl/RDbROF):\r\n```javascript\r\nvar a = [1];\r\n\r\nvar map = new Map([[\'a\', 1], [42, 2]]);\r\nmap.set(a, 3).set(true, 4);\r\n\r\nlog(map.size); // => 4\r\nlog(map.has(a)); // => true\r\nlog(map.has([1])); // => false\r\nlog(map.get(a)); // => 3\r\nmap.forEach(function(val, key){\r\n log(val); // => 1, 2, 3, 4\r\n log(key); // => \'a\', 42, [1], true\r\n});\r\nmap.delete(a);\r\nlog(map.size); // => 3\r\nlog(map.get(a)); // => undefined\r\nlog(Array.from(map)); // => [[\'a\', 1], [42, 2], [true, 4]]\r\n```\r\n#### Set\r\nModule `es6.set`. About iterators from this module [here](#ecmascript-6-iterators).\r\n```javascript\r\nnew Set(iterable?) -> set\r\n #add(key) -> @\r\n #clear() -> void\r\n #delete(key) -> bool\r\n #forEach(fn(el, el, @), that) -> void\r\n #has(key) -> bool\r\n #size -> uint\r\n```\r\n[Example](http://goo.gl/7XYya3):\r\n```javascript\r\nvar set = new Set([\'a\', \'b\', \'a\', \'c\']);\r\nset.add(\'d\').add(\'b\').add(\'e\');\r\nlog(set.size); // => 5\r\nlog(set.has(\'b\')); // => true\r\nset.forEach(function(it){\r\n log(it); // => \'a\', \'b\', \'c\', \'d\', \'e\'\r\n});\r\nset.delete(\'b\');\r\nlog(set.size); // => 4\r\nlog(set.has(\'b\')); // => false\r\nlog(Array.from(set)); // => [\'a\', \'c\', \'d\', \'e\']\r\n```\r\n#### WeakMap\r\nModule `es6.weak-map`.\r\n```javascript\r\nnew WeakMap(iterable (entries) ?) -> weakmap\r\n #delete(key) -> bool\r\n #get(key) -> val\r\n #has(key) -> bool\r\n #set(key, val) -> @\r\n```\r\n[Example](http://goo.gl/SILXyw):\r\n```javascript\r\nvar a = [1]\r\n , b = [2]\r\n , c = [3];\r\n\r\nvar wmap = new WeakMap([[a, 1], [b, 2]]);\r\nwmap.set(c, 3).set(b, 4);\r\nlog(wmap.has(a)); // => true\r\nlog(wmap.has([1])); // => false\r\nlog(wmap.get(a)); // => 1\r\nwmap.delete(a);\r\nlog(wmap.get(a)); // => undefined\r\n\r\n// Private properties store:\r\nvar Person = (function(){\r\n var names = new WeakMap;\r\n function Person(name){\r\n names.set(this, name);\r\n }\r\n Person.prototype.getName = function(){\r\n return names.get(this);\r\n };\r\n return Person;\r\n})();\r\n\r\nvar person = new Person(\'Vasya\');\r\nlog(person.getName()); // => \'Vasya\'\r\nfor(var key in person)log(key); // => only \'getName\'\r\n```\r\n#### WeakSet\r\nModule `es6.weak-set`.\r\n```javascript\r\nnew WeakSet(iterable?) -> weakset\r\n #add(key) -> @\r\n #delete(key) -> bool\r\n #has(key) -> bool\r\n```\r\n[Example](http://goo.gl/TdFbEx):\r\n```javascript\r\nvar a = [1]\r\n , b = [2]\r\n , c = [3];\r\n\r\nvar wset = new WeakSet([a, b, a]);\r\nwset.add(c).add(b).add(c);\r\nlog(wset.has(b)); // => true\r\nlog(wset.has([2])); // => false\r\nwset.delete(b);\r\nlog(wset.has(b)); // => false\r\n```\r\n#### Caveats when using collections polyfill:\r\n\r\n* Frozen objects as collection keys are supported, but not recomended - it\'s slow (O(n) instead of O(1)) and, for weak-collections, leak.\r\n* Weak-collections polyfill stores values as hidden properties of keys. It works correct and not leak in most cases. However, it is desirable to store a collection longer than its keys.\r\n* Unlike the `default` or `shim` versions `core-js`, `library` version does not repair broken native methods of collections prototypes.\r\n\r\n### ECMAScript 6: Iterators\r\nModules `es6.string.iterator` and `es6.array.iterator`:\r\n```javascript\r\nString\r\n #@@iterator() -> iterator\r\nArray\r\n #values() -> iterator\r\n #keys() -> iterator\r\n #entries() -> iterator (entries)\r\n #@@iterator() -> iterator\r\nArguments\r\n #@@iterator() -> iterator (sham, available only in core-js methods)\r\n```\r\nModules `es6.map` and `es6.set`:\r\n```javascript\r\nMap\r\n #values() -> iterator\r\n #keys() -> iterator\r\n #entries() -> iterator (entries)\r\n #@@iterator() -> iterator (entries)\r\nSet\r\n #values() -> iterator\r\n #keys() -> iterator\r\n #entries() -> iterator (entries)\r\n #@@iterator() -> iterator\r\n```\r\nModule `web.dom.iterable`:\r\n```javascript\r\nNodeList\r\n #@@iterator() -> iterator\r\n```\r\n[Example](http://goo.gl/nzHVQF):\r\n```javascript\r\nvar string = \'a𠮷b\';\r\n\r\nfor(var val of string)log(val); // => \'a\', \'𠮷\', \'b\'\r\n\r\nvar array = [\'a\', \'b\', \'c\'];\r\n\r\nfor(var val of array)log(val); // => \'a\', \'b\', \'c\'\r\nfor(var val of array.values())log(val); // => \'a\', \'b\', \'c\'\r\nfor(var key of array.keys())log(key); // => 0, 1, 2\r\nfor(var [key, val] of array.entries()){\r\n log(key); // => 0, 1, 2\r\n log(val); // => \'a\', \'b\', \'c\'\r\n}\r\n\r\nvar map = new Map([[\'a\', 1], [\'b\', 2], [\'c\', 3]]);\r\n\r\nfor(var [key, val] of map){\r\n log(key); // => \'a\', \'b\', \'c\'\r\n log(val); // => 1, 2, 3\r\n}\r\nfor(var val of map.values())log(val); // => 1, 2, 3\r\nfor(var key of map.keys())log(key); // => \'a\', \'b\', \'c\'\r\nfor(var [key, val] of map.entries()){\r\n log(key); // => \'a\', \'b\', \'c\'\r\n log(val); // => 1, 2, 3\r\n}\r\n\r\nvar set = new Set([1, 2, 3, 2, 1]);\r\n\r\nfor(var val of set)log(val); // => 1, 2, 3\r\nfor(var val of set.values())log(val); // => 1, 2, 3\r\nfor(var key of set.keys())log(key); // => 1, 2, 3\r\nfor(var [key, val] of set.entries()){\r\n log(key); // => 1, 2, 3\r\n log(val); // => 1, 2, 3\r\n}\r\n\r\nfor(var x of document.querySelectorAll(\'*\')){\r\n log(x.id);\r\n}\r\n```\r\nModule `core.iter-helpers` - helpers for check iterable / get iterator in `library` version or, for example, for `arguments` object:\r\n```javascript\r\ncore\r\n .isIterable(var) -> bool\r\n .getIterator(iterable) -> iterator\r\n```\r\n[Example](http://goo.gl/uFvXW6):\r\n```js\r\nvar list = (function(){\r\n return arguments;\r\n})(1, 2, 3);\r\n\r\nlog(core.isIterable(list)); // true;\r\n\r\nvar iter = core.getIterator(list);\r\nlog(iter.next().value); // 1\r\nlog(iter.next().value); // 2\r\nlog(iter.next().value); // 3\r\nlog(iter.next().value); // undefined\r\n```\r\nModule `core.$for` - iterators chaining - `for-of` and array / generator comprehensions helpers for ES5- syntax.\r\n```javascript\r\n$for(iterable, entries) -> iterator ($for)\r\n #of(fn(value, key?), that) -> void\r\n #array(mapFn(value, key?)?, that) -> array\r\n #filter(fn(value, key?), that) -> iterator ($for)\r\n #map(fn(value, key?), that) -> iterator ($for)\r\n```\r\n[Examples](http://goo.gl/Jtz0oG):\r\n```javascript\r\n$for(new Set([1, 2, 3, 2, 1])).of(function(it){\r\n log(it); // => 1, 2, 3\r\n});\r\n\r\n$for([1, 2, 3].entries(), true).of(function(key, value){\r\n log(key); // => 0, 1, 2\r\n log(value); // => 1, 2, 3\r\n});\r\n\r\n$for(\'abc\').of(console.log, console); // => \'a\', \'b\', \'c\'\r\n\r\n$for([1, 2, 3, 4, 5]).of(function(it){\r\n log(it); // => 1, 2, 3\r\n if(it == 3)return false;\r\n});\r\n\r\nvar ar1 = $for([1, 2, 3]).array(function(v){\r\n return v * v;\r\n}); // => [1, 4, 9]\r\n\r\nvar set = new Set([1, 2, 3, 2, 1]);\r\nvar ar1 = $for(set).filter(function(v){\r\n return v % 2;\r\n}).array(function(v){\r\n return v * v;\r\n}); // => [1, 9]\r\n\r\nvar iter = $for(set).filter(function(v){\r\n return v % 2;\r\n}).map(function(v){\r\n return v * v;\r\n});\r\niter.next(); // => {value: 1, done: false}\r\niter.next(); // => {value: 9, done: false}\r\niter.next(); // => {value: undefined, done: true}\r\n\r\nvar map1 = new Map([[\'a\', 1], [\'b\', 2], [\'c\', 3]]);\r\nvar map2 = new Map($for(map1, true).filter(function(k, v){\r\n return v % 2;\r\n}).map(function(k, v){\r\n return [k + k, v * v];\r\n})); // => Map {aa: 1, cc: 9}\r\n```\r\n\r\n### ECMAScript 6: Promises\r\nModule `es6.promise`.\r\n```javascript\r\nnew Promise(executor(resolve(var), reject(var))) -> promise\r\n #then(resolved(var), rejected(var)) -> promise\r\n #catch(rejected(var)) -> promise\r\n .resolve(var || promise) -> promise\r\n .reject(var) -> promise\r\n .all(iterable) -> promise\r\n .race(iterable) -> promise\r\n```\r\nBasic [example](http://goo.gl/vGrtUC):\r\n```javascript\r\nfunction sleepRandom(time){\r\n return new Promise(function(resolve, reject){\r\n setTimeout(resolve, time * 1e3, 0 | Math.random() * 1e3);\r\n });\r\n}\r\n\r\nlog(\'Run\'); // => Run\r\nsleepRandom(5).then(function(result){\r\n log(result); // => 869, after 5 sec.\r\n return sleepRandom(10);\r\n}).then(function(result){\r\n log(result); // => 202, after 10 sec.\r\n}).then(function(){\r\n log(\'immediately after\'); // => immediately after\r\n throw Error(\'Irror!\');\r\n}).then(function(){\r\n log(\'will not be displayed\');\r\n}).catch(log); // => => Error: Irror!\r\n```\r\n`Promise.resolve` and `Promise.reject` [example](http://goo.gl/vr8TN3):\r\n```javascript\r\nPromise.resolve(42).then(log); // => 42\r\nPromise.reject(42).catch(log); // => 42\r\n\r\nPromise.resolve($.getJSON(\'/data.json\')); // => ES6 promise\r\n```\r\n`Promise.all` [example](http://goo.gl/RdoDBZ):\r\n```javascript\r\nPromise.all([\r\n \'foo\',\r\n sleepRandom(5),\r\n sleepRandom(15),\r\n sleepRandom(10) // after 15 sec:\r\n]).then(log); // => [\'foo\', 956, 85, 382]\r\n```\r\n`Promise.race` [example](http://goo.gl/L8ovkJ):\r\n```javascript\r\nfunction timeLimit(promise, time){\r\n return Promise.race([promise, new Promise(function(resolve, reject){\r\n setTimeout(reject, time * 1e3, Error(\'Await > \' + time + \' sec\'));\r\n })]);\r\n}\r\n\r\ntimeLimit(sleepRandom(5), 10).then(log); // => 853, after 5 sec.\r\ntimeLimit(sleepRandom(15), 10).catch(log); // Error: Await > 10 sec\r\n```\r\nECMAScript 7 [async functions](https://github.com/lukehoban/ecmascript-asyncawait) [example](http://goo.gl/wnQS4j):\r\n```javascript\r\nvar delay = time => new Promise(resolve => setTimeout(resolve, time))\r\n\r\nasync function sleepRandom(time){\r\n await delay(time * 1e3);\r\n return 0 | Math.random() * 1e3;\r\n};\r\nasync function sleepError(time, msg){\r\n await delay(time * 1e3);\r\n throw Error(msg);\r\n};\r\n\r\n(async () => {\r\n try {\r\n log(\'Run\'); // => Run\r\n log(await sleepRandom(5)); // => 936, after 5 sec.\r\n var [a, b, c] = await Promise.all([\r\n sleepRandom(5),\r\n sleepRandom(15),\r\n sleepRandom(10)\r\n ]);\r\n log(a, b, c); // => 210 445 71, after 15 sec.\r\n await sleepError(5, \'Irror!\');\r\n log(\'Will not be displayed\');\r\n } catch(e){\r\n log(e); // => Error: \'Irror!\', after 5 sec.\r\n }\r\n})();\r\n```\r\n### ECMAScript 6: Reflect\r\nModule `es6.reflect`.\r\n```javascript\r\nReflect\r\n .apply(target, thisArgument, argumentsList) -> var\r\n .construct(target, argumentsList, newTarget?) -> object\r\n .defineProperty(target, propertyKey, attributes) -> bool\r\n .deleteProperty(target, propertyKey) -> bool\r\n .enumerate(target) -> iterator\r\n .get(target, propertyKey, receiver?) -> var\r\n .getOwnPropertyDescriptor(target, propertyKey) -> desc\r\n .getPrototypeOf(target) -> object | null\r\n .has(target, propertyKey) -> bool\r\n .isExtensible(target) -> bool\r\n .ownKeys(target) -> array\r\n .preventExtensions(target) -> bool\r\n .set(target, propertyKey, V, receiver?) -> bool\r\n .setPrototypeOf(target, proto) -> bool, sham(ie11+)\r\n```\r\n[Example](http://goo.gl/gVT0cH):\r\n```javascript\r\nvar O = {a: 1};\r\nObject.defineProperty(O, \'b\', {value: 2});\r\nO[Symbol(\'c\')] = 3;\r\nReflect.ownKeys(O); // => [\'a\', \'b\', Symbol(c)]\r\n\r\nfunction C(a, b){\r\n this.c = a + b;\r\n}\r\n\r\nvar instance = Reflect.construct(C, [20, 22]);\r\ninstance.c; // => 42\r\n```\r\n### ECMAScript 7\r\n* `Array#includes` [proposal](https://github.com/domenic/Array.prototype.includes) - module `es7.array.includes`\r\n* `String#at` [proposal](https://github.com/mathiasbynens/String.prototype.at) - module `es7.string.at`\r\n* `Object.values`, `Object.entries` [tc39 discuss](https://github.com/rwaldron/tc39-notes/blob/master/es6/2014-04/apr-9.md#51-objectentries-objectvalues) - module `es7.object.to-array`\r\n* `Object.getOwnPropertyDescriptors` [proposal](https://gist.github.com/WebReflection/9353781) - module `es7.object.get-own-property-descriptors`\r\n* `RegExp.escape` [proposal](https://gist.github.com/kangax/9698100) - module `es7.regexp.escape`\r\n* `Set#toJSON` [proposal](https://github.com/DavidBruant/Map-Set.prototype.toJSON) - module `es7.set.to-json`\r\n\r\n```javascript\r\nArray\r\n #includes(var, from?) -> bool\r\nString\r\n #at(index) -> string\r\nObject\r\n .values(object) -> array\r\n .entries(object) -> array\r\n .getOwnPropertyDescriptors(object) -> object\r\nRegExp\r\n .escape(str) -> str\r\nSet\r\n #toJSON() -> array\r\n```\r\n[Examples](http://goo.gl/inyWkw):\r\n```javascript\r\n[1, 2, 3].includes(2); // => true\r\n[1, 2, 3].includes(4); // => false\r\n[1, 2, 3].includes(2, 2); // => false\r\n\r\n[NaN].indexOf(NaN); // => -1\r\n[NaN].includes(NaN); // => true\r\nArray(1).indexOf(undefined); // => -1\r\nArray(1).includes(undefined); // => true\r\n\r\n\'a𠮷b\'.at(1); // => \'𠮷\'\r\n\'a𠮷b\'.at(1).length; // => 2\r\n\r\nObject.values({a: 1, b: 2, c: 3}); // => [1, 2, 3]\r\nObject.entries({a: 1, b: 2, c: 3}); // => [[\'a\', 1], [\'b\', 2], [\'c\', 3]]\r\n\r\n// Shallow object cloning with prototype and descriptors:\r\nvar copy = Object.create(Object.getPrototypeOf(O), Object.getOwnPropertyDescriptors(O));\r\n// Mixin:\r\nObject.defineProperties(target, Object.getOwnPropertyDescriptors(source));\r\n\r\nRegExp.escape(\'Hello -[]{}()*+?.,\\\\^$|\'); // => \'Hello \\-\\[\\]\\{\\}\\(\\)\\*\\+\\?\\.\\,\\\\\\^\\$\\|\'\r\n\r\nJSON.stringify(new Set([1, 2, 3, 2, 1])); // => \'[1,2,3]\'\r\n```\r\n### Mozilla JavaScript: Array generics\r\nModule `js.array.statics`.\r\n```javascript\r\nArray\r\n .{...ArrayPrototype methods}\r\n```\r\n\r\n```javascript\r\nArray.slice(arguments, 1);\r\n\r\nArray.join(\'abcdef\', \'+\'); // => \'a+b+c+d+e+f\'\r\n\r\nvar form = document.getElementsByClassName(\'form__input\');\r\nArray.reduce(form, function(memo, it){\r\n memo[it.name] = it.value;\r\n return memo;\r\n}, {}); // => {name: \'Vasya\', age: \'42\', sex: \'yes, please\'}\r\n```\r\n### setTimeout / setInterval\r\nModule `web.timers`. Additional arguments fix for IE9-.\r\n```javascript\r\nsetTimeout(fn(...args), time, ...args) -> id\r\nsetInterval(fn(...args), time, ...args) -> id\r\n```\r\n```javascript\r\n// Before:\r\nsetTimeout(log.bind(null, 42), 1000);\r\n// After:\r\nsetTimeout(log, 1000, 42);\r\n```\r\n### setImmediate\r\nModule `web.immediate`. [setImmediate](https://developer.mozilla.org/en-US/docs/Web/API/Window.setImmediate) polyfill.\r\n```javascript\r\nsetImmediate(fn(...args), ...args) -> id\r\nclearImmediate(id) -> void\r\n```\r\n[Example](http://goo.gl/6nXGrx):\r\n```javascript\r\nsetImmediate(function(arg1, arg2){\r\n log(arg1, arg2); // => Message will be displayed with minimum delay\r\n}, \'Message will be displayed\', \'with minimum delay\');\r\n\r\nclearImmediate(setImmediate(function(){\r\n log(\'Message will not be displayed\');\r\n}));\r\n```\r\n### Console\r\nModule `core.log`. Console cap for old browsers and some additional functionality. In IE, Node.js / IO.js and Firebug `console` methods not require call from `console` object, but in Chromium and V8 this throws error. For some reason, we can\'t replace `console` methods by their bound versions. Add `log` object with bound console methods. Some more sugar: `log` is shortcut for `log.log`, we can disable output.\r\n```javascript\r\nlog ==== log.log\r\n .{...console API}\r\n .enable() -> void\r\n .disable() -> void\r\n```\r\n```javascript\r\n// Before:\r\nif(window.console && console.warn)console.warn(42);\r\n// After:\r\nlog.warn(42);\r\n\r\n// Before:\r\nsetTimeout(console.warn.bind(console, 42), 1000);\r\n[1, 2, 3].forEach(console.warn, console);\r\n// After:\r\nsetTimeout(log.warn, 1000, 42);\r\n[1, 2, 3].forEach(log.warn);\r\n\r\n// log is shortcut for log.log\r\nsetImmediate(log, 42); // => 42\r\n\r\nlog.disable();\r\nlog.warn(\'Console is disabled, you will not see this message.\');\r\nlog.enable();\r\nlog.warn(\'Console is enabled again.\');\r\n```\r\n### Object\r\nModule `core.object`.\r\n```javascript\r\nObject\r\n .isObject(var) -> bool\r\n .classof(var) -> string \r\n .define(target, mixin) -> target\r\n .make(proto | null, mixin?) -> object\r\n```\r\nObject classify [examples](http://goo.gl/YZQmGo):\r\n```javascript\r\nObject.isObject({}); // => true\r\nObject.isObject(isNaN); // => true\r\nObject.isObject(null); // => false\r\n\r\nvar classof = Object.classof;\r\n\r\nclassof(null); // => \'Null\'\r\nclassof(undefined); // => \'Undefined\'\r\nclassof(1); // => \'Number\'\r\nclassof(true); // => \'Boolean\'\r\nclassof(\'string\'); // => \'String\'\r\nclassof(Symbol()); // => \'Symbol\'\r\n\r\nclassof(new Number(1)); // => \'Number\'\r\nclassof(new Boolean(true)); // => \'Boolean\'\r\nclassof(new String(\'string\')); // => \'String\'\r\n\r\nvar fn = function(){}\r\n , list = (function(){return arguments})(1, 2, 3);\r\n\r\nclassof({}); // => \'Object\'\r\nclassof(fn); // => \'Function\'\r\nclassof([]); // => \'Array\'\r\nclassof(list); // => \'Arguments\'\r\nclassof(/./); // => \'RegExp\'\r\nclassof(new TypeError); // => \'Error\'\r\n\r\nclassof(new Set); // => \'Set\'\r\nclassof(new Map); // => \'Map\'\r\nclassof(new WeakSet); // => \'WeakSet\'\r\nclassof(new WeakMap); // => \'WeakMap\'\r\nclassof(new Promise(fn)); // => \'Promise\'\r\n\r\nclassof([].values()); // => \'Array Iterator\'\r\nclassof(new Set().values()); // => \'Set Iterator\'\r\nclassof(new Map().values()); // => \'Map Iterator\'\r\n\r\nclassof(Math); // => \'Math\'\r\nclassof(JSON); // => \'JSON\'\r\n\r\nfunction Example(){}\r\nExample.prototype[Symbol.toStringTag] = \'Example\';\r\n\r\nclassof(new Example); // => \'Example\'\r\n```\r\n`Object.define` and `Object.make` [examples](http://goo.gl/rtpD5Z):\r\n```javascript\r\n// Before:\r\nObject.defineProperty(target, \'c\', {\r\n enumerable: true,\r\n configurable: true,\r\n get: function(){\r\n return this.a + this.b;\r\n }\r\n});\r\n\r\n// After:\r\nObject.define(target, {\r\n get c(){\r\n return this.a + this.b;\r\n }\r\n});\r\n\r\n// Shallow object cloning with prototype and descriptors:\r\nvar copy = Object.make(Object.getPrototypeOf(src), src);\r\n\r\n// Simple inheritance:\r\nfunction Vector2D(x, y){\r\n this.x = x;\r\n this.y = y;\r\n}\r\nObject.define(Vector2D.prototype, {\r\n get xy(){\r\n return Math.hypot(this.x, this.y);\r\n }\r\n});\r\nfunction Vector3D(x, y, z){\r\n Vector2D.apply(this, arguments);\r\n this.z = z;\r\n}\r\nVector3D.prototype = Object.make(Vector2D.prototype, {\r\n constructor: Vector3D,\r\n get xyz(){\r\n return Math.hypot(this.x, this.y, this.z);\r\n }\r\n});\r\n\r\nvar vector = new Vector3D(9, 12, 20);\r\nlog(vector.xy); // => 15\r\nlog(vector.xyz); // => 25\r\nvector.y++;\r\nlog(vector.xy); // => 15.811388300841896\r\nlog(vector.xyz); // => 25.495097567963924\r\n```\r\n### Dict\r\nModule `core.dict`. Based on [TC39 discuss](https://github.com/rwaldron/tc39-notes/blob/master/es6/2012-11/nov-29.md#collection-apis-review) / [strawman](http://wiki.ecmascript.org/doku.php?id=harmony:modules_standard#dictionaries).\r\n```javascript\r\n[new] Dict(iterable (entries) | object ?) -> dict\r\n .isDict(var) -> bool\r\n .values(object) -> iterator\r\n .keys(object) -> iterator\r\n .entries(object) -> iterator (entries)\r\n .has(object, key) -> bool\r\n .get(object, key) -> val\r\n .set(object, key, value) -> object\r\n .forEach(object, fn(val, key, @), that) -> void\r\n .map(object, fn(val, key, @), that) -> new @\r\n .mapPairs(object, fn(val, key, @), that) -> new @\r\n .filter(object, fn(val, key, @), that) -> new @\r\n .some(object, fn(val, key, @), that) -> bool\r\n .every(object, fn(val, key, @), that) -> bool\r\n .find(object, fn(val, key, @), that) -> val\r\n .findKey(object, fn(val, key, @), that) -> key\r\n .keyOf(object, var) -> key\r\n .includes(object, var) -> bool\r\n .reduce(object, fn(memo, val, key, @), memo?) -> var\r\n .turn(object, fn(memo, val, key, @), memo = new @) -> memo\r\n```\r\n`Dict` create object without prototype from iterable or simple object. [Example](http://goo.gl/pnp8Vr):\r\n```javascript\r\nvar map = new Map([[\'a\', 1], [\'b\', 2], [\'c\', 3]]);\r\n\r\nDict(); // => {__proto__: null}\r\nDict({a: 1, b: 2, c: 3}); // => {__proto__: null, a: 1, b: 2, c: 3}\r\nDict(map); // => {__proto__: null, a: 1, b: 2, c: 3}\r\nDict([1, 2, 3].entries()); // => {__proto__: null, 0: 1, 1: 2, 2: 3}\r\n\r\nvar dict = Dict({a: 42});\r\ndict instanceof Object; // => false\r\ndict.a; // => 42\r\ndict.toString; // => undefined\r\n\'a\' in dict; // => true\r\n\'hasOwnProperty\' in dict; // => false\r\n\r\nDict.isDict({}); // => false\r\nDict.isDict(Dict()); // => true\r\n```\r\n`Dict.keys`, `Dict.values` and `Dict.entries` returns iterators for objects, [examples](http://goo.gl/4u8UDK):\r\n```javascript\r\nvar dict = {a: 1, b: 2, c: 3};\r\n\r\nfor(var key of Dict.keys(dict))log(key); // => \'a\', \'b\', \'c\'\r\n\r\nfor(var val of Dict.values(dict))log(val); // => 1, 2, 3\r\n\r\nfor(var [key, val] of Dict.entries(dict)){\r\n log(key); // => \'a\', \'b\', \'c\'\r\n log(val); // => 1, 2, 3\r\n}\r\n\r\nnew Map(Dict.entries(dict)); // => Map {a: 1, b: 2, c: 3}\r\n\r\nnew Map((for([k, v] of Dict.entries(dict))if(v % 2)[k + k, v * v])); // => Map {aa: 1, cc: 9}\r\n```\r\nBasic dict operations for objects with prototype [example](http://goo.gl/B28UnG):\r\n```js\r\n\'q\' in {q: 1}; // => true\r\n\'toString\' in {}; // => true\r\n\r\nDict.has({q: 1}, \'q\'); // => true\r\nDict.has({}, \'toString\'); // => false\r\n\r\n({q: 1})[\'q\']; // => 1\r\n({}).toString; // => function toString(){ [native code] }\r\n\r\nDict.get({q: 1}, \'q\'); // => 1\r\nDict.get({}, \'toString\'); // => undefined\r\n\r\nvar O = {};\r\nO[\'q\'] = 1;\r\nO[\'q\']; // => 1\r\nO[\'__proto__\'] = {w: 2};\r\nO[\'__proto__\']; // => {w: 2}\r\nO[\'w\']; // => 2\r\n\r\nvar O = {};\r\nDict.set(O, \'q\', 1);\r\nO[\'q\']; // => 1\r\nDict.set(O, \'__proto__\', {w: 2});\r\nO[\'__proto__\']; // => {w: 2}\r\nO[\'w\']; // => undefined\r\n```\r\nOther methods of `Dict` module are static equialents of `Array.prototype` methods for dictionaries, [examples](http://goo.gl/yARYXR):\r\n```javascript\r\nvar dict = {a: 1, b: 2, c: 3};\r\n\r\nDict.forEach(dict, console.log, console);\r\n// => 1, \'a\', {a: 1, b: 2, c: 3}\r\n// => 2, \'b\', {a: 1, b: 2, c: 3}\r\n// => 3, \'c\', {a: 1, b: 2, c: 3}\r\n\r\nDict.map(dict, function(it){\r\n return it * it;\r\n}); // => {a: 1, b: 4, c: 9}\r\n\r\nDict.mapPairs(dict, function(val, key){\r\n if(key != \'b\')return [key + key, val * val];\r\n}); // => {aa: 1, cc: 9}\r\n\r\nDict.filter(dict, function(it){\r\n return it % 2;\r\n}); // => {a: 1, c: 3}\r\n\r\nDict.some(dict, function(it){\r\n return it === 2;\r\n}); // => true\r\n\r\nDict.every(dict, function(it){\r\n return it === 2;\r\n}); // => false\r\n\r\nDict.find(dict, function(it){\r\n return it > 2;\r\n}); // => 3\r\nDict.find(dict, function(it){\r\n return it > 4;\r\n}); // => undefined\r\n\r\nDict.findKey(dict, function(it){\r\n return it > 2;\r\n}); // => \'c\'\r\nDict.findKey(dict, function(it){\r\n return it > 4;\r\n}); // => undefined\r\n\r\nDict.keyOf(dict, 2); // => \'b\'\r\nDict.keyOf(dict, 4); // => undefined\r\n\r\nDict.includes(dict, 2); // => true\r\nDict.includes(dict, 4); // => false\r\n\r\nDict.reduce(dict, function(memo, it){\r\n return memo + it;\r\n}); // => 6\r\nDict.reduce(dict, function(memo, it){\r\n return memo + it;\r\n}, \'\'); // => \'123\'\r\n\r\nDict.turn(dict, function(memo, it, key){\r\n memo[key + key] = it;\r\n}); // => {aa: 1, bb: 2, cc: 3}\r\nDict.turn(dict, function(memo, it, key){\r\n it % 2 && memo.push(key + it);\r\n}, []); // => [\'a1\', \'c3\']\r\n```\r\n### Partial application\r\nModule `core.binding`.\r\n```javascript\r\nFunction\r\n #part(...args | _) -> fn(...args)\r\n #only(num, that /* = @ */) -> (fn | boundFn)(...args)\r\nObject\r\n #[_](key) -> boundFn\r\n```\r\n`Function#part` partial apply function without `this` binding. Uses global variable `_` (`core._` for builds without global namespace pollution) as placeholder and not conflict with `Underscore` / `LoDash`. [Examples](http://goo.gl/p9ZJ8K):\r\n```javascript\r\nvar fn1 = log.part(1, 2);\r\nfn1(3, 4); // => 1, 2, 3, 4\r\n\r\nvar fn2 = log.part(_, 2, _, 4);\r\nfn2(1, 3); // => 1, 2, 3, 4\r\n\r\nvar fn3 = log.part(1, _, _, 4);\r\nfn3(2, 3); // => 1, 2, 3, 4\r\n\r\nfn2(1, 3, 5); // => 1, 2, 3, 4, 5\r\nfn2(1); // => 1, 2, undefined, 4\r\n```\r\nMethod `Object#[_]` extracts bound method from object, [examples](http://goo.gl/dQsSTi):\r\n```javascript\r\n[\'foobar\', \'foobaz\', \'barbaz\'].filter(/bar/[_](\'test\')); // => [\'foobar\', \'barbaz\']\r\n\r\nvar has = {}.hasOwnProperty[_](\'call\');\r\n\r\nlog(has({key: 42}, \'foo\')); // => false\r\nlog(has({key: 42}, \'key\')); // => true\r\n\r\nvar array = []\r\n , push = array[_](\'push\');\r\npush(1);\r\npush(2, 3);\r\nlog(array); // => [1, 2, 3];\r\n```\r\nMethod `Function#only` limits number of arguments. [Example](http://goo.gl/ROgBsL):\r\n```javascript\r\n[1, 2, 3].forEach(log.only(1)); // => 1, 2, 3\r\n```\r\n### Date formatting\r\nModule `core.date`. Much more simple and compact (~60 lines with `en` & `ru` locales) than [Intl](https://github.com/andyearnshaw/Intl.js) or [Moment.js](http://momentjs.com/). Use them if you need extended work with `Date`.\r\n```javascript\r\nDate\r\n #format(str, key?) -> str\r\n #formatUTC(str, key?) -> str\r\ncore\r\n .addLocale(key, object) -> core\r\n .locale(key?) -> key\r\n```\r\nToken | Unit | Sample\r\n------|----- | ------\r\ns | Seconds | 0-59\r\nss | Seconds, 2 digits | 00-59\r\nm | Minutes | 0-59\r\nmm | Minutes, 2 digits | 00-59\r\nh | Hours | 0-23\r\nhh | Hours, 2 digits | 00-23\r\nD | Date | 1-31\r\nDD | Date, 2 digits | 01-31\r\nW | Weekday, string | Вторник\r\nN | Month | 1-12\r\nNN | Month, 2 digits | 01-12\r\nM | Month, string | Ноябрь\r\nMM | Of month, string | Ноября\r\nY | Year, full | 2014\r\nYY | Year, 2 digits | 14\r\n[Examples](http://goo.gl/nkCJ15):\r\n```javascript\r\nnew Date().format(\'W, MM D, YY, h:mm:ss\'); // => \'Friday, November 28, 14, 18:47:05\'\r\nnew Date().formatUTC(\'W, MM D, YY, h:mm:ss\'); // => \'Friday, November 28, 14, 12:47:05\'\r\n\r\nnew Date().format(\'W, D MM Y г., h:mm:ss\', \'ru\'); // => \'Пятница, 28 Ноября 2014 г., 18:07:25\'\r\n\r\ncore.locale(\'ru\');\r\nnew Date().format(\'W, D MM Y г., h:mm:ss\'); // => \'Пятница, 28 Ноября 2014 г., 18:07:25\'\r\n\r\nnew Date().format(\'DD.NN.YY\'); // => \'28.11.14\'\r\nnew Date().format(\'hh:mm:ss\'); // => \'18:47:05\'\r\nnew Date().format(\'DD.NN.Y hh:mm:ss\'); // => \'28.11.2014 18:47:05\'\r\nnew Date().format(\'W, D MM Y года\'); // => \'Пятница, 28 Ноября 2014 года\'\r\nnew Date().format(\'D MM, h:mm\'); // => \'28 Ноября, 16:47\'\r\nnew Date().format(\'M Y\'); // => \'Ноябрь 2014\'\r\n\r\n(typeof core != \'undefined\' ? core : require(\'core-js/library\')).addLocale(\'ru\', {\r\n weekdays: \'Воскресенье,Понедельник,Вторник,Среда,Четверг,Пятница,Суббота\',\r\n months: \'Январ:я|ь,Феврал:я|ь,Март:а|,Апрел:я|ь,Ма:я|й,Июн:я|ь,Июл:я|ь,Август:а|,Сентябр:я|ь,Октябр:я|ь,Ноябр:я|ь,Декабр:я|ь\'\r\n});\r\n```\r\n### Array\r\nModule `core.array.turn`.\r\n```javascript\r\nArray\r\n #turn(fn(memo, val, index, @), memo = []) -> memo\r\n```\r\nMethod `Array#turn` reduce array to object, [example](http://goo.gl/zZbvq7):\r\n```javascript\r\n[1, 2, 3, 4, 5].turn(function(memo, it){\r\n memo[\'key\' + it] = !!(it % 2);\r\n}, {}); // => {key1: true, key2: false, key3: true, key4: false, key5: true}\r\n\r\n[1, 2, 3, 4, 5, 6, 7, 8, 9].turn(function(memo, it){\r\n it % 2 && memo.push(it * it);\r\n if(memo.length == 3)return false;\r\n}); // => [1, 9, 25]\r\n```\r\n### Number\r\nModules `core.number.iterator` and `core.number.math`.\r\n```javascript\r\nNumber\r\n #@@iterator() -> iterator\r\n #random(lim = 0) -> num\r\n #{...Math} \r\n```\r\nNumber Iterator [examples](http://goo.gl/RI60Ot):\r\n```javascript\r\nfor(var i of 3)log(i); // => 0, 1, 2\r\n\r\nArray.from(10, Math.random); // => [0.9817775336559862, 0.02720663254149258, ...]\r\n\r\nArray.from(10); // => [0, 1, 2, 3, 4, 5, 6, 7, 8, 9]\r\n\r\nArray.from(10, function(it){\r\n return this + it * it;\r\n}, .42); // => [0.42, 1.42, 4.42, 9.42, 16.42, 25.42, 36.42, 49.42, 64.42, 81.42]\r\n\r\n// Comprehensions:\r\n[for(i of 10)if(i % 2)i * i]; // => [1, 9, 25, 49, 81]\r\n\r\nDict((for(i of 3)[\'key\' + i, !(i % 2)])); // => {key0: true, key1: false, key2: true}\r\n```\r\n`Math` methods in `Number.prototype` [examples](http://goo.gl/06bs1k):\r\n```javascript\r\n3..pow(3); // => 27\r\n(-729).abs().sqrt(); // => 27\r\n\r\n10..random(20); // => Random number (10, 20), for example, 16.818793776910752\r\n10..random(20).floor(); // => Random integer [10, 19], for example, 16\r\n\r\nvar array = [1, 2, 3, 4, 5];\r\narray[array.length.random().floor()]; // => Random element, for example, 4\r\n```\r\n### Escaping characters\r\nModule `core.string.escape-html`.\r\n```javascript\r\nString\r\n #escapeHTML() -> str\r\n #unescapeHTML() -> str\r\n```\r\n[Examples](http://goo.gl/6bOvsQ):\r\n```javascript\r\n\'<script>doSomething();</script>\'.escapeHTML(); // => \'<script>doSomething();</script>\'\r\n\'<script>doSomething();</script>\'.unescapeHTML(); // => \'<script>doSomething();</script>\'\r\n```\r\n### delay\r\nModule `core.delay`. [Promise](#ecmascript-6-promises)-returning delay function, [esdiscuss](https://esdiscuss.org/topic/promise-returning-delay-function). [Example](http://goo.gl/lbucba):\r\n```javascript\r\ndelay(1e3).then(() => log(\'after 1 sec\'));\r\n\r\n(async () => {\r\n await delay(3e3);\r\n log(\'after 3 sec\');\r\n \r\n while(await delay(3e3))log(\'each 3 sec\');\r\n})();\r\n```\r\n\r\n## Changelog\r\n##### 0.8.4 - 2015.04.18\r\n * uses `webpack` instead of `browserify` for browser builds - more compression-friendly result\r\n\r\n##### 0.8.3 - 2015.04.14\r\n * fixed `Array` statics with single entry points\r\n\r\n##### 0.8.2 - 2015.04.13\r\n * [`Math.fround`](#ecmascript-6-number--math) now also works in IE9-\r\n * added [`Set#toJSON`](#ecmascript-7)\r\n * some optimizations and fixes\r\n\r\n##### 0.8.1 - 2015.04.03\r\n * fixed `Symbol.keyFor`\r\n\r\n##### 0.8.0 - 2015.04.02\r\n * changed [CommonJS API](#commonjs)\r\n * splitted and renamed some modules\r\n * added support ES3 environment (ES5 polyfill) to **all** default versions - size increases slightly (+ ~4kb w/o gzip), many issues disappear, if you don\'t need it - [simply include only required namespaces / features / modules](#commonjs)\r\n * removed [abstract references](https://github.com/zenparsing/es-abstract-refs) support - proposal has been superseded =\\\r\n * [`$for.isIterable` -> `core.isIterable`, `$for.getIterator` -> `core.getIterator`](#ecmascript-6-iterators), temporary available in old namespace\r\n * fixed iterators support in v8 `Promise.all` and `Promise.race`\r\n * many other fixes\r\n\r\n##### 0.7.2 - 2015.03.09\r\n * some fixes\r\n\r\n##### 0.7.1 - 2015.03.07\r\n * some fixes\r\n\r\n##### 0.7.0 - 2015.03.06\r\n * rewritten and splitted into [CommonJS modules](#commonjs)\r\n\r\n##### 0.6.1 - 2015.02.24\r\n * fixed support [`Object.defineProperty`](#ecmascript-5) with accessors on DOM elements on IE8\r\n\r\n##### 0.6.0 - 2015.02.23\r\n * added support safe closing iteration - calling `iterator.return` on abort iteration, if it exists\r\n * added basic support [`Promise`](#ecmascript-6-promises) unhandled rejection tracking in shim\r\n * added [`Object.getOwnPropertyDescriptors`](#ecmascript-7)\r\n * removed `console` cap - creates too many problems - you can use [`core.log`](#console) module as that\r\n * restructuring [namespaces](#custom-build)\r\n * some fixes\r\n\r\n##### 0.5.4 - 2015.02.15\r\n * some fixes\r\n\r\n##### 0.5.3 - 2015.02.14\r\n * added [support binary and octal literals](#ecmascript-6-number--math) to `Number` constructor\r\n * added [`Date#toISOString`](#ecmascript-5)\r\n\r\n##### 0.5.2 - 2015.02.10\r\n * some fixes\r\n\r\n##### 0.5.1 - 2015.02.09\r\n * some fixes\r\n\r\n##### 0.5.0 - 2015.02.08\r\n * systematization of modules\r\n * splitted [`es6` module](#ecmascript-6)\r\n * splitted [`console` module](#console): `web.console` - only cap for missing methods, `core.log` - bound methods & additional features\r\n * added [`delay` method](#delay)\r\n * some fixes\r\n\r\n##### 0.4.10 - 2015.01.28\r\n * [`Object.getOwnPropertySymbols`](#ecmascript-6-symbols) polyfill returns array of wrapped keys\r\n\r\n##### 0.4.9 - 2015.01.27\r\n * FF20-24 fix\r\n\r\n##### 0.4.8 - 2015.01.25\r\n * some [collections](#ecmascript-6-collections) fixes\r\n\r\n##### 0.4.7 - 2015.01.25\r\n * added support frozen objects as [collections](#ecmascript-6-collections) keys\r\n\r\n##### 0.4.6 - 2015.01.21\r\n * added [`Object.getOwnPropertySymbols`](#ecmascript-6-symbols)\r\n * added [`NodeList.prototype[@@iterator]`](#ecmascript-6-iterators)\r\n * added basic `@@species` logic - getter in native constructors\r\n * removed `Function#by`\r\n * some fixes\r\n\r\n##### 0.4.5 - 2015.01.16\r\n * some fixes\r\n\r\n##### 0.4.4 - 2015.01.11\r\n * enabled CSP support\r\n\r\n##### 0.4.3 - 2015.01.10\r\n * added `Function` instances `name` property for IE9+\r\n\r\n##### 0.4.2 - 2015.01.10\r\n * `Object` static methods accept primitives\r\n * `RegExp` constructor can alter flags (IE9+)\r\n * added `Array.prototype[Symbol.unscopables]`\r\n\r\n##### 0.4.1 - 2015.01.05\r\n * some fixes\r\n\r\n##### 0.4.0 - 2015.01.03\r\n * added [`es6.reflect`](#ecmascript-6-reflect) module:\r\n * added `Reflect.apply`\r\n * added `Reflect.construct`\r\n * added `Reflect.defineProperty`\r\n * added `Reflect.deleteProperty`\r\n * added `Reflect.enumerate`\r\n * added `Reflect.get`\r\n * added `Reflect.getOwnPropertyDescriptor`\r\n * added `Reflect.getPrototypeOf`\r\n * added `Reflect.has`\r\n * added `Reflect.isExtensible`\r\n * added `Reflect.preventExtensions`\r\n * added `Reflect.set`\r\n * added `Reflect.setPrototypeOf`\r\n * `core-js` methods now can use external `Symbol.iterator` polyfill\r\n * some fixes\r\n\r\n##### 0.3.3 - 2014.12.28\r\n * [console cap](#console) excluded from node.js default builds\r\n\r\n##### 0.3.2 - 2014.12.25\r\n * added cap for [ES5](#ecmascript-5) freeze-family methods\r\n * fixed `console` bug\r\n\r\n##### 0.3.1 - 2014.12.23\r\n * some fixes\r\n\r\n##### 0.3.0 - 2014.12.23\r\n * Optimize [`Map` & `Set`](#ecmascript-6-collections):\r\n * use entries chain on hash table\r\n * fast & correct iteration\r\n * iterators moved to [`es6`](#ecmascript-6) and [`es6.collections`](#ecmascript-6-collections) modules\r\n\r\n##### 0.2.5 - 2014.12.20\r\n * `console` no longer shortcut for `console.log` (compatibility problems)\r\n * some fixes\r\n\r\n##### 0.2.4 - 2014.12.17\r\n * better compliance of ES6\r\n * added [`Math.fround`](#ecmascript-6-number--math) (IE10+)\r\n * some fixes\r\n\r\n##### 0.2.3 - 2014.12.15\r\n * [Symbols](#ecmascript-6-symbols):\r\n * added option to disable addition setter to `Object.prototype` for Symbol polyfill:\r\n * added `Symbol.useSimple`\r\n * added `Symbol.useSetter`\r\n * added cap for well-known Symbols:\r\n * added `Symbol.hasInstance`\r\n * added `Symbol.isConcatSpreadable`\r\n * added `Symbol.match`\r\n * added `Symbol.replace`\r\n * added `Symbol.search`\r\n * added `Symbol.species`\r\n * added `Symbol.split`\r\n * added `Symbol.toPrimitive`\r\n * added `Symbol.unscopables`\r\n\r\n##### 0.2.2 - 2014.12.13\r\n * added [`RegExp#flags`](#ecmascript-6-string--regexp) ([December 2014 Draft Rev 29](http://wiki.ecmascript.org/doku.php?id=harmony:specification_drafts#december_6_2014_draft_rev_29))\r\n * added [`String.raw`](#ecmascript-6-string--regexp)\r\n\r\n##### 0.2.1 - 2014.12.12\r\n * repair converting -0 to +0 in [native collections](#ecmascript-6-collections)\r\n\r\n##### 0.2.0 - 2014.12.06\r\n * added [`es7.proposals`](#ecmascript-7) and [`es7.abstract-refs`](https://github.com/zenparsing/es-abstract-refs) modules\r\n * added [`String#at`](#ecmascript-7)\r\n * added real [`String Iterator`](#ecmascript-6-iterators), older versions used Array Iterator\r\n * added abstract references support:\r\n * added `Symbol.referenceGet`\r\n * added `Symbol.referenceSet`\r\n * added `Symbol.referenceDelete`\r\n * added `Function#@@referenceGet`\r\n * added `Map#@@referenceGet`\r\n * added `Map#@@referenceSet`\r\n * added `Map#@@referenceDelete`\r\n * added `WeakMap#@@referenceGet`\r\n * added `WeakMap#@@referenceSet`\r\n * added `WeakMap#@@referenceDelete`\r\n * added `Dict.{...methods}[@@referenceGet]`\r\n * removed deprecated `.contains` methods\r\n * some fixes\r\n\r\n##### 0.1.5 - 2014.12.01\r\n * added [`Array#copyWithin`](#ecmascript-6-array)\r\n * added [`String#codePointAt`](#ecmascript-6-string--regexp)\r\n * added [`String.fromCodePoint`](#ecmascript-6-string--regexp)\r\n\r\n##### 0.1.4 - 2014.11.27\r\n * added [`Dict.mapPairs`](#dict)\r\n\r\n##### 0.1.3 - 2014.11.20\r\n * [TC39 November meeting](https://github.com/rwaldron/tc39-notes/tree/master/es6/2014-11):\r\n * [`.contains` -> `.includes`](https://github.com/rwaldron/tc39-notes/blob/master/es6/2014-11/nov-18.md#51--44-arrayprototypecontains-and-stringprototypecontains)\r\n * `String#contains` -> [`String#includes`](#ecmascript-6-string--regexp)\r\n * `Array#contains` -> [`Array#includes`](#ecmascript-7)\r\n * `Dict.contains` -> [`Dict.includes`](#dict)\r\n * [removed `WeakMap#clear`](https://github.com/rwaldron/tc39-notes/blob/master/es6/2014-11/nov-19.md#412-should-weakmapweakset-have-a-clear-method-markm)\r\n * [removed `WeakSet#clear`](https://github.com/rwaldron/tc39-notes/blob/master/es6/2014-11/nov-19.md#412-should-weakmapweakset-have-a-clear-method-markm)\r\n\r\n##### 0.1.2 - 2014.11.19\r\n * `Map` & `Set` bug fix\r\n\r\n##### 0.1.1 - 2014.11.18\r\n * public release', | |
| 86723 silly resolved readmeFilename: 'README.md', | |
| 86723 silly resolved bugs: { url: 'https://github.com/zloirock/core-js/issues' }, | |
| 86723 silly resolved _id: 'core-js@0.8.4', | |
| 86723 silly resolved _from: 'core-js@^0.8.3', | |
| 86723 silly resolved dist: { shasum: '2e293d3de2121dde8e6f1947fffd1e221b6d295c' }, | |
| 86723 silly resolved _resolved: 'https://registry.npmjs.org/core-js/-/core-js-0.8.4.tgz' }, | |
| 86723 silly resolved { name: 'leven', | |
| 86723 silly resolved version: '1.0.1', | |
| 86723 silly resolved description: 'Measure the difference between two strings using the fastest JS implementation of the Levenshtein distance algorithm', | |
| 86723 silly resolved license: 'MIT', | |
| 86723 silly resolved repository: { type: 'git', url: 'sindresorhus/leven' }, | |
| 86723 silly resolved bin: { leven: 'cli.js' }, | |
| 86723 silly resolved author: | |
| 86723 silly resolved { name: 'Sindre Sorhus', | |
| 86723 silly resolved email: 'sindresorhus@gmail.com', | |
| 86723 silly resolved url: 'http://sindresorhus.com' }, | |
| 86723 silly resolved engines: { node: '>=0.10.0' }, | |
| 86723 silly resolved scripts: { test: 'node test.js', bench: 'matcha bench.js' }, | |
| 86723 silly resolved files: [ 'index.js', 'cli.js' ], | |
| 86723 silly resolved keywords: | |
| 86723 silly resolved [ 'cli', | |
| 86723 silly resolved 'bin', | |
| 86723 silly resolved 'leven', | |
| 86723 silly resolved 'levenshtein', | |
| 86723 silly resolved 'distance', | |
| 86723 silly resolved 'algorithm', | |
| 86723 silly resolved 'algo', | |
| 86723 silly resolved 'string', | |
| 86723 silly resolved 'difference', | |
| 86723 silly resolved 'diff', | |
| 86723 silly resolved 'fast', | |
| 86723 silly resolved 'fuzzy', | |
| 86723 silly resolved 'similar', | |
| 86723 silly resolved 'compare', | |
| 86723 silly resolved 'comparison' ], | |
| 86723 silly resolved devDependencies: | |
| 86723 silly resolved { ava: '0.0.4', | |
| 86723 silly resolved 'fast-levenshtein': '^1.0.3', | |
| 86723 silly resolved ld: '^0.1.0', | |
| 86723 silly resolved levdist: '^1.0.0', | |
| 86723 silly resolved levenshtein: '^1.0.4', | |
| 86723 silly resolved 'levenshtein-component': '0.0.1', | |
| 86723 silly resolved 'levenshtein-edit-distance': '^0.1.0', | |
| 86723 silly resolved matcha: '^0.5.0', | |
| 86723 silly resolved natural: '^0.1.28' }, | |
| 86723 silly resolved readme: '# leven [](https://travis-ci.org/sindresorhus/leven)\n\n> Measure the difference between two strings \n> The fastest JS implementation of the [Levenshtein distance](http://en.wikipedia.org/wiki/Levenshtein_distance) algorithm\n\n\n## Install\n\n```sh\n$ npm install --save leven\n```\n\n\n## Usage\n\n```js\nvar leven = require(\'leven\');\n\nleven(\'cat\', \'cow\');\n//=> 2\n```\n\n\n## Benchmark\n\n```sh\n$ npm run bench\n```\n```\n 230,113 op/s » leven\n 201,026 op/s » levenshtein-edit-distance\n 40,454 op/s » fast-levenshtein\n 28,664 op/s » levenshtein-component\n 22,952 op/s » ld\n 16,882 op/s » levdist\n 11,180 op/s » levenshtein\n 9,624 op/s » natural\n```\n\n\n## CLI\n\n```sh\n$ npm install --global leven\n```\n\n```sh\n$ leven --help\n\n Example\n leven cat cow\n 2\n```\n\n\n## License\n\nMIT © [Sindre Sorhus](http://sindresorhus.com)\n', | |
| 86723 silly resolved readmeFilename: 'readme.md', | |
| 86723 silly resolved _id: 'leven@1.0.1', | |
| 86723 silly resolved _from: 'leven@^1.0.1' }, | |
| 86723 silly resolved { name: 'fs-readdir-recursive', | |
| 86723 silly resolved description: 'Recursively read a directory', | |
| 86723 silly resolved version: '0.1.1', | |
| 86723 silly resolved scripts: | |
| 86723 silly resolved { test: 'mocha --reporter spec', | |
| 86723 silly resolved 'test-cov': 'istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot', | |
| 86723 silly resolved 'test-travis': 'istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter dot' }, | |
| 86723 silly resolved devDependencies: { istanbul: '0', mocha: '*', should: '*' }, | |
| 86723 silly resolved author: | |
| 86723 silly resolved { name: 'Jonathan Ong', | |
| 86723 silly resolved email: 'me@jongleberry.com', | |
| 86723 silly resolved url: 'http://jongleberry.com' }, | |
| 86723 silly resolved repository: { type: 'git', url: 'fs-utils/fs-readdir-recursive' }, | |
| 86723 silly resolved files: [ 'index.js' ], | |
| 86723 silly resolved license: 'MIT', | |
| 86723 silly resolved readme: '# fs.readdirSyncRecursive\n\n[![NPM version][npm-image]][npm-url]\n[![Build status][travis-image]][travis-url]\n[![Test coverage][coveralls-image]][coveralls-url]\n[![Dependency Status][david-image]][david-url]\n[![License][license-image]][license-url]\n[![Downloads][downloads-image]][downloads-url]\n[![Gittip][gittip-image]][gittip-url]\n\nRead a directory recursively.\n\n## Install\n\n```bash\nnpm install fs-readdir-recursive\n```\n\n## Example\n\n```js\nvar read = require(\'fs-readdir-recursive\')\nread(__dirname) === [\n \'test/test.js\',\n \'index.js\',\n \'LICENSE\',\n \'package.json\',\n \'README.md\'\n]\n```\n\n## API\n\n### read(root [, filter])\n\n`root` is the directory you wish to scan. `filter` is an optional filter for the files. By default, filter is:\n\n```js\nfunction (x) {\n return x[0] !== \'.\'\n}\n```\n\nWhich basically just ignores `.` files.\n\n[npm-image]: https://img.shields.io/npm/v/fs-readdir-recursive.svg?style=flat-square\n[npm-url]: https://npmjs.org/package/fs-readdir-recursive\n[github-tag]: http://img.shields.io/github/tag/fs-utils/fs-readdir-recursive.svg?style=flat-square\n[github-url]: https://github.com/fs-utils/fs-readdir-recursive/tags\n[travis-image]: https://img.shields.io/travis/fs-utils/fs-readdir-recursive.svg?style=flat-square\n[travis-url]: https://travis-ci.org/fs-utils/fs-readdir-recursive\n[coveralls-image]: https://img.shields.io/coveralls/fs-utils/fs-readdir-recursive.svg?style=flat-square\n[coveralls-url]: https://coveralls.io/r/fs-utils/fs-readdir-recursive\n[david-image]: http://img.shields.io/david/fs-utils/fs-readdir-recursive.svg?style=flat-square\n[david-url]: https://david-dm.org/fs-utils/fs-readdir-recursive\n[license-image]: http://img.shields.io/npm/l/fs-readdir-recursive.svg?style=flat-square\n[license-url]: LICENSE\n[downloads-image]: http://img.shields.io/npm/dm/fs-readdir-recursive.svg?style=flat-square\n[downloads-url]: https://npmjs.org/package/fs-readdir-recursive\n[gittip-image]: https://img.shields.io/gratipay/jonathanong.svg?style=flat-square\n[gittip-url]: https://gratipay.com/jonathanong/\n', | |
| 86723 silly resolved readmeFilename: 'README.md', | |
| 86723 silly resolved _id: 'fs-readdir-recursive@0.1.1', | |
| 86723 silly resolved _from: 'fs-readdir-recursive@^0.1.0', | |
| 86723 silly resolved dist: { shasum: '40ba983fb0e063308a40b0b0b4f50ee0b4af329c' }, | |
| 86723 silly resolved _resolved: 'https://registry.npmjs.org/fs-readdir-recursive/-/fs-readdir-recursive-0.1.1.tgz' }, | |
| 86723 silly resolved { author: { name: 'Ben Newman', email: 'bn@cs.stanford.edu' }, | |
| 86723 silly resolved name: 'ast-types', | |
| 86723 silly resolved description: 'Esprima-compatible implementation of the Mozilla JS Parser API', | |
| 86723 silly resolved keywords: | |
| 86723 silly resolved [ 'ast', | |
| 86723 silly resolved 'abstract syntax tree', | |
| 86723 silly resolved 'hierarchy', | |
| 86723 silly resolved 'mozilla', | |
| 86723 silly resolved 'spidermonkey', | |
| 86723 silly resolved 'parser api', | |
| 86723 silly resolved 'esprima', | |
| 86723 silly resolved 'types', | |
| 86723 silly resolved 'type system', | |
| 86723 silly resolved 'type checking', | |
| 86723 silly resolved 'dynamic types', | |
| 86723 silly resolved 'parsing', | |
| 86723 silly resolved 'transformation', | |
| 86723 silly resolved 'syntax' ], | |
| 86723 silly resolved version: '0.7.6', | |
| 86723 silly resolved homepage: 'http://github.com/benjamn/ast-types', | |
| 86723 silly resolved repository: { type: 'git', url: 'git://github.com/benjamn/ast-types.git' }, | |
| 86723 silly resolved license: 'MIT', | |
| 86723 silly resolved main: 'main.js', | |
| 86723 silly resolved scripts: { test: 'mocha --reporter spec test/run.js' }, | |
| 86723 silly resolved dependencies: {}, | |
| 86723 silly resolved devDependencies: | |
| 86723 silly resolved { esprima: '~1.2.2', | |
| 86723 silly resolved 'esprima-fb': '~14001.1.0-dev-harmony-fb', | |
| 86723 silly resolved mocha: '~1.20.1' }, | |
| 86723 silly resolved engines: { node: '>= 0.6' }, | |
| 86723 silly resolved readme: 'AST Types\n===\n\nThis module provides an efficient, modular,\n[Esprima](https://github.com/ariya/esprima)-compatible implementation of\nthe [abstract syntax\ntree](http://en.wikipedia.org/wiki/Abstract_syntax_tree) type hierarchy\npioneered by the [Mozilla Parser\nAPI](https://developer.mozilla.org/en-US/docs/SpiderMonkey/Parser_API).\n\n[](https://travis-ci.org/benjamn/ast-types)\n\nInstallation\n---\n\nFrom NPM:\n\n npm install ast-types\n\nFrom GitHub:\n\n cd path/to/node_modules\n git clone git://github.com/benjamn/ast-types.git\n cd ast-types\n npm install .\n\nBasic Usage\n---\n```js\nvar assert = require("assert");\nvar n = require("ast-types").namedTypes;\nvar b = require("ast-types").builders;\n\nvar fooId = b.identifier("foo");\nvar ifFoo = b.ifStatement(fooId, b.blockStatement([\n b.expressionStatement(b.callExpression(fooId, []))\n]));\n\nassert.ok(n.IfStatement.check(ifFoo));\nassert.ok(n.Statement.check(ifFoo));\nassert.ok(n.Node.check(ifFoo));\n\nassert.ok(n.BlockStatement.check(ifFoo.consequent));\nassert.strictEqual(\n ifFoo.consequent.body[0].expression.arguments.length,\n 0);\n\nassert.strictEqual(ifFoo.test, fooId);\nassert.ok(n.Expression.check(ifFoo.test));\nassert.ok(n.Identifier.check(ifFoo.test));\nassert.ok(!n.Statement.check(ifFoo.test));\n```\n\nAST Traversal\n---\n\nBecause it understands the AST type system so thoroughly, this library\nis able to provide excellent node iteration and traversal mechanisms.\n\nIf you want complete control over the traversal, and all you need is a way\nof enumerating the known fields of your AST nodes and getting their\nvalues, you may be interested in the primitives `getFieldNames` and\n`getFieldValue`:\n```js\nvar types = require("ast-types");\nvar partialFunExpr = { type: "FunctionExpression" };\n\n// Even though partialFunExpr doesn\'t actually contain all the fields that\n// are expected for a FunctionExpression, types.getFieldNames knows:\nconsole.log(types.getFieldNames(partialFunExpr));\n// [ \'type\', \'id\', \'params\', \'body\', \'generator\', \'expression\',\n// \'defaults\', \'rest\', \'async\' ]\n\n// For fields that have default values, types.getFieldValue will return\n// the default if the field is not actually defined.\nconsole.log(types.getFieldValue(partialFunExpr, "generator"));\n// false\n```\n\nTwo more low-level helper functions, `eachField` and `someField`, are\ndefined in terms of `getFieldNames` and `getFieldValue`:\n```js\n// Iterate over all defined fields of an object, including those missing\n// or undefined, passing each field name and effective value (as returned\n// by getFieldValue) to the callback. If the object has no corresponding\n// Def, the callback will never be called.\nexports.eachField = function(object, callback, context) {\n getFieldNames(object).forEach(function(name) {\n callback.call(this, name, getFieldValue(object, name));\n }, context);\n};\n\n// Similar to eachField, except that iteration stops as soon as the\n// callback returns a truthy value. Like Array.prototype.some, the final\n// result is either true or false to indicates whether the callback\n// returned true for any element or not.\nexports.someField = function(object, callback, context) {\n return getFieldNames(object).some(function(name) {\n return callback.call(this, name, getFieldValue(object, name));\n }, context);\n};\n```\n\nSo here\'s how you might make a copy of an AST node:\n```js\nvar copy = {};\nrequire("ast-types").eachField(node, function(name, value) {\n // Note that undefined fields will be visited too, according to\n // the rules associated with node.type, and default field values\n // will be substituted if appropriate.\n copy[name] = value;\n})\n```\n\nBut that\'s not all! You can also easily visit entire syntax trees using\nthe powerful `types.visit` abstraction.\n\nHere\'s a trivial example of how you might assert that `arguments.callee`\nis never used in `ast`:\n```js\nvar assert = require("assert");\nvar types = require("ast-types");\nvar n = types.namedTypes;\n\ntypes.visit(ast, {\n // This method will be called for any node with .type "MemberExpression":\n visitMemberExpression: function(path) {\n // Visitor methods receive a single argument, a NodePath object\n // wrapping the node of interest.\n var node = path.node;\n\n if (n.Identifier.check(node.object) &&\n node.object.name === "arguments" &&\n n.Identifier.check(node.property)) {\n assert.notStrictEqual(node.property.name, "callee");\n }\n\n // It\'s your responsibility to call this.traverse with some\n // NodePath object (usually the one passed into the visitor\n // method) before the visitor method returns, or return false to\n // indicate that the traversal need not continue any further down\n // this subtree.\n this.traverse(path);\n }\n});\n```\n\nHere\'s a slightly more involved example of transforming `...rest`\nparameters into browser-runnable ES5 JavaScript:\n\n```js\nvar b = types.builders;\n\n// Reuse the same AST structure for Array.prototype.slice.call.\nvar sliceExpr = b.memberExpression(\n b.memberExpression(\n b.memberExpression(\n b.identifier("Array"),\n b.identifier("prototype"),\n false\n ),\n b.identifier("slice"),\n false\n ),\n b.identifier("call"),\n false\n);\n\ntypes.visit(ast, {\n // This method will be called for any node whose type is a subtype of\n // Function (e.g., FunctionDeclaration, FunctionExpression, and\n // ArrowFunctionExpression). Note that types.visit precomputes a\n // lookup table from every known type to the appropriate visitor\n // method to call for nodes of that type, so the dispatch takes\n // constant time.\n visitFunction: function(path) {\n // Visitor methods receive a single argument, a NodePath object\n // wrapping the node of interest.\n var node = path.node;\n\n // It\'s your responsibility to call this.traverse with some\n // NodePath object (usually the one passed into the visitor\n // method) before the visitor method returns, or return false to\n // indicate that the traversal need not continue any further down\n // this subtree. An assertion will fail if you forget, which is\n // awesome, because it means you will never again make the\n // disastrous mistake of forgetting to traverse a subtree. Also\n // cool: because you can call this method at any point in the\n // visitor method, it\'s up to you whether your traversal is\n // pre-order, post-order, or both!\n this.traverse(path);\n\n // This traversal is only concerned with Function nodes that have\n // rest parameters.\n if (!node.rest) {\n return;\n }\n\n // For the purposes of this example, we won\'t worry about functions\n // with Expression bodies.\n n.BlockStatement.assert(node.body);\n\n // Use types.builders to build a variable declaration of the form\n //\n // var rest = Array.prototype.slice.call(arguments, n);\n //\n // where `rest` is the name of the rest parameter, and `n` is a\n // numeric literal specifying the number of named parameters the\n // function takes.\n var restVarDecl = b.variableDeclaration("var", [\n b.variableDeclarator(\n node.rest,\n b.callExpression(sliceExpr, [\n b.identifier("arguments"),\n b.literal(node.params.length)\n ])\n )\n ]);\n\n // Similar to doing node.body.body.unshift(restVarDecl), except\n // that the other NodePath objects wrapping body statements will\n // have their indexes updated to accommodate the new statement.\n path.get("body", "body").unshift(restVarDecl);\n\n // Nullify node.rest now that we have simulated the behavior of\n // the rest parameter using ordinary JavaScript.\n path.get("rest").replace(null);\n\n // There\'s nothing wrong with doing node.rest = null, but I wanted\n // to point out that the above statement has the same effect.\n assert.strictEqual(node.rest, null);\n }\n});\n```\n\nHere\'s how you might use `types.visit` to implement a function that\ndetermines if a given function node refers to `this`:\n\n```js\nfunction usesThis(funcNode) {\n n.Function.assert(funcNode);\n var result = false;\n\n types.visit(funcNode, {\n visitThisExpression: function(path) {\n result = true;\n\n // The quickest way to terminate the traversal is to call\n // this.abort(), which throws a special exception (instanceof\n // this.AbortRequest) that will be caught in the top-level\n // types.visit method, so you don\'t have to worry about\n // catching the exception yourself.\n this.abort();\n },\n\n visitFunction: function(path) {\n // ThisExpression nodes in nested scopes don\'t count as `this`\n // references for the original function node, so we can safely\n // avoid traversing this subtree.\n return false;\n },\n\n visitCallExpression: function(path) {\n var node = path.node;\n\n // If the function contains CallExpression nodes involving\n // super, those expressions will implicitly depend on the\n // value of `this`, even though they do not explicitly contain\n // any ThisExpression nodes.\n if (this.isSuperCallExpression(node)) {\n result = true;\n this.abort(); // Throws AbortRequest exception.\n }\n\n this.traverse(path);\n },\n\n // Yes, you can define arbitrary helper methods.\n isSuperCallExpression: function(callExpr) {\n n.CallExpression.assert(callExpr);\n return this.isSuperIdentifier(callExpr.callee)\n || this.isSuperMemberExpression(callExpr.callee);\n },\n\n // And even helper helper methods!\n isSuperIdentifier: function(node) {\n return n.Identifier.check(node.callee)\n && node.callee.name === "super";\n },\n\n isSuperMemberExpression: function(node) {\n return n.MemberExpression.check(node.callee)\n && n.Identifier.check(node.callee.object)\n && node.callee.object.name === "super";\n }\n });\n\n return result;\n}\n```\n\nAs you might guess, when an `AbortRequest` is thrown from a subtree, the\nexception will propagate from the corresponding calls to `this.traverse`\nin the ancestor visitor methods. If you decide you want to cancel the\nrequest, simply catch the exception and call its `.cancel()` method. The\nrest of the subtree beneath the `try`-`catch` block will be abandoned, but\nthe remaining siblings of the ancestor node will still be visited.\n\nNodePath\n---\n\nThe `NodePath` object passed to visitor methods is a wrapper around an AST\nnode, and it serves to provide access to the chain of ancestor objects\n(all the way back to the root of the AST) and scope information.\n\nIn general, `path.node` refers to the wrapped node, `path.parent.node`\nrefers to the nearest `Node` ancestor, `path.parent.parent.node` to the\ngrandparent, and so on.\n\nNote that `path.node` may not be a direct property value of\n`path.parent.node`; for instance, it might be the case that `path.node` is\nan element of an array that is a direct child of the parent node:\n```js\npath.node === path.parent.node.elements[3]\n```\nin which case you should know that `path.parentPath` provides\nfiner-grained access to the complete path of objects (not just the `Node`\nones) from the root of the AST:\n```js\n// In reality, path.parent is the grandparent of path:\npath.parentPath.parentPath === path.parent\n\n// The path.parentPath object wraps the elements array (note that we use\n// .value because the elements array is not a Node):\npath.parentPath.value === path.parent.node.elements\n\n// The path.node object is the fourth element in that array:\npath.parentPath.value[3] === path.node\n\n// Unlike path.node and path.value, which are synonyms because path.node\n// is a Node object, path.parentPath.node is distinct from\n// path.parentPath.value, because the elements array is not a\n// Node. Instead, path.parentPath.node refers to the closest ancestor\n// Node, which happens to be the same as path.parent.node:\npath.parentPath.node === path.parent.node\n\n// The path is named for its index in the elements array:\npath.name === 3\n\n// Likewise, path.parentPath is named for the property by which\n// path.parent.node refers to it:\npath.parentPath.name === "elements"\n\n// Putting it all together, we can follow the chain of object references\n// from path.parent.node all the way to path.node by accessing each\n// property by name:\npath.parent.node[path.parentPath.name][path.name] === path.node\n```\n\nThese `NodePath` objects are created during the traversal without\nmodifying the AST nodes themselves, so it\'s not a problem if the same node\nappears more than once in the AST (like `Array.prototype.slice.call` in\nthe example above), because it will be visited with a distict `NodePath`\neach time it appears.\n\nChild `NodePath` objects are created lazily, by calling the `.get` method\nof a parent `NodePath` object:\n```js\n// If a NodePath object for the elements array has never been created\n// before, it will be created here and cached in the future:\npath.get("elements").get(3).value === path.value.elements[3]\n\n// Alternatively, you can pass multiple property names to .get instead of\n// chaining multiple .get calls:\npath.get("elements", 0).value === path.value.elements[0]\n```\n\n`NodePath` objects support a number of useful methods:\n```js\n// Replace one node with another node:\nvar fifth = path.get("elements", 4);\nfifth.replace(newNode);\n\n// Now do some stuff that might rearrange the list, and this replacement\n// remains safe:\nfifth.replace(newerNode);\n\n// Replace the third element in an array with two new nodes:\npath.get("elements", 2).replace(\n b.identifier("foo"),\n b.thisExpression()\n);\n\n// Remove a node and its parent if it would leave a redundant AST node:\n//e.g. var t = 1, y =2; removing the `t` and `y` declarators results in `var undefined`.\npath.prune(); //returns the closest parent `NodePath`.\n\n// Remove a node from a list of nodes:\npath.get("elements", 3).replace();\n\n// Add three new nodes to the beginning of a list of nodes:\npath.get("elements").unshift(a, b, c);\n\n// Remove and return the first node in a list of nodes:\npath.get("elements").shift();\n\n// Push two new nodes onto the end of a list of nodes:\npath.get("elements").push(d, e);\n\n// Remove and return the last node in a list of nodes:\npath.get("elements").pop();\n\n// Insert a new node before/after the seventh node in a list of nodes:\nvar seventh = path.get("elements", 6);\nseventh.insertBefore(newNode);\nseventh.insertAfter(newNode);\n\n// Insert a new element at index 5 in a list of nodes:\npath.get("elements").insertAt(5, newNode);\n```\n\nScope\n---\n\nThe object exposed as `path.scope` during AST traversals provides\ninformation about variable and function declarations in the scope that\ncontains `path.node`. See [scope.js](lib/scope.js) for its public\ninterface, which currently includes `.isGlobal`, `.getGlobalScope()`,\n`.depth`, `.declares(name)`, `.lookup(name)`, and `.getBindings()`.\n\nCustom AST Node Types\n---\n\nThe `ast-types` module was designed to be extended. To that end, it\nprovides a readable, declarative syntax for specifying new AST node types,\nbased primarily upon the `require("ast-types").Type.def` function:\n```js\nvar types = require("ast-types");\nvar def = types.Type.def;\nvar string = types.builtInTypes.string;\nvar b = types.builders;\n\n// Suppose you need a named File type to wrap your Programs.\ndef("File")\n .bases("Node")\n .build("name", "program")\n .field("name", string)\n .field("program", def("Program"));\n\n// Prevent further modifications to the File type (and any other\n// types newly introduced by def(...)).\ntypes.finalize();\n\n// The b.file builder function is now available. It expects two\n// arguments, as named by .build("name", "program") above.\nvar main = b.file("main.js", b.program([\n // Pointless program contents included for extra color.\n b.functionDeclaration(b.identifier("succ"), [\n b.identifier("x")\n ], b.blockStatement([\n b.returnStatement(\n b.binaryExpression(\n "+", b.identifier("x"), b.literal(1)\n )\n )\n ]))\n]));\n\nassert.strictEqual(main.name, "main.js");\nassert.strictEqual(main.program.body[0].params[0].name, "x");\n// etc.\n\n// If you pass the wrong type of arguments, or fail to pass enough\n// arguments, an AssertionError will be thrown.\n\nb.file(b.blockStatement([]));\n// ==> AssertionError: {"body":[],"type":"BlockStatement","loc":null} does not match type string\n\nb.file("lib/types.js", b.thisExpression());\n// ==> AssertionError: {"type":"ThisExpression","loc":null} does not match type Program\n```\nThe `def` syntax is used to define all the default AST node types found in\n[core.js](def/core.js),\n[es6.js](def/es6.js),\n[mozilla.js](def/mozilla.js),\n[e4x.js](def/e4x.js), and\n[fb-harmony.js](def/fb-harmony.js), so you have\nno shortage of examples to learn from.\n', | |
| 86723 silly resolved readmeFilename: 'README.md', | |
| 86723 silly resolved bugs: { url: 'https://github.com/benjamn/ast-types/issues' }, | |
| 86723 silly resolved _id: 'ast-types@0.7.6', | |
| 86723 silly resolved _from: 'ast-types@~0.7.0' }, | |
| 86723 silly resolved { name: 'path-is-absolute', | |
| 86723 silly resolved version: '1.0.0', | |
| 86723 silly resolved description: 'Node.js 0.12 path.isAbsolute() ponyfill', | |
| 86723 silly resolved license: 'MIT', | |
| 86723 silly resolved repository: { type: 'git', url: 'sindresorhus/path-is-absolute' }, | |
| 86723 silly resolved author: | |
| 86723 silly resolved { name: 'Sindre Sorhus', | |
| 86723 silly resolved email: 'sindresorhus@gmail.com', | |
| 86723 silly resolved url: 'sindresorhus.com' }, | |
| 86723 silly resolved engines: { node: '>=0.10.0' }, | |
| 86723 silly resolved scripts: { test: 'node test.js' }, | |
| 86723 silly resolved files: [ 'index.js' ], | |
| 86723 silly resolved keywords: | |
| 86723 silly resolved [ 'path', | |
| 86723 silly resolved 'paths', | |
| 86723 silly resolved 'file', | |
| 86723 silly resolved 'dir', | |
| 86723 silly resolved 'absolute', | |
| 86723 silly resolved 'isabsolute', | |
| 86723 silly resolved 'is-absolute', | |
| 86723 silly resolved 'built-in', | |
| 86723 silly resolved 'util', | |
| 86723 silly resolved 'utils', | |
| 86723 silly resolved 'core', | |
| 86723 silly resolved 'ponyfill', | |
| 86723 silly resolved 'polyfill', | |
| 86723 silly resolved 'shim', | |
| 86723 silly resolved 'is', | |
| 86723 silly resolved 'detect', | |
| 86723 silly resolved 'check' ], | |
| 86723 silly resolved readme: '# path-is-absolute [](https://travis-ci.org/sindresorhus/path-is-absolute)\n\n> Node.js 0.12 [`path.isAbsolute()`](http://nodejs.org/api/path.html#path_path_isabsolute_path) ponyfill\n\n> Ponyfill: A polyfill that doesn\'t overwrite the native method\n\n\n## Install\n\n```\n$ npm install --save path-is-absolute\n```\n\n\n## Usage\n\n```js\nvar pathIsAbsolute = require(\'path-is-absolute\');\n\n// Linux\npathIsAbsolute(\'/home/foo\');\n//=> true\n\n// Windows\npathIsAbsolute(\'C:/Users/\');\n//=> true\n\n// Any OS\npathIsAbsolute.posix(\'/home/foo\');\n//=> true\n```\n\n\n## API\n\nSee the [`path.isAbsolute()` docs](http://nodejs.org/api/path.html#path_path_isabsolute_path).\n\n### pathIsAbsolute(path)\n\n### pathIsAbsolute.posix(path)\n\nThe Posix specific version.\n\n### pathIsAbsolute.win32(path)\n\nThe Windows specific version.\n\n\n## License\n\nMIT © [Sindre Sorhus](http://sindresorhus.com)\n', | |
| 86723 silly resolved readmeFilename: 'readme.md', | |
| 86723 silly resolved _id: 'path-is-absolute@1.0.0', | |
| 86723 silly resolved _from: 'path-is-absolute@^1.0.0' }, | |
| 86723 silly resolved { name: 'lodash', | |
| 86723 silly resolved version: '3.7.0', | |
| 86723 silly resolved description: 'The modern build of lodash modular utilities.', | |
| 86723 silly resolved homepage: 'https://lodash.com/', | |
| 86723 silly resolved icon: 'https://lodash.com/icon.svg', | |
| 86723 silly resolved license: 'MIT', | |
| 86723 silly resolved main: 'index.js', | |
| 86723 silly resolved keywords: [ 'modules', 'stdlib', 'util' ], | |
| 86723 silly resolved author: | |
| 86723 silly resolved { name: 'John-David Dalton', | |
| 86723 silly resolved email: 'john.david.dalton@gmail.com', | |
| 86723 silly resolved url: 'http://allyoucanleet.com/' }, | |
| 86723 silly resolved contributors: [ [Object], [Object], [Object], [Object], [Object] ], | |
| 86723 silly resolved repository: { type: 'git', url: 'lodash/lodash' }, | |
| 86723 silly resolved scripts: { test: 'echo "See https://travis-ci.org/lodash/lodash-cli for testing details."' }, | |
| 86723 silly resolved readme: '# lodash v3.7.0\n\nThe [modern build](https://github.com/lodash/lodash/wiki/Build-Differences) of [lodash](https://lodash.com/) exported as [Node.js](http://nodejs.org/)/[io.js](https://iojs.org/) modules.\n\nGenerated using [lodash-cli](https://www.npmjs.com/package/lodash-cli):\n```bash\n$ lodash modularize modern exports=node -o ./\n$ lodash modern -d -o ./index.js\n```\n\n## Installation\n\nUsing npm:\n\n```bash\n$ {sudo -H} npm i -g npm\n$ npm i --save lodash\n```\n\nIn Node.js/io.js:\n\n```js\n// load the modern build\nvar _ = require(\'lodash\');\n// or a method category\nvar array = require(\'lodash/array\');\n// or a method (great for smaller builds with browserify/webpack)\nvar chunk = require(\'lodash/array/chunk\');\n```\n\nSee the [package source](https://github.com/lodash/lodash/tree/3.7.0-npm) for more details.\n\n**Note:**<br>\nDon’t assign values to the [special variable](http://nodejs.org/api/repl.html#repl_repl_features) `_` when in the REPL.<br>\nInstall [n_](https://www.npmjs.com/package/n_) for a REPL that includes lodash by default.\n\n## Module formats\n\nlodash is also available in a variety of other builds & module formats.\n\n * npm packages for [modern](https://www.npmjs.com/package/lodash), [compatibility](https://www.npmjs.com/package/lodash-compat), & [per method](https://www.npmjs.com/browse/keyword/lodash-modularized) builds\n * AMD modules for [modern](https://github.com/lodash/lodash/tree/3.7.0-amd) & [compatibility](https://github.com/lodash/lodash-compat/tree/3.7.0-amd) builds\n * ES modules for the [modern](https://github.com/lodash/lodash/tree/3.7.0-es) build\n\n## Further Reading\n\n * [API Documentation](https://lodash.com/docs)\n * [Build Differences](https://github.com/lodash/lodash/wiki/Build-Differences)\n * [Changelog](https://github.com/lodash/lodash/wiki/Changelog)\n * [Release Notes](https://github.com/lodash/lodash/releases)\n * [Roadmap](https://github.com/lodash/lodash/wiki/Roadmap)\n * [More Resources](https://github.com/lodash/lodash/wiki/Resources)\n\n## Features\n\n * ~100% [code coverage](https://coveralls.io/r/lodash)\n * Follows [semantic versioning](http://semver.org/) for releases\n * [Lazily evaluated](http://filimanjaro.com/blog/2014/introducing-lazy-evaluation/) chaining\n * [_(…)](https://lodash.com/docs#_) supports intuitive chaining\n * [_.add](https://lodash.com/docs#add) for mathematical composition\n * [_.ary](https://lodash.com/docs#ary) & [_.rearg](https://lodash.com/docs#rearg) to change function argument limits & order\n * [_.at](https://lodash.com/docs#at) for cherry-picking collection values\n * [_.attempt](https://lodash.com/docs#attempt) to execute functions which may error without a try-catch\n * [_.before](https://lodash.com/docs#before) to complement [_.after](https://lodash.com/docs#after)\n * [_.bindKey](https://lodash.com/docs#bindKey) for binding [*“lazy”*](http://michaux.ca/articles/lazy-function-definition-pattern) defined methods\n * [_.chunk](https://lodash.com/docs#chunk) for splitting an array into chunks of a given size\n * [_.clone](https://lodash.com/docs#clone) supports shallow cloning of `Date` & `RegExp` objects\n * [_.cloneDeep](https://lodash.com/docs#cloneDeep) for deep cloning arrays & objects\n * [_.create](https://lodash.com/docs#create) for easier object inheritance\n * [_.curry](https://lodash.com/docs#curry) & [_.curryRight](https://lodash.com/docs#curryRight) for creating [curried](http://hughfdjackson.com/javascript/why-curry-helps/) functions\n * [_.debounce](https://lodash.com/docs#debounce) & [_.throttle](https://lodash.com/docs#throttle) are cancelable & accept options for more control\n * [_.fill](https://lodash.com/docs#fill) to fill arrays with values\n * [_.findKey](https://lodash.com/docs#findKey) for finding keys\n * [_.flow](https://lodash.com/docs#flow) to complement [_.flowRight](https://lodash.com/docs#flowRight) (a.k.a `_.compose`)\n * [_.forEach](https://lodash.com/docs#forEach) supports exiting early\n * [_.forIn](https://lodash.com/docs#forIn) for iterating all enumerable properties\n * [_.forOwn](https://lodash.com/docs#forOwn) for iterating own properties\n * [_.get](https://lodash.com/docs#get) & [_.set](https://lodash.com/docs#set) for deep property getting & setting\n * [_.inRange](https://lodash.com/docs#inRange) for checking whether a number is within a given range\n * [_.isNative](https://lodash.com/docs#isNative) to check for native functions\n * [_.isPlainObject](https://lodash.com/docs#isPlainObject) & [_.toPlainObject](https://lodash.com/docs#toPlainObject) to check for & convert to `Object` objects\n * [_.isTypedArray](https://lodash.com/docs#isTypedArray) to check for typed arrays\n * [_.matches](https://lodash.com/docs#matches) supports deep object comparisons\n * [_.matchesProperty](https://lodash.com/docs#matchesProperty) to complement [_.matches](https://lodash.com/docs#matches) & [_.property](https://lodash.com/docs#property)\n * [_.method](https://lodash.com/docs#method) & [_.methodOf](https://lodash.com/docs#methodOf) to create functions that invoke methods\n * [_.merge](https://lodash.com/docs#merge) for a deep [_.extend](https://lodash.com/docs#extend)\n * [_.parseInt](https://lodash.com/docs#parseInt) for consistent cross-environment behavior\n * [_.pull](https://lodash.com/docs#pull), [_.pullAt](https://lodash.com/docs#pullAt), & [_.remove](https://lodash.com/docs#remove) for mutating arrays\n * [_.random](https://lodash.com/docs#random) supports returning floating-point numbers\n * [_.restParam](https://lodash.com/docs#restParam) & [_.spread](https://lodash.com/docs#spread) for applying rest parameters & spreading arguments to functions\n * [_.runInContext](https://lodash.com/docs#runInContext) for collisionless mixins & easier mocking\n * [_.slice](https://lodash.com/docs#slice) for creating subsets of array-like values\n * [_.sortByAll](https://lodash.com/docs#sortByAll) & [_.sortByOrder](https://lodash.com/docs#sortByOrder) for sorting by multiple properties & orders\n * [_.sum](https://lodash.com/docs#sum) to get the sum of values\n * [_.support](https://lodash.com/docs#support) for flagging environment features\n * [_.template](https://lodash.com/docs#template) supports [*“imports”*](https://lodash.com/docs#templateSettings-imports) options & [ES template delimiters](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-template-literal-lexical-components)\n * [_.transform](https://lodash.com/docs#transform) as a powerful alternative to [_.reduce](https://lodash.com/docs#reduce) for transforming objects\n * [_.xor](https://lodash.com/docs#xor) to complement [_.difference](https://lodash.com/docs#difference), [_.intersection](https://lodash.com/docs#intersection), & [_.union](https://lodash.com/docs#union)\n * [_.valuesIn](https://lodash.com/docs#valuesIn) for getting values of all enumerable properties\n * [_.bind](https://lodash.com/docs#bind), [_.curry](https://lodash.com/docs#curry), [_.partial](https://lodash.com/docs#partial), &\n [more](https://lodash.com/docs "_.bindKey, _.curryRight, _.partialRight") support customizable argument placeholders\n * [_.capitalize](https://lodash.com/docs#capitalize), [_.trim](https://lodash.com/docs#trim), &\n [more](https://lodash.com/docs "_.camelCase, _.deburr, _.endsWith, _.escapeRegExp, _.kebabCase, _.pad, _.padLeft, _.padRight, _.repeat, _.snakeCase, _.startCase, _.startsWith, _.trimLeft, _.trimRight, _.trunc, _.words") string methods\n * [_.clone](https://lodash.com/docs#clone), [_.isEqual](https://lodash.com/docs#isEqual), &\n [more](https://lodash.com/docs "_.assign, _.cloneDeep, _.merge") accept callbacks\n * [_.dropWhile](https://lodash.com/docs#dropWhile), [_.takeWhile](https://lodash.com/docs#takeWhile), &\n [more](https://lodash.com/docs "_.drop, _.dropRightWhile, _.take, _.takeRightWhile") to complement [_.first](https://lodash.com/docs#first), [_.initial](https://lodash.com/docs#initial), [_.last](https://lodash.com/docs#last), & [_.rest](https://lodash.com/docs#rest)\n * [_.findLast](https://lodash.com/docs#findLast), [_.findLastKey](https://lodash.com/docs#findLastKey), &\n [more](https://lodash.com/docs "_.flowRight, _.forEachRight, _.forInRight, _.forOwnRight, _.partialRight") right-associative methods\n * [_.includes](https://lodash.com/docs#includes), [_.toArray](https://lodash.com/docs#toArray), &\n [more](https://lodash.com/docs "_.at, _.countBy, _.every, _.filter, _.find, _.findLast, _.forEach, _.forEachRight, _.groupBy, _.indexBy, _.invoke, _.map, _.max, _.min, _.partition, _.pluck, _.reduce, _.reduceRight, _.reject, _.shuffle, _.size, _.some, _.sortBy") accept strings\n * [_#commit](https://lodash.com/docs#prototype-commit) & [_#plant](https://lodash.com/docs#prototype-plant) for working with chain sequences\n * [_#thru](https://lodash.com/docs#thru) to pass values thru a chain sequence\n\n## Support\n\nTested in Chrome 41-42, Firefox 36-37, IE 6-11, Opera 27-28, Safari 5-8, io.js 1.7.1, Node.js 0.8.28, 0.10.38, & 0.12.2, PhantomJS 1.9.8, RingoJS 0.11, & Rhino 1.7RC5.\nAutomated [browser](https://saucelabs.com/u/lodash) & [CI](https://travis-ci.org/lodash/lodash/) test runs are available. Special thanks to [Sauce Labs](https://saucelabs.com/) for providing automated browser testing.\n', | |
| 86723 silly resolved readmeFilename: 'README.md', | |
| 86723 silly resolved _id: 'lodash@3.7.0', | |
| 86723 silly resolved dist: { shasum: '043ea2a03d16123f15fcbcf81cd9eff529678308' }, | |
| 86723 silly resolved _from: 'lodash@^3.6.0', | |
| 86723 silly resolved _resolved: 'https://registry.npmjs.org/lodash/-/lodash-3.7.0.tgz' }, | |
| 86723 silly resolved { name: 'repeating', | |
| 86723 silly resolved version: '1.1.2', | |
| 86723 silly resolved description: 'Repeat a string - fast', | |
| 86723 silly resolved license: 'MIT', | |
| 86723 silly resolved repository: { type: 'git', url: 'sindresorhus/repeating' }, | |
| 86723 silly resolved author: | |
| 86723 silly resolved { name: 'Sindre Sorhus', | |
| 86723 silly resolved email: 'sindresorhus@gmail.com', | |
| 86723 silly resolved url: 'http://sindresorhus.com' }, | |
| 86723 silly resolved bin: { repeating: 'cli.js' }, | |
| 86723 silly resolved engines: { node: '>=0.10.0' }, | |
| 86723 silly resolved scripts: { test: 'node test.js' }, | |
| 86723 silly resolved files: [ 'index.js', 'cli.js' ], | |
| 86723 silly resolved keywords: | |
| 86723 silly resolved [ 'cli-app', | |
| 86723 silly resolved 'cli', | |
| 86723 silly resolved 'bin', | |
| 86723 silly resolved 'repeat', | |
| 86723 silly resolved 'repeating', | |
| 86723 silly resolved 'string', | |
| 86723 silly resolved 'str', | |
| 86723 silly resolved 'text', | |
| 86723 silly resolved 'fill' ], | |
| 86723 silly resolved dependencies: { 'is-finite': '^1.0.0', meow: '^3.0.0' }, | |
| 86723 silly resolved devDependencies: { ava: '0.0.4' }, | |
| 86723 silly resolved readme: '# repeating [](https://travis-ci.org/sindresorhus/repeating)\n\n> Repeat a string - fast\n\n\n## Usage\n\n```sh\n$ npm install --save repeating\n```\n\n```js\nvar repeating = require(\'repeating\');\n\nrepeating(\'unicorn \', 100);\n//=> unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn unicorn \n```\n\n\n## CLI\n\n```sh\n$ npm install --global repeating\n```\n\n```\n$ repeating --help\n\n Usage\n repeating <string> <count>\n\n Example\n repeating \'unicorn \' 2\n unicorn unicorn \n```\n\n\n## License\n\nMIT © [Sindre Sorhus](http://sindresorhus.com)\n', | |
| 86723 silly resolved readmeFilename: 'readme.md', | |
| 86723 silly resolved _id: 'repeating@1.1.2', | |
| 86723 silly resolved _from: 'repeating@^1.1.2' }, | |
| 86723 silly resolved { name: 'output-file-sync', | |
| 86723 silly resolved version: '1.1.0', | |
| 86723 silly resolved description: 'Synchronously write a file and create its ancestor directories if needed', | |
| 86723 silly resolved repository: { type: 'git', url: 'shinnn/output-file-sync' }, | |
| 86723 silly resolved author: | |
| 86723 silly resolved { name: 'Shinnosuke Watanabe', | |
| 86723 silly resolved url: 'https://github.com/shinnn' }, | |
| 86723 silly resolved scripts: | |
| 86723 silly resolved { pretest: 'eslint *.js & jscs *.js', | |
| 86723 silly resolved test: 'node test.js | tap-spec;', | |
| 86723 silly resolved coverage: 'istanbul cover test.js; ${npm_package_scripts_clean}', | |
| 86723 silly resolved coveralls: 'istanbul cover test.js && istanbul-coveralls' }, | |
| 86723 silly resolved licenses: [ [Object] ], | |
| 86723 silly resolved files: [ 'index.js', 'LICENSE' ], | |
| 86723 silly resolved keywords: | |
| 86723 silly resolved [ 'fs', | |
| 86723 silly resolved 'write', | |
| 86723 silly resolved 'sync', | |
| 86723 silly resolved 'synchronous', | |
| 86723 silly resolved 'output', | |
| 86723 silly resolved 'file', | |
| 86723 silly resolved 'mkdir', | |
| 86723 silly resolved 'mkdirp' ], | |
| 86723 silly resolved dependencies: { mkdirp: '^0.5.0', xtend: '^4.0.0' }, | |
| 86723 silly resolved devDependencies: | |
| 86723 silly resolved { eslint: '^0.10.0', | |
| 86723 silly resolved istanbul: '^0.3.2', | |
| 86723 silly resolved 'istanbul-coveralls': '^1.0.1', | |
| 86723 silly resolved jscs: '^1.8.0', | |
| 86723 silly resolved 'read-remove-file': '^1.0.0', | |
| 86723 silly resolved 'tap-spec': '^2.1.0', | |
| 86723 silly resolved tape: '^3.0.3' }, | |
| 86723 silly resolved jscsConfig: { preset: 'google', maximumLineLength: 98 }, | |
| 86723 silly resolved readme: '# output-file-sync\n\n[](https://travis-ci.org/shinnn/output-file-sync)\n[](https://ci.appveyor.com/project/ShinnosukeWatanabe/output-file-sync)\n[](https://coveralls.io/r/shinnn/output-file-sync)\n[](https://david-dm.org/shinnn/output-file-sync)\n[](https://david-dm.org/shinnn/output-file-sync#info=devDependencies)\n\nSynchronously write a file and create its ancestor directories if needed\n\n```javascript\nvar fs = require(\'fs\');\nvar outputFileSync = require(\'output-file-sync\');\n\noutputFileSync(\'foo/bar/baz.txt\', \'Hi!\');\nfs.readFileSync(\'foo/bar/baz.txt\').toString(); //=> \'Hi!\'\n```\n\n## Difference from fs.outputFileSync\n\nThis module is very similar to [fs-extra](https://github.com/jprichardson/node-fs-extra)\'s [`fs.outputFileSync`](https://github.com/jprichardson/node-fs-extra#outputfilefile-data-callback) but they are different in the following points:\n\n1. *output-file-sync* returns the path of the directory created first. [See the API document for more details.](#outputfilesyncpath-data--options)\n2. *output-file-sync* accepts [mkdirp] options.\n ```javascript\n var fs = require(\'fs\');\n var outputFileSync = require(\'output-file-sync\');\n outputFileSync(\'foo/bar\', \'content\', {mode: 33260});\n\n fs.statSync(\'foo\').mode; //=> 33260\n ```\n\n## Installation\n\n[](https://www.npmjs.org/package/output-file-sync)\n\n[Use npm.](https://www.npmjs.org/doc/cli/npm-install.html)\n\n```sh\nnpm install output-file-sync\n```\n\n## API\n\n```javascript\nvar outputFileSync = require(\'output-file-sync\');\n```\n\n### outputFileSync(*path*, *data* [, *options*])\n\n*path*: `String` \n*data*: `String` or [`Buffer`](http://nodejs.org/api/buffer.html#buffer_class_buffer) \n*options*: `Object` or `String` (options for [fs.writeFile] and [mkdirp]) \nReturn: `String` if it creates more than one directories, otherwise `null`\n\nIt writes the data to a file synchronously. If ancestor directories of the file don\'t exist, it creates the directories before writing the file.\n\n```javascript\nvar fs = require(\'fs\');\nvar outputFileSync = require(\'output-file-sync\');\n\n// When the directory `foo/bar` exists\noutputFileSync(\'foo/bar/baz/qux.txt\', \'Hello\', \'utf-8\');\n\nfs.statSync(\'foo/bar/baz\').isDirectory(); //=> true\nfs.statSync(\'foo/bar/baz/qux.txt\').isFile(); //=> true\n```\n\nIt returns the directory path just like [mkdirp.sync](https://github.com/substack/node-mkdirp#mkdirpsyncdir-opts):\n\n> Returns the first directory that had to be created, if any.\n\n```javascript\nvar dir = outputFileSync(\'foo/bar/baz.txt\', \'Hello\');\ndir; //=> Same value as `path.resolve(\'foo\')`\n```\n\n#### options\n\nAll options for [fs.writeFile] and [mkdirp] are available.\n\nAdditionally, you can use [`fileMode`](#optionsfilemode) option and [`dirMode`](#optionsdirmode) option to set different permission between the file and directories.\n\n##### options.fileMode\n\nSet modes of a file, overriding `mode` option.\n\n##### options.dirMode\n\nSet modes of a directories, overriding `mode` option.\n\n```javascript\noutputFileSync(\'dir/file\', \'content\', {dirMode: \'0745\', fileMode: \'0644\'});\nfs.statSync(\'dir\').mode.toString(8); //=> \'40745\'\nfs.statSync(\'dir/file\').mode.toString(8); //=> \'100644\'\n```\n\n## Related project\n\n* [output-file](https://github.com/shinnn/output-file) (asynchronous version)\n\n## License\n\nCopyright (c) 2014 [Shinnosuke Watanabe](https://github.com/shinnn)\n\nLicensed under [the MIT License](./LICENSE).\n\n[fs.writeFile]: http://nodejs.org/api/fs.html#fs_fs_writefile_filename_data_options_callback\n[mkdirp]: https://github.com/substack/node-mkdirp\n', | |
| 86723 silly resolved readmeFilename: 'README.md', | |
| 86723 silly resolved _id: 'output-file-sync@1.1.0', | |
| 86723 silly resolved _from: 'output-file-sync@^1.1.0' }, | |
| 86723 silly resolved { author: | |
| 86723 silly resolved { name: 'Isaac Z. Schlueter', | |
| 86723 silly resolved email: 'i@izs.me', | |
| 86723 silly resolved url: 'http://blog.izs.me' }, | |
| 86723 silly resolved name: 'minimatch', | |
| 86723 silly resolved description: 'a glob matcher in javascript', | |
| 86723 silly resolved version: '2.0.4', | |
| 86723 silly resolved repository: { type: 'git', url: 'git://github.com/isaacs/minimatch.git' }, | |
| 86723 silly resolved main: 'minimatch.js', | |
| 86723 silly resolved scripts: | |
| 86723 silly resolved { test: 'tap test/*.js', | |
| 86723 silly resolved prepublish: 'browserify -o browser.js -e minimatch.js --bare' }, | |
| 86723 silly resolved engines: { node: '*' }, | |
| 86723 silly resolved dependencies: { 'brace-expansion': '^1.0.0' }, | |
| 86723 silly resolved devDependencies: { browserify: '^9.0.3', tap: '' }, | |
| 86723 silly resolved license: | |
| 86723 silly resolved { type: 'MIT', | |
| 86723 silly resolved url: 'http://github.com/isaacs/minimatch/raw/master/LICENSE' }, | |
| 86723 silly resolved files: [ 'minimatch.js', 'browser.js' ], | |
| 86723 silly resolved readme: '# minimatch\n\nA minimal matching utility.\n\n[](http://travis-ci.org/isaacs/minimatch)\n\n\nThis is the matching library used internally by npm.\n\nIt works by converting glob expressions into JavaScript `RegExp`\nobjects.\n\n## Usage\n\n```javascript\nvar minimatch = require("minimatch")\n\nminimatch("bar.foo", "*.foo") // true!\nminimatch("bar.foo", "*.bar") // false!\nminimatch("bar.foo", "*.+(bar|foo)", { debug: true }) // true, and noisy!\n```\n\n## Features\n\nSupports these glob features:\n\n* Brace Expansion\n* Extended glob matching\n* "Globstar" `**` matching\n\nSee:\n\n* `man sh`\n* `man bash`\n* `man 3 fnmatch`\n* `man 5 gitignore`\n\n## Minimatch Class\n\nCreate a minimatch object by instanting the `minimatch.Minimatch` class.\n\n```javascript\nvar Minimatch = require("minimatch").Minimatch\nvar mm = new Minimatch(pattern, options)\n```\n\n### Properties\n\n* `pattern` The original pattern the minimatch object represents.\n* `options` The options supplied to the constructor.\n* `set` A 2-dimensional array of regexp or string expressions.\n Each row in the\n array corresponds to a brace-expanded pattern. Each item in the row\n corresponds to a single path-part. For example, the pattern\n `{a,b/c}/d` would expand to a set of patterns like:\n\n [ [ a, d ]\n , [ b, c, d ] ]\n\n If a portion of the pattern doesn\'t have any "magic" in it\n (that is, it\'s something like `"foo"` rather than `fo*o?`), then it\n will be left as a string rather than converted to a regular\n expression.\n\n* `regexp` Created by the `makeRe` method. A single regular expression\n expressing the entire pattern. This is useful in cases where you wish\n to use the pattern somewhat like `fnmatch(3)` with `FNM_PATH` enabled.\n* `negate` True if the pattern is negated.\n* `comment` True if the pattern is a comment.\n* `empty` True if the pattern is `""`.\n\n### Methods\n\n* `makeRe` Generate the `regexp` member if necessary, and return it.\n Will return `false` if the pattern is invalid.\n* `match(fname)` Return true if the filename matches the pattern, or\n false otherwise.\n* `matchOne(fileArray, patternArray, partial)` Take a `/`-split\n filename, and match it against a single row in the `regExpSet`. This\n method is mainly for internal use, but is exposed so that it can be\n used by a glob-walker that needs to avoid excessive filesystem calls.\n\nAll other methods are internal, and will be called as necessary.\n\n## Functions\n\nThe top-level exported function has a `cache` property, which is an LRU\ncache set to store 100 items. So, calling these methods repeatedly\nwith the same pattern and options will use the same Minimatch object,\nsaving the cost of parsing it multiple times.\n\n### minimatch(path, pattern, options)\n\nMain export. Tests a path against the pattern using the options.\n\n```javascript\nvar isJS = minimatch(file, "*.js", { matchBase: true })\n```\n\n### minimatch.filter(pattern, options)\n\nReturns a function that tests its\nsupplied argument, suitable for use with `Array.filter`. Example:\n\n```javascript\nvar javascripts = fileList.filter(minimatch.filter("*.js", {matchBase: true}))\n```\n\n### minimatch.match(list, pattern, options)\n\nMatch against the list of\nfiles, in the style of fnmatch or glob. If nothing is matched, and\noptions.nonull is set, then return a list containing the pattern itself.\n\n```javascript\nvar javascripts = minimatch.match(fileList, "*.js", {matchBase: true}))\n```\n\n### minimatch.makeRe(pattern, options)\n\nMake a regular expression object from the pattern.\n\n## Options\n\nAll options are `false` by default.\n\n### debug\n\nDump a ton of stuff to stderr.\n\n### nobrace\n\nDo not expand `{a,b}` and `{1..3}` brace sets.\n\n### noglobstar\n\nDisable `**` matching against multiple folder names.\n\n### dot\n\nAllow patterns to match filenames starting with a period, even if\nthe pattern does not explicitly have a period in that spot.\n\nNote that by default, `a/**/b` will **not** match `a/.d/b`, unless `dot`\nis set.\n\n### noext\n\nDisable "extglob" style patterns like `+(a|b)`.\n\n### nocase\n\nPerform a case-insensitive match.\n\n### nonull\n\nWhen a match is not found by `minimatch.match`, return a list containing\nthe pattern itself if this option is set. When not set, an empty list\nis returned if there are no matches.\n\n### matchBase\n\nIf set, then patterns without slashes will be matched\nagainst the basename of the path if it contains slashes. For example,\n`a?b` would match the path `/xyz/123/acb`, but not `/xyz/acb/123`.\n\n### nocomment\n\nSuppress the behavior of treating `#` at the start of a pattern as a\ncomment.\n\n### nonegate\n\nSuppress the behavior of treating a leading `!` character as negation.\n\n### flipNegate\n\nReturns from negate expressions the same as if they were not negated.\n(Ie, true on a hit, false on a miss.)\n\n\n## Comparisons to other fnmatch/glob implementations\n\nWhile strict compliance with the existing standards is a worthwhile\ngoal, some discrepancies exist between minimatch and other\nimplementations, and are intentional.\n\nIf the pattern starts with a `!` character, then it is negated. Set the\n`nonegate` flag to suppress this behavior, and treat leading `!`\ncharacters normally. This is perhaps relevant if you wish to start the\npattern with a negative extglob pattern like `!(a|B)`. Multiple `!`\ncharacters at the start of a pattern will negate the pattern multiple\ntimes.\n\nIf a pattern starts with `#`, then it is treated as a comment, and\nwill not match anything. Use `\\#` to match a literal `#` at the\nstart of a line, or set the `nocomment` flag to suppress this behavior.\n\nThe double-star character `**` is supported by default, unless the\n`noglobstar` flag is set. This is supported in the manner of bsdglob\nand bash 4.1, where `**` only has special significance if it is the only\nthing in a path part. That is, `a/**/b` will match `a/x/y/b`, but\n`a/**b` will not.\n\nIf an escaped pattern has no matches, and the `nonull` flag is set,\nthen minimatch.match returns the pattern as-provided, rather than\ninterpreting the character escapes. For example,\n`minimatch.match([], "\\\\*a\\\\?")` will return `"\\\\*a\\\\?"` rather than\n`"*a?"`. This is akin to setting the `nullglob` option in bash, except\nthat it does not resolve escaped pattern characters.\n\nIf brace expansion is not disabled, then it is performed before any\nother interpretation of the glob pattern. Thus, a pattern like\n`+(a|{b),c)}`, which would not be valid in bash or zsh, is expanded\n**first** into the set of `+(a|b)` and `+(a|c)`, and those patterns are\nchecked for validity. Since those two are valid, matching proceeds.\n', | |
| 86723 silly resolved readmeFilename: 'README.md', | |
| 86723 silly resolved bugs: { url: 'https://github.com/isaacs/minimatch/issues' }, | |
| 86723 silly resolved _id: 'minimatch@2.0.4', | |
| 86723 silly resolved _from: 'minimatch@^2.0.3' }, | |
| 86723 silly resolved { name: 'slash', | |
| 86723 silly resolved version: '1.0.0', | |
| 86723 silly resolved description: 'Convert Windows backslash paths to slash paths', | |
| 86723 silly resolved keywords: | |
| 86723 silly resolved [ 'path', | |
| 86723 silly resolved 'seperator', | |
| 86723 silly resolved 'sep', | |
| 86723 silly resolved 'slash', | |
| 86723 silly resolved 'backslash', | |
| 86723 silly resolved 'windows', | |
| 86723 silly resolved 'win' ], | |
| 86723 silly resolved author: | |
| 86723 silly resolved { name: 'Sindre Sorhus', | |
| 86723 silly resolved email: 'sindresorhus@gmail.com', | |
| 86723 silly resolved url: 'http://sindresorhus.com' }, | |
| 86723 silly resolved repository: { type: 'git', url: 'sindresorhus/slash' }, | |
| 86723 silly resolved scripts: { test: 'mocha' }, | |
| 86723 silly resolved devDependencies: { mocha: '*' }, | |
| 86723 silly resolved engines: { node: '>=0.10.0' }, | |
| 86723 silly resolved license: 'MIT', | |
| 86723 silly resolved files: [ 'index.js' ], | |
| 86723 silly resolved readme: '# slash [](https://travis-ci.org/sindresorhus/slash)\n\n> Convert Windows backslash paths to slash paths: `foo\\\\bar` ➔ `foo/bar`\n\n[Forward-slash paths can be used in Windows](http://superuser.com/a/176395/6877) as long as they\'re not extended-length paths and don\'t contain any non-ascii characters.\n\nThis was created since the `path` methods in Node outputs `\\\\` paths on Windows.\n\n\n## Install\n\n```sh\n$ npm install --save slash\n```\n\n\n## Usage\n\n```js\nvar path = require(\'path\');\nvar slash = require(\'slash\');\n\nvar str = path.join(\'foo\', \'bar\');\n// Unix => foo/bar\n// Windows => foo\\\\bar\n\nslash(str);\n// Unix => foo/bar\n// Windows => foo/bar\n```\n\n\n## API\n\n### slash(path)\n\nType: `string`\n\nAccepts a Windows backslash path and returns a slash path.\n\n\n## License\n\nMIT © [Sindre Sorhus](http://sindresorhus.com)\n', | |
| 86723 silly resolved readmeFilename: 'readme.md', | |
| 86723 silly resolved _id: 'slash@1.0.0', | |
| 86723 silly resolved _from: 'slash@^1.0.0' }, | |
| 86723 silly resolved { name: 'shebang-regex', | |
| 86723 silly resolved version: '1.0.0', | |
| 86723 silly resolved description: 'Regular expression for matching a shebang', | |
| 86723 silly resolved license: 'MIT', | |
| 86723 silly resolved repository: { type: 'git', url: 'sindresorhus/shebang-regex' }, | |
| 86723 silly resolved author: | |
| 86723 silly resolved { name: 'Sindre Sorhus', | |
| 86723 silly resolved email: 'sindresorhus@gmail.com', | |
| 86723 silly resolved url: 'sindresorhus.com' }, | |
| 86723 silly resolved engines: { node: '>=0.10.0' }, | |
| 86723 silly resolved scripts: { test: 'node test.js' }, | |
| 86723 silly resolved files: [ 'index.js' ], | |
| 86723 silly resolved keywords: [ 're', 'regex', 'regexp', 'shebang', 'match', 'test' ], | |
| 86723 silly resolved devDependencies: { ava: '0.0.4' }, | |
| 86723 silly resolved readme: '# shebang-regex [](https://travis-ci.org/sindresorhus/shebang-regex)\n\n> Regular expression for matching a [shebang](https://en.wikipedia.org/wiki/Shebang_(Unix))\n\n\n## Install\n\n```\n$ npm install --save shebang-regex\n```\n\n\n## Usage\n\n```js\nvar shebangRegex = require(\'shebang-regex\');\nvar str = \'#!/usr/bin/env node\\nconsole.log("unicorns");\';\n\nshebangRegex.test(str);\n//=> true\n\nshebangRegex.exec(str)[0];\n//=> \'#!/usr/bin/env node\'\n```\n\n\n## License\n\nMIT © [Sindre Sorhus](http://sindresorhus.com)\n', | |
| 86723 silly resolved readmeFilename: 'readme.md', | |
| 86723 silly resolved _id: 'shebang-regex@1.0.0', | |
| 86723 silly resolved dist: { shasum: '6a78d9f95f01e678fc91900533b3a3ea770a4f76' }, | |
| 86723 silly resolved _from: 'shebang-regex@^1.0.0', | |
| 86723 silly resolved _resolved: 'https://registry.npmjs.org/shebang-regex/-/shebang-regex-1.0.0.tgz' }, | |
| 86723 silly resolved { name: 'strip-json-comments', | |
| 86723 silly resolved version: '1.0.2', | |
| 86723 silly resolved description: 'Strip comments from JSON. Lets you use comments in your JSON files!', | |
| 86723 silly resolved keywords: | |
| 86723 silly resolved [ 'json', | |
| 86723 silly resolved 'strip', | |
| 86723 silly resolved 'remove', | |
| 86723 silly resolved 'delete', | |
| 86723 silly resolved 'trim', | |
| 86723 silly resolved 'comments', | |
| 86723 silly resolved 'multiline', | |
| 86723 silly resolved 'parse', | |
| 86723 silly resolved 'config', | |
| 86723 silly resolved 'configuration', | |
| 86723 silly resolved 'conf', | |
| 86723 silly resolved 'settings', | |
| 86723 silly resolved 'util', | |
| 86723 silly resolved 'env', | |
| 86723 silly resolved 'environment', | |
| 86723 silly resolved 'cli', | |
| 86723 silly resolved 'bin' ], | |
| 86723 silly resolved license: 'MIT', | |
| 86723 silly resolved author: | |
| 86723 silly resolved { name: 'Sindre Sorhus', | |
| 86723 silly resolved email: 'sindresorhus@gmail.com', | |
| 86723 silly resolved url: 'http://sindresorhus.com' }, | |
| 86723 silly resolved files: [ 'cli.js', 'strip-json-comments.js' ], | |
| 86723 silly resolved main: 'strip-json-comments', | |
| 86723 silly resolved bin: { 'strip-json-comments': 'cli.js' }, | |
| 86723 silly resolved repository: { type: 'git', url: 'sindresorhus/strip-json-comments' }, | |
| 86723 silly resolved scripts: { test: 'mocha' }, | |
| 86723 silly resolved devDependencies: { mocha: '*' }, | |
| 86723 silly resolved engines: { node: '>=0.8.0' }, | |
| 86723 silly resolved readme: '# strip-json-comments [](https://travis-ci.org/sindresorhus/strip-json-comments)\n\n> Strip comments from JSON. Lets you use comments in your JSON files!\n\nThis is now possible:\n\n```js\n{\n\t// rainbows\n\t"unicorn": /* ❤ */ "cake"\n}\n```\n\nIt will remove single-line comments `//` and multi-line comments `/**/`.\n\nAlso available as a [gulp](https://github.com/sindresorhus/gulp-strip-json-comments)/[grunt](https://github.com/sindresorhus/grunt-strip-json-comments)/[broccoli](https://github.com/sindresorhus/broccoli-strip-json-comments) plugin and a [require hook](https://github.com/uTest/autostrip-json-comments).\n\n\n*There\'s already [json-comments](https://npmjs.org/package/json-comments), but it\'s only for Node.js and uses a naive regex to strip comments which fails on simple cases like `{"a":"//"}`. This module however parses out the comments.*\n\n\n## Install\n\n```sh\n$ npm install --save strip-json-comments\n```\n\n```sh\n$ bower install --save strip-json-comments\n```\n\n```sh\n$ component install sindresorhus/strip-json-comments\n```\n\n\n## Usage\n\n```js\nvar json = \'{/*rainbows*/"unicorn":"cake"}\';\nJSON.parse(stripJsonComments(json));\n//=> {unicorn: \'cake\'}\n```\n\n\n## API\n\n### stripJsonComments(input)\n\n#### input\n\nType: `string`\n\nAccepts a string with JSON and returns a string without comments.\n\n\n## CLI\n\n```sh\n$ npm install --global strip-json-comments\n```\n\n```sh\n$ strip-json-comments --help\n\nstrip-json-comments input-file > output-file\n# or\nstrip-json-comments < input-file > output-file\n```\n\n\n## License\n\nMIT © [Sindre Sorhus](http://sindresorhus.com)\n', | |
| 86723 silly resolved readmeFilename: 'readme.md', | |
| 86723 silly resolved _id: 'strip-json-comments@1.0.2', | |
| 86723 silly resolved dist: { shasum: 'b60a30e7cd5be661aa978be3e09f0fe8fb1e2c8b' }, | |
| 86723 silly resolved _from: 'strip-json-comments@^1.0.2', | |
| 86723 silly resolved _resolved: 'https://registry.npmjs.org/strip-json-comments/-/strip-json-comments-1.0.2.tgz' }, | |
| 86723 silly resolved { name: 'trim-right', | |
| 86723 silly resolved version: '1.0.0', | |
| 86723 silly resolved description: 'Similar to String#trim() but removes only whitespace on the right', | |
| 86723 silly resolved license: 'MIT', | |
| 86723 silly resolved repository: { type: 'git', url: 'sindresorhus/trim-right' }, | |
| 86723 silly resolved author: | |
| 86723 silly resolved { name: 'Sindre Sorhus', | |
| 86723 silly resolved email: 'sindresorhus@gmail.com', | |
| 86723 silly resolved url: 'sindresorhus.com' }, | |
| 86723 silly resolved engines: { node: '>=0.10.0' }, | |
| 86723 silly resolved scripts: { test: 'node test.js' }, | |
| 86723 silly resolved files: [ 'index.js' ], | |
| 86723 silly resolved keywords: | |
| 86723 silly resolved [ 'trim', | |
| 86723 silly resolved 'right', | |
| 86723 silly resolved 'string', | |
| 86723 silly resolved 'str', | |
| 86723 silly resolved 'util', | |
| 86723 silly resolved 'utils', | |
| 86723 silly resolved 'utility', | |
| 86723 silly resolved 'whitespace', | |
| 86723 silly resolved 'space', | |
| 86723 silly resolved 'remove', | |
| 86723 silly resolved 'delete' ], | |
| 86723 silly resolved devDependencies: { ava: '0.0.4' }, | |
| 86723 silly resolved readme: '# trim-right [](https://travis-ci.org/sindresorhus/trim-right)\n\n> Similar to [`String#trim()`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/String/Trim) but removes only whitespace on the right\n\n\n## Install\n\n```\n$ npm install --save trim-right\n```\n\n\n## Usage\n\n```js\nvar trimRight = require(\'trim-right\');\n\ntrimRight(\' unicorn \');\n//=> \' unicorn\'\n```\n\n\n## Related\n\n- [`trim-left`](https://github.com/sindresorhus/trim-left) - Similar to `String#trim()` but removes only whitespace on the left\n\n\n## License\n\nMIT © [Sindre Sorhus](http://sindresorhus.com)\n', | |
| 86723 silly resolved readmeFilename: 'readme.md', | |
| 86723 silly resolved _id: 'trim-right@1.0.0', | |
| 86723 silly resolved dist: { shasum: 'ab00952b3f57fb21bbb0a95f1db7749cc4ef1543' }, | |
| 86723 silly resolved _from: 'trim-right@^1.0.0', | |
| 86723 silly resolved _resolved: 'https://registry.npmjs.org/trim-right/-/trim-right-1.0.0.tgz' }, | |
| 86723 silly resolved { name: 'user-home', | |
| 86723 silly resolved version: '1.1.1', | |
| 86723 silly resolved description: 'Get the path to the user home directory', | |
| 86723 silly resolved license: 'MIT', | |
| 86723 silly resolved repository: { type: 'git', url: 'sindresorhus/user-home' }, | |
| 86723 silly resolved bin: { 'user-home': 'cli.js' }, | |
| 86723 silly resolved author: | |
| 86723 silly resolved { name: 'Sindre Sorhus', | |
| 86723 silly resolved email: 'sindresorhus@gmail.com', | |
| 86723 silly resolved url: 'http://sindresorhus.com' }, | |
| 86723 silly resolved engines: { node: '>=0.10.0' }, | |
| 86723 silly resolved scripts: { test: 'node test.js' }, | |
| 86723 silly resolved files: [ 'index.js', 'cli.js' ], | |
| 86723 silly resolved keywords: | |
| 86723 silly resolved [ 'cli', | |
| 86723 silly resolved 'bin', | |
| 86723 silly resolved 'user', | |
| 86723 silly resolved 'home', | |
| 86723 silly resolved 'homedir', | |
| 86723 silly resolved 'dir', | |
| 86723 silly resolved 'directory', | |
| 86723 silly resolved 'folder', | |
| 86723 silly resolved 'path' ], | |
| 86723 silly resolved devDependencies: { ava: '0.0.3' }, | |
| 86723 silly resolved readme: '# user-home [](https://travis-ci.org/sindresorhus/user-home)\n\n> Get the path to the user home directory\n\n\n## Install\n\n```sh\n$ npm install --save user-home\n```\n\n\n## Usage\n\n```js\nvar userHome = require(\'user-home\');\n\nconsole.log(userHome);\n//=> /Users/sindresorhus\n```\n\nReturns `null` in the unlikely scenario that the home directory can\'t be found.\n\n\n## CLI\n\n```sh\n$ npm install --global user-home\n```\n\n```sh\n$ user-home --help\n\nExample\n $ user-home\n /Users/sindresorhus\n```\n\n\n## License\n\nMIT © [Sindre Sorhus](http://sindresorhus.com)\n', | |
| 86723 silly resolved readmeFilename: 'readme.md', | |
| 86723 silly resolved _id: 'user-home@1.1.1', | |
| 86723 silly resolved dist: { shasum: '5b841fc81fc780c04e68660f361c280d655aee07' }, | |
| 86723 silly resolved _from: 'user-home@^1.1.1', | |
| 86723 silly resolved _resolved: 'https://registry.npmjs.org/user-home/-/user-home-1.1.1.tgz' }, | |
| 86723 silly resolved { name: 'detect-indent', | |
| 86723 silly resolved version: '3.0.1', | |
| 86723 silly resolved description: 'Detect the indentation of code', | |
| 86723 silly resolved license: 'MIT', | |
| 86723 silly resolved repository: { type: 'git', url: 'sindresorhus/detect-indent' }, | |
| 86723 silly resolved author: | |
| 86723 silly resolved { name: 'Sindre Sorhus', | |
| 86723 silly resolved email: 'sindresorhus@gmail.com', | |
| 86723 silly resolved url: 'http://sindresorhus.com' }, | |
| 86723 silly resolved bin: { 'detect-indent': 'cli.js' }, | |
| 86723 silly resolved engines: { node: '>=0.10.0' }, | |
| 86723 silly resolved scripts: { test: 'mocha' }, | |
| 86723 silly resolved files: [ 'index.js', 'cli.js' ], | |
| 86723 silly resolved keywords: | |
| 86723 silly resolved [ 'cli', | |
| 86723 silly resolved 'bin', | |
| 86723 silly resolved 'indent', | |
| 86723 silly resolved 'indentation', | |
| 86723 silly resolved 'detect', | |
| 86723 silly resolved 'infer', | |
| 86723 silly resolved 'identify', | |
| 86723 silly resolved 'code', | |
| 86723 silly resolved 'string', | |
| 86723 silly resolved 'text', | |
| 86723 silly resolved 'source', | |
| 86723 silly resolved 'space', | |
| 86723 silly resolved 'tab' ], | |
| 86723 silly resolved dependencies: | |
| 86723 silly resolved { 'get-stdin': '^4.0.1', | |
| 86723 silly resolved minimist: '^1.1.0', | |
| 86723 silly resolved repeating: '^1.1.0' }, | |
| 86723 silly resolved devDependencies: { mocha: '*' }, | |
| 86723 silly resolved readme: '# detect-indent [](https://travis-ci.org/sindresorhus/detect-indent)\n\n> Detect the indentation of code\n\nPass in a string of any kind of text and get the indentation.\n\n\n## Use cases\n\n- Persisting the indentation when modifying a file.\n- Have new content match the existing indentation.\n- Setting the right indentation in your editor.\n\n\n## Install\n\n```sh\n$ npm install --save detect-indent\n```\n\n\n## Usage\n\n```js\n// modify a JSON file while persisting the indentation in Node\nvar fs = require(\'fs\');\nvar detectIndent = require(\'detect-indent\');\n/*\n{\n "ilove": "pizza"\n}\n*/\nvar file = fs.readFileSync(\'foo.json\', \'utf8\');\n// tries to detect the indentation and falls back to a default if it can\'t\nvar indent = detectIndent(file).indent || \' \';\nvar json = JSON.parse(file);\n\njson.ilove = \'unicorns\';\n\nfs.writeFileSync(\'foo.json\', JSON.stringify(json, null, indent));\n/*\n{\n "ilove": "unicorns"\n}\n*/\n```\n\n\n## API\n\nAccepts a string and returns an object with stats about the indentation: \n\n* `amount`: {Number} the amount of indentation, e.g. `2` \n* `type`: {String|Null} the type of indentation. Possible values are `tab`, `space` or `null` if no indentation is detected \n* `indent`: {String} the actual indentation\n\n\n## CLI\n\n```sh\n$ npm install --global detect-indent\n```\n\n```\n$ detect-indent --help\n\n Usage\n detect-indent <file>\n echo <string> | detect-indent\n\n Example\n echo \' foo\\n bar\' | detect-indent | wc --chars\n 2\n```\n\n\n## Algorithm\n\nThe current algorithm looks for the most common difference between two consecutive non-empty lines.\n\nIn the following example, even if the 4-space indentation is used 3 times whereas the 2-space one is used 2 times, it is detected as less used because there were only 2 differences with this value instead of 4 for the 2-space indentation:\n\n```css\nhtml {\n box-sizing: border-box;\n}\n\nbody {\n background: grey;\n}\n\np {\n line-height: 1.3em;\n margin-top: 1em;\n text-indent: 2em;\n}\n```\n\n[Source](https://medium.com/@heatherarthur/detecting-code-indentation-eff3ed0fb56b#3918).\n\nFurthermore, if there are more than one most used difference, the indentation with the most lines is selected.\n\nIn the following example, the indentation is detected as 4-spaces:\n\n```css\nbody {\n background: grey;\n}\n\np {\n line-height: 1.3em;\n margin-top: 1em;\n text-indent: 2em;\n}\n```\n\n\n## License\n\nMIT © [Sindre Sorhus](http://sindresorhus.com)\n', | |
| 86723 silly resolved readmeFilename: 'readme.md', | |
| 86723 silly resolved _id: 'detect-indent@3.0.1', | |
| 86723 silly resolved _from: 'detect-indent@^3.0.0', | |
| 86723 silly resolved dist: { shasum: '08551b033aac1ca794f989bd018e529b64fe8bdc' }, | |
| 86723 silly resolved _resolved: 'https://registry.npmjs.org/detect-indent/-/detect-indent-3.0.1.tgz' }, | |
| 86723 silly resolved { name: 'to-fast-properties', | |
| 86723 silly resolved version: '1.0.1', | |
| 86723 silly resolved description: 'Force V8 to use fast properties for an object', | |
| 86723 silly resolved license: 'MIT', | |
| 86723 silly resolved repository: { type: 'git', url: 'sindresorhus/to-fast-properties' }, | |
| 86723 silly resolved author: | |
| 86723 silly resolved { name: 'Sindre Sorhus', | |
| 86723 silly resolved email: 'sindresorhus@gmail.com', | |
| 86723 silly resolved url: 'sindresorhus.com' }, | |
| 86723 silly resolved engines: { node: '>=0.10.0' }, | |
| 86723 silly resolved scripts: { test: 'node --allow-natives-syntax test.js' }, | |
| 86723 silly resolved files: [ 'index.js' ], | |
| 86723 silly resolved keywords: | |
| 86723 silly resolved [ 'object', | |
| 86723 silly resolved 'obj', | |
| 86723 silly resolved 'properties', | |
| 86723 silly resolved 'props', | |
| 86723 silly resolved 'v8', | |
| 86723 silly resolved 'optimize', | |
| 86723 silly resolved 'fast', | |
| 86723 silly resolved 'convert', | |
| 86723 silly resolved 'mode' ], | |
| 86723 silly resolved devDependencies: { ava: '0.0.4' }, | |
| 86723 silly resolved readme: '# to-fast-properties [](https://travis-ci.org/sindresorhus/to-fast-properties)\n\n> Force V8 to use fast properties for an object\n\n[Read more.](http://stackoverflow.com/questions/24987896/)\n\nUse `%HasFastProperties(object)` and `--allow-natives-syntax` to check whether an object already has fast properties.\n\n\n## Install\n\n```\n$ npm install --save to-fast-properties\n```\n\n\n## Usage\n\n```js\nvar toFastProperties = require(\'to-fast-properties\');\n\nvar obj = {\n\tfoo: true,\n\tbar: true\n};\n\ndelete foo;\n// `obj` now has slow properties\n\ntoFastProperties(obj);\n// `obj` now has fast properties\n```\n\n\n## License\n\nMIT © [Sindre Sorhus](http://sindresorhus.com)\n', | |
| 86723 silly resolved readmeFilename: 'readme.md', | |
| 86723 silly resolved _id: 'to-fast-properties@1.0.1', | |
| 86723 silly resolved dist: { shasum: 'c8d4c48b838545e4423145a6c236108322b03dd5' }, | |
| 86723 silly resolved _from: 'to-fast-properties@^1.0.0', | |
| 86723 silly resolved _resolved: 'https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-1.0.1.tgz' }, | |
| 86723 silly resolved { name: 'estraverse', | |
| 86723 silly resolved description: 'ECMAScript JS AST traversal functions', | |
| 86723 silly resolved homepage: 'https://github.com/estools/estraverse', | |
| 86723 silly resolved main: 'estraverse.js', | |
| 86723 silly resolved version: '3.1.0', | |
| 86723 silly resolved engines: { node: '>=0.10.0' }, | |
| 86723 silly resolved maintainers: [ [Object] ], | |
| 86723 silly resolved repository: { type: 'git', url: 'http://github.com/estools/estraverse.git' }, | |
| 86723 silly resolved devDependencies: | |
| 86723 silly resolved { chai: '^2.1.1', | |
| 86723 silly resolved 'coffee-script': '^1.8.0', | |
| 86723 silly resolved espree: '^1.11.0', | |
| 86723 silly resolved gulp: '^3.8.10', | |
| 86723 silly resolved 'gulp-bump': '^0.2.2', | |
| 86723 silly resolved 'gulp-filter': '^2.0.0', | |
| 86723 silly resolved 'gulp-git': '^1.0.1', | |
| 86723 silly resolved 'gulp-tag-version': '^1.2.1', | |
| 86723 silly resolved jshint: '^2.5.6', | |
| 86723 silly resolved mocha: '^2.1.0' }, | |
| 86723 silly resolved licenses: [ [Object] ], | |
| 86723 silly resolved scripts: | |
| 86723 silly resolved { test: 'npm run-script lint && npm run-script unit-test', | |
| 86723 silly resolved lint: 'jshint estraverse.js', | |
| 86723 silly resolved 'unit-test': 'mocha --compilers coffee:coffee-script/register' }, | |
| 86723 silly resolved readme: '### Estraverse [](http://travis-ci.org/estools/estraverse)\n\nEstraverse ([estraverse](http://github.com/estools/estraverse)) is\n[ECMAScript](http://www.ecma-international.org/publications/standards/Ecma-262.htm)\ntraversal functions from [esmangle project](http://github.com/estools/esmangle).\n\n### Documentation\n\nYou can find usage docs at [wiki page](https://github.com/estools/estraverse/wiki/Usage).\n\n### Example Usage\n\nThe following code will output all variables declared at the root of a file.\n\n```javascript\nestraverse.traverse(ast, {\n enter: function (node, parent) {\n if (node.type == \'FunctionExpression\' || node.type == \'FunctionDeclaration\')\n return estraverse.VisitorOption.Skip;\n },\n leave: function (node, parent) {\n if (node.type == \'VariableDeclarator\')\n console.log(node.id.name);\n }\n});\n```\n\nWe can use `this.skip`, `this.remove` and `this.break` functions instead of using Skip, Remove and Break.\n\n```javascript\nestraverse.traverse(ast, {\n enter: function (node) {\n this.break();\n }\n});\n```\n\nAnd estraverse provides `estraverse.replace` function. When returning node from `enter`/`leave`, current node is replaced with it.\n\n```javascript\nresult = estraverse.replace(tree, {\n enter: function (node) {\n // Replace it with replaced.\n if (node.type === \'Literal\')\n return replaced;\n }\n});\n```\n\nBy passing `visitor.keys` mapping, we can extend estraverse traversing functionality.\n\n```javascript\n// This tree contains a user-defined `TestExpression` node.\nvar tree = {\n type: \'TestExpression\',\n\n // This \'argument\' is the property containing the other **node**.\n argument: {\n type: \'Literal\',\n value: 20\n },\n\n // This \'extended\' is the property not containing the other **node**.\n extended: true\n};\nestraverse.traverse(tree, {\n enter: function (node) { },\n\n // Extending the exising traversing rules.\n keys: {\n // TargetNodeName: [ \'keys\', \'containing\', \'the\', \'other\', \'**node**\' ]\n TestExpression: [\'argument\']\n }\n});\n```\n\nBy passing `visitor.fallback` option, we can control the behavior when encountering unknown nodes.\n```javascript\n// This tree contains a user-defined `TestExpression` node.\nvar tree = {\n type: \'TestExpression\',\n\n // This \'argument\' is the property containing the other **node**.\n argument: {\n type: \'Literal\',\n value: 20\n },\n\n // This \'extended\' is the property not containing the other **node**.\n extended: true\n};\nestraverse.traverse(tree, {\n enter: function (node) { },\n\n // Iterating the child **nodes** of unknown nodes.\n fallback: \'iteration\'\n});\n```\n\n### License\n\nCopyright (C) 2012-2013 [Yusuke Suzuki](http://github.com/Constellation)\n (twitter: [@Constellation](http://twitter.com/Constellation)) and other contributors.\n\nRedistribution and use in source and binary forms, with or without\nmodification, are permitted provided that the following conditions are met:\n\n * Redistributions of source code must retain the above copyright\n notice, this list of conditions and the following disclaimer.\n\n * Redistributions in binary form must reproduce the above copyright\n notice, this list of conditions and the following disclaimer in the\n documentation and/or other materials provided with the distribution.\n\nTHIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"\nAND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE\nIMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE\nARE DISCLAIMED. IN NO EVENT SHALL <COPYRIGHT HOLDER> BE LIABLE FOR ANY\nDIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES\n(INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;\nLOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND\nON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT\n(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF\nTHIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.\n', | |
| 86723 silly resolved readmeFilename: 'README.md', | |
| 86723 silly resolved bugs: { url: 'https://github.com/estools/estraverse/issues' }, | |
| 86723 silly resolved _id: 'estraverse@3.1.0', | |
| 86723 silly resolved dist: { shasum: 'f1bd3f34d890a26e7971be0479bd40ef79fcf56a' }, | |
| 86723 silly resolved _from: 'estraverse@^3.0.0', | |
| 86723 silly resolved _resolved: 'https://registry.npmjs.org/estraverse/-/estraverse-3.1.0.tgz' }, | |
| 86723 silly resolved { author: { name: 'Ben Newman', email: 'bn@cs.stanford.edu' }, | |
| 86723 silly resolved name: 'private', | |
| 86723 silly resolved description: 'Utility for associating truly private state with any JavaScript object', | |
| 86723 silly resolved keywords: | |
| 86723 silly resolved [ 'private', | |
| 86723 silly resolved 'access control', | |
| 86723 silly resolved 'access modifiers', | |
| 86723 silly resolved 'encapsulation', | |
| 86723 silly resolved 'secret', | |
| 86723 silly resolved 'state', | |
| 86723 silly resolved 'privilege', | |
| 86723 silly resolved 'scope', | |
| 86723 silly resolved 'es5' ], | |
| 86723 silly resolved version: '0.1.6', | |
| 86723 silly resolved homepage: 'http://github.com/benjamn/private', | |
| 86723 silly resolved repository: { type: 'git', url: 'git://github.com/benjamn/private.git' }, | |
| 86723 silly resolved license: 'MIT', | |
| 86723 silly resolved main: 'private.js', | |
| 86723 silly resolved scripts: { test: 'node test/run.js' }, | |
| 86723 silly resolved engines: { node: '>= 0.6' }, | |
| 86723 silly resolved readme: 'private [](https://travis-ci.org/benjamn/private)\n===\n\nA general-purpose utility for associating truly private state with any JavaScript object.\n\nInstallation\n---\n\nFrom NPM:\n\n npm install private\n\nFrom GitHub:\n\n cd path/to/node_modules\n git clone git://github.com/benjamn/private.git\n cd private\n npm install .\n\nUsage\n---\n**Get or create a secret object associated with any (non-frozen) object:**\n```js\nvar getSecret = require("private").makeAccessor();\nvar obj = Object.create(null); // any kind of object works\ngetSecret(obj).totallySafeProperty = "p455w0rd";\n\nconsole.log(Object.keys(obj)); // []\nconsole.log(Object.getOwnPropertyNames(obj)); // []\nconsole.log(getSecret(obj)); // { totallySafeProperty: "p455w0rd" }\n```\nNow, only code that has a reference to both `getSecret` and `obj` can possibly access `.totallySafeProperty`.\n\n*Importantly, no global references to the secret object are retained by the `private` package, so as soon as `obj` gets garbage collected, the secret will be reclaimed as well. In other words, you don\'t have to worry about memory leaks.*\n\n**Create a unique property name that cannot be enumerated or guessed:**\n```js\nvar secretKey = require("private").makeUniqueKey();\nvar obj = Object.create(null); // any kind of object works\n\nObject.defineProperty(obj, secretKey, {\n value: { totallySafeProperty: "p455w0rd" },\n enumerable: false // optional; non-enumerability is the default\n});\n\nObject.defineProperty(obj, "nonEnumerableProperty", {\n value: "anyone can guess my name",\n enumerable: false\n});\n\nconsole.log(obj[secretKey].totallySafeProperty); // p455w0rd\nconsole.log(obj.nonEnumerableProperty); // "anyone can guess my name"\nconsole.log(Object.keys(obj)); // []\nconsole.log(Object.getOwnPropertyNames(obj)); // ["nonEnumerableProperty"]\n\nfor (var key in obj) {\n console.log(key); // never called\n}\n```\nBecause these keys are non-enumerable, you can\'t discover them using a `for`-`in` loop. Because `secretKey` is a long string of random characters, you would have a lot of trouble guessing it. And because the `private` module wraps `Object.getOwnPropertyNames` to exclude the keys it generates, you can\'t even use that interface to discover it.\n\nUnless you have access to the value of the `secretKey` property name, there is no way to access the value associated with it. So your only responsibility as secret-keeper is to avoid handing out the value of `secretKey` to untrusted code.\n\nThink of this style as a home-grown version of the first style. Note, however, that it requires a full implementation of ES5\'s `Object.defineProperty` method in order to make any safety guarantees, whereas the first example will provide safety even in environments that do not support `Object.defineProperty`.\n\nRationale\n---\n\nIn JavaScript, the only data that are truly private are local variables\nwhose values do not *leak* from the scope in which they were defined.\n\nThis notion of *closure privacy* is powerful, and it readily provides some\nof the benefits of traditional data privacy, a la Java or C++:\n```js\nfunction MyClass(secret) {\n this.increment = function() {\n return ++secret;\n };\n}\n\nvar mc = new MyClass(3);\nconsole.log(mc.increment()); // 4\n```\nYou can learn something about `secret` by calling `.increment()`, and you\ncan increase its value by one as many times as you like, but you can never\ndecrease its value, because it is completely inaccessible except through\nthe `.increment` method. And if the `.increment` method were not\navailable, it would be as if no `secret` variable had ever been declared,\nas far as you could tell.\n\nThis style breaks down as soon as you want to inherit methods from the\nprototype of a class:\n```js\nfunction MyClass(secret) {\n this.secret = secret;\n}\n\nMyClass.prototype.increment = function() {\n return ++this.secret;\n};\n```\nThe only way to communicate between the `MyClass` constructor and the\n`.increment` method in this example is to manipulate shared properties of\n`this`. Unfortunately `this.secret` is now exposed to unlicensed\nmodification:\n```js\nvar mc = new MyClass(6);\nconsole.log(mc.increment()); // 7\nmc.secret -= Infinity;\nconsole.log(mc.increment()); // -Infinity\nmc.secret = "Go home JavaScript, you\'re drunk.";\nmc.increment(); // NaN\n```\nAnother problem with closure privacy is that it only lends itself to\nper-instance privacy, whereas the `private` keyword in most\nobject-oriented languages indicates that the data member in question is\nvisible to all instances of the same class.\n\nSuppose you have a `Node` class with a notion of parents and children:\n```js\nfunction Node() {\n var parent;\n var children = [];\n\n this.getParent = function() {\n return parent;\n };\n\n this.appendChild = function(child) {\n children.push(child);\n child.parent = this; // Can this be made to work?\n };\n}\n```\nThe desire here is to allow other `Node` objects to manipulate the value\nreturned by `.getParent()`, but otherwise disallow any modification of the\n`parent` variable. You could expose a `.setParent` function, but then\nanyone could call it, and you might as well give up on the getter/setter\npattern.\n\nThis module solves both of these problems.\n\nUsage\n---\n\nLet\'s revisit the `Node` example from above:\n```js\nvar p = require("private").makeAccessor();\n\nfunction Node() {\n var privates = p(this);\n var children = [];\n\n this.getParent = function() {\n return privates.parent;\n };\n\n this.appendChild = function(child) {\n children.push(child);\n var cp = p(child);\n if (cp.parent)\n cp.parent.removeChild(child);\n cp.parent = this;\n return child;\n };\n}\n```\nNow, in order to access the private data of a `Node` object, you need to\nhave access to the unique `p` function that is being used here. This is\nalready an improvement over the previous example, because it allows\nrestricted access by other `Node` instances, but can it help with the\n`Node.prototype` problem too?\n\nYes it can!\n```js\nvar p = require("private").makeAccessor();\n\nfunction Node() {\n p(this).children = [];\n}\n\nvar Np = Node.prototype;\n\nNp.getParent = function() {\n return p(this).parent;\n};\n\nNp.appendChild = function(child) {\n p(this).children.push(child);\n var cp = p(child);\n if (cp.parent)\n cp.parent.removeChild(child);\n cp.parent = this;\n return child;\n};\n```\nBecause `p` is in scope not only within the `Node` constructor but also\nwithin `Node` methods, we can finally avoid redefining methods every time\nthe `Node` constructor is called.\n\nNow, you might be wondering how you can restrict access to `p` so that no\nuntrusted code is able to call it. The answer is to use your favorite\nmodule pattern, be it CommonJS, AMD `define`, or even the old\nImmediately-Invoked Function Expression:\n```js\nvar Node = (function() {\n var p = require("private").makeAccessor();\n\n function Node() {\n p(this).children = [];\n }\n\n var Np = Node.prototype;\n\n Np.getParent = function() {\n return p(this).parent;\n };\n\n Np.appendChild = function(child) {\n p(this).children.push(child);\n var cp = p(child);\n if (cp.parent)\n cp.parent.removeChild(child);\n cp.parent = this;\n return child;\n };\n\n return Node;\n}());\n\nvar parent = new Node;\nvar child = new Node;\nparent.appendChild(child);\nassert.strictEqual(child.getParent(), parent);\n```\nBecause this version of `p` never leaks from the enclosing function scope,\nonly `Node` objects have access to it.\n\nSo, you see, the claim I made at the beginning of this README remains\ntrue:\n\n> In JavaScript, the only data that are truly private are local variables\n> whose values do not *leak* from the scope in which they were defined.\n\nIt just so happens that closure privacy is sufficient to implement a\nprivacy model similar to that provided by other languages.\n', | |
| 86723 silly resolved readmeFilename: 'README.md', | |
| 86723 silly resolved bugs: { url: 'https://github.com/benjamn/private/issues' }, | |
| 86723 silly resolved _id: 'private@0.1.6', | |
| 86723 silly resolved _from: 'private@^0.1.6', | |
| 86723 silly resolved dist: { shasum: '893ea83f5cc81a90b6e187c693b6c4fffbe9ba3c' }, | |
| 86723 silly resolved _resolved: 'https://registry.npmjs.org/private/-/private-0.1.6.tgz' }, | |
| 86723 silly resolved { name: 'line-numbers', | |
| 86723 silly resolved version: '0.2.0', | |
| 86723 silly resolved author: { name: 'Simon Lydell' }, | |
| 86723 silly resolved license: 'MIT', | |
| 86723 silly resolved description: 'Add line numbers to a string.', | |
| 86723 silly resolved keywords: | |
| 86723 silly resolved [ 'line', | |
| 86723 silly resolved 'number', | |
| 86723 silly resolved 'numbers', | |
| 86723 silly resolved 'file', | |
| 86723 silly resolved 'add', | |
| 86723 silly resolved 'insert', | |
| 86723 silly resolved 'gutter', | |
| 86723 silly resolved 'column', | |
| 86723 silly resolved 'each' ], | |
| 86723 silly resolved repository: { type: 'git', url: 'lydell/line-numbers' }, | |
| 86723 silly resolved scripts: { test: 'mocha --ui tdd' }, | |
| 86723 silly resolved devDependencies: { mocha: '^2.0.1' }, | |
| 86723 silly resolved dependencies: { 'left-pad': '0.0.3' }, | |
| 86723 silly resolved readme: 'Overview [](https://travis-ci.org/lydell/line-numbers)\n========\n\nAdd line numbers to a string.\n\n```js\nvar lineNumbers = require("line-numbers")\n\nvar string = [\n "function sum(a, b) {",\n " return a + b;",\n "}"\n].join("\\n")\n\nlineNumbers(string)\n// 1 | function sum(a, b) {\n// 2 | return a + b;\n// 3 | }\n```\n\n\nInstallation\n============\n\n- `npm install line-numbers`\n\n```js\nvar lineNumbers = require("line-numbers")\n```\n\n\nUsage\n=====\n\n### `lineNumbers(code, [options])` ###\n\nInserts a line number at the beginning of each line in `code`, which is either a\nstring or an array of strings—one for each line. All the line numbers are of the\nsame width; shorter numbers are padded on the left side.\n\nThe return value is of the same type as `code`.\n\n`options`:\n\n- start: `Number`. The number to use for the first line. Defaults to `1`.\n- padding: `String`. The character to pad numbers with. Defaults to `" "`.\n- before: `String`. String to put before the line number. Defaults to `" "`.\n- after: `String`. String to put between the line number and the line itself.\n Defaults to `" | "`.\n- transform: `Function`. It is called for each line and passed an object with\n the following properties:\n\n - before: `options.before`\n - number: `Number`. The current line number.\n - width: `Number`. The padded width of the line numbers.\n - after: `options.after`\n - line: `String`. The current line.\n\n You may modify the above properties to alter the line numbering for the\n current line. This is useful if `before` and `after` aren’t enough, if you\n want to colorize the line numbers, or highlight the current line.\n\n\nLicense\n=======\n\n[The X11 (“MIT”) License](LICENSE).\n', | |
| 86723 silly resolved readmeFilename: 'readme.md', | |
| 86723 silly resolved _id: 'line-numbers@0.2.0', | |
| 86723 silly resolved dist: { shasum: '7f0e96ea532cccfa0d67fab2f896064c8029b407' }, | |
| 86723 silly resolved _from: 'line-numbers@0.2.0', | |
| 86723 silly resolved _resolved: 'https://registry.npmjs.org/line-numbers/-/line-numbers-0.2.0.tgz' }, | |
| 86723 silly resolved { name: 'regexpu', | |
| 86723 silly resolved version: '1.1.2', | |
| 86723 silly resolved description: 'A source code transpiler that enables the use of ES6 Unicode regular expressions in ES5.', | |
| 86723 silly resolved homepage: 'https://mths.be/regexpu', | |
| 86723 silly resolved main: 'regexpu.js', | |
| 86723 silly resolved bin: { regexpu: 'bin/regexpu' }, | |
| 86723 silly resolved keywords: | |
| 86723 silly resolved [ 'codegen', | |
| 86723 silly resolved 'desugaring', | |
| 86723 silly resolved 'ecmascript', | |
| 86723 silly resolved 'es5', | |
| 86723 silly resolved 'es6', | |
| 86723 silly resolved 'harmony', | |
| 86723 silly resolved 'javascript', | |
| 86723 silly resolved 'refactoring', | |
| 86723 silly resolved 'regex', | |
| 86723 silly resolved 'regexp', | |
| 86723 silly resolved 'regular expressions', | |
| 86723 silly resolved 'rewriting', | |
| 86723 silly resolved 'syntax', | |
| 86723 silly resolved 'transformation', | |
| 86723 silly resolved 'transpile', | |
| 86723 silly resolved 'transpiler', | |
| 86723 silly resolved 'unicode' ], | |
| 86723 silly resolved license: 'MIT', | |
| 86723 silly resolved author: { name: 'Mathias Bynens', url: 'https://mathiasbynens.be/' }, | |
| 86723 silly resolved repository: | |
| 86723 silly resolved { type: 'git', | |
| 86723 silly resolved url: 'https://github.com/mathiasbynens/regexpu.git' }, | |
| 86723 silly resolved bugs: { url: 'https://github.com/mathiasbynens/regexpu/issues' }, | |
| 86723 silly resolved files: | |
| 86723 silly resolved [ 'LICENSE-MIT.txt', | |
| 86723 silly resolved 'regexpu.js', | |
| 86723 silly resolved 'rewrite-pattern.js', | |
| 86723 silly resolved 'transform-tree.js', | |
| 86723 silly resolved 'transpile-code.js', | |
| 86723 silly resolved 'data/character-class-escape-sets.js', | |
| 86723 silly resolved 'data/iu-mappings.json', | |
| 86723 silly resolved 'bin/', | |
| 86723 silly resolved 'man/' ], | |
| 86723 silly resolved directories: { bin: 'bin', man: 'man' }, | |
| 86723 silly resolved scripts: | |
| 86723 silly resolved { build: 'node scripts/iu-mappings.js && node scripts/character-class-escape-sets.js', | |
| 86723 silly resolved test: 'mocha tests', | |
| 86723 silly resolved coverage: 'istanbul cover --report html node_modules/.bin/_mocha tests/tests.js -- -u exports -R spec' }, | |
| 86723 silly resolved dependencies: | |
| 86723 silly resolved { recast: '^0.10.1', | |
| 86723 silly resolved regenerate: '^1.2.1', | |
| 86723 silly resolved regjsgen: '^0.2.0', | |
| 86723 silly resolved regjsparser: '^0.1.4' }, | |
| 86723 silly resolved devDependencies: | |
| 86723 silly resolved { coveralls: '^2.11.2', | |
| 86723 silly resolved istanbul: '^0.3.6', | |
| 86723 silly resolved jsesc: '^0.5.0', | |
| 86723 silly resolved lodash: '^3.3.1', | |
| 86723 silly resolved mocha: '^2.1.0', | |
| 86723 silly resolved 'unicode-5.1.0': '^0.1.5', | |
| 86723 silly resolved 'unicode-7.0.0': '^0.1.5' }, | |
| 86723 silly resolved man: [ 'C:\\Users\\Vince\\AppData\\Roaming\\npm-cache\\regexpu\\1.1.2\\package\\man\\regexpu.1' ], | |
| 86723 silly resolved readme: '# regexpu [](https://travis-ci.org/mathiasbynens/regexpu) [](https://coveralls.io/r/mathiasbynens/regexpu) [](https://gemnasium.com/mathiasbynens/regexpu)\n\n_regexpu_ is a source code transpiler that enables the use of ES6 Unicode regular expressions in JavaScript-of-today (ES5). It rewrites regular expressions that make use of [the ES6 `u` flag](https://mathiasbynens.be/notes/es6-unicode-regex) into equivalent ES5-compatible regular expressions.\n\n[Here’s an online demo.](https://mothereff.in/regexpu)\n\n[Traceur v0.0.61+](https://github.com/google/traceur-compiler), [Babel v1.5.0+](https://github.com/babel/babel), and [esnext v0.12.0+](https://github.com/esnext/esnext) use _regexpu_ for their `u` regexp transpilation. The REPL demos for [Traceur](https://google.github.io/traceur-compiler/demo/repl.html#%2F%2F%20Traceur%20now%20uses%20regexpu%20%28https%3A%2F%2Fmths.be%2Fregexpu%29%20to%20transpile%20regular%0A%2F%2F%20expression%20literals%20that%20have%20the%20ES6%20%60u%60%20flag%20set%20into%20equivalent%20ES5.%0A%0A%2F%2F%20Match%20any%20symbol%20from%20U%2B1F4A9%20PILE%20OF%20POO%20to%20U%2B1F4AB%20DIZZY%20SYMBOL.%0Avar%20regex%20%3D%20%2F%5B%F0%9F%92%A9-%F0%9F%92%AB%5D%2Fu%3B%20%2F%2F%20Or%2C%20%60%2F%5Cu%7B1F4A9%7D-%5Cu%7B1F4AB%7D%2Fu%60.%0Aconsole.log%28%0A%20%20regex.test%28\'%F0%9F%92%A8\'%29%2C%20%2F%2F%20false%0A%20%20regex.test%28\'%F0%9F%92%A9\'%29%2C%20%2F%2F%20true%0A%20%20regex.test%28\'%F0%9F%92%AA\'%29%2C%20%2F%2F%20true%0A%20%20regex.test%28\'%F0%9F%92%AB\'%29%2C%20%2F%2F%20true%0A%20%20regex.test%28\'%F0%9F%92%AC\'%29%20%20%2F%2F%20false%0A%29%3B%0A%0A%2F%2F%20See%20https%3A%2F%2Fmathiasbynens.be%2Fnotes%2Fes6-unicode-regex%20for%20more%20examples%20and%0A%2F%2F%20info.%0A), [Babel](https://babeljs.io/repl/#?experimental=true&playground=true&evaluate=true&code=%2F%2F%20Babel%20now%20uses%20regexpu%20%28https%3A%2F%2Fmths.be%2Fregexpu%29%20to%20transpile%20regular%0A%2F%2F%20expression%20literals%20that%20have%20the%20ES6%20%60u%60%20flag%20set%20into%20equivalent%20ES5.%0A%0A%2F%2F%20Match%20any%20symbol%20from%20U%2B1F4A9%20PILE%20OF%20POO%20to%20U%2B1F4AB%20DIZZY%20SYMBOL.%0Avar%20regex%20%3D%20%2F%5B%F0%9F%92%A9-%F0%9F%92%AB%5D%2Fu%3B%20%2F%2F%20Or%2C%20%60%2F%5Cu%7B1F4A9%7D-%5Cu%7B1F4AB%7D%2Fu%60.%0Aconsole.log%28%0A%20%20regex.test%28\'%F0%9F%92%A8\'%29%2C%20%2F%2F%20false%0A%20%20regex.test%28\'%F0%9F%92%A9\'%29%2C%20%2F%2F%20true%0A%20%20regex.test%28\'%F0%9F%92%AA\'%29%2C%20%2F%2F%20true%0A%20%20regex.test%28\'%F0%9F%92%AB\'%29%2C%20%2F%2F%20true%0A%20%20regex.test%28\'%F0%9F%92%AC\'%29%20%20%2F%2F%20false%0A%29%3B%0A%0A%2F%2F%20See%20https%3A%2F%2Fmathiasbynens.be%2Fnotes%2Fes6-unicode-regex%20for%20more%20examples%20and%0A%2F%2F%20info.%0A), and [esnext](https://esnext.github.io/esnext/#%2F%2F%20esnext%20now%20uses%20regexpu%20%28https%3A%2F%2Fmths.be%2Fregexpu%29%20to%20transpile%20regular%0A%2F%2F%20expression%20literals%20that%20have%20the%20ES6%20%60u%60%20flag%20set%20into%20equivalent%20ES5.%0A%0A%2F%2F%20Match%20any%20symbol%20from%20U%2B1F4A9%20PILE%20OF%20POO%20to%20U%2B1F4AB%20DIZZY%20SYMBOL.%0Avar%20regex%20%3D%20%2F%5B%F0%9F%92%A9-%F0%9F%92%AB%5D%2Fu%3B%20%2F%2F%20Or%2C%20%60%2F%5Cu%7B1F4A9%7D-%5Cu%7B1F4AB%7D%2Fu%60.%0Aconsole.log%28%0A%20%20regex.test%28\'%F0%9F%92%A8\'%29%2C%20%2F%2F%20false%0A%20%20regex.test%28\'%F0%9F%92%A9\'%29%2C%20%2F%2F%20true%0A%20%20regex.test%28\'%F0%9F%92%AA\'%29%2C%20%2F%2F%20true%0A%20%20regex.test%28\'%F0%9F%92%AB\'%29%2C%20%2F%2F%20true%0A%20%20regex.test%28\'%F0%9F%92%AC\'%29%20%20%2F%2F%20false%0A%29%3B%0A%0A%2F%2F%20See%20https%3A%2F%2Fmathiasbynens.be%2Fnotes%2Fes6-unicode-regex%20for%20more%20examples%20and%0A%2F%2F%20info.%0A) let you try `u` regexps as well as other ES.next features.\n\n## Example\n\nConsider a file named `example-es6.js` with the following contents:\n\n```js\nvar string = \'foo💩bar\';\nvar match = string.match(/foo(.)bar/u);\nconsole.log(match[1]);\n// → \'💩\'\n\n// This regex matches any symbol from U+1F4A9 to U+1F4AB, and nothing else.\nvar regex = /[\\u{1F4A9}-\\u{1F4AB}]/u;\n// The following regex is equivalent.\nvar alternative = /[💩-💫]/u;\nconsole.log([\n regex.test(\'a\'), // false\n regex.test(\'💩\'), // true\n regex.test(\'💪\'), // true\n regex.test(\'💫\'), // true\n regex.test(\'💬\') // false\n]);\n```\n\nLet’s transpile it:\n\n```bash\n$ regexpu -f example-es6.js > example-es5.js\n```\n\n`example-es5.js` can now be used in ES5 environments. Its contents are as follows:\n\n```js\nvar string = \'foo💩bar\';\nvar match = string.match(/foo((?:[\\0-\\t\\x0B\\f\\x0E-\\u2027\\u202A-\\uD7FF\\uDC00-\\uFFFF]|[\\uD800-\\uDBFF][\\uDC00-\\uDFFF]|[\\uD800-\\uDBFF]))bar/);\nconsole.log(match[1]);\n// → \'💩\'\n\n// This regex matches any symbol from U+1F4A9 to U+1F4AB, and nothing else.\nvar regex = /(?:\\uD83D[\\uDCA9-\\uDCAB])/;\n// The following regex is equivalent.\nvar alternative = /(?:\\uD83D[\\uDCA9-\\uDCAB])/;\nconsole.log([\n regex.test(\'a\'), // false\n regex.test(\'💩\'), // true\n regex.test(\'💪\'), // true\n regex.test(\'💫\'), // true\n regex.test(\'💬\') // false\n]);\n```\n\n## Known limitations\n\n1. _regexpu_ only transpiles regular expression _literals_, so things like `RegExp(\'…\', \'u\')` are not affected.\n2. _regexpu_ doesn’t polyfill [the `RegExp.prototype.unicode` getter](https://mths.be/es6#sec-get-regexp.prototype.unicode) because it’s not possible to do so without side effects.\n3. _regexpu_ doesn’t support [canonicalizing the contents of back-references in regular expressions with both the `i` and `u` flag set](https://github.com/mathiasbynens/regexpu/issues/4), since that would require transpiling/wrapping strings.\n4. _regexpu_ [doesn’t match lone low surrogates accurately](https://github.com/mathiasbynens/regexpu/issues/17). Unfortunately that is impossible to implement due to the lack of lookbehind support in JavaScript regular expressions.\n\n## Installation\n\nTo use _regexpu_ programmatically, install it as a dependency via [npm](https://www.npmjs.com/):\n\n```bash\nnpm install regexpu --save-dev\n```\n\nTo use the command-line interface, install _regexpu_ globally:\n\n```bash\nnpm install regexpu -g\n```\n\n## API\n\n### `regexpu.version`\n\nA string representing the semantic version number.\n\n### `regexpu.rewritePattern(pattern, flags)`\n\nThis function takes a string that represents a regular expression pattern as well as a string representing its flags, and returns an ES5-compatible version of the pattern.\n\n```js\nregexpu.rewritePattern(\'foo.bar\', \'u\');\n// → \'foo(?:[\\\\0-\\\\t\\\\x0B\\\\f\\\\x0E-\\\\u2027\\\\u202A-\\\\uD7FF\\\\uDC00-\\\\uFFFF]|[\\\\uD800-\\\\uDBFF][\\\\uDC00-\\\\uDFFF]|[\\\\uD800-\\\\uDBFF])bar\'\n\nregexpu.rewritePattern(\'[\\\\u{1D306}-\\\\u{1D308}a-z]\', \'u\');\n// → \'(?:[a-z]|\\\\uD834[\\\\uDF06-\\\\uDF08])\'\n\nregexpu.rewritePattern(\'[\\\\u{1D306}-\\\\u{1D308}a-z]\', \'ui\');\n// → \'(?:[a-z\\\\u017F\\\\u212A]|\\\\uD834[\\\\uDF06-\\\\uDF08])\'\n```\n\n_regexpu_ can rewrite non-ES6 regular expressions too, which is useful to demonstrate how their behavior changes once the `u` and `i` flags are added:\n\n```js\n// In ES5, the dot operator only matches BMP symbols:\nregexpu.rewritePattern(\'foo.bar\');\n// → \'foo(?:[\\\\0-\\\\t\\\\x0B\\\\f\\\\x0E-\\\\u2027\\\\u202A-\\\\uFFFF])bar\'\n\n// But with the ES6 `u` flag, it matches astral symbols too:\nregexpu.rewritePattern(\'foo.bar\', \'u\');\n// → \'foo(?:[\\\\0-\\\\t\\\\x0B\\\\f\\\\x0E-\\\\u2027\\\\u202A-\\\\uD7FF\\\\uDC00-\\\\uFFFF]|[\\\\uD800-\\\\uDBFF][\\\\uDC00-\\\\uDFFF]|[\\\\uD800-\\\\uDBFF])bar\'\n```\n\n`regexpu.rewritePattern` uses [regjsgen](https://github.com/d10/regjsgen), [regjsparser](https://github.com/jviereck/regjsparser), and [regenerate](https://github.com/mathiasbynens/regenerate) as internal dependencies. If you only need this function in your program, it’s better to include it directly:\n\n```js\nvar rewritePattern = require(\'regexpu/rewrite-pattern\');\n```\n\nThis prevents the [Recast](https://github.com/benjamn/recast) and [Esprima](https://github.com/ariya/esprima) dependencies from being loaded into memory.\n\n### `regexpu.transformTree(ast)` or its alias `regexpu.transform(ast)`\n\nThis function accepts an abstract syntax tree representing some JavaScript code, and returns a transformed version of the tree in which any regular expression literals that use the ES6 `u` flag are rewritten in ES5.\n\n```js\nvar regexpu = require(\'regexpu\');\nvar recast = require(\'recast\');\nvar tree = recast.parse(code); // ES6 code\ntree = regexpu.transform(tree);\nvar result = recast.print(tree);\nconsole.log(result.code); // transpiled ES5 code\nconsole.log(result.map); // source map\n```\n\n`regexpu.transformTree` uses [Recast](https://github.com/benjamn/recast), [regjsgen](https://github.com/d10/regjsgen), [regjsparser](https://github.com/jviereck/regjsparser), and [regenerate](https://github.com/mathiasbynens/regenerate) as internal dependencies. If you only need this function in your program, it’s better to include it directly:\n\n```js\nvar transformTree = require(\'regexpu/transform-tree\');\n```\n\nThis prevents the [Esprima](https://github.com/ariya/esprima) dependency from being loaded into memory.\n\n### `regexpu.transpileCode(code, options)`\n\nThis function accepts a string representing some JavaScript code, and returns a transpiled version of this code tree in which any regular expression literals that use the ES6 `u` flag are rewritten in ES5.\n\n```js\nvar es6 = \'console.log(/foo.bar/u.test("foo💩bar"));\';\nvar es5 = regexpu.transpileCode(es6);\n// → \'console.log(/foo(?:[\\\\0-\\\\t\\\\x0B\\\\f\\\\x0E-\\\\u2027\\\\u202A-\\\\uD7FF\\\\uDC00-\\\\uFFFF]|[\\\\uD800-\\\\uDBFF][\\\\uDC00-\\\\uDFFF]|[\\\\uD800-\\\\uDBFF])bar/.test("foo💩bar"));\'\n```\n\nThe optional `options` object recognizes the following properties:\n\n* `sourceFileName`: a string representing the file name of the original ES6 source file.\n* `sourceMapName`: a string representing the desired file name of the source map.\n\nThese properties must be provided if you want to generate source maps.\n\n```js\nvar result = regexpu.transpileCode(code, {\n \'sourceFileName\': \'es6.js\',\n \'sourceMapName\': \'es6.js.map\',\n});\nconsole.log(result.code); // transpiled source code\nconsole.log(result.map); // source map\n```\n\n`regexpu.transpileCode` uses [Esprima](https://github.com/ariya/esprima), [Recast](https://github.com/benjamn/recast), [regjsgen](https://github.com/d10/regjsgen), [regjsparser](https://github.com/jviereck/regjsparser), and [regenerate](https://github.com/mathiasbynens/regenerate) as internal dependencies. If you only need this function in your program, feel free to include it directly:\n\n```js\nvar transpileCode = require(\'regexpu/transpile-code\');\n```\n\n## Transpilers that use regexpu internally\n\nIf you’re looking for a general-purpose ES.next-to-ES5 transpiler with support for Unicode regular expressions, consider using one of these:\n\n* [Traceur](https://github.com/google/traceur-compiler) v0.0.61+\n* [Babel](https://github.com/babel/babel) v1.5.0+\n* [esnext](https://github.com/esnext/esnext) v0.12.0+\n\n## Author\n\n| [](https://twitter.com/mathias "Follow @mathias on Twitter") |\n|---|\n| [Mathias Bynens](https://mathiasbynens.be/) |\n\n## License\n\n_regexpu_ is available under the [MIT](https://mths.be/mit) license.\n', | |
| 86723 silly resolved readmeFilename: 'README.md', | |
| 86723 silly resolved _id: 'regexpu@1.1.2', | |
| 86723 silly resolved _from: 'regexpu@^1.1.2', | |
| 86723 silly resolved dist: { shasum: 'c424b808d0ee3d5b1cdfd29d10dc7a4c77f85671' }, | |
| 86723 silly resolved _resolved: 'https://registry.npmjs.org/regexpu/-/regexpu-1.1.2.tgz' }, | |
| 86723 silly resolved { name: 'js-tokens', | |
| 86723 silly resolved version: '1.0.0', | |
| 86723 silly resolved author: { name: 'Simon Lydell' }, | |
| 86723 silly resolved license: 'MIT', | |
| 86723 silly resolved description: 'A regex that tokenizes JavaScript.', | |
| 86723 silly resolved keywords: [ 'JavaScript', 'js', 'token', 'tokenize', 'regex' ], | |
| 86723 silly resolved repository: { type: 'git', url: 'lydell/js-tokens' }, | |
| 86723 silly resolved scripts: | |
| 86723 silly resolved { test: 'mocha --ui tdd', | |
| 86723 silly resolved build: 'node generate-index.js', | |
| 86723 silly resolved dev: 'npm run build && npm test' }, | |
| 86723 silly resolved devDependencies: { 'coffee-script': '^1.8.0', mocha: '^2.0.1' }, | |
| 86723 silly resolved readme: 'Overview [](https://travis-ci.org/lydell/js-tokens)\n========\n\nA regex that tokenizes JavaScript.\n\n```js\nvar jsTokens = require("js-tokens")\n\nvar jsString = "var foo=opts.foo;\\n..."\n\njsString.match(jsTokens)\n// ["var", " ", "foo", "=", "opts", ".", "foo", ";", "\\n", ...]\n```\n\n\nInstallation\n============\n\n- `npm install js-tokens`\n\n```js\nvar jsTokens = require("js-tokens")\n```\n\n\nUsage\n=====\n\n### `jsTokens` ###\n\nA regex with the `g` flag that matches JavaScript tokens.\n\nThe regex _always_ matches, even invalid JavaScript and the empty string.\n\nThe next match is always directly after the previous.\n\n### `var token = jsTokens.matchToToken(match)` ###\n\nTakes a `match` returned by `jsTokens.exec(string)`, and returns a `{type:\nString, value: String}` object. The following types are available:\n\n- string\n- comment\n- regex\n- number\n- name\n- punctuator\n- whitespace\n- invalid\n\nMulti-line comments and strings also have a `closed` property indicating if the\ntoken was closed or not (see below).\n\nComments and strings both come in several flavors. To distinguish them, check if\nthe token starts with `//`, `/*`, `\'`, `"` or `` ` ``.\n\nNames are ECMAScript IdentifierNames, that is, including both identifiers and\nkeywords. You may use [is-keyword-js] to tell them apart.\n\nWhitespace includes both line terminators and other whitespace.\n\nFor example usage, please see this [gist].\n\n[is-keyword-js]: https://github.com/crissdev/is-keyword-js\n[gist]: https://gist.github.com/lydell/be49dbf80c382c473004\n\n\nInvalid code handling\n=====================\n\nUnterminated strings are still matched as strings. JavaScript strings cannot\ncontain (unescaped) newlines, so unterminated strings simply end at the end of\nthe line. Unterminated template strings can contain unescaped newlines, though,\nso they go on to the end of input.\n\nUnterminated multi-line comments are also still matched as comments. They\nsimply go on to the end of the input.\n\nUnterminated regex literals are likely matched as division and whatever is\ninside the regex.\n\nInvalid ASCII characters have their own capturing group.\n\nInvalid non-ASCII characters are treated as names, to simplify the matching of\nnames (except unicode spaces which are treated as whitespace).\n\nRegex literals may contain invalid regex syntax. They are still matched as\nregex literals. They may also contain repeated regex flags, to keep the regex\nsimple.\n\nStrings may contain invalid escape sequences.\n\n\nLimitations\n===========\n\nTokenizing JavaScript using regexes—in fact, _one single regex_—won’t be\nperfect. But that’s not the point either.\n\n### Template string interpolation ###\n\nTemplate strings are matched as single tokens, from the starting `` ` `` to the\nending `` ` ``, including interpolations (whose tokens are not matched\nindividually).\n\nMatching template string interpolations requires recursive balancing of `{` and\n`}`—something that JavaScript regexes cannot do. Only one level of nesting is\nsupported.\n\n### Division and regex literals collision ###\n\nConsider this example:\n\n```js\nvar g = 9.82\nvar number = bar / 2/g\n\nvar regex = / 2/g\n```\n\nA human can easily understand that in the `number` line we’re dealing with\ndivision, and in the `regex` line we’re dealing with a regex literal. How come?\nBecause humans can look at the whole code to put the `/` characters in context.\nA JavaScript regex cannot. It only sees forwards.\n\nWhen the `jsTokens` regex scans throught the above, it will see the following\nat the end of both the `number` and `regex` rows:\n\n```js\n/ 2/g\n```\n\nIt is then impossible to know if that is a regex literal, or part of an\nexpression dealing with division.\n\nHere is a similar case:\n\n```js\nfoo /= 2/g\nfoo(/= 2/g)\n```\n\nThe first line divides the `foo` variable with `2/g`. The second line calls the\n`foo` function with the regex literal `/= 2/g`. Again, since `jsTokens` only\nsees forwards, it cannot tell the two cases apart.\n\nThere are some cases where we _can_ tell division and regex literals apart,\nthough.\n\nFirst off, we have the simple cases where there’s only one slash in the line:\n\n```js\nvar foo = 2/g\nfoo /= 2\n```\n\nRegex literals cannot contain newlines, so the above cases are correctly\nidentified as division. Things are only problematic when there are more than\none non-comment slash in a single line.\n\nSecondly, not every character is a valid regex flag.\n\n```js\nvar number = bar / 2/e\n```\n\nThe above example is also correctly identified as division, because `e` is not a\nvalid regex flag. I initially wanted to future-proof by allowing `[a-zA-Z]*`\n(any letter) as flags, but it is not worth it since it increases the amount of\nambigous cases. So only the standard `g`, `m`, `i`, `y` and `u` flags are\nallowed. This means that the above example will be identified as division as\nlong as you don’t rename the `e` variable to some permutation of `gmiyu` 1 to 5\ncharacters long.\n\nLastly, we can look _forward_ for information.\n\n- If the token following what looks like a regex literal is not valid after a\n regex literal, but is valid in a division expression, then the regex literal\n is treated as division instead. For example, a flagless regex cannot be\n followed by a string, number or name, but all of those three can be the\n denominator of a division.\n- Generally, if what looks like a regex literal is followed by an operator, the\n regex literal is treated as division instead. This is because regexes are\n seldomly used with operators (such as `+`, `*`, `&&` and `==`), but division\n could likely be part of such an expression.\n\nPlease consult the regex source and the test cases for precise information on\nwhen regex or division is matched (should you need to know). In short, you\ncould sum it up as:\n\nIf the end of a statement looks like a regex literal (even if it isn’t), it\nwill be treated as one. Otherwise it should work as expected (if you write sane\ncode).\n\n\nLicense\n=======\n\n[The X11 (“MIT”) License](LICENSE).\n', | |
| 86723 silly resolved readmeFilename: 'readme.md', | |
| 86723 silly resolved _id: 'js-tokens@1.0.0', | |
| 86723 silly resolved dist: { shasum: 'e4dba498bff9cc7d080f43802207cbfdf1be67e7' }, | |
| 86723 silly resolved _from: 'js-tokens@1.0.0', | |
| 86723 silly resolved _resolved: 'https://registry.npmjs.org/js-tokens/-/js-tokens-1.0.0.tgz' }, | |
| 86723 silly resolved { author: { name: 'Ben Newman', email: 'bn@cs.stanford.edu' }, | |
| 86723 silly resolved name: 'regenerator', | |
| 86723 silly resolved description: 'Source transformer enabling ECMAScript 6 generator functions (yield) in JavaScript-of-today (ES5)', | |
| 86723 silly resolved keywords: | |
| 86723 silly resolved [ 'generator', | |
| 86723 silly resolved 'yield', | |
| 86723 silly resolved 'coroutine', | |
| 86723 silly resolved 'rewriting', | |
| 86723 silly resolved 'transformation', | |
| 86723 silly resolved 'syntax', | |
| 86723 silly resolved 'codegen', | |
| 86723 silly resolved 'rewriting', | |
| 86723 silly resolved 'refactoring', | |
| 86723 silly resolved 'transpiler', | |
| 86723 silly resolved 'desugaring', | |
| 86723 silly resolved 'ES6' ], | |
| 86723 silly resolved version: '0.8.22', | |
| 86723 silly resolved homepage: 'http://github.com/facebook/regenerator', | |
| 86723 silly resolved repository: | |
| 86723 silly resolved { type: 'git', | |
| 86723 silly resolved url: 'git://github.com/facebook/regenerator.git' }, | |
| 86723 silly resolved main: 'main.js', | |
| 86723 silly resolved bin: { regenerator: 'bin/regenerator' }, | |
| 86723 silly resolved scripts: { test: 'node test/run.js' }, | |
| 86723 silly resolved dependencies: | |
| 86723 silly resolved { commoner: '~0.10.0', | |
| 86723 silly resolved 'esprima-fb': '~13001.1.0-dev-harmony-fb', | |
| 86723 silly resolved recast: '~0.10.3', | |
| 86723 silly resolved private: '~0.1.5', | |
| 86723 silly resolved through: '~2.3.6', | |
| 86723 silly resolved defs: '~1.1.0' }, | |
| 86723 silly resolved devDependencies: { mocha: '~1.21.4', promise: '~6.0.1', semver: '~4.0.3' }, | |
| 86723 silly resolved license: 'BSD', | |
| 86723 silly resolved engines: { node: '>= 0.6' }, | |
| 86723 silly resolved readme: 'regenerator [](https://travis-ci.org/facebook/regenerator)\n===\n\nThis package implements a fully-functional source transformation that\ntakes the proposed syntax for generators/`yield` from future versions of\nJS ([ECMAScript6 or ES6](http://wiki.ecmascript.org/doku.php?id=harmony:specification_drafts), experimentally implemented in Node.js v0.11) and\nspits out efficient JS-of-today (ES5) that behaves the same way.\n\nA small runtime library (less than 1KB compressed) is required to provide the\n`wrapGenerator` function. You can install it either as a CommonJS module\nor as a standalone .js file, whichever you prefer.\n\nInstallation\n---\n\nFrom NPM:\n```sh\nnpm install -g regenerator\n```\n\nFrom GitHub:\n```sh\ncd path/to/node_modules\ngit clone git://github.com/facebook/regenerator.git\ncd regenerator\nnpm install .\nnpm test\n```\n\nUsage\n---\n\nYou have several options for using this module.\n\nSimplest usage:\n```sh\nregenerator es6.js > es5.js # Just the transform.\nregenerator --include-runtime es6.js > es5.js # Add the runtime too.\nregenerator src lib # Transform every .js file in src and output to lib.\n```\n\nProgrammatic usage:\n```js\nvar es5Source = require("regenerator").compile(es6Source).code;\nvar es5SourceWithRuntime = require("regenerator").compile(es6Source, {\n includeRuntime: true\n}).code;\n```\n\nAST transformation:\n```js\nvar recast = require("recast");\nvar ast = recast.parse(es6Source);\nast = require("regenerator").transform(ast);\nvar es5Source = recast.print(ast);\n```\n\nHow can you get involved?\n---\n\nThe easiest way to get involved is to look for buggy examples using [the\nsandbox](http://facebook.github.io/regenerator/), and when you find\nsomething strange just click the "report a bug" link (the new issue form\nwill be populated automatically with the problematic code).\n\nAlternatively, you can\n[fork](https://github.com/facebook/regenerator/fork) the repository,\ncreate some failing tests cases in [test/tests.es6.js](test/tests.es6.js),\nand send pull requests for me to fix.\n\nIf you\'re feeling especially brave, you are more than welcome to dive into\nthe transformer code and fix the bug(s) yourself, but I must warn you that\nthe code could really benefit from [better implementation\ncomments](https://github.com/facebook/regenerator/issues/7).\n', | |
| 86723 silly resolved readmeFilename: 'README.md', | |
| 86723 silly resolved bugs: { url: 'https://github.com/facebook/regenerator/issues' }, | |
| 86723 silly resolved _id: 'regenerator@0.8.22', | |
| 86723 silly resolved dist: { shasum: 'cc7ca81752ed7c4b1585d3e2600662995ecad967' }, | |
| 86723 silly resolved _from: 'regenerator@^0.8.20', | |
| 86723 silly resolved _resolved: 'https://registry.npmjs.org/regenerator/-/regenerator-0.8.22.tgz' }, | |
| 86723 silly resolved { name: 'source-map-support', | |
| 86723 silly resolved description: 'Fixes stack traces for files with source maps', | |
| 86723 silly resolved version: '0.2.10', | |
| 86723 silly resolved main: './source-map-support.js', | |
| 86723 silly resolved scripts: { test: 'node_modules/mocha/bin/mocha' }, | |
| 86723 silly resolved dependencies: { 'source-map': '0.1.32' }, | |
| 86723 silly resolved devDependencies: | |
| 86723 silly resolved { 'coffee-script': '1.7.1', | |
| 86723 silly resolved browserify: '3.44.2', | |
| 86723 silly resolved mocha: '1.18.2' }, | |
| 86723 silly resolved repository: | |
| 86723 silly resolved { type: 'git', | |
| 86723 silly resolved url: 'https://github.com/evanw/node-source-map-support' }, | |
| 86723 silly resolved bugs: { url: 'https://github.com/evanw/node-source-map-support/issues' }, | |
| 86723 silly resolved licenses: [ [Object] ], | |
| 86723 silly resolved readme: '# Source Map Support\n\nThis module provides source map support for stack traces in node via the [V8 stack trace API](http://code.google.com/p/v8/wiki/JavaScriptStackTraceApi). It uses the [source-map](https://github.com/mozilla/source-map) module to replace the paths and line numbers of source-mapped files with their original paths and line numbers. The output mimics node\'s stack trace format with the goal of making every compile-to-JS language more of a first-class citizen. Source maps are completely general (not specific to any one language) so you can use source maps with multiple compile-to-JS languages in the same node process.\n\n## Installation and Usage\n\n#### Node support\n\n npm install source-map-support\n\nSource maps can be generated using libraries such as [source-map-index-generator](https://github.com/twolfson/source-map-index-generator). Once you have a valid source map, insert the following two lines at the top of your compiled code:\n\n //# sourceMappingURL=path/to/source.map\n require(\'source-map-support\').install();\n\nThe path should either be absolute or relative to the compiled file.\n\n#### Browser support\n\nThis library also works in Chrome. While the DevTools console already supports source maps, the V8 engine doesn\'t and `Error.prototype.stack` will be incorrect without this library. Everything will just work if you deploy your source files using [browserify](http://browserify.org/). Just make sure to pass the `--debug` flag to the browserify command so your source maps are included in the bundled code.\n\nThis library also works if you use another build process or just include the source files directly. In this case, include the file `browser-source-map-support.js` in your page and call `sourceMapSupport.install()`. It contains the whole library already bundled for the browser using browserify.\n\n <script src="browser-source-map-support.js"></script>\n <script>sourceMapSupport.install();</script>\n\nThis library also works if you use AMD (Asynchronous Module Definition), which is used in tools like [RequireJS](http://requirejs.org/). Just list `browser-source-map-support` as a dependency:\n\n <script>\n define([\'browser-source-map-support\'], function(sourceMapSupport) {\n sourceMapSupport.install();\n });\n </script>\n\n## Options\n\nThis module installs two things: a change to the `stack` property on `Error` objects and a handler for uncaught exceptions that mimics node\'s default exception handler (the handler can be seen in the demos below). You may want to disable the handler if you have your own uncaught exception handler. This can be done by passing an argument to the installer:\n\n require(\'source-map-support\').install({\n handleUncaughtExceptions: false\n });\n\nThis module loads source maps from the filesystem by default. You can provide alternate loading behavior through a callback as shown below. For example, [Meteor](https://github.com/meteor) keeps all source maps cached in memory to avoid disk access.\n\n require(\'source-map-support\').install({\n retrieveSourceMap: function(source) {\n if (source === \'compiled.js\') {\n return {\n url: \'original.js\',\n map: fs.readFileSync(\'compiled.js.map\', \'utf8\')\n };\n }\n return null;\n }\n });\n\n## Demos\n\n#### Basic Demo\n\noriginal.js:\n\n throw new Error(\'test\'); // This is the original code\n\ncompiled.js:\n\n //# sourceMappingURL=compiled.js.map\n require(\'source-map-support\').install();\n\n throw new Error(\'test\'); // This is the compiled code\n\ncompiled.js.map:\n\n {\n "version": 3,\n "file": "compiled.js",\n "sources": ["original.js"],\n "names": [],\n "mappings": ";;;AAAA,MAAM,IAAI"\n }\n\nRun compiled.js using node (notice how the stack trace uses original.js instead of compiled.js):\n\n $ node compiled.js\n\n original.js:1\n throw new Error(\'test\'); // This is the original code\n ^\n Error: test\n at Object.<anonymous> (original.js:1:7)\n at Module._compile (module.js:456:26)\n at Object.Module._extensions..js (module.js:474:10)\n at Module.load (module.js:356:32)\n at Function.Module._load (module.js:312:12)\n at Function.Module.runMain (module.js:497:10)\n at startup (node.js:119:16)\n at node.js:901:3\n\n#### TypeScript Demo\n\ndemo.ts:\n\n declare function require(name: string);\n require(\'source-map-support\').install();\n class Foo {\n constructor() { this.bar(); }\n bar() { throw new Error(\'this is a demo\'); }\n }\n new Foo();\n\nCompile and run the file using the TypeScript compiler from the terminal:\n\n $ npm install source-map-support typescript\n $ node_modules/typescript/bin/tsc -sourcemap demo.ts\n $ node demo.js\n\n demo.ts:5\n bar() { throw new Error(\'this is a demo\'); }\n ^\n Error: this is a demo\n at Foo.bar (demo.ts:5:17)\n at new Foo (demo.ts:4:24)\n at Object.<anonymous> (demo.ts:7:1)\n at Module._compile (module.js:456:26)\n at Object.Module._extensions..js (module.js:474:10)\n at Module.load (module.js:356:32)\n at Function.Module._load (module.js:312:12)\n at Function.Module.runMain (module.js:497:10)\n at startup (node.js:119:16)\n at node.js:901:3\n\n#### CoffeeScript Demo\n\ndemo.coffee:\n\n require(\'source-map-support\').install()\n foo = ->\n bar = -> throw new Error \'this is a demo\'\n bar()\n foo()\n\nCompile and run the file using the CoffeeScript compiler from the terminal:\n\n $ npm install source-map-support coffee-script\n $ node_modules/coffee-script/bin/coffee --map --compile demo.coffee\n $ node demo.js\n\n demo.coffee:3\n bar = -> throw new Error \'this is a demo\'\n ^\n Error: this is a demo\n at bar (demo.coffee:3:22)\n at foo (demo.coffee:4:3)\n at Object.<anonymous> (demo.coffee:5:1)\n at Object.<anonymous> (demo.coffee:1:1)\n at Module._compile (module.js:456:26)\n at Object.Module._extensions..js (module.js:474:10)\n at Module.load (module.js:356:32)\n at Function.Module._load (module.js:312:12)\n at Function.Module.runMain (module.js:497:10)\n at startup (node.js:119:16)\n\n## License\n\nThis code is available under the [MIT license](http://opensource.org/licenses/MIT).\n', | |
| 86723 silly resolved readmeFilename: 'README.md', | |
| 86723 silly resolved _id: 'source-map-support@0.2.10', | |
| 86723 silly resolved _from: 'source-map-support@^0.2.10', | |
| 86723 silly resolved dist: { shasum: '1325e1188b8bf952d261615ab2bf94b44c00534c' }, | |
| 86723 silly resolved _resolved: 'https://registry.npmjs.org/source-map-support/-/source-map-support-0.2.10.tgz' }, | |
| 86723 silly resolved { name: 'source-map', | |
| 86723 silly resolved description: 'Generates and consumes source maps', | |
| 86723 silly resolved version: '0.4.2', | |
| 86723 silly resolved homepage: 'https://github.com/mozilla/source-map', | |
| 86723 silly resolved author: { name: 'Nick Fitzgerald', email: 'nfitzgerald@mozilla.com' }, | |
| 86723 silly resolved contributors: | |
| 86723 silly resolved [ [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object], | |
| 86723 silly resolved [Object] ], | |
| 86723 silly resolved repository: { type: 'git', url: 'http://github.com/mozilla/source-map.git' }, | |
| 86723 silly resolved directories: { lib: './lib' }, | |
| 86723 silly resolved main: './lib/source-map.js', | |
| 86723 silly resolved engines: { node: '>=0.8.0' }, | |
| 86723 silly resolved licenses: [ [Object] ], | |
| 86723 silly resolved dependencies: { amdefine: '>=0.0.4' }, | |
| 86723 silly resolved devDependencies: { dryice: '>=0.4.8' }, | |
| 86723 silly resolved scripts: | |
| 86723 silly resolved { test: 'node test/run-tests.js', | |
| 86723 silly resolved build: 'node Makefile.dryice.js' }, | |
| 86723 silly resolved readme: '# Source Map\n\nThis is a library to generate and consume the source map format\n[described here][format].\n\nThis library is written in the Asynchronous Module Definition format, and works\nin the following environments:\n\n* Modern Browsers supporting ECMAScript 5 (either after the build, or with an\n AMD loader such as RequireJS)\n\n* Inside Firefox (as a JSM file, after the build)\n\n* With NodeJS versions 0.8.X and higher\n\n## Node\n\n $ npm install source-map\n\n## Building from Source (for everywhere else)\n\nInstall Node and then run\n\n $ git clone https://fitzgen@github.com/mozilla/source-map.git\n $ cd source-map\n $ npm link .\n\nNext, run\n\n $ node Makefile.dryice.js\n\nThis should spew a bunch of stuff to stdout, and create the following files:\n\n* `dist/source-map.js` - The unminified browser version.\n\n* `dist/source-map.min.js` - The minified browser version.\n\n* `dist/SourceMap.jsm` - The JavaScript Module for inclusion in Firefox source.\n\n## Examples\n\n### Consuming a source map\n\n```js\nvar rawSourceMap = {\n version: 3,\n file: \'min.js\',\n names: [\'bar\', \'baz\', \'n\'],\n sources: [\'one.js\', \'two.js\'],\n sourceRoot: \'http://example.com/www/js/\',\n mappings: \'CAAC,IAAI,IAAM,SAAUA,GAClB,OAAOC,IAAID;CCDb,IAAI,IAAM,SAAUE,GAClB,OAAOA\'\n};\n\nvar smc = new SourceMapConsumer(rawSourceMap);\n\nconsole.log(smc.sources);\n// [ \'http://example.com/www/js/one.js\',\n// \'http://example.com/www/js/two.js\' ]\n\nconsole.log(smc.originalPositionFor({\n line: 2,\n column: 28\n}));\n// { source: \'http://example.com/www/js/two.js\',\n// line: 2,\n// column: 10,\n// name: \'n\' }\n\nconsole.log(smc.generatedPositionFor({\n source: \'http://example.com/www/js/two.js\',\n line: 2,\n column: 10\n}));\n// { line: 2, column: 28 }\n\nsmc.eachMapping(function (m) {\n // ...\n});\n```\n\n### Generating a source map\n\nIn depth guide:\n[**Compiling to JavaScript, and Debugging with Source Maps**](https://hacks.mozilla.org/2013/05/compiling-to-javascript-and-debugging-with-source-maps/)\n\n#### With SourceNode (high level API)\n\n```js\nfunction compile(ast) {\n switch (ast.type) {\n case \'BinaryExpression\':\n return new SourceNode(\n ast.location.line,\n ast.location.column,\n ast.location.source,\n [compile(ast.left), " + ", compile(ast.right)]\n );\n case \'Literal\':\n return new SourceNode(\n ast.location.line,\n ast.location.column,\n ast.location.source,\n String(ast.value)\n );\n // ...\n default:\n throw new Error("Bad AST");\n }\n}\n\nvar ast = parse("40 + 2", "add.js");\nconsole.log(compile(ast).toStringWithSourceMap({\n file: \'add.js\'\n}));\n// { code: \'40 + 2\',\n// map: [object SourceMapGenerator] }\n```\n\n#### With SourceMapGenerator (low level API)\n\n```js\nvar map = new SourceMapGenerator({\n file: "source-mapped.js"\n});\n\nmap.addMapping({\n generated: {\n line: 10,\n column: 35\n },\n source: "foo.js",\n original: {\n line: 33,\n column: 2\n },\n name: "christopher"\n});\n\nconsole.log(map.toString());\n// \'{"version":3,"file":"source-mapped.js","sources":["foo.js"],"names":["christopher"],"mappings":";;;;;;;;;mCAgCEA"}\'\n```\n\n## API\n\nGet a reference to the module:\n\n```js\n// NodeJS\nvar sourceMap = require(\'source-map\');\n\n// Browser builds\nvar sourceMap = window.sourceMap;\n\n// Inside Firefox\nlet sourceMap = {};\nComponents.utils.import(\'resource:///modules/devtools/SourceMap.jsm\', sourceMap);\n```\n\n### SourceMapConsumer\n\nA SourceMapConsumer instance represents a parsed source map which we can query\nfor information about the original file positions by giving it a file position\nin the generated source.\n\n#### new SourceMapConsumer(rawSourceMap)\n\nThe only parameter is the raw source map (either as a string which can be\n`JSON.parse`\'d, or an object). According to the spec, source maps have the\nfollowing attributes:\n\n* `version`: Which version of the source map spec this map is following.\n\n* `sources`: An array of URLs to the original source files.\n\n* `names`: An array of identifiers which can be referrenced by individual\n mappings.\n\n* `sourceRoot`: Optional. The URL root from which all sources are relative.\n\n* `sourcesContent`: Optional. An array of contents of the original source files.\n\n* `mappings`: A string of base64 VLQs which contain the actual mappings.\n\n* `file`: Optional. The generated filename this source map is associated with.\n\n#### SourceMapConsumer.prototype.computeColumnSpans()\n\nCompute the last column for each generated mapping. The last column is\ninclusive.\n\n#### SourceMapConsumer.prototype.originalPositionFor(generatedPosition)\n\nReturns the original source, line, and column information for the generated\nsource\'s line and column positions provided. The only argument is an object with\nthe following properties:\n\n* `line`: The line number in the generated source.\n\n* `column`: The column number in the generated source.\n\n* `bias`: Either `SourceMapConsumer.GREATEST_LOWER_BOUND` or\n `SourceMapConsumer.LEAST_UPPER_BOUND`. Specifies whether to return the closest\n element that is smaller than or greater than the one we are searching for,\n respectively, if the exact element cannot be found. Defaults to\n `SourceMapConsumer.GREATEST_LOWER_BOUND`.\n\nand an object is returned with the following properties:\n\n* `source`: The original source file, or null if this information is not\n available.\n\n* `line`: The line number in the original source, or null if this information is\n not available.\n\n* `column`: The column number in the original source, or null or null if this\n information is not available.\n\n* `name`: The original identifier, or null if this information is not available.\n\n#### SourceMapConsumer.prototype.generatedPositionFor(originalPosition)\n\nReturns the generated line and column information for the original source,\nline, and column positions provided. The only argument is an object with\nthe following properties:\n\n* `source`: The filename of the original source.\n\n* `line`: The line number in the original source.\n\n* `column`: The column number in the original source.\n\nand an object is returned with the following properties:\n\n* `line`: The line number in the generated source, or null.\n\n* `column`: The column number in the generated source, or null.\n\n#### SourceMapConsumer.prototype.allGeneratedPositionsFor(originalPosition)\n\nReturns all generated line and column information for the original source,\nline, and column provided. If no column is provided, returns all mappings\ncorresponding to a single line. Otherwise, returns all mappings corresponding to\na single line and column.\n\nThe only argument is an object with the following properties:\n\n* `source`: The filename of the original source.\n\n* `line`: The line number in the original source.\n\n* `column`: Optional. The column number in the original source.\n\nand an array of objects is returned, each with the following properties:\n\n* `line`: The line number in the generated source, or null.\n\n* `column`: The column number in the generated source, or null.\n\n#### SourceMapConsumer.prototype.sourceContentFor(source[, returnNullOnMissing])\n\nReturns the original source content for the source provided. The only\nargument is the URL of the original source file.\n\nIf the source content for the given source is not found, then an error is\nthrown. Optionally, pass `true` as the second param to have `null` returned\ninstead.\n\n#### SourceMapConsumer.prototype.eachMapping(callback, context, order)\n\nIterate over each mapping between an original source/line/column and a\ngenerated line/column in this source map.\n\n* `callback`: The function that is called with each mapping. Mappings have the\n form `{ source, generatedLine, generatedColumn, originalLine, originalColumn,\n name }`\n\n* `context`: Optional. If specified, this object will be the value of `this`\n every time that `callback` is called.\n\n* `order`: Either `SourceMapConsumer.GENERATED_ORDER` or\n `SourceMapConsumer.ORIGINAL_ORDER`. Specifies whether you want to iterate over\n the mappings sorted by the generated file\'s line/column order or the\n original\'s source/line/column order, respectively. Defaults to\n `SourceMapConsumer.GENERATED_ORDER`.\n\n### SourceMapGenerator\n\nAn instance of the SourceMapGenerator represents a source map which is being\nbuilt incrementally.\n\n#### new SourceMapGenerator([startOfSourceMap])\n\nYou may pass an object with the following properties:\n\n* `file`: The filename of the generated source that this source map is\n associated with.\n\n* `sourceRoot`: A root for all relative URLs in this source map.\n\n* `skipValidation`: Optional. When `true`, disables validation of mappings as\n they are added. This can improve performance but should be used with\n discretion, as a last resort. Even then, one should avoid using this flag when\n running tests, if possible.\n\n#### SourceMapGenerator.fromSourceMap(sourceMapConsumer)\n\nCreates a new SourceMapGenerator based on a SourceMapConsumer\n\n* `sourceMapConsumer` The SourceMap.\n\n#### SourceMapGenerator.prototype.addMapping(mapping)\n\nAdd a single mapping from original source line and column to the generated\nsource\'s line and column for this source map being created. The mapping object\nshould have the following properties:\n\n* `generated`: An object with the generated line and column positions.\n\n* `original`: An object with the original line and column positions.\n\n* `source`: The original source file (relative to the sourceRoot).\n\n* `name`: An optional original token name for this mapping.\n\n#### SourceMapGenerator.prototype.setSourceContent(sourceFile, sourceContent)\n\nSet the source content for an original source file.\n\n* `sourceFile` the URL of the original source file.\n\n* `sourceContent` the content of the source file.\n\n#### SourceMapGenerator.prototype.applySourceMap(sourceMapConsumer[, sourceFile[, sourceMapPath]])\n\nApplies a SourceMap for a source file to the SourceMap.\nEach mapping to the supplied source file is rewritten using the\nsupplied SourceMap. Note: The resolution for the resulting mappings\nis the minimium of this map and the supplied map.\n\n* `sourceMapConsumer`: The SourceMap to be applied.\n\n* `sourceFile`: Optional. The filename of the source file.\n If omitted, sourceMapConsumer.file will be used, if it exists.\n Otherwise an error will be thrown.\n\n* `sourceMapPath`: Optional. The dirname of the path to the SourceMap\n to be applied. If relative, it is relative to the SourceMap.\n\n This parameter is needed when the two SourceMaps aren\'t in the same\n directory, and the SourceMap to be applied contains relative source\n paths. If so, those relative source paths need to be rewritten\n relative to the SourceMap.\n\n If omitted, it is assumed that both SourceMaps are in the same directory,\n thus not needing any rewriting. (Supplying `\'.\'` has the same effect.)\n\n#### SourceMapGenerator.prototype.toString()\n\nRenders the source map being generated to a string.\n\n### SourceNode\n\nSourceNodes provide a way to abstract over interpolating and/or concatenating\nsnippets of generated JavaScript source code, while maintaining the line and\ncolumn information associated between those snippets and the original source\ncode. This is useful as the final intermediate representation a compiler might\nuse before outputting the generated JS and source map.\n\n#### new SourceNode([line, column, source[, chunk[, name]]])\n\n* `line`: The original line number associated with this source node, or null if\n it isn\'t associated with an original line.\n\n* `column`: The original column number associated with this source node, or null\n if it isn\'t associated with an original column.\n\n* `source`: The original source\'s filename; null if no filename is provided.\n\n* `chunk`: Optional. Is immediately passed to `SourceNode.prototype.add`, see\n below.\n\n* `name`: Optional. The original identifier.\n\n#### SourceNode.fromStringWithSourceMap(code, sourceMapConsumer[, relativePath])\n\nCreates a SourceNode from generated code and a SourceMapConsumer.\n\n* `code`: The generated code\n\n* `sourceMapConsumer` The SourceMap for the generated code\n\n* `relativePath` The optional path that relative sources in `sourceMapConsumer`\n should be relative to.\n\n#### SourceNode.prototype.add(chunk)\n\nAdd a chunk of generated JS to this source node.\n\n* `chunk`: A string snippet of generated JS code, another instance of\n `SourceNode`, or an array where each member is one of those things.\n\n#### SourceNode.prototype.prepend(chunk)\n\nPrepend a chunk of generated JS to this source node.\n\n* `chunk`: A string snippet of generated JS code, another instance of\n `SourceNode`, or an array where each member is one of those things.\n\n#### SourceNode.prototype.setSourceContent(sourceFile, sourceContent)\n\nSet the source content for a source file. This will be added to the\n`SourceMap` in the `sourcesContent` field.\n\n* `sourceFile`: The filename of the source file\n\n* `sourceContent`: The content of the source file\n\n#### SourceNode.prototype.walk(fn)\n\nWalk over the tree of JS snippets in this node and its children. The walking\nfunction is called once for each snippet of JS and is passed that snippet and\nthe its original associated source\'s line/column location.\n\n* `fn`: The traversal function.\n\n#### SourceNode.prototype.walkSourceContents(fn)\n\nWalk over the tree of SourceNodes. The walking function is called for each\nsource file content and is passed the filename and source content.\n\n* `fn`: The traversal function.\n\n#### SourceNode.prototype.join(sep)\n\nLike `Array.prototype.join` except for SourceNodes. Inserts the separator\nbetween each of this source node\'s children.\n\n* `sep`: The separator.\n\n#### SourceNode.prototype.replaceRight(pattern, replacement)\n\nCall `String.prototype.replace` on the very right-most source snippet. Useful\nfor trimming whitespace from the end of a source node, etc.\n\n* `pattern`: The pattern to replace.\n\n* `replacement`: The thing to replace the pattern with.\n\n#### SourceNode.prototype.toString()\n\nReturn the string representation of this source node. Walks over the tree and\nconcatenates all the various snippets together to one string.\n\n#### SourceNode.prototype.toStringWithSourceMap([startOfSourceMap])\n\nReturns the string representation of this tree of source nodes, plus a\nSourceMapGenerator which contains all the mappings between the generated and\noriginal sources.\n\nThe arguments are the same as those to `new SourceMapGenerator`.\n\n## Tests\n\n[](https://travis-ci.org/mozilla/source-map)\n\nInstall NodeJS version 0.8.0 or greater, then run `node test/run-tests.js`.\n\nTo add new tests, create a new file named `test/test-<your new test name>.js`\nand export your test functions with names that start with "test", for example\n\n```js\nexports["test doing the foo bar"] = function (assert, util) {\n ...\n};\n```\n\nThe new test will be located automatically when you run the suite.\n\nThe `util` argument is the test utility module located at `test/source-map/util`.\n\nThe `assert` argument is a cut down version of node\'s assert module. You have\naccess to the following assertion functions:\n\n* `doesNotThrow`\n\n* `equal`\n\n* `ok`\n\n* `strictEqual`\n\n* `throws`\n\n(The reason for the restricted set of test functions is because we need the\ntests to run inside Firefox\'s test suite as well and so the assert module is\nshimmed in that environment. See `build/assert-shim.js`.)\n\n[format]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit\n[feature]: https://wiki.mozilla.org/DevTools/Features/SourceMap\n[Dryice]: https://github.com/mozilla/dryice\n', | |
| 86723 silly resolved readmeFilename: 'README.md', | |
| 86723 silly resolved bugs: { url: 'https://github.com/mozilla/source-map/issues' }, | |
| 86723 silly resolved _id: 'source-map@0.4.2', | |
| 86723 silly resolved _from: 'source-map@^0.4.0', | |
| 86723 silly resolved dist: { shasum: '9282e081631a4f6e576980e97600f5325c199aa9' }, | |
| 86723 silly resolved _resolved: 'https://registry.npmjs.org/source-map/-/source-map-0.4.2.tgz' } ] | |
| 86724 info install convert-source-map@1.0.0 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86725 info install chalk@1.0.0 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86726 info install esutils@2.0.2 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86727 info install globals@6.4.1 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86728 info install debug@2.1.3 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86729 info install is-integer@1.0.4 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86730 info install core-js@0.8.4 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86731 info install leven@1.0.1 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86732 info install fs-readdir-recursive@0.1.1 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86733 info install ast-types@0.7.6 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86734 info install path-is-absolute@1.0.0 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86735 info install lodash@3.7.0 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86736 info install repeating@1.1.2 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86737 info install output-file-sync@1.1.0 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86738 info install minimatch@2.0.4 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86739 info install slash@1.0.0 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86740 info install shebang-regex@1.0.0 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86741 info install strip-json-comments@1.0.2 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86742 info install trim-right@1.0.0 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86743 info install user-home@1.1.1 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86744 info install detect-indent@3.0.1 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86745 info install to-fast-properties@1.0.1 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86746 info install estraverse@3.1.0 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86747 info install private@0.1.6 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86748 info install line-numbers@0.2.0 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86749 info install regexpu@1.1.2 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86750 info install js-tokens@1.0.0 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86751 info install regenerator@0.8.22 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86752 info install source-map-support@0.2.10 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86753 info install source-map@0.4.2 into C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core | |
| 86754 info installOne convert-source-map@1.0.0 | |
| 86755 info installOne chalk@1.0.0 | |
| 86756 info installOne esutils@2.0.2 | |
| 86757 info installOne globals@6.4.1 | |
| 86758 info installOne debug@2.1.3 | |
| 86759 info installOne is-integer@1.0.4 | |
| 86760 info installOne core-js@0.8.4 | |
| 86761 info installOne leven@1.0.1 | |
| 86762 info installOne fs-readdir-recursive@0.1.1 | |
| 86763 info installOne ast-types@0.7.6 | |
| 86764 info installOne path-is-absolute@1.0.0 | |
| 86765 info installOne lodash@3.7.0 | |
| 86766 info installOne repeating@1.1.2 | |
| 86767 info installOne output-file-sync@1.1.0 | |
| 86768 info installOne minimatch@2.0.4 | |
| 86769 info installOne slash@1.0.0 | |
| 86770 info installOne shebang-regex@1.0.0 | |
| 86771 info installOne strip-json-comments@1.0.2 | |
| 86772 info installOne trim-right@1.0.0 | |
| 86773 info installOne user-home@1.1.1 | |
| 86774 info installOne detect-indent@3.0.1 | |
| 86775 info installOne to-fast-properties@1.0.1 | |
| 86776 info installOne estraverse@3.1.0 | |
| 86777 info installOne private@0.1.6 | |
| 86778 info installOne line-numbers@0.2.0 | |
| 86779 info installOne regexpu@1.1.2 | |
| 86780 info installOne js-tokens@1.0.0 | |
| 86781 info installOne regenerator@0.8.22 | |
| 86782 info installOne source-map-support@0.2.10 | |
| 86783 info installOne source-map@0.4.2 | |
| 86784 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\convert-source-map unbuild | |
| 86785 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\chalk unbuild | |
| 86786 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\esutils unbuild | |
| 86787 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\globals unbuild | |
| 86788 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\debug unbuild | |
| 86789 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\is-integer unbuild | |
| 86790 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\core-js unbuild | |
| 86791 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\leven unbuild | |
| 86792 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\fs-readdir-recursive unbuild | |
| 86793 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\ast-types unbuild | |
| 86794 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\path-is-absolute unbuild | |
| 86795 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\lodash unbuild | |
| 86796 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\repeating unbuild | |
| 86797 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\output-file-sync unbuild | |
| 86798 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\minimatch unbuild | |
| 86799 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\slash unbuild | |
| 86800 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\shebang-regex unbuild | |
| 86801 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\strip-json-comments unbuild | |
| 86802 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\trim-right unbuild | |
| 86803 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\user-home unbuild | |
| 86804 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\detect-indent unbuild | |
| 86805 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\to-fast-properties unbuild | |
| 86806 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\estraverse unbuild | |
| 86807 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\private unbuild | |
| 86808 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\line-numbers unbuild | |
| 86809 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\regexpu unbuild | |
| 86810 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\js-tokens unbuild | |
| 86811 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\regenerator unbuild | |
| 86812 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\source-map-support unbuild | |
| 86813 info C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\source-map unbuild | |
| 86814 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\convert-source-map\1.0.0\package.tgz | |
| 86815 silly lockFile 252cafdb--node-modules-convert-source-map tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\convert-source-map | |
| 86816 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\convert-source-map C:\Users\Vince\AppData\Roaming\npm-cache\252cafdb--node-modules-convert-source-map.lock | |
| 86817 silly lockFile 7973cd2f-ert-source-map-1-0-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\convert-source-map\1.0.0\package.tgz | |
| 86818 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\convert-source-map\1.0.0\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\7973cd2f-ert-source-map-1-0-0-package-tgz.lock | |
| 86819 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\chalk\1.0.0\package.tgz | |
| 86820 silly lockFile 40a72e14-es-babel-core-node-modules-chalk tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\chalk | |
| 86821 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\chalk C:\Users\Vince\AppData\Roaming\npm-cache\40a72e14-es-babel-core-node-modules-chalk.lock | |
| 86822 silly lockFile e3cd71b4-pm-cache-chalk-1-0-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\chalk\1.0.0\package.tgz | |
| 86823 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\chalk\1.0.0\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\e3cd71b4-pm-cache-chalk-1-0-0-package-tgz.lock | |
| 86824 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\esutils\2.0.2\package.tgz | |
| 86825 silly lockFile 18f8f96f--babel-core-node-modules-esutils tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\esutils | |
| 86826 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\esutils C:\Users\Vince\AppData\Roaming\npm-cache\18f8f96f--babel-core-node-modules-esutils.lock | |
| 86827 silly lockFile 34c9e7cd--cache-esutils-2-0-2-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\esutils\2.0.2\package.tgz | |
| 86828 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\esutils\2.0.2\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\34c9e7cd--cache-esutils-2-0-2-package-tgz.lock | |
| 86829 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\globals\6.4.1\package.tgz | |
| 86830 silly lockFile 0788e1ff--babel-core-node-modules-globals tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\globals | |
| 86831 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\globals C:\Users\Vince\AppData\Roaming\npm-cache\0788e1ff--babel-core-node-modules-globals.lock | |
| 86832 silly lockFile e7244268--cache-globals-6-4-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\globals\6.4.1\package.tgz | |
| 86833 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\globals\6.4.1\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\e7244268--cache-globals-6-4-1-package-tgz.lock | |
| 86834 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\debug\2.1.3\package.tgz | |
| 86835 silly lockFile 7b337c3c-es-babel-core-node-modules-debug tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\debug | |
| 86836 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\debug C:\Users\Vince\AppData\Roaming\npm-cache\7b337c3c-es-babel-core-node-modules-debug.lock | |
| 86837 silly lockFile 0b54053b-pm-cache-debug-2-1-3-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\debug\2.1.3\package.tgz | |
| 86838 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\debug\2.1.3\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\0b54053b-pm-cache-debug-2-1-3-package-tgz.lock | |
| 86839 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\is-integer\1.0.4\package.tgz | |
| 86840 silly lockFile 53acc573-bel-core-node-modules-is-integer tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\is-integer | |
| 86841 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\is-integer C:\Users\Vince\AppData\Roaming\npm-cache\53acc573-bel-core-node-modules-is-integer.lock | |
| 86842 silly lockFile 8018f59f-che-is-integer-1-0-4-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\is-integer\1.0.4\package.tgz | |
| 86843 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\is-integer\1.0.4\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\8018f59f-che-is-integer-1-0-4-package-tgz.lock | |
| 86844 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\core-js\0.8.4\package.tgz | |
| 86845 silly lockFile d88c0143--babel-core-node-modules-core-js tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\core-js | |
| 86846 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\core-js C:\Users\Vince\AppData\Roaming\npm-cache\d88c0143--babel-core-node-modules-core-js.lock | |
| 86847 silly lockFile f6d97a4e--cache-core-js-0-8-4-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\core-js\0.8.4\package.tgz | |
| 86848 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\core-js\0.8.4\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\f6d97a4e--cache-core-js-0-8-4-package-tgz.lock | |
| 86849 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\leven\1.0.1\package.tgz | |
| 86850 silly lockFile deb1e3ac-es-babel-core-node-modules-leven tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\leven | |
| 86851 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\leven C:\Users\Vince\AppData\Roaming\npm-cache\deb1e3ac-es-babel-core-node-modules-leven.lock | |
| 86852 silly lockFile 3000c9f2-pm-cache-leven-1-0-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\leven\1.0.1\package.tgz | |
| 86853 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\leven\1.0.1\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\3000c9f2-pm-cache-leven-1-0-1-package-tgz.lock | |
| 86854 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\fs-readdir-recursive\0.1.1\package.tgz | |
| 86855 silly lockFile fd63b575-ode-modules-fs-readdir-recursive tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\fs-readdir-recursive | |
| 86856 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\fs-readdir-recursive C:\Users\Vince\AppData\Roaming\npm-cache\fd63b575-ode-modules-fs-readdir-recursive.lock | |
| 86857 silly lockFile c1d5d650-ddir-recursive-0-1-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\fs-readdir-recursive\0.1.1\package.tgz | |
| 86858 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\fs-readdir-recursive\0.1.1\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\c1d5d650-ddir-recursive-0-1-1-package-tgz.lock | |
| 86859 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.7.6\package.tgz | |
| 86860 silly lockFile 6ea6cc6d-abel-core-node-modules-ast-types tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\ast-types | |
| 86861 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\ast-types C:\Users\Vince\AppData\Roaming\npm-cache\6ea6cc6d-abel-core-node-modules-ast-types.lock | |
| 86862 silly lockFile de853ab1-ache-ast-types-0-7-6-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.7.6\package.tgz | |
| 86863 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\ast-types\0.7.6\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\de853ab1-ache-ast-types-0-7-6-package-tgz.lock | |
| 86864 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\path-is-absolute\1.0.0\package.tgz | |
| 86865 silly lockFile d8c50092-re-node-modules-path-is-absolute tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\path-is-absolute | |
| 86866 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\path-is-absolute C:\Users\Vince\AppData\Roaming\npm-cache\d8c50092-re-node-modules-path-is-absolute.lock | |
| 86867 silly lockFile ae851f8d-th-is-absolute-1-0-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\path-is-absolute\1.0.0\package.tgz | |
| 86868 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\path-is-absolute\1.0.0\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\ae851f8d-th-is-absolute-1-0-0-package-tgz.lock | |
| 86869 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\lodash\3.7.0\package.tgz | |
| 86870 silly lockFile 0846edab-s-babel-core-node-modules-lodash tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\lodash | |
| 86871 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\lodash C:\Users\Vince\AppData\Roaming\npm-cache\0846edab-s-babel-core-node-modules-lodash.lock | |
| 86872 silly lockFile bd74ed63-m-cache-lodash-3-7-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\lodash\3.7.0\package.tgz | |
| 86873 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\lodash\3.7.0\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\bd74ed63-m-cache-lodash-3-7-0-package-tgz.lock | |
| 86874 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\repeating\1.1.2\package.tgz | |
| 86875 silly lockFile 0a33e198-abel-core-node-modules-repeating tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\repeating | |
| 86876 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\repeating C:\Users\Vince\AppData\Roaming\npm-cache\0a33e198-abel-core-node-modules-repeating.lock | |
| 86877 silly lockFile 557f16e4-ache-repeating-1-1-2-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\repeating\1.1.2\package.tgz | |
| 86878 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\repeating\1.1.2\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\557f16e4-ache-repeating-1-1-2-package-tgz.lock | |
| 86879 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\output-file-sync\1.1.0\package.tgz | |
| 86880 silly lockFile 08573f63-re-node-modules-output-file-sync tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\output-file-sync | |
| 86881 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\output-file-sync C:\Users\Vince\AppData\Roaming\npm-cache\08573f63-re-node-modules-output-file-sync.lock | |
| 86882 silly lockFile 0971c28b-tput-file-sync-1-1-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\output-file-sync\1.1.0\package.tgz | |
| 86883 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\output-file-sync\1.1.0\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\0971c28b-tput-file-sync-1-1-0-package-tgz.lock | |
| 86884 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\minimatch\2.0.4\package.tgz | |
| 86885 silly lockFile 4731eebe-abel-core-node-modules-minimatch tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\minimatch | |
| 86886 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\minimatch C:\Users\Vince\AppData\Roaming\npm-cache\4731eebe-abel-core-node-modules-minimatch.lock | |
| 86887 silly lockFile 5aa0fed0-ache-minimatch-2-0-4-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\minimatch\2.0.4\package.tgz | |
| 86888 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\minimatch\2.0.4\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\5aa0fed0-ache-minimatch-2-0-4-package-tgz.lock | |
| 86889 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\slash\1.0.0\package.tgz | |
| 86890 silly lockFile 0d74ed1e-es-babel-core-node-modules-slash tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\slash | |
| 86891 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\slash C:\Users\Vince\AppData\Roaming\npm-cache\0d74ed1e-es-babel-core-node-modules-slash.lock | |
| 86892 silly lockFile 09945aa5-pm-cache-slash-1-0-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\slash\1.0.0\package.tgz | |
| 86893 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\slash\1.0.0\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\09945aa5-pm-cache-slash-1-0-0-package-tgz.lock | |
| 86894 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\shebang-regex\1.0.0\package.tgz | |
| 86895 silly lockFile 0b979cb0--core-node-modules-shebang-regex tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\shebang-regex | |
| 86896 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\shebang-regex C:\Users\Vince\AppData\Roaming\npm-cache\0b979cb0--core-node-modules-shebang-regex.lock | |
| 86897 silly lockFile 6cc5b3c8--shebang-regex-1-0-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\shebang-regex\1.0.0\package.tgz | |
| 86898 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\shebang-regex\1.0.0\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\6cc5b3c8--shebang-regex-1-0-0-package-tgz.lock | |
| 86899 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\strip-json-comments\1.0.2\package.tgz | |
| 86900 silly lockFile 1f491a39-node-modules-strip-json-comments tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\strip-json-comments | |
| 86901 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\strip-json-comments C:\Users\Vince\AppData\Roaming\npm-cache\1f491a39-node-modules-strip-json-comments.lock | |
| 86902 silly lockFile 7f74635f--json-comments-1-0-2-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\strip-json-comments\1.0.2\package.tgz | |
| 86903 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\strip-json-comments\1.0.2\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\7f74635f--json-comments-1-0-2-package-tgz.lock | |
| 86904 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\trim-right\1.0.0\package.tgz | |
| 86905 silly lockFile 8ed0c466-bel-core-node-modules-trim-right tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\trim-right | |
| 86906 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\trim-right C:\Users\Vince\AppData\Roaming\npm-cache\8ed0c466-bel-core-node-modules-trim-right.lock | |
| 86907 silly lockFile 5ec71eeb-che-trim-right-1-0-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\trim-right\1.0.0\package.tgz | |
| 86908 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\trim-right\1.0.0\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\5ec71eeb-che-trim-right-1-0-0-package-tgz.lock | |
| 86909 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\user-home\1.1.1\package.tgz | |
| 86910 silly lockFile 7db5f2ec-abel-core-node-modules-user-home tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\user-home | |
| 86911 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\user-home C:\Users\Vince\AppData\Roaming\npm-cache\7db5f2ec-abel-core-node-modules-user-home.lock | |
| 86912 silly lockFile 8a3b02d5-ache-user-home-1-1-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\user-home\1.1.1\package.tgz | |
| 86913 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\user-home\1.1.1\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\8a3b02d5-ache-user-home-1-1-1-package-tgz.lock | |
| 86914 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\detect-indent\3.0.1\package.tgz | |
| 86915 silly lockFile 99a9b8c2--core-node-modules-detect-indent tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\detect-indent | |
| 86916 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\detect-indent C:\Users\Vince\AppData\Roaming\npm-cache\99a9b8c2--core-node-modules-detect-indent.lock | |
| 86917 silly lockFile 94040487--detect-indent-3-0-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\detect-indent\3.0.1\package.tgz | |
| 86918 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\detect-indent\3.0.1\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\94040487--detect-indent-3-0-1-package-tgz.lock | |
| 86919 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\to-fast-properties\1.0.1\package.tgz | |
| 86920 silly lockFile 0d87c72c--node-modules-to-fast-properties tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\to-fast-properties | |
| 86921 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\to-fast-properties C:\Users\Vince\AppData\Roaming\npm-cache\0d87c72c--node-modules-to-fast-properties.lock | |
| 86922 silly lockFile 8de6028c-ast-properties-1-0-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\to-fast-properties\1.0.1\package.tgz | |
| 86923 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\to-fast-properties\1.0.1\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\8de6028c-ast-properties-1-0-1-package-tgz.lock | |
| 86924 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\private\0.1.6\package.tgz | |
| 86925 silly lockFile 192dce3c--babel-core-node-modules-private tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\private | |
| 86926 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\private C:\Users\Vince\AppData\Roaming\npm-cache\192dce3c--babel-core-node-modules-private.lock | |
| 86927 silly lockFile ecd3127e--cache-private-0-1-6-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\private\0.1.6\package.tgz | |
| 86928 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\private\0.1.6\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\ecd3127e--cache-private-0-1-6-package-tgz.lock | |
| 86929 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\estraverse\3.1.0\package.tgz | |
| 86930 silly lockFile 159ded82-bel-core-node-modules-estraverse tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\estraverse | |
| 86931 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\estraverse C:\Users\Vince\AppData\Roaming\npm-cache\159ded82-bel-core-node-modules-estraverse.lock | |
| 86932 silly lockFile 97ff7ad1-che-estraverse-3-1-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\estraverse\3.1.0\package.tgz | |
| 86933 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\estraverse\3.1.0\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\97ff7ad1-che-estraverse-3-1-0-package-tgz.lock | |
| 86934 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\line-numbers\0.2.0\package.tgz | |
| 86935 silly lockFile b1b99528-l-core-node-modules-line-numbers tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\line-numbers | |
| 86936 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\line-numbers C:\Users\Vince\AppData\Roaming\npm-cache\b1b99528-l-core-node-modules-line-numbers.lock | |
| 86937 silly lockFile 93892149-e-line-numbers-0-2-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\line-numbers\0.2.0\package.tgz | |
| 86938 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\line-numbers\0.2.0\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\93892149-e-line-numbers-0-2-0-package-tgz.lock | |
| 86939 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\regexpu\1.1.2\package.tgz | |
| 86940 silly lockFile 7b0da49a--babel-core-node-modules-regexpu tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\regexpu | |
| 86941 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\regexpu C:\Users\Vince\AppData\Roaming\npm-cache\7b0da49a--babel-core-node-modules-regexpu.lock | |
| 86942 silly lockFile 4e025d0c--cache-regexpu-1-1-2-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\regexpu\1.1.2\package.tgz | |
| 86943 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\regexpu\1.1.2\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\4e025d0c--cache-regexpu-1-1-2-package-tgz.lock | |
| 86944 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\js-tokens\1.0.0\package.tgz | |
| 86945 silly lockFile a8c1fcc9-abel-core-node-modules-js-tokens tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\js-tokens | |
| 86946 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\js-tokens C:\Users\Vince\AppData\Roaming\npm-cache\a8c1fcc9-abel-core-node-modules-js-tokens.lock | |
| 86947 silly lockFile 8cdaa6a5-ache-js-tokens-1-0-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\js-tokens\1.0.0\package.tgz | |
| 86948 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\js-tokens\1.0.0\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\8cdaa6a5-ache-js-tokens-1-0-0-package-tgz.lock | |
| 86949 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\regenerator\0.8.22\package.tgz | |
| 86950 silly lockFile f6029cd1-el-core-node-modules-regenerator tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\regenerator | |
| 86951 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\regenerator C:\Users\Vince\AppData\Roaming\npm-cache\f6029cd1-el-core-node-modules-regenerator.lock | |
| 86952 silly lockFile 467d96b6-e-regenerator-0-8-22-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\regenerator\0.8.22\package.tgz | |
| 86953 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\regenerator\0.8.22\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\467d96b6-e-regenerator-0-8-22-package-tgz.lock | |
| 86954 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\source-map-support\0.2.10\package.tgz | |
| 86955 silly lockFile 0bf32ca3--node-modules-source-map-support tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\source-map-support | |
| 86956 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\source-map-support C:\Users\Vince\AppData\Roaming\npm-cache\0bf32ca3--node-modules-source-map-support.lock | |
| 86957 silly lockFile c89f0a3c-e-map-support-0-2-10-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map-support\0.2.10\package.tgz | |
| 86958 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map-support\0.2.10\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\c89f0a3c-e-map-support-0-2-10-package-tgz.lock | |
| 86959 verbose tar unpack C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.4.2\package.tgz | |
| 86960 silly lockFile 4e30837c-bel-core-node-modules-source-map tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\source-map | |
| 86961 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\source-map C:\Users\Vince\AppData\Roaming\npm-cache\4e30837c-bel-core-node-modules-source-map.lock | |
| 86962 silly lockFile fa6b540d-che-source-map-0-4-2-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.4.2\package.tgz | |
| 86963 verbose lock tar://C:\Users\Vince\AppData\Roaming\npm-cache\source-map\0.4.2\package.tgz C:\Users\Vince\AppData\Roaming\npm-cache\fa6b540d-che-source-map-0-4-2-package-tgz.lock | |
| 86964 silly gunzTarPerm modes [ '755', '644' ] | |
| 86965 silly gunzTarPerm modes [ '755', '644' ] | |
| 86966 silly gunzTarPerm modes [ '755', '644' ] | |
| 86967 silly gunzTarPerm modes [ '755', '644' ] | |
| 86968 silly gunzTarPerm modes [ '755', '644' ] | |
| 86969 silly gunzTarPerm modes [ '755', '644' ] | |
| 86970 silly gunzTarPerm modes [ '755', '644' ] | |
| 86971 silly gunzTarPerm modes [ '755', '644' ] | |
| 86972 silly gunzTarPerm modes [ '755', '644' ] | |
| 86973 silly gunzTarPerm modes [ '755', '644' ] | |
| 86974 silly gunzTarPerm modes [ '755', '644' ] | |
| 86975 silly gunzTarPerm modes [ '755', '644' ] | |
| 86976 silly gunzTarPerm modes [ '755', '644' ] | |
| 86977 silly gunzTarPerm modes [ '755', '644' ] | |
| 86978 silly gunzTarPerm modes [ '755', '644' ] | |
| 86979 silly gunzTarPerm modes [ '755', '644' ] | |
| 86980 silly gunzTarPerm modes [ '755', '644' ] | |
| 86981 silly gunzTarPerm modes [ '755', '644' ] | |
| 86982 silly gunzTarPerm modes [ '755', '644' ] | |
| 86983 silly gunzTarPerm modes [ '755', '644' ] | |
| 86984 silly gunzTarPerm modes [ '755', '644' ] | |
| 86985 silly gunzTarPerm modes [ '755', '644' ] | |
| 86986 silly gunzTarPerm modes [ '755', '644' ] | |
| 86987 silly gunzTarPerm modes [ '755', '644' ] | |
| 86988 silly gunzTarPerm modes [ '755', '644' ] | |
| 86989 silly gunzTarPerm modes [ '755', '644' ] | |
| 86990 silly gunzTarPerm modes [ '755', '644' ] | |
| 86991 silly gunzTarPerm modes [ '755', '644' ] | |
| 86992 silly gunzTarPerm modes [ '755', '644' ] | |
| 86993 silly gunzTarPerm modes [ '755', '644' ] | |
| 86994 silly gunzTarPerm extractEntry test/pow.js | |
| 86995 silly gunzTarPerm modified mode [ 'test/pow.js', 438, 420 ] | |
| 86996 silly gunzTarPerm extractEntry package.json | |
| 86997 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 86998 silly gunzTarPerm extractEntry package.json | |
| 86999 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87000 silly gunzTarPerm extractEntry package.json | |
| 87001 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87002 silly gunzTarPerm extractEntry package.json | |
| 87003 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87004 silly gunzTarPerm extractEntry package.json | |
| 87005 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87006 silly gunzTarPerm extractEntry package.json | |
| 87007 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87008 silly gunzTarPerm extractEntry package.json | |
| 87009 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87010 silly gunzTarPerm extractEntry package.json | |
| 87011 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87012 silly gunzTarPerm extractEntry package.json | |
| 87013 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87014 silly gunzTarPerm extractEntry package.json | |
| 87015 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87016 silly gunzTarPerm extractEntry package.json | |
| 87017 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87018 silly gunzTarPerm extractEntry package.json | |
| 87019 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87020 silly gunzTarPerm extractEntry package.json | |
| 87021 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87022 silly gunzTarPerm extractEntry package.json | |
| 87023 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87024 silly gunzTarPerm extractEntry package.json | |
| 87025 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87026 silly gunzTarPerm extractEntry package.json | |
| 87027 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87028 silly gunzTarPerm extractEntry package.json | |
| 87029 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87030 silly gunzTarPerm extractEntry package.json | |
| 87031 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87032 silly gunzTarPerm extractEntry package.json | |
| 87033 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87034 silly gunzTarPerm extractEntry package.json | |
| 87035 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87036 silly gunzTarPerm extractEntry package.json | |
| 87037 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87038 silly gunzTarPerm extractEntry package.json | |
| 87039 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87040 silly gunzTarPerm extractEntry package.json | |
| 87041 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87042 silly gunzTarPerm extractEntry package.json | |
| 87043 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87044 silly gunzTarPerm extractEntry package.json | |
| 87045 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87046 silly gunzTarPerm extractEntry package.json | |
| 87047 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87048 silly gunzTarPerm extractEntry package.json | |
| 87049 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87050 silly gunzTarPerm extractEntry package.json | |
| 87051 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87052 silly gunzTarPerm extractEntry package.json | |
| 87053 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87054 silly gunzTarPerm extractEntry package.json | |
| 87055 silly gunzTarPerm modified mode [ 'package.json', 438, 420 ] | |
| 87056 silly gunzTarPerm extractEntry .npmignore | |
| 87057 silly gunzTarPerm modified mode [ '.npmignore', 438, 420 ] | |
| 87058 silly gunzTarPerm extractEntry README.md | |
| 87059 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 87060 silly gunzTarPerm extractEntry README.md | |
| 87061 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 87062 silly gunzTarPerm extractEntry lib/ast.js | |
| 87063 silly gunzTarPerm modified mode [ 'lib/ast.js', 438, 420 ] | |
| 87064 silly gunzTarPerm extractEntry index.js | |
| 87065 silly gunzTarPerm modified mode [ 'index.js', 438, 420 ] | |
| 87066 silly gunzTarPerm extractEntry globals.json | |
| 87067 silly gunzTarPerm modified mode [ 'globals.json', 438, 420 ] | |
| 87068 silly gunzTarPerm extractEntry .npmignore | |
| 87069 silly gunzTarPerm modified mode [ '.npmignore', 438, 420 ] | |
| 87070 silly gunzTarPerm extractEntry README.md | |
| 87071 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 87072 silly gunzTarPerm extractEntry .npmignore | |
| 87073 silly gunzTarPerm modified mode [ '.npmignore', 438, 420 ] | |
| 87074 silly gunzTarPerm extractEntry debug.js | |
| 87075 silly gunzTarPerm modified mode [ 'debug.js', 438, 420 ] | |
| 87076 silly gunzTarPerm extractEntry cli.js | |
| 87077 silly gunzTarPerm modified mode [ 'cli.js', 438, 420 ] | |
| 87078 silly gunzTarPerm extractEntry index.js | |
| 87079 silly gunzTarPerm modified mode [ 'index.js', 438, 420 ] | |
| 87080 silly gunzTarPerm extractEntry README.md | |
| 87081 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 87082 silly gunzTarPerm extractEntry LICENSE | |
| 87083 silly gunzTarPerm modified mode [ 'LICENSE', 438, 420 ] | |
| 87084 silly gunzTarPerm extractEntry index.js | |
| 87085 silly gunzTarPerm modified mode [ 'index.js', 438, 420 ] | |
| 87086 silly gunzTarPerm extractEntry readme.md | |
| 87087 silly gunzTarPerm modified mode [ 'readme.md', 438, 420 ] | |
| 87088 silly gunzTarPerm extractEntry README.md | |
| 87089 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 87090 silly gunzTarPerm extractEntry index.js | |
| 87091 silly gunzTarPerm modified mode [ 'index.js', 438, 420 ] | |
| 87092 silly gunzTarPerm extractEntry index.js | |
| 87093 silly gunzTarPerm modified mode [ 'index.js', 438, 420 ] | |
| 87094 silly gunzTarPerm extractEntry readme.md | |
| 87095 silly gunzTarPerm modified mode [ 'readme.md', 438, 420 ] | |
| 87096 silly gunzTarPerm extractEntry cli.js | |
| 87097 silly gunzTarPerm modified mode [ 'cli.js', 438, 420 ] | |
| 87098 silly gunzTarPerm extractEntry strip-json-comments.js | |
| 87099 silly gunzTarPerm modified mode [ 'strip-json-comments.js', 438, 420 ] | |
| 87100 silly gunzTarPerm extractEntry index.js | |
| 87101 silly gunzTarPerm modified mode [ 'index.js', 438, 420 ] | |
| 87102 silly gunzTarPerm extractEntry readme.md | |
| 87103 silly gunzTarPerm modified mode [ 'readme.md', 438, 420 ] | |
| 87104 silly gunzTarPerm extractEntry cli.js | |
| 87105 silly gunzTarPerm modified mode [ 'cli.js', 438, 420 ] | |
| 87106 silly gunzTarPerm extractEntry index.js | |
| 87107 silly gunzTarPerm modified mode [ 'index.js', 438, 420 ] | |
| 87108 silly gunzTarPerm extractEntry cli.js | |
| 87109 silly gunzTarPerm modified mode [ 'cli.js', 438, 420 ] | |
| 87110 silly gunzTarPerm extractEntry index.js | |
| 87111 silly gunzTarPerm modified mode [ 'index.js', 438, 420 ] | |
| 87112 silly gunzTarPerm extractEntry index.js | |
| 87113 silly gunzTarPerm modified mode [ 'index.js', 438, 420 ] | |
| 87114 silly gunzTarPerm extractEntry readme.md | |
| 87115 silly gunzTarPerm modified mode [ 'readme.md', 438, 420 ] | |
| 87116 silly gunzTarPerm extractEntry README.md | |
| 87117 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 87118 silly gunzTarPerm extractEntry LICENSE | |
| 87119 silly gunzTarPerm modified mode [ 'LICENSE', 438, 420 ] | |
| 87120 silly gunzTarPerm extractEntry README.md | |
| 87121 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 87122 silly gunzTarPerm extractEntry browser.js | |
| 87123 silly gunzTarPerm modified mode [ 'browser.js', 438, 420 ] | |
| 87124 silly gunzTarPerm extractEntry .npmignore | |
| 87125 silly gunzTarPerm modified mode [ '.npmignore', 438, 420 ] | |
| 87126 silly gunzTarPerm extractEntry README.md | |
| 87127 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 87128 silly gunzTarPerm extractEntry index.js | |
| 87129 silly gunzTarPerm modified mode [ 'index.js', 438, 420 ] | |
| 87130 silly gunzTarPerm extractEntry readme.md | |
| 87131 silly gunzTarPerm modified mode [ 'readme.md', 438, 420 ] | |
| 87132 silly gunzTarPerm extractEntry .npmignore | |
| 87133 silly gunzTarPerm modified mode [ '.npmignore', 438, 420 ] | |
| 87134 silly gunzTarPerm extractEntry README.md | |
| 87135 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 87136 silly gunzTarPerm extractEntry README.md | |
| 87137 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 87138 silly gunzTarPerm extractEntry regexpu.js | |
| 87139 silly gunzTarPerm modified mode [ 'regexpu.js', 438, 420 ] | |
| 87140 silly gunzTarPerm extractEntry .npmignore | |
| 87141 silly gunzTarPerm modified mode [ '.npmignore', 438, 420 ] | |
| 87142 silly gunzTarPerm extractEntry LICENSE | |
| 87143 silly gunzTarPerm modified mode [ 'LICENSE', 438, 420 ] | |
| 87144 silly gunzTarPerm extractEntry .npmignore | |
| 87145 silly gunzTarPerm modified mode [ '.npmignore', 438, 420 ] | |
| 87146 silly gunzTarPerm extractEntry LICENSE | |
| 87147 silly gunzTarPerm modified mode [ 'LICENSE', 438, 420 ] | |
| 87148 silly gunzTarPerm extractEntry .npmignore | |
| 87149 silly gunzTarPerm modified mode [ '.npmignore', 438, 420 ] | |
| 87150 silly gunzTarPerm extractEntry README.md | |
| 87151 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 87152 silly gunzTarPerm extractEntry .npmignore | |
| 87153 silly gunzTarPerm modified mode [ '.npmignore', 438, 420 ] | |
| 87154 silly gunzTarPerm extractEntry README.md | |
| 87155 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 87156 silly gunzTarPerm extractEntry .npmignore | |
| 87157 silly gunzTarPerm modified mode [ '.npmignore', 438, 420 ] | |
| 87158 silly gunzTarPerm extractEntry README.md | |
| 87159 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 87160 silly gunzTarPerm extractEntry cli.js | |
| 87161 silly gunzTarPerm modified mode [ 'cli.js', 438, 420 ] | |
| 87162 silly gunzTarPerm extractEntry index.js | |
| 87163 silly gunzTarPerm modified mode [ 'index.js', 438, 420 ] | |
| 87164 silly gunzTarPerm extractEntry README.md | |
| 87165 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 87166 silly gunzTarPerm extractEntry estraverse.js | |
| 87167 silly gunzTarPerm modified mode [ 'estraverse.js', 438, 420 ] | |
| 87168 silly gunzTarPerm extractEntry index.js | |
| 87169 silly gunzTarPerm modified mode [ 'index.js', 438, 420 ] | |
| 87170 silly gunzTarPerm extractEntry readme.md | |
| 87171 silly gunzTarPerm modified mode [ 'readme.md', 438, 420 ] | |
| 87172 silly gunzTarPerm extractEntry README.md | |
| 87173 silly gunzTarPerm modified mode [ 'README.md', 438, 420 ] | |
| 87174 silly gunzTarPerm extractEntry function.js | |
| 87175 silly gunzTarPerm modified mode [ 'function.js', 438, 420 ] | |
| 87176 silly gunzTarPerm extractEntry index.js | |
| 87177 silly gunzTarPerm modified mode [ 'index.js', 438, 420 ] | |
| 87178 silly gunzTarPerm extractEntry .travis.yml | |
| 87179 silly gunzTarPerm modified mode [ '.travis.yml', 438, 420 ] | |
| 87180 silly gunzTarPerm extractEntry generate-index.js | |
| 87181 silly gunzTarPerm modified mode [ 'generate-index.js', 438, 420 ] | |
| 87182 silly gunzTarPerm extractEntry index.js | |
| 87183 silly gunzTarPerm modified mode [ 'index.js', 438, 420 ] | |
| 87184 silly gunzTarPerm extractEntry readme.md | |
| 87185 silly gunzTarPerm modified mode [ 'readme.md', 438, 420 ] | |
| 87186 silly gunzTarPerm extractEntry LICENSE | |
| 87187 silly gunzTarPerm modified mode [ 'LICENSE', 438, 420 ] | |
| 87188 silly gunzTarPerm extractEntry index.js | |
| 87189 silly gunzTarPerm modified mode [ 'index.js', 438, 420 ] | |
| 87190 silly gunzTarPerm extractEntry browser.js | |
| 87191 silly gunzTarPerm modified mode [ 'browser.js', 438, 420 ] | |
| 87192 silly gunzTarPerm extractEntry node.js | |
| 87193 silly gunzTarPerm modified mode [ 'node.js', 438, 420 ] | |
| 87194 silly gunzTarPerm extractEntry LICENSE | |
| 87195 silly gunzTarPerm modified mode [ 'LICENSE', 438, 420 ] | |
| 87196 silly gunzTarPerm extractEntry readme.md | |
| 87197 silly gunzTarPerm modified mode [ 'readme.md', 438, 420 ] | |
| 87198 silly gunzTarPerm extractEntry index.js | |
| 87199 silly gunzTarPerm modified mode [ 'index.js', 438, 420 ] | |
| 87200 silly gunzTarPerm extractEntry test.js | |
| 87201 silly gunzTarPerm modified mode [ 'test.js', 438, 420 ] | |
| 87202 silly gunzTarPerm extractEntry readme.md | |
| 87203 silly gunzTarPerm modified mode [ 'readme.md', 438, 420 ] | |
| 87204 silly gunzTarPerm extractEntry minimatch.js | |
| 87205 silly gunzTarPerm modified mode [ 'minimatch.js', 438, 420 ] | |
| 87206 silly gunzTarPerm extractEntry readme.md | |
| 87207 silly gunzTarPerm modified mode [ 'readme.md', 438, 420 ] | |
| 87208 silly gunzTarPerm extractEntry browser-source-map-support.js | |
| 87209 silly gunzTarPerm modified mode [ 'browser-source-map-support.js', 438, 420 ] | |
| 87210 silly gunzTarPerm extractEntry source-map-support.js | |
| 87211 silly gunzTarPerm modified mode [ 'source-map-support.js', 438, 420 ] | |
| 87212 silly gunzTarPerm extractEntry build.js | |
| 87213 silly gunzTarPerm modified mode [ 'build.js', 438, 420 ] | |
| 87214 silly gunzTarPerm extractEntry test.js | |
| 87215 silly gunzTarPerm modified mode [ 'test.js', 438, 420 ] | |
| 87216 silly gunzTarPerm extractEntry LICENSE.md | |
| 87217 silly gunzTarPerm modified mode [ 'LICENSE.md', 438, 420 ] | |
| 87218 silly gunzTarPerm extractEntry amd-test/browser-source-map-support.js | |
| 87219 silly gunzTarPerm modified mode [ 'amd-test/browser-source-map-support.js', 438, 420 ] | |
| 87220 silly gunzTarPerm extractEntry amd-test/require.js | |
| 87221 silly gunzTarPerm modified mode [ 'amd-test/require.js', 438, 420 ] | |
| 87222 silly gunzTarPerm extractEntry amd-test/script.js | |
| 87223 silly gunzTarPerm modified mode [ 'amd-test/script.js', 438, 420 ] | |
| 87224 silly gunzTarPerm extractEntry amd-test/index.html | |
| 87225 silly gunzTarPerm modified mode [ 'amd-test/index.html', 438, 420 ] | |
| 87226 silly gunzTarPerm extractEntry amd-test/script.coffee | |
| 87227 silly gunzTarPerm modified mode [ 'amd-test/script.coffee', 438, 420 ] | |
| 87228 silly gunzTarPerm extractEntry amd-test/script.map | |
| 87229 silly gunzTarPerm modified mode [ 'amd-test/script.map', 438, 420 ] | |
| 87230 silly gunzTarPerm extractEntry browser-test/script.js | |
| 87231 silly gunzTarPerm modified mode [ 'browser-test/script.js', 438, 420 ] | |
| 87232 silly gunzTarPerm extractEntry browser-test/index.html | |
| 87233 silly gunzTarPerm modified mode [ 'browser-test/index.html', 438, 420 ] | |
| 87234 silly gunzTarPerm extractEntry browser-test/script.coffee | |
| 87235 silly gunzTarPerm modified mode [ 'browser-test/script.coffee', 438, 420 ] | |
| 87236 silly gunzTarPerm extractEntry browser-test/script.map | |
| 87237 silly gunzTarPerm modified mode [ 'browser-test/script.map', 438, 420 ] | |
| 87238 silly gunzTarPerm extractEntry header-test/script.js | |
| 87239 silly gunzTarPerm modified mode [ 'header-test/script.js', 438, 420 ] | |
| 87240 silly gunzTarPerm extractEntry header-test/server.js | |
| 87241 silly gunzTarPerm modified mode [ 'header-test/server.js', 438, 420 ] | |
| 87242 silly gunzTarPerm extractEntry header-test/index.html | |
| 87243 silly gunzTarPerm modified mode [ 'header-test/index.html', 438, 420 ] | |
| 87244 silly gunzTarPerm extractEntry header-test/script.coffee | |
| 87245 silly gunzTarPerm modified mode [ 'header-test/script.coffee', 438, 420 ] | |
| 87246 silly gunzTarPerm extractEntry header-test/script.map | |
| 87247 silly gunzTarPerm modified mode [ 'header-test/script.map', 438, 420 ] | |
| 87248 silly gunzTarPerm extractEntry private.js | |
| 87249 silly gunzTarPerm modified mode [ 'private.js', 438, 420 ] | |
| 87250 silly gunzTarPerm extractEntry .travis.yml | |
| 87251 silly gunzTarPerm modified mode [ '.travis.yml', 438, 420 ] | |
| 87252 silly gunzTarPerm extractEntry test/run.js | |
| 87253 silly gunzTarPerm modified mode [ 'test/run.js', 438, 420 ] | |
| 87254 silly gunzTarPerm extractEntry readme.md | |
| 87255 silly gunzTarPerm modified mode [ 'readme.md', 438, 420 ] | |
| 87256 silly gunzTarPerm extractEntry lib/code.js | |
| 87257 silly gunzTarPerm modified mode [ 'lib/code.js', 438, 420 ] | |
| 87258 silly gunzTarPerm extractEntry lib/keyword.js | |
| 87259 silly gunzTarPerm modified mode [ 'lib/keyword.js', 438, 420 ] | |
| 87260 silly gunzTarPerm extractEntry lib/utils.js | |
| 87261 silly gunzTarPerm modified mode [ 'lib/utils.js', 438, 420 ] | |
| 87262 silly gunzTarPerm extractEntry LICENSE.BSD | |
| 87263 silly gunzTarPerm modified mode [ 'LICENSE.BSD', 438, 420 ] | |
| 87264 silly gunzTarPerm extractEntry index.js | |
| 87265 silly gunzTarPerm modified mode [ 'index.js', 438, 420 ] | |
| 87266 silly gunzTarPerm extractEntry LICENSE | |
| 87267 silly gunzTarPerm modified mode [ 'LICENSE', 438, 420 ] | |
| 87268 silly gunzTarPerm extractEntry runtime-module.js | |
| 87269 silly gunzTarPerm modified mode [ 'runtime-module.js', 438, 420 ] | |
| 87270 silly gunzTarPerm extractEntry readme.md | |
| 87271 silly gunzTarPerm modified mode [ 'readme.md', 438, 420 ] | |
| 87272 silly gunzTarPerm extractEntry index.js | |
| 87273 silly gunzTarPerm modified mode [ 'index.js', 438, 420 ] | |
| 87274 silly gunzTarPerm extractEntry gulpfile.js | |
| 87275 silly gunzTarPerm modified mode [ 'gulpfile.js', 438, 420 ] | |
| 87276 silly gunzTarPerm extractEntry LICENSE | |
| 87277 silly gunzTarPerm modified mode [ 'LICENSE', 438, 420 ] | |
| 87278 silly gunzTarPerm extractEntry rewrite-pattern.js | |
| 87279 silly gunzTarPerm modified mode [ 'rewrite-pattern.js', 438, 420 ] | |
| 87280 silly gunzTarPerm extractEntry transform-tree.js | |
| 87281 silly gunzTarPerm modified mode [ 'transform-tree.js', 438, 420 ] | |
| 87282 silly gunzTarPerm extractEntry transpile-code.js | |
| 87283 silly gunzTarPerm modified mode [ 'transpile-code.js', 438, 420 ] | |
| 87284 silly gunzTarPerm extractEntry bin/regexpu | |
| 87285 silly gunzTarPerm modified mode [ 'bin/regexpu', 438, 420 ] | |
| 87286 silly gunzTarPerm extractEntry data/character-class-escape-sets.js | |
| 87287 silly gunzTarPerm modified mode [ 'data/character-class-escape-sets.js', 438, 420 ] | |
| 87288 silly gunzTarPerm extractEntry data/iu-mappings.json | |
| 87289 silly gunzTarPerm modified mode [ 'data/iu-mappings.json', 438, 420 ] | |
| 87290 silly gunzTarPerm extractEntry LICENSE-MIT.txt | |
| 87291 silly gunzTarPerm modified mode [ 'LICENSE-MIT.txt', 438, 420 ] | |
| 87292 silly gunzTarPerm extractEntry man/regexpu.1 | |
| 87293 silly gunzTarPerm modified mode [ 'man/regexpu.1', 438, 420 ] | |
| 87294 silly gunzTarPerm extractEntry LICENSE | |
| 87295 silly gunzTarPerm modified mode [ 'LICENSE', 438, 420 ] | |
| 87296 silly gunzTarPerm extractEntry changelog.md | |
| 87297 silly gunzTarPerm modified mode [ 'changelog.md', 438, 420 ] | |
| 87298 silly gunzTarPerm extractEntry readme.md | |
| 87299 silly gunzTarPerm modified mode [ 'readme.md', 438, 420 ] | |
| 87300 silly gunzTarPerm extractEntry .travis.yml | |
| 87301 silly gunzTarPerm modified mode [ '.travis.yml', 438, 420 ] | |
| 87302 silly gunzTarPerm extractEntry example/comment-to-json.js | |
| 87303 silly gunzTarPerm modified mode [ 'example/comment-to-json.js', 438, 420 ] | |
| 87304 silly gunzTarPerm extractEntry main.js | |
| 87305 silly gunzTarPerm modified mode [ 'main.js', 438, 420 ] | |
| 87306 silly gunzTarPerm extractEntry .travis.yml | |
| 87307 silly gunzTarPerm modified mode [ '.travis.yml', 438, 420 ] | |
| 87308 silly gunzTarPerm extractEntry bower.json | |
| 87309 silly gunzTarPerm modified mode [ 'bower.json', 438, 420 ] | |
| 87310 silly gunzTarPerm extractEntry .travis.yml | |
| 87311 silly gunzTarPerm modified mode [ '.travis.yml', 438, 420 ] | |
| 87312 silly gunzTarPerm extractEntry changelog.md | |
| 87313 silly gunzTarPerm modified mode [ 'changelog.md', 438, 420 ] | |
| 87314 silly gunzTarPerm extractEntry runtime.js | |
| 87315 silly gunzTarPerm modified mode [ 'runtime.js', 438, 420 ] | |
| 87316 silly gunzTarPerm extractEntry main.js | |
| 87317 silly gunzTarPerm modified mode [ 'main.js', 438, 420 ] | |
| 87318 silly gunzTarPerm extractEntry .travis.yml | |
| 87319 silly gunzTarPerm modified mode [ '.travis.yml', 438, 420 ] | |
| 87320 silly gunzTarPerm extractEntry lib/emit.js | |
| 87321 silly gunzTarPerm modified mode [ 'lib/emit.js', 438, 420 ] | |
| 87322 silly gunzTarPerm extractEntry lib/hoist.js | |
| 87323 silly gunzTarPerm modified mode [ 'lib/hoist.js', 438, 420 ] | |
| 87324 silly gunzTarPerm extractEntry lib/leap.js | |
| 87325 silly gunzTarPerm modified mode [ 'lib/leap.js', 438, 420 ] | |
| 87326 silly gunzTarPerm extractEntry lib/meta.js | |
| 87327 silly gunzTarPerm modified mode [ 'lib/meta.js', 438, 420 ] | |
| 87328 silly gunzTarPerm extractEntry lib/util.js | |
| 87329 silly gunzTarPerm modified mode [ 'lib/util.js', 438, 420 ] | |
| 87330 silly gunzTarPerm extractEntry lib/visit.js | |
| 87331 silly gunzTarPerm modified mode [ 'lib/visit.js', 438, 420 ] | |
| 87332 silly gunzTarPerm extractEntry PATENTS | |
| 87333 silly gunzTarPerm modified mode [ 'PATENTS', 438, 420 ] | |
| 87334 silly gunzTarPerm extractEntry CONTRIBUTING.md | |
| 87335 silly gunzTarPerm modified mode [ 'CONTRIBUTING.md', 438, 420 ] | |
| 87336 silly gunzTarPerm extractEntry bin/regenerator | |
| 87337 silly gunzTarPerm modified mode [ 'bin/regenerator', 438, 420 ] | |
| 87338 silly gunzTarPerm extractEntry lang.js | |
| 87339 silly gunzTarPerm modified mode [ 'lang.js', 438, 420 ] | |
| 87340 silly gunzTarPerm extractEntry Gruntfile.js | |
| 87341 silly gunzTarPerm modified mode [ 'Gruntfile.js', 438, 420 ] | |
| 87342 silly gunzTarPerm extractEntry index.js | |
| 87343 silly gunzTarPerm modified mode [ 'index.js', 438, 420 ] | |
| 87344 silly gunzTarPerm extractEntry Makefile.dryice.js | |
| 87345 silly gunzTarPerm modified mode [ 'Makefile.dryice.js', 438, 420 ] | |
| 87346 silly gunzTarPerm extractEntry .gitattributes | |
| 87347 silly gunzTarPerm modified mode [ '.gitattributes', 438, 420 ] | |
| 87348 silly gunzTarPerm extractEntry test/index.js | |
| 87349 silly gunzTarPerm modified mode [ 'test/index.js', 438, 420 ] | |
| 87350 silly gunzTarPerm extractEntry readme.md | |
| 87351 silly gunzTarPerm modified mode [ 'readme.md', 438, 420 ] | |
| 87352 silly gunzTarPerm extractEntry regex.coffee | |
| 87353 silly gunzTarPerm modified mode [ 'regex.coffee', 438, 420 ] | |
| 87354 silly gunzTarPerm extractEntry test/index.js | |
| 87355 silly gunzTarPerm modified mode [ 'test/index.js', 438, 420 ] | |
| 87356 silly gunzTarPerm extractEntry test/fixtures/base64.js | |
| 87357 silly gunzTarPerm modified mode [ 'test/fixtures/base64.js', 438, 420 ] | |
| 87358 silly gunzTarPerm extractEntry test/fixtures/division.js | |
| 87359 silly gunzTarPerm modified mode [ 'test/fixtures/division.js', 438, 420 ] | |
| 87360 silly gunzTarPerm extractEntry test/fixtures/errors.js | |
| 87361 silly gunzTarPerm modified mode [ 'test/fixtures/errors.js', 438, 420 ] | |
| 87362 silly gunzTarPerm extractEntry test/fixtures/regex.js | |
| 87363 silly gunzTarPerm modified mode [ 'test/fixtures/regex.js', 438, 420 ] | |
| 87364 silly gunzTarPerm extractEntry test/fixtures/base64.json | |
| 87365 silly gunzTarPerm modified mode [ 'test/fixtures/base64.json', 438, 420 ] | |
| 87366 silly gunzTarPerm extractEntry test/fixtures/division.json | |
| 87367 silly gunzTarPerm modified mode [ 'test/fixtures/division.json', 438, 420 ] | |
| 87368 silly gunzTarPerm extractEntry test/fixtures/errors.json | |
| 87369 silly gunzTarPerm modified mode [ 'test/fixtures/errors.json', 438, 420 ] | |
| 87370 silly gunzTarPerm extractEntry test/fixtures/regex.json | |
| 87371 silly gunzTarPerm modified mode [ 'test/fixtures/regex.json', 438, 420 ] | |
| 87372 silly gunzTarPerm extractEntry .jshintrc | |
| 87373 silly gunzTarPerm modified mode [ '.jshintrc', 438, 420 ] | |
| 87374 silly gunzTarPerm extractEntry LICENSE.BSD | |
| 87375 silly gunzTarPerm modified mode [ 'LICENSE.BSD', 438, 420 ] | |
| 87376 silly lockFile 0d87c72c--node-modules-to-fast-properties tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\to-fast-properties | |
| 87377 silly lockFile 0d87c72c--node-modules-to-fast-properties tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\to-fast-properties | |
| 87378 silly lockFile 0b979cb0--core-node-modules-shebang-regex tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\shebang-regex | |
| 87379 silly lockFile 0b979cb0--core-node-modules-shebang-regex tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\shebang-regex | |
| 87380 silly lockFile 0d74ed1e-es-babel-core-node-modules-slash tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\slash | |
| 87381 silly lockFile 0d74ed1e-es-babel-core-node-modules-slash tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\slash | |
| 87382 silly gunzTarPerm extractEntry test/comment-regex.js | |
| 87383 silly gunzTarPerm modified mode [ 'test/comment-regex.js', 438, 420 ] | |
| 87384 silly lockFile 8ed0c466-bel-core-node-modules-trim-right tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\trim-right | |
| 87385 silly lockFile 8ed0c466-bel-core-node-modules-trim-right tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\trim-right | |
| 87386 silly gunzTarPerm extractEntry History.md | |
| 87387 silly gunzTarPerm modified mode [ 'History.md', 438, 420 ] | |
| 87388 silly gunzTarPerm extractEntry Makefile | |
| 87389 silly gunzTarPerm modified mode [ 'Makefile', 438, 420 ] | |
| 87390 silly lockFile 8de6028c-ast-properties-1-0-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\to-fast-properties\1.0.1\package.tgz | |
| 87391 silly lockFile 8de6028c-ast-properties-1-0-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\to-fast-properties\1.0.1\package.tgz | |
| 87392 silly gunzTarPerm extractEntry date.js | |
| 87393 silly gunzTarPerm modified mode [ 'date.js', 438, 420 ] | |
| 87394 silly gunzTarPerm extractEntry math.js | |
| 87395 silly gunzTarPerm modified mode [ 'math.js', 438, 420 ] | |
| 87396 silly lockFile 6cc5b3c8--shebang-regex-1-0-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\shebang-regex\1.0.0\package.tgz | |
| 87397 silly lockFile 6cc5b3c8--shebang-regex-1-0-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\shebang-regex\1.0.0\package.tgz | |
| 87398 silly lockFile 09945aa5-pm-cache-slash-1-0-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\slash\1.0.0\package.tgz | |
| 87399 silly lockFile 09945aa5-pm-cache-slash-1-0-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\slash\1.0.0\package.tgz | |
| 87400 silly lockFile 5ec71eeb-che-trim-right-1-0-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\trim-right\1.0.0\package.tgz | |
| 87401 silly lockFile 5ec71eeb-che-trim-right-1-0-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\trim-right\1.0.0\package.tgz | |
| 87402 silly lockFile d8c50092-re-node-modules-path-is-absolute tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\path-is-absolute | |
| 87403 silly lockFile d8c50092-re-node-modules-path-is-absolute tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\path-is-absolute | |
| 87404 silly lockFile ae851f8d-th-is-absolute-1-0-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\path-is-absolute\1.0.0\package.tgz | |
| 87405 silly lockFile ae851f8d-th-is-absolute-1-0-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\path-is-absolute\1.0.0\package.tgz | |
| 87406 silly lockFile fd63b575-ode-modules-fs-readdir-recursive tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\fs-readdir-recursive | |
| 87407 silly lockFile fd63b575-ode-modules-fs-readdir-recursive tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\fs-readdir-recursive | |
| 87408 info preinstall shebang-regex@1.0.0 | |
| 87409 info preinstall slash@1.0.0 | |
| 87410 silly lockFile c1d5d650-ddir-recursive-0-1-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\fs-readdir-recursive\0.1.1\package.tgz | |
| 87411 silly lockFile c1d5d650-ddir-recursive-0-1-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\fs-readdir-recursive\0.1.1\package.tgz | |
| 87412 info preinstall to-fast-properties@1.0.1 | |
| 87413 info preinstall trim-right@1.0.0 | |
| 87414 verbose readDependencies using package.json deps | |
| 87415 verbose readDependencies using package.json deps | |
| 87416 silly gunzTarPerm extractEntry test/convert-source-map.js | |
| 87417 silly gunzTarPerm modified mode [ 'test/convert-source-map.js', 438, 420 ] | |
| 87418 silly gunzTarPerm extractEntry test/map-file-comment.js | |
| 87419 silly gunzTarPerm modified mode [ 'test/map-file-comment.js', 438, 420 ] | |
| 87420 info preinstall path-is-absolute@1.0.0 | |
| 87421 verbose readDependencies using package.json deps | |
| 87422 verbose readDependencies using package.json deps | |
| 87423 silly resolved [] | |
| 87424 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\shebang-regex | |
| 87425 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\shebang-regex | |
| 87426 verbose linkStuff [ true, | |
| 87426 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 87426 verbose linkStuff false, | |
| 87426 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel-core\\node_modules' ] | |
| 87427 info linkStuff shebang-regex@1.0.0 | |
| 87428 verbose readDependencies using package.json deps | |
| 87429 silly resolved [] | |
| 87430 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\slash | |
| 87431 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\slash | |
| 87432 verbose linkStuff [ true, | |
| 87432 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 87432 verbose linkStuff false, | |
| 87432 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel-core\\node_modules' ] | |
| 87433 info linkStuff slash@1.0.0 | |
| 87434 silly lockFile deb1e3ac-es-babel-core-node-modules-leven tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\leven | |
| 87435 silly lockFile deb1e3ac-es-babel-core-node-modules-leven tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\leven | |
| 87436 verbose readDependencies using package.json deps | |
| 87437 verbose readDependencies using package.json deps | |
| 87438 silly resolved [] | |
| 87439 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\to-fast-properties | |
| 87440 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\to-fast-properties | |
| 87441 verbose linkStuff [ true, | |
| 87441 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 87441 verbose linkStuff false, | |
| 87441 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel-core\\node_modules' ] | |
| 87442 info linkStuff to-fast-properties@1.0.1 | |
| 87443 silly gunzTarPerm extractEntry number.js | |
| 87444 silly gunzTarPerm modified mode [ 'number.js', 438, 420 ] | |
| 87445 silly gunzTarPerm extractEntry object.js | |
| 87446 silly gunzTarPerm modified mode [ 'object.js', 438, 420 ] | |
| 87447 verbose readDependencies using package.json deps | |
| 87448 silly resolved [] | |
| 87449 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\trim-right | |
| 87450 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\trim-right | |
| 87451 verbose linkStuff [ true, | |
| 87451 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 87451 verbose linkStuff false, | |
| 87451 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel-core\\node_modules' ] | |
| 87452 info linkStuff trim-right@1.0.0 | |
| 87453 silly lockFile 7db5f2ec-abel-core-node-modules-user-home tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\user-home | |
| 87454 silly lockFile 7db5f2ec-abel-core-node-modules-user-home tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\user-home | |
| 87455 info preinstall fs-readdir-recursive@0.1.1 | |
| 87456 verbose linkBins shebang-regex@1.0.0 | |
| 87457 verbose linkMans shebang-regex@1.0.0 | |
| 87458 verbose rebuildBundles shebang-regex@1.0.0 | |
| 87459 silly lockFile 0a33e198-abel-core-node-modules-repeating tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\repeating | |
| 87460 silly lockFile 0a33e198-abel-core-node-modules-repeating tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\repeating | |
| 87461 verbose linkBins slash@1.0.0 | |
| 87462 verbose linkMans slash@1.0.0 | |
| 87463 verbose rebuildBundles slash@1.0.0 | |
| 87464 silly lockFile 3000c9f2-pm-cache-leven-1-0-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\leven\1.0.1\package.tgz | |
| 87465 silly lockFile 3000c9f2-pm-cache-leven-1-0-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\leven\1.0.1\package.tgz | |
| 87466 verbose readDependencies using package.json deps | |
| 87467 verbose linkBins to-fast-properties@1.0.1 | |
| 87468 verbose linkMans to-fast-properties@1.0.1 | |
| 87469 verbose rebuildBundles to-fast-properties@1.0.1 | |
| 87470 info install shebang-regex@1.0.0 | |
| 87471 info install slash@1.0.0 | |
| 87472 verbose readDependencies using package.json deps | |
| 87473 silly resolved [] | |
| 87474 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\path-is-absolute | |
| 87475 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\path-is-absolute | |
| 87476 verbose linkStuff [ true, | |
| 87476 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 87476 verbose linkStuff false, | |
| 87476 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel-core\\node_modules' ] | |
| 87477 info linkStuff path-is-absolute@1.0.0 | |
| 87478 verbose linkBins trim-right@1.0.0 | |
| 87479 verbose linkMans trim-right@1.0.0 | |
| 87480 verbose rebuildBundles trim-right@1.0.0 | |
| 87481 silly lockFile 40a72e14-es-babel-core-node-modules-chalk tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\chalk | |
| 87482 silly lockFile 40a72e14-es-babel-core-node-modules-chalk tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\chalk | |
| 87483 silly lockFile 8a3b02d5-ache-user-home-1-1-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\user-home\1.1.1\package.tgz | |
| 87484 silly lockFile 8a3b02d5-ache-user-home-1-1-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\user-home\1.1.1\package.tgz | |
| 87485 info install to-fast-properties@1.0.1 | |
| 87486 silly lockFile 557f16e4-ache-repeating-1-1-2-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\repeating\1.1.2\package.tgz | |
| 87487 silly lockFile 557f16e4-ache-repeating-1-1-2-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\repeating\1.1.2\package.tgz | |
| 87488 info install trim-right@1.0.0 | |
| 87489 silly lockFile 1f491a39-node-modules-strip-json-comments tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\strip-json-comments | |
| 87490 silly lockFile 1f491a39-node-modules-strip-json-comments tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\strip-json-comments | |
| 87491 verbose readDependencies using package.json deps | |
| 87492 info postinstall shebang-regex@1.0.0 | |
| 87493 info postinstall slash@1.0.0 | |
| 87494 verbose linkBins path-is-absolute@1.0.0 | |
| 87495 verbose linkMans path-is-absolute@1.0.0 | |
| 87496 verbose rebuildBundles path-is-absolute@1.0.0 | |
| 87497 silly gunzTarPerm extractEntry .jshintrc | |
| 87498 silly gunzTarPerm modified mode [ '.jshintrc', 438, 420 ] | |
| 87499 silly gunzTarPerm extractEntry component.json | |
| 87500 silly gunzTarPerm modified mode [ 'component.json', 438, 420 ] | |
| 87501 silly lockFile e3cd71b4-pm-cache-chalk-1-0-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\chalk\1.0.0\package.tgz | |
| 87502 silly lockFile e3cd71b4-pm-cache-chalk-1-0-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\chalk\1.0.0\package.tgz | |
| 87503 silly lockFile 99a9b8c2--core-node-modules-detect-indent tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\detect-indent | |
| 87504 silly lockFile 99a9b8c2--core-node-modules-detect-indent tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\detect-indent | |
| 87505 info postinstall to-fast-properties@1.0.1 | |
| 87506 verbose readDependencies using package.json deps | |
| 87507 silly resolved [] | |
| 87508 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\fs-readdir-recursive | |
| 87509 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\fs-readdir-recursive | |
| 87510 verbose linkStuff [ true, | |
| 87510 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 87510 verbose linkStuff false, | |
| 87510 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel-core\\node_modules' ] | |
| 87511 info linkStuff fs-readdir-recursive@0.1.1 | |
| 87512 info install path-is-absolute@1.0.0 | |
| 87513 info postinstall trim-right@1.0.0 | |
| 87514 silly lockFile 7f74635f--json-comments-1-0-2-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\strip-json-comments\1.0.2\package.tgz | |
| 87515 silly lockFile 7f74635f--json-comments-1-0-2-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\strip-json-comments\1.0.2\package.tgz | |
| 87516 info preinstall leven@1.0.1 | |
| 87517 silly lockFile 94040487--detect-indent-3-0-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\detect-indent\3.0.1\package.tgz | |
| 87518 silly lockFile 94040487--detect-indent-3-0-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\detect-indent\3.0.1\package.tgz | |
| 87519 verbose linkBins fs-readdir-recursive@0.1.1 | |
| 87520 verbose linkMans fs-readdir-recursive@0.1.1 | |
| 87521 verbose rebuildBundles fs-readdir-recursive@0.1.1 | |
| 87522 info postinstall path-is-absolute@1.0.0 | |
| 87523 silly lockFile 08573f63-re-node-modules-output-file-sync tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\output-file-sync | |
| 87524 silly lockFile 08573f63-re-node-modules-output-file-sync tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\output-file-sync | |
| 87525 info install fs-readdir-recursive@0.1.1 | |
| 87526 info preinstall user-home@1.1.1 | |
| 87527 info preinstall repeating@1.1.2 | |
| 87528 verbose readDependencies using package.json deps | |
| 87529 silly lockFile 53acc573-bel-core-node-modules-is-integer tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\is-integer | |
| 87530 silly lockFile 53acc573-bel-core-node-modules-is-integer tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\is-integer | |
| 87531 info postinstall fs-readdir-recursive@0.1.1 | |
| 87532 silly lockFile 0971c28b-tput-file-sync-1-1-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\output-file-sync\1.1.0\package.tgz | |
| 87533 silly lockFile 0971c28b-tput-file-sync-1-1-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\output-file-sync\1.1.0\package.tgz | |
| 87534 verbose readDependencies using package.json deps | |
| 87535 silly resolved [] | |
| 87536 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\leven | |
| 87537 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\leven | |
| 87538 verbose linkStuff [ true, | |
| 87538 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 87538 verbose linkStuff false, | |
| 87538 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel-core\\node_modules' ] | |
| 87539 info linkStuff leven@1.0.1 | |
| 87540 verbose readDependencies using package.json deps | |
| 87541 verbose readDependencies using package.json deps | |
| 87542 info preinstall chalk@1.0.0 | |
| 87543 silly lockFile 8018f59f-che-is-integer-1-0-4-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\is-integer\1.0.4\package.tgz | |
| 87544 silly lockFile 8018f59f-che-is-integer-1-0-4-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\is-integer\1.0.4\package.tgz | |
| 87545 info preinstall strip-json-comments@1.0.2 | |
| 87546 verbose readDependencies using package.json deps | |
| 87547 silly resolved [] | |
| 87548 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\user-home | |
| 87549 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\user-home | |
| 87550 verbose linkStuff [ true, | |
| 87550 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 87550 verbose linkStuff false, | |
| 87550 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel-core\\node_modules' ] | |
| 87551 info linkStuff user-home@1.1.1 | |
| 87552 verbose readDependencies using package.json deps | |
| 87553 info preinstall detect-indent@3.0.1 | |
| 87554 verbose linkBins leven@1.0.1 | |
| 87555 verbose link bins [ { leven: 'cli.js' }, | |
| 87555 verbose link bins 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel-core\\node_modules\\.bin', | |
| 87555 verbose link bins false ] | |
| 87556 verbose linkMans leven@1.0.1 | |
| 87557 verbose rebuildBundles leven@1.0.1 | |
| 87558 verbose linkBins user-home@1.1.1 | |
| 87559 verbose link bins [ { 'user-home': 'cli.js' }, | |
| 87559 verbose link bins 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel-core\\node_modules\\.bin', | |
| 87559 verbose link bins false ] | |
| 87560 verbose linkMans user-home@1.1.1 | |
| 87561 verbose rebuildBundles user-home@1.1.1 | |
| 87562 silly gunzTarPerm extractEntry lib/source-map.js | |
| 87563 silly gunzTarPerm modified mode [ 'lib/source-map.js', 438, 420 ] | |
| 87564 silly gunzTarPerm extractEntry lib/source-map/array-set.js | |
| 87565 silly gunzTarPerm modified mode [ 'lib/source-map/array-set.js', 438, 420 ] | |
| 87566 silly gunzTarPerm extractEntry def/core.js | |
| 87567 silly gunzTarPerm modified mode [ 'def/core.js', 438, 420 ] | |
| 87568 silly gunzTarPerm extractEntry def/e4x.js | |
| 87569 silly gunzTarPerm modified mode [ 'def/e4x.js', 438, 420 ] | |
| 87570 verbose readDependencies using package.json deps | |
| 87571 verbose cache add [ 'is-finite@^1.0.0', null ] | |
| 87572 verbose cache add name=undefined spec="is-finite@^1.0.0" args=["is-finite@^1.0.0",null] | |
| 87573 verbose parsed url { protocol: null, | |
| 87573 verbose parsed url slashes: null, | |
| 87573 verbose parsed url auth: null, | |
| 87573 verbose parsed url host: null, | |
| 87573 verbose parsed url port: null, | |
| 87573 verbose parsed url hostname: null, | |
| 87573 verbose parsed url hash: null, | |
| 87573 verbose parsed url search: null, | |
| 87573 verbose parsed url query: null, | |
| 87573 verbose parsed url pathname: 'is-finite@^1.0.0', | |
| 87573 verbose parsed url path: 'is-finite@^1.0.0', | |
| 87573 verbose parsed url href: 'is-finite@^1.0.0' } | |
| 87574 verbose cache add name="is-finite" spec="^1.0.0" args=["is-finite","^1.0.0"] | |
| 87575 verbose parsed url { protocol: null, | |
| 87575 verbose parsed url slashes: null, | |
| 87575 verbose parsed url auth: null, | |
| 87575 verbose parsed url host: null, | |
| 87575 verbose parsed url port: null, | |
| 87575 verbose parsed url hostname: null, | |
| 87575 verbose parsed url hash: null, | |
| 87575 verbose parsed url search: null, | |
| 87575 verbose parsed url query: null, | |
| 87575 verbose parsed url pathname: '^1.0.0', | |
| 87575 verbose parsed url path: '^1.0.0', | |
| 87575 verbose parsed url href: '^1.0.0' } | |
| 87576 verbose addNamed [ 'is-finite', '^1.0.0' ] | |
| 87577 verbose addNamed [ null, null ] | |
| 87578 silly lockFile 158d7f9e-is-finite-1-0-0 is-finite@^1.0.0 | |
| 87579 verbose lock is-finite@^1.0.0 C:\Users\Vince\AppData\Roaming\npm-cache\158d7f9e-is-finite-1-0-0.lock | |
| 87580 verbose cache add [ 'meow@^3.0.0', null ] | |
| 87581 verbose cache add name=undefined spec="meow@^3.0.0" args=["meow@^3.0.0",null] | |
| 87582 verbose parsed url { protocol: null, | |
| 87582 verbose parsed url slashes: null, | |
| 87582 verbose parsed url auth: null, | |
| 87582 verbose parsed url host: null, | |
| 87582 verbose parsed url port: null, | |
| 87582 verbose parsed url hostname: null, | |
| 87582 verbose parsed url hash: null, | |
| 87582 verbose parsed url search: null, | |
| 87582 verbose parsed url query: null, | |
| 87582 verbose parsed url pathname: 'meow@^3.0.0', | |
| 87582 verbose parsed url path: 'meow@^3.0.0', | |
| 87582 verbose parsed url href: 'meow@^3.0.0' } | |
| 87583 verbose cache add name="meow" spec="^3.0.0" args=["meow","^3.0.0"] | |
| 87584 verbose parsed url { protocol: null, | |
| 87584 verbose parsed url slashes: null, | |
| 87584 verbose parsed url auth: null, | |
| 87584 verbose parsed url host: null, | |
| 87584 verbose parsed url port: null, | |
| 87584 verbose parsed url hostname: null, | |
| 87584 verbose parsed url hash: null, | |
| 87584 verbose parsed url search: null, | |
| 87584 verbose parsed url query: null, | |
| 87584 verbose parsed url pathname: '^3.0.0', | |
| 87584 verbose parsed url path: '^3.0.0', | |
| 87584 verbose parsed url href: '^3.0.0' } | |
| 87585 verbose addNamed [ 'meow', '^3.0.0' ] | |
| 87586 verbose addNamed [ null, null ] | |
| 87587 silly lockFile c31da25e-meow-3-0-0 meow@^3.0.0 | |
| 87588 verbose lock meow@^3.0.0 C:\Users\Vince\AppData\Roaming\npm-cache\c31da25e-meow-3-0-0.lock | |
| 87589 verbose readDependencies using package.json deps | |
| 87590 silly gunzTarPerm extractEntry test/fixtures/map-file-comment-double-slash.css | |
| 87591 silly gunzTarPerm modified mode [ 'test/fixtures/map-file-comment-double-slash.css', 438, 420 ] | |
| 87592 silly gunzTarPerm extractEntry test/fixtures/map-file-comment-inline.css | |
| 87593 silly gunzTarPerm modified mode [ 'test/fixtures/map-file-comment-inline.css', 438, 420 ] | |
| 87594 verbose readDependencies using package.json deps | |
| 87595 verbose readDependencies using package.json deps | |
| 87596 silly addNameRange { name: 'is-finite', range: '*', hasData: false } | |
| 87597 silly addNameRange { name: 'meow', range: '*', hasData: false } | |
| 87598 verbose readDependencies using package.json deps | |
| 87599 silly resolved [] | |
| 87600 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\strip-json-comments | |
| 87601 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\strip-json-comments | |
| 87602 verbose linkStuff [ true, | |
| 87602 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 87602 verbose linkStuff false, | |
| 87602 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel-core\\node_modules' ] | |
| 87603 info linkStuff strip-json-comments@1.0.2 | |
| 87604 info preinstall output-file-sync@1.1.0 | |
| 87605 verbose readDependencies using package.json deps | |
| 87606 info preinstall is-integer@1.0.4 | |
| 87607 verbose linkBins strip-json-comments@1.0.2 | |
| 87608 verbose link bins [ { 'strip-json-comments': 'cli.js' }, | |
| 87608 verbose link bins 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel-core\\node_modules\\.bin', | |
| 87608 verbose link bins false ] | |
| 87609 verbose linkMans strip-json-comments@1.0.2 | |
| 87610 verbose rebuildBundles strip-json-comments@1.0.2 | |
| 87611 verbose cache add [ 'get-stdin@^4.0.1', null ] | |
| 87612 verbose cache add name=undefined spec="get-stdin@^4.0.1" args=["get-stdin@^4.0.1",null] | |
| 87613 verbose parsed url { protocol: null, | |
| 87613 verbose parsed url slashes: null, | |
| 87613 verbose parsed url auth: null, | |
| 87613 verbose parsed url host: null, | |
| 87613 verbose parsed url port: null, | |
| 87613 verbose parsed url hostname: null, | |
| 87613 verbose parsed url hash: null, | |
| 87613 verbose parsed url search: null, | |
| 87613 verbose parsed url query: null, | |
| 87613 verbose parsed url pathname: 'get-stdin@^4.0.1', | |
| 87613 verbose parsed url path: 'get-stdin@^4.0.1', | |
| 87613 verbose parsed url href: 'get-stdin@^4.0.1' } | |
| 87614 verbose cache add name="get-stdin" spec="^4.0.1" args=["get-stdin","^4.0.1"] | |
| 87615 verbose parsed url { protocol: null, | |
| 87615 verbose parsed url slashes: null, | |
| 87615 verbose parsed url auth: null, | |
| 87615 verbose parsed url host: null, | |
| 87615 verbose parsed url port: null, | |
| 87615 verbose parsed url hostname: null, | |
| 87615 verbose parsed url hash: null, | |
| 87615 verbose parsed url search: null, | |
| 87615 verbose parsed url query: null, | |
| 87615 verbose parsed url pathname: '^4.0.1', | |
| 87615 verbose parsed url path: '^4.0.1', | |
| 87615 verbose parsed url href: '^4.0.1' } | |
| 87616 verbose addNamed [ 'get-stdin', '^4.0.1' ] | |
| 87617 verbose addNamed [ null, null ] | |
| 87618 silly lockFile adfbe0a5-get-stdin-4-0-1 get-stdin@^4.0.1 | |
| 87619 verbose lock get-stdin@^4.0.1 C:\Users\Vince\AppData\Roaming\npm-cache\adfbe0a5-get-stdin-4-0-1.lock | |
| 87620 verbose cache add [ 'minimist@^1.1.0', null ] | |
| 87621 verbose cache add name=undefined spec="minimist@^1.1.0" args=["minimist@^1.1.0",null] | |
| 87622 verbose parsed url { protocol: null, | |
| 87622 verbose parsed url slashes: null, | |
| 87622 verbose parsed url auth: null, | |
| 87622 verbose parsed url host: null, | |
| 87622 verbose parsed url port: null, | |
| 87622 verbose parsed url hostname: null, | |
| 87622 verbose parsed url hash: null, | |
| 87622 verbose parsed url search: null, | |
| 87622 verbose parsed url query: null, | |
| 87622 verbose parsed url pathname: 'minimist@^1.1.0', | |
| 87622 verbose parsed url path: 'minimist@^1.1.0', | |
| 87622 verbose parsed url href: 'minimist@^1.1.0' } | |
| 87623 verbose cache add name="minimist" spec="^1.1.0" args=["minimist","^1.1.0"] | |
| 87624 verbose parsed url { protocol: null, | |
| 87624 verbose parsed url slashes: null, | |
| 87624 verbose parsed url auth: null, | |
| 87624 verbose parsed url host: null, | |
| 87624 verbose parsed url port: null, | |
| 87624 verbose parsed url hostname: null, | |
| 87624 verbose parsed url hash: null, | |
| 87624 verbose parsed url search: null, | |
| 87624 verbose parsed url query: null, | |
| 87624 verbose parsed url pathname: '^1.1.0', | |
| 87624 verbose parsed url path: '^1.1.0', | |
| 87624 verbose parsed url href: '^1.1.0' } | |
| 87625 verbose addNamed [ 'minimist', '^1.1.0' ] | |
| 87626 verbose addNamed [ null, null ] | |
| 87627 silly lockFile b7cda548-minimist-1-1-0 minimist@^1.1.0 | |
| 87628 verbose lock minimist@^1.1.0 C:\Users\Vince\AppData\Roaming\npm-cache\b7cda548-minimist-1-1-0.lock | |
| 87629 verbose cache add [ 'ansi-styles@^2.0.1', null ] | |
| 87630 verbose cache add name=undefined spec="ansi-styles@^2.0.1" args=["ansi-styles@^2.0.1",null] | |
| 87631 verbose parsed url { protocol: null, | |
| 87631 verbose parsed url slashes: null, | |
| 87631 verbose parsed url auth: null, | |
| 87631 verbose parsed url host: null, | |
| 87631 verbose parsed url port: null, | |
| 87631 verbose parsed url hostname: null, | |
| 87631 verbose parsed url hash: null, | |
| 87631 verbose parsed url search: null, | |
| 87631 verbose parsed url query: null, | |
| 87631 verbose parsed url pathname: 'ansi-styles@^2.0.1', | |
| 87631 verbose parsed url path: 'ansi-styles@^2.0.1', | |
| 87631 verbose parsed url href: 'ansi-styles@^2.0.1' } | |
| 87632 verbose cache add name="ansi-styles" spec="^2.0.1" args=["ansi-styles","^2.0.1"] | |
| 87633 verbose parsed url { protocol: null, | |
| 87633 verbose parsed url slashes: null, | |
| 87633 verbose parsed url auth: null, | |
| 87633 verbose parsed url host: null, | |
| 87633 verbose parsed url port: null, | |
| 87633 verbose parsed url hostname: null, | |
| 87633 verbose parsed url hash: null, | |
| 87633 verbose parsed url search: null, | |
| 87633 verbose parsed url query: null, | |
| 87633 verbose parsed url pathname: '^2.0.1', | |
| 87633 verbose parsed url path: '^2.0.1', | |
| 87633 verbose parsed url href: '^2.0.1' } | |
| 87634 verbose addNamed [ 'ansi-styles', '^2.0.1' ] | |
| 87635 verbose addNamed [ null, null ] | |
| 87636 silly lockFile 314d507b-ansi-styles-2-0-1 ansi-styles@^2.0.1 | |
| 87637 verbose lock ansi-styles@^2.0.1 C:\Users\Vince\AppData\Roaming\npm-cache\314d507b-ansi-styles-2-0-1.lock | |
| 87638 verbose cache add [ 'escape-string-regexp@^1.0.2', null ] | |
| 87639 verbose cache add name=undefined spec="escape-string-regexp@^1.0.2" args=["escape-string-regexp@^1.0.2",null] | |
| 87640 verbose parsed url { protocol: null, | |
| 87640 verbose parsed url slashes: null, | |
| 87640 verbose parsed url auth: null, | |
| 87640 verbose parsed url host: null, | |
| 87640 verbose parsed url port: null, | |
| 87640 verbose parsed url hostname: null, | |
| 87640 verbose parsed url hash: null, | |
| 87640 verbose parsed url search: null, | |
| 87640 verbose parsed url query: null, | |
| 87640 verbose parsed url pathname: 'escape-string-regexp@^1.0.2', | |
| 87640 verbose parsed url path: 'escape-string-regexp@^1.0.2', | |
| 87640 verbose parsed url href: 'escape-string-regexp@^1.0.2' } | |
| 87641 verbose cache add name="escape-string-regexp" spec="^1.0.2" args=["escape-string-regexp","^1.0.2"] | |
| 87642 verbose parsed url { protocol: null, | |
| 87642 verbose parsed url slashes: null, | |
| 87642 verbose parsed url auth: null, | |
| 87642 verbose parsed url host: null, | |
| 87642 verbose parsed url port: null, | |
| 87642 verbose parsed url hostname: null, | |
| 87642 verbose parsed url hash: null, | |
| 87642 verbose parsed url search: null, | |
| 87642 verbose parsed url query: null, | |
| 87642 verbose parsed url pathname: '^1.0.2', | |
| 87642 verbose parsed url path: '^1.0.2', | |
| 87642 verbose parsed url href: '^1.0.2' } | |
| 87643 verbose addNamed [ 'escape-string-regexp', '^1.0.2' ] | |
| 87644 verbose addNamed [ null, null ] | |
| 87645 silly lockFile bb748e44-escape-string-regexp-1-0-2 escape-string-regexp@^1.0.2 | |
| 87646 verbose lock escape-string-regexp@^1.0.2 C:\Users\Vince\AppData\Roaming\npm-cache\bb748e44-escape-string-regexp-1-0-2.lock | |
| 87647 verbose cache add [ 'has-ansi@^1.0.3', null ] | |
| 87648 verbose cache add name=undefined spec="has-ansi@^1.0.3" args=["has-ansi@^1.0.3",null] | |
| 87649 verbose parsed url { protocol: null, | |
| 87649 verbose parsed url slashes: null, | |
| 87649 verbose parsed url auth: null, | |
| 87649 verbose parsed url host: null, | |
| 87649 verbose parsed url port: null, | |
| 87649 verbose parsed url hostname: null, | |
| 87649 verbose parsed url hash: null, | |
| 87649 verbose parsed url search: null, | |
| 87649 verbose parsed url query: null, | |
| 87649 verbose parsed url pathname: 'has-ansi@^1.0.3', | |
| 87649 verbose parsed url path: 'has-ansi@^1.0.3', | |
| 87649 verbose parsed url href: 'has-ansi@^1.0.3' } | |
| 87650 verbose cache add name="has-ansi" spec="^1.0.3" args=["has-ansi","^1.0.3"] | |
| 87651 verbose parsed url { protocol: null, | |
| 87651 verbose parsed url slashes: null, | |
| 87651 verbose parsed url auth: null, | |
| 87651 verbose parsed url host: null, | |
| 87651 verbose parsed url port: null, | |
| 87651 verbose parsed url hostname: null, | |
| 87651 verbose parsed url hash: null, | |
| 87651 verbose parsed url search: null, | |
| 87651 verbose parsed url query: null, | |
| 87651 verbose parsed url pathname: '^1.0.3', | |
| 87651 verbose parsed url path: '^1.0.3', | |
| 87651 verbose parsed url href: '^1.0.3' } | |
| 87652 verbose addNamed [ 'has-ansi', '^1.0.3' ] | |
| 87653 verbose addNamed [ null, null ] | |
| 87654 silly lockFile edbc7473-has-ansi-1-0-3 has-ansi@^1.0.3 | |
| 87655 verbose lock has-ansi@^1.0.3 C:\Users\Vince\AppData\Roaming\npm-cache\edbc7473-has-ansi-1-0-3.lock | |
| 87656 verbose cache add [ 'strip-ansi@^2.0.1', null ] | |
| 87657 verbose cache add name=undefined spec="strip-ansi@^2.0.1" args=["strip-ansi@^2.0.1",null] | |
| 87658 verbose parsed url { protocol: null, | |
| 87658 verbose parsed url slashes: null, | |
| 87658 verbose parsed url auth: null, | |
| 87658 verbose parsed url host: null, | |
| 87658 verbose parsed url port: null, | |
| 87658 verbose parsed url hostname: null, | |
| 87658 verbose parsed url hash: null, | |
| 87658 verbose parsed url search: null, | |
| 87658 verbose parsed url query: null, | |
| 87658 verbose parsed url pathname: 'strip-ansi@^2.0.1', | |
| 87658 verbose parsed url path: 'strip-ansi@^2.0.1', | |
| 87658 verbose parsed url href: 'strip-ansi@^2.0.1' } | |
| 87659 verbose cache add name="strip-ansi" spec="^2.0.1" args=["strip-ansi","^2.0.1"] | |
| 87660 verbose parsed url { protocol: null, | |
| 87660 verbose parsed url slashes: null, | |
| 87660 verbose parsed url auth: null, | |
| 87660 verbose parsed url host: null, | |
| 87660 verbose parsed url port: null, | |
| 87660 verbose parsed url hostname: null, | |
| 87660 verbose parsed url hash: null, | |
| 87660 verbose parsed url search: null, | |
| 87660 verbose parsed url query: null, | |
| 87660 verbose parsed url pathname: '^2.0.1', | |
| 87660 verbose parsed url path: '^2.0.1', | |
| 87660 verbose parsed url href: '^2.0.1' } | |
| 87661 verbose addNamed [ 'strip-ansi', '^2.0.1' ] | |
| 87662 verbose addNamed [ null, null ] | |
| 87663 silly lockFile 8c6b9172-strip-ansi-2-0-1 strip-ansi@^2.0.1 | |
| 87664 verbose lock strip-ansi@^2.0.1 C:\Users\Vince\AppData\Roaming\npm-cache\8c6b9172-strip-ansi-2-0-1.lock | |
| 87665 verbose cache add [ 'supports-color@^1.3.0', null ] | |
| 87666 verbose cache add name=undefined spec="supports-color@^1.3.0" args=["supports-color@^1.3.0",null] | |
| 87667 verbose parsed url { protocol: null, | |
| 87667 verbose parsed url slashes: null, | |
| 87667 verbose parsed url auth: null, | |
| 87667 verbose parsed url host: null, | |
| 87667 verbose parsed url port: null, | |
| 87667 verbose parsed url hostname: null, | |
| 87667 verbose parsed url hash: null, | |
| 87667 verbose parsed url search: null, | |
| 87667 verbose parsed url query: null, | |
| 87667 verbose parsed url pathname: 'supports-color@^1.3.0', | |
| 87667 verbose parsed url path: 'supports-color@^1.3.0', | |
| 87667 verbose parsed url href: 'supports-color@^1.3.0' } | |
| 87668 verbose cache add name="supports-color" spec="^1.3.0" args=["supports-color","^1.3.0"] | |
| 87669 verbose parsed url { protocol: null, | |
| 87669 verbose parsed url slashes: null, | |
| 87669 verbose parsed url auth: null, | |
| 87669 verbose parsed url host: null, | |
| 87669 verbose parsed url port: null, | |
| 87669 verbose parsed url hostname: null, | |
| 87669 verbose parsed url hash: null, | |
| 87669 verbose parsed url search: null, | |
| 87669 verbose parsed url query: null, | |
| 87669 verbose parsed url pathname: '^1.3.0', | |
| 87669 verbose parsed url path: '^1.3.0', | |
| 87669 verbose parsed url href: '^1.3.0' } | |
| 87670 verbose addNamed [ 'supports-color', '^1.3.0' ] | |
| 87671 verbose addNamed [ null, null ] | |
| 87672 silly lockFile e601069b-supports-color-1-3-0 supports-color@^1.3.0 | |
| 87673 verbose lock supports-color@^1.3.0 C:\Users\Vince\AppData\Roaming\npm-cache\e601069b-supports-color-1-3-0.lock | |
| 87674 silly addNameRange { name: 'get-stdin', range: '*', hasData: false } | |
| 87675 silly addNameRange { name: 'minimist', range: '*', hasData: false } | |
| 87676 silly addNameRange { name: 'ansi-styles', range: '*', hasData: false } | |
| 87677 silly addNameRange { name: 'escape-string-regexp', range: '*', hasData: false } | |
| 87678 silly addNameRange { name: 'has-ansi', range: '*', hasData: false } | |
| 87679 silly addNameRange { name: 'strip-ansi', range: '*', hasData: false } | |
| 87680 verbose readDependencies using package.json deps | |
| 87681 silly addNameRange { name: 'supports-color', range: '*', hasData: false } | |
| 87682 verbose readDependencies using package.json deps | |
| 87683 verbose url raw is-finite | |
| 87684 verbose url resolving [ 'https://registry.npmjs.org/', './is-finite' ] | |
| 87685 verbose url resolved https://registry.npmjs.org/is-finite | |
| 87686 info trying registry request attempt 1 at 14:11:41 | |
| 87687 verbose etag "1M8MD177RWA7RD4TZHKQOF6IL" | |
| 87688 http GET https://registry.npmjs.org/is-finite | |
| 87689 verbose url raw meow | |
| 87690 verbose url resolving [ 'https://registry.npmjs.org/', './meow' ] | |
| 87691 verbose url resolved https://registry.npmjs.org/meow | |
| 87692 info trying registry request attempt 1 at 14:11:41 | |
| 87693 verbose etag "10ZQ2FVJ47D5M5WB1X4SAWQ04" | |
| 87694 http GET https://registry.npmjs.org/meow | |
| 87695 verbose readDependencies using package.json deps | |
| 87696 silly gunzTarPerm extractEntry Readme.md | |
| 87697 silly gunzTarPerm modified mode [ 'Readme.md', 438, 420 ] | |
| 87698 verbose readDependencies using package.json deps | |
| 87699 verbose cache add [ 'xtend@^4.0.0', null ] | |
| 87700 verbose cache add name=undefined spec="xtend@^4.0.0" args=["xtend@^4.0.0",null] | |
| 87701 verbose parsed url { protocol: null, | |
| 87701 verbose parsed url slashes: null, | |
| 87701 verbose parsed url auth: null, | |
| 87701 verbose parsed url host: null, | |
| 87701 verbose parsed url port: null, | |
| 87701 verbose parsed url hostname: null, | |
| 87701 verbose parsed url hash: null, | |
| 87701 verbose parsed url search: null, | |
| 87701 verbose parsed url query: null, | |
| 87701 verbose parsed url pathname: 'xtend@^4.0.0', | |
| 87701 verbose parsed url path: 'xtend@^4.0.0', | |
| 87701 verbose parsed url href: 'xtend@^4.0.0' } | |
| 87702 verbose cache add name="xtend" spec="^4.0.0" args=["xtend","^4.0.0"] | |
| 87703 verbose parsed url { protocol: null, | |
| 87703 verbose parsed url slashes: null, | |
| 87703 verbose parsed url auth: null, | |
| 87703 verbose parsed url host: null, | |
| 87703 verbose parsed url port: null, | |
| 87703 verbose parsed url hostname: null, | |
| 87703 verbose parsed url hash: null, | |
| 87703 verbose parsed url search: null, | |
| 87703 verbose parsed url query: null, | |
| 87703 verbose parsed url pathname: '^4.0.0', | |
| 87703 verbose parsed url path: '^4.0.0', | |
| 87703 verbose parsed url href: '^4.0.0' } | |
| 87704 verbose addNamed [ 'xtend', '^4.0.0' ] | |
| 87705 verbose addNamed [ null, null ] | |
| 87706 silly lockFile 409d9c3a-xtend-4-0-0 xtend@^4.0.0 | |
| 87707 verbose lock xtend@^4.0.0 C:\Users\Vince\AppData\Roaming\npm-cache\409d9c3a-xtend-4-0-0.lock | |
| 87708 silly gunzTarPerm extractEntry test/fixtures/map-file-comment.css | |
| 87709 silly gunzTarPerm modified mode [ 'test/fixtures/map-file-comment.css', 438, 420 ] | |
| 87710 silly gunzTarPerm extractEntry test/fixtures/map-file-comment.css.map | |
| 87711 silly gunzTarPerm modified mode [ 'test/fixtures/map-file-comment.css.map', 438, 420 ] | |
| 87712 silly addNameRange { name: 'xtend', range: '*', hasData: false } | |
| 87713 verbose url raw get-stdin | |
| 87714 verbose url resolving [ 'https://registry.npmjs.org/', './get-stdin' ] | |
| 87715 verbose url resolved https://registry.npmjs.org/get-stdin | |
| 87716 info trying registry request attempt 1 at 14:11:41 | |
| 87717 verbose etag "2BIMV9BIWVCQ8JGJ14KAEP3I0" | |
| 87718 http GET https://registry.npmjs.org/get-stdin | |
| 87719 verbose url raw minimist | |
| 87720 verbose url resolving [ 'https://registry.npmjs.org/', './minimist' ] | |
| 87721 verbose url resolved https://registry.npmjs.org/minimist | |
| 87722 info trying registry request attempt 1 at 14:11:41 | |
| 87723 verbose etag "CEX0FSU5O43OUXA3I1GZKJI10" | |
| 87724 http GET https://registry.npmjs.org/minimist | |
| 87725 verbose url raw ansi-styles | |
| 87726 verbose url resolving [ 'https://registry.npmjs.org/', './ansi-styles' ] | |
| 87727 verbose url resolved https://registry.npmjs.org/ansi-styles | |
| 87728 info trying registry request attempt 1 at 14:11:41 | |
| 87729 verbose etag "9O45NVZEP528XJ58TZ8A6DMA0" | |
| 87730 http GET https://registry.npmjs.org/ansi-styles | |
| 87731 verbose url raw escape-string-regexp | |
| 87732 verbose url resolving [ 'https://registry.npmjs.org/', './escape-string-regexp' ] | |
| 87733 verbose url resolved https://registry.npmjs.org/escape-string-regexp | |
| 87734 info trying registry request attempt 1 at 14:11:41 | |
| 87735 verbose etag "2W5TL8OY840WK6PWOBDI6WE1T" | |
| 87736 http GET https://registry.npmjs.org/escape-string-regexp | |
| 87737 verbose url raw strip-ansi | |
| 87738 verbose url resolving [ 'https://registry.npmjs.org/', './strip-ansi' ] | |
| 87739 verbose url resolved https://registry.npmjs.org/strip-ansi | |
| 87740 info trying registry request attempt 1 at 14:11:41 | |
| 87741 verbose etag "9D9S1Y0BBQD36UMUV9U38ZKG1" | |
| 87742 http GET https://registry.npmjs.org/strip-ansi | |
| 87743 verbose url raw has-ansi | |
| 87744 verbose url resolving [ 'https://registry.npmjs.org/', './has-ansi' ] | |
| 87745 verbose url resolved https://registry.npmjs.org/has-ansi | |
| 87746 info trying registry request attempt 1 at 14:11:41 | |
| 87747 verbose etag "E4845616HRC12WMH43M936NTT" | |
| 87748 http GET https://registry.npmjs.org/has-ansi | |
| 87749 verbose url raw supports-color | |
| 87750 verbose url resolving [ 'https://registry.npmjs.org/', './supports-color' ] | |
| 87751 verbose url resolved https://registry.npmjs.org/supports-color | |
| 87752 info trying registry request attempt 1 at 14:11:41 | |
| 87753 verbose etag "4SHNAEHD19S3VGADXSKO905S7" | |
| 87754 http GET https://registry.npmjs.org/supports-color | |
| 87755 silly gunzTarPerm extractEntry def/es6.js | |
| 87756 silly gunzTarPerm modified mode [ 'def/es6.js', 438, 420 ] | |
| 87757 silly gunzTarPerm extractEntry def/es7.js | |
| 87758 silly gunzTarPerm modified mode [ 'def/es7.js', 438, 420 ] | |
| 87759 verbose cache add [ 'is-finite@^1.0.0', null ] | |
| 87760 verbose cache add name=undefined spec="is-finite@^1.0.0" args=["is-finite@^1.0.0",null] | |
| 87761 verbose parsed url { protocol: null, | |
| 87761 verbose parsed url slashes: null, | |
| 87761 verbose parsed url auth: null, | |
| 87761 verbose parsed url host: null, | |
| 87761 verbose parsed url port: null, | |
| 87761 verbose parsed url hostname: null, | |
| 87761 verbose parsed url hash: null, | |
| 87761 verbose parsed url search: null, | |
| 87761 verbose parsed url query: null, | |
| 87761 verbose parsed url pathname: 'is-finite@^1.0.0', | |
| 87761 verbose parsed url path: 'is-finite@^1.0.0', | |
| 87761 verbose parsed url href: 'is-finite@^1.0.0' } | |
| 87762 verbose cache add name="is-finite" spec="^1.0.0" args=["is-finite","^1.0.0"] | |
| 87763 verbose parsed url { protocol: null, | |
| 87763 verbose parsed url slashes: null, | |
| 87763 verbose parsed url auth: null, | |
| 87763 verbose parsed url host: null, | |
| 87763 verbose parsed url port: null, | |
| 87763 verbose parsed url hostname: null, | |
| 87763 verbose parsed url hash: null, | |
| 87763 verbose parsed url search: null, | |
| 87763 verbose parsed url query: null, | |
| 87763 verbose parsed url pathname: '^1.0.0', | |
| 87763 verbose parsed url path: '^1.0.0', | |
| 87763 verbose parsed url href: '^1.0.0' } | |
| 87764 verbose addNamed [ 'is-finite', '^1.0.0' ] | |
| 87765 verbose cache add [ 'is-nan@^1.0.1', null ] | |
| 87766 verbose cache add name=undefined spec="is-nan@^1.0.1" args=["is-nan@^1.0.1",null] | |
| 87767 verbose parsed url { protocol: null, | |
| 87767 verbose parsed url slashes: null, | |
| 87767 verbose parsed url auth: null, | |
| 87767 verbose parsed url host: null, | |
| 87767 verbose parsed url port: null, | |
| 87767 verbose parsed url hostname: null, | |
| 87767 verbose parsed url hash: null, | |
| 87767 verbose parsed url search: null, | |
| 87767 verbose parsed url query: null, | |
| 87767 verbose parsed url pathname: 'is-nan@^1.0.1', | |
| 87767 verbose parsed url path: 'is-nan@^1.0.1', | |
| 87767 verbose parsed url href: 'is-nan@^1.0.1' } | |
| 87768 verbose cache add name="is-nan" spec="^1.0.1" args=["is-nan","^1.0.1"] | |
| 87769 verbose parsed url { protocol: null, | |
| 87769 verbose parsed url slashes: null, | |
| 87769 verbose parsed url auth: null, | |
| 87769 verbose parsed url host: null, | |
| 87769 verbose parsed url port: null, | |
| 87769 verbose parsed url hostname: null, | |
| 87769 verbose parsed url hash: null, | |
| 87769 verbose parsed url search: null, | |
| 87769 verbose parsed url query: null, | |
| 87769 verbose parsed url pathname: '^1.0.1', | |
| 87769 verbose parsed url path: '^1.0.1', | |
| 87769 verbose parsed url href: '^1.0.1' } | |
| 87770 verbose addNamed [ 'is-nan', '^1.0.1' ] | |
| 87771 verbose addNamed [ null, null ] | |
| 87772 silly lockFile 2902ab9b-is-nan-1-0-1 is-nan@^1.0.1 | |
| 87773 verbose lock is-nan@^1.0.1 C:\Users\Vince\AppData\Roaming\npm-cache\2902ab9b-is-nan-1-0-1.lock | |
| 87774 silly gunzTarPerm extractEntry lib/source-map/base64-vlq.js | |
| 87775 silly gunzTarPerm modified mode [ 'lib/source-map/base64-vlq.js', 438, 420 ] | |
| 87776 silly gunzTarPerm extractEntry lib/source-map/base64.js | |
| 87777 silly gunzTarPerm modified mode [ 'lib/source-map/base64.js', 438, 420 ] | |
| 87778 silly addNameRange { name: 'is-nan', range: '*', hasData: false } | |
| 87779 info install leven@1.0.1 | |
| 87780 info postinstall leven@1.0.1 | |
| 87781 info install user-home@1.1.1 | |
| 87782 verbose url raw xtend | |
| 87783 verbose url resolving [ 'https://registry.npmjs.org/', './xtend' ] | |
| 87784 verbose url resolved https://registry.npmjs.org/xtend | |
| 87785 info trying registry request attempt 1 at 14:11:41 | |
| 87786 verbose etag "1IRSKRUZQ2WOW7CNER4BR27DS" | |
| 87787 http GET https://registry.npmjs.org/xtend | |
| 87788 silly lockFile 0788e1ff--babel-core-node-modules-globals tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\globals | |
| 87789 silly lockFile 0788e1ff--babel-core-node-modules-globals tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\globals | |
| 87790 info postinstall user-home@1.1.1 | |
| 87791 verbose url raw is-nan | |
| 87792 verbose url resolving [ 'https://registry.npmjs.org/', './is-nan' ] | |
| 87793 verbose url resolved https://registry.npmjs.org/is-nan | |
| 87794 info trying registry request attempt 1 at 14:11:41 | |
| 87795 verbose etag "7L9I9AR1O8NA6LKQ5Q9LWFYCX" | |
| 87796 http GET https://registry.npmjs.org/is-nan | |
| 87797 silly lockFile e7244268--cache-globals-6-4-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\globals\6.4.1\package.tgz | |
| 87798 silly lockFile e7244268--cache-globals-6-4-1-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\globals\6.4.1\package.tgz | |
| 87799 info install strip-json-comments@1.0.2 | |
| 87800 info postinstall strip-json-comments@1.0.2 | |
| 87801 silly gunzTarPerm extractEntry def/fb-harmony.js | |
| 87802 silly gunzTarPerm modified mode [ 'def/fb-harmony.js', 438, 420 ] | |
| 87803 silly gunzTarPerm extractEntry def/mozilla.js | |
| 87804 silly gunzTarPerm modified mode [ 'def/mozilla.js', 438, 420 ] | |
| 87805 silly lockFile b1b99528-l-core-node-modules-line-numbers tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\line-numbers | |
| 87806 silly lockFile b1b99528-l-core-node-modules-line-numbers tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\line-numbers | |
| 87807 info preinstall globals@6.4.1 | |
| 87808 silly gunzTarPerm extractEntry lib/source-map/binary-search.js | |
| 87809 silly gunzTarPerm modified mode [ 'lib/source-map/binary-search.js', 438, 420 ] | |
| 87810 silly gunzTarPerm extractEntry lib/source-map/mapping-list.js | |
| 87811 silly gunzTarPerm modified mode [ 'lib/source-map/mapping-list.js', 438, 420 ] | |
| 87812 silly lockFile 192dce3c--babel-core-node-modules-private tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\private | |
| 87813 silly lockFile 192dce3c--babel-core-node-modules-private tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\private | |
| 87814 silly lockFile 93892149-e-line-numbers-0-2-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\line-numbers\0.2.0\package.tgz | |
| 87815 silly lockFile 93892149-e-line-numbers-0-2-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\line-numbers\0.2.0\package.tgz | |
| 87816 verbose readDependencies using package.json deps | |
| 87817 silly lockFile ecd3127e--cache-private-0-1-6-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\private\0.1.6\package.tgz | |
| 87818 silly lockFile ecd3127e--cache-private-0-1-6-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\private\0.1.6\package.tgz | |
| 87819 verbose readDependencies using package.json deps | |
| 87820 silly resolved [] | |
| 87821 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\globals | |
| 87822 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\globals | |
| 87823 verbose linkStuff [ true, | |
| 87823 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 87823 verbose linkStuff false, | |
| 87823 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel-core\\node_modules' ] | |
| 87824 info linkStuff globals@6.4.1 | |
| 87825 silly gunzTarPerm extractEntry lib/equiv.js | |
| 87826 silly gunzTarPerm modified mode [ 'lib/equiv.js', 438, 420 ] | |
| 87827 silly gunzTarPerm extractEntry lib/node-path.js | |
| 87828 silly gunzTarPerm modified mode [ 'lib/node-path.js', 438, 420 ] | |
| 87829 verbose linkBins globals@6.4.1 | |
| 87830 verbose linkMans globals@6.4.1 | |
| 87831 verbose rebuildBundles globals@6.4.1 | |
| 87832 info install globals@6.4.1 | |
| 87833 info postinstall globals@6.4.1 | |
| 87834 info preinstall line-numbers@0.2.0 | |
| 87835 silly gunzTarPerm extractEntry lib/source-map/source-map-consumer.js | |
| 87836 silly gunzTarPerm modified mode [ 'lib/source-map/source-map-consumer.js', 438, 420 ] | |
| 87837 silly gunzTarPerm extractEntry lib/source-map/source-map-generator.js | |
| 87838 silly gunzTarPerm modified mode [ 'lib/source-map/source-map-generator.js', 438, 420 ] | |
| 87839 info preinstall private@0.1.6 | |
| 87840 http 304 https://registry.npmjs.org/is-finite | |
| 87841 silly registry.get cb [ 304, | |
| 87841 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 87841 silly registry.get etag: '"1M8MD177RWA7RD4TZHKQOF6IL"', | |
| 87841 silly registry.get 'cache-control': 'max-age=60', | |
| 87841 silly registry.get 'accept-ranges': 'bytes', | |
| 87841 silly registry.get date: 'Mon, 20 Apr 2015 19:12:08 GMT', | |
| 87841 silly registry.get via: '1.1 varnish', | |
| 87841 silly registry.get connection: 'keep-alive', | |
| 87841 silly registry.get 'x-served-by': 'cache-ord1726-ORD', | |
| 87841 silly registry.get 'x-cache': 'MISS', | |
| 87841 silly registry.get 'x-cache-hits': '0', | |
| 87841 silly registry.get 'x-timer': 'S1429557128.023618,VS0,VE38' } ] | |
| 87842 verbose etag is-finite from cache | |
| 87843 http 304 https://registry.npmjs.org/meow | |
| 87844 silly registry.get cb [ 304, | |
| 87844 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 87844 silly registry.get etag: '"10ZQ2FVJ47D5M5WB1X4SAWQ04"', | |
| 87844 silly registry.get 'cache-control': 'max-age=60', | |
| 87844 silly registry.get 'accept-ranges': 'bytes', | |
| 87844 silly registry.get date: 'Mon, 20 Apr 2015 19:12:08 GMT', | |
| 87844 silly registry.get via: '1.1 varnish', | |
| 87844 silly registry.get connection: 'keep-alive', | |
| 87844 silly registry.get 'x-served-by': 'cache-ord1726-ORD', | |
| 87844 silly registry.get 'x-cache': 'MISS', | |
| 87844 silly registry.get 'x-cache-hits': '0', | |
| 87844 silly registry.get 'x-timer': 'S1429557128.028065,VS0,VE65' } ] | |
| 87845 verbose etag meow from cache | |
| 87846 http 304 https://registry.npmjs.org/minimist | |
| 87847 silly registry.get cb [ 304, | |
| 87847 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 87847 silly registry.get etag: '"CEX0FSU5O43OUXA3I1GZKJI10"', | |
| 87847 silly registry.get 'cache-control': 'max-age=60', | |
| 87847 silly registry.get 'accept-ranges': 'bytes', | |
| 87847 silly registry.get date: 'Mon, 20 Apr 2015 19:12:08 GMT', | |
| 87847 silly registry.get via: '1.1 varnish', | |
| 87847 silly registry.get connection: 'keep-alive', | |
| 87847 silly registry.get 'x-served-by': 'cache-ord1728-ORD', | |
| 87847 silly registry.get 'x-cache': 'MISS', | |
| 87847 silly registry.get 'x-cache-hits': '0', | |
| 87847 silly registry.get 'x-timer': 'S1429557128.064445,VS0,VE39' } ] | |
| 87848 verbose etag minimist from cache | |
| 87849 http 304 https://registry.npmjs.org/get-stdin | |
| 87850 silly registry.get cb [ 304, | |
| 87850 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 87850 silly registry.get etag: '"2BIMV9BIWVCQ8JGJ14KAEP3I0"', | |
| 87850 silly registry.get 'cache-control': 'max-age=60', | |
| 87850 silly registry.get 'accept-ranges': 'bytes', | |
| 87850 silly registry.get date: 'Mon, 20 Apr 2015 19:12:08 GMT', | |
| 87850 silly registry.get via: '1.1 varnish', | |
| 87850 silly registry.get connection: 'keep-alive', | |
| 87850 silly registry.get 'x-served-by': 'cache-ord1731-ORD', | |
| 87850 silly registry.get 'x-cache': 'MISS', | |
| 87850 silly registry.get 'x-cache-hits': '0', | |
| 87850 silly registry.get 'x-timer': 'S1429557128.059082,VS0,VE67' } ] | |
| 87851 verbose etag get-stdin from cache | |
| 87852 verbose readDependencies using package.json deps | |
| 87853 verbose readDependencies using package.json deps | |
| 87854 verbose readDependencies using package.json deps | |
| 87855 verbose readDependencies using package.json deps | |
| 87856 silly resolved [] | |
| 87857 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\private | |
| 87858 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\private | |
| 87859 verbose linkStuff [ true, | |
| 87859 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 87859 verbose linkStuff false, | |
| 87859 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel-core\\node_modules' ] | |
| 87860 info linkStuff private@0.1.6 | |
| 87861 verbose cache add [ 'left-pad@0.0.3', null ] | |
| 87862 verbose cache add name=undefined spec="left-pad@0.0.3" args=["left-pad@0.0.3",null] | |
| 87863 verbose parsed url { protocol: null, | |
| 87863 verbose parsed url slashes: null, | |
| 87863 verbose parsed url auth: null, | |
| 87863 verbose parsed url host: null, | |
| 87863 verbose parsed url port: null, | |
| 87863 verbose parsed url hostname: null, | |
| 87863 verbose parsed url hash: null, | |
| 87863 verbose parsed url search: null, | |
| 87863 verbose parsed url query: null, | |
| 87863 verbose parsed url pathname: 'left-pad@0.0.3', | |
| 87863 verbose parsed url path: 'left-pad@0.0.3', | |
| 87863 verbose parsed url href: 'left-pad@0.0.3' } | |
| 87864 verbose cache add name="left-pad" spec="0.0.3" args=["left-pad","0.0.3"] | |
| 87865 verbose parsed url { protocol: null, | |
| 87865 verbose parsed url slashes: null, | |
| 87865 verbose parsed url auth: null, | |
| 87865 verbose parsed url host: null, | |
| 87865 verbose parsed url port: null, | |
| 87865 verbose parsed url hostname: null, | |
| 87865 verbose parsed url hash: null, | |
| 87865 verbose parsed url search: null, | |
| 87865 verbose parsed url query: null, | |
| 87865 verbose parsed url pathname: '0.0.3', | |
| 87865 verbose parsed url path: '0.0.3', | |
| 87865 verbose parsed url href: '0.0.3' } | |
| 87866 verbose addNamed [ 'left-pad', '0.0.3' ] | |
| 87867 verbose addNamed [ '0.0.3', '0.0.3' ] | |
| 87868 silly lockFile 5e3ea73f-left-pad-0-0-3 left-pad@0.0.3 | |
| 87869 verbose lock left-pad@0.0.3 C:\Users\Vince\AppData\Roaming\npm-cache\5e3ea73f-left-pad-0-0-3.lock | |
| 87870 verbose linkBins private@0.1.6 | |
| 87871 verbose linkMans private@0.1.6 | |
| 87872 verbose rebuildBundles private@0.1.6 | |
| 87873 info install private@0.1.6 | |
| 87874 silly addNameRange number 2 { name: 'is-finite', range: '*', hasData: true } | |
| 87875 silly addNameRange versions [ 'is-finite', [ '1.0.0' ] ] | |
| 87876 verbose addNamed [ 'is-finite', '1.0.0' ] | |
| 87877 verbose addNamed [ '1.0.0', '1.0.0' ] | |
| 87878 silly lockFile 8dcf5e49-is-finite-1-0-0 is-finite@1.0.0 | |
| 87879 verbose lock is-finite@1.0.0 C:\Users\Vince\AppData\Roaming\npm-cache\8dcf5e49-is-finite-1-0-0.lock | |
| 87880 info postinstall private@0.1.6 | |
| 87881 silly addNameRange number 2 { name: 'meow', range: '*', hasData: true } | |
| 87882 silly addNameRange versions [ 'meow', [ '1.0.0', '2.0.0', '2.1.0', '3.0.0', '3.1.0' ] ] | |
| 87883 verbose addNamed [ 'meow', '3.1.0' ] | |
| 87884 verbose addNamed [ '3.1.0', '3.1.0' ] | |
| 87885 silly lockFile 14072dab-meow-3-1-0 meow@3.1.0 | |
| 87886 verbose lock meow@3.1.0 C:\Users\Vince\AppData\Roaming\npm-cache\14072dab-meow-3-1-0.lock | |
| 87887 silly addNameRange number 2 { name: 'minimist', range: '*', hasData: true } | |
| 87888 silly addNameRange versions [ 'minimist', | |
| 87888 silly addNameRange [ '0.0.0', | |
| 87888 silly addNameRange '0.0.1', | |
| 87888 silly addNameRange '0.0.2', | |
| 87888 silly addNameRange '0.0.3', | |
| 87888 silly addNameRange '0.0.4', | |
| 87888 silly addNameRange '0.0.5', | |
| 87888 silly addNameRange '0.0.6', | |
| 87888 silly addNameRange '0.0.7', | |
| 87888 silly addNameRange '0.0.8', | |
| 87888 silly addNameRange '0.0.9', | |
| 87888 silly addNameRange '0.0.10', | |
| 87888 silly addNameRange '0.1.0', | |
| 87888 silly addNameRange '0.2.0', | |
| 87888 silly addNameRange '1.0.0', | |
| 87888 silly addNameRange '1.1.0', | |
| 87888 silly addNameRange '1.1.1' ] ] | |
| 87889 verbose addNamed [ 'minimist', '1.1.1' ] | |
| 87890 verbose addNamed [ '1.1.1', '1.1.1' ] | |
| 87891 silly lockFile 79a6a221-minimist-1-1-1 minimist@1.1.1 | |
| 87892 verbose lock minimist@1.1.1 C:\Users\Vince\AppData\Roaming\npm-cache\79a6a221-minimist-1-1-1.lock | |
| 87893 silly gunzTarPerm extractEntry lib/source-map/source-node.js | |
| 87894 silly gunzTarPerm modified mode [ 'lib/source-map/source-node.js', 438, 420 ] | |
| 87895 silly gunzTarPerm extractEntry lib/source-map/util.js | |
| 87896 silly gunzTarPerm modified mode [ 'lib/source-map/util.js', 438, 420 ] | |
| 87897 silly addNameRange number 2 { name: 'get-stdin', range: '*', hasData: true } | |
| 87898 silly addNameRange versions [ 'get-stdin', | |
| 87898 silly addNameRange [ '0.1.0', | |
| 87898 silly addNameRange '1.0.0', | |
| 87898 silly addNameRange '2.0.0', | |
| 87898 silly addNameRange '3.0.0', | |
| 87898 silly addNameRange '3.0.1', | |
| 87898 silly addNameRange '3.0.2', | |
| 87898 silly addNameRange '4.0.0', | |
| 87898 silly addNameRange '4.0.1' ] ] | |
| 87899 verbose addNamed [ 'get-stdin', '4.0.1' ] | |
| 87900 verbose addNamed [ '4.0.1', '4.0.1' ] | |
| 87901 silly lockFile e5f31dd4-get-stdin-4-0-1 get-stdin@4.0.1 | |
| 87902 verbose lock get-stdin@4.0.1 C:\Users\Vince\AppData\Roaming\npm-cache\e5f31dd4-get-stdin-4-0-1.lock | |
| 87903 silly lockFile 8dcf5e49-is-finite-1-0-0 is-finite@1.0.0 | |
| 87904 silly lockFile 8dcf5e49-is-finite-1-0-0 is-finite@1.0.0 | |
| 87905 verbose url raw left-pad/0.0.3 | |
| 87906 verbose url resolving [ 'https://registry.npmjs.org/', './left-pad/0.0.3' ] | |
| 87907 verbose url resolved https://registry.npmjs.org/left-pad/0.0.3 | |
| 87908 info trying registry request attempt 1 at 14:11:41 | |
| 87909 verbose etag "6X5FVP67Z2JQV36I0NQ57JVOR" | |
| 87910 http GET https://registry.npmjs.org/left-pad/0.0.3 | |
| 87911 silly lockFile e5f31dd4-get-stdin-4-0-1 get-stdin@4.0.1 | |
| 87912 silly lockFile e5f31dd4-get-stdin-4-0-1 get-stdin@4.0.1 | |
| 87913 http 304 https://registry.npmjs.org/escape-string-regexp | |
| 87914 silly registry.get cb [ 304, | |
| 87914 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 87914 silly registry.get etag: '"2W5TL8OY840WK6PWOBDI6WE1T"', | |
| 87914 silly registry.get 'cache-control': 'max-age=60', | |
| 87914 silly registry.get 'accept-ranges': 'bytes', | |
| 87914 silly registry.get date: 'Mon, 20 Apr 2015 19:12:08 GMT', | |
| 87914 silly registry.get via: '1.1 varnish', | |
| 87914 silly registry.get connection: 'keep-alive', | |
| 87914 silly registry.get 'x-served-by': 'cache-ord1726-ORD', | |
| 87914 silly registry.get 'x-cache': 'MISS', | |
| 87914 silly registry.get 'x-cache-hits': '0', | |
| 87914 silly registry.get 'x-timer': 'S1429557128.146822,VS0,VE66' } ] | |
| 87915 verbose etag escape-string-regexp from cache | |
| 87916 silly lockFile 158d7f9e-is-finite-1-0-0 is-finite@^1.0.0 | |
| 87917 silly lockFile 158d7f9e-is-finite-1-0-0 is-finite@^1.0.0 | |
| 87918 silly lockFile 689d5e4f-ry-npmjs-org-meow-meow-3-1-0-tgz https://registry.npmjs.org/meow/-/meow-3.1.0.tgz | |
| 87919 verbose lock https://registry.npmjs.org/meow/-/meow-3.1.0.tgz C:\Users\Vince\AppData\Roaming\npm-cache\689d5e4f-ry-npmjs-org-meow-meow-3-1-0-tgz.lock | |
| 87920 silly lockFile 644ffb24--org-minimist-minimist-1-1-1-tgz https://registry.npmjs.org/minimist/-/minimist-1.1.1.tgz | |
| 87921 verbose lock https://registry.npmjs.org/minimist/-/minimist-1.1.1.tgz C:\Users\Vince\AppData\Roaming\npm-cache\644ffb24--org-minimist-minimist-1-1-1-tgz.lock | |
| 87922 silly lockFile adfbe0a5-get-stdin-4-0-1 get-stdin@^4.0.1 | |
| 87923 silly lockFile adfbe0a5-get-stdin-4-0-1 get-stdin@^4.0.1 | |
| 87924 verbose addRemoteTarball [ 'https://registry.npmjs.org/meow/-/meow-3.1.0.tgz', | |
| 87924 verbose addRemoteTarball '5974708a0fe0dcbf27e0e6a49120b4c5e82c3cea' ] | |
| 87925 info retry fetch attempt 1 at 14:11:41 | |
| 87926 verbose fetch to= C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557101896-0.26857838965952396\tmp.tgz | |
| 87927 verbose addRemoteTarball [ 'https://registry.npmjs.org/minimist/-/minimist-1.1.1.tgz', | |
| 87927 verbose addRemoteTarball '1bc2bc71658cdca5712475684363615b0b4f695b' ] | |
| 87928 http GET https://registry.npmjs.org/meow/-/meow-3.1.0.tgz | |
| 87929 info retry fetch attempt 1 at 14:11:41 | |
| 87930 verbose fetch to= C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557101896-0.09437729534693062\tmp.tgz | |
| 87931 http 304 https://registry.npmjs.org/has-ansi | |
| 87932 silly registry.get cb [ 304, | |
| 87932 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 87932 silly registry.get etag: '"E4845616HRC12WMH43M936NTT"', | |
| 87932 silly registry.get 'cache-control': 'max-age=60', | |
| 87932 silly registry.get 'accept-ranges': 'bytes', | |
| 87932 silly registry.get date: 'Mon, 20 Apr 2015 19:12:08 GMT', | |
| 87932 silly registry.get via: '1.1 varnish', | |
| 87932 silly registry.get connection: 'keep-alive', | |
| 87932 silly registry.get 'x-served-by': 'cache-ord1728-ORD', | |
| 87932 silly registry.get 'x-cache': 'MISS', | |
| 87932 silly registry.get 'x-cache-hits': '0', | |
| 87932 silly registry.get 'x-timer': 'S1429557128.176516,VS0,VE65' } ] | |
| 87933 verbose etag has-ansi from cache | |
| 87934 http GET https://registry.npmjs.org/minimist/-/minimist-1.1.1.tgz | |
| 87935 http 304 https://registry.npmjs.org/supports-color | |
| 87936 silly registry.get cb [ 304, | |
| 87936 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 87936 silly registry.get etag: '"4SHNAEHD19S3VGADXSKO905S7"', | |
| 87936 silly registry.get 'cache-control': 'max-age=60', | |
| 87936 silly registry.get 'accept-ranges': 'bytes', | |
| 87936 silly registry.get date: 'Mon, 20 Apr 2015 19:12:08 GMT', | |
| 87936 silly registry.get via: '1.1 varnish', | |
| 87936 silly registry.get connection: 'keep-alive', | |
| 87936 silly registry.get 'x-served-by': 'cache-ord1731-ORD', | |
| 87936 silly registry.get 'x-cache': 'MISS', | |
| 87936 silly registry.get 'x-cache-hits': '0', | |
| 87936 silly registry.get 'x-timer': 'S1429557128.186640,VS0,VE66' } ] | |
| 87937 verbose etag supports-color from cache | |
| 87938 silly addNameRange number 2 { name: 'escape-string-regexp', range: '*', hasData: true } | |
| 87939 silly addNameRange versions [ 'escape-string-regexp', | |
| 87939 silly addNameRange [ '1.0.0', '1.0.1', '1.0.2', '1.0.3' ] ] | |
| 87940 verbose addNamed [ 'escape-string-regexp', '1.0.3' ] | |
| 87941 verbose addNamed [ '1.0.3', '1.0.3' ] | |
| 87942 silly lockFile 2e4a00fa-escape-string-regexp-1-0-3 escape-string-regexp@1.0.3 | |
| 87943 verbose lock escape-string-regexp@1.0.3 C:\Users\Vince\AppData\Roaming\npm-cache\2e4a00fa-escape-string-regexp-1-0-3.lock | |
| 87944 silly lockFile 2e4a00fa-escape-string-regexp-1-0-3 escape-string-regexp@1.0.3 | |
| 87945 silly lockFile 2e4a00fa-escape-string-regexp-1-0-3 escape-string-regexp@1.0.3 | |
| 87946 silly lockFile bb748e44-escape-string-regexp-1-0-2 escape-string-regexp@^1.0.2 | |
| 87947 silly lockFile bb748e44-escape-string-regexp-1-0-2 escape-string-regexp@^1.0.2 | |
| 87948 silly gunzTarPerm extractEntry .travis.yml | |
| 87949 silly gunzTarPerm modified mode [ '.travis.yml', 438, 420 ] | |
| 87950 silly gunzTarPerm extractEntry build/assert-shim.js | |
| 87951 silly gunzTarPerm modified mode [ 'build/assert-shim.js', 438, 420 ] | |
| 87952 silly addNameRange number 2 { name: 'has-ansi', range: '*', hasData: true } | |
| 87953 silly addNameRange versions [ 'has-ansi', [ '0.1.0', '1.0.0', '1.0.1', '1.0.2', '1.0.3' ] ] | |
| 87954 verbose addNamed [ 'has-ansi', '1.0.3' ] | |
| 87955 verbose addNamed [ '1.0.3', '1.0.3' ] | |
| 87956 silly lockFile 53256e6d-has-ansi-1-0-3 has-ansi@1.0.3 | |
| 87957 verbose lock has-ansi@1.0.3 C:\Users\Vince\AppData\Roaming\npm-cache\53256e6d-has-ansi-1-0-3.lock | |
| 87958 silly gunzTarPerm extractEntry lib/path-visitor.js | |
| 87959 silly gunzTarPerm modified mode [ 'lib/path-visitor.js', 438, 420 ] | |
| 87960 silly gunzTarPerm extractEntry lib/path.js | |
| 87961 silly gunzTarPerm modified mode [ 'lib/path.js', 438, 420 ] | |
| 87962 silly lockFile 53256e6d-has-ansi-1-0-3 has-ansi@1.0.3 | |
| 87963 silly lockFile 53256e6d-has-ansi-1-0-3 has-ansi@1.0.3 | |
| 87964 silly addNameRange number 2 { name: 'supports-color', range: '*', hasData: true } | |
| 87965 silly addNameRange versions [ 'supports-color', | |
| 87965 silly addNameRange [ '0.2.0', '1.0.0', '1.1.0', '1.2.0', '1.2.1', '1.3.0', '1.3.1' ] ] | |
| 87966 verbose addNamed [ 'supports-color', '1.3.1' ] | |
| 87967 verbose addNamed [ '1.3.1', '1.3.1' ] | |
| 87968 silly lockFile 8e833f52-supports-color-1-3-1 supports-color@1.3.1 | |
| 87969 verbose lock supports-color@1.3.1 C:\Users\Vince\AppData\Roaming\npm-cache\8e833f52-supports-color-1-3-1.lock | |
| 87970 silly lockFile edbc7473-has-ansi-1-0-3 has-ansi@^1.0.3 | |
| 87971 silly lockFile edbc7473-has-ansi-1-0-3 has-ansi@^1.0.3 | |
| 87972 silly gunzTarPerm extractEntry shim.js | |
| 87973 silly gunzTarPerm modified mode [ 'shim.js', 438, 420 ] | |
| 87974 silly gunzTarPerm extractEntry fn/$for.js | |
| 87975 silly gunzTarPerm modified mode [ 'fn/$for.js', 438, 420 ] | |
| 87976 silly lockFile 8e833f52-supports-color-1-3-1 supports-color@1.3.1 | |
| 87977 silly lockFile 8e833f52-supports-color-1-3-1 supports-color@1.3.1 | |
| 87978 http 304 https://registry.npmjs.org/ansi-styles | |
| 87979 silly registry.get cb [ 304, | |
| 87979 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 87979 silly registry.get etag: '"9O45NVZEP528XJ58TZ8A6DMA0"', | |
| 87979 silly registry.get 'cache-control': 'max-age=60', | |
| 87979 silly registry.get 'accept-ranges': 'bytes', | |
| 87979 silly registry.get date: 'Mon, 20 Apr 2015 19:12:08 GMT', | |
| 87979 silly registry.get via: '1.1 varnish', | |
| 87979 silly registry.get connection: 'keep-alive', | |
| 87979 silly registry.get 'x-served-by': 'cache-ord1734-ORD', | |
| 87979 silly registry.get 'x-cache': 'MISS', | |
| 87979 silly registry.get 'x-cache-hits': '0', | |
| 87979 silly registry.get 'x-timer': 'S1429557128.070269,VS0,VE272' } ] | |
| 87980 verbose etag ansi-styles from cache | |
| 87981 silly lockFile e601069b-supports-color-1-3-0 supports-color@^1.3.0 | |
| 87982 silly lockFile e601069b-supports-color-1-3-0 supports-color@^1.3.0 | |
| 87983 http 304 https://registry.npmjs.org/left-pad/0.0.3 | |
| 87984 silly registry.get cb [ 304, | |
| 87984 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 87984 silly registry.get etag: '"6X5FVP67Z2JQV36I0NQ57JVOR"', | |
| 87984 silly registry.get 'cache-control': 'max-age=60', | |
| 87984 silly registry.get 'accept-ranges': 'bytes', | |
| 87984 silly registry.get date: 'Mon, 20 Apr 2015 19:12:08 GMT', | |
| 87984 silly registry.get via: '1.1 varnish', | |
| 87984 silly registry.get connection: 'keep-alive', | |
| 87984 silly registry.get 'x-served-by': 'cache-ord1731-ORD', | |
| 87984 silly registry.get 'x-cache': 'MISS', | |
| 87984 silly registry.get 'x-cache-hits': '0', | |
| 87984 silly registry.get 'x-timer': 'S1429557128.311369,VS0,VE38' } ] | |
| 87985 verbose etag left-pad/0.0.3 from cache | |
| 87986 silly gunzTarPerm extractEntry lib/scope.js | |
| 87987 silly gunzTarPerm modified mode [ 'lib/scope.js', 438, 420 ] | |
| 87988 silly gunzTarPerm extractEntry lib/shared.js | |
| 87989 silly gunzTarPerm modified mode [ 'lib/shared.js', 438, 420 ] | |
| 87990 silly lockFile 159ded82-bel-core-node-modules-estraverse tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\estraverse | |
| 87991 silly lockFile 159ded82-bel-core-node-modules-estraverse tar://C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\estraverse | |
| 87992 silly gunzTarPerm extractEntry fn/dict.js | |
| 87993 silly gunzTarPerm modified mode [ 'fn/dict.js', 438, 420 ] | |
| 87994 silly gunzTarPerm extractEntry fn/weak-map.js | |
| 87995 silly gunzTarPerm modified mode [ 'fn/weak-map.js', 438, 420 ] | |
| 87996 silly addNameRange number 2 { name: 'ansi-styles', range: '*', hasData: true } | |
| 87997 silly addNameRange versions [ 'ansi-styles', | |
| 87997 silly addNameRange [ '0.1.0', | |
| 87997 silly addNameRange '0.1.1', | |
| 87997 silly addNameRange '0.1.2', | |
| 87997 silly addNameRange '0.2.0', | |
| 87997 silly addNameRange '1.0.0', | |
| 87997 silly addNameRange '1.1.0', | |
| 87997 silly addNameRange '2.0.0', | |
| 87997 silly addNameRange '2.0.1' ] ] | |
| 87998 verbose addNamed [ 'ansi-styles', '2.0.1' ] | |
| 87999 verbose addNamed [ '2.0.1', '2.0.1' ] | |
| 88000 silly lockFile 383d5b19-ansi-styles-2-0-1 ansi-styles@2.0.1 | |
| 88001 verbose lock ansi-styles@2.0.1 C:\Users\Vince\AppData\Roaming\npm-cache\383d5b19-ansi-styles-2-0-1.lock | |
| 88002 silly lockFile 97ff7ad1-che-estraverse-3-1-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\estraverse\3.1.0\package.tgz | |
| 88003 silly lockFile 97ff7ad1-che-estraverse-3-1-0-package-tgz tar://C:\Users\Vince\AppData\Roaming\npm-cache\estraverse\3.1.0\package.tgz | |
| 88004 silly gunzTarPerm extractEntry build/mini-require.js | |
| 88005 silly gunzTarPerm modified mode [ 'build/mini-require.js', 438, 420 ] | |
| 88006 silly gunzTarPerm extractEntry build/suffix-browser.js | |
| 88007 silly gunzTarPerm modified mode [ 'build/suffix-browser.js', 438, 420 ] | |
| 88008 http 304 https://registry.npmjs.org/is-nan | |
| 88009 silly registry.get cb [ 304, | |
| 88009 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 88009 silly registry.get etag: '"7L9I9AR1O8NA6LKQ5Q9LWFYCX"', | |
| 88009 silly registry.get 'cache-control': 'max-age=60', | |
| 88009 silly registry.get 'accept-ranges': 'bytes', | |
| 88009 silly registry.get date: 'Mon, 20 Apr 2015 19:12:08 GMT', | |
| 88009 silly registry.get via: '1.1 varnish', | |
| 88009 silly registry.get connection: 'keep-alive', | |
| 88009 silly registry.get 'x-served-by': 'cache-ord1728-ORD', | |
| 88009 silly registry.get 'x-cache': 'MISS', | |
| 88009 silly registry.get 'x-cache-hits': '0', | |
| 88009 silly registry.get 'x-timer': 'S1429557128.301178,VS0,VE64' } ] | |
| 88010 verbose etag is-nan from cache | |
| 88011 silly lockFile 383d5b19-ansi-styles-2-0-1 ansi-styles@2.0.1 | |
| 88012 silly lockFile 383d5b19-ansi-styles-2-0-1 ansi-styles@2.0.1 | |
| 88013 silly lockFile c85ac080--org-left-pad-left-pad-0-0-3-tgz https://registry.npmjs.org/left-pad/-/left-pad-0.0.3.tgz | |
| 88014 verbose lock https://registry.npmjs.org/left-pad/-/left-pad-0.0.3.tgz C:\Users\Vince\AppData\Roaming\npm-cache\c85ac080--org-left-pad-left-pad-0-0-3-tgz.lock | |
| 88015 silly lockFile 314d507b-ansi-styles-2-0-1 ansi-styles@^2.0.1 | |
| 88016 silly lockFile 314d507b-ansi-styles-2-0-1 ansi-styles@^2.0.1 | |
| 88017 verbose addRemoteTarball [ 'https://registry.npmjs.org/left-pad/-/left-pad-0.0.3.tgz', | |
| 88017 verbose addRemoteTarball '04d99b4a1eaf9e5f79c05e5d745d53edd1aa8aa1' ] | |
| 88018 info retry fetch attempt 1 at 14:11:42 | |
| 88019 verbose fetch to= C:\Users\Vince\AppData\Local\Temp\npm-11116\1429557102083-0.3216052178759128\tmp.tgz | |
| 88020 http GET https://registry.npmjs.org/left-pad/-/left-pad-0.0.3.tgz | |
| 88021 silly gunzTarPerm extractEntry fn/get-iterator.js | |
| 88022 silly gunzTarPerm modified mode [ 'fn/get-iterator.js', 438, 420 ] | |
| 88023 silly gunzTarPerm extractEntry fn/global.js | |
| 88024 silly gunzTarPerm modified mode [ 'fn/global.js', 438, 420 ] | |
| 88025 silly addNameRange number 2 { name: 'is-nan', range: '*', hasData: true } | |
| 88026 silly addNameRange versions [ 'is-nan', [ '0.0.0', '1.0.1' ] ] | |
| 88027 verbose addNamed [ 'is-nan', '1.0.1' ] | |
| 88028 verbose addNamed [ '1.0.1', '1.0.1' ] | |
| 88029 silly lockFile 6b2725ad-is-nan-1-0-1 is-nan@1.0.1 | |
| 88030 verbose lock is-nan@1.0.1 C:\Users\Vince\AppData\Roaming\npm-cache\6b2725ad-is-nan-1-0-1.lock | |
| 88031 http 304 https://registry.npmjs.org/strip-ansi | |
| 88032 silly registry.get cb [ 304, | |
| 88032 silly registry.get { server: 'CouchDB/1.5.0 (Erlang OTP/R16B03)', | |
| 88032 silly registry.get etag: '"9D9S1Y0BBQD36UMUV9U38ZKG1"', | |
| 88032 silly registry.get 'cache-control': 'max-age=60', | |
| 88032 silly registry.get 'accept-ranges': 'bytes', | |
| 88032 silly registry.get date: 'Mon, 20 Apr 2015 19:12:08 GMT', | |
| 88032 silly registry.get via: '1.1 varnish', | |
| 88032 silly registry.get connection: 'keep-alive', | |
| 88032 silly registry.get 'x-served-by': 'cache-ord1726-ORD', | |
| 88032 silly registry.get 'x-cache': 'MISS', | |
| 88032 silly registry.get 'x-cache-hits': '0', | |
| 88032 silly registry.get 'x-timer': 'S1429557128.156537,VS0,VE267' } ] | |
| 88033 verbose etag strip-ansi from cache | |
| 88034 info preinstall estraverse@3.1.0 | |
| 88035 silly lockFile 6b2725ad-is-nan-1-0-1 is-nan@1.0.1 | |
| 88036 silly lockFile 6b2725ad-is-nan-1-0-1 is-nan@1.0.1 | |
| 88037 silly gunzTarPerm extractEntry build/test-prefix.js | |
| 88038 silly gunzTarPerm modified mode [ 'build/test-prefix.js', 438, 420 ] | |
| 88039 silly gunzTarPerm extractEntry build/test-suffix.js | |
| 88040 silly gunzTarPerm modified mode [ 'build/test-suffix.js', 438, 420 ] | |
| 88041 verbose readDependencies using package.json deps | |
| 88042 silly lockFile 2902ab9b-is-nan-1-0-1 is-nan@^1.0.1 | |
| 88043 silly lockFile 2902ab9b-is-nan-1-0-1 is-nan@^1.0.1 | |
| 88044 verbose readDependencies using package.json deps | |
| 88045 silly resolved [] | |
| 88046 verbose about to build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\estraverse | |
| 88047 info build C:\Users\Vince\AppData\Roaming\npm\node_modules\reapp\node_modules\reapp-pack\node_modules\babel-core\node_modules\estraverse | |
| 88048 verbose linkStuff [ true, | |
| 88048 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules', | |
| 88048 verbose linkStuff false, | |
| 88048 verbose linkStuff 'C:\\Users\\Vince\\AppData\\Roaming\\npm\\node_modules\\reapp\\node_modules\\reapp-pack\\node_modules\\babel-core\\node_modules' ] | |
| 88049 info linkStuff estraverse@3.1.0 | |
| 88050 silly resolved [ { name: 'is-finite', | |
| 88050 silly resolved version: '1.0.0', | |
| 88050 silly resolved description: 'ES6 Number.isFinite() ponyfill', | |
| 88050 silly resolved license: 'MIT', | |
| 88050 silly resolved repository: { type: 'git', url: 'sindresorhus/is-finite' }, | |
| 88050 silly resolved author: | |
| 88050 silly resolved { name: 'Sindre Sorhus', | |
| 88050 silly resolved email: 'sindresorhus@gmail.com', | |
| 88050 silly resolved url: 'http://sindresorhus.com' }, | |
| 88050 silly resolved engines: { node: '>=0.10.0' }, | |
| 88050 silly resolved scripts: { test: 'node test.js' }, | |
| 88050 silly resolved files: [ 'index.js' ], | |
| 88050 silly resolved keywords: | |
| 88050 silly resolved [ 'es6', | |
| 88050 silly resolved 'ecmascript', | |
| 88050 silly resolved 'harmony', | |
| 88050 silly resolved 'ponyfill', | |
| 88050 silly resolved 'prollyfill', | |
| 88050 silly resolved 'polyfill', | |
| 88050 silly resolved 'shim', | |
| 88050 silly resolved 'browser', | |
| 88050 silly resolved 'number', | |
| 88050 silly resolved 'finite', | |
| 88050 silly resolved 'is' ], | |
| 88050 silly resolved devDependencies: { ava: '0.0.3' }, | |
| 88050 silly resolved readme: '# is-finite [](https://travis-ci.org/sindresorhus/is-finite)\n\n> ES6 [`Number.isFinite()`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Number/isFinite) ponyfill\n\n> Ponyfill: A polyfill that doesn\'t overwrite the native method\n\n\n## Install\n\n```sh\n$ npm install --save is-finite\n```\n\n\n## Usage\n\n```js\nvar numIsFinite = require(\'is-finite\');\n\nnumIsFinite(4);\n//=> true\n\nnumIsFinite(Infinity);\n//=> false\n```\n\n\n## License\n\nMIT © [Sindre Sorhus](http://sindresorhus.com)\n', | |
| 88050 silly resolved readmeFilename: 'readme.md', | |
| 88050 silly resolved _id: 'is-finite@1.0.0', | |
| 88050 silly resolved _from: 'is-finite@^1.0.0', | |
| 88050 silly resolved dist: { shasum: '22243a2a42cad7749ab7994535932f0986a12be3' }, | |
| 88050 silly resolved _resolved: 'https://registry.npmjs.org/is-finite/-/is-finite-1.0.0.tgz' }, | |
| 88050 silly resolved { name: 'is-nan', | |
| 88050 silly resolved version: '1.0.1', | |
| 88050 silly resolved description: 'ES6-compliant shim for Number.isNaN - the global isNaN returns false positives.', | |
| 88050 silly resolved author: { name: 'Jordan Harband' }, | |
| 88050 silly resolved license: 'MIT', | |
| 88050 silly resolved main: 'index.js', | |
| 88050 silly resolved scripts: |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment